diff --git a/README.md b/README.md index a421055e019..f74b7339a81 100644 --- a/README.md +++ b/README.md @@ -337,6 +337,11 @@ Update existing frontend dependencies: yarn upgrade ``` +To upgrade yarn itself, download a new yarn release from +, replace the release in +`frontend/.yarn/releases` with the new version, and update `yarn-path` in +`frontend/.yarnrc`. + #### Supported Browsers We support the latest versions of the following browsers: diff --git a/cmd/bridge/main.go b/cmd/bridge/main.go index 500b22dfc18..f81cc4066d7 100644 --- a/cmd/bridge/main.go +++ b/cmd/bridge/main.go @@ -70,6 +70,7 @@ func main() { fK8sModeOffClusterSkipVerifyTLS := fs.Bool("k8s-mode-off-cluster-skip-verify-tls", false, "DEV ONLY. When true, skip verification of certs presented by k8s API server.") fK8sModeOffClusterPrometheus := fs.String("k8s-mode-off-cluster-prometheus", "", "DEV ONLY. URL of the cluster's Prometheus server.") fK8sModeOffClusterAlertmanager := fs.String("k8s-mode-off-cluster-alertmanager", "", "DEV ONLY. URL of the cluster's AlertManager server.") + fK8sModeOffClusterMetering := fs.String("k8s-mode-off-cluster-metering", "", "DEV ONLY. URL of the cluster's metering server.") fK8sAuth := fs.String("k8s-auth", "service-account", "service-account | bearer-token | oidc | openshift") fK8sAuthBearerToken := fs.String("k8s-auth-bearer-token", "", "Authorization token to send with proxied Kubernetes API requests.") @@ -146,18 +147,6 @@ func main() { documentationBaseURL = bridge.ValidateFlagIsURL("documentation-base-url", *fDocumentationBaseURL) } - offClusterPrometheusURL := &url.URL{} - if *fK8sModeOffClusterPrometheus != "" && *fK8sMode == "off-cluster" { - offClusterPrometheusURL = bridge.ValidateFlagIsURL("k8s-mode-off-cluster-prometheus", *fK8sModeOffClusterPrometheus) - offClusterPrometheusURL.Path = "/api" - } - - offClusterAlertManagerURL := &url.URL{} - if *fK8sModeOffClusterAlertmanager != "" && *fK8sMode == "off-cluster" { - offClusterAlertManagerURL = bridge.ValidateFlagIsURL("k8s-mode-off-cluster-alertmanager", *fK8sModeOffClusterAlertmanager) - offClusterAlertManagerURL.Path = "/api" - } - branding := *fBranding if branding == "origin" { branding = "okd" @@ -311,7 +300,9 @@ func main() { Endpoint: k8sEndpoint, } - if offClusterPrometheusURL.String() != "" { + if *fK8sModeOffClusterPrometheus != "" { + offClusterPrometheusURL := bridge.ValidateFlagIsURL("k8s-mode-off-cluster-prometheus", *fK8sModeOffClusterPrometheus) + offClusterPrometheusURL.Path = "/api" srv.PrometheusProxyConfig = &proxy.Config{ TLSClientConfig: serviceProxyTLSConfig, HeaderBlacklist: []string{"Cookie", "X-CSRFToken"}, @@ -324,7 +315,9 @@ func main() { } } - if offClusterAlertManagerURL.String() != "" { + if *fK8sModeOffClusterAlertmanager != "" { + offClusterAlertManagerURL := bridge.ValidateFlagIsURL("k8s-mode-off-cluster-alertmanager", *fK8sModeOffClusterAlertmanager) + offClusterAlertManagerURL.Path = "/api" srv.AlertManagerProxyConfig = &proxy.Config{ TLSClientConfig: serviceProxyTLSConfig, HeaderBlacklist: []string{"Cookie", "X-CSRFToken"}, @@ -332,6 +325,16 @@ func main() { } } + if *fK8sModeOffClusterMetering != "" { + offClusterMeteringURL := bridge.ValidateFlagIsURL("k8s-mode-off-cluster-metering", *fK8sModeOffClusterMetering) + offClusterMeteringURL.Path = "/api" + srv.MeteringProxyConfig = &proxy.Config{ + TLSClientConfig: serviceProxyTLSConfig, + HeaderBlacklist: []string{"Cookie", "X-CSRFToken"}, + Endpoint: offClusterMeteringURL, + } + } + default: bridge.FlagFatalf("k8s-mode", "must be one of: in-cluster, off-cluster") } diff --git a/frontend/.yarn/releases/yarn-1.15.2.js b/frontend/.yarn/releases/yarn-1.17.3.js similarity index 90% rename from frontend/.yarn/releases/yarn-1.15.2.js rename to frontend/.yarn/releases/yarn-1.17.3.js index eb0090d975a..e59b58319e8 100644 --- a/frontend/.yarn/releases/yarn-1.15.2.js +++ b/frontend/.yarn/releases/yarn-1.17.3.js @@ -65,7 +65,7 @@ module.exports = /******/ __webpack_require__.p = ""; /******/ /******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 517); +/******/ return __webpack_require__(__webpack_require__.s = 548); /******/ }) /************************************************************************/ /******/ ([ @@ -295,7 +295,7 @@ function __importDefault(mod) { exports.__esModule = true; -var _promise = __webpack_require__(217); +var _promise = __webpack_require__(227); var _promise2 = _interopRequireDefault(_promise); @@ -1451,13 +1451,13 @@ function _load_fs() { var _glob; function _load_glob() { - return _glob = _interopRequireDefault(__webpack_require__(93)); + return _glob = _interopRequireDefault(__webpack_require__(99)); } var _os; function _load_os() { - return _os = _interopRequireDefault(__webpack_require__(46)); + return _os = _interopRequireDefault(__webpack_require__(49)); } var _path; @@ -1469,31 +1469,31 @@ function _load_path() { var _blockingQueue; function _load_blockingQueue() { - return _blockingQueue = _interopRequireDefault(__webpack_require__(103)); + return _blockingQueue = _interopRequireDefault(__webpack_require__(110)); } var _promise; function _load_promise() { - return _promise = _interopRequireWildcard(__webpack_require__(47)); + return _promise = _interopRequireWildcard(__webpack_require__(50)); } var _promise2; function _load_promise2() { - return _promise2 = __webpack_require__(47); + return _promise2 = __webpack_require__(50); } var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } var _fsNormalized; function _load_fsNormalized() { - return _fsNormalized = __webpack_require__(208); + return _fsNormalized = __webpack_require__(218); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -1517,7 +1517,7 @@ const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify) const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename); const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access); const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat); -const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(136)); +const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(145)); const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true); const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat); const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod); @@ -1532,8 +1532,8 @@ exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink; const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4; const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink); -const invariant = __webpack_require__(8); -const stripBOM = __webpack_require__(151); +const invariant = __webpack_require__(9); +const stripBOM = __webpack_require__(160); const noop = () => {}; @@ -1576,12 +1576,12 @@ const lf = '\n'.charCodeAt(0); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; }); /* unused harmony export SafeSubscriber */ /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(145); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(388); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(24); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(288); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(176); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(290); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(154); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(419); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(321); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(185); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(323); /** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */ @@ -1825,64 +1825,6 @@ var SafeSubscriber = /*@__PURE__*/ (function (_super) { /* 8 */ /***/ (function(module, exports, __webpack_require__) { -"use strict"; -/** - * Copyright (c) 2013-present, Facebook, Inc. - * - * This source code is licensed under the MIT license found in the - * LICENSE file in the root directory of this source tree. - */ - - - -/** - * Use invariant() to assert state which your program assumes to be true. - * - * Provide sprintf-style format (only %s is supported) and arguments - * to provide information about what broke and what you were - * expecting. - * - * The invariant message will be stripped in production, but the invariant - * will remain to ensure logic does not differ in production. - */ - -var NODE_ENV = process.env.NODE_ENV; - -var invariant = function(condition, format, a, b, c, d, e, f) { - if (NODE_ENV !== 'production') { - if (format === undefined) { - throw new Error('invariant requires an error message argument'); - } - } - - if (!condition) { - var error; - if (format === undefined) { - error = new Error( - 'Minified exception occurred; use the non-minified dev environment ' + - 'for the full error message and additional helpful warnings.' - ); - } else { - var args = [a, b, c, d, e, f]; - var argIndex = 0; - error = new Error( - format.replace(/%s/g, function() { return args[argIndex++]; }) - ); - error.name = 'Invariant Violation'; - } - - error.framesToPop = 1; // we don't care about invariant's own frame - throw error; - } -}; - -module.exports = invariant; - - -/***/ }), -/* 9 */ -/***/ (function(module, exports, __webpack_require__) { - "use strict"; @@ -1890,17 +1832,17 @@ Object.defineProperty(exports, "__esModule", { value: true }); exports.getPathKey = getPathKey; -const os = __webpack_require__(46); +const os = __webpack_require__(49); const path = __webpack_require__(0); -const userHome = __webpack_require__(60).default; +const userHome = __webpack_require__(66).default; -var _require = __webpack_require__(215); +var _require = __webpack_require__(225); const getCacheDir = _require.getCacheDir, getConfigDir = _require.getConfigDir, getDataDir = _require.getDataDir; -const isWebpackBundle = __webpack_require__(267); +const isWebpackBundle = __webpack_require__(278); const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; const OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies']; @@ -2020,17 +1962,143 @@ const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = { unknown: 'red' }; +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/** + * Copyright (c) 2013-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ + + + +/** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + +var NODE_ENV = process.env.NODE_ENV; + +var invariant = function(condition, format, a, b, c, d, e, f) { + if (NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error( + 'Minified exception occurred; use the non-minified dev environment ' + + 'for the full error message and additional helpful warnings.' + ); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error( + format.replace(/%s/g, function() { return args[argIndex++]; }) + ); + error.name = 'Invariant Violation'; + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } +}; + +module.exports = invariant; + + /***/ }), /* 10 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var YAMLException = __webpack_require__(54); + +var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'defaultStyle', + 'styleAliases' +]; + +var YAML_NODE_KINDS = [ + 'scalar', + 'sequence', + 'mapping' +]; + +function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function (style) { + map[style].forEach(function (alias) { + result[String(alias)] = style; + }); + }); + } + + return result; +} + +function Type(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function (name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); + } + }); + + // TODO: Add tag format check. + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = options['resolve'] || function () { return true; }; + this.construct = options['construct'] || function (data) { return data; }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.styleAliases = compileStyleAliases(options['styleAliases'] || null); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); + } +} + +module.exports = Type; + + +/***/ }), +/* 11 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(289); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(901); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(109); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(291); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(176); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(322); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(932); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(117); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(185); /** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */ @@ -2150,13 +2218,13 @@ function getPromiseCtor(promiseCtor) { /***/ }), -/* 11 */ +/* 12 */ /***/ (function(module, exports) { module.exports = require("crypto"); /***/ }), -/* 12 */ +/* 13 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -2187,13 +2255,13 @@ var OuterSubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 13 */ +/* 14 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(77); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(414); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(84); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(445); /** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */ @@ -2210,7 +2278,7 @@ function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, dest /***/ }), -/* 14 */ +/* 15 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -2218,7 +2286,7 @@ function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, dest -var buffer = __webpack_require__(80) +var buffer = __webpack_require__(64) var Buffer = buffer.Buffer var safer = {} @@ -2294,14 +2362,14 @@ module.exports = safer /***/ }), -/* 15 */ +/* 16 */ /***/ (function(module, exports, __webpack_require__) { // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. -var assert = __webpack_require__(27); -var Stream = __webpack_require__(22).Stream; +var assert = __webpack_require__(28); +var Stream = __webpack_require__(23).Stream; var util = __webpack_require__(3); @@ -2511,7 +2579,7 @@ module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), -/* 16 */ +/* 17 */ /***/ (function(module, exports) { // https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 @@ -2523,7 +2591,7 @@ if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef /***/ }), -/* 17 */ +/* 18 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -2542,7 +2610,7 @@ exports.hyphenate = hyphenate; exports.camelCase = camelCase; exports.compareSortedArrays = compareSortedArrays; exports.sleep = sleep; -const _camelCase = __webpack_require__(220); +const _camelCase = __webpack_require__(230); function sortAlpha(a, b) { // sort alphabetically in a deterministic way @@ -2630,7 +2698,7 @@ function sleep(ms) { } /***/ }), -/* 18 */ +/* 19 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -2650,7 +2718,7 @@ function _load_asyncToGenerator() { var _parse; function _load_parse() { - return _parse = __webpack_require__(98); + return _parse = __webpack_require__(105); } Object.defineProperty(exports, 'parse', { @@ -2663,7 +2731,7 @@ Object.defineProperty(exports, 'parse', { var _stringify; function _load_stringify() { - return _stringify = __webpack_require__(190); + return _stringify = __webpack_require__(199); } Object.defineProperty(exports, 'stringify', { @@ -2678,25 +2746,25 @@ exports.explodeEntry = explodeEntry; var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } var _normalizePattern; function _load_normalizePattern() { - return _normalizePattern = __webpack_require__(36); + return _normalizePattern = __webpack_require__(37); } var _parse2; function _load_parse2() { - return _parse2 = _interopRequireDefault(__webpack_require__(98)); + return _parse2 = _interopRequireDefault(__webpack_require__(105)); } var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _fs; @@ -2709,10 +2777,10 @@ function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const invariant = __webpack_require__(8); +const invariant = __webpack_require__(9); const path = __webpack_require__(0); -const ssri = __webpack_require__(70); +const ssri = __webpack_require__(77); function getName(pattern) { return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name; @@ -2918,12 +2986,12 @@ class Lockfile { exports.default = Lockfile; /***/ }), -/* 19 */ +/* 20 */ /***/ (function(module, exports, __webpack_require__) { -var store = __webpack_require__(126)('wks'); -var uid = __webpack_require__(130); -var Symbol = __webpack_require__(16).Symbol; +var store = __webpack_require__(133)('wks'); +var uid = __webpack_require__(137); +var Symbol = __webpack_require__(17).Symbol; var USE_SYMBOL = typeof Symbol == 'function'; var $exports = module.exports = function (name) { @@ -2935,7 +3003,7 @@ $exports.store = store; /***/ }), -/* 20 */ +/* 21 */ /***/ (function(module, exports) { exports = module.exports = SemVer; @@ -4265,7 +4333,7 @@ function coerce(version) { /***/ }), -/* 21 */ +/* 22 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -4273,7 +4341,7 @@ function coerce(version) { exports.__esModule = true; -var _assign = __webpack_require__(560); +var _assign = __webpack_require__(591); var _assign2 = _interopRequireDefault(_assign); @@ -4294,29 +4362,29 @@ exports.default = _assign2.default || function (target) { }; /***/ }), -/* 22 */ +/* 23 */ /***/ (function(module, exports) { module.exports = require("stream"); /***/ }), -/* 23 */ +/* 24 */ /***/ (function(module, exports) { module.exports = require("url"); /***/ }), -/* 24 */ +/* 25 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(40); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(412); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(145); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(51); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(44); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(409); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(41); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(443); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(154); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(56); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(47); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(440); /** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */ @@ -4452,7 +4520,7 @@ function flattenUnsubscriptionErrors(errors) { /***/ }), -/* 25 */ +/* 26 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. @@ -4477,13 +4545,13 @@ module.exports = { readBitString: readBitString }; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var PrivateKey = __webpack_require__(32); -var Key = __webpack_require__(26); -var crypto = __webpack_require__(11); -var algs = __webpack_require__(31); -var asn1 = __webpack_require__(59); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var PrivateKey = __webpack_require__(33); +var Key = __webpack_require__(27); +var crypto = __webpack_require__(12); +var algs = __webpack_require__(32); +var asn1 = __webpack_require__(65); var ec, jsbn; var nacl; @@ -4714,7 +4782,7 @@ function calculateDSAPublic(g, p, x) { assert.buffer(p); assert.buffer(x); try { - var bigInt = __webpack_require__(74).BigInteger; + var bigInt = __webpack_require__(81).BigInteger; } catch (e) { throw (new Error('To load a PKCS#8 format DSA private key, ' + 'the node jsbn library is required.')); @@ -4731,7 +4799,7 @@ function calculateED25519Public(k) { assert.buffer(k); if (nacl === undefined) - nacl = __webpack_require__(68); + nacl = __webpack_require__(75); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); @@ -4741,7 +4809,7 @@ function calculateX25519Public(k) { assert.buffer(k); if (nacl === undefined) - nacl = __webpack_require__(68); + nacl = __webpack_require__(75); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); @@ -4751,7 +4819,7 @@ function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); try { - var bigInt = __webpack_require__(74).BigInteger; + var bigInt = __webpack_require__(81).BigInteger; } catch (e) { throw (new Error('To write a PEM private key from ' + 'this source, the node jsbn lib is required.')); @@ -4782,9 +4850,9 @@ function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); if (ec === undefined) - ec = __webpack_require__(132); + ec = __webpack_require__(139); if (jsbn === undefined) - jsbn = __webpack_require__(74).BigInteger; + jsbn = __webpack_require__(81).BigInteger; var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); @@ -4847,26 +4915,26 @@ function opensshCipherInfo(cipher) { /***/ }), -/* 26 */ +/* 27 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Key; -var assert = __webpack_require__(15); -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(147); -var Signature = __webpack_require__(67); -var DiffieHellman = __webpack_require__(292).DiffieHellman; -var errs = __webpack_require__(66); -var utils = __webpack_require__(25); -var PrivateKey = __webpack_require__(32); +var assert = __webpack_require__(16); +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(74); +var DiffieHellman = __webpack_require__(325).DiffieHellman; +var errs = __webpack_require__(73); +var utils = __webpack_require__(26); +var PrivateKey = __webpack_require__(33); var edCompat; try { - edCompat = __webpack_require__(422); + edCompat = __webpack_require__(453); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } @@ -4875,15 +4943,15 @@ var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var formats = {}; -formats['auto'] = __webpack_require__(423); -formats['pem'] = __webpack_require__(79); -formats['pkcs1'] = __webpack_require__(294); -formats['pkcs8'] = __webpack_require__(148); -formats['rfc4253'] = __webpack_require__(96); -formats['ssh'] = __webpack_require__(424); -formats['ssh-private'] = __webpack_require__(183); +formats['auto'] = __webpack_require__(454); +formats['pem'] = __webpack_require__(86); +formats['pkcs1'] = __webpack_require__(327); +formats['pkcs8'] = __webpack_require__(157); +formats['rfc4253'] = __webpack_require__(103); +formats['ssh'] = __webpack_require__(455); +formats['ssh-private'] = __webpack_require__(192); formats['openssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(293); +formats['dnssec'] = __webpack_require__(326); function Key(opts) { assert.object(opts, 'options'); @@ -5128,13 +5196,13 @@ Key._oldVersionDetect = function (obj) { /***/ }), -/* 27 */ +/* 28 */ /***/ (function(module, exports) { module.exports = require("assert"); /***/ }), -/* 28 */ +/* 29 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -5177,16 +5245,16 @@ function nullify(obj = {}) { } /***/ }), -/* 29 */ +/* 30 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -const escapeStringRegexp = __webpack_require__(355); -const ansiStyles = __webpack_require__(474); -const stdoutColor = __webpack_require__(567).stdout; +const escapeStringRegexp = __webpack_require__(387); +const ansiStyles = __webpack_require__(505); +const stdoutColor = __webpack_require__(598).stdout; -const template = __webpack_require__(568); +const template = __webpack_require__(599); const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm'); @@ -5412,7 +5480,7 @@ module.exports.default = module.exports; // For TypeScript /***/ }), -/* 30 */ +/* 31 */ /***/ (function(module, exports) { var core = module.exports = { version: '2.5.7' }; @@ -5420,12 +5488,12 @@ if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef /***/ }), -/* 31 */ +/* 32 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. -var Buffer = __webpack_require__(14).Buffer; +var Buffer = __webpack_require__(15).Buffer; var algInfo = { 'dsa': { @@ -5594,50 +5662,50 @@ module.exports = { /***/ }), -/* 32 */ +/* 33 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = PrivateKey; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(147); -var Signature = __webpack_require__(67); -var errs = __webpack_require__(66); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(74); +var errs = __webpack_require__(73); var util = __webpack_require__(3); -var utils = __webpack_require__(25); -var dhe = __webpack_require__(292); +var utils = __webpack_require__(26); +var dhe = __webpack_require__(325); var generateECDSA = dhe.generateECDSA; var generateED25519 = dhe.generateED25519; var edCompat; var nacl; try { - edCompat = __webpack_require__(422); + edCompat = __webpack_require__(453); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } -var Key = __webpack_require__(26); +var Key = __webpack_require__(27); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var KeyEncryptedError = errs.KeyEncryptedError; var formats = {}; -formats['auto'] = __webpack_require__(423); -formats['pem'] = __webpack_require__(79); -formats['pkcs1'] = __webpack_require__(294); -formats['pkcs8'] = __webpack_require__(148); -formats['rfc4253'] = __webpack_require__(96); -formats['ssh-private'] = __webpack_require__(183); +formats['auto'] = __webpack_require__(454); +formats['pem'] = __webpack_require__(86); +formats['pkcs1'] = __webpack_require__(327); +formats['pkcs8'] = __webpack_require__(157); +formats['rfc4253'] = __webpack_require__(103); +formats['ssh-private'] = __webpack_require__(192); formats['openssh'] = formats['ssh-private']; formats['ssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(293); +formats['dnssec'] = __webpack_require__(326); function PrivateKey(opts) { assert.object(opts, 'options'); @@ -5690,7 +5758,7 @@ PrivateKey.prototype.derive = function (newType) { if (this.type === 'ed25519' && newType === 'curve25519') { if (nacl === undefined) - nacl = __webpack_require__(68); + nacl = __webpack_require__(75); priv = this.part.k.data; if (priv[0] === 0x00) @@ -5708,7 +5776,7 @@ PrivateKey.prototype.derive = function (newType) { })); } else if (this.type === 'curve25519' && newType === 'ed25519') { if (nacl === undefined) - nacl = __webpack_require__(68); + nacl = __webpack_require__(75); priv = this.part.k.data; if (priv[0] === 0x00) @@ -5853,7 +5921,7 @@ PrivateKey._oldVersionDetect = function (obj) { /***/ }), -/* 33 */ +/* 34 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -5867,7 +5935,7 @@ exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefi var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _asyncToGenerator2; @@ -5959,16 +6027,22 @@ let wrapLifecycle = exports.wrapLifecycle = (() => { exports.hasWrapper = hasWrapper; exports.setFlags = setFlags; +var _objectPath; + +function _load_objectPath() { + return _objectPath = _interopRequireDefault(__webpack_require__(304)); +} + var _hooks; function _load_hooks() { - return _hooks = __webpack_require__(550); + return _hooks = __webpack_require__(581); } var _index; function _load_index() { - return _index = _interopRequireDefault(__webpack_require__(210)); + return _index = _interopRequireDefault(__webpack_require__(220)); } var _errors; @@ -5980,79 +6054,79 @@ function _load_errors() { var _integrityChecker; function _load_integrityChecker() { - return _integrityChecker = _interopRequireDefault(__webpack_require__(199)); + return _integrityChecker = _interopRequireDefault(__webpack_require__(208)); } var _lockfile; function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(18)); + return _lockfile = _interopRequireDefault(__webpack_require__(19)); } var _lockfile2; function _load_lockfile2() { - return _lockfile2 = __webpack_require__(18); + return _lockfile2 = __webpack_require__(19); } var _packageFetcher; function _load_packageFetcher() { - return _packageFetcher = _interopRequireWildcard(__webpack_require__(200)); + return _packageFetcher = _interopRequireWildcard(__webpack_require__(210)); } var _packageInstallScripts; function _load_packageInstallScripts() { - return _packageInstallScripts = _interopRequireDefault(__webpack_require__(525)); + return _packageInstallScripts = _interopRequireDefault(__webpack_require__(556)); } var _packageCompatibility; function _load_packageCompatibility() { - return _packageCompatibility = _interopRequireWildcard(__webpack_require__(332)); + return _packageCompatibility = _interopRequireWildcard(__webpack_require__(209)); } var _packageResolver; function _load_packageResolver() { - return _packageResolver = _interopRequireDefault(__webpack_require__(334)); + return _packageResolver = _interopRequireDefault(__webpack_require__(366)); } var _packageLinker; function _load_packageLinker() { - return _packageLinker = _interopRequireDefault(__webpack_require__(201)); + return _packageLinker = _interopRequireDefault(__webpack_require__(211)); } var _index2; function _load_index2() { - return _index2 = __webpack_require__(52); + return _index2 = __webpack_require__(57); } var _index3; function _load_index3() { - return _index3 = __webpack_require__(71); + return _index3 = __webpack_require__(78); } var _autoclean; function _load_autoclean() { - return _autoclean = __webpack_require__(321); + return _autoclean = __webpack_require__(354); } var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _normalizePattern; function _load_normalizePattern() { - return _normalizePattern = __webpack_require__(36); + return _normalizePattern = __webpack_require__(37); } var _fs; @@ -6064,57 +6138,57 @@ function _load_fs() { var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } var _yarnVersion; function _load_yarnVersion() { - return _yarnVersion = __webpack_require__(112); + return _yarnVersion = __webpack_require__(120); } var _generatePnpMap; function _load_generatePnpMap() { - return _generatePnpMap = __webpack_require__(547); + return _generatePnpMap = __webpack_require__(578); } var _workspaceLayout; function _load_workspaceLayout() { - return _workspaceLayout = _interopRequireDefault(__webpack_require__(84)); + return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); } var _resolutionMap; function _load_resolutionMap() { - return _resolutionMap = _interopRequireDefault(__webpack_require__(204)); + return _resolutionMap = _interopRequireDefault(__webpack_require__(214)); } var _guessName; function _load_guessName() { - return _guessName = _interopRequireDefault(__webpack_require__(160)); + return _guessName = _interopRequireDefault(__webpack_require__(169)); } var _audit; function _load_audit() { - return _audit = _interopRequireDefault(__webpack_require__(320)); + return _audit = _interopRequireDefault(__webpack_require__(353)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const deepEqual = __webpack_require__(600); +const deepEqual = __webpack_require__(631); -const emoji = __webpack_require__(270); -const invariant = __webpack_require__(8); +const emoji = __webpack_require__(302); +const invariant = __webpack_require__(9); const path = __webpack_require__(0); -const semver = __webpack_require__(20); -const uuid = __webpack_require__(111); -const ssri = __webpack_require__(70); +const semver = __webpack_require__(21); +const uuid = __webpack_require__(119); +const ssri = __webpack_require__(77); const ONE_DAY = 1000 * 60 * 60 * 24; @@ -6151,6 +6225,10 @@ function getUpdateCommand(installationMethod) { return 'apk update && apk add -u yarn'; } + if (installationMethod === 'portage') { + return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn'; + } + return null; } @@ -6355,6 +6433,7 @@ class Install { const packageName = _ref4; + const optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, packageName) && _this.flags.ignoreOptional; for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) { var _ref9; @@ -6370,7 +6449,7 @@ class Install { const _ref8 = _ref9; const pattern = _ref8.pattern; - resolutionDeps = [...resolutionDeps, { registry, pattern, optional: false, hint: 'resolution' }]; + resolutionDeps = [...resolutionDeps, { registry, pattern, optional, hint: 'resolution' }]; } } @@ -6753,7 +6832,7 @@ class Install { })()); } - const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter); + const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES }); let auditFoundProblems = false; steps.push(function (curr, total) { @@ -6929,7 +7008,7 @@ class Install { const manifest = _ref24.manifest; - yield (_packageCompatibility || _load_packageCompatibility()).checkOne((0, (_extends2 || _load_extends()).default)({ _reference: {} }, manifest), _this7.config, _this7.flags.ignoreEngines); + yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines); })(); } @@ -7393,10 +7472,10 @@ function setFlags(commander) { } /***/ }), -/* 34 */ +/* 35 */ /***/ (function(module, exports, __webpack_require__) { -var isObject = __webpack_require__(49); +var isObject = __webpack_require__(52); module.exports = function (it) { if (!isObject(it)) throw TypeError(it + ' is not an object!'); return it; @@ -7404,7 +7483,7 @@ module.exports = function (it) { /***/ }), -/* 35 */ +/* 36 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -7412,12 +7491,12 @@ module.exports = function (it) { /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; }); /* unused harmony export AnonymousSubject */ /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(10); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(11); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(7); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(24); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(180); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(390); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(288); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(189); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(421); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(321); /** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */ @@ -7579,7 +7658,7 @@ var AnonymousSubject = /*@__PURE__*/ (function (_super) { /***/ }), -/* 36 */ +/* 37 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -7628,7 +7707,7 @@ function normalizePattern(pattern) { } /***/ }), -/* 37 */ +/* 38 */ /***/ (function(module, exports, __webpack_require__) { /* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** @@ -24738,17 +24817,17 @@ function normalizePattern(pattern) { } }.call(this)); -/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(154)(module))) +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(163)(module))) /***/ }), -/* 38 */ +/* 39 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return EMPTY; }); /* harmony export (immutable) */ __webpack_exports__["a"] = empty; /* unused harmony export emptyScheduled */ -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(10); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(11); /** PURE_IMPORTS_START _Observable PURE_IMPORTS_END */ var EMPTY = /*@__PURE__*/ new __WEBPACK_IMPORTED_MODULE_0__Observable__["a" /* Observable */](function (subscriber) { return subscriber.complete(); }); @@ -24762,13 +24841,13 @@ function emptyScheduled(scheduler) { /***/ }), -/* 39 */ +/* 40 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return async; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__AsyncAction__ = __webpack_require__(140); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__AsyncScheduler__ = __webpack_require__(141); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__AsyncAction__ = __webpack_require__(149); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__AsyncScheduler__ = __webpack_require__(150); /** PURE_IMPORTS_START _AsyncAction,_AsyncScheduler PURE_IMPORTS_END */ @@ -24777,7 +24856,7 @@ var async = /*@__PURE__*/ new __WEBPACK_IMPORTED_MODULE_1__AsyncScheduler__["a" /***/ }), -/* 40 */ +/* 41 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -24788,12 +24867,12 @@ var isArray = Array.isArray || (function (x) { return x && typeof x.length === ' /***/ }), -/* 41 */ +/* 42 */ /***/ (function(module, exports, __webpack_require__) { -var dP = __webpack_require__(65); -var createDesc = __webpack_require__(125); -module.exports = __webpack_require__(48) ? function (object, key, value) { +var dP = __webpack_require__(71); +var createDesc = __webpack_require__(132); +module.exports = __webpack_require__(51) ? function (object, key, value) { return dP.f(object, key, createDesc(1, value)); } : function (object, key, value) { object[key] = value; @@ -24802,11 +24881,192 @@ module.exports = __webpack_require__(48) ? function (object, key, value) { /***/ }), -/* 42 */ +/* 43 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + + +function isNothing(subject) { + return (typeof subject === 'undefined') || (subject === null); +} + + +function isObject(subject) { + return (typeof subject === 'object') && (subject !== null); +} + + +function toArray(sequence) { + if (Array.isArray(sequence)) return sequence; + else if (isNothing(sequence)) return []; + + return [ sequence ]; +} + + +function extend(target, source) { + var index, length, key, sourceKeys; + + if (source) { + sourceKeys = Object.keys(source); + + for (index = 0, length = sourceKeys.length; index < length; index += 1) { + key = sourceKeys[index]; + target[key] = source[key]; + } + } + + return target; +} + + +function repeat(string, count) { + var result = '', cycle; + + for (cycle = 0; cycle < count; cycle += 1) { + result += string; + } + + return result; +} + + +function isNegativeZero(number) { + return (number === 0) && (Number.NEGATIVE_INFINITY === 1 / number); +} + + +module.exports.isNothing = isNothing; +module.exports.isObject = isObject; +module.exports.toArray = toArray; +module.exports.repeat = repeat; +module.exports.isNegativeZero = isNegativeZero; +module.exports.extend = extend; + + +/***/ }), +/* 44 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/*eslint-disable max-len*/ + +var common = __webpack_require__(43); +var YAMLException = __webpack_require__(54); +var Type = __webpack_require__(10); + + +function compileList(schema, name, result) { + var exclude = []; + + schema.include.forEach(function (includedSchema) { + result = compileList(includedSchema, name, result); + }); + + schema[name].forEach(function (currentType) { + result.forEach(function (previousType, previousIndex) { + if (previousType.tag === currentType.tag && previousType.kind === currentType.kind) { + exclude.push(previousIndex); + } + }); + + result.push(currentType); + }); + + return result.filter(function (type, index) { + return exclude.indexOf(index) === -1; + }); +} + + +function compileMap(/* lists... */) { + var result = { + scalar: {}, + sequence: {}, + mapping: {}, + fallback: {} + }, index, length; + + function collectType(type) { + result[type.kind][type.tag] = result['fallback'][type.tag] = type; + } + + for (index = 0, length = arguments.length; index < length; index += 1) { + arguments[index].forEach(collectType); + } + return result; +} + + +function Schema(definition) { + this.include = definition.include || []; + this.implicit = definition.implicit || []; + this.explicit = definition.explicit || []; + + this.implicit.forEach(function (type) { + if (type.loadKind && type.loadKind !== 'scalar') { + throw new YAMLException('There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.'); + } + }); + + this.compiledImplicit = compileList(this, 'implicit', []); + this.compiledExplicit = compileList(this, 'explicit', []); + this.compiledTypeMap = compileMap(this.compiledImplicit, this.compiledExplicit); +} + + +Schema.DEFAULT = null; + + +Schema.create = function createSchema() { + var schemas, types; + + switch (arguments.length) { + case 1: + schemas = Schema.DEFAULT; + types = arguments[0]; + break; + + case 2: + schemas = arguments[0]; + types = arguments[1]; + break; + + default: + throw new YAMLException('Wrong number of arguments for Schema.create function'); + } + + schemas = common.toArray(schemas); + types = common.toArray(types); + + if (!schemas.every(function (schema) { return schema instanceof Schema; })) { + throw new YAMLException('Specified list of super schemas (or a single Schema object) contains a non-Schema object.'); + } + + if (!types.every(function (type) { return type instanceof Type; })) { + throw new YAMLException('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + + return new Schema({ + include: schemas, + explicit: types + }); +}; + + +module.exports = Schema; + + +/***/ }), +/* 45 */ /***/ (function(module, exports, __webpack_require__) { /* eslint-disable node/no-deprecated-api */ -var buffer = __webpack_require__(80) +var buffer = __webpack_require__(64) var Buffer = buffer.Buffer // alternative to using Object.keys for old browsers @@ -24870,7 +25130,7 @@ SafeBuffer.allocUnsafeSlow = function (size) { /***/ }), -/* 43 */ +/* 46 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -24926,7 +25186,7 @@ var MapSubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 44 */ +/* 47 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -24937,7 +25197,7 @@ var errorObject = { e: {} }; /***/ }), -/* 45 */ +/* 48 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -24950,13 +25210,13 @@ function isScheduler(value) { /***/ }), -/* 46 */ +/* 49 */ /***/ (function(module, exports) { module.exports = require("os"); /***/ }), -/* 47 */ +/* 50 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -25039,17 +25299,17 @@ function queue(arr, promiseProducer, concurrency = Infinity) { } /***/ }), -/* 48 */ +/* 51 */ /***/ (function(module, exports, __webpack_require__) { // Thank's IE8 for his funny defineProperty -module.exports = !__webpack_require__(104)(function () { +module.exports = !__webpack_require__(112)(function () { return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7; }); /***/ }), -/* 49 */ +/* 52 */ /***/ (function(module, exports) { module.exports = function (it) { @@ -25058,19 +25318,104 @@ module.exports = function (it) { /***/ }), -/* 50 */ +/* 53 */ /***/ (function(module, exports) { module.exports = {}; /***/ }), -/* 51 */ +/* 54 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// YAML error class. http://stackoverflow.com/questions/8458984 +// + + +function YAMLException(reason, mark) { + // Super constructor + Error.call(this); + + this.name = 'YAMLException'; + this.reason = reason; + this.mark = mark; + this.message = (this.reason || '(unknown reason)') + (this.mark ? ' ' + this.mark.toString() : ''); + + // Include stack trace in error object + if (Error.captureStackTrace) { + // Chrome and NodeJS + Error.captureStackTrace(this, this.constructor); + } else { + // FF, IE 10+ and Safari 6+. Fallback for others + this.stack = (new Error()).stack || ''; + } +} + + +// Inherit from Error +YAMLException.prototype = Object.create(Error.prototype); +YAMLException.prototype.constructor = YAMLException; + + +YAMLException.prototype.toString = function toString(compact) { + var result = this.name + ': '; + + result += this.reason || '(unknown reason)'; + + if (!compact && this.mark) { + result += ' ' + this.mark.toString(); + } + + return result; +}; + + +module.exports = YAMLException; + + +/***/ }), +/* 55 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// JS-YAML's default schema for `safeLoad` function. +// It is not described in the YAML specification. +// +// This schema is based on standard YAML's Core schema and includes most of +// extra types described at YAML tag repository. (http://yaml.org/type/) + + + + + +var Schema = __webpack_require__(44); + + +module.exports = new Schema({ + include: [ + __webpack_require__(143) + ], + implicit: [ + __webpack_require__(299), + __webpack_require__(292) + ], + explicit: [ + __webpack_require__(284), + __webpack_require__(294), + __webpack_require__(295), + __webpack_require__(297) + ] +}); + + +/***/ }), +/* 56 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = tryCatch; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__errorObject__ = __webpack_require__(44); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__errorObject__ = __webpack_require__(47); /** PURE_IMPORTS_START _errorObject PURE_IMPORTS_END */ var tryCatchTarget; @@ -25091,7 +25436,7 @@ function tryCatch(fn) { /***/ }), -/* 52 */ +/* 57 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -25105,13 +25450,13 @@ exports.registryNames = exports.registries = undefined; var _yarnRegistry; function _load_yarnRegistry() { - return _yarnRegistry = _interopRequireDefault(__webpack_require__(527)); + return _yarnRegistry = _interopRequireDefault(__webpack_require__(558)); } var _npmRegistry; function _load_npmRegistry() { - return _npmRegistry = _interopRequireDefault(__webpack_require__(82)); + return _npmRegistry = _interopRequireDefault(__webpack_require__(88)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -25124,7 +25469,7 @@ const registries = exports.registries = { const registryNames = exports.registryNames = Object.keys(registries); /***/ }), -/* 53 */ +/* 58 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -25142,13 +25487,13 @@ exports.spawn = spawn; var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _blockingQueue; function _load_blockingQueue() { - return _blockingQueue = _interopRequireDefault(__webpack_require__(103)); + return _blockingQueue = _interopRequireDefault(__webpack_require__(110)); } var _errors; @@ -25160,7 +25505,7 @@ function _load_errors() { var _promise; function _load_promise() { - return _promise = __webpack_require__(47); + return _promise = __webpack_require__(50); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -25169,7 +25514,7 @@ function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; /* global child_process$spawnOpts */ -const child = __webpack_require__(298); +const child = __webpack_require__(331); const queue = exports.queue = new (_blockingQueue || _load_blockingQueue()).default('child', (_constants || _load_constants()).CHILD_CONCURRENCY); @@ -25300,7 +25645,7 @@ function spawn(program, args, opts = {}, onData) { } /***/ }), -/* 54 */ +/* 59 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -25381,20 +25726,20 @@ function _load_errors() { var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } /***/ }), -/* 55 */ +/* 60 */ /***/ (function(module, exports, __webpack_require__) { -var global = __webpack_require__(16); -var core = __webpack_require__(30); -var ctx = __webpack_require__(63); -var hide = __webpack_require__(41); -var has = __webpack_require__(64); +var global = __webpack_require__(17); +var core = __webpack_require__(31); +var ctx = __webpack_require__(69); +var hide = __webpack_require__(42); +var has = __webpack_require__(70); var PROTOTYPE = 'prototype'; var $export = function (type, name, source) { @@ -25455,7 +25800,7 @@ module.exports = $export; /***/ }), -/* 56 */ +/* 61 */ /***/ (function(module, exports, __webpack_require__) { try { @@ -25463,26 +25808,26 @@ try { if (typeof util.inherits !== 'function') throw ''; module.exports = util.inherits; } catch (e) { - module.exports = __webpack_require__(264); + module.exports = __webpack_require__(275); } /***/ }), -/* 57 */ +/* 62 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = from; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(10); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isPromise__ = __webpack_require__(413); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isArrayLike__ = __webpack_require__(410); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_isInteropObservable__ = __webpack_require__(897); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_isIterable__ = __webpack_require__(898); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__fromArray__ = __webpack_require__(78); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__fromPromise__ = __webpack_require__(799); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__fromIterable__ = __webpack_require__(797); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__fromObservable__ = __webpack_require__(798); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__util_subscribeTo__ = __webpack_require__(414); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(11); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isPromise__ = __webpack_require__(444); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isArrayLike__ = __webpack_require__(441); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_isInteropObservable__ = __webpack_require__(928); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_isIterable__ = __webpack_require__(929); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__fromArray__ = __webpack_require__(85); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__fromPromise__ = __webpack_require__(830); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__fromIterable__ = __webpack_require__(828); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__fromObservable__ = __webpack_require__(829); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__util_subscribeTo__ = __webpack_require__(445); /** PURE_IMPORTS_START _Observable,_util_isPromise,_util_isArrayLike,_util_isInteropObservable,_util_isIterable,_fromArray,_fromPromise,_fromIterable,_fromObservable,_util_subscribeTo PURE_IMPORTS_END */ @@ -25521,217 +25866,217 @@ function from(input, scheduler) { /***/ }), -/* 58 */ +/* 63 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; Object.defineProperty(__webpack_exports__, "__esModule", { value: true }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__internal_operators_audit__ = __webpack_require__(396); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__internal_operators_audit__ = __webpack_require__(427); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "audit", function() { return __WEBPACK_IMPORTED_MODULE_0__internal_operators_audit__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__internal_operators_auditTime__ = __webpack_require__(807); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__internal_operators_auditTime__ = __webpack_require__(838); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "auditTime", function() { return __WEBPACK_IMPORTED_MODULE_1__internal_operators_auditTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_operators_buffer__ = __webpack_require__(808); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_operators_buffer__ = __webpack_require__(839); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "buffer", function() { return __WEBPACK_IMPORTED_MODULE_2__internal_operators_buffer__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__internal_operators_bufferCount__ = __webpack_require__(809); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__internal_operators_bufferCount__ = __webpack_require__(840); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bufferCount", function() { return __WEBPACK_IMPORTED_MODULE_3__internal_operators_bufferCount__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_operators_bufferTime__ = __webpack_require__(810); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_operators_bufferTime__ = __webpack_require__(841); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bufferTime", function() { return __WEBPACK_IMPORTED_MODULE_4__internal_operators_bufferTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__internal_operators_bufferToggle__ = __webpack_require__(811); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__internal_operators_bufferToggle__ = __webpack_require__(842); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bufferToggle", function() { return __WEBPACK_IMPORTED_MODULE_5__internal_operators_bufferToggle__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_operators_bufferWhen__ = __webpack_require__(812); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_operators_bufferWhen__ = __webpack_require__(843); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bufferWhen", function() { return __WEBPACK_IMPORTED_MODULE_6__internal_operators_bufferWhen__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__internal_operators_catchError__ = __webpack_require__(813); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__internal_operators_catchError__ = __webpack_require__(844); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "catchError", function() { return __WEBPACK_IMPORTED_MODULE_7__internal_operators_catchError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__internal_operators_combineAll__ = __webpack_require__(814); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__internal_operators_combineAll__ = __webpack_require__(845); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "combineAll", function() { return __WEBPACK_IMPORTED_MODULE_8__internal_operators_combineAll__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__internal_operators_combineLatest__ = __webpack_require__(815); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__internal_operators_combineLatest__ = __webpack_require__(846); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "combineLatest", function() { return __WEBPACK_IMPORTED_MODULE_9__internal_operators_combineLatest__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__internal_operators_concat__ = __webpack_require__(816); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__internal_operators_concat__ = __webpack_require__(847); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "concat", function() { return __WEBPACK_IMPORTED_MODULE_10__internal_operators_concat__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__internal_operators_concatAll__ = __webpack_require__(397); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__internal_operators_concatAll__ = __webpack_require__(428); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "concatAll", function() { return __WEBPACK_IMPORTED_MODULE_11__internal_operators_concatAll__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__internal_operators_concatMap__ = __webpack_require__(398); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__internal_operators_concatMap__ = __webpack_require__(429); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "concatMap", function() { return __WEBPACK_IMPORTED_MODULE_12__internal_operators_concatMap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__internal_operators_concatMapTo__ = __webpack_require__(817); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__internal_operators_concatMapTo__ = __webpack_require__(848); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "concatMapTo", function() { return __WEBPACK_IMPORTED_MODULE_13__internal_operators_concatMapTo__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__internal_operators_count__ = __webpack_require__(818); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__internal_operators_count__ = __webpack_require__(849); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "count", function() { return __WEBPACK_IMPORTED_MODULE_14__internal_operators_count__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__internal_operators_debounce__ = __webpack_require__(819); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__internal_operators_debounce__ = __webpack_require__(850); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "debounce", function() { return __WEBPACK_IMPORTED_MODULE_15__internal_operators_debounce__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__internal_operators_debounceTime__ = __webpack_require__(820); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__internal_operators_debounceTime__ = __webpack_require__(851); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "debounceTime", function() { return __WEBPACK_IMPORTED_MODULE_16__internal_operators_debounceTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__internal_operators_defaultIfEmpty__ = __webpack_require__(137); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__internal_operators_defaultIfEmpty__ = __webpack_require__(146); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "defaultIfEmpty", function() { return __WEBPACK_IMPORTED_MODULE_17__internal_operators_defaultIfEmpty__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__internal_operators_delay__ = __webpack_require__(821); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__internal_operators_delay__ = __webpack_require__(852); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "delay", function() { return __WEBPACK_IMPORTED_MODULE_18__internal_operators_delay__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__internal_operators_delayWhen__ = __webpack_require__(822); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__internal_operators_delayWhen__ = __webpack_require__(853); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "delayWhen", function() { return __WEBPACK_IMPORTED_MODULE_19__internal_operators_delayWhen__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__internal_operators_dematerialize__ = __webpack_require__(823); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__internal_operators_dematerialize__ = __webpack_require__(854); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "dematerialize", function() { return __WEBPACK_IMPORTED_MODULE_20__internal_operators_dematerialize__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__internal_operators_distinct__ = __webpack_require__(824); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__internal_operators_distinct__ = __webpack_require__(855); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "distinct", function() { return __WEBPACK_IMPORTED_MODULE_21__internal_operators_distinct__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__internal_operators_distinctUntilChanged__ = __webpack_require__(399); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__internal_operators_distinctUntilChanged__ = __webpack_require__(430); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "distinctUntilChanged", function() { return __WEBPACK_IMPORTED_MODULE_22__internal_operators_distinctUntilChanged__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__internal_operators_distinctUntilKeyChanged__ = __webpack_require__(825); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__internal_operators_distinctUntilKeyChanged__ = __webpack_require__(856); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "distinctUntilKeyChanged", function() { return __WEBPACK_IMPORTED_MODULE_23__internal_operators_distinctUntilKeyChanged__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__internal_operators_elementAt__ = __webpack_require__(826); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__internal_operators_elementAt__ = __webpack_require__(857); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "elementAt", function() { return __WEBPACK_IMPORTED_MODULE_24__internal_operators_elementAt__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__internal_operators_endWith__ = __webpack_require__(827); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__internal_operators_endWith__ = __webpack_require__(858); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "endWith", function() { return __WEBPACK_IMPORTED_MODULE_25__internal_operators_endWith__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__internal_operators_every__ = __webpack_require__(828); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__internal_operators_every__ = __webpack_require__(859); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "every", function() { return __WEBPACK_IMPORTED_MODULE_26__internal_operators_every__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__internal_operators_exhaust__ = __webpack_require__(829); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__internal_operators_exhaust__ = __webpack_require__(860); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "exhaust", function() { return __WEBPACK_IMPORTED_MODULE_27__internal_operators_exhaust__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__internal_operators_exhaustMap__ = __webpack_require__(830); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__internal_operators_exhaustMap__ = __webpack_require__(861); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "exhaustMap", function() { return __WEBPACK_IMPORTED_MODULE_28__internal_operators_exhaustMap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__internal_operators_expand__ = __webpack_require__(831); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__internal_operators_expand__ = __webpack_require__(862); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "expand", function() { return __WEBPACK_IMPORTED_MODULE_29__internal_operators_expand__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__internal_operators_filter__ = __webpack_require__(138); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__internal_operators_filter__ = __webpack_require__(147); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "filter", function() { return __WEBPACK_IMPORTED_MODULE_30__internal_operators_filter__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__internal_operators_finalize__ = __webpack_require__(832); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__internal_operators_finalize__ = __webpack_require__(863); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "finalize", function() { return __WEBPACK_IMPORTED_MODULE_31__internal_operators_finalize__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__internal_operators_find__ = __webpack_require__(400); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__internal_operators_find__ = __webpack_require__(431); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "find", function() { return __WEBPACK_IMPORTED_MODULE_32__internal_operators_find__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__internal_operators_findIndex__ = __webpack_require__(833); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__internal_operators_findIndex__ = __webpack_require__(864); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "findIndex", function() { return __WEBPACK_IMPORTED_MODULE_33__internal_operators_findIndex__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__internal_operators_first__ = __webpack_require__(834); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__internal_operators_first__ = __webpack_require__(865); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "first", function() { return __WEBPACK_IMPORTED_MODULE_34__internal_operators_first__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__internal_operators_groupBy__ = __webpack_require__(401); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__internal_operators_groupBy__ = __webpack_require__(432); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "groupBy", function() { return __WEBPACK_IMPORTED_MODULE_35__internal_operators_groupBy__["b"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__internal_operators_ignoreElements__ = __webpack_require__(835); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__internal_operators_ignoreElements__ = __webpack_require__(866); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "ignoreElements", function() { return __WEBPACK_IMPORTED_MODULE_36__internal_operators_ignoreElements__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__internal_operators_isEmpty__ = __webpack_require__(836); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__internal_operators_isEmpty__ = __webpack_require__(867); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "isEmpty", function() { return __WEBPACK_IMPORTED_MODULE_37__internal_operators_isEmpty__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__internal_operators_last__ = __webpack_require__(837); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__internal_operators_last__ = __webpack_require__(868); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "last", function() { return __WEBPACK_IMPORTED_MODULE_38__internal_operators_last__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__internal_operators_map__ = __webpack_require__(43); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__internal_operators_map__ = __webpack_require__(46); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "map", function() { return __WEBPACK_IMPORTED_MODULE_39__internal_operators_map__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__internal_operators_mapTo__ = __webpack_require__(838); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__internal_operators_mapTo__ = __webpack_require__(869); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "mapTo", function() { return __WEBPACK_IMPORTED_MODULE_40__internal_operators_mapTo__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__internal_operators_materialize__ = __webpack_require__(839); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__internal_operators_materialize__ = __webpack_require__(870); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "materialize", function() { return __WEBPACK_IMPORTED_MODULE_41__internal_operators_materialize__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__internal_operators_max__ = __webpack_require__(840); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__internal_operators_max__ = __webpack_require__(871); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "max", function() { return __WEBPACK_IMPORTED_MODULE_42__internal_operators_max__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__internal_operators_merge__ = __webpack_require__(841); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__internal_operators_merge__ = __webpack_require__(872); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "merge", function() { return __WEBPACK_IMPORTED_MODULE_43__internal_operators_merge__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__internal_operators_mergeAll__ = __webpack_require__(282); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__internal_operators_mergeAll__ = __webpack_require__(315); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "mergeAll", function() { return __WEBPACK_IMPORTED_MODULE_44__internal_operators_mergeAll__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__internal_operators_mergeMap__ = __webpack_require__(139); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__internal_operators_mergeMap__ = __webpack_require__(148); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "mergeMap", function() { return __WEBPACK_IMPORTED_MODULE_45__internal_operators_mergeMap__["a"]; }); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "flatMap", function() { return __WEBPACK_IMPORTED_MODULE_45__internal_operators_mergeMap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__internal_operators_mergeMapTo__ = __webpack_require__(842); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__internal_operators_mergeMapTo__ = __webpack_require__(873); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "mergeMapTo", function() { return __WEBPACK_IMPORTED_MODULE_46__internal_operators_mergeMapTo__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__internal_operators_mergeScan__ = __webpack_require__(843); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__internal_operators_mergeScan__ = __webpack_require__(874); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "mergeScan", function() { return __WEBPACK_IMPORTED_MODULE_47__internal_operators_mergeScan__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__internal_operators_min__ = __webpack_require__(844); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__internal_operators_min__ = __webpack_require__(875); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "min", function() { return __WEBPACK_IMPORTED_MODULE_48__internal_operators_min__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__internal_operators_multicast__ = __webpack_require__(108); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__internal_operators_multicast__ = __webpack_require__(116); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "multicast", function() { return __WEBPACK_IMPORTED_MODULE_49__internal_operators_multicast__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__internal_operators_observeOn__ = __webpack_require__(402); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__internal_operators_observeOn__ = __webpack_require__(433); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "observeOn", function() { return __WEBPACK_IMPORTED_MODULE_50__internal_operators_observeOn__["b"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_51__internal_operators_onErrorResumeNext__ = __webpack_require__(845); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_51__internal_operators_onErrorResumeNext__ = __webpack_require__(876); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "onErrorResumeNext", function() { return __WEBPACK_IMPORTED_MODULE_51__internal_operators_onErrorResumeNext__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_52__internal_operators_pairwise__ = __webpack_require__(846); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_52__internal_operators_pairwise__ = __webpack_require__(877); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "pairwise", function() { return __WEBPACK_IMPORTED_MODULE_52__internal_operators_pairwise__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_53__internal_operators_partition__ = __webpack_require__(847); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_53__internal_operators_partition__ = __webpack_require__(878); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "partition", function() { return __WEBPACK_IMPORTED_MODULE_53__internal_operators_partition__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_54__internal_operators_pluck__ = __webpack_require__(848); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_54__internal_operators_pluck__ = __webpack_require__(879); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "pluck", function() { return __WEBPACK_IMPORTED_MODULE_54__internal_operators_pluck__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_55__internal_operators_publish__ = __webpack_require__(849); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_55__internal_operators_publish__ = __webpack_require__(880); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "publish", function() { return __WEBPACK_IMPORTED_MODULE_55__internal_operators_publish__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_56__internal_operators_publishBehavior__ = __webpack_require__(850); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_56__internal_operators_publishBehavior__ = __webpack_require__(881); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "publishBehavior", function() { return __WEBPACK_IMPORTED_MODULE_56__internal_operators_publishBehavior__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_57__internal_operators_publishLast__ = __webpack_require__(851); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_57__internal_operators_publishLast__ = __webpack_require__(882); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "publishLast", function() { return __WEBPACK_IMPORTED_MODULE_57__internal_operators_publishLast__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_58__internal_operators_publishReplay__ = __webpack_require__(852); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_58__internal_operators_publishReplay__ = __webpack_require__(883); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "publishReplay", function() { return __WEBPACK_IMPORTED_MODULE_58__internal_operators_publishReplay__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_59__internal_operators_race__ = __webpack_require__(853); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_59__internal_operators_race__ = __webpack_require__(884); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "race", function() { return __WEBPACK_IMPORTED_MODULE_59__internal_operators_race__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_60__internal_operators_reduce__ = __webpack_require__(178); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_60__internal_operators_reduce__ = __webpack_require__(187); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "reduce", function() { return __WEBPACK_IMPORTED_MODULE_60__internal_operators_reduce__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_61__internal_operators_repeat__ = __webpack_require__(854); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_61__internal_operators_repeat__ = __webpack_require__(885); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "repeat", function() { return __WEBPACK_IMPORTED_MODULE_61__internal_operators_repeat__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_62__internal_operators_repeatWhen__ = __webpack_require__(855); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_62__internal_operators_repeatWhen__ = __webpack_require__(886); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "repeatWhen", function() { return __WEBPACK_IMPORTED_MODULE_62__internal_operators_repeatWhen__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_63__internal_operators_retry__ = __webpack_require__(856); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_63__internal_operators_retry__ = __webpack_require__(887); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "retry", function() { return __WEBPACK_IMPORTED_MODULE_63__internal_operators_retry__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_64__internal_operators_retryWhen__ = __webpack_require__(857); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_64__internal_operators_retryWhen__ = __webpack_require__(888); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "retryWhen", function() { return __WEBPACK_IMPORTED_MODULE_64__internal_operators_retryWhen__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_65__internal_operators_refCount__ = __webpack_require__(283); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_65__internal_operators_refCount__ = __webpack_require__(316); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "refCount", function() { return __WEBPACK_IMPORTED_MODULE_65__internal_operators_refCount__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_66__internal_operators_sample__ = __webpack_require__(858); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_66__internal_operators_sample__ = __webpack_require__(889); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "sample", function() { return __WEBPACK_IMPORTED_MODULE_66__internal_operators_sample__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_67__internal_operators_sampleTime__ = __webpack_require__(859); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_67__internal_operators_sampleTime__ = __webpack_require__(890); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "sampleTime", function() { return __WEBPACK_IMPORTED_MODULE_67__internal_operators_sampleTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_68__internal_operators_scan__ = __webpack_require__(284); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_68__internal_operators_scan__ = __webpack_require__(317); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "scan", function() { return __WEBPACK_IMPORTED_MODULE_68__internal_operators_scan__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_69__internal_operators_sequenceEqual__ = __webpack_require__(860); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_69__internal_operators_sequenceEqual__ = __webpack_require__(891); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "sequenceEqual", function() { return __WEBPACK_IMPORTED_MODULE_69__internal_operators_sequenceEqual__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_70__internal_operators_share__ = __webpack_require__(861); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_70__internal_operators_share__ = __webpack_require__(892); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "share", function() { return __WEBPACK_IMPORTED_MODULE_70__internal_operators_share__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_71__internal_operators_shareReplay__ = __webpack_require__(862); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_71__internal_operators_shareReplay__ = __webpack_require__(893); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "shareReplay", function() { return __WEBPACK_IMPORTED_MODULE_71__internal_operators_shareReplay__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_72__internal_operators_single__ = __webpack_require__(863); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_72__internal_operators_single__ = __webpack_require__(894); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "single", function() { return __WEBPACK_IMPORTED_MODULE_72__internal_operators_single__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_73__internal_operators_skip__ = __webpack_require__(864); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_73__internal_operators_skip__ = __webpack_require__(895); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "skip", function() { return __WEBPACK_IMPORTED_MODULE_73__internal_operators_skip__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_74__internal_operators_skipLast__ = __webpack_require__(865); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_74__internal_operators_skipLast__ = __webpack_require__(896); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "skipLast", function() { return __WEBPACK_IMPORTED_MODULE_74__internal_operators_skipLast__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_75__internal_operators_skipUntil__ = __webpack_require__(866); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_75__internal_operators_skipUntil__ = __webpack_require__(897); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "skipUntil", function() { return __WEBPACK_IMPORTED_MODULE_75__internal_operators_skipUntil__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_76__internal_operators_skipWhile__ = __webpack_require__(867); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_76__internal_operators_skipWhile__ = __webpack_require__(898); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "skipWhile", function() { return __WEBPACK_IMPORTED_MODULE_76__internal_operators_skipWhile__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_77__internal_operators_startWith__ = __webpack_require__(868); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_77__internal_operators_startWith__ = __webpack_require__(899); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "startWith", function() { return __WEBPACK_IMPORTED_MODULE_77__internal_operators_startWith__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_78__internal_operators_subscribeOn__ = __webpack_require__(869); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_78__internal_operators_subscribeOn__ = __webpack_require__(900); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "subscribeOn", function() { return __WEBPACK_IMPORTED_MODULE_78__internal_operators_subscribeOn__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_79__internal_operators_switchAll__ = __webpack_require__(870); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_79__internal_operators_switchAll__ = __webpack_require__(901); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "switchAll", function() { return __WEBPACK_IMPORTED_MODULE_79__internal_operators_switchAll__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_80__internal_operators_switchMap__ = __webpack_require__(285); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_80__internal_operators_switchMap__ = __webpack_require__(318); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "switchMap", function() { return __WEBPACK_IMPORTED_MODULE_80__internal_operators_switchMap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_81__internal_operators_switchMapTo__ = __webpack_require__(871); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_81__internal_operators_switchMapTo__ = __webpack_require__(902); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "switchMapTo", function() { return __WEBPACK_IMPORTED_MODULE_81__internal_operators_switchMapTo__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_82__internal_operators_take__ = __webpack_require__(286); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_82__internal_operators_take__ = __webpack_require__(319); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "take", function() { return __WEBPACK_IMPORTED_MODULE_82__internal_operators_take__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_83__internal_operators_takeLast__ = __webpack_require__(287); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_83__internal_operators_takeLast__ = __webpack_require__(320); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "takeLast", function() { return __WEBPACK_IMPORTED_MODULE_83__internal_operators_takeLast__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_84__internal_operators_takeUntil__ = __webpack_require__(872); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_84__internal_operators_takeUntil__ = __webpack_require__(903); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "takeUntil", function() { return __WEBPACK_IMPORTED_MODULE_84__internal_operators_takeUntil__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_85__internal_operators_takeWhile__ = __webpack_require__(873); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_85__internal_operators_takeWhile__ = __webpack_require__(904); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "takeWhile", function() { return __WEBPACK_IMPORTED_MODULE_85__internal_operators_takeWhile__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_86__internal_operators_tap__ = __webpack_require__(403); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_86__internal_operators_tap__ = __webpack_require__(434); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "tap", function() { return __WEBPACK_IMPORTED_MODULE_86__internal_operators_tap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_87__internal_operators_throttle__ = __webpack_require__(404); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_87__internal_operators_throttle__ = __webpack_require__(435); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "throttle", function() { return __WEBPACK_IMPORTED_MODULE_87__internal_operators_throttle__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_88__internal_operators_throttleTime__ = __webpack_require__(874); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_88__internal_operators_throttleTime__ = __webpack_require__(905); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "throttleTime", function() { return __WEBPACK_IMPORTED_MODULE_88__internal_operators_throttleTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_89__internal_operators_throwIfEmpty__ = __webpack_require__(179); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_89__internal_operators_throwIfEmpty__ = __webpack_require__(188); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "throwIfEmpty", function() { return __WEBPACK_IMPORTED_MODULE_89__internal_operators_throwIfEmpty__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_90__internal_operators_timeInterval__ = __webpack_require__(875); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_90__internal_operators_timeInterval__ = __webpack_require__(906); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "timeInterval", function() { return __WEBPACK_IMPORTED_MODULE_90__internal_operators_timeInterval__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_91__internal_operators_timeout__ = __webpack_require__(876); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_91__internal_operators_timeout__ = __webpack_require__(907); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "timeout", function() { return __WEBPACK_IMPORTED_MODULE_91__internal_operators_timeout__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_92__internal_operators_timeoutWith__ = __webpack_require__(405); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_92__internal_operators_timeoutWith__ = __webpack_require__(436); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "timeoutWith", function() { return __WEBPACK_IMPORTED_MODULE_92__internal_operators_timeoutWith__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_93__internal_operators_timestamp__ = __webpack_require__(877); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_93__internal_operators_timestamp__ = __webpack_require__(908); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "timestamp", function() { return __WEBPACK_IMPORTED_MODULE_93__internal_operators_timestamp__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_94__internal_operators_toArray__ = __webpack_require__(878); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_94__internal_operators_toArray__ = __webpack_require__(909); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "toArray", function() { return __WEBPACK_IMPORTED_MODULE_94__internal_operators_toArray__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_95__internal_operators_window__ = __webpack_require__(879); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_95__internal_operators_window__ = __webpack_require__(910); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "window", function() { return __WEBPACK_IMPORTED_MODULE_95__internal_operators_window__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_96__internal_operators_windowCount__ = __webpack_require__(880); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_96__internal_operators_windowCount__ = __webpack_require__(911); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "windowCount", function() { return __WEBPACK_IMPORTED_MODULE_96__internal_operators_windowCount__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_97__internal_operators_windowTime__ = __webpack_require__(881); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_97__internal_operators_windowTime__ = __webpack_require__(912); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "windowTime", function() { return __WEBPACK_IMPORTED_MODULE_97__internal_operators_windowTime__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_98__internal_operators_windowToggle__ = __webpack_require__(882); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_98__internal_operators_windowToggle__ = __webpack_require__(913); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "windowToggle", function() { return __WEBPACK_IMPORTED_MODULE_98__internal_operators_windowToggle__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_99__internal_operators_windowWhen__ = __webpack_require__(883); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_99__internal_operators_windowWhen__ = __webpack_require__(914); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "windowWhen", function() { return __WEBPACK_IMPORTED_MODULE_99__internal_operators_windowWhen__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_100__internal_operators_withLatestFrom__ = __webpack_require__(884); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_100__internal_operators_withLatestFrom__ = __webpack_require__(915); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "withLatestFrom", function() { return __WEBPACK_IMPORTED_MODULE_100__internal_operators_withLatestFrom__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_101__internal_operators_zip__ = __webpack_require__(885); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_101__internal_operators_zip__ = __webpack_require__(916); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "zip", function() { return __WEBPACK_IMPORTED_MODULE_101__internal_operators_zip__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_102__internal_operators_zipAll__ = __webpack_require__(886); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_102__internal_operators_zipAll__ = __webpack_require__(917); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "zipAll", function() { return __WEBPACK_IMPORTED_MODULE_102__internal_operators_zipAll__["a"]; }); /** PURE_IMPORTS_START PURE_IMPORTS_END */ @@ -25842,7 +26187,13 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true }); /***/ }), -/* 59 */ +/* 64 */ +/***/ (function(module, exports) { + +module.exports = require("buffer"); + +/***/ }), +/* 65 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. @@ -25850,7 +26201,7 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true }); // If you have no idea what ASN.1 or BER is, see this: // ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc -var Ber = __webpack_require__(482); +var Ber = __webpack_require__(513); @@ -25868,7 +26219,7 @@ module.exports = { /***/ }), -/* 60 */ +/* 66 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -25882,21 +26233,21 @@ exports.home = undefined; var _rootUser; function _load_rootUser() { - return _rootUser = _interopRequireDefault(__webpack_require__(213)); + return _rootUser = _interopRequireDefault(__webpack_require__(223)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } const path = __webpack_require__(0); -const home = exports.home = __webpack_require__(46).homedir(); +const home = exports.home = __webpack_require__(49).homedir(); const userHomeDir = (_rootUser || _load_rootUser()).default ? path.resolve('/usr/local/share') : home; exports.default = userHomeDir; /***/ }), -/* 61 */ +/* 67 */ /***/ (function(module, exports) { module.exports = function (it) { @@ -25906,7 +26257,7 @@ module.exports = function (it) { /***/ }), -/* 62 */ +/* 68 */ /***/ (function(module, exports) { var toString = {}.toString; @@ -25917,11 +26268,11 @@ module.exports = function (it) { /***/ }), -/* 63 */ +/* 69 */ /***/ (function(module, exports, __webpack_require__) { // optional / simple context binding -var aFunction = __webpack_require__(61); +var aFunction = __webpack_require__(67); module.exports = function (fn, that, length) { aFunction(fn); if (that === undefined) return fn; @@ -25943,7 +26294,7 @@ module.exports = function (fn, that, length) { /***/ }), -/* 64 */ +/* 70 */ /***/ (function(module, exports) { var hasOwnProperty = {}.hasOwnProperty; @@ -25953,15 +26304,15 @@ module.exports = function (it, key) { /***/ }), -/* 65 */ +/* 71 */ /***/ (function(module, exports, __webpack_require__) { -var anObject = __webpack_require__(34); -var IE8_DOM_DEFINE = __webpack_require__(228); -var toPrimitive = __webpack_require__(245); +var anObject = __webpack_require__(35); +var IE8_DOM_DEFINE = __webpack_require__(238); +var toPrimitive = __webpack_require__(255); var dP = Object.defineProperty; -exports.f = __webpack_require__(48) ? Object.defineProperty : function defineProperty(O, P, Attributes) { +exports.f = __webpack_require__(51) ? Object.defineProperty : function defineProperty(O, P, Attributes) { anObject(O); P = toPrimitive(P, true); anObject(Attributes); @@ -25975,12 +26326,44 @@ exports.f = __webpack_require__(48) ? Object.defineProperty : function definePro /***/ }), -/* 66 */ +/* 72 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// JS-YAML's default schema for `load` function. +// It is not described in the YAML specification. +// +// This schema is based on JS-YAML's default safe schema and includes +// JavaScript-specific types: !!js/undefined, !!js/regexp and !!js/function. +// +// Also this schema is used as default base schema at `Schema.create` function. + + + + + +var Schema = __webpack_require__(44); + + +module.exports = Schema.DEFAULT = new Schema({ + include: [ + __webpack_require__(55) + ], + explicit: [ + __webpack_require__(290), + __webpack_require__(289), + __webpack_require__(288) + ] +}); + + +/***/ }), +/* 73 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. -var assert = __webpack_require__(15); +var assert = __webpack_require__(16); var util = __webpack_require__(3); function FingerprintFormatError(fp, format) { @@ -26065,21 +26448,21 @@ module.exports = { /***/ }), -/* 67 */ +/* 74 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = Signature; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var errs = __webpack_require__(66); -var utils = __webpack_require__(25); -var asn1 = __webpack_require__(59); -var SSHBuffer = __webpack_require__(150); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var errs = __webpack_require__(73); +var utils = __webpack_require__(26); +var asn1 = __webpack_require__(65); +var SSHBuffer = __webpack_require__(159); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var SignatureParseError = errs.SignatureParseError; @@ -26385,7 +26768,7 @@ Signature._oldVersionDetect = function (obj) { /***/ }), -/* 68 */ +/* 75 */ /***/ (function(module, exports, __webpack_require__) { (function(nacl) { @@ -28764,7 +29147,7 @@ nacl.setPRNG = function(fn) { }); } else if (true) { // Node.js. - crypto = __webpack_require__(11); + crypto = __webpack_require__(12); if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); @@ -28779,22 +29162,22 @@ nacl.setPRNG = function(fn) { /***/ }), -/* 69 */ +/* 76 */ /***/ (function(module, exports) { module.exports = require("events"); /***/ }), -/* 70 */ +/* 77 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -const Buffer = __webpack_require__(42).Buffer +const Buffer = __webpack_require__(45).Buffer -const crypto = __webpack_require__(11) -const Transform = __webpack_require__(22).Transform +const crypto = __webpack_require__(12) +const Transform = __webpack_require__(23).Transform const SPEC_ALGORITHMS = ['sha256', 'sha384', 'sha512'] @@ -29171,7 +29554,7 @@ function getPrioritizedHash (algo1, algo2) { /***/ }), -/* 71 */ +/* 78 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -29187,79 +29570,79 @@ exports.hostedGitFragmentToGitUrl = hostedGitFragmentToGitUrl; var _baseResolver; function _load_baseResolver() { - return _baseResolver = _interopRequireDefault(__webpack_require__(115)); + return _baseResolver = _interopRequireDefault(__webpack_require__(123)); } var _npmResolver; function _load_npmResolver() { - return _npmResolver = _interopRequireDefault(__webpack_require__(207)); + return _npmResolver = _interopRequireDefault(__webpack_require__(217)); } var _yarnResolver; function _load_yarnResolver() { - return _yarnResolver = _interopRequireDefault(__webpack_require__(544)); + return _yarnResolver = _interopRequireDefault(__webpack_require__(575)); } var _gitResolver; function _load_gitResolver() { - return _gitResolver = _interopRequireDefault(__webpack_require__(116)); + return _gitResolver = _interopRequireDefault(__webpack_require__(124)); } var _tarballResolver; function _load_tarballResolver() { - return _tarballResolver = _interopRequireDefault(__webpack_require__(542)); + return _tarballResolver = _interopRequireDefault(__webpack_require__(573)); } var _githubResolver; function _load_githubResolver() { - return _githubResolver = _interopRequireDefault(__webpack_require__(335)); + return _githubResolver = _interopRequireDefault(__webpack_require__(367)); } var _fileResolver; function _load_fileResolver() { - return _fileResolver = _interopRequireDefault(__webpack_require__(205)); + return _fileResolver = _interopRequireDefault(__webpack_require__(215)); } var _linkResolver; function _load_linkResolver() { - return _linkResolver = _interopRequireDefault(__webpack_require__(336)); + return _linkResolver = _interopRequireDefault(__webpack_require__(368)); } var _gitlabResolver; function _load_gitlabResolver() { - return _gitlabResolver = _interopRequireDefault(__webpack_require__(540)); + return _gitlabResolver = _interopRequireDefault(__webpack_require__(571)); } var _gistResolver; function _load_gistResolver() { - return _gistResolver = _interopRequireDefault(__webpack_require__(206)); + return _gistResolver = _interopRequireDefault(__webpack_require__(216)); } var _bitbucketResolver; function _load_bitbucketResolver() { - return _bitbucketResolver = _interopRequireDefault(__webpack_require__(539)); + return _bitbucketResolver = _interopRequireDefault(__webpack_require__(570)); } var _hostedGitResolver; function _load_hostedGitResolver() { - return _hostedGitResolver = __webpack_require__(102); + return _hostedGitResolver = __webpack_require__(109); } var _registryResolver; function _load_registryResolver() { - return _registryResolver = _interopRequireDefault(__webpack_require__(541)); + return _registryResolver = _interopRequireDefault(__webpack_require__(572)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -29325,7 +29708,7 @@ for (const key in registries) { } /***/ }), -/* 72 */ +/* 79 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -29335,12 +29718,12 @@ for (const key in registries) { * Should be extended by prompt types. */ -var _ = __webpack_require__(37); -var chalk = __webpack_require__(29); -var runAsync = __webpack_require__(172); -var { filter, flatMap, share, take, takeUntil } = __webpack_require__(58); -var Choices = __webpack_require__(655); -var ScreenManager = __webpack_require__(666); +var _ = __webpack_require__(38); +var chalk = __webpack_require__(30); +var runAsync = __webpack_require__(181); +var { filter, flatMap, share, take, takeUntil } = __webpack_require__(63); +var Choices = __webpack_require__(686); +var ScreenManager = __webpack_require__(697); class Prompt { constructor(question, rl, answers) { @@ -29480,13 +29863,13 @@ module.exports = Prompt; /***/ }), -/* 73 */ +/* 80 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var { fromEvent } = __webpack_require__(173); -var { filter, map, share } = __webpack_require__(58); +var { fromEvent } = __webpack_require__(182); +var { filter, map, share } = __webpack_require__(63); function normalizeKeypressEvents(value, key) { return { value: value, key: key || {} }; @@ -29540,7 +29923,7 @@ module.exports = function(rl) { /***/ }), -/* 74 */ +/* 81 */ /***/ (function(module, exports, __webpack_require__) { (function(){ @@ -30903,7 +31286,7 @@ module.exports = function(rl) { /***/ }), -/* 75 */ +/* 82 */ /***/ (function(module, exports, __webpack_require__) { module.exports = minimatch @@ -30915,7 +31298,7 @@ try { } catch (er) {} var GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {} -var expand = __webpack_require__(219) +var expand = __webpack_require__(229) var plTypes = { '!': { open: '(?:(?!(?:', close: '))[^/]*?)'}, @@ -31832,10 +32215,10 @@ function regExpEscape (s) { /***/ }), -/* 76 */ +/* 83 */ /***/ (function(module, exports, __webpack_require__) { -var wrappy = __webpack_require__(152) +var wrappy = __webpack_require__(161) module.exports = wrappy(once) module.exports.strict = wrappy(onceStrict) @@ -31880,7 +32263,7 @@ function onceStrict (fn) { /***/ }), -/* 77 */ +/* 84 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -31918,14 +32301,14 @@ var InnerSubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 78 */ +/* 85 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = fromArray; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(10); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscription__ = __webpack_require__(24); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_subscribeToArray__ = __webpack_require__(415); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Observable__ = __webpack_require__(11); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscription__ = __webpack_require__(25); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_subscribeToArray__ = __webpack_require__(446); /** PURE_IMPORTS_START _Observable,_Subscription,_util_subscribeToArray PURE_IMPORTS_END */ @@ -31956,7 +32339,7 @@ function fromArray(input, scheduler) { /***/ }), -/* 79 */ +/* 86 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. @@ -31966,21 +32349,21 @@ module.exports = { write: write }; -var assert = __webpack_require__(15); -var asn1 = __webpack_require__(59); -var crypto = __webpack_require__(11); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var utils = __webpack_require__(25); -var Key = __webpack_require__(26); -var PrivateKey = __webpack_require__(32); +var assert = __webpack_require__(16); +var asn1 = __webpack_require__(65); +var crypto = __webpack_require__(12); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var utils = __webpack_require__(26); +var Key = __webpack_require__(27); +var PrivateKey = __webpack_require__(33); -var pkcs1 = __webpack_require__(294); -var pkcs8 = __webpack_require__(148); -var sshpriv = __webpack_require__(183); -var rfc4253 = __webpack_require__(96); +var pkcs1 = __webpack_require__(327); +var pkcs8 = __webpack_require__(157); +var sshpriv = __webpack_require__(192); +var rfc4253 = __webpack_require__(103); -var errors = __webpack_require__(66); +var errors = __webpack_require__(73); /* * For reading we support both PKCS#1 and PKCS#8. If we find a private key, @@ -32154,19 +32537,13 @@ function write(key, options, type) { /***/ }), -/* 80 */ -/***/ (function(module, exports) { - -module.exports = require("buffer"); - -/***/ }), -/* 81 */ +/* 87 */ /***/ (function(module, exports) { module.exports = require("http"); /***/ }), -/* 82 */ +/* 88 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -32180,7 +32557,7 @@ exports.SCOPE_SEPARATOR = undefined; var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _asyncToGenerator2; @@ -32192,7 +32569,7 @@ function _load_asyncToGenerator() { var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _fs; @@ -32204,49 +32581,49 @@ function _load_fs() { var _npmResolver; function _load_npmResolver() { - return _npmResolver = _interopRequireDefault(__webpack_require__(207)); + return _npmResolver = _interopRequireDefault(__webpack_require__(217)); } var _envReplace; function _load_envReplace() { - return _envReplace = _interopRequireDefault(__webpack_require__(545)); + return _envReplace = _interopRequireDefault(__webpack_require__(576)); } var _baseRegistry; function _load_baseRegistry() { - return _baseRegistry = _interopRequireDefault(__webpack_require__(526)); + return _baseRegistry = _interopRequireDefault(__webpack_require__(557)); } var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } var _path; function _load_path() { - return _path = __webpack_require__(344); + return _path = __webpack_require__(376); } var _normalizeUrl; function _load_normalizeUrl() { - return _normalizeUrl = _interopRequireDefault(__webpack_require__(369)); + return _normalizeUrl = _interopRequireDefault(__webpack_require__(401)); } var _userHomeDir; function _load_userHomeDir() { - return _userHomeDir = _interopRequireDefault(__webpack_require__(60)); + return _userHomeDir = _interopRequireDefault(__webpack_require__(66)); } var _userHomeDir2; function _load_userHomeDir2() { - return _userHomeDir2 = __webpack_require__(60); + return _userHomeDir2 = __webpack_require__(66); } var _errors; @@ -32258,7 +32635,7 @@ function _load_errors() { var _login; function _load_login() { - return _login = __webpack_require__(100); + return _login = __webpack_require__(107); } var _path2; @@ -32270,13 +32647,13 @@ function _load_path2() { var _url; function _load_url() { - return _url = _interopRequireDefault(__webpack_require__(23)); + return _url = _interopRequireDefault(__webpack_require__(24)); } var _ini; function _load_ini() { - return _ini = _interopRequireDefault(__webpack_require__(653)); + return _ini = _interopRequireDefault(__webpack_require__(684)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -32284,6 +32661,7 @@ function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } const DEFAULT_REGISTRY = 'https://registry.npmjs.org/'; +const REGEX_REGISTRY_ENFORCED_HTTPS = /^https?:\/\/([^\/]+\.)?(yarnpkg\.com|npmjs\.(org|com))(\/|$)/; const REGEX_REGISTRY_HTTP_PROTOCOL = /^https?:/i; const REGEX_REGISTRY_PREFIX = /^(https?:)?\/\//i; const REGEX_REGISTRY_SUFFIX = /registry\/?$/; @@ -32360,13 +32738,17 @@ class NpmRegistry extends (_baseRegistry || _load_baseRegistry()).default { } getRequestUrl(registry, pathname) { - const isUrl = REGEX_REGISTRY_PREFIX.test(pathname); + let resolved = pathname; - if (isUrl) { - return pathname; - } else { - return (_url || _load_url()).default.resolve((0, (_misc || _load_misc()).addSuffix)(registry, '/'), pathname); + if (!REGEX_REGISTRY_PREFIX.test(pathname)) { + resolved = (_url || _load_url()).default.resolve((0, (_misc || _load_misc()).addSuffix)(registry, '/'), pathname); } + + if (REGEX_REGISTRY_ENFORCED_HTTPS.test(resolved)) { + resolved = resolved.replace(/^http:\/\//, 'https://'); + } + + return resolved; } isRequestToRegistry(requestUrl, registryUrl) { @@ -32743,7 +33125,7 @@ exports.default = NpmRegistry; NpmRegistry.filename = 'package.json'; /***/ }), -/* 83 */ +/* 89 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -32756,7 +33138,7 @@ Object.defineProperty(exports, "__esModule", { var _baseResolver; function _load_baseResolver() { - return _baseResolver = _interopRequireDefault(__webpack_require__(115)); + return _baseResolver = _interopRequireDefault(__webpack_require__(123)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -32775,7 +33157,7 @@ class ExoticResolver extends (_baseResolver || _load_baseResolver()).default { exports.default = ExoticResolver; /***/ }), -/* 84 */ +/* 90 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -32788,10 +33170,10 @@ Object.defineProperty(exports, "__esModule", { var _normalizePattern2; function _load_normalizePattern() { - return _normalizePattern2 = __webpack_require__(36); + return _normalizePattern2 = __webpack_require__(37); } -const semver = __webpack_require__(20); +const semver = __webpack_require__(21); class WorkspaceLayout { constructor(workspaces, config) { @@ -32819,7 +33201,7 @@ class WorkspaceLayout { exports.default = WorkspaceLayout; /***/ }), -/* 85 */ +/* 91 */ /***/ (function(module, exports) { // 7.2.1 RequireObjectCoercible(argument) @@ -32830,11 +33212,11 @@ module.exports = function (it) { /***/ }), -/* 86 */ +/* 92 */ /***/ (function(module, exports, __webpack_require__) { -var isObject = __webpack_require__(49); -var document = __webpack_require__(16).document; +var isObject = __webpack_require__(52); +var document = __webpack_require__(17).document; // typeof document.createElement is 'object' in old IE var is = isObject(document) && isObject(document.createElement); module.exports = function (it) { @@ -32843,20 +33225,20 @@ module.exports = function (it) { /***/ }), -/* 87 */ +/* 93 */ /***/ (function(module, exports) { module.exports = true; /***/ }), -/* 88 */ +/* 94 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; // 25.4.1.5 NewPromiseCapability(C) -var aFunction = __webpack_require__(61); +var aFunction = __webpack_require__(67); function PromiseCapability(C) { var resolve, reject; @@ -32875,12 +33257,12 @@ module.exports.f = function (C) { /***/ }), -/* 89 */ +/* 95 */ /***/ (function(module, exports, __webpack_require__) { -var def = __webpack_require__(65).f; -var has = __webpack_require__(64); -var TAG = __webpack_require__(19)('toStringTag'); +var def = __webpack_require__(71).f; +var has = __webpack_require__(70); +var TAG = __webpack_require__(20)('toStringTag'); module.exports = function (it, tag, stat) { if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag }); @@ -32888,18 +33270,18 @@ module.exports = function (it, tag, stat) { /***/ }), -/* 90 */ +/* 96 */ /***/ (function(module, exports, __webpack_require__) { -var shared = __webpack_require__(126)('keys'); -var uid = __webpack_require__(130); +var shared = __webpack_require__(133)('keys'); +var uid = __webpack_require__(137); module.exports = function (key) { return shared[key] || (shared[key] = uid(key)); }; /***/ }), -/* 91 */ +/* 97 */ /***/ (function(module, exports) { // 7.1.4 ToInteger @@ -32911,19 +33293,19 @@ module.exports = function (it) { /***/ }), -/* 92 */ +/* 98 */ /***/ (function(module, exports, __webpack_require__) { // to indexed object, toObject with fallback for non-array-like ES3 strings -var IObject = __webpack_require__(161); -var defined = __webpack_require__(85); +var IObject = __webpack_require__(170); +var defined = __webpack_require__(91); module.exports = function (it) { return IObject(defined(it)); }; /***/ }), -/* 93 */ +/* 99 */ /***/ (function(module, exports, __webpack_require__) { // Approach: @@ -32969,26 +33351,26 @@ module.exports = function (it) { module.exports = glob var fs = __webpack_require__(4) -var rp = __webpack_require__(133) -var minimatch = __webpack_require__(75) +var rp = __webpack_require__(140) +var minimatch = __webpack_require__(82) var Minimatch = minimatch.Minimatch -var inherits = __webpack_require__(56) -var EE = __webpack_require__(69).EventEmitter +var inherits = __webpack_require__(61) +var EE = __webpack_require__(76).EventEmitter var path = __webpack_require__(0) -var assert = __webpack_require__(27) -var isAbsolute = __webpack_require__(94) -var globSync = __webpack_require__(261) -var common = __webpack_require__(134) +var assert = __webpack_require__(28) +var isAbsolute = __webpack_require__(101) +var globSync = __webpack_require__(272) +var common = __webpack_require__(141) var alphasort = common.alphasort var alphasorti = common.alphasorti var setopts = common.setopts var ownProp = common.ownProp -var inflight = __webpack_require__(263) +var inflight = __webpack_require__(274) var util = __webpack_require__(3) var childrenIgnored = common.childrenIgnored var isIgnored = common.isIgnored -var once = __webpack_require__(76) +var once = __webpack_require__(83) function glob (pattern, options, cb) { if (typeof options === 'function') cb = options, options = {} @@ -33719,7 +34101,31 @@ Glob.prototype._stat2 = function (f, abs, er, stat, cb) { /***/ }), -/* 94 */ +/* 100 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// Standard YAML's Failsafe schema. +// http://www.yaml.org/spec/1.2/spec.html#id2802346 + + + + + +var Schema = __webpack_require__(44); + + +module.exports = new Schema({ + explicit: [ + __webpack_require__(298), + __webpack_require__(296), + __webpack_require__(291) + ] +}); + + +/***/ }), +/* 101 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -33746,10 +34152,10 @@ module.exports.win32 = win32; /***/ }), -/* 95 */ +/* 102 */ /***/ (function(module, exports, __webpack_require__) { -var Stream = __webpack_require__(22); +var Stream = __webpack_require__(23); if (process.env.READABLE_STREAM === 'disable' && Stream) { module.exports = Stream; exports = module.exports = Stream.Readable; @@ -33760,18 +34166,18 @@ if (process.env.READABLE_STREAM === 'disable' && Stream) { exports.PassThrough = Stream.PassThrough; exports.Stream = Stream; } else { - exports = module.exports = __webpack_require__(374); + exports = module.exports = __webpack_require__(405); exports.Stream = Stream || exports; exports.Readable = exports; - exports.Writable = __webpack_require__(376); - exports.Duplex = __webpack_require__(107); - exports.Transform = __webpack_require__(375); - exports.PassThrough = __webpack_require__(761); + exports.Writable = __webpack_require__(407); + exports.Duplex = __webpack_require__(115); + exports.Transform = __webpack_require__(406); + exports.PassThrough = __webpack_require__(792); } /***/ }), -/* 96 */ +/* 103 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. @@ -33789,13 +34195,13 @@ module.exports = { algToKeyType: algToKeyType }; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var utils = __webpack_require__(25); -var Key = __webpack_require__(26); -var PrivateKey = __webpack_require__(32); -var SSHBuffer = __webpack_require__(150); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var utils = __webpack_require__(26); +var Key = __webpack_require__(27); +var PrivateKey = __webpack_require__(33); +var SSHBuffer = __webpack_require__(159); function algToKeyType(alg) { assert.string(alg); @@ -33943,13 +34349,13 @@ function write(key, options) { /***/ }), -/* 97 */ +/* 104 */ /***/ (function(module, exports) { module.exports = require("tty"); /***/ }), -/* 98 */ +/* 105 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -33973,19 +34379,19 @@ function _load_util() { var _invariant; function _load_invariant() { - return _invariant = _interopRequireDefault(__webpack_require__(8)); + return _invariant = _interopRequireDefault(__webpack_require__(9)); } var _stripBom; function _load_stripBom() { - return _stripBom = _interopRequireDefault(__webpack_require__(151)); + return _stripBom = _interopRequireDefault(__webpack_require__(160)); } var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _errors; @@ -33997,13 +34403,19 @@ function _load_errors() { var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } /* eslint quotes: 0 */ +var _require = __webpack_require__(279); + +const safeLoad = _require.safeLoad, + FAILSAFE_SCHEMA = _require.FAILSAFE_SCHEMA; + + const VERSION_REGEX = /^yarn lockfile v(\d+)$/; const TOKEN_TYPES = { @@ -34114,7 +34526,7 @@ function* tokenise(input) { } else if (input[0] === ',') { yield buildToken(TOKEN_TYPES.comma); chop++; - } else if (/^[a-zA-Z\/-]/g.test(input)) { + } else if (/^[a-zA-Z\/.-]/g.test(input)) { let i = 0; for (; i < input.length; i++) { const char = input[i]; @@ -34261,15 +34673,13 @@ class Parser { this.next(); } - const valToken = this.token; - - if (valToken.type === TOKEN_TYPES.colon) { - // object + const wasColon = this.token.type === TOKEN_TYPES.colon; + if (wasColon) { this.next(); + } - // parse object - const val = this.parse(indent + 1); - + if (isValidPropValueToken(this.token)) { + // plain value for (var _iterator = keys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { var _ref; @@ -34284,14 +34694,14 @@ class Parser { const key = _ref; - obj[key] = val; + obj[key] = this.token.value; } - if (indent && this.token.type !== TOKEN_TYPES.indent) { - break; - } - } else if (isValidPropValueToken(valToken)) { - // plain value + this.next(); + } else if (wasColon) { + // parse object + const val = this.parse(indent + 1); + for (var _iterator2 = keys, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { var _ref2; @@ -34306,10 +34716,12 @@ class Parser { const key = _ref2; - obj[key] = valToken.value; + obj[key] = val; } - this.next(); + if (indent && this.token.type !== TOKEN_TYPES.indent) { + break; + } } else { this.unexpected('Invalid value type'); } @@ -34383,7 +34795,17 @@ function hasMergeConflicts(str) { function parse(str, fileLoc) { const parser = new Parser(str, fileLoc); parser.next(); - return parser.parse(); + try { + return parser.parse(); + } catch (error1) { + try { + return safeLoad(str, { + schema: FAILSAFE_SCHEMA + }); + } catch (error2) { + throw error1; + } + } } /** @@ -34403,7 +34825,7 @@ function parseWithConflict(str, fileLoc) { } /***/ }), -/* 99 */ +/* 106 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -34418,8 +34840,8 @@ module.exports = { toHash: toHash, getProperty: getProperty, escapeQuotes: escapeQuotes, - equal: __webpack_require__(195), - ucs2length: __webpack_require__(448), + equal: __webpack_require__(204), + ucs2length: __webpack_require__(479), varOccurences: varOccurences, varReplace: varReplace, cleanUpCode: cleanUpCode, @@ -34677,7 +35099,7 @@ function unescapeJsonPointer(str) { /***/ }), -/* 100 */ +/* 107 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -34791,6 +35213,7 @@ let getToken = exports.getToken = (() => { // const res = yield config.registries.npm.request(`-/user/org.couchdb.user:${encodeURIComponent(username)}`, { method: 'PUT', + registry, body: userobj, auth: { username, password, email } }); @@ -34860,7 +35283,7 @@ function setFlags(commander) { } /***/ }), -/* 101 */ +/* 108 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -34881,25 +35304,25 @@ exports.stringifyLangArgs = stringifyLangArgs; var _format; function _load_format() { - return _format = __webpack_require__(534); + return _format = __webpack_require__(565); } var _index; function _load_index() { - return _index = _interopRequireWildcard(__webpack_require__(536)); + return _index = _interopRequireWildcard(__webpack_require__(567)); } var _isCi; function _load_isCi() { - return _isCi = _interopRequireDefault(__webpack_require__(364)); + return _isCi = _interopRequireDefault(__webpack_require__(396)); } var _os; function _load_os() { - return _os = _interopRequireDefault(__webpack_require__(46)); + return _os = _interopRequireDefault(__webpack_require__(49)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -34909,7 +35332,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { de /* eslint no-unused-vars: 0 */ const util = __webpack_require__(3); -const EventEmitter = __webpack_require__(69).EventEmitter; +const EventEmitter = __webpack_require__(76).EventEmitter; function stringifyLangArgs(args) { return args.map(function (val) { @@ -35174,7 +35597,7 @@ class BaseReporter { exports.default = BaseReporter; /***/ }), -/* 102 */ +/* 109 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -35201,31 +35624,31 @@ function _load_errors() { var _index; function _load_index() { - return _index = __webpack_require__(52); + return _index = __webpack_require__(57); } var _gitResolver; function _load_gitResolver() { - return _gitResolver = _interopRequireDefault(__webpack_require__(116)); + return _gitResolver = _interopRequireDefault(__webpack_require__(124)); } var _exoticResolver; function _load_exoticResolver() { - return _exoticResolver = _interopRequireDefault(__webpack_require__(83)); + return _exoticResolver = _interopRequireDefault(__webpack_require__(89)); } var _git; function _load_git() { - return _git = _interopRequireDefault(__webpack_require__(209)); + return _git = _interopRequireDefault(__webpack_require__(219)); } var _guessName; function _load_guessName() { - return _guessName = _interopRequireDefault(__webpack_require__(160)); + return _guessName = _interopRequireDefault(__webpack_require__(169)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -35467,7 +35890,7 @@ class HostedGitResolver extends (_exoticResolver || _load_exoticResolver()).defa exports.default = HostedGitResolver; /***/ }), -/* 103 */ +/* 110 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -35480,12 +35903,12 @@ Object.defineProperty(exports, "__esModule", { var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const debug = __webpack_require__(256)('yarn'); +const debug = __webpack_require__(266)('yarn'); class BlockingQueue { constructor(alias, maxConcurrency = Infinity) { @@ -35612,7 +36035,499 @@ class BlockingQueue { exports.default = BlockingQueue; /***/ }), -/* 104 */ +/* 111 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.execCommand = exports.execFromManifest = exports.executeLifecycleScript = exports.makeEnv = exports.getWrappersFolder = exports.IGNORE_MANIFEST_KEYS = undefined; + +var _extends2; + +function _load_extends() { + return _extends2 = _interopRequireDefault(__webpack_require__(22)); +} + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); +} + +let getWrappersFolder = exports.getWrappersFolder = (() => { + var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config) { + if (wrappersFolder) { + return wrappersFolder; + } + + wrappersFolder = yield (_fs || _load_fs()).makeTempDir(); + + yield (0, (_portableScript || _load_portableScript()).makePortableProxyScript)(process.execPath, wrappersFolder, { + proxyBasename: 'node' + }); + + yield (0, (_portableScript || _load_portableScript()).makePortableProxyScript)(process.execPath, wrappersFolder, { + proxyBasename: 'yarn', + prependArguments: [process.argv[1]] + }); + + return wrappersFolder; + }); + + return function getWrappersFolder(_x) { + return _ref.apply(this, arguments); + }; +})(); + +let makeEnv = exports.makeEnv = (() => { + var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (stage, cwd, config) { + const env = (0, (_extends2 || _load_extends()).default)({ + NODE: process.execPath, + INIT_CWD: process.cwd() + }, process.env); + + // Merge in the `env` object specified in .yarnrc + const customEnv = config.getOption('env'); + if (customEnv && typeof customEnv === 'object') { + Object.assign(env, customEnv); + } + + env.npm_lifecycle_event = stage; + env.npm_node_execpath = env.NODE; + env.npm_execpath = env.npm_execpath || process.mainModule && process.mainModule.filename; + + // Set the env to production for npm compat if production mode. + // https://github.com/npm/npm/blob/30d75e738b9cb7a6a3f9b50e971adcbe63458ed3/lib/utils/lifecycle.js#L336 + if (config.production) { + env.NODE_ENV = 'production'; + } + + // Note: npm_config_argv environment variable contains output of nopt - command-line + // parser used by npm. Since we use other parser, we just roughly emulate it's output. (See: #684) + env.npm_config_argv = JSON.stringify({ + remain: [], + cooked: config.commandName === 'run' ? [config.commandName, stage] : [config.commandName], + original: process.argv.slice(2) + }); + + const manifest = yield config.maybeReadManifest(cwd); + if (manifest) { + if (manifest.scripts && Object.prototype.hasOwnProperty.call(manifest.scripts, stage)) { + env.npm_lifecycle_script = manifest.scripts[stage]; + } + + // add npm_package_* + const queue = [['', manifest]]; + while (queue.length) { + var _queue$pop = queue.pop(); + + const key = _queue$pop[0], + val = _queue$pop[1]; + + if (typeof val === 'object') { + for (const subKey in val) { + const fullKey = [key, subKey].filter(Boolean).join('_'); + if (fullKey && fullKey[0] !== '_' && !IGNORE_MANIFEST_KEYS.has(fullKey)) { + queue.push([fullKey, val[subKey]]); + } + } + } else { + let cleanVal = String(val); + if (cleanVal.indexOf('\n') >= 0) { + cleanVal = JSON.stringify(cleanVal); + } + + //replacing invalid chars with underscore + const cleanKey = key.replace(INVALID_CHAR_REGEX, '_'); + + env[`npm_package_${cleanKey}`] = cleanVal; + } + } + } + + // add npm_config_* and npm_package_config_* from yarn config + const keys = new Set([...Object.keys(config.registries.yarn.config), ...Object.keys(config.registries.npm.config)]); + const cleaned = Array.from(keys).filter(function (key) { + return !key.match(/:_/) && IGNORE_CONFIG_KEYS.indexOf(key) === -1; + }).map(function (key) { + let val = config.getOption(key); + if (!val) { + val = ''; + } else if (typeof val === 'number') { + val = '' + val; + } else if (typeof val !== 'string') { + val = JSON.stringify(val); + } + + if (val.indexOf('\n') >= 0) { + val = JSON.stringify(val); + } + return [key, val]; + }); + // add npm_config_* + for (var _iterator = cleaned, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref4; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref4 = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref4 = _i.value; + } + + const _ref3 = _ref4; + const key = _ref3[0]; + const val = _ref3[1]; + + const cleanKey = key.replace(/^_+/, ''); + const envKey = `npm_config_${cleanKey}`.replace(INVALID_CHAR_REGEX, '_'); + env[envKey] = val; + } + // add npm_package_config_* + if (manifest && manifest.name) { + const packageConfigPrefix = `${manifest.name}:`; + for (var _iterator2 = cleaned, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { + var _ref6; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref6 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref6 = _i2.value; + } + + const _ref5 = _ref6; + const key = _ref5[0]; + const val = _ref5[1]; + + if (key.indexOf(packageConfigPrefix) !== 0) { + continue; + } + const cleanKey = key.replace(/^_+/, '').replace(packageConfigPrefix, ''); + const envKey = `npm_package_config_${cleanKey}`.replace(INVALID_CHAR_REGEX, '_'); + env[envKey] = val; + } + } + + // split up the path + const envPath = env[(_constants || _load_constants()).ENV_PATH_KEY]; + const pathParts = envPath ? envPath.split(path.delimiter) : []; + + // Include node-gyp version that was bundled with the current Node.js version, + // if available. + pathParts.unshift(path.join(path.dirname(process.execPath), 'node_modules', 'npm', 'bin', 'node-gyp-bin')); + pathParts.unshift(path.join(path.dirname(process.execPath), '..', 'lib', 'node_modules', 'npm', 'bin', 'node-gyp-bin')); + // Include node-gyp version from homebrew managed npm, if available. + pathParts.unshift(path.join(path.dirname(process.execPath), '..', 'libexec', 'lib', 'node_modules', 'npm', 'bin', 'node-gyp-bin')); + + // Add global bin folder if it is not present already, as some packages depend + // on a globally-installed version of node-gyp. + const globalBin = yield (0, (_global || _load_global()).getBinFolder)(config, {}); + if (pathParts.indexOf(globalBin) === -1) { + pathParts.unshift(globalBin); + } + + // Add node_modules .bin folders to the PATH + for (var _iterator3 = config.registryFolders, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { + var _ref7; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref7 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref7 = _i3.value; + } + + const registryFolder = _ref7; + + const binFolder = path.join(registryFolder, '.bin'); + if (config.workspacesEnabled && config.workspaceRootFolder) { + pathParts.unshift(path.join(config.workspaceRootFolder, binFolder)); + } + pathParts.unshift(path.join(config.linkFolder, binFolder)); + pathParts.unshift(path.join(cwd, binFolder)); + } + + let pnpFile; + + if (process.versions.pnp) { + pnpFile = (_dynamicRequire || _load_dynamicRequire()).dynamicRequire.resolve('pnpapi'); + } else { + const candidate = `${config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`; + if (yield (_fs || _load_fs()).exists(candidate)) { + pnpFile = candidate; + } + } + + if (pnpFile) { + const pnpApi = (0, (_dynamicRequire || _load_dynamicRequire()).dynamicRequire)(pnpFile); + + const packageLocator = pnpApi.findPackageLocator(`${cwd}/`); + const packageInformation = pnpApi.getPackageInformation(packageLocator); + + for (var _iterator4 = packageInformation.packageDependencies.entries(), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { + var _ref9; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref9 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref9 = _i4.value; + } + + const _ref8 = _ref9; + const name = _ref8[0]; + const reference = _ref8[1]; + + const dependencyInformation = pnpApi.getPackageInformation({ name, reference }); + + if (!dependencyInformation || !dependencyInformation.packageLocation) { + continue; + } + + const binFolder = `${dependencyInformation.packageLocation}/.bin`; + if (yield (_fs || _load_fs()).exists(binFolder)) { + pathParts.unshift(binFolder); + } + } + + // Note that NODE_OPTIONS doesn't support any style of quoting its arguments at the moment + // For this reason, it won't work if the user has a space inside its $PATH + env.NODE_OPTIONS = env.NODE_OPTIONS || ''; + env.NODE_OPTIONS = `--require ${pnpFile} ${env.NODE_OPTIONS}`; + } + + pathParts.unshift((yield getWrappersFolder(config))); + + // join path back together + env[(_constants || _load_constants()).ENV_PATH_KEY] = pathParts.join(path.delimiter); + + return env; + }); + + return function makeEnv(_x2, _x3, _x4) { + return _ref2.apply(this, arguments); + }; +})(); + +let executeLifecycleScript = exports.executeLifecycleScript = (() => { + var _ref10 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* ({ + stage, + config, + cwd, + cmd, + isInteractive, + onProgress, + customShell + }) { + const env = yield makeEnv(stage, cwd, config); + + yield checkForGypIfNeeded(config, cmd, env[(_constants || _load_constants()).ENV_PATH_KEY].split(path.delimiter)); + + if (process.platform === 'win32' && (!customShell || customShell === 'cmd')) { + // handle windows run scripts starting with a relative path + cmd = (0, (_fixCmdWinSlashes || _load_fixCmdWinSlashes()).fixCmdWinSlashes)(cmd); + } + + // By default (non-interactive), pipe everything to the terminal and run child process detached + // as long as it's not Windows (since windows does not have /dev/tty) + let stdio = ['ignore', 'pipe', 'pipe']; + let detached = process.platform !== 'win32'; + + if (isInteractive) { + stdio = 'inherit'; + detached = false; + } + + const shell = customShell || true; + const stdout = yield (_child || _load_child()).spawn(cmd, [], { cwd, env, stdio, detached, shell }, onProgress); + + return { cwd, command: cmd, stdout }; + }); + + return function executeLifecycleScript(_x5) { + return _ref10.apply(this, arguments); + }; +})(); + +let _checkForGyp = (() => { + var _ref11 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, paths) { + const reporter = config.reporter; + + // Check every directory in the PATH + + const allChecks = yield Promise.all(paths.map(function (dir) { + return (_fs || _load_fs()).exists(path.join(dir, 'node-gyp')); + })); + if (allChecks.some(Boolean)) { + // node-gyp is available somewhere + return; + } + + reporter.info(reporter.lang('packageRequiresNodeGyp')); + + try { + yield (0, (_global || _load_global()).run)(config, reporter, {}, ['add', 'node-gyp']); + } catch (e) { + throw new (_errors || _load_errors()).MessageError(reporter.lang('nodeGypAutoInstallFailed', e.message)); + } + }); + + return function _checkForGyp(_x6, _x7) { + return _ref11.apply(this, arguments); + }; +})(); + +let execFromManifest = exports.execFromManifest = (() => { + var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, commandName, cwd) { + const pkg = yield config.maybeReadManifest(cwd); + if (!pkg || !pkg.scripts) { + return; + } + + const cmd = pkg.scripts[commandName]; + if (cmd) { + yield execCommand({ stage: commandName, config, cmd, cwd, isInteractive: true }); + } + }); + + return function execFromManifest(_x8, _x9, _x10) { + return _ref12.apply(this, arguments); + }; +})(); + +let execCommand = exports.execCommand = (() => { + var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* ({ + stage, + config, + cmd, + cwd, + isInteractive, + customShell + }) { + const reporter = config.reporter; + + try { + reporter.command(cmd); + yield executeLifecycleScript({ stage, config, cwd, cmd, isInteractive, customShell }); + return Promise.resolve(); + } catch (err) { + if (err instanceof (_errors || _load_errors()).ProcessTermError) { + const formattedError = new (_errors || _load_errors()).ProcessTermError(err.EXIT_SIGNAL ? reporter.lang('commandFailedWithSignal', err.EXIT_SIGNAL) : reporter.lang('commandFailedWithCode', err.EXIT_CODE)); + formattedError.EXIT_CODE = err.EXIT_CODE; + formattedError.EXIT_SIGNAL = err.EXIT_SIGNAL; + throw formattedError; + } else { + throw err; + } + } + }); + + return function execCommand(_x11) { + return _ref13.apply(this, arguments); + }; +})(); + +var _errors; + +function _load_errors() { + return _errors = __webpack_require__(5); +} + +var _constants; + +function _load_constants() { + return _constants = _interopRequireWildcard(__webpack_require__(8)); +} + +var _child; + +function _load_child() { + return _child = _interopRequireWildcard(__webpack_require__(58)); +} + +var _fs; + +function _load_fs() { + return _fs = _interopRequireWildcard(__webpack_require__(6)); +} + +var _dynamicRequire; + +function _load_dynamicRequire() { + return _dynamicRequire = __webpack_require__(371); +} + +var _portableScript; + +function _load_portableScript() { + return _portableScript = __webpack_require__(589); +} + +var _fixCmdWinSlashes; + +function _load_fixCmdWinSlashes() { + return _fixCmdWinSlashes = __webpack_require__(577); +} + +var _global; + +function _load_global() { + return _global = __webpack_require__(121); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const path = __webpack_require__(0); + +const IGNORE_MANIFEST_KEYS = exports.IGNORE_MANIFEST_KEYS = new Set(['readme', 'notice', 'licenseText']); + +// We treat these configs as internal, thus not expose them to process.env. +// This helps us avoid some gyp issues when building native modules. +// See https://github.com/yarnpkg/yarn/issues/2286. +const IGNORE_CONFIG_KEYS = ['lastUpdateCheck']; + +let wrappersFolder = null; + +const INVALID_CHAR_REGEX = /\W/g; + +exports.default = executeLifecycleScript; + + +let checkGypPromise = null; +/** + * Special case: Some packages depend on node-gyp, but don't specify this in + * their package.json dependencies. They assume that node-gyp is available + * globally. We need to detect this case and show an error message. + */ +function checkForGypIfNeeded(config, cmd, paths) { + if (cmd.substr(0, cmd.indexOf(' ')) !== 'node-gyp') { + return Promise.resolve(); + } + + // Ensure this only runs once, rather than multiple times in parallel. + if (!checkGypPromise) { + checkGypPromise = _checkForGyp(config, paths); + } + return checkGypPromise; +} + +/***/ }), +/* 112 */ /***/ (function(module, exports) { module.exports = function (exec) { @@ -35625,7 +36540,7 @@ module.exports = function (exec) { /***/ }), -/* 105 */ +/* 113 */ /***/ (function(module, exports) { // Copyright Joyent, Inc. and other Node contributors. @@ -35738,7 +36653,7 @@ function objectToString(o) { /***/ }), -/* 106 */ +/* 114 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -35751,8 +36666,8 @@ function objectToString(o) { -var expand = __webpack_require__(722); -var utils = __webpack_require__(268); +var expand = __webpack_require__(753); +var utils = __webpack_require__(300); /** * The main function. Pass an array of filepaths, @@ -36176,7 +37091,7 @@ module.exports = micromatch; /***/ }), -/* 107 */ +/* 115 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -36210,7 +37125,7 @@ module.exports = micromatch; /**/ -var pna = __webpack_require__(171); +var pna = __webpack_require__(180); /**/ /**/ @@ -36225,12 +37140,12 @@ var objectKeys = Object.keys || function (obj) { module.exports = Duplex; /**/ -var util = __webpack_require__(105); -util.inherits = __webpack_require__(56); +var util = __webpack_require__(113); +util.inherits = __webpack_require__(61); /**/ -var Readable = __webpack_require__(374); -var Writable = __webpack_require__(376); +var Readable = __webpack_require__(405); +var Writable = __webpack_require__(407); util.inherits(Duplex, Readable); @@ -36313,13 +37228,13 @@ Duplex.prototype._destroy = function (err, cb) { }; /***/ }), -/* 108 */ +/* 116 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = multicast; /* unused harmony export MulticastOperator */ -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__observable_ConnectableObservable__ = __webpack_require__(391); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__observable_ConnectableObservable__ = __webpack_require__(422); /** PURE_IMPORTS_START _observable_ConnectableObservable PURE_IMPORTS_END */ function multicast(subjectOrSubjectFactory, selector) { @@ -36361,7 +37276,7 @@ var MulticastOperator = /*@__PURE__*/ (function () { /***/ }), -/* 109 */ +/* 117 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -36372,7 +37287,7 @@ var observable = typeof Symbol === 'function' && Symbol.observable || '@@observa /***/ }), -/* 110 */ +/* 118 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -36385,11 +37300,11 @@ function identity(x) { /***/ }), -/* 111 */ +/* 119 */ /***/ (function(module, exports, __webpack_require__) { -var v1 = __webpack_require__(926); -var v4 = __webpack_require__(927); +var v1 = __webpack_require__(957); +var v4 = __webpack_require__(958); var uuid = v4; uuid.v1 = v1; @@ -36399,7 +37314,7 @@ module.exports = uuid; /***/ }), -/* 112 */ +/* 120 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -36468,7 +37383,7 @@ function _load_path() { function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } // This will be bundled directly in the .js file for production builds -var _require = __webpack_require__(185); /** +var _require = __webpack_require__(194); /** * Determines the current version of Yarn itself. * */ @@ -36478,7 +37393,7 @@ const version = _require.version, exports.version = version; /***/ }), -/* 113 */ +/* 121 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -36501,6 +37416,7 @@ let updateCwd = (() => { yield config.init({ cwd: config.globalFolder, + offline: config.offline, binLinks: true, globalFolder: config.globalFolder, cacheFolder: config._cacheRootFolder, @@ -36768,67 +37684,67 @@ function _load_errors() { var _index; function _load_index() { - return _index = __webpack_require__(52); + return _index = __webpack_require__(57); } var _baseReporter; function _load_baseReporter() { - return _baseReporter = _interopRequireDefault(__webpack_require__(101)); + return _baseReporter = _interopRequireDefault(__webpack_require__(108)); } var _buildSubCommands2; function _load_buildSubCommands() { - return _buildSubCommands2 = _interopRequireDefault(__webpack_require__(54)); + return _buildSubCommands2 = _interopRequireDefault(__webpack_require__(59)); } var _lockfile; function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(18)); + return _lockfile = _interopRequireDefault(__webpack_require__(19)); } var _install; function _load_install() { - return _install = __webpack_require__(33); + return _install = __webpack_require__(34); } var _add; function _load_add() { - return _add = __webpack_require__(156); + return _add = __webpack_require__(165); } var _remove; function _load_remove() { - return _remove = __webpack_require__(326); + return _remove = __webpack_require__(359); } var _upgrade; function _load_upgrade() { - return _upgrade = __webpack_require__(198); + return _upgrade = __webpack_require__(207); } var _upgradeInteractive; function _load_upgradeInteractive() { - return _upgradeInteractive = __webpack_require__(329); + return _upgradeInteractive = __webpack_require__(362); } var _packageLinker; function _load_packageLinker() { - return _packageLinker = __webpack_require__(201); + return _packageLinker = __webpack_require__(211); } var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _fs; @@ -36993,7 +37909,7 @@ function setFlags(commander) { } /***/ }), -/* 114 */ +/* 122 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -37018,37 +37934,37 @@ function _load_path() { var _invariant; function _load_invariant() { - return _invariant = _interopRequireDefault(__webpack_require__(8)); + return _invariant = _interopRequireDefault(__webpack_require__(9)); } var _semver; function _load_semver() { - return _semver = _interopRequireDefault(__webpack_require__(20)); + return _semver = _interopRequireDefault(__webpack_require__(21)); } var _validate; function _load_validate() { - return _validate = __webpack_require__(118); + return _validate = __webpack_require__(125); } var _lockfile; function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(18)); + return _lockfile = _interopRequireDefault(__webpack_require__(19)); } var _packageReference; function _load_packageReference() { - return _packageReference = _interopRequireDefault(__webpack_require__(333)); + return _packageReference = _interopRequireDefault(__webpack_require__(365)); } var _index; function _load_index() { - return _index = __webpack_require__(71); + return _index = __webpack_require__(78); } var _errors; @@ -37060,19 +37976,19 @@ function _load_errors() { var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _version; function _load_version() { - return _version = _interopRequireWildcard(__webpack_require__(216)); + return _version = _interopRequireWildcard(__webpack_require__(226)); } var _workspaceResolver; function _load_workspaceResolver() { - return _workspaceResolver = _interopRequireDefault(__webpack_require__(538)); + return _workspaceResolver = _interopRequireDefault(__webpack_require__(569)); } var _fs; @@ -37084,14 +38000,14 @@ function _load_fs() { var _normalizePattern4; function _load_normalizePattern() { - return _normalizePattern4 = __webpack_require__(36); + return _normalizePattern4 = __webpack_require__(37); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const micromatch = __webpack_require__(106); +const micromatch = __webpack_require__(114); class PackageRequest { constructor(req, resolver) { @@ -37574,7 +38490,7 @@ class PackageRequest { exports.default = PackageRequest; /***/ }), -/* 115 */ +/* 123 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -37607,7 +38523,7 @@ class BaseResolver { exports.default = BaseResolver; /***/ }), -/* 116 */ +/* 124 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -37626,50 +38542,50 @@ function _load_asyncToGenerator() { var _index; function _load_index() { - return _index = __webpack_require__(71); + return _index = __webpack_require__(78); } var _misc; function _load_misc() { - return _misc = _interopRequireWildcard(__webpack_require__(17)); + return _misc = _interopRequireWildcard(__webpack_require__(18)); } var _version; function _load_version() { - return _version = _interopRequireWildcard(__webpack_require__(216)); + return _version = _interopRequireWildcard(__webpack_require__(226)); } var _guessName; function _load_guessName() { - return _guessName = _interopRequireDefault(__webpack_require__(160)); + return _guessName = _interopRequireDefault(__webpack_require__(169)); } var _index2; function _load_index2() { - return _index2 = __webpack_require__(52); + return _index2 = __webpack_require__(57); } var _exoticResolver; function _load_exoticResolver() { - return _exoticResolver = _interopRequireDefault(__webpack_require__(83)); + return _exoticResolver = _interopRequireDefault(__webpack_require__(89)); } var _git; function _load_git() { - return _git = _interopRequireDefault(__webpack_require__(209)); + return _git = _interopRequireDefault(__webpack_require__(219)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const urlParse = __webpack_require__(23).parse; +const urlParse = __webpack_require__(24).parse; const GIT_HOSTS = ['github.com', 'gitlab.com', 'bitbucket.com', 'bitbucket.org']; @@ -37827,499 +38743,7 @@ class GitResolver extends (_exoticResolver || _load_exoticResolver()).default { exports.default = GitResolver; /***/ }), -/* 117 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.execCommand = exports.execFromManifest = exports.executeLifecycleScript = exports.makeEnv = exports.getWrappersFolder = exports.IGNORE_MANIFEST_KEYS = undefined; - -var _extends2; - -function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); -} - -var _asyncToGenerator2; - -function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); -} - -let getWrappersFolder = exports.getWrappersFolder = (() => { - var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config) { - if (wrappersFolder) { - return wrappersFolder; - } - - wrappersFolder = yield (_fs || _load_fs()).makeTempDir(); - - yield (0, (_portableScript || _load_portableScript()).makePortableProxyScript)(process.execPath, wrappersFolder, { - proxyBasename: 'node' - }); - - yield (0, (_portableScript || _load_portableScript()).makePortableProxyScript)(process.execPath, wrappersFolder, { - proxyBasename: 'yarn', - prependArguments: [process.argv[1]] - }); - - return wrappersFolder; - }); - - return function getWrappersFolder(_x) { - return _ref.apply(this, arguments); - }; -})(); - -let makeEnv = exports.makeEnv = (() => { - var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (stage, cwd, config) { - const env = (0, (_extends2 || _load_extends()).default)({ - NODE: process.execPath, - INIT_CWD: process.cwd() - }, process.env); - - // Merge in the `env` object specified in .yarnrc - const customEnv = config.getOption('env'); - if (customEnv && typeof customEnv === 'object') { - Object.assign(env, customEnv); - } - - env.npm_lifecycle_event = stage; - env.npm_node_execpath = env.NODE; - env.npm_execpath = env.npm_execpath || process.mainModule && process.mainModule.filename; - - // Set the env to production for npm compat if production mode. - // https://github.com/npm/npm/blob/30d75e738b9cb7a6a3f9b50e971adcbe63458ed3/lib/utils/lifecycle.js#L336 - if (config.production) { - env.NODE_ENV = 'production'; - } - - // Note: npm_config_argv environment variable contains output of nopt - command-line - // parser used by npm. Since we use other parser, we just roughly emulate it's output. (See: #684) - env.npm_config_argv = JSON.stringify({ - remain: [], - cooked: config.commandName === 'run' ? [config.commandName, stage] : [config.commandName], - original: process.argv.slice(2) - }); - - const manifest = yield config.maybeReadManifest(cwd); - if (manifest) { - if (manifest.scripts && Object.prototype.hasOwnProperty.call(manifest.scripts, stage)) { - env.npm_lifecycle_script = manifest.scripts[stage]; - } - - // add npm_package_* - const queue = [['', manifest]]; - while (queue.length) { - var _queue$pop = queue.pop(); - - const key = _queue$pop[0], - val = _queue$pop[1]; - - if (typeof val === 'object') { - for (const subKey in val) { - const fullKey = [key, subKey].filter(Boolean).join('_'); - if (fullKey && fullKey[0] !== '_' && !IGNORE_MANIFEST_KEYS.has(fullKey)) { - queue.push([fullKey, val[subKey]]); - } - } - } else { - let cleanVal = String(val); - if (cleanVal.indexOf('\n') >= 0) { - cleanVal = JSON.stringify(cleanVal); - } - - //replacing invalid chars with underscore - const cleanKey = key.replace(INVALID_CHAR_REGEX, '_'); - - env[`npm_package_${cleanKey}`] = cleanVal; - } - } - } - - // add npm_config_* and npm_package_config_* from yarn config - const keys = new Set([...Object.keys(config.registries.yarn.config), ...Object.keys(config.registries.npm.config)]); - const cleaned = Array.from(keys).filter(function (key) { - return !key.match(/:_/) && IGNORE_CONFIG_KEYS.indexOf(key) === -1; - }).map(function (key) { - let val = config.getOption(key); - if (!val) { - val = ''; - } else if (typeof val === 'number') { - val = '' + val; - } else if (typeof val !== 'string') { - val = JSON.stringify(val); - } - - if (val.indexOf('\n') >= 0) { - val = JSON.stringify(val); - } - return [key, val]; - }); - // add npm_config_* - for (var _iterator = cleaned, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { - var _ref4; - - if (_isArray) { - if (_i >= _iterator.length) break; - _ref4 = _iterator[_i++]; - } else { - _i = _iterator.next(); - if (_i.done) break; - _ref4 = _i.value; - } - - const _ref3 = _ref4; - const key = _ref3[0]; - const val = _ref3[1]; - - const cleanKey = key.replace(/^_+/, ''); - const envKey = `npm_config_${cleanKey}`.replace(INVALID_CHAR_REGEX, '_'); - env[envKey] = val; - } - // add npm_package_config_* - if (manifest && manifest.name) { - const packageConfigPrefix = `${manifest.name}:`; - for (var _iterator2 = cleaned, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { - var _ref6; - - if (_isArray2) { - if (_i2 >= _iterator2.length) break; - _ref6 = _iterator2[_i2++]; - } else { - _i2 = _iterator2.next(); - if (_i2.done) break; - _ref6 = _i2.value; - } - - const _ref5 = _ref6; - const key = _ref5[0]; - const val = _ref5[1]; - - if (key.indexOf(packageConfigPrefix) !== 0) { - continue; - } - const cleanKey = key.replace(/^_+/, '').replace(packageConfigPrefix, ''); - const envKey = `npm_package_config_${cleanKey}`.replace(INVALID_CHAR_REGEX, '_'); - env[envKey] = val; - } - } - - // split up the path - const envPath = env[(_constants || _load_constants()).ENV_PATH_KEY]; - const pathParts = envPath ? envPath.split(path.delimiter) : []; - - // Include node-gyp version that was bundled with the current Node.js version, - // if available. - pathParts.unshift(path.join(path.dirname(process.execPath), 'node_modules', 'npm', 'bin', 'node-gyp-bin')); - pathParts.unshift(path.join(path.dirname(process.execPath), '..', 'lib', 'node_modules', 'npm', 'bin', 'node-gyp-bin')); - // Include node-gyp version from homebrew managed npm, if available. - pathParts.unshift(path.join(path.dirname(process.execPath), '..', 'libexec', 'lib', 'node_modules', 'npm', 'bin', 'node-gyp-bin')); - - // Add global bin folder if it is not present already, as some packages depend - // on a globally-installed version of node-gyp. - const globalBin = yield (0, (_global || _load_global()).getBinFolder)(config, {}); - if (pathParts.indexOf(globalBin) === -1) { - pathParts.unshift(globalBin); - } - - // Add node_modules .bin folders to the PATH - for (var _iterator3 = config.registryFolders, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { - var _ref7; - - if (_isArray3) { - if (_i3 >= _iterator3.length) break; - _ref7 = _iterator3[_i3++]; - } else { - _i3 = _iterator3.next(); - if (_i3.done) break; - _ref7 = _i3.value; - } - - const registryFolder = _ref7; - - const binFolder = path.join(registryFolder, '.bin'); - if (config.workspacesEnabled && config.workspaceRootFolder) { - pathParts.unshift(path.join(config.workspaceRootFolder, binFolder)); - } - pathParts.unshift(path.join(config.linkFolder, binFolder)); - pathParts.unshift(path.join(cwd, binFolder)); - } - - let pnpFile; - - if (process.versions.pnp) { - pnpFile = (_dynamicRequire || _load_dynamicRequire()).dynamicRequire.resolve('pnpapi'); - } else { - const candidate = `${config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`; - if (yield (_fs || _load_fs()).exists(candidate)) { - pnpFile = candidate; - } - } - - if (pnpFile) { - const pnpApi = (0, (_dynamicRequire || _load_dynamicRequire()).dynamicRequire)(pnpFile); - - const packageLocator = pnpApi.findPackageLocator(`${cwd}/`); - const packageInformation = pnpApi.getPackageInformation(packageLocator); - - for (var _iterator4 = packageInformation.packageDependencies.entries(), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { - var _ref9; - - if (_isArray4) { - if (_i4 >= _iterator4.length) break; - _ref9 = _iterator4[_i4++]; - } else { - _i4 = _iterator4.next(); - if (_i4.done) break; - _ref9 = _i4.value; - } - - const _ref8 = _ref9; - const name = _ref8[0]; - const reference = _ref8[1]; - - const dependencyInformation = pnpApi.getPackageInformation({ name, reference }); - - if (!dependencyInformation || !dependencyInformation.packageLocation) { - continue; - } - - const binFolder = `${dependencyInformation.packageLocation}/.bin`; - if (yield (_fs || _load_fs()).exists(binFolder)) { - pathParts.unshift(binFolder); - } - } - - // Note that NODE_OPTIONS doesn't support any style of quoting its arguments at the moment - // For this reason, it won't work if the user has a space inside its $PATH - env.NODE_OPTIONS = env.NODE_OPTIONS || ''; - env.NODE_OPTIONS = `--require ${pnpFile} ${env.NODE_OPTIONS}`; - } - - pathParts.unshift((yield getWrappersFolder(config))); - - // join path back together - env[(_constants || _load_constants()).ENV_PATH_KEY] = pathParts.join(path.delimiter); - - return env; - }); - - return function makeEnv(_x2, _x3, _x4) { - return _ref2.apply(this, arguments); - }; -})(); - -let executeLifecycleScript = exports.executeLifecycleScript = (() => { - var _ref10 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* ({ - stage, - config, - cwd, - cmd, - isInteractive, - onProgress, - customShell - }) { - const env = yield makeEnv(stage, cwd, config); - - yield checkForGypIfNeeded(config, cmd, env[(_constants || _load_constants()).ENV_PATH_KEY].split(path.delimiter)); - - if (process.platform === 'win32' && (!customShell || customShell === 'cmd')) { - // handle windows run scripts starting with a relative path - cmd = (0, (_fixCmdWinSlashes || _load_fixCmdWinSlashes()).fixCmdWinSlashes)(cmd); - } - - // By default (non-interactive), pipe everything to the terminal and run child process detached - // as long as it's not Windows (since windows does not have /dev/tty) - let stdio = ['ignore', 'pipe', 'pipe']; - let detached = process.platform !== 'win32'; - - if (isInteractive) { - stdio = 'inherit'; - detached = false; - } - - const shell = customShell || true; - const stdout = yield (_child || _load_child()).spawn(cmd, [], { cwd, env, stdio, detached, shell }, onProgress); - - return { cwd, command: cmd, stdout }; - }); - - return function executeLifecycleScript(_x5) { - return _ref10.apply(this, arguments); - }; -})(); - -let _checkForGyp = (() => { - var _ref11 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, paths) { - const reporter = config.reporter; - - // Check every directory in the PATH - - const allChecks = yield Promise.all(paths.map(function (dir) { - return (_fs || _load_fs()).exists(path.join(dir, 'node-gyp')); - })); - if (allChecks.some(Boolean)) { - // node-gyp is available somewhere - return; - } - - reporter.info(reporter.lang('packageRequiresNodeGyp')); - - try { - yield (0, (_global || _load_global()).run)(config, reporter, {}, ['add', 'node-gyp']); - } catch (e) { - throw new (_errors || _load_errors()).MessageError(reporter.lang('nodeGypAutoInstallFailed', e.message)); - } - }); - - return function _checkForGyp(_x6, _x7) { - return _ref11.apply(this, arguments); - }; -})(); - -let execFromManifest = exports.execFromManifest = (() => { - var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, commandName, cwd) { - const pkg = yield config.maybeReadManifest(cwd); - if (!pkg || !pkg.scripts) { - return; - } - - const cmd = pkg.scripts[commandName]; - if (cmd) { - yield execCommand({ stage: commandName, config, cmd, cwd, isInteractive: true }); - } - }); - - return function execFromManifest(_x8, _x9, _x10) { - return _ref12.apply(this, arguments); - }; -})(); - -let execCommand = exports.execCommand = (() => { - var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* ({ - stage, - config, - cmd, - cwd, - isInteractive, - customShell - }) { - const reporter = config.reporter; - - try { - reporter.command(cmd); - yield executeLifecycleScript({ stage, config, cwd, cmd, isInteractive, customShell }); - return Promise.resolve(); - } catch (err) { - if (err instanceof (_errors || _load_errors()).ProcessTermError) { - const formattedError = new (_errors || _load_errors()).ProcessTermError(err.EXIT_SIGNAL ? reporter.lang('commandFailedWithSignal', err.EXIT_SIGNAL) : reporter.lang('commandFailedWithCode', err.EXIT_CODE)); - formattedError.EXIT_CODE = err.EXIT_CODE; - formattedError.EXIT_SIGNAL = err.EXIT_SIGNAL; - throw formattedError; - } else { - throw err; - } - } - }); - - return function execCommand(_x11) { - return _ref13.apply(this, arguments); - }; -})(); - -var _errors; - -function _load_errors() { - return _errors = __webpack_require__(5); -} - -var _constants; - -function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); -} - -var _child; - -function _load_child() { - return _child = _interopRequireWildcard(__webpack_require__(53)); -} - -var _fs; - -function _load_fs() { - return _fs = _interopRequireWildcard(__webpack_require__(6)); -} - -var _dynamicRequire; - -function _load_dynamicRequire() { - return _dynamicRequire = __webpack_require__(339); -} - -var _portableScript; - -function _load_portableScript() { - return _portableScript = __webpack_require__(558); -} - -var _fixCmdWinSlashes; - -function _load_fixCmdWinSlashes() { - return _fixCmdWinSlashes = __webpack_require__(546); -} - -var _global; - -function _load_global() { - return _global = __webpack_require__(113); -} - -function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const path = __webpack_require__(0); - -const IGNORE_MANIFEST_KEYS = exports.IGNORE_MANIFEST_KEYS = new Set(['readme', 'notice', 'licenseText']); - -// We treat these configs as internal, thus not expose them to process.env. -// This helps us avoid some gyp issues when building native modules. -// See https://github.com/yarnpkg/yarn/issues/2286. -const IGNORE_CONFIG_KEYS = ['lastUpdateCheck']; - -let wrappersFolder = null; - -const INVALID_CHAR_REGEX = /\W/g; - -exports.default = executeLifecycleScript; - - -let checkGypPromise = null; -/** - * Special case: Some packages depend on node-gyp, but don't specify this in - * their package.json dependencies. They assume that node-gyp is available - * globally. We need to detect this case and show an error message. - */ -function checkForGypIfNeeded(config, cmd, paths) { - if (cmd.substr(0, cmd.indexOf(' ')) !== 'node-gyp') { - return Promise.resolve(); - } - - // Ensure this only runs once, rather than multiple times in parallel. - if (!checkGypPromise) { - checkGypPromise = _checkForGyp(config, paths); - } - return checkGypPromise; -} - -/***/ }), -/* 118 */ +/* 125 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -38411,18 +38835,18 @@ function _load_errors() { var _util; function _load_util() { - return _util = __webpack_require__(211); + return _util = __webpack_require__(221); } var _typos; function _load_typos() { - return _typos = _interopRequireDefault(__webpack_require__(556)); + return _typos = _interopRequireDefault(__webpack_require__(587)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const isBuiltinModule = __webpack_require__(699); +const isBuiltinModule = __webpack_require__(730); const strings = ['name', 'version']; @@ -38570,12 +38994,12 @@ function cleanDependencies(info, isRoot, reporter, warn) { } /***/ }), -/* 119 */ +/* 126 */ /***/ (function(module, exports, __webpack_require__) { // getting tag from 19.1.3.6 Object.prototype.toString() -var cof = __webpack_require__(62); -var TAG = __webpack_require__(19)('toStringTag'); +var cof = __webpack_require__(68); +var TAG = __webpack_require__(20)('toStringTag'); // ES3 wrong here var ARG = cof(function () { return arguments; }()) == 'Arguments'; @@ -38599,7 +39023,7 @@ module.exports = function (it) { /***/ }), -/* 120 */ +/* 127 */ /***/ (function(module, exports) { // IE 8- don't enum bug keys @@ -38609,28 +39033,28 @@ module.exports = ( /***/ }), -/* 121 */ +/* 128 */ /***/ (function(module, exports, __webpack_require__) { -var document = __webpack_require__(16).document; +var document = __webpack_require__(17).document; module.exports = document && document.documentElement; /***/ }), -/* 122 */ +/* 129 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var LIBRARY = __webpack_require__(87); -var $export = __webpack_require__(55); -var redefine = __webpack_require__(241); -var hide = __webpack_require__(41); -var Iterators = __webpack_require__(50); -var $iterCreate = __webpack_require__(232); -var setToStringTag = __webpack_require__(89); -var getPrototypeOf = __webpack_require__(238); -var ITERATOR = __webpack_require__(19)('iterator'); +var LIBRARY = __webpack_require__(93); +var $export = __webpack_require__(60); +var redefine = __webpack_require__(251); +var hide = __webpack_require__(42); +var Iterators = __webpack_require__(53); +var $iterCreate = __webpack_require__(242); +var setToStringTag = __webpack_require__(95); +var getPrototypeOf = __webpack_require__(248); +var ITERATOR = __webpack_require__(20)('iterator'); var BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next` var FF_ITERATOR = '@@iterator'; var KEYS = 'keys'; @@ -38693,7 +39117,7 @@ module.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCE /***/ }), -/* 123 */ +/* 130 */ /***/ (function(module, exports) { module.exports = function (exec) { @@ -38706,12 +39130,12 @@ module.exports = function (exec) { /***/ }), -/* 124 */ +/* 131 */ /***/ (function(module, exports, __webpack_require__) { -var anObject = __webpack_require__(34); -var isObject = __webpack_require__(49); -var newPromiseCapability = __webpack_require__(88); +var anObject = __webpack_require__(35); +var isObject = __webpack_require__(52); +var newPromiseCapability = __webpack_require__(94); module.exports = function (C, x) { anObject(C); @@ -38724,7 +39148,7 @@ module.exports = function (C, x) { /***/ }), -/* 125 */ +/* 132 */ /***/ (function(module, exports) { module.exports = function (bitmap, value) { @@ -38738,11 +39162,11 @@ module.exports = function (bitmap, value) { /***/ }), -/* 126 */ +/* 133 */ /***/ (function(module, exports, __webpack_require__) { -var core = __webpack_require__(30); -var global = __webpack_require__(16); +var core = __webpack_require__(31); +var global = __webpack_require__(17); var SHARED = '__core-js_shared__'; var store = global[SHARED] || (global[SHARED] = {}); @@ -38750,19 +39174,19 @@ var store = global[SHARED] || (global[SHARED] = {}); return store[key] || (store[key] = value !== undefined ? value : {}); })('versions', []).push({ version: core.version, - mode: __webpack_require__(87) ? 'pure' : 'global', + mode: __webpack_require__(93) ? 'pure' : 'global', copyright: '© 2018 Denis Pushkarev (zloirock.ru)' }); /***/ }), -/* 127 */ +/* 134 */ /***/ (function(module, exports, __webpack_require__) { // 7.3.20 SpeciesConstructor(O, defaultConstructor) -var anObject = __webpack_require__(34); -var aFunction = __webpack_require__(61); -var SPECIES = __webpack_require__(19)('species'); +var anObject = __webpack_require__(35); +var aFunction = __webpack_require__(67); +var SPECIES = __webpack_require__(20)('species'); module.exports = function (O, D) { var C = anObject(O).constructor; var S; @@ -38771,14 +39195,14 @@ module.exports = function (O, D) { /***/ }), -/* 128 */ +/* 135 */ /***/ (function(module, exports, __webpack_require__) { -var ctx = __webpack_require__(63); -var invoke = __webpack_require__(229); -var html = __webpack_require__(121); -var cel = __webpack_require__(86); -var global = __webpack_require__(16); +var ctx = __webpack_require__(69); +var invoke = __webpack_require__(239); +var html = __webpack_require__(128); +var cel = __webpack_require__(92); +var global = __webpack_require__(17); var process = global.process; var setTask = global.setImmediate; var clearTask = global.clearImmediate; @@ -38817,7 +39241,7 @@ if (!setTask || !clearTask) { delete queue[id]; }; // Node.js 0.8- - if (__webpack_require__(62)(process) == 'process') { + if (__webpack_require__(68)(process) == 'process') { defer = function (id) { process.nextTick(ctx(run, id, 1)); }; @@ -38861,11 +39285,11 @@ module.exports = { /***/ }), -/* 129 */ +/* 136 */ /***/ (function(module, exports, __webpack_require__) { // 7.1.15 ToLength -var toInteger = __webpack_require__(91); +var toInteger = __webpack_require__(97); var min = Math.min; module.exports = function (it) { return it > 0 ? min(toInteger(it), 0x1fffffffffffff) : 0; // pow(2, 53) - 1 == 9007199254740991 @@ -38873,7 +39297,7 @@ module.exports = function (it) { /***/ }), -/* 130 */ +/* 137 */ /***/ (function(module, exports) { var id = 0; @@ -38884,7 +39308,7 @@ module.exports = function (key) { /***/ }), -/* 131 */ +/* 138 */ /***/ (function(module, exports, __webpack_require__) { @@ -38900,7 +39324,7 @@ exports.coerce = coerce; exports.disable = disable; exports.enable = enable; exports.enabled = enabled; -exports.humanize = __webpack_require__(269); +exports.humanize = __webpack_require__(301); /** * Active `debug` instances. @@ -39115,7 +39539,7 @@ function coerce(val) { /***/ }), -/* 132 */ +/* 139 */ /***/ (function(module, exports, __webpack_require__) { // Basic Javascript Elliptic Curve implementation @@ -39123,7 +39547,7 @@ function coerce(val) { // Only Fp curves implemented for now // Requires jsbn.js and jsbn2.js -var BigInteger = __webpack_require__(74).BigInteger +var BigInteger = __webpack_require__(81).BigInteger var Barrett = BigInteger.prototype.Barrett // ---------------- @@ -39682,7 +40106,7 @@ module.exports = exports /***/ }), -/* 133 */ +/* 140 */ /***/ (function(module, exports, __webpack_require__) { module.exports = realpath @@ -39698,7 +40122,7 @@ var origRealpathSync = fs.realpathSync var version = process.version var ok = /^v[0-5]\./.test(version) -var old = __webpack_require__(260) +var old = __webpack_require__(271) function newError (er) { return er && er.syscall === 'realpath' && ( @@ -39754,7 +40178,7 @@ function unmonkeypatch () { /***/ }), -/* 134 */ +/* 141 */ /***/ (function(module, exports, __webpack_require__) { exports.alphasort = alphasort @@ -39772,8 +40196,8 @@ function ownProp (obj, field) { } var path = __webpack_require__(0) -var minimatch = __webpack_require__(75) -var isAbsolute = __webpack_require__(94) +var minimatch = __webpack_require__(82) +var isAbsolute = __webpack_require__(101) var Minimatch = minimatch.Minimatch function alphasorti (a, b) { @@ -40000,7 +40424,7 @@ function childrenIgnored (self, path) { /***/ }), -/* 135 */ +/* 142 */ /***/ (function(module, exports) { @@ -40012,7 +40436,64 @@ module.exports = function(det, rec, confidence, name, lang) { /***/ }), -/* 136 */ +/* 143 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// Standard YAML's Core schema. +// http://www.yaml.org/spec/1.2/spec.html#id2804923 +// +// NOTE: JS-YAML does not support schema-specific tag resolution restrictions. +// So, Core schema has no distinctions from JSON schema is JS-YAML. + + + + + +var Schema = __webpack_require__(44); + + +module.exports = new Schema({ + include: [ + __webpack_require__(144) + ] +}); + + +/***/ }), +/* 144 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// Standard YAML's JSON schema. +// http://www.yaml.org/spec/1.2/spec.html#id2803231 +// +// NOTE: JS-YAML does not support schema-specific tag resolution restrictions. +// So, this schema is not such strict as defined in the YAML specification. +// It allows numbers in binary notaion, use `Null` and `NULL` as `null`, etc. + + + + + +var Schema = __webpack_require__(44); + + +module.exports = new Schema({ + include: [ + __webpack_require__(100) + ], + implicit: [ + __webpack_require__(293), + __webpack_require__(285), + __webpack_require__(287), + __webpack_require__(286) + ] +}); + + +/***/ }), +/* 145 */ /***/ (function(module, exports, __webpack_require__) { var path = __webpack_require__(0); @@ -40116,7 +40597,7 @@ mkdirP.sync = function sync (p, opts, made) { /***/ }), -/* 137 */ +/* 146 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40165,7 +40646,7 @@ var DefaultIfEmptySubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 138 */ +/* 147 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40218,7 +40699,7 @@ var FilterSubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 139 */ +/* 148 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40226,11 +40707,11 @@ var FilterSubscriber = /*@__PURE__*/ (function (_super) { /* unused harmony export MergeMapOperator */ /* unused harmony export MergeMapSubscriber */ /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_subscribeToResult__ = __webpack_require__(13); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__OuterSubscriber__ = __webpack_require__(12); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__InnerSubscriber__ = __webpack_require__(77); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__map__ = __webpack_require__(43); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__observable_from__ = __webpack_require__(57); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_subscribeToResult__ = __webpack_require__(14); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__OuterSubscriber__ = __webpack_require__(13); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__InnerSubscriber__ = __webpack_require__(84); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__map__ = __webpack_require__(46); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__observable_from__ = __webpack_require__(62); /** PURE_IMPORTS_START tslib,_util_subscribeToResult,_OuterSubscriber,_InnerSubscriber,_map,_observable_from PURE_IMPORTS_END */ @@ -40334,13 +40815,13 @@ var MergeMapSubscriber = /*@__PURE__*/ (function (_super) { /***/ }), -/* 140 */ +/* 149 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return AsyncAction; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Action__ = __webpack_require__(887); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Action__ = __webpack_require__(918); /** PURE_IMPORTS_START tslib,_Action PURE_IMPORTS_END */ @@ -40438,13 +40919,13 @@ var AsyncAction = /*@__PURE__*/ (function (_super) { /***/ }), -/* 141 */ +/* 150 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return AsyncScheduler; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Scheduler__ = __webpack_require__(389); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Scheduler__ = __webpack_require__(420); /** PURE_IMPORTS_START tslib,_Scheduler PURE_IMPORTS_END */ @@ -40506,7 +40987,7 @@ var AsyncScheduler = /*@__PURE__*/ (function (_super) { /***/ }), -/* 142 */ +/* 151 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40526,7 +41007,7 @@ var $$iterator = iterator; /***/ }), -/* 143 */ +/* 152 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40544,7 +41025,7 @@ var ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl; /***/ }), -/* 144 */ +/* 153 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40562,7 +41043,7 @@ var EmptyError = EmptyErrorImpl; /***/ }), -/* 145 */ +/* 154 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -40575,30 +41056,30 @@ function isFunction(x) { /***/ }), -/* 146 */ +/* 155 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2016 Joyent, Inc. module.exports = Certificate; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(147); -var Signature = __webpack_require__(67); -var errs = __webpack_require__(66); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(74); +var errs = __webpack_require__(73); var util = __webpack_require__(3); -var utils = __webpack_require__(25); -var Key = __webpack_require__(26); -var PrivateKey = __webpack_require__(32); -var Identity = __webpack_require__(149); +var utils = __webpack_require__(26); +var Key = __webpack_require__(27); +var PrivateKey = __webpack_require__(33); +var Identity = __webpack_require__(158); var formats = {}; -formats['openssh'] = __webpack_require__(909); -formats['x509'] = __webpack_require__(425); -formats['pem'] = __webpack_require__(910); +formats['openssh'] = __webpack_require__(940); +formats['x509'] = __webpack_require__(456); +formats['pem'] = __webpack_require__(941); var CertificateParseError = errs.CertificateParseError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; @@ -40959,21 +41440,21 @@ Certificate._oldVersionDetect = function (obj) { /***/ }), -/* 147 */ +/* 156 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = Fingerprint; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var errs = __webpack_require__(66); -var Key = __webpack_require__(26); -var Certificate = __webpack_require__(146); -var utils = __webpack_require__(25); +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var errs = __webpack_require__(73); +var Key = __webpack_require__(27); +var Certificate = __webpack_require__(155); +var utils = __webpack_require__(26); var FingerprintFormatError = errs.FingerprintFormatError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; @@ -41127,7 +41608,7 @@ Fingerprint._oldVersionDetect = function (obj) { /***/ }), -/* 148 */ +/* 157 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. @@ -41142,14 +41623,14 @@ module.exports = { writeECDSACurve: writeECDSACurve }; -var assert = __webpack_require__(15); -var asn1 = __webpack_require__(59); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var utils = __webpack_require__(25); -var Key = __webpack_require__(26); -var PrivateKey = __webpack_require__(32); -var pem = __webpack_require__(79); +var assert = __webpack_require__(16); +var asn1 = __webpack_require__(65); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var utils = __webpack_require__(26); +var Key = __webpack_require__(27); +var PrivateKey = __webpack_require__(33); +var pem = __webpack_require__(86); function read(buf, options) { return (pem.read(buf, options, 'pkcs8')); @@ -41745,23 +42226,23 @@ function writePkcs8EdDSAPrivate(key, der) { /***/ }), -/* 149 */ +/* 158 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Identity; -var assert = __webpack_require__(15); -var algs = __webpack_require__(31); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(147); -var Signature = __webpack_require__(67); -var errs = __webpack_require__(66); +var assert = __webpack_require__(16); +var algs = __webpack_require__(32); +var crypto = __webpack_require__(12); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(74); +var errs = __webpack_require__(73); var util = __webpack_require__(3); -var utils = __webpack_require__(25); -var asn1 = __webpack_require__(59); -var Buffer = __webpack_require__(14).Buffer; +var utils = __webpack_require__(26); +var asn1 = __webpack_require__(65); +var Buffer = __webpack_require__(15).Buffer; /*JSSTYLED*/ var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; @@ -42040,15 +42521,15 @@ Identity._oldVersionDetect = function (obj) { /***/ }), -/* 150 */ +/* 159 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = SSHBuffer; -var assert = __webpack_require__(15); -var Buffer = __webpack_require__(14).Buffer; +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; function SSHBuffer(opts) { assert.object(opts, 'options'); @@ -42195,7 +42676,7 @@ SSHBuffer.prototype.write = function (buf) { /***/ }), -/* 151 */ +/* 160 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -42216,7 +42697,7 @@ module.exports = x => { /***/ }), -/* 152 */ +/* 161 */ /***/ (function(module, exports) { // Returns a wrapper function that returns a wrapped callback @@ -42255,7 +42736,7 @@ function wrappy (fn, cb) { /***/ }), -/* 153 */ +/* 162 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -42268,7 +42749,7 @@ Object.defineProperty(exports, "__esModule", { var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _asyncToGenerator2; @@ -42282,25 +42763,25 @@ exports.extractWorkspaces = extractWorkspaces; var _executeLifecycleScript; function _load_executeLifecycleScript() { - return _executeLifecycleScript = __webpack_require__(117); + return _executeLifecycleScript = __webpack_require__(111); } var _path; function _load_path() { - return _path = __webpack_require__(344); + return _path = __webpack_require__(376); } var _conversion; function _load_conversion() { - return _conversion = __webpack_require__(303); + return _conversion = __webpack_require__(336); } var _index; function _load_index() { - return _index = _interopRequireDefault(__webpack_require__(210)); + return _index = _interopRequireDefault(__webpack_require__(220)); } var _errors; @@ -42318,48 +42799,48 @@ function _load_fs() { var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _packageConstraintResolver; function _load_packageConstraintResolver() { - return _packageConstraintResolver = _interopRequireDefault(__webpack_require__(523)); + return _packageConstraintResolver = _interopRequireDefault(__webpack_require__(554)); } var _requestManager; function _load_requestManager() { - return _requestManager = _interopRequireDefault(__webpack_require__(345)); + return _requestManager = _interopRequireDefault(__webpack_require__(377)); } var _index2; function _load_index2() { - return _index2 = __webpack_require__(52); + return _index2 = __webpack_require__(57); } var _index3; function _load_index3() { - return _index3 = __webpack_require__(191); + return _index3 = __webpack_require__(200); } var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const detectIndent = __webpack_require__(604); -const invariant = __webpack_require__(8); +const detectIndent = __webpack_require__(635); +const invariant = __webpack_require__(9); const path = __webpack_require__(0); -const micromatch = __webpack_require__(106); -const isCi = __webpack_require__(364); +const micromatch = __webpack_require__(114); +const isCi = __webpack_require__(396); function sortObject(object) { const sortedObject = {}; @@ -43389,7 +43870,7 @@ function extractWorkspaces(manifest) { } /***/ }), -/* 154 */ +/* 163 */ /***/ (function(module, exports) { module.exports = function(module) { @@ -43417,13 +43898,13 @@ module.exports = function(module) { /***/ }), -/* 155 */ +/* 164 */ /***/ (function(module, exports) { module.exports = require("net"); /***/ }), -/* 156 */ +/* 165 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -43443,7 +43924,7 @@ function _load_asyncToGenerator() { var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } let run = exports.run = (() => { @@ -43471,37 +43952,37 @@ exports.setFlags = setFlags; var _lockfile; function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(18)); + return _lockfile = _interopRequireDefault(__webpack_require__(19)); } var _normalizePattern2; function _load_normalizePattern() { - return _normalizePattern2 = __webpack_require__(36); + return _normalizePattern2 = __webpack_require__(37); } var _workspaceLayout; function _load_workspaceLayout() { - return _workspaceLayout = _interopRequireDefault(__webpack_require__(84)); + return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); } var _index; function _load_index() { - return _index = __webpack_require__(71); + return _index = __webpack_require__(78); } var _list; function _load_list() { - return _list = __webpack_require__(325); + return _list = __webpack_require__(358); } var _install; function _load_install() { - return _install = __webpack_require__(33); + return _install = __webpack_require__(34); } var _errors; @@ -43513,7 +43994,7 @@ function _load_errors() { var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _fs; @@ -43525,7 +44006,7 @@ function _load_fs() { var _invariant; function _load_invariant() { - return _invariant = _interopRequireDefault(__webpack_require__(8)); + return _invariant = _interopRequireDefault(__webpack_require__(9)); } var _path; @@ -43537,7 +44018,7 @@ function _load_path() { var _semver; function _load_semver() { - return _semver = _interopRequireDefault(__webpack_require__(20)); + return _semver = _interopRequireDefault(__webpack_require__(21)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -43892,11 +44373,11 @@ function setFlags(commander) { commander.option('-O, --optional', 'save package to your `optionalDependencies`'); commander.option('-E, --exact', 'install exact version'); commander.option('-T, --tilde', 'install most recent release with the same minor version'); - commander.option('-A', '--audit', 'Run vulnerability audit on installed packages'); + commander.option('-A, --audit', 'Run vulnerability audit on installed packages'); } /***/ }), -/* 157 */ +/* 166 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -44119,7 +44600,7 @@ function _load_fs() { var _filter; function _load_filter() { - return _filter = __webpack_require__(340); + return _filter = __webpack_require__(372); } var _errors; @@ -44132,11 +44613,11 @@ function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const zlib = __webpack_require__(189); +const zlib = __webpack_require__(198); const path = __webpack_require__(0); -const tar = __webpack_require__(184); +const tar = __webpack_require__(193); const fs2 = __webpack_require__(4); -const depsFor = __webpack_require__(647); +const depsFor = __webpack_require__(678); const FOLDERS_IGNORE = [ // never allow version control folders @@ -44174,7 +44655,7 @@ function hasWrapper(commander, args) { } /***/ }), -/* 158 */ +/* 167 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -44193,13 +44674,13 @@ function _load_asyncToGenerator() { var _index; function _load_index() { - return _index = _interopRequireDefault(__webpack_require__(210)); + return _index = _interopRequireDefault(__webpack_require__(220)); } var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _fs; @@ -44211,7 +44692,7 @@ function _load_fs() { var _mutex; function _load_mutex() { - return _mutex = _interopRequireDefault(__webpack_require__(342)); + return _mutex = _interopRequireDefault(__webpack_require__(374)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -44220,7 +44701,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { de /* eslint no-unused-vars: 0 */ -const cmdShim = __webpack_require__(192); +const cmdShim = __webpack_require__(201); const path = __webpack_require__(0); class BaseFetcher { @@ -44331,7 +44812,7 @@ class BaseFetcher { exports.default = BaseFetcher; /***/ }), -/* 159 */ +/* 168 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -44341,8 +44822,8 @@ Object.defineProperty(exports, "__esModule", { value: true }); exports.hash = hash; -const crypto = __webpack_require__(11); -const stream = __webpack_require__(22); +const crypto = __webpack_require__(12); +const stream = __webpack_require__(23); function hash(content, type = 'md5') { return crypto.createHash(type).update(content).digest('hex'); @@ -44372,7 +44853,7 @@ class HashStream extends stream.Transform { exports.HashStream = HashStream; /***/ }), -/* 160 */ +/* 169 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -44386,7 +44867,7 @@ exports.default = guessName; var _url; function _load_url() { - return _url = _interopRequireDefault(__webpack_require__(23)); + return _url = _interopRequireDefault(__webpack_require__(24)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -44454,11 +44935,11 @@ function guessName(source) { } /***/ }), -/* 161 */ +/* 170 */ /***/ (function(module, exports, __webpack_require__) { // fallback for non-array-like ES3 and non-enumerable old V8 strings -var cof = __webpack_require__(62); +var cof = __webpack_require__(68); // eslint-disable-next-line no-prototype-builtins module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) { return cof(it) == 'String' ? it.split('') : Object(it); @@ -44466,12 +44947,12 @@ module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) { /***/ }), -/* 162 */ +/* 171 */ /***/ (function(module, exports, __webpack_require__) { // 19.1.2.14 / 15.2.3.14 Object.keys(O) -var $keys = __webpack_require__(239); -var enumBugKeys = __webpack_require__(120); +var $keys = __webpack_require__(249); +var enumBugKeys = __webpack_require__(127); module.exports = Object.keys || function keys(O) { return $keys(O, enumBugKeys); @@ -44479,21 +44960,21 @@ module.exports = Object.keys || function keys(O) { /***/ }), -/* 163 */ +/* 172 */ /***/ (function(module, exports, __webpack_require__) { // 7.1.13 ToObject(argument) -var defined = __webpack_require__(85); +var defined = __webpack_require__(91); module.exports = function (it) { return Object(defined(it)); }; /***/ }), -/* 164 */ +/* 173 */ /***/ (function(module, exports, __webpack_require__) { -var once = __webpack_require__(76); +var once = __webpack_require__(83); var noop = function() {}; @@ -44583,13 +45064,13 @@ module.exports = eos; /***/ }), -/* 165 */ +/* 174 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. -var assert = __webpack_require__(15); -var sshpk = __webpack_require__(295); +var assert = __webpack_require__(16); +var sshpk = __webpack_require__(328); var util = __webpack_require__(3); var HASH_ALGOS = { @@ -44701,13 +45182,13 @@ module.exports = { /***/ }), -/* 166 */ +/* 175 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var chalk = __webpack_require__(29); -var figures = __webpack_require__(259); +var chalk = __webpack_require__(30); +var figures = __webpack_require__(270); /** * Separator object @@ -44745,14 +45226,14 @@ module.exports = Separator; /***/ }), -/* 167 */ +/* 176 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var _ = __webpack_require__(37); -var chalk = __webpack_require__(29); +var _ = __webpack_require__(38); +var chalk = __webpack_require__(30); /** * The paginator keeps track of a pointer index in a list and returns @@ -44805,7 +45286,7 @@ module.exports = Paginator; /***/ }), -/* 168 */ +/* 177 */ /***/ (function(module, exports) { /*! @@ -44822,7 +45303,7 @@ module.exports = function isExtglob(str) { /***/ }), -/* 169 */ +/* 178 */ /***/ (function(module, exports, __webpack_require__) { /*! @@ -44832,7 +45313,7 @@ module.exports = function isExtglob(str) { * Licensed under the MIT License. */ -var isExtglob = __webpack_require__(168); +var isExtglob = __webpack_require__(177); module.exports = function isGlob(str) { return typeof str === 'string' @@ -44841,10 +45322,10 @@ module.exports = function isGlob(str) { }; /***/ }), -/* 170 */ +/* 179 */ /***/ (function(module, exports, __webpack_require__) { -var isBuffer = __webpack_require__(698); +var isBuffer = __webpack_require__(729); var toString = Object.prototype.toString; /** @@ -44963,7 +45444,7 @@ module.exports = function kindOf(val) { /***/ }), -/* 171 */ +/* 180 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -45014,13 +45495,13 @@ function nextTick(fn, arg1, arg2, arg3) { /***/ }), -/* 172 */ +/* 181 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var isPromise = __webpack_require__(710); +var isPromise = __webpack_require__(741); /** * Return a function that will run a function asynchronously or synchronously @@ -45082,115 +45563,115 @@ runAsync.cb = function (func, cb) { /***/ }), -/* 173 */ +/* 182 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; Object.defineProperty(__webpack_exports__, "__esModule", { value: true }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__internal_Observable__ = __webpack_require__(10); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__internal_Observable__ = __webpack_require__(11); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Observable", function() { return __WEBPACK_IMPORTED_MODULE_0__internal_Observable__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__internal_observable_ConnectableObservable__ = __webpack_require__(391); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__internal_observable_ConnectableObservable__ = __webpack_require__(422); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "ConnectableObservable", function() { return __WEBPACK_IMPORTED_MODULE_1__internal_observable_ConnectableObservable__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_operators_groupBy__ = __webpack_require__(401); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_operators_groupBy__ = __webpack_require__(432); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "GroupedObservable", function() { return __WEBPACK_IMPORTED_MODULE_2__internal_operators_groupBy__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__internal_symbol_observable__ = __webpack_require__(109); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__internal_symbol_observable__ = __webpack_require__(117); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "observable", function() { return __WEBPACK_IMPORTED_MODULE_3__internal_symbol_observable__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_Subject__ = __webpack_require__(35); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_Subject__ = __webpack_require__(36); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Subject", function() { return __WEBPACK_IMPORTED_MODULE_4__internal_Subject__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__internal_BehaviorSubject__ = __webpack_require__(387); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__internal_BehaviorSubject__ = __webpack_require__(418); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "BehaviorSubject", function() { return __WEBPACK_IMPORTED_MODULE_5__internal_BehaviorSubject__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_ReplaySubject__ = __webpack_require__(275); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_ReplaySubject__ = __webpack_require__(308); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "ReplaySubject", function() { return __WEBPACK_IMPORTED_MODULE_6__internal_ReplaySubject__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__internal_AsyncSubject__ = __webpack_require__(174); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__internal_AsyncSubject__ = __webpack_require__(183); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "AsyncSubject", function() { return __WEBPACK_IMPORTED_MODULE_7__internal_AsyncSubject__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__internal_scheduler_asap__ = __webpack_require__(406); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__internal_scheduler_asap__ = __webpack_require__(437); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "asapScheduler", function() { return __WEBPACK_IMPORTED_MODULE_8__internal_scheduler_asap__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__internal_scheduler_async__ = __webpack_require__(39); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__internal_scheduler_async__ = __webpack_require__(40); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "asyncScheduler", function() { return __WEBPACK_IMPORTED_MODULE_9__internal_scheduler_async__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__internal_scheduler_queue__ = __webpack_require__(407); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__internal_scheduler_queue__ = __webpack_require__(438); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "queueScheduler", function() { return __WEBPACK_IMPORTED_MODULE_10__internal_scheduler_queue__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__internal_scheduler_animationFrame__ = __webpack_require__(895); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__internal_scheduler_animationFrame__ = __webpack_require__(926); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "animationFrameScheduler", function() { return __WEBPACK_IMPORTED_MODULE_11__internal_scheduler_animationFrame__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__internal_scheduler_VirtualTimeScheduler__ = __webpack_require__(894); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__internal_scheduler_VirtualTimeScheduler__ = __webpack_require__(925); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "VirtualTimeScheduler", function() { return __WEBPACK_IMPORTED_MODULE_12__internal_scheduler_VirtualTimeScheduler__["a"]; }); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "VirtualAction", function() { return __WEBPACK_IMPORTED_MODULE_12__internal_scheduler_VirtualTimeScheduler__["b"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__internal_Scheduler__ = __webpack_require__(389); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__internal_Scheduler__ = __webpack_require__(420); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Scheduler", function() { return __WEBPACK_IMPORTED_MODULE_13__internal_Scheduler__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__internal_Subscription__ = __webpack_require__(24); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__internal_Subscription__ = __webpack_require__(25); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Subscription", function() { return __WEBPACK_IMPORTED_MODULE_14__internal_Subscription__["a"]; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__internal_Subscriber__ = __webpack_require__(7); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Subscriber", function() { return __WEBPACK_IMPORTED_MODULE_15__internal_Subscriber__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__internal_Notification__ = __webpack_require__(175); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__internal_Notification__ = __webpack_require__(184); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Notification", function() { return __WEBPACK_IMPORTED_MODULE_16__internal_Notification__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__internal_util_pipe__ = __webpack_require__(291); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__internal_util_pipe__ = __webpack_require__(324); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "pipe", function() { return __WEBPACK_IMPORTED_MODULE_17__internal_util_pipe__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__internal_util_noop__ = __webpack_require__(182); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__internal_util_noop__ = __webpack_require__(191); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "noop", function() { return __WEBPACK_IMPORTED_MODULE_18__internal_util_noop__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__internal_util_identity__ = __webpack_require__(110); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__internal_util_identity__ = __webpack_require__(118); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "identity", function() { return __WEBPACK_IMPORTED_MODULE_19__internal_util_identity__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__internal_util_isObservable__ = __webpack_require__(899); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__internal_util_isObservable__ = __webpack_require__(930); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "isObservable", function() { return __WEBPACK_IMPORTED_MODULE_20__internal_util_isObservable__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__internal_util_ArgumentOutOfRangeError__ = __webpack_require__(143); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__internal_util_ArgumentOutOfRangeError__ = __webpack_require__(152); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "ArgumentOutOfRangeError", function() { return __WEBPACK_IMPORTED_MODULE_21__internal_util_ArgumentOutOfRangeError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__internal_util_EmptyError__ = __webpack_require__(144); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__internal_util_EmptyError__ = __webpack_require__(153); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "EmptyError", function() { return __WEBPACK_IMPORTED_MODULE_22__internal_util_EmptyError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__internal_util_ObjectUnsubscribedError__ = __webpack_require__(180); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__internal_util_ObjectUnsubscribedError__ = __webpack_require__(189); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "ObjectUnsubscribedError", function() { return __WEBPACK_IMPORTED_MODULE_23__internal_util_ObjectUnsubscribedError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__internal_util_UnsubscriptionError__ = __webpack_require__(409); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__internal_util_UnsubscriptionError__ = __webpack_require__(440); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "UnsubscriptionError", function() { return __WEBPACK_IMPORTED_MODULE_24__internal_util_UnsubscriptionError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__internal_util_TimeoutError__ = __webpack_require__(408); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__internal_util_TimeoutError__ = __webpack_require__(439); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "TimeoutError", function() { return __WEBPACK_IMPORTED_MODULE_25__internal_util_TimeoutError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__internal_observable_bindCallback__ = __webpack_require__(792); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__internal_observable_bindCallback__ = __webpack_require__(823); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bindCallback", function() { return __WEBPACK_IMPORTED_MODULE_26__internal_observable_bindCallback__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__internal_observable_bindNodeCallback__ = __webpack_require__(793); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__internal_observable_bindNodeCallback__ = __webpack_require__(824); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "bindNodeCallback", function() { return __WEBPACK_IMPORTED_MODULE_27__internal_observable_bindNodeCallback__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__internal_observable_combineLatest__ = __webpack_require__(276); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__internal_observable_combineLatest__ = __webpack_require__(309); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "combineLatest", function() { return __WEBPACK_IMPORTED_MODULE_28__internal_observable_combineLatest__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__internal_observable_concat__ = __webpack_require__(177); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__internal_observable_concat__ = __webpack_require__(186); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "concat", function() { return __WEBPACK_IMPORTED_MODULE_29__internal_observable_concat__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__internal_observable_defer__ = __webpack_require__(277); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__internal_observable_defer__ = __webpack_require__(310); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "defer", function() { return __WEBPACK_IMPORTED_MODULE_30__internal_observable_defer__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__internal_observable_empty__ = __webpack_require__(38); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__internal_observable_empty__ = __webpack_require__(39); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "empty", function() { return __WEBPACK_IMPORTED_MODULE_31__internal_observable_empty__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__internal_observable_forkJoin__ = __webpack_require__(794); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__internal_observable_forkJoin__ = __webpack_require__(825); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "forkJoin", function() { return __WEBPACK_IMPORTED_MODULE_32__internal_observable_forkJoin__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__internal_observable_from__ = __webpack_require__(57); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__internal_observable_from__ = __webpack_require__(62); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "from", function() { return __WEBPACK_IMPORTED_MODULE_33__internal_observable_from__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__internal_observable_fromEvent__ = __webpack_require__(795); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__internal_observable_fromEvent__ = __webpack_require__(826); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "fromEvent", function() { return __WEBPACK_IMPORTED_MODULE_34__internal_observable_fromEvent__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__internal_observable_fromEventPattern__ = __webpack_require__(796); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__internal_observable_fromEventPattern__ = __webpack_require__(827); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "fromEventPattern", function() { return __WEBPACK_IMPORTED_MODULE_35__internal_observable_fromEventPattern__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__internal_observable_generate__ = __webpack_require__(800); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__internal_observable_generate__ = __webpack_require__(831); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "generate", function() { return __WEBPACK_IMPORTED_MODULE_36__internal_observable_generate__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__internal_observable_iif__ = __webpack_require__(801); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__internal_observable_iif__ = __webpack_require__(832); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "iif", function() { return __WEBPACK_IMPORTED_MODULE_37__internal_observable_iif__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__internal_observable_interval__ = __webpack_require__(802); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__internal_observable_interval__ = __webpack_require__(833); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "interval", function() { return __WEBPACK_IMPORTED_MODULE_38__internal_observable_interval__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__internal_observable_merge__ = __webpack_require__(392); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__internal_observable_merge__ = __webpack_require__(423); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "merge", function() { return __WEBPACK_IMPORTED_MODULE_39__internal_observable_merge__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__internal_observable_never__ = __webpack_require__(393); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__internal_observable_never__ = __webpack_require__(424); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "never", function() { return __WEBPACK_IMPORTED_MODULE_40__internal_observable_never__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__internal_observable_of__ = __webpack_require__(278); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__internal_observable_of__ = __webpack_require__(311); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "of", function() { return __WEBPACK_IMPORTED_MODULE_41__internal_observable_of__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__internal_observable_onErrorResumeNext__ = __webpack_require__(803); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__internal_observable_onErrorResumeNext__ = __webpack_require__(834); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "onErrorResumeNext", function() { return __WEBPACK_IMPORTED_MODULE_42__internal_observable_onErrorResumeNext__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__internal_observable_pairs__ = __webpack_require__(804); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__internal_observable_pairs__ = __webpack_require__(835); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "pairs", function() { return __WEBPACK_IMPORTED_MODULE_43__internal_observable_pairs__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__internal_observable_race__ = __webpack_require__(394); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__internal_observable_race__ = __webpack_require__(425); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "race", function() { return __WEBPACK_IMPORTED_MODULE_44__internal_observable_race__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__internal_observable_range__ = __webpack_require__(805); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__internal_observable_range__ = __webpack_require__(836); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "range", function() { return __WEBPACK_IMPORTED_MODULE_45__internal_observable_range__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__internal_observable_throwError__ = __webpack_require__(280); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__internal_observable_throwError__ = __webpack_require__(313); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "throwError", function() { return __WEBPACK_IMPORTED_MODULE_46__internal_observable_throwError__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__internal_observable_timer__ = __webpack_require__(395); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__internal_observable_timer__ = __webpack_require__(426); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "timer", function() { return __WEBPACK_IMPORTED_MODULE_47__internal_observable_timer__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__internal_observable_using__ = __webpack_require__(806); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__internal_observable_using__ = __webpack_require__(837); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "using", function() { return __WEBPACK_IMPORTED_MODULE_48__internal_observable_using__["a"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__internal_observable_zip__ = __webpack_require__(281); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__internal_observable_zip__ = __webpack_require__(314); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "zip", function() { return __WEBPACK_IMPORTED_MODULE_49__internal_observable_zip__["a"]; }); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "EMPTY", function() { return __WEBPACK_IMPORTED_MODULE_31__internal_observable_empty__["b"]; }); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "NEVER", function() { return __WEBPACK_IMPORTED_MODULE_40__internal_observable_never__["b"]; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__internal_config__ = __webpack_require__(176); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__internal_config__ = __webpack_require__(185); /* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "config", function() { return __WEBPACK_IMPORTED_MODULE_50__internal_config__["a"]; }); /** PURE_IMPORTS_START PURE_IMPORTS_END */ @@ -45250,14 +45731,14 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true }); /***/ }), -/* 174 */ +/* 183 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return AsyncSubject; }); /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subject__ = __webpack_require__(35); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscription__ = __webpack_require__(24); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subject__ = __webpack_require__(36); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscription__ = __webpack_require__(25); /** PURE_IMPORTS_START tslib,_Subject,_Subscription PURE_IMPORTS_END */ @@ -45308,14 +45789,14 @@ var AsyncSubject = /*@__PURE__*/ (function (_super) { /***/ }), -/* 175 */ +/* 184 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Notification; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__observable_empty__ = __webpack_require__(38); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__observable_of__ = __webpack_require__(278); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__observable_throwError__ = __webpack_require__(280); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__observable_empty__ = __webpack_require__(39); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__observable_of__ = __webpack_require__(311); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__observable_throwError__ = __webpack_require__(313); /** PURE_IMPORTS_START _observable_empty,_observable_of,_observable_throwError PURE_IMPORTS_END */ @@ -45389,7 +45870,7 @@ var Notification = /*@__PURE__*/ (function () { /***/ }), -/* 176 */ +/* 185 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -45416,15 +45897,15 @@ var config = { /***/ }), -/* 177 */ +/* 186 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = concat; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isScheduler__ = __webpack_require__(45); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__of__ = __webpack_require__(278); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__from__ = __webpack_require__(57); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__operators_concatAll__ = __webpack_require__(397); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isScheduler__ = __webpack_require__(48); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__of__ = __webpack_require__(311); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__from__ = __webpack_require__(62); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__operators_concatAll__ = __webpack_require__(428); /** PURE_IMPORTS_START _util_isScheduler,_of,_from,_operators_concatAll PURE_IMPORTS_END */ @@ -45444,15 +45925,15 @@ function concat() { /***/ }), -/* 178 */ +/* 187 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = reduce; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__scan__ = __webpack_require__(284); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__takeLast__ = __webpack_require__(287); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__defaultIfEmpty__ = __webpack_require__(137); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(291); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__scan__ = __webpack_require__(317); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__takeLast__ = __webpack_require__(320); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__defaultIfEmpty__ = __webpack_require__(146); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324); /** PURE_IMPORTS_START _scan,_takeLast,_defaultIfEmpty,_util_pipe PURE_IMPORTS_END */ @@ -45472,13 +45953,13 @@ function reduce(accumulator, seed) { /***/ }), -/* 179 */ +/* 188 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return throwIfEmpty; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tap__ = __webpack_require__(403); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_EmptyError__ = __webpack_require__(144); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tap__ = __webpack_require__(434); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_EmptyError__ = __webpack_require__(153); /** PURE_IMPORTS_START _tap,_util_EmptyError PURE_IMPORTS_END */ @@ -45503,7 +45984,7 @@ function defaultErrorFactory() { /***/ }), -/* 180 */ +/* 189 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -45521,12 +46002,12 @@ var ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl; /***/ }), -/* 181 */ +/* 190 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; /* harmony export (immutable) */ __webpack_exports__["a"] = isNumeric; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__isArray__ = __webpack_require__(40); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__isArray__ = __webpack_require__(41); /** PURE_IMPORTS_START _isArray PURE_IMPORTS_END */ function isNumeric(val) { @@ -45536,7 +46017,7 @@ function isNumeric(val) { /***/ }), -/* 182 */ +/* 191 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; @@ -45547,7 +46028,7 @@ function noop() { } /***/ }), -/* 183 */ +/* 192 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. @@ -45558,19 +46039,19 @@ module.exports = { write: write }; -var assert = __webpack_require__(15); -var asn1 = __webpack_require__(59); -var Buffer = __webpack_require__(14).Buffer; -var algs = __webpack_require__(31); -var utils = __webpack_require__(25); -var crypto = __webpack_require__(11); +var assert = __webpack_require__(16); +var asn1 = __webpack_require__(65); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var utils = __webpack_require__(26); +var crypto = __webpack_require__(12); -var Key = __webpack_require__(26); -var PrivateKey = __webpack_require__(32); -var pem = __webpack_require__(79); -var rfc4253 = __webpack_require__(96); -var SSHBuffer = __webpack_require__(150); -var errors = __webpack_require__(66); +var Key = __webpack_require__(27); +var PrivateKey = __webpack_require__(33); +var pem = __webpack_require__(86); +var rfc4253 = __webpack_require__(103); +var SSHBuffer = __webpack_require__(159); +var errors = __webpack_require__(73); var bcrypt; @@ -45619,7 +46100,7 @@ function readSSHPrivate(type, buf, options) { var rounds = kdfOptsBuf.readInt(); var cinf = utils.opensshCipherInfo(cipher); if (bcrypt === undefined) { - bcrypt = __webpack_require__(346); + bcrypt = __webpack_require__(378); } if (typeof (options.passphrase) === 'string') { @@ -45740,7 +46221,7 @@ function write(key, options) { kdfopts = kdfssh.toBuffer(); if (bcrypt === undefined) { - bcrypt = __webpack_require__(346); + bcrypt = __webpack_require__(378); } var pass = new Uint8Array(passphrase); var salti = new Uint8Array(salt); @@ -45815,16 +46296,16 @@ function write(key, options) { /***/ }), -/* 184 */ +/* 193 */ /***/ (function(module, exports, __webpack_require__) { -var chownr = __webpack_require__(569) -var tar = __webpack_require__(428) -var pump = __webpack_require__(750) -var mkdirp = __webpack_require__(136) +var chownr = __webpack_require__(600) +var tar = __webpack_require__(459) +var pump = __webpack_require__(781) +var mkdirp = __webpack_require__(145) var fs = __webpack_require__(4) var path = __webpack_require__(0) -var os = __webpack_require__(46) +var os = __webpack_require__(49) var win32 = os.platform() === 'win32' @@ -46166,37 +46647,37 @@ function mkdirfix (name, opts, cb) { /***/ }), -/* 185 */ +/* 194 */ /***/ (function(module, exports) { -module.exports = {"name":"yarn","installationMethod":"unknown","version":"1.15.2","license":"BSD-2-Clause","preferGlobal":true,"description":"📦🐈 Fast, reliable, and secure dependency management.","dependencies":{"@zkochan/cmd-shim":"^3.1.0","babel-runtime":"^6.26.0","bytes":"^3.0.0","camelcase":"^4.0.0","chalk":"^2.1.0","cli-table3":"^0.4.0","commander":"^2.9.0","death":"^1.0.0","debug":"^3.0.0","deep-equal":"^1.0.1","detect-indent":"^5.0.0","dnscache":"^1.0.1","glob":"^7.1.1","gunzip-maybe":"^1.4.0","hash-for-dep":"^1.2.3","imports-loader":"^0.8.0","ini":"^1.3.4","inquirer":"^6.2.0","invariant":"^2.2.0","is-builtin-module":"^2.0.0","is-ci":"^1.0.10","is-webpack-bundle":"^1.0.0","leven":"^2.0.0","loud-rejection":"^1.2.0","micromatch":"^2.3.11","mkdirp":"^0.5.1","node-emoji":"^1.6.1","normalize-url":"^2.0.0","npm-logical-tree":"^1.2.1","object-path":"^0.11.2","proper-lockfile":"^2.0.0","puka":"^1.0.0","read":"^1.0.7","request":"^2.87.0","request-capture-har":"^1.2.2","rimraf":"^2.5.0","semver":"^5.1.0","ssri":"^5.3.0","strip-ansi":"^4.0.0","strip-bom":"^3.0.0","tar-fs":"^1.16.0","tar-stream":"^1.6.1","uuid":"^3.0.1","v8-compile-cache":"^2.0.0","validate-npm-package-license":"^3.0.4","yn":"^2.0.0"},"devDependencies":{"babel-core":"^6.26.0","babel-eslint":"^7.2.3","babel-loader":"^6.2.5","babel-plugin-array-includes":"^2.0.3","babel-plugin-inline-import":"^3.0.0","babel-plugin-transform-builtin-extend":"^1.1.2","babel-plugin-transform-inline-imports-commonjs":"^1.0.0","babel-plugin-transform-runtime":"^6.4.3","babel-preset-env":"^1.6.0","babel-preset-flow":"^6.23.0","babel-preset-stage-0":"^6.0.0","babylon":"^6.5.0","commitizen":"^2.9.6","cz-conventional-changelog":"^2.0.0","eslint":"^4.3.0","eslint-config-fb-strict":"^22.0.0","eslint-plugin-babel":"^5.0.0","eslint-plugin-flowtype":"^2.35.0","eslint-plugin-jasmine":"^2.6.2","eslint-plugin-jest":"^21.0.0","eslint-plugin-jsx-a11y":"^6.0.2","eslint-plugin-prefer-object-spread":"^1.2.1","eslint-plugin-prettier":"^2.1.2","eslint-plugin-react":"^7.1.0","eslint-plugin-relay":"^0.0.28","eslint-plugin-yarn-internal":"file:scripts/eslint-rules","execa":"^0.11.0","fancy-log":"^1.3.2","flow-bin":"^0.66.0","git-release-notes":"^3.0.0","gulp":"^4.0.0","gulp-babel":"^7.0.0","gulp-if":"^2.0.1","gulp-newer":"^1.0.0","gulp-plumber":"^1.0.1","gulp-sourcemaps":"^2.2.0","jest":"^22.4.4","jsinspect":"^0.12.6","minimatch":"^3.0.4","mock-stdin":"^0.3.0","prettier":"^1.5.2","string-replace-loader":"^2.1.1","temp":"^0.8.3","webpack":"^2.1.0-beta.25","yargs":"^6.3.0"},"resolutions":{"sshpk":"^1.14.2"},"engines":{"node":">=4.0.0"},"repository":"yarnpkg/yarn","bin":{"yarn":"./bin/yarn.js","yarnpkg":"./bin/yarn.js"},"scripts":{"build":"gulp build","build-bundle":"node ./scripts/build-webpack.js","build-chocolatey":"powershell ./scripts/build-chocolatey.ps1","build-deb":"./scripts/build-deb.sh","build-dist":"bash ./scripts/build-dist.sh","build-win-installer":"scripts\\build-windows-installer.bat","changelog":"git-release-notes $(git describe --tags --abbrev=0 $(git describe --tags --abbrev=0)^)..$(git describe --tags --abbrev=0) scripts/changelog.md","dupe-check":"yarn jsinspect ./src","lint":"eslint . && flow check","pkg-tests":"yarn --cwd packages/pkg-tests jest yarn.test.js","prettier":"eslint src __tests__ --fix","release-branch":"./scripts/release-branch.sh","test":"yarn lint && yarn test-only","test-only":"node --max_old_space_size=4096 node_modules/jest/bin/jest.js --verbose","test-only-debug":"node --inspect-brk --max_old_space_size=4096 node_modules/jest/bin/jest.js --runInBand --verbose","test-coverage":"node --max_old_space_size=4096 node_modules/jest/bin/jest.js --coverage --verbose","watch":"gulp watch","commit":"git-cz"},"jest":{"collectCoverageFrom":["src/**/*.js"],"testEnvironment":"node","modulePathIgnorePatterns":["__tests__/fixtures/","packages/pkg-tests/pkg-tests-fixtures","dist/"],"testPathIgnorePatterns":["__tests__/(fixtures|__mocks__)/","updates/","_(temp|mock|install|init|helpers).js$","packages/pkg-tests"]},"config":{"commitizen":{"path":"./node_modules/cz-conventional-changelog"}}} +module.exports = {"name":"yarn","installationMethod":"unknown","version":"1.17.3","license":"BSD-2-Clause","preferGlobal":true,"description":"📦🐈 Fast, reliable, and secure dependency management.","dependencies":{"@zkochan/cmd-shim":"^3.1.0","babel-runtime":"^6.26.0","bytes":"^3.0.0","camelcase":"^4.0.0","chalk":"^2.1.0","cli-table3":"^0.4.0","commander":"^2.9.0","death":"^1.0.0","debug":"^3.0.0","deep-equal":"^1.0.1","detect-indent":"^5.0.0","dnscache":"^1.0.1","glob":"^7.1.1","gunzip-maybe":"^1.4.0","hash-for-dep":"^1.2.3","imports-loader":"^0.8.0","ini":"^1.3.4","inquirer":"^6.2.0","invariant":"^2.2.0","is-builtin-module":"^2.0.0","is-ci":"^1.0.10","is-webpack-bundle":"^1.0.0","js-yaml":"^3.13.1","leven":"^2.0.0","loud-rejection":"^1.2.0","micromatch":"^2.3.11","mkdirp":"^0.5.1","node-emoji":"^1.6.1","normalize-url":"^2.0.0","npm-logical-tree":"^1.2.1","object-path":"^0.11.2","proper-lockfile":"^2.0.0","puka":"^1.0.0","read":"^1.0.7","request":"^2.87.0","request-capture-har":"^1.2.2","rimraf":"^2.5.0","semver":"^5.1.0","ssri":"^5.3.0","strip-ansi":"^4.0.0","strip-bom":"^3.0.0","tar-fs":"^1.16.0","tar-stream":"^1.6.1","uuid":"^3.0.1","v8-compile-cache":"^2.0.0","validate-npm-package-license":"^3.0.4","yn":"^2.0.0"},"devDependencies":{"babel-core":"^6.26.0","babel-eslint":"^7.2.3","babel-loader":"^6.2.5","babel-plugin-array-includes":"^2.0.3","babel-plugin-inline-import":"^3.0.0","babel-plugin-transform-builtin-extend":"^1.1.2","babel-plugin-transform-inline-imports-commonjs":"^1.0.0","babel-plugin-transform-runtime":"^6.4.3","babel-preset-env":"^1.6.0","babel-preset-flow":"^6.23.0","babel-preset-stage-0":"^6.0.0","babylon":"^6.5.0","commitizen":"^2.9.6","cz-conventional-changelog":"^2.0.0","eslint":"^4.3.0","eslint-config-fb-strict":"^22.0.0","eslint-plugin-babel":"^5.0.0","eslint-plugin-flowtype":"^2.35.0","eslint-plugin-jasmine":"^2.6.2","eslint-plugin-jest":"^21.0.0","eslint-plugin-jsx-a11y":"^6.0.2","eslint-plugin-prefer-object-spread":"^1.2.1","eslint-plugin-prettier":"^2.1.2","eslint-plugin-react":"^7.1.0","eslint-plugin-relay":"^0.0.28","eslint-plugin-yarn-internal":"file:scripts/eslint-rules","execa":"^0.11.0","fancy-log":"^1.3.2","flow-bin":"^0.66.0","git-release-notes":"^3.0.0","gulp":"^4.0.0","gulp-babel":"^7.0.0","gulp-if":"^2.0.1","gulp-newer":"^1.0.0","gulp-plumber":"^1.0.1","gulp-sourcemaps":"^2.2.0","jest":"^22.4.4","jsinspect":"^0.12.6","minimatch":"^3.0.4","mock-stdin":"^0.3.0","prettier":"^1.5.2","string-replace-loader":"^2.1.1","temp":"^0.8.3","webpack":"^2.1.0-beta.25","yargs":"^6.3.0"},"resolutions":{"sshpk":"^1.14.2"},"engines":{"node":">=4.0.0"},"repository":"yarnpkg/yarn","bin":{"yarn":"./bin/yarn.js","yarnpkg":"./bin/yarn.js"},"scripts":{"build":"gulp build","build-bundle":"node ./scripts/build-webpack.js","build-chocolatey":"powershell ./scripts/build-chocolatey.ps1","build-deb":"./scripts/build-deb.sh","build-dist":"bash ./scripts/build-dist.sh","build-win-installer":"scripts\\build-windows-installer.bat","changelog":"git-release-notes $(git describe --tags --abbrev=0 $(git describe --tags --abbrev=0)^)..$(git describe --tags --abbrev=0) scripts/changelog.md","dupe-check":"yarn jsinspect ./src","lint":"eslint . && flow check","pkg-tests":"yarn --cwd packages/pkg-tests jest yarn.test.js","prettier":"eslint src __tests__ --fix","release-branch":"./scripts/release-branch.sh","test":"yarn lint && yarn test-only","test-only":"node --max_old_space_size=4096 node_modules/jest/bin/jest.js --verbose","test-only-debug":"node --inspect-brk --max_old_space_size=4096 node_modules/jest/bin/jest.js --runInBand --verbose","test-coverage":"node --max_old_space_size=4096 node_modules/jest/bin/jest.js --coverage --verbose","watch":"gulp watch","commit":"git-cz"},"jest":{"collectCoverageFrom":["src/**/*.js"],"testEnvironment":"node","modulePathIgnorePatterns":["__tests__/fixtures/","packages/pkg-tests/pkg-tests-fixtures","dist/"],"testPathIgnorePatterns":["__tests__/(fixtures|__mocks__)/","updates/","_(temp|mock|install|init|helpers).js$","packages/pkg-tests"]},"config":{"commitizen":{"path":"./node_modules/cz-conventional-changelog"}}} /***/ }), -/* 186 */ +/* 195 */ /***/ (function(module, exports) { module.exports = require("https"); /***/ }), -/* 187 */ +/* 196 */ /***/ (function(module, exports) { module.exports = require("querystring"); /***/ }), -/* 188 */ +/* 197 */ /***/ (function(module, exports) { module.exports = require("readline"); /***/ }), -/* 189 */ +/* 198 */ /***/ (function(module, exports) { module.exports = require("zlib"); /***/ }), -/* 190 */ +/* 199 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -46210,19 +46691,19 @@ exports.default = stringify; var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _package; function _load_package() { - return _package = __webpack_require__(185); + return _package = __webpack_require__(194); } const NODE_VERSION = process.version; @@ -46330,7 +46811,7 @@ function stringify(obj, noHeader, enableVersions) { } /***/ }), -/* 191 */ +/* 200 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -46343,7 +46824,7 @@ Object.defineProperty(exports, "__esModule", { var _consoleReporter; function _load_consoleReporter() { - return _consoleReporter = __webpack_require__(529); + return _consoleReporter = __webpack_require__(560); } Object.defineProperty(exports, 'ConsoleReporter', { @@ -46356,7 +46837,7 @@ Object.defineProperty(exports, 'ConsoleReporter', { var _bufferReporter; function _load_bufferReporter() { - return _bufferReporter = __webpack_require__(528); + return _bufferReporter = __webpack_require__(559); } Object.defineProperty(exports, 'BufferReporter', { @@ -46369,7 +46850,7 @@ Object.defineProperty(exports, 'BufferReporter', { var _eventReporter; function _load_eventReporter() { - return _eventReporter = __webpack_require__(533); + return _eventReporter = __webpack_require__(564); } Object.defineProperty(exports, 'EventReporter', { @@ -46382,7 +46863,7 @@ Object.defineProperty(exports, 'EventReporter', { var _jsonReporter; function _load_jsonReporter() { - return _jsonReporter = __webpack_require__(203); + return _jsonReporter = __webpack_require__(213); } Object.defineProperty(exports, 'JSONReporter', { @@ -46395,7 +46876,7 @@ Object.defineProperty(exports, 'JSONReporter', { var _noopReporter; function _load_noopReporter() { - return _noopReporter = __webpack_require__(537); + return _noopReporter = __webpack_require__(568); } Object.defineProperty(exports, 'NoopReporter', { @@ -46408,7 +46889,7 @@ Object.defineProperty(exports, 'NoopReporter', { var _baseReporter; function _load_baseReporter() { - return _baseReporter = __webpack_require__(101); + return _baseReporter = __webpack_require__(108); } Object.defineProperty(exports, 'Reporter', { @@ -46421,7 +46902,7 @@ Object.defineProperty(exports, 'Reporter', { function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } /***/ }), -/* 192 */ +/* 201 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -46439,11 +46920,11 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { de module.exports = cmdShim cmdShim.ifExists = cmdShimIfExists -const fs = __webpack_require__(731) +const fs = __webpack_require__(762) -const mkdir = __webpack_require__(730) +const mkdir = __webpack_require__(761) const path = __webpack_require__(0) -const isWindows = __webpack_require__(712) +const isWindows = __webpack_require__(743) const shebangExpr = /^#!\s*(?:\/usr\/bin\/env)?\s*([^ \t]+)(.*)$/ const DEFAULT_OPTIONS = { // Create PowerShell file by default if the option hasn't been specified @@ -46694,13 +47175,13 @@ function normalizePathEnvVar (nodePath) { /***/ }), -/* 193 */ +/* 202 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var resolve = __webpack_require__(194); +var resolve = __webpack_require__(203); module.exports = { Validation: errorSubclass(ValidationError), @@ -46735,17 +47216,17 @@ function errorSubclass(Subclass) { /***/ }), -/* 194 */ +/* 203 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var url = __webpack_require__(23) - , equal = __webpack_require__(195) - , util = __webpack_require__(99) - , SchemaObject = __webpack_require__(306) - , traverse = __webpack_require__(471); +var url = __webpack_require__(24) + , equal = __webpack_require__(204) + , util = __webpack_require__(106) + , SchemaObject = __webpack_require__(339) + , traverse = __webpack_require__(502); module.exports = resolve; @@ -47013,7 +47494,7 @@ function resolveIds(schema) { /***/ }), -/* 195 */ +/* 204 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -47075,7 +47556,7 @@ module.exports = function equal(a, b) { /***/ }), -/* 196 */ +/* 205 */ /***/ (function(module, exports) { // Copyright 2011 Mark Cavage All rights reserved. @@ -47094,7 +47575,7 @@ module.exports = { /***/ }), -/* 197 */ +/* 206 */ /***/ (function(module, exports) { // Copyright 2011 Mark Cavage All rights reserved. @@ -47136,7 +47617,7 @@ module.exports = { /***/ }), -/* 198 */ +/* 207 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -47244,31 +47725,31 @@ exports.hasWrapper = hasWrapper; var _add; function _load_add() { - return _add = __webpack_require__(156); + return _add = __webpack_require__(165); } var _lockfile; function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(18)); + return _lockfile = _interopRequireDefault(__webpack_require__(19)); } var _packageRequest; function _load_packageRequest() { - return _packageRequest = _interopRequireDefault(__webpack_require__(114)); + return _packageRequest = _interopRequireDefault(__webpack_require__(122)); } var _normalizePattern; function _load_normalizePattern() { - return _normalizePattern = __webpack_require__(36); + return _normalizePattern = __webpack_require__(37); } var _install; function _load_install() { - return _install = __webpack_require__(33); + return _install = __webpack_require__(34); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -47406,7 +47887,7 @@ function setFlags(commander) { commander.option('-P, --pattern [pattern]', 'upgrade packages that match pattern'); commander.option('-T, --tilde', 'install most recent release with the same minor version. Only used when --latest is specified.'); commander.option('-C, --caret', 'install most recent release with the same major version. Only used when --latest is specified.'); - commander.option('-A', '--audit', 'Run vulnerability audit on installed packages'); + commander.option('-A, --audit', 'Run vulnerability audit on installed packages'); } function hasWrapper(commander, args) { @@ -47416,7 +47897,7 @@ function hasWrapper(commander, args) { const requireLockfile = exports.requireLockfile = true; /***/ }), -/* 199 */ +/* 208 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -47430,7 +47911,7 @@ exports.integrityErrors = undefined; var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _asyncToGenerator2; @@ -47442,7 +47923,7 @@ function _load_asyncToGenerator() { var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _fs; @@ -47454,26 +47935,26 @@ function _load_fs() { var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } var _packageNameUtils; function _load_packageNameUtils() { - return _packageNameUtils = __webpack_require__(212); + return _packageNameUtils = __webpack_require__(222); } var _workspaceLayout; function _load_workspaceLayout() { - return _workspaceLayout = _interopRequireDefault(__webpack_require__(84)); + return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const invariant = __webpack_require__(8); +const invariant = __webpack_require__(9); const path = __webpack_require__(0); @@ -48038,7 +48519,275 @@ class InstallationIntegrityChecker { exports.default = InstallationIntegrityChecker; /***/ }), -/* 200 */ +/* 209 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.testEngine = testEngine; +exports.checkOne = checkOne; +exports.check = check; +exports.shouldCheck = shouldCheck; + +var _errors; + +function _load_errors() { + return _errors = __webpack_require__(5); +} + +var _map; + +function _load_map() { + return _map = _interopRequireDefault(__webpack_require__(29)); +} + +var _misc; + +function _load_misc() { + return _misc = __webpack_require__(18); +} + +var _yarnVersion; + +function _load_yarnVersion() { + return _yarnVersion = __webpack_require__(120); +} + +var _semver; + +function _load_semver() { + return _semver = __webpack_require__(224); +} + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const semver = __webpack_require__(21); + +const VERSIONS = Object.assign({}, process.versions, { + yarn: (_yarnVersion || _load_yarnVersion()).version +}); + +function isValid(items, actual) { + let isNotWhitelist = true; + let isBlacklist = false; + + for (var _iterator = items, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const item = _ref; + + // blacklist + if (item[0] === '!') { + isBlacklist = true; + + if (actual === item.slice(1)) { + return false; + } + // whitelist + } else { + isNotWhitelist = false; + + if (item === actual) { + return true; + } + } + } + + // npm allows blacklists and whitelists to be mixed. Blacklists with + // whitelisted items should be treated as whitelists. + return isBlacklist && isNotWhitelist; +} + +const aliases = (0, (_map || _load_map()).default)({ + iojs: 'node' // we should probably prompt these libraries to fix this +}); + +const ignore = ['npm', // we'll never satisfy this for obvious reasons +'teleport', // a module bundler used by some modules +'rhino', // once a target for older modules +'cordovaDependencies']; + +function testEngine(name, range, versions, looseSemver) { + const actual = versions[name]; + if (!actual) { + return false; + } + + if (!semver.valid(actual, looseSemver)) { + return false; + } + + if (semver.satisfies(actual, range, looseSemver)) { + return true; + } + + if (name === 'yarn' && (0, (_semver || _load_semver()).satisfiesWithPrereleases)(actual, range, looseSemver)) { + return true; + } + + if (name === 'node' && semver.gt(actual, '1.0.0', looseSemver)) { + // WARNING: this is a massive hack and is super gross but necessary for compatibility + // some modules have the `engines.node` field set to a caret version below semver major v1 + // eg. ^0.12.0. this is problematic as we enforce engines checks and node is now on version >=1 + // to allow this pattern we transform the node version to fake ones in the minor range 10-13 + const major = semver.major(actual, looseSemver); + const fakes = [`0.10.${major}`, `0.11.${major}`, `0.12.${major}`, `0.13.${major}`]; + for (var _iterator2 = fakes, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { + var _ref2; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref2 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref2 = _i2.value; + } + + const actualFake = _ref2; + + if (semver.satisfies(actualFake, range, looseSemver)) { + return true; + } + } + } + + // incompatible version + return false; +} + +function isValidArch(archs) { + return isValid(archs, process.arch); +} + +function isValidPlatform(platforms) { + return isValid(platforms, process.platform); +} + +function checkOne(info, config, ignoreEngines) { + let didIgnore = false; + let didError = false; + const reporter = config.reporter; + const human = `${info.name}@${info.version}`; + + const pushError = msg => { + const ref = info._reference; + + if (ref && ref.optional) { + ref.ignore = true; + ref.incompatible = true; + + reporter.info(`${human}: ${msg}`); + if (!didIgnore) { + reporter.info(reporter.lang('optionalCompatibilityExcluded', human)); + didIgnore = true; + } + } else { + reporter.error(`${human}: ${msg}`); + didError = true; + } + }; + + const os = info.os, + cpu = info.cpu, + engines = info.engines; + + + if (shouldCheckPlatform(os, config.ignorePlatform) && !isValidPlatform(os)) { + pushError(reporter.lang('incompatibleOS', process.platform)); + } + + if (shouldCheckCpu(cpu, config.ignorePlatform) && !isValidArch(cpu)) { + pushError(reporter.lang('incompatibleCPU', process.arch)); + } + + if (shouldCheckEngines(engines, ignoreEngines)) { + for (var _iterator3 = (0, (_misc || _load_misc()).entries)(info.engines), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { + var _ref3; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref3 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref3 = _i3.value; + } + + const entry = _ref3; + + let name = entry[0]; + const range = entry[1]; + + if (aliases[name]) { + name = aliases[name]; + } + + if (VERSIONS[name]) { + if (!testEngine(name, range, VERSIONS, config.looseSemver)) { + pushError(reporter.lang('incompatibleEngine', name, range, VERSIONS[name])); + } + } else if (ignore.indexOf(name) < 0) { + reporter.warn(`${human}: ${reporter.lang('invalidEngine', name)}`); + } + } + } + + if (didError) { + throw new (_errors || _load_errors()).MessageError(reporter.lang('foundIncompatible')); + } +} + +function check(infos, config, ignoreEngines) { + for (var _iterator4 = infos, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { + var _ref4; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref4 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref4 = _i4.value; + } + + const info = _ref4; + + checkOne(info, config, ignoreEngines); + } +} + +function shouldCheckCpu(cpu, ignorePlatform) { + return !ignorePlatform && Array.isArray(cpu) && cpu.length > 0; +} + +function shouldCheckPlatform(os, ignorePlatform) { + return !ignorePlatform && Array.isArray(os) && os.length > 0; +} + +function shouldCheckEngines(engines, ignoreEngines) { + return !ignoreEngines && typeof engines === 'object'; +} + +function shouldCheck(manifest, options) { + return shouldCheckCpu(manifest.cpu, options.ignorePlatform) || shouldCheckPlatform(manifest.os, options.ignorePlatform) || shouldCheckEngines(manifest.engines, options.ignoreEngines); +} + +/***/ }), +/* 210 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -48147,7 +48896,7 @@ function _load_errors() { var _index; function _load_index() { - return _index = _interopRequireWildcard(__webpack_require__(520)); + return _index = _interopRequireWildcard(__webpack_require__(551)); } var _fs; @@ -48159,7 +48908,7 @@ function _load_fs() { var _promise; function _load_promise() { - return _promise = _interopRequireWildcard(__webpack_require__(47)); + return _promise = _interopRequireWildcard(__webpack_require__(50)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -48244,7 +48993,7 @@ function fetch(pkgs, config) { } /***/ }), -/* 201 */ +/* 211 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -48285,31 +49034,31 @@ let linkBin = exports.linkBin = (() => { var _packageHoister; function _load_packageHoister() { - return _packageHoister = _interopRequireDefault(__webpack_require__(524)); + return _packageHoister = _interopRequireDefault(__webpack_require__(555)); } var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(9)); + return _constants = _interopRequireWildcard(__webpack_require__(8)); } var _promise; function _load_promise() { - return _promise = _interopRequireWildcard(__webpack_require__(47)); + return _promise = _interopRequireWildcard(__webpack_require__(50)); } var _normalizePattern2; function _load_normalizePattern() { - return _normalizePattern2 = __webpack_require__(36); + return _normalizePattern2 = __webpack_require__(37); } var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } var _fs; @@ -48321,30 +49070,30 @@ function _load_fs() { var _mutex; function _load_mutex() { - return _mutex = _interopRequireDefault(__webpack_require__(342)); + return _mutex = _interopRequireDefault(__webpack_require__(374)); } var _semver; function _load_semver() { - return _semver = __webpack_require__(214); + return _semver = __webpack_require__(224); } var _workspaceLayout; function _load_workspaceLayout() { - return _workspaceLayout = _interopRequireDefault(__webpack_require__(84)); + return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const invariant = __webpack_require__(8); +const invariant = __webpack_require__(9); -const cmdShim = __webpack_require__(192); +const cmdShim = __webpack_require__(201); const path = __webpack_require__(0); -const semver = __webpack_require__(20); +const semver = __webpack_require__(21); // Concurrency for creating bin links disabled because of the issue #1961 const linkBinConcurrency = 1; @@ -49384,7 +50133,7 @@ class PackageLinker { exports.default = PackageLinker; /***/ }), -/* 202 */ +/* 212 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -49401,14 +50150,14 @@ exports.clearNthLine = clearNthLine; var _tty; function _load_tty() { - return _tty = _interopRequireDefault(__webpack_require__(97)); + return _tty = _interopRequireDefault(__webpack_require__(104)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const readline = __webpack_require__(188); +const readline = __webpack_require__(197); -var _require = __webpack_require__(29); +var _require = __webpack_require__(30); const supportsColor = _require.supportsColor; @@ -49475,7 +50224,7 @@ function clearNthLine(stdout, n) { } /***/ }), -/* 203 */ +/* 213 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -49488,13 +50237,13 @@ Object.defineProperty(exports, "__esModule", { var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _baseReporter; function _load_baseReporter() { - return _baseReporter = _interopRequireDefault(__webpack_require__(101)); + return _baseReporter = _interopRequireDefault(__webpack_require__(108)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -49669,7 +50418,7 @@ class JSONReporter extends (_baseReporter || _load_baseReporter()).default { exports.default = JSONReporter; /***/ }), -/* 204 */ +/* 214 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -49683,43 +50432,43 @@ exports.shouldUpdateLockfile = undefined; var _semver; function _load_semver() { - return _semver = _interopRequireDefault(__webpack_require__(20)); + return _semver = _interopRequireDefault(__webpack_require__(21)); } var _minimatch; function _load_minimatch() { - return _minimatch = _interopRequireDefault(__webpack_require__(75)); + return _minimatch = _interopRequireDefault(__webpack_require__(82)); } var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } var _normalizePattern2; function _load_normalizePattern() { - return _normalizePattern2 = __webpack_require__(36); + return _normalizePattern2 = __webpack_require__(37); } var _parsePackagePath; function _load_parsePackagePath() { - return _parsePackagePath = _interopRequireDefault(__webpack_require__(343)); + return _parsePackagePath = _interopRequireDefault(__webpack_require__(375)); } var _parsePackagePath2; function _load_parsePackagePath2() { - return _parsePackagePath2 = __webpack_require__(343); + return _parsePackagePath2 = __webpack_require__(375); } var _resolvers; function _load_resolvers() { - return _resolvers = __webpack_require__(71); + return _resolvers = __webpack_require__(78); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -49817,7 +50566,7 @@ const shouldUpdateLockfile = exports.shouldUpdateLockfile = (lockfileEntry, reso }; /***/ }), -/* 205 */ +/* 215 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -49843,13 +50592,13 @@ function _load_path() { var _invariant; function _load_invariant() { - return _invariant = _interopRequireDefault(__webpack_require__(8)); + return _invariant = _interopRequireDefault(__webpack_require__(9)); } var _uuid; function _load_uuid() { - return _uuid = _interopRequireDefault(__webpack_require__(111)); + return _uuid = _interopRequireDefault(__webpack_require__(119)); } var _errors; @@ -49861,13 +50610,13 @@ function _load_errors() { var _exoticResolver; function _load_exoticResolver() { - return _exoticResolver = _interopRequireDefault(__webpack_require__(83)); + return _exoticResolver = _interopRequireDefault(__webpack_require__(89)); } var _misc; function _load_misc() { - return _misc = _interopRequireWildcard(__webpack_require__(17)); + return _misc = _interopRequireWildcard(__webpack_require__(18)); } var _fs; @@ -49955,7 +50704,7 @@ FileResolver.protocol = 'file'; FileResolver.prefixMatcher = /^\.{1,2}\//; /***/ }), -/* 206 */ +/* 216 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -49975,19 +50724,19 @@ function _load_errors() { var _gitResolver; function _load_gitResolver() { - return _gitResolver = _interopRequireDefault(__webpack_require__(116)); + return _gitResolver = _interopRequireDefault(__webpack_require__(124)); } var _exoticResolver; function _load_exoticResolver() { - return _exoticResolver = _interopRequireDefault(__webpack_require__(83)); + return _exoticResolver = _interopRequireDefault(__webpack_require__(89)); } var _misc; function _load_misc() { - return _misc = _interopRequireWildcard(__webpack_require__(17)); + return _misc = _interopRequireWildcard(__webpack_require__(18)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -50031,7 +50780,7 @@ exports.default = GistResolver; GistResolver.protocol = 'gist'; /***/ }), -/* 207 */ +/* 217 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -50050,7 +50799,7 @@ function _load_asyncToGenerator() { var _cache; function _load_cache() { - return _cache = __webpack_require__(322); + return _cache = __webpack_require__(355); } var _errors; @@ -50062,19 +50811,19 @@ function _load_errors() { var _registryResolver; function _load_registryResolver() { - return _registryResolver = _interopRequireDefault(__webpack_require__(543)); + return _registryResolver = _interopRequireDefault(__webpack_require__(574)); } var _npmRegistry; function _load_npmRegistry() { - return _npmRegistry = _interopRequireDefault(__webpack_require__(82)); + return _npmRegistry = _interopRequireDefault(__webpack_require__(88)); } var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } var _fs; @@ -50086,24 +50835,24 @@ function _load_fs() { var _constants; function _load_constants() { - return _constants = __webpack_require__(9); + return _constants = __webpack_require__(8); } var _packageNameUtils; function _load_packageNameUtils() { - return _packageNameUtils = __webpack_require__(212); + return _packageNameUtils = __webpack_require__(222); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const inquirer = __webpack_require__(265); -const tty = __webpack_require__(97); +const inquirer = __webpack_require__(276); +const tty = __webpack_require__(104); const path = __webpack_require__(0); -const semver = __webpack_require__(20); -const ssri = __webpack_require__(70); +const semver = __webpack_require__(21); +const ssri = __webpack_require__(77); const NPM_REGISTRY_ID = 'npm'; @@ -50320,7 +51069,7 @@ exports.default = NpmResolver; NpmResolver.registry = NPM_REGISTRY_ID; /***/ }), -/* 208 */ +/* 218 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -50406,7 +51155,7 @@ function _load_fs() { var _promise; function _load_promise() { - return _promise = __webpack_require__(47); + return _promise = __webpack_require__(50); } var _fs2; @@ -50429,7 +51178,7 @@ const futimes = (0, (_promise || _load_promise()).promisify)((_fs || _load_fs()) const write = (0, (_promise || _load_promise()).promisify)((_fs || _load_fs()).default.write); -const unlink = exports.unlink = (0, (_promise || _load_promise()).promisify)(__webpack_require__(274)); +const unlink = exports.unlink = (0, (_promise || _load_promise()).promisify)(__webpack_require__(307)); /** * Unlinks the destination to force a recreation. This is needed on case-insensitive file systems @@ -50518,7 +51267,7 @@ const copyWithBuffer = (() => { }; /***/ }), -/* 209 */ +/* 219 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -50537,37 +51286,37 @@ function _load_asyncToGenerator() { var _extends2; function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); + return _extends2 = _interopRequireDefault(__webpack_require__(22)); } var _invariant; function _load_invariant() { - return _invariant = _interopRequireDefault(__webpack_require__(8)); + return _invariant = _interopRequireDefault(__webpack_require__(9)); } var _string_decoder; function _load_string_decoder() { - return _string_decoder = __webpack_require__(300); + return _string_decoder = __webpack_require__(333); } var _tarFs; function _load_tarFs() { - return _tarFs = _interopRequireDefault(__webpack_require__(184)); + return _tarFs = _interopRequireDefault(__webpack_require__(193)); } var _tarStream; function _load_tarStream() { - return _tarStream = _interopRequireDefault(__webpack_require__(428)); + return _tarStream = _interopRequireDefault(__webpack_require__(459)); } var _url; function _load_url() { - return _url = _interopRequireDefault(__webpack_require__(23)); + return _url = _interopRequireDefault(__webpack_require__(24)); } var _fs; @@ -50585,19 +51334,19 @@ function _load_errors() { var _gitSpawn; function _load_gitSpawn() { - return _gitSpawn = __webpack_require__(341); + return _gitSpawn = __webpack_require__(373); } var _gitRefResolver; function _load_gitRefResolver() { - return _gitRefResolver = __webpack_require__(549); + return _gitRefResolver = __webpack_require__(580); } var _crypto; function _load_crypto() { - return _crypto = _interopRequireWildcard(__webpack_require__(159)); + return _crypto = _interopRequireWildcard(__webpack_require__(168)); } var _fs2; @@ -50609,13 +51358,13 @@ function _load_fs2() { var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(28)); + return _map = _interopRequireDefault(__webpack_require__(29)); } var _misc; function _load_misc() { - return _misc = __webpack_require__(17); + return _misc = __webpack_require__(18); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } @@ -51162,7 +51911,7 @@ class Git { exports.default = Git; /***/ }), -/* 210 */ +/* 220 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51181,19 +51930,19 @@ function _load_asyncToGenerator() { var _resolveRelative; function _load_resolveRelative() { - return _resolveRelative = _interopRequireDefault(__webpack_require__(555)); + return _resolveRelative = _interopRequireDefault(__webpack_require__(586)); } var _validate; function _load_validate() { - return _validate = _interopRequireDefault(__webpack_require__(118)); + return _validate = _interopRequireDefault(__webpack_require__(125)); } var _fix; function _load_fix() { - return _fix = _interopRequireDefault(__webpack_require__(552)); + return _fix = _interopRequireDefault(__webpack_require__(583)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -51249,7 +51998,7 @@ exports.default = (() => { })(); /***/ }), -/* 211 */ +/* 221 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51266,7 +52015,7 @@ exports.extractDescription = extractDescription; exports.extractRepositoryUrl = extractRepositoryUrl; -const validateLicense = __webpack_require__(928); +const validateLicense = __webpack_require__(959); function isValidLicense(license) { return !!license && validateLicense(license).validForNewPackages; @@ -51369,7 +52118,7 @@ function extractRepositoryUrl(repository) { } /***/ }), -/* 212 */ +/* 222 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51393,7 +52142,7 @@ function getSystemParams() { } /***/ }), -/* 213 */ +/* 223 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51421,7 +52170,7 @@ function isRootUser(uid) { } /***/ }), -/* 214 */ +/* 224 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51436,7 +52185,7 @@ exports.diffWithUnstable = diffWithUnstable; var _semver; function _load_semver() { - return _semver = _interopRequireDefault(__webpack_require__(20)); + return _semver = _interopRequireDefault(__webpack_require__(21)); } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } @@ -51554,7 +52303,7 @@ function diffWithUnstable(version1, version2) { } /***/ }), -/* 215 */ +/* 225 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51567,7 +52316,7 @@ exports.getDataDir = getDataDir; exports.getCacheDir = getCacheDir; exports.getConfigDir = getConfigDir; const path = __webpack_require__(0); -const userHome = __webpack_require__(60).default; +const userHome = __webpack_require__(66).default; const FALLBACK_CONFIG_DIR = path.join(userHome, '.config', 'yarn'); const FALLBACK_CACHE_DIR = path.join(userHome, '.cache', 'yarn'); @@ -51620,7 +52369,7 @@ function getLocalAppDataDir() { } /***/ }), -/* 216 */ +/* 226 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51640,13 +52389,13 @@ function explodeHashedUrl(url) { } /***/ }), -/* 217 */ +/* 227 */ /***/ (function(module, exports, __webpack_require__) { -module.exports = { "default": __webpack_require__(223), __esModule: true }; +module.exports = { "default": __webpack_require__(233), __esModule: true }; /***/ }), -/* 218 */ +/* 228 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51712,11 +52461,11 @@ function range(a, b, str) { /***/ }), -/* 219 */ +/* 229 */ /***/ (function(module, exports, __webpack_require__) { -var concatMap = __webpack_require__(222); -var balanced = __webpack_require__(218); +var concatMap = __webpack_require__(232); +var balanced = __webpack_require__(228); module.exports = expandTop; @@ -51919,7 +52668,7 @@ function expand(str, isTop) { /***/ }), -/* 220 */ +/* 230 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -51990,7 +52739,7 @@ module.exports = function (str) { /***/ }), -/* 221 */ +/* 231 */ /***/ (function(module, exports) { function Caseless (dict) { @@ -52063,7 +52812,7 @@ module.exports.httpify = function (resp, headers) { /***/ }), -/* 222 */ +/* 232 */ /***/ (function(module, exports) { module.exports = function (xs, fn) { @@ -52082,27 +52831,27 @@ var isArray = Array.isArray || function (xs) { /***/ }), -/* 223 */ +/* 233 */ /***/ (function(module, exports, __webpack_require__) { -__webpack_require__(249); -__webpack_require__(251); -__webpack_require__(254); -__webpack_require__(250); -__webpack_require__(252); -__webpack_require__(253); -module.exports = __webpack_require__(30).Promise; +__webpack_require__(259); +__webpack_require__(261); +__webpack_require__(264); +__webpack_require__(260); +__webpack_require__(262); +__webpack_require__(263); +module.exports = __webpack_require__(31).Promise; /***/ }), -/* 224 */ +/* 234 */ /***/ (function(module, exports) { module.exports = function () { /* empty */ }; /***/ }), -/* 225 */ +/* 235 */ /***/ (function(module, exports) { module.exports = function (it, Constructor, name, forbiddenField) { @@ -52113,14 +52862,14 @@ module.exports = function (it, Constructor, name, forbiddenField) { /***/ }), -/* 226 */ +/* 236 */ /***/ (function(module, exports, __webpack_require__) { // false -> Array#indexOf // true -> Array#includes -var toIObject = __webpack_require__(92); -var toLength = __webpack_require__(129); -var toAbsoluteIndex = __webpack_require__(244); +var toIObject = __webpack_require__(98); +var toLength = __webpack_require__(136); +var toAbsoluteIndex = __webpack_require__(254); module.exports = function (IS_INCLUDES) { return function ($this, el, fromIndex) { var O = toIObject($this); @@ -52142,15 +52891,15 @@ module.exports = function (IS_INCLUDES) { /***/ }), -/* 227 */ +/* 237 */ /***/ (function(module, exports, __webpack_require__) { -var ctx = __webpack_require__(63); -var call = __webpack_require__(231); -var isArrayIter = __webpack_require__(230); -var anObject = __webpack_require__(34); -var toLength = __webpack_require__(129); -var getIterFn = __webpack_require__(247); +var ctx = __webpack_require__(69); +var call = __webpack_require__(241); +var isArrayIter = __webpack_require__(240); +var anObject = __webpack_require__(35); +var toLength = __webpack_require__(136); +var getIterFn = __webpack_require__(257); var BREAK = {}; var RETURN = {}; var exports = module.exports = function (iterable, entries, fn, that, ITERATOR) { @@ -52173,16 +52922,16 @@ exports.RETURN = RETURN; /***/ }), -/* 228 */ +/* 238 */ /***/ (function(module, exports, __webpack_require__) { -module.exports = !__webpack_require__(48) && !__webpack_require__(104)(function () { - return Object.defineProperty(__webpack_require__(86)('div'), 'a', { get: function () { return 7; } }).a != 7; +module.exports = !__webpack_require__(51) && !__webpack_require__(112)(function () { + return Object.defineProperty(__webpack_require__(92)('div'), 'a', { get: function () { return 7; } }).a != 7; }); /***/ }), -/* 229 */ +/* 239 */ /***/ (function(module, exports) { // fast apply, http://jsperf.lnkit.com/fast-apply/5 @@ -52204,12 +52953,12 @@ module.exports = function (fn, args, that) { /***/ }), -/* 230 */ +/* 240 */ /***/ (function(module, exports, __webpack_require__) { // check on default Array iterator -var Iterators = __webpack_require__(50); -var ITERATOR = __webpack_require__(19)('iterator'); +var Iterators = __webpack_require__(53); +var ITERATOR = __webpack_require__(20)('iterator'); var ArrayProto = Array.prototype; module.exports = function (it) { @@ -52218,11 +52967,11 @@ module.exports = function (it) { /***/ }), -/* 231 */ +/* 241 */ /***/ (function(module, exports, __webpack_require__) { // call something on iterator step with safe closing on error -var anObject = __webpack_require__(34); +var anObject = __webpack_require__(35); module.exports = function (iterator, fn, value, entries) { try { return entries ? fn(anObject(value)[0], value[1]) : fn(value); @@ -52236,18 +52985,18 @@ module.exports = function (iterator, fn, value, entries) { /***/ }), -/* 232 */ +/* 242 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var create = __webpack_require__(236); -var descriptor = __webpack_require__(125); -var setToStringTag = __webpack_require__(89); +var create = __webpack_require__(246); +var descriptor = __webpack_require__(132); +var setToStringTag = __webpack_require__(95); var IteratorPrototype = {}; // 25.1.2.1.1 %IteratorPrototype%[@@iterator]() -__webpack_require__(41)(IteratorPrototype, __webpack_require__(19)('iterator'), function () { return this; }); +__webpack_require__(42)(IteratorPrototype, __webpack_require__(20)('iterator'), function () { return this; }); module.exports = function (Constructor, NAME, next) { Constructor.prototype = create(IteratorPrototype, { next: descriptor(1, next) }); @@ -52256,10 +53005,10 @@ module.exports = function (Constructor, NAME, next) { /***/ }), -/* 233 */ +/* 243 */ /***/ (function(module, exports, __webpack_require__) { -var ITERATOR = __webpack_require__(19)('iterator'); +var ITERATOR = __webpack_require__(20)('iterator'); var SAFE_CLOSING = false; try { @@ -52284,7 +53033,7 @@ module.exports = function (exec, skipClosing) { /***/ }), -/* 234 */ +/* 244 */ /***/ (function(module, exports) { module.exports = function (done, value) { @@ -52293,15 +53042,15 @@ module.exports = function (done, value) { /***/ }), -/* 235 */ +/* 245 */ /***/ (function(module, exports, __webpack_require__) { -var global = __webpack_require__(16); -var macrotask = __webpack_require__(128).set; +var global = __webpack_require__(17); +var macrotask = __webpack_require__(135).set; var Observer = global.MutationObserver || global.WebKitMutationObserver; var process = global.process; var Promise = global.Promise; -var isNode = __webpack_require__(62)(process) == 'process'; +var isNode = __webpack_require__(68)(process) == 'process'; module.exports = function () { var head, last, notify; @@ -52368,27 +53117,27 @@ module.exports = function () { /***/ }), -/* 236 */ +/* 246 */ /***/ (function(module, exports, __webpack_require__) { // 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties]) -var anObject = __webpack_require__(34); -var dPs = __webpack_require__(237); -var enumBugKeys = __webpack_require__(120); -var IE_PROTO = __webpack_require__(90)('IE_PROTO'); +var anObject = __webpack_require__(35); +var dPs = __webpack_require__(247); +var enumBugKeys = __webpack_require__(127); +var IE_PROTO = __webpack_require__(96)('IE_PROTO'); var Empty = function () { /* empty */ }; var PROTOTYPE = 'prototype'; // Create object with fake `null` prototype: use iframe Object with cleared prototype var createDict = function () { // Thrash, waste and sodomy: IE GC bug - var iframe = __webpack_require__(86)('iframe'); + var iframe = __webpack_require__(92)('iframe'); var i = enumBugKeys.length; var lt = '<'; var gt = '>'; var iframeDocument; iframe.style.display = 'none'; - __webpack_require__(121).appendChild(iframe); + __webpack_require__(128).appendChild(iframe); iframe.src = 'javascript:'; // eslint-disable-line no-script-url // createDict = iframe.contentWindow.Object; // html.removeChild(iframe); @@ -52415,14 +53164,14 @@ module.exports = Object.create || function create(O, Properties) { /***/ }), -/* 237 */ +/* 247 */ /***/ (function(module, exports, __webpack_require__) { -var dP = __webpack_require__(65); -var anObject = __webpack_require__(34); -var getKeys = __webpack_require__(162); +var dP = __webpack_require__(71); +var anObject = __webpack_require__(35); +var getKeys = __webpack_require__(171); -module.exports = __webpack_require__(48) ? Object.defineProperties : function defineProperties(O, Properties) { +module.exports = __webpack_require__(51) ? Object.defineProperties : function defineProperties(O, Properties) { anObject(O); var keys = getKeys(Properties); var length = keys.length; @@ -52434,13 +53183,13 @@ module.exports = __webpack_require__(48) ? Object.defineProperties : function de /***/ }), -/* 238 */ +/* 248 */ /***/ (function(module, exports, __webpack_require__) { // 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O) -var has = __webpack_require__(64); -var toObject = __webpack_require__(163); -var IE_PROTO = __webpack_require__(90)('IE_PROTO'); +var has = __webpack_require__(70); +var toObject = __webpack_require__(172); +var IE_PROTO = __webpack_require__(96)('IE_PROTO'); var ObjectProto = Object.prototype; module.exports = Object.getPrototypeOf || function (O) { @@ -52453,13 +53202,13 @@ module.exports = Object.getPrototypeOf || function (O) { /***/ }), -/* 239 */ +/* 249 */ /***/ (function(module, exports, __webpack_require__) { -var has = __webpack_require__(64); -var toIObject = __webpack_require__(92); -var arrayIndexOf = __webpack_require__(226)(false); -var IE_PROTO = __webpack_require__(90)('IE_PROTO'); +var has = __webpack_require__(70); +var toIObject = __webpack_require__(98); +var arrayIndexOf = __webpack_require__(236)(false); +var IE_PROTO = __webpack_require__(96)('IE_PROTO'); module.exports = function (object, names) { var O = toIObject(object); @@ -52476,10 +53225,10 @@ module.exports = function (object, names) { /***/ }), -/* 240 */ +/* 250 */ /***/ (function(module, exports, __webpack_require__) { -var hide = __webpack_require__(41); +var hide = __webpack_require__(42); module.exports = function (target, src, safe) { for (var key in src) { if (safe && target[key]) target[key] = src[key]; @@ -52489,23 +53238,23 @@ module.exports = function (target, src, safe) { /***/ }), -/* 241 */ +/* 251 */ /***/ (function(module, exports, __webpack_require__) { -module.exports = __webpack_require__(41); +module.exports = __webpack_require__(42); /***/ }), -/* 242 */ +/* 252 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var global = __webpack_require__(16); -var core = __webpack_require__(30); -var dP = __webpack_require__(65); -var DESCRIPTORS = __webpack_require__(48); -var SPECIES = __webpack_require__(19)('species'); +var global = __webpack_require__(17); +var core = __webpack_require__(31); +var dP = __webpack_require__(71); +var DESCRIPTORS = __webpack_require__(51); +var SPECIES = __webpack_require__(20)('species'); module.exports = function (KEY) { var C = typeof core[KEY] == 'function' ? core[KEY] : global[KEY]; @@ -52517,11 +53266,11 @@ module.exports = function (KEY) { /***/ }), -/* 243 */ +/* 253 */ /***/ (function(module, exports, __webpack_require__) { -var toInteger = __webpack_require__(91); -var defined = __webpack_require__(85); +var toInteger = __webpack_require__(97); +var defined = __webpack_require__(91); // true -> String#at // false -> String#codePointAt module.exports = function (TO_STRING) { @@ -52540,10 +53289,10 @@ module.exports = function (TO_STRING) { /***/ }), -/* 244 */ +/* 254 */ /***/ (function(module, exports, __webpack_require__) { -var toInteger = __webpack_require__(91); +var toInteger = __webpack_require__(97); var max = Math.max; var min = Math.min; module.exports = function (index, length) { @@ -52553,11 +53302,11 @@ module.exports = function (index, length) { /***/ }), -/* 245 */ +/* 255 */ /***/ (function(module, exports, __webpack_require__) { // 7.1.1 ToPrimitive(input [, PreferredType]) -var isObject = __webpack_require__(49); +var isObject = __webpack_require__(52); // instead of the ES6 spec version, we didn't implement @@toPrimitive case // and the second argument - flag - preferred type is a string module.exports = function (it, S) { @@ -52571,23 +53320,23 @@ module.exports = function (it, S) { /***/ }), -/* 246 */ +/* 256 */ /***/ (function(module, exports, __webpack_require__) { -var global = __webpack_require__(16); +var global = __webpack_require__(17); var navigator = global.navigator; module.exports = navigator && navigator.userAgent || ''; /***/ }), -/* 247 */ +/* 257 */ /***/ (function(module, exports, __webpack_require__) { -var classof = __webpack_require__(119); -var ITERATOR = __webpack_require__(19)('iterator'); -var Iterators = __webpack_require__(50); -module.exports = __webpack_require__(30).getIteratorMethod = function (it) { +var classof = __webpack_require__(126); +var ITERATOR = __webpack_require__(20)('iterator'); +var Iterators = __webpack_require__(53); +module.exports = __webpack_require__(31).getIteratorMethod = function (it) { if (it != undefined) return it[ITERATOR] || it['@@iterator'] || Iterators[classof(it)]; @@ -52595,21 +53344,21 @@ module.exports = __webpack_require__(30).getIteratorMethod = function (it) { /***/ }), -/* 248 */ +/* 258 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var addToUnscopables = __webpack_require__(224); -var step = __webpack_require__(234); -var Iterators = __webpack_require__(50); -var toIObject = __webpack_require__(92); +var addToUnscopables = __webpack_require__(234); +var step = __webpack_require__(244); +var Iterators = __webpack_require__(53); +var toIObject = __webpack_require__(98); // 22.1.3.4 Array.prototype.entries() // 22.1.3.13 Array.prototype.keys() // 22.1.3.29 Array.prototype.values() // 22.1.3.30 Array.prototype[@@iterator]() -module.exports = __webpack_require__(122)(Array, 'Array', function (iterated, kind) { +module.exports = __webpack_require__(129)(Array, 'Array', function (iterated, kind) { this._t = toIObject(iterated); // target this._i = 0; // next index this._k = kind; // kind @@ -52636,33 +53385,33 @@ addToUnscopables('entries'); /***/ }), -/* 249 */ +/* 259 */ /***/ (function(module, exports) { /***/ }), -/* 250 */ +/* 260 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var LIBRARY = __webpack_require__(87); -var global = __webpack_require__(16); -var ctx = __webpack_require__(63); -var classof = __webpack_require__(119); -var $export = __webpack_require__(55); -var isObject = __webpack_require__(49); -var aFunction = __webpack_require__(61); -var anInstance = __webpack_require__(225); -var forOf = __webpack_require__(227); -var speciesConstructor = __webpack_require__(127); -var task = __webpack_require__(128).set; -var microtask = __webpack_require__(235)(); -var newPromiseCapabilityModule = __webpack_require__(88); -var perform = __webpack_require__(123); -var userAgent = __webpack_require__(246); -var promiseResolve = __webpack_require__(124); +var LIBRARY = __webpack_require__(93); +var global = __webpack_require__(17); +var ctx = __webpack_require__(69); +var classof = __webpack_require__(126); +var $export = __webpack_require__(60); +var isObject = __webpack_require__(52); +var aFunction = __webpack_require__(67); +var anInstance = __webpack_require__(235); +var forOf = __webpack_require__(237); +var speciesConstructor = __webpack_require__(134); +var task = __webpack_require__(135).set; +var microtask = __webpack_require__(245)(); +var newPromiseCapabilityModule = __webpack_require__(94); +var perform = __webpack_require__(130); +var userAgent = __webpack_require__(256); +var promiseResolve = __webpack_require__(131); var PROMISE = 'Promise'; var TypeError = global.TypeError; var process = global.process; @@ -52678,7 +53427,7 @@ var USE_NATIVE = !!function () { try { // correct subclassing with @@species support var promise = $Promise.resolve(1); - var FakePromise = (promise.constructor = {})[__webpack_require__(19)('species')] = function (exec) { + var FakePromise = (promise.constructor = {})[__webpack_require__(20)('species')] = function (exec) { exec(empty, empty); }; // unhandled rejections tracking support, NodeJS Promise without it fails @@species test @@ -52837,7 +53586,7 @@ if (!USE_NATIVE) { this._h = 0; // <- rejection state, 0 - default, 1 - handled, 2 - unhandled this._n = false; // <- notify }; - Internal.prototype = __webpack_require__(240)($Promise.prototype, { + Internal.prototype = __webpack_require__(250)($Promise.prototype, { // 25.4.5.3 Promise.prototype.then(onFulfilled, onRejected) then: function then(onFulfilled, onRejected) { var reaction = newPromiseCapability(speciesConstructor(this, $Promise)); @@ -52868,9 +53617,9 @@ if (!USE_NATIVE) { } $export($export.G + $export.W + $export.F * !USE_NATIVE, { Promise: $Promise }); -__webpack_require__(89)($Promise, PROMISE); -__webpack_require__(242)(PROMISE); -Wrapper = __webpack_require__(30)[PROMISE]; +__webpack_require__(95)($Promise, PROMISE); +__webpack_require__(252)(PROMISE); +Wrapper = __webpack_require__(31)[PROMISE]; // statics $export($export.S + $export.F * !USE_NATIVE, PROMISE, { @@ -52888,7 +53637,7 @@ $export($export.S + $export.F * (LIBRARY || !USE_NATIVE), PROMISE, { return promiseResolve(LIBRARY && this === Wrapper ? $Promise : this, x); } }); -$export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(233)(function (iter) { +$export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(243)(function (iter) { $Promise.all(iter)['catch'](empty); })), PROMISE, { // 25.4.4.1 Promise.all(iterable) @@ -52935,15 +53684,15 @@ $export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(233)(functio /***/ }), -/* 251 */ +/* 261 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var $at = __webpack_require__(243)(true); +var $at = __webpack_require__(253)(true); // 21.1.3.27 String.prototype[@@iterator]() -__webpack_require__(122)(String, 'String', function (iterated) { +__webpack_require__(129)(String, 'String', function (iterated) { this._t = String(iterated); // target this._i = 0; // next index // 21.1.5.2.1 %StringIteratorPrototype%.next() @@ -52959,17 +53708,17 @@ __webpack_require__(122)(String, 'String', function (iterated) { /***/ }), -/* 252 */ +/* 262 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; // https://github.com/tc39/proposal-promise-finally -var $export = __webpack_require__(55); -var core = __webpack_require__(30); -var global = __webpack_require__(16); -var speciesConstructor = __webpack_require__(127); -var promiseResolve = __webpack_require__(124); +var $export = __webpack_require__(60); +var core = __webpack_require__(31); +var global = __webpack_require__(17); +var speciesConstructor = __webpack_require__(134); +var promiseResolve = __webpack_require__(131); $export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) { var C = speciesConstructor(this, core.Promise || global.Promise); @@ -52986,15 +53735,15 @@ $export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) { /***/ }), -/* 253 */ +/* 263 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; // https://github.com/tc39/proposal-promise-try -var $export = __webpack_require__(55); -var newPromiseCapability = __webpack_require__(88); -var perform = __webpack_require__(123); +var $export = __webpack_require__(60); +var newPromiseCapability = __webpack_require__(94); +var perform = __webpack_require__(130); $export($export.S, 'Promise', { 'try': function (callbackfn) { var promiseCapability = newPromiseCapability.f(this); @@ -53005,14 +53754,14 @@ $export($export.S, 'Promise', { 'try': function (callbackfn) { /***/ }), -/* 254 */ +/* 264 */ /***/ (function(module, exports, __webpack_require__) { -__webpack_require__(248); -var global = __webpack_require__(16); -var hide = __webpack_require__(41); -var Iterators = __webpack_require__(50); -var TO_STRING_TAG = __webpack_require__(19)('toStringTag'); +__webpack_require__(258); +var global = __webpack_require__(17); +var hide = __webpack_require__(42); +var Iterators = __webpack_require__(53); +var TO_STRING_TAG = __webpack_require__(20)('toStringTag'); var DOMIterables = ('CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,' + 'DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,' + @@ -53030,7 +53779,7 @@ for (var i = 0; i < DOMIterables.length; i++) { /***/ }), -/* 255 */ +/* 265 */ /***/ (function(module, exports, __webpack_require__) { /** @@ -53039,7 +53788,7 @@ for (var i = 0; i < DOMIterables.length; i++) { * Expose `debug()` as the module. */ -exports = module.exports = __webpack_require__(131); +exports = module.exports = __webpack_require__(138); exports.log = log; exports.formatArgs = formatArgs; exports.save = save; @@ -53231,7 +53980,7 @@ function localstorage() { /***/ }), -/* 256 */ +/* 266 */ /***/ (function(module, exports, __webpack_require__) { /** @@ -53240,21 +53989,21 @@ function localstorage() { */ if (typeof process === 'undefined' || process.type === 'renderer') { - module.exports = __webpack_require__(255); + module.exports = __webpack_require__(265); } else { - module.exports = __webpack_require__(257); + module.exports = __webpack_require__(267); } /***/ }), -/* 257 */ +/* 267 */ /***/ (function(module, exports, __webpack_require__) { /** * Module dependencies. */ -var tty = __webpack_require__(97); +var tty = __webpack_require__(104); var util = __webpack_require__(3); /** @@ -53263,7 +54012,7 @@ var util = __webpack_require__(3); * Expose `debug()` as the module. */ -exports = module.exports = __webpack_require__(131); +exports = module.exports = __webpack_require__(138); exports.init = init; exports.log = log; exports.formatArgs = formatArgs; @@ -53278,7 +54027,7 @@ exports.useColors = useColors; exports.colors = [ 6, 2, 3, 4, 5, 1 ]; try { - var supportsColor = __webpack_require__(297); + var supportsColor = __webpack_require__(330); if (supportsColor && supportsColor.level >= 2) { exports.colors = [ 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, @@ -53439,7 +54188,6721 @@ exports.enable(load()); /***/ }), -/* 258 */ +/* 268 */ +/***/ (function(module, exports, __webpack_require__) { + +(function webpackUniversalModuleDefinition(root, factory) { +/* istanbul ignore next */ + if(true) + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); +/* istanbul ignore next */ + else if(typeof exports === 'object') + exports["esprima"] = factory(); + else + root["esprima"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/* istanbul ignore if */ +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + /* + Copyright JS Foundation and other contributors, https://js.foundation/ + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + Object.defineProperty(exports, "__esModule", { value: true }); + var comment_handler_1 = __webpack_require__(1); + var jsx_parser_1 = __webpack_require__(3); + var parser_1 = __webpack_require__(8); + var tokenizer_1 = __webpack_require__(15); + function parse(code, options, delegate) { + var commentHandler = null; + var proxyDelegate = function (node, metadata) { + if (delegate) { + delegate(node, metadata); + } + if (commentHandler) { + commentHandler.visit(node, metadata); + } + }; + var parserDelegate = (typeof delegate === 'function') ? proxyDelegate : null; + var collectComment = false; + if (options) { + collectComment = (typeof options.comment === 'boolean' && options.comment); + var attachComment = (typeof options.attachComment === 'boolean' && options.attachComment); + if (collectComment || attachComment) { + commentHandler = new comment_handler_1.CommentHandler(); + commentHandler.attach = attachComment; + options.comment = true; + parserDelegate = proxyDelegate; + } + } + var isModule = false; + if (options && typeof options.sourceType === 'string') { + isModule = (options.sourceType === 'module'); + } + var parser; + if (options && typeof options.jsx === 'boolean' && options.jsx) { + parser = new jsx_parser_1.JSXParser(code, options, parserDelegate); + } + else { + parser = new parser_1.Parser(code, options, parserDelegate); + } + var program = isModule ? parser.parseModule() : parser.parseScript(); + var ast = program; + if (collectComment && commentHandler) { + ast.comments = commentHandler.comments; + } + if (parser.config.tokens) { + ast.tokens = parser.tokens; + } + if (parser.config.tolerant) { + ast.errors = parser.errorHandler.errors; + } + return ast; + } + exports.parse = parse; + function parseModule(code, options, delegate) { + var parsingOptions = options || {}; + parsingOptions.sourceType = 'module'; + return parse(code, parsingOptions, delegate); + } + exports.parseModule = parseModule; + function parseScript(code, options, delegate) { + var parsingOptions = options || {}; + parsingOptions.sourceType = 'script'; + return parse(code, parsingOptions, delegate); + } + exports.parseScript = parseScript; + function tokenize(code, options, delegate) { + var tokenizer = new tokenizer_1.Tokenizer(code, options); + var tokens; + tokens = []; + try { + while (true) { + var token = tokenizer.getNextToken(); + if (!token) { + break; + } + if (delegate) { + token = delegate(token); + } + tokens.push(token); + } + } + catch (e) { + tokenizer.errorHandler.tolerate(e); + } + if (tokenizer.errorHandler.tolerant) { + tokens.errors = tokenizer.errors(); + } + return tokens; + } + exports.tokenize = tokenize; + var syntax_1 = __webpack_require__(2); + exports.Syntax = syntax_1.Syntax; + // Sync with *.json manifests. + exports.version = '4.0.1'; + + +/***/ }, +/* 1 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + var syntax_1 = __webpack_require__(2); + var CommentHandler = (function () { + function CommentHandler() { + this.attach = false; + this.comments = []; + this.stack = []; + this.leading = []; + this.trailing = []; + } + CommentHandler.prototype.insertInnerComments = function (node, metadata) { + // innnerComments for properties empty block + // `function a() {/** comments **\/}` + if (node.type === syntax_1.Syntax.BlockStatement && node.body.length === 0) { + var innerComments = []; + for (var i = this.leading.length - 1; i >= 0; --i) { + var entry = this.leading[i]; + if (metadata.end.offset >= entry.start) { + innerComments.unshift(entry.comment); + this.leading.splice(i, 1); + this.trailing.splice(i, 1); + } + } + if (innerComments.length) { + node.innerComments = innerComments; + } + } + }; + CommentHandler.prototype.findTrailingComments = function (metadata) { + var trailingComments = []; + if (this.trailing.length > 0) { + for (var i = this.trailing.length - 1; i >= 0; --i) { + var entry_1 = this.trailing[i]; + if (entry_1.start >= metadata.end.offset) { + trailingComments.unshift(entry_1.comment); + } + } + this.trailing.length = 0; + return trailingComments; + } + var entry = this.stack[this.stack.length - 1]; + if (entry && entry.node.trailingComments) { + var firstComment = entry.node.trailingComments[0]; + if (firstComment && firstComment.range[0] >= metadata.end.offset) { + trailingComments = entry.node.trailingComments; + delete entry.node.trailingComments; + } + } + return trailingComments; + }; + CommentHandler.prototype.findLeadingComments = function (metadata) { + var leadingComments = []; + var target; + while (this.stack.length > 0) { + var entry = this.stack[this.stack.length - 1]; + if (entry && entry.start >= metadata.start.offset) { + target = entry.node; + this.stack.pop(); + } + else { + break; + } + } + if (target) { + var count = target.leadingComments ? target.leadingComments.length : 0; + for (var i = count - 1; i >= 0; --i) { + var comment = target.leadingComments[i]; + if (comment.range[1] <= metadata.start.offset) { + leadingComments.unshift(comment); + target.leadingComments.splice(i, 1); + } + } + if (target.leadingComments && target.leadingComments.length === 0) { + delete target.leadingComments; + } + return leadingComments; + } + for (var i = this.leading.length - 1; i >= 0; --i) { + var entry = this.leading[i]; + if (entry.start <= metadata.start.offset) { + leadingComments.unshift(entry.comment); + this.leading.splice(i, 1); + } + } + return leadingComments; + }; + CommentHandler.prototype.visitNode = function (node, metadata) { + if (node.type === syntax_1.Syntax.Program && node.body.length > 0) { + return; + } + this.insertInnerComments(node, metadata); + var trailingComments = this.findTrailingComments(metadata); + var leadingComments = this.findLeadingComments(metadata); + if (leadingComments.length > 0) { + node.leadingComments = leadingComments; + } + if (trailingComments.length > 0) { + node.trailingComments = trailingComments; + } + this.stack.push({ + node: node, + start: metadata.start.offset + }); + }; + CommentHandler.prototype.visitComment = function (node, metadata) { + var type = (node.type[0] === 'L') ? 'Line' : 'Block'; + var comment = { + type: type, + value: node.value + }; + if (node.range) { + comment.range = node.range; + } + if (node.loc) { + comment.loc = node.loc; + } + this.comments.push(comment); + if (this.attach) { + var entry = { + comment: { + type: type, + value: node.value, + range: [metadata.start.offset, metadata.end.offset] + }, + start: metadata.start.offset + }; + if (node.loc) { + entry.comment.loc = node.loc; + } + node.type = type; + this.leading.push(entry); + this.trailing.push(entry); + } + }; + CommentHandler.prototype.visit = function (node, metadata) { + if (node.type === 'LineComment') { + this.visitComment(node, metadata); + } + else if (node.type === 'BlockComment') { + this.visitComment(node, metadata); + } + else if (this.attach) { + this.visitNode(node, metadata); + } + }; + return CommentHandler; + }()); + exports.CommentHandler = CommentHandler; + + +/***/ }, +/* 2 */ +/***/ function(module, exports) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + exports.Syntax = { + AssignmentExpression: 'AssignmentExpression', + AssignmentPattern: 'AssignmentPattern', + ArrayExpression: 'ArrayExpression', + ArrayPattern: 'ArrayPattern', + ArrowFunctionExpression: 'ArrowFunctionExpression', + AwaitExpression: 'AwaitExpression', + BlockStatement: 'BlockStatement', + BinaryExpression: 'BinaryExpression', + BreakStatement: 'BreakStatement', + CallExpression: 'CallExpression', + CatchClause: 'CatchClause', + ClassBody: 'ClassBody', + ClassDeclaration: 'ClassDeclaration', + ClassExpression: 'ClassExpression', + ConditionalExpression: 'ConditionalExpression', + ContinueStatement: 'ContinueStatement', + DoWhileStatement: 'DoWhileStatement', + DebuggerStatement: 'DebuggerStatement', + EmptyStatement: 'EmptyStatement', + ExportAllDeclaration: 'ExportAllDeclaration', + ExportDefaultDeclaration: 'ExportDefaultDeclaration', + ExportNamedDeclaration: 'ExportNamedDeclaration', + ExportSpecifier: 'ExportSpecifier', + ExpressionStatement: 'ExpressionStatement', + ForStatement: 'ForStatement', + ForOfStatement: 'ForOfStatement', + ForInStatement: 'ForInStatement', + FunctionDeclaration: 'FunctionDeclaration', + FunctionExpression: 'FunctionExpression', + Identifier: 'Identifier', + IfStatement: 'IfStatement', + ImportDeclaration: 'ImportDeclaration', + ImportDefaultSpecifier: 'ImportDefaultSpecifier', + ImportNamespaceSpecifier: 'ImportNamespaceSpecifier', + ImportSpecifier: 'ImportSpecifier', + Literal: 'Literal', + LabeledStatement: 'LabeledStatement', + LogicalExpression: 'LogicalExpression', + MemberExpression: 'MemberExpression', + MetaProperty: 'MetaProperty', + MethodDefinition: 'MethodDefinition', + NewExpression: 'NewExpression', + ObjectExpression: 'ObjectExpression', + ObjectPattern: 'ObjectPattern', + Program: 'Program', + Property: 'Property', + RestElement: 'RestElement', + ReturnStatement: 'ReturnStatement', + SequenceExpression: 'SequenceExpression', + SpreadElement: 'SpreadElement', + Super: 'Super', + SwitchCase: 'SwitchCase', + SwitchStatement: 'SwitchStatement', + TaggedTemplateExpression: 'TaggedTemplateExpression', + TemplateElement: 'TemplateElement', + TemplateLiteral: 'TemplateLiteral', + ThisExpression: 'ThisExpression', + ThrowStatement: 'ThrowStatement', + TryStatement: 'TryStatement', + UnaryExpression: 'UnaryExpression', + UpdateExpression: 'UpdateExpression', + VariableDeclaration: 'VariableDeclaration', + VariableDeclarator: 'VariableDeclarator', + WhileStatement: 'WhileStatement', + WithStatement: 'WithStatement', + YieldExpression: 'YieldExpression' + }; + + +/***/ }, +/* 3 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; +/* istanbul ignore next */ + var __extends = (this && this.__extends) || (function () { + var extendStatics = Object.setPrototypeOf || + ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || + function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; }; + return function (d, b) { + extendStatics(d, b); + function __() { this.constructor = d; } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); + }; + })(); + Object.defineProperty(exports, "__esModule", { value: true }); + var character_1 = __webpack_require__(4); + var JSXNode = __webpack_require__(5); + var jsx_syntax_1 = __webpack_require__(6); + var Node = __webpack_require__(7); + var parser_1 = __webpack_require__(8); + var token_1 = __webpack_require__(13); + var xhtml_entities_1 = __webpack_require__(14); + token_1.TokenName[100 /* Identifier */] = 'JSXIdentifier'; + token_1.TokenName[101 /* Text */] = 'JSXText'; + // Fully qualified element name, e.g. returns "svg:path" + function getQualifiedElementName(elementName) { + var qualifiedName; + switch (elementName.type) { + case jsx_syntax_1.JSXSyntax.JSXIdentifier: + var id = elementName; + qualifiedName = id.name; + break; + case jsx_syntax_1.JSXSyntax.JSXNamespacedName: + var ns = elementName; + qualifiedName = getQualifiedElementName(ns.namespace) + ':' + + getQualifiedElementName(ns.name); + break; + case jsx_syntax_1.JSXSyntax.JSXMemberExpression: + var expr = elementName; + qualifiedName = getQualifiedElementName(expr.object) + '.' + + getQualifiedElementName(expr.property); + break; + /* istanbul ignore next */ + default: + break; + } + return qualifiedName; + } + var JSXParser = (function (_super) { + __extends(JSXParser, _super); + function JSXParser(code, options, delegate) { + return _super.call(this, code, options, delegate) || this; + } + JSXParser.prototype.parsePrimaryExpression = function () { + return this.match('<') ? this.parseJSXRoot() : _super.prototype.parsePrimaryExpression.call(this); + }; + JSXParser.prototype.startJSX = function () { + // Unwind the scanner before the lookahead token. + this.scanner.index = this.startMarker.index; + this.scanner.lineNumber = this.startMarker.line; + this.scanner.lineStart = this.startMarker.index - this.startMarker.column; + }; + JSXParser.prototype.finishJSX = function () { + // Prime the next lookahead. + this.nextToken(); + }; + JSXParser.prototype.reenterJSX = function () { + this.startJSX(); + this.expectJSX('}'); + // Pop the closing '}' added from the lookahead. + if (this.config.tokens) { + this.tokens.pop(); + } + }; + JSXParser.prototype.createJSXNode = function () { + this.collectComments(); + return { + index: this.scanner.index, + line: this.scanner.lineNumber, + column: this.scanner.index - this.scanner.lineStart + }; + }; + JSXParser.prototype.createJSXChildNode = function () { + return { + index: this.scanner.index, + line: this.scanner.lineNumber, + column: this.scanner.index - this.scanner.lineStart + }; + }; + JSXParser.prototype.scanXHTMLEntity = function (quote) { + var result = '&'; + var valid = true; + var terminated = false; + var numeric = false; + var hex = false; + while (!this.scanner.eof() && valid && !terminated) { + var ch = this.scanner.source[this.scanner.index]; + if (ch === quote) { + break; + } + terminated = (ch === ';'); + result += ch; + ++this.scanner.index; + if (!terminated) { + switch (result.length) { + case 2: + // e.g. '{' + numeric = (ch === '#'); + break; + case 3: + if (numeric) { + // e.g. 'A' + hex = (ch === 'x'); + valid = hex || character_1.Character.isDecimalDigit(ch.charCodeAt(0)); + numeric = numeric && !hex; + } + break; + default: + valid = valid && !(numeric && !character_1.Character.isDecimalDigit(ch.charCodeAt(0))); + valid = valid && !(hex && !character_1.Character.isHexDigit(ch.charCodeAt(0))); + break; + } + } + } + if (valid && terminated && result.length > 2) { + // e.g. 'A' becomes just '#x41' + var str = result.substr(1, result.length - 2); + if (numeric && str.length > 1) { + result = String.fromCharCode(parseInt(str.substr(1), 10)); + } + else if (hex && str.length > 2) { + result = String.fromCharCode(parseInt('0' + str.substr(1), 16)); + } + else if (!numeric && !hex && xhtml_entities_1.XHTMLEntities[str]) { + result = xhtml_entities_1.XHTMLEntities[str]; + } + } + return result; + }; + // Scan the next JSX token. This replaces Scanner#lex when in JSX mode. + JSXParser.prototype.lexJSX = function () { + var cp = this.scanner.source.charCodeAt(this.scanner.index); + // < > / : = { } + if (cp === 60 || cp === 62 || cp === 47 || cp === 58 || cp === 61 || cp === 123 || cp === 125) { + var value = this.scanner.source[this.scanner.index++]; + return { + type: 7 /* Punctuator */, + value: value, + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: this.scanner.index - 1, + end: this.scanner.index + }; + } + // " ' + if (cp === 34 || cp === 39) { + var start = this.scanner.index; + var quote = this.scanner.source[this.scanner.index++]; + var str = ''; + while (!this.scanner.eof()) { + var ch = this.scanner.source[this.scanner.index++]; + if (ch === quote) { + break; + } + else if (ch === '&') { + str += this.scanXHTMLEntity(quote); + } + else { + str += ch; + } + } + return { + type: 8 /* StringLiteral */, + value: str, + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: start, + end: this.scanner.index + }; + } + // ... or . + if (cp === 46) { + var n1 = this.scanner.source.charCodeAt(this.scanner.index + 1); + var n2 = this.scanner.source.charCodeAt(this.scanner.index + 2); + var value = (n1 === 46 && n2 === 46) ? '...' : '.'; + var start = this.scanner.index; + this.scanner.index += value.length; + return { + type: 7 /* Punctuator */, + value: value, + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: start, + end: this.scanner.index + }; + } + // ` + if (cp === 96) { + // Only placeholder, since it will be rescanned as a real assignment expression. + return { + type: 10 /* Template */, + value: '', + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: this.scanner.index, + end: this.scanner.index + }; + } + // Identifer can not contain backslash (char code 92). + if (character_1.Character.isIdentifierStart(cp) && (cp !== 92)) { + var start = this.scanner.index; + ++this.scanner.index; + while (!this.scanner.eof()) { + var ch = this.scanner.source.charCodeAt(this.scanner.index); + if (character_1.Character.isIdentifierPart(ch) && (ch !== 92)) { + ++this.scanner.index; + } + else if (ch === 45) { + // Hyphen (char code 45) can be part of an identifier. + ++this.scanner.index; + } + else { + break; + } + } + var id = this.scanner.source.slice(start, this.scanner.index); + return { + type: 100 /* Identifier */, + value: id, + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: start, + end: this.scanner.index + }; + } + return this.scanner.lex(); + }; + JSXParser.prototype.nextJSXToken = function () { + this.collectComments(); + this.startMarker.index = this.scanner.index; + this.startMarker.line = this.scanner.lineNumber; + this.startMarker.column = this.scanner.index - this.scanner.lineStart; + var token = this.lexJSX(); + this.lastMarker.index = this.scanner.index; + this.lastMarker.line = this.scanner.lineNumber; + this.lastMarker.column = this.scanner.index - this.scanner.lineStart; + if (this.config.tokens) { + this.tokens.push(this.convertToken(token)); + } + return token; + }; + JSXParser.prototype.nextJSXText = function () { + this.startMarker.index = this.scanner.index; + this.startMarker.line = this.scanner.lineNumber; + this.startMarker.column = this.scanner.index - this.scanner.lineStart; + var start = this.scanner.index; + var text = ''; + while (!this.scanner.eof()) { + var ch = this.scanner.source[this.scanner.index]; + if (ch === '{' || ch === '<') { + break; + } + ++this.scanner.index; + text += ch; + if (character_1.Character.isLineTerminator(ch.charCodeAt(0))) { + ++this.scanner.lineNumber; + if (ch === '\r' && this.scanner.source[this.scanner.index] === '\n') { + ++this.scanner.index; + } + this.scanner.lineStart = this.scanner.index; + } + } + this.lastMarker.index = this.scanner.index; + this.lastMarker.line = this.scanner.lineNumber; + this.lastMarker.column = this.scanner.index - this.scanner.lineStart; + var token = { + type: 101 /* Text */, + value: text, + lineNumber: this.scanner.lineNumber, + lineStart: this.scanner.lineStart, + start: start, + end: this.scanner.index + }; + if ((text.length > 0) && this.config.tokens) { + this.tokens.push(this.convertToken(token)); + } + return token; + }; + JSXParser.prototype.peekJSXToken = function () { + var state = this.scanner.saveState(); + this.scanner.scanComments(); + var next = this.lexJSX(); + this.scanner.restoreState(state); + return next; + }; + // Expect the next JSX token to match the specified punctuator. + // If not, an exception will be thrown. + JSXParser.prototype.expectJSX = function (value) { + var token = this.nextJSXToken(); + if (token.type !== 7 /* Punctuator */ || token.value !== value) { + this.throwUnexpectedToken(token); + } + }; + // Return true if the next JSX token matches the specified punctuator. + JSXParser.prototype.matchJSX = function (value) { + var next = this.peekJSXToken(); + return next.type === 7 /* Punctuator */ && next.value === value; + }; + JSXParser.prototype.parseJSXIdentifier = function () { + var node = this.createJSXNode(); + var token = this.nextJSXToken(); + if (token.type !== 100 /* Identifier */) { + this.throwUnexpectedToken(token); + } + return this.finalize(node, new JSXNode.JSXIdentifier(token.value)); + }; + JSXParser.prototype.parseJSXElementName = function () { + var node = this.createJSXNode(); + var elementName = this.parseJSXIdentifier(); + if (this.matchJSX(':')) { + var namespace = elementName; + this.expectJSX(':'); + var name_1 = this.parseJSXIdentifier(); + elementName = this.finalize(node, new JSXNode.JSXNamespacedName(namespace, name_1)); + } + else if (this.matchJSX('.')) { + while (this.matchJSX('.')) { + var object = elementName; + this.expectJSX('.'); + var property = this.parseJSXIdentifier(); + elementName = this.finalize(node, new JSXNode.JSXMemberExpression(object, property)); + } + } + return elementName; + }; + JSXParser.prototype.parseJSXAttributeName = function () { + var node = this.createJSXNode(); + var attributeName; + var identifier = this.parseJSXIdentifier(); + if (this.matchJSX(':')) { + var namespace = identifier; + this.expectJSX(':'); + var name_2 = this.parseJSXIdentifier(); + attributeName = this.finalize(node, new JSXNode.JSXNamespacedName(namespace, name_2)); + } + else { + attributeName = identifier; + } + return attributeName; + }; + JSXParser.prototype.parseJSXStringLiteralAttribute = function () { + var node = this.createJSXNode(); + var token = this.nextJSXToken(); + if (token.type !== 8 /* StringLiteral */) { + this.throwUnexpectedToken(token); + } + var raw = this.getTokenRaw(token); + return this.finalize(node, new Node.Literal(token.value, raw)); + }; + JSXParser.prototype.parseJSXExpressionAttribute = function () { + var node = this.createJSXNode(); + this.expectJSX('{'); + this.finishJSX(); + if (this.match('}')) { + this.tolerateError('JSX attributes must only be assigned a non-empty expression'); + } + var expression = this.parseAssignmentExpression(); + this.reenterJSX(); + return this.finalize(node, new JSXNode.JSXExpressionContainer(expression)); + }; + JSXParser.prototype.parseJSXAttributeValue = function () { + return this.matchJSX('{') ? this.parseJSXExpressionAttribute() : + this.matchJSX('<') ? this.parseJSXElement() : this.parseJSXStringLiteralAttribute(); + }; + JSXParser.prototype.parseJSXNameValueAttribute = function () { + var node = this.createJSXNode(); + var name = this.parseJSXAttributeName(); + var value = null; + if (this.matchJSX('=')) { + this.expectJSX('='); + value = this.parseJSXAttributeValue(); + } + return this.finalize(node, new JSXNode.JSXAttribute(name, value)); + }; + JSXParser.prototype.parseJSXSpreadAttribute = function () { + var node = this.createJSXNode(); + this.expectJSX('{'); + this.expectJSX('...'); + this.finishJSX(); + var argument = this.parseAssignmentExpression(); + this.reenterJSX(); + return this.finalize(node, new JSXNode.JSXSpreadAttribute(argument)); + }; + JSXParser.prototype.parseJSXAttributes = function () { + var attributes = []; + while (!this.matchJSX('/') && !this.matchJSX('>')) { + var attribute = this.matchJSX('{') ? this.parseJSXSpreadAttribute() : + this.parseJSXNameValueAttribute(); + attributes.push(attribute); + } + return attributes; + }; + JSXParser.prototype.parseJSXOpeningElement = function () { + var node = this.createJSXNode(); + this.expectJSX('<'); + var name = this.parseJSXElementName(); + var attributes = this.parseJSXAttributes(); + var selfClosing = this.matchJSX('/'); + if (selfClosing) { + this.expectJSX('/'); + } + this.expectJSX('>'); + return this.finalize(node, new JSXNode.JSXOpeningElement(name, selfClosing, attributes)); + }; + JSXParser.prototype.parseJSXBoundaryElement = function () { + var node = this.createJSXNode(); + this.expectJSX('<'); + if (this.matchJSX('/')) { + this.expectJSX('/'); + var name_3 = this.parseJSXElementName(); + this.expectJSX('>'); + return this.finalize(node, new JSXNode.JSXClosingElement(name_3)); + } + var name = this.parseJSXElementName(); + var attributes = this.parseJSXAttributes(); + var selfClosing = this.matchJSX('/'); + if (selfClosing) { + this.expectJSX('/'); + } + this.expectJSX('>'); + return this.finalize(node, new JSXNode.JSXOpeningElement(name, selfClosing, attributes)); + }; + JSXParser.prototype.parseJSXEmptyExpression = function () { + var node = this.createJSXChildNode(); + this.collectComments(); + this.lastMarker.index = this.scanner.index; + this.lastMarker.line = this.scanner.lineNumber; + this.lastMarker.column = this.scanner.index - this.scanner.lineStart; + return this.finalize(node, new JSXNode.JSXEmptyExpression()); + }; + JSXParser.prototype.parseJSXExpressionContainer = function () { + var node = this.createJSXNode(); + this.expectJSX('{'); + var expression; + if (this.matchJSX('}')) { + expression = this.parseJSXEmptyExpression(); + this.expectJSX('}'); + } + else { + this.finishJSX(); + expression = this.parseAssignmentExpression(); + this.reenterJSX(); + } + return this.finalize(node, new JSXNode.JSXExpressionContainer(expression)); + }; + JSXParser.prototype.parseJSXChildren = function () { + var children = []; + while (!this.scanner.eof()) { + var node = this.createJSXChildNode(); + var token = this.nextJSXText(); + if (token.start < token.end) { + var raw = this.getTokenRaw(token); + var child = this.finalize(node, new JSXNode.JSXText(token.value, raw)); + children.push(child); + } + if (this.scanner.source[this.scanner.index] === '{') { + var container = this.parseJSXExpressionContainer(); + children.push(container); + } + else { + break; + } + } + return children; + }; + JSXParser.prototype.parseComplexJSXElement = function (el) { + var stack = []; + while (!this.scanner.eof()) { + el.children = el.children.concat(this.parseJSXChildren()); + var node = this.createJSXChildNode(); + var element = this.parseJSXBoundaryElement(); + if (element.type === jsx_syntax_1.JSXSyntax.JSXOpeningElement) { + var opening = element; + if (opening.selfClosing) { + var child = this.finalize(node, new JSXNode.JSXElement(opening, [], null)); + el.children.push(child); + } + else { + stack.push(el); + el = { node: node, opening: opening, closing: null, children: [] }; + } + } + if (element.type === jsx_syntax_1.JSXSyntax.JSXClosingElement) { + el.closing = element; + var open_1 = getQualifiedElementName(el.opening.name); + var close_1 = getQualifiedElementName(el.closing.name); + if (open_1 !== close_1) { + this.tolerateError('Expected corresponding JSX closing tag for %0', open_1); + } + if (stack.length > 0) { + var child = this.finalize(el.node, new JSXNode.JSXElement(el.opening, el.children, el.closing)); + el = stack[stack.length - 1]; + el.children.push(child); + stack.pop(); + } + else { + break; + } + } + } + return el; + }; + JSXParser.prototype.parseJSXElement = function () { + var node = this.createJSXNode(); + var opening = this.parseJSXOpeningElement(); + var children = []; + var closing = null; + if (!opening.selfClosing) { + var el = this.parseComplexJSXElement({ node: node, opening: opening, closing: closing, children: children }); + children = el.children; + closing = el.closing; + } + return this.finalize(node, new JSXNode.JSXElement(opening, children, closing)); + }; + JSXParser.prototype.parseJSXRoot = function () { + // Pop the opening '<' added from the lookahead. + if (this.config.tokens) { + this.tokens.pop(); + } + this.startJSX(); + var element = this.parseJSXElement(); + this.finishJSX(); + return element; + }; + JSXParser.prototype.isStartOfExpression = function () { + return _super.prototype.isStartOfExpression.call(this) || this.match('<'); + }; + return JSXParser; + }(parser_1.Parser)); + exports.JSXParser = JSXParser; + + +/***/ }, +/* 4 */ +/***/ function(module, exports) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + // See also tools/generate-unicode-regex.js. + var Regex = { + // Unicode v8.0.0 NonAsciiIdentifierStart: + NonAsciiIdentifierStart: /[\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0561-\u0587\u05D0-\u05EA\u05F0-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u08A0-\u08B4\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C60\u0C61\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D05-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E87\u0E88\u0E8A\u0E8D\u0E94-\u0E97\u0E99-\u0E9F\u0EA1-\u0EA3\u0EA5\u0EA7\u0EAA\u0EAB\u0EAD-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16EE-\u16F8\u1700-\u170C\u170E-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1877\u1880-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4B\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1CE9-\u1CEC\u1CEE-\u1CF1\u1CF5\u1CF6\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2118-\u211D\u2124\u2126\u2128\u212A-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2160-\u2188\u2C00-\u2C2E\u2C30-\u2C5E\u2C60-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303C\u3041-\u3096\u309B-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312D\u3131-\u318E\u31A0-\u31BA\u31F0-\u31FF\u3400-\u4DB5\u4E00-\u9FD5\uA000-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6EF\uA717-\uA71F\uA722-\uA788\uA78B-\uA7AD\uA7B0-\uA7B7\uA7F7-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB65\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE70-\uFE74\uFE76-\uFEFC\uFF21-\uFF3A\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDD40-\uDD74\uDE80-\uDE9C\uDEA0-\uDED0\uDF00-\uDF1F\uDF30-\uDF4A\uDF50-\uDF75\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF\uDFD1-\uDFD5]|\uD801[\uDC00-\uDC9D\uDD00-\uDD27\uDD30-\uDD63\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00\uDE10-\uDE13\uDE15-\uDE17\uDE19-\uDE33\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE4\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2]|\uD804[\uDC03-\uDC37\uDC83-\uDCAF\uDCD0-\uDCE8\uDD03-\uDD26\uDD50-\uDD72\uDD76\uDD83-\uDDB2\uDDC1-\uDDC4\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE2B\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEDE\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3D\uDF50\uDF5D-\uDF61]|\uD805[\uDC80-\uDCAF\uDCC4\uDCC5\uDCC7\uDD80-\uDDAE\uDDD8-\uDDDB\uDE00-\uDE2F\uDE44\uDE80-\uDEAA\uDF00-\uDF19]|\uD806[\uDCA0-\uDCDF\uDCFF\uDEC0-\uDEF8]|\uD808[\uDC00-\uDF99]|\uD809[\uDC00-\uDC6E\uDC80-\uDD43]|[\uD80C\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDED0-\uDEED\uDF00-\uDF2F\uDF40-\uDF43\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDF00-\uDF44\uDF50\uDF93-\uDF9F]|\uD82C[\uDC00\uDC01]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB]|\uD83A[\uDC00-\uDCC4]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDED6\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF34\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1]|\uD87E[\uDC00-\uDE1D]/, + // Unicode v8.0.0 NonAsciiIdentifierPart: + NonAsciiIdentifierPart: /[\xAA\xB5\xB7\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0300-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u0483-\u0487\u048A-\u052F\u0531-\u0556\u0559\u0561-\u0587\u0591-\u05BD\u05BF\u05C1\u05C2\u05C4\u05C5\u05C7\u05D0-\u05EA\u05F0-\u05F2\u0610-\u061A\u0620-\u0669\u066E-\u06D3\u06D5-\u06DC\u06DF-\u06E8\u06EA-\u06FC\u06FF\u0710-\u074A\u074D-\u07B1\u07C0-\u07F5\u07FA\u0800-\u082D\u0840-\u085B\u08A0-\u08B4\u08E3-\u0963\u0966-\u096F\u0971-\u0983\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BC-\u09C4\u09C7\u09C8\u09CB-\u09CE\u09D7\u09DC\u09DD\u09DF-\u09E3\u09E6-\u09F1\u0A01-\u0A03\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A3C\u0A3E-\u0A42\u0A47\u0A48\u0A4B-\u0A4D\u0A51\u0A59-\u0A5C\u0A5E\u0A66-\u0A75\u0A81-\u0A83\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABC-\u0AC5\u0AC7-\u0AC9\u0ACB-\u0ACD\u0AD0\u0AE0-\u0AE3\u0AE6-\u0AEF\u0AF9\u0B01-\u0B03\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3C-\u0B44\u0B47\u0B48\u0B4B-\u0B4D\u0B56\u0B57\u0B5C\u0B5D\u0B5F-\u0B63\u0B66-\u0B6F\u0B71\u0B82\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BBE-\u0BC2\u0BC6-\u0BC8\u0BCA-\u0BCD\u0BD0\u0BD7\u0BE6-\u0BEF\u0C00-\u0C03\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D-\u0C44\u0C46-\u0C48\u0C4A-\u0C4D\u0C55\u0C56\u0C58-\u0C5A\u0C60-\u0C63\u0C66-\u0C6F\u0C81-\u0C83\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBC-\u0CC4\u0CC6-\u0CC8\u0CCA-\u0CCD\u0CD5\u0CD6\u0CDE\u0CE0-\u0CE3\u0CE6-\u0CEF\u0CF1\u0CF2\u0D01-\u0D03\u0D05-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D-\u0D44\u0D46-\u0D48\u0D4A-\u0D4E\u0D57\u0D5F-\u0D63\u0D66-\u0D6F\u0D7A-\u0D7F\u0D82\u0D83\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0DCA\u0DCF-\u0DD4\u0DD6\u0DD8-\u0DDF\u0DE6-\u0DEF\u0DF2\u0DF3\u0E01-\u0E3A\u0E40-\u0E4E\u0E50-\u0E59\u0E81\u0E82\u0E84\u0E87\u0E88\u0E8A\u0E8D\u0E94-\u0E97\u0E99-\u0E9F\u0EA1-\u0EA3\u0EA5\u0EA7\u0EAA\u0EAB\u0EAD-\u0EB9\u0EBB-\u0EBD\u0EC0-\u0EC4\u0EC6\u0EC8-\u0ECD\u0ED0-\u0ED9\u0EDC-\u0EDF\u0F00\u0F18\u0F19\u0F20-\u0F29\u0F35\u0F37\u0F39\u0F3E-\u0F47\u0F49-\u0F6C\u0F71-\u0F84\u0F86-\u0F97\u0F99-\u0FBC\u0FC6\u1000-\u1049\u1050-\u109D\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u135D-\u135F\u1369-\u1371\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16EE-\u16F8\u1700-\u170C\u170E-\u1714\u1720-\u1734\u1740-\u1753\u1760-\u176C\u176E-\u1770\u1772\u1773\u1780-\u17D3\u17D7\u17DC\u17DD\u17E0-\u17E9\u180B-\u180D\u1810-\u1819\u1820-\u1877\u1880-\u18AA\u18B0-\u18F5\u1900-\u191E\u1920-\u192B\u1930-\u193B\u1946-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u19D0-\u19DA\u1A00-\u1A1B\u1A20-\u1A5E\u1A60-\u1A7C\u1A7F-\u1A89\u1A90-\u1A99\u1AA7\u1AB0-\u1ABD\u1B00-\u1B4B\u1B50-\u1B59\u1B6B-\u1B73\u1B80-\u1BF3\u1C00-\u1C37\u1C40-\u1C49\u1C4D-\u1C7D\u1CD0-\u1CD2\u1CD4-\u1CF6\u1CF8\u1CF9\u1D00-\u1DF5\u1DFC-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u200C\u200D\u203F\u2040\u2054\u2071\u207F\u2090-\u209C\u20D0-\u20DC\u20E1\u20E5-\u20F0\u2102\u2107\u210A-\u2113\u2115\u2118-\u211D\u2124\u2126\u2128\u212A-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2160-\u2188\u2C00-\u2C2E\u2C30-\u2C5E\u2C60-\u2CE4\u2CEB-\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D7F-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2DE0-\u2DFF\u3005-\u3007\u3021-\u302F\u3031-\u3035\u3038-\u303C\u3041-\u3096\u3099-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312D\u3131-\u318E\u31A0-\u31BA\u31F0-\u31FF\u3400-\u4DB5\u4E00-\u9FD5\uA000-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA62B\uA640-\uA66F\uA674-\uA67D\uA67F-\uA6F1\uA717-\uA71F\uA722-\uA788\uA78B-\uA7AD\uA7B0-\uA7B7\uA7F7-\uA827\uA840-\uA873\uA880-\uA8C4\uA8D0-\uA8D9\uA8E0-\uA8F7\uA8FB\uA8FD\uA900-\uA92D\uA930-\uA953\uA960-\uA97C\uA980-\uA9C0\uA9CF-\uA9D9\uA9E0-\uA9FE\uAA00-\uAA36\uAA40-\uAA4D\uAA50-\uAA59\uAA60-\uAA76\uAA7A-\uAAC2\uAADB-\uAADD\uAAE0-\uAAEF\uAAF2-\uAAF6\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB65\uAB70-\uABEA\uABEC\uABED\uABF0-\uABF9\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE00-\uFE0F\uFE20-\uFE2F\uFE33\uFE34\uFE4D-\uFE4F\uFE70-\uFE74\uFE76-\uFEFC\uFF10-\uFF19\uFF21-\uFF3A\uFF3F\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDD40-\uDD74\uDDFD\uDE80-\uDE9C\uDEA0-\uDED0\uDEE0\uDF00-\uDF1F\uDF30-\uDF4A\uDF50-\uDF7A\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF\uDFD1-\uDFD5]|\uD801[\uDC00-\uDC9D\uDCA0-\uDCA9\uDD00-\uDD27\uDD30-\uDD63\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00-\uDE03\uDE05\uDE06\uDE0C-\uDE13\uDE15-\uDE17\uDE19-\uDE33\uDE38-\uDE3A\uDE3F\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE6\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2]|\uD804[\uDC00-\uDC46\uDC66-\uDC6F\uDC7F-\uDCBA\uDCD0-\uDCE8\uDCF0-\uDCF9\uDD00-\uDD34\uDD36-\uDD3F\uDD50-\uDD73\uDD76\uDD80-\uDDC4\uDDCA-\uDDCC\uDDD0-\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE37\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEEA\uDEF0-\uDEF9\uDF00-\uDF03\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3C-\uDF44\uDF47\uDF48\uDF4B-\uDF4D\uDF50\uDF57\uDF5D-\uDF63\uDF66-\uDF6C\uDF70-\uDF74]|\uD805[\uDC80-\uDCC5\uDCC7\uDCD0-\uDCD9\uDD80-\uDDB5\uDDB8-\uDDC0\uDDD8-\uDDDD\uDE00-\uDE40\uDE44\uDE50-\uDE59\uDE80-\uDEB7\uDEC0-\uDEC9\uDF00-\uDF19\uDF1D-\uDF2B\uDF30-\uDF39]|\uD806[\uDCA0-\uDCE9\uDCFF\uDEC0-\uDEF8]|\uD808[\uDC00-\uDF99]|\uD809[\uDC00-\uDC6E\uDC80-\uDD43]|[\uD80C\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDE60-\uDE69\uDED0-\uDEED\uDEF0-\uDEF4\uDF00-\uDF36\uDF40-\uDF43\uDF50-\uDF59\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDF00-\uDF44\uDF50-\uDF7E\uDF8F-\uDF9F]|\uD82C[\uDC00\uDC01]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99\uDC9D\uDC9E]|\uD834[\uDD65-\uDD69\uDD6D-\uDD72\uDD7B-\uDD82\uDD85-\uDD8B\uDDAA-\uDDAD\uDE42-\uDE44]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB\uDFCE-\uDFFF]|\uD836[\uDE00-\uDE36\uDE3B-\uDE6C\uDE75\uDE84\uDE9B-\uDE9F\uDEA1-\uDEAF]|\uD83A[\uDC00-\uDCC4\uDCD0-\uDCD6]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDED6\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF34\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1]|\uD87E[\uDC00-\uDE1D]|\uDB40[\uDD00-\uDDEF]/ + }; + exports.Character = { + /* tslint:disable:no-bitwise */ + fromCodePoint: function (cp) { + return (cp < 0x10000) ? String.fromCharCode(cp) : + String.fromCharCode(0xD800 + ((cp - 0x10000) >> 10)) + + String.fromCharCode(0xDC00 + ((cp - 0x10000) & 1023)); + }, + // https://tc39.github.io/ecma262/#sec-white-space + isWhiteSpace: function (cp) { + return (cp === 0x20) || (cp === 0x09) || (cp === 0x0B) || (cp === 0x0C) || (cp === 0xA0) || + (cp >= 0x1680 && [0x1680, 0x2000, 0x2001, 0x2002, 0x2003, 0x2004, 0x2005, 0x2006, 0x2007, 0x2008, 0x2009, 0x200A, 0x202F, 0x205F, 0x3000, 0xFEFF].indexOf(cp) >= 0); + }, + // https://tc39.github.io/ecma262/#sec-line-terminators + isLineTerminator: function (cp) { + return (cp === 0x0A) || (cp === 0x0D) || (cp === 0x2028) || (cp === 0x2029); + }, + // https://tc39.github.io/ecma262/#sec-names-and-keywords + isIdentifierStart: function (cp) { + return (cp === 0x24) || (cp === 0x5F) || + (cp >= 0x41 && cp <= 0x5A) || + (cp >= 0x61 && cp <= 0x7A) || + (cp === 0x5C) || + ((cp >= 0x80) && Regex.NonAsciiIdentifierStart.test(exports.Character.fromCodePoint(cp))); + }, + isIdentifierPart: function (cp) { + return (cp === 0x24) || (cp === 0x5F) || + (cp >= 0x41 && cp <= 0x5A) || + (cp >= 0x61 && cp <= 0x7A) || + (cp >= 0x30 && cp <= 0x39) || + (cp === 0x5C) || + ((cp >= 0x80) && Regex.NonAsciiIdentifierPart.test(exports.Character.fromCodePoint(cp))); + }, + // https://tc39.github.io/ecma262/#sec-literals-numeric-literals + isDecimalDigit: function (cp) { + return (cp >= 0x30 && cp <= 0x39); // 0..9 + }, + isHexDigit: function (cp) { + return (cp >= 0x30 && cp <= 0x39) || + (cp >= 0x41 && cp <= 0x46) || + (cp >= 0x61 && cp <= 0x66); // a..f + }, + isOctalDigit: function (cp) { + return (cp >= 0x30 && cp <= 0x37); // 0..7 + } + }; + + +/***/ }, +/* 5 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + var jsx_syntax_1 = __webpack_require__(6); + /* tslint:disable:max-classes-per-file */ + var JSXClosingElement = (function () { + function JSXClosingElement(name) { + this.type = jsx_syntax_1.JSXSyntax.JSXClosingElement; + this.name = name; + } + return JSXClosingElement; + }()); + exports.JSXClosingElement = JSXClosingElement; + var JSXElement = (function () { + function JSXElement(openingElement, children, closingElement) { + this.type = jsx_syntax_1.JSXSyntax.JSXElement; + this.openingElement = openingElement; + this.children = children; + this.closingElement = closingElement; + } + return JSXElement; + }()); + exports.JSXElement = JSXElement; + var JSXEmptyExpression = (function () { + function JSXEmptyExpression() { + this.type = jsx_syntax_1.JSXSyntax.JSXEmptyExpression; + } + return JSXEmptyExpression; + }()); + exports.JSXEmptyExpression = JSXEmptyExpression; + var JSXExpressionContainer = (function () { + function JSXExpressionContainer(expression) { + this.type = jsx_syntax_1.JSXSyntax.JSXExpressionContainer; + this.expression = expression; + } + return JSXExpressionContainer; + }()); + exports.JSXExpressionContainer = JSXExpressionContainer; + var JSXIdentifier = (function () { + function JSXIdentifier(name) { + this.type = jsx_syntax_1.JSXSyntax.JSXIdentifier; + this.name = name; + } + return JSXIdentifier; + }()); + exports.JSXIdentifier = JSXIdentifier; + var JSXMemberExpression = (function () { + function JSXMemberExpression(object, property) { + this.type = jsx_syntax_1.JSXSyntax.JSXMemberExpression; + this.object = object; + this.property = property; + } + return JSXMemberExpression; + }()); + exports.JSXMemberExpression = JSXMemberExpression; + var JSXAttribute = (function () { + function JSXAttribute(name, value) { + this.type = jsx_syntax_1.JSXSyntax.JSXAttribute; + this.name = name; + this.value = value; + } + return JSXAttribute; + }()); + exports.JSXAttribute = JSXAttribute; + var JSXNamespacedName = (function () { + function JSXNamespacedName(namespace, name) { + this.type = jsx_syntax_1.JSXSyntax.JSXNamespacedName; + this.namespace = namespace; + this.name = name; + } + return JSXNamespacedName; + }()); + exports.JSXNamespacedName = JSXNamespacedName; + var JSXOpeningElement = (function () { + function JSXOpeningElement(name, selfClosing, attributes) { + this.type = jsx_syntax_1.JSXSyntax.JSXOpeningElement; + this.name = name; + this.selfClosing = selfClosing; + this.attributes = attributes; + } + return JSXOpeningElement; + }()); + exports.JSXOpeningElement = JSXOpeningElement; + var JSXSpreadAttribute = (function () { + function JSXSpreadAttribute(argument) { + this.type = jsx_syntax_1.JSXSyntax.JSXSpreadAttribute; + this.argument = argument; + } + return JSXSpreadAttribute; + }()); + exports.JSXSpreadAttribute = JSXSpreadAttribute; + var JSXText = (function () { + function JSXText(value, raw) { + this.type = jsx_syntax_1.JSXSyntax.JSXText; + this.value = value; + this.raw = raw; + } + return JSXText; + }()); + exports.JSXText = JSXText; + + +/***/ }, +/* 6 */ +/***/ function(module, exports) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + exports.JSXSyntax = { + JSXAttribute: 'JSXAttribute', + JSXClosingElement: 'JSXClosingElement', + JSXElement: 'JSXElement', + JSXEmptyExpression: 'JSXEmptyExpression', + JSXExpressionContainer: 'JSXExpressionContainer', + JSXIdentifier: 'JSXIdentifier', + JSXMemberExpression: 'JSXMemberExpression', + JSXNamespacedName: 'JSXNamespacedName', + JSXOpeningElement: 'JSXOpeningElement', + JSXSpreadAttribute: 'JSXSpreadAttribute', + JSXText: 'JSXText' + }; + + +/***/ }, +/* 7 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + var syntax_1 = __webpack_require__(2); + /* tslint:disable:max-classes-per-file */ + var ArrayExpression = (function () { + function ArrayExpression(elements) { + this.type = syntax_1.Syntax.ArrayExpression; + this.elements = elements; + } + return ArrayExpression; + }()); + exports.ArrayExpression = ArrayExpression; + var ArrayPattern = (function () { + function ArrayPattern(elements) { + this.type = syntax_1.Syntax.ArrayPattern; + this.elements = elements; + } + return ArrayPattern; + }()); + exports.ArrayPattern = ArrayPattern; + var ArrowFunctionExpression = (function () { + function ArrowFunctionExpression(params, body, expression) { + this.type = syntax_1.Syntax.ArrowFunctionExpression; + this.id = null; + this.params = params; + this.body = body; + this.generator = false; + this.expression = expression; + this.async = false; + } + return ArrowFunctionExpression; + }()); + exports.ArrowFunctionExpression = ArrowFunctionExpression; + var AssignmentExpression = (function () { + function AssignmentExpression(operator, left, right) { + this.type = syntax_1.Syntax.AssignmentExpression; + this.operator = operator; + this.left = left; + this.right = right; + } + return AssignmentExpression; + }()); + exports.AssignmentExpression = AssignmentExpression; + var AssignmentPattern = (function () { + function AssignmentPattern(left, right) { + this.type = syntax_1.Syntax.AssignmentPattern; + this.left = left; + this.right = right; + } + return AssignmentPattern; + }()); + exports.AssignmentPattern = AssignmentPattern; + var AsyncArrowFunctionExpression = (function () { + function AsyncArrowFunctionExpression(params, body, expression) { + this.type = syntax_1.Syntax.ArrowFunctionExpression; + this.id = null; + this.params = params; + this.body = body; + this.generator = false; + this.expression = expression; + this.async = true; + } + return AsyncArrowFunctionExpression; + }()); + exports.AsyncArrowFunctionExpression = AsyncArrowFunctionExpression; + var AsyncFunctionDeclaration = (function () { + function AsyncFunctionDeclaration(id, params, body) { + this.type = syntax_1.Syntax.FunctionDeclaration; + this.id = id; + this.params = params; + this.body = body; + this.generator = false; + this.expression = false; + this.async = true; + } + return AsyncFunctionDeclaration; + }()); + exports.AsyncFunctionDeclaration = AsyncFunctionDeclaration; + var AsyncFunctionExpression = (function () { + function AsyncFunctionExpression(id, params, body) { + this.type = syntax_1.Syntax.FunctionExpression; + this.id = id; + this.params = params; + this.body = body; + this.generator = false; + this.expression = false; + this.async = true; + } + return AsyncFunctionExpression; + }()); + exports.AsyncFunctionExpression = AsyncFunctionExpression; + var AwaitExpression = (function () { + function AwaitExpression(argument) { + this.type = syntax_1.Syntax.AwaitExpression; + this.argument = argument; + } + return AwaitExpression; + }()); + exports.AwaitExpression = AwaitExpression; + var BinaryExpression = (function () { + function BinaryExpression(operator, left, right) { + var logical = (operator === '||' || operator === '&&'); + this.type = logical ? syntax_1.Syntax.LogicalExpression : syntax_1.Syntax.BinaryExpression; + this.operator = operator; + this.left = left; + this.right = right; + } + return BinaryExpression; + }()); + exports.BinaryExpression = BinaryExpression; + var BlockStatement = (function () { + function BlockStatement(body) { + this.type = syntax_1.Syntax.BlockStatement; + this.body = body; + } + return BlockStatement; + }()); + exports.BlockStatement = BlockStatement; + var BreakStatement = (function () { + function BreakStatement(label) { + this.type = syntax_1.Syntax.BreakStatement; + this.label = label; + } + return BreakStatement; + }()); + exports.BreakStatement = BreakStatement; + var CallExpression = (function () { + function CallExpression(callee, args) { + this.type = syntax_1.Syntax.CallExpression; + this.callee = callee; + this.arguments = args; + } + return CallExpression; + }()); + exports.CallExpression = CallExpression; + var CatchClause = (function () { + function CatchClause(param, body) { + this.type = syntax_1.Syntax.CatchClause; + this.param = param; + this.body = body; + } + return CatchClause; + }()); + exports.CatchClause = CatchClause; + var ClassBody = (function () { + function ClassBody(body) { + this.type = syntax_1.Syntax.ClassBody; + this.body = body; + } + return ClassBody; + }()); + exports.ClassBody = ClassBody; + var ClassDeclaration = (function () { + function ClassDeclaration(id, superClass, body) { + this.type = syntax_1.Syntax.ClassDeclaration; + this.id = id; + this.superClass = superClass; + this.body = body; + } + return ClassDeclaration; + }()); + exports.ClassDeclaration = ClassDeclaration; + var ClassExpression = (function () { + function ClassExpression(id, superClass, body) { + this.type = syntax_1.Syntax.ClassExpression; + this.id = id; + this.superClass = superClass; + this.body = body; + } + return ClassExpression; + }()); + exports.ClassExpression = ClassExpression; + var ComputedMemberExpression = (function () { + function ComputedMemberExpression(object, property) { + this.type = syntax_1.Syntax.MemberExpression; + this.computed = true; + this.object = object; + this.property = property; + } + return ComputedMemberExpression; + }()); + exports.ComputedMemberExpression = ComputedMemberExpression; + var ConditionalExpression = (function () { + function ConditionalExpression(test, consequent, alternate) { + this.type = syntax_1.Syntax.ConditionalExpression; + this.test = test; + this.consequent = consequent; + this.alternate = alternate; + } + return ConditionalExpression; + }()); + exports.ConditionalExpression = ConditionalExpression; + var ContinueStatement = (function () { + function ContinueStatement(label) { + this.type = syntax_1.Syntax.ContinueStatement; + this.label = label; + } + return ContinueStatement; + }()); + exports.ContinueStatement = ContinueStatement; + var DebuggerStatement = (function () { + function DebuggerStatement() { + this.type = syntax_1.Syntax.DebuggerStatement; + } + return DebuggerStatement; + }()); + exports.DebuggerStatement = DebuggerStatement; + var Directive = (function () { + function Directive(expression, directive) { + this.type = syntax_1.Syntax.ExpressionStatement; + this.expression = expression; + this.directive = directive; + } + return Directive; + }()); + exports.Directive = Directive; + var DoWhileStatement = (function () { + function DoWhileStatement(body, test) { + this.type = syntax_1.Syntax.DoWhileStatement; + this.body = body; + this.test = test; + } + return DoWhileStatement; + }()); + exports.DoWhileStatement = DoWhileStatement; + var EmptyStatement = (function () { + function EmptyStatement() { + this.type = syntax_1.Syntax.EmptyStatement; + } + return EmptyStatement; + }()); + exports.EmptyStatement = EmptyStatement; + var ExportAllDeclaration = (function () { + function ExportAllDeclaration(source) { + this.type = syntax_1.Syntax.ExportAllDeclaration; + this.source = source; + } + return ExportAllDeclaration; + }()); + exports.ExportAllDeclaration = ExportAllDeclaration; + var ExportDefaultDeclaration = (function () { + function ExportDefaultDeclaration(declaration) { + this.type = syntax_1.Syntax.ExportDefaultDeclaration; + this.declaration = declaration; + } + return ExportDefaultDeclaration; + }()); + exports.ExportDefaultDeclaration = ExportDefaultDeclaration; + var ExportNamedDeclaration = (function () { + function ExportNamedDeclaration(declaration, specifiers, source) { + this.type = syntax_1.Syntax.ExportNamedDeclaration; + this.declaration = declaration; + this.specifiers = specifiers; + this.source = source; + } + return ExportNamedDeclaration; + }()); + exports.ExportNamedDeclaration = ExportNamedDeclaration; + var ExportSpecifier = (function () { + function ExportSpecifier(local, exported) { + this.type = syntax_1.Syntax.ExportSpecifier; + this.exported = exported; + this.local = local; + } + return ExportSpecifier; + }()); + exports.ExportSpecifier = ExportSpecifier; + var ExpressionStatement = (function () { + function ExpressionStatement(expression) { + this.type = syntax_1.Syntax.ExpressionStatement; + this.expression = expression; + } + return ExpressionStatement; + }()); + exports.ExpressionStatement = ExpressionStatement; + var ForInStatement = (function () { + function ForInStatement(left, right, body) { + this.type = syntax_1.Syntax.ForInStatement; + this.left = left; + this.right = right; + this.body = body; + this.each = false; + } + return ForInStatement; + }()); + exports.ForInStatement = ForInStatement; + var ForOfStatement = (function () { + function ForOfStatement(left, right, body) { + this.type = syntax_1.Syntax.ForOfStatement; + this.left = left; + this.right = right; + this.body = body; + } + return ForOfStatement; + }()); + exports.ForOfStatement = ForOfStatement; + var ForStatement = (function () { + function ForStatement(init, test, update, body) { + this.type = syntax_1.Syntax.ForStatement; + this.init = init; + this.test = test; + this.update = update; + this.body = body; + } + return ForStatement; + }()); + exports.ForStatement = ForStatement; + var FunctionDeclaration = (function () { + function FunctionDeclaration(id, params, body, generator) { + this.type = syntax_1.Syntax.FunctionDeclaration; + this.id = id; + this.params = params; + this.body = body; + this.generator = generator; + this.expression = false; + this.async = false; + } + return FunctionDeclaration; + }()); + exports.FunctionDeclaration = FunctionDeclaration; + var FunctionExpression = (function () { + function FunctionExpression(id, params, body, generator) { + this.type = syntax_1.Syntax.FunctionExpression; + this.id = id; + this.params = params; + this.body = body; + this.generator = generator; + this.expression = false; + this.async = false; + } + return FunctionExpression; + }()); + exports.FunctionExpression = FunctionExpression; + var Identifier = (function () { + function Identifier(name) { + this.type = syntax_1.Syntax.Identifier; + this.name = name; + } + return Identifier; + }()); + exports.Identifier = Identifier; + var IfStatement = (function () { + function IfStatement(test, consequent, alternate) { + this.type = syntax_1.Syntax.IfStatement; + this.test = test; + this.consequent = consequent; + this.alternate = alternate; + } + return IfStatement; + }()); + exports.IfStatement = IfStatement; + var ImportDeclaration = (function () { + function ImportDeclaration(specifiers, source) { + this.type = syntax_1.Syntax.ImportDeclaration; + this.specifiers = specifiers; + this.source = source; + } + return ImportDeclaration; + }()); + exports.ImportDeclaration = ImportDeclaration; + var ImportDefaultSpecifier = (function () { + function ImportDefaultSpecifier(local) { + this.type = syntax_1.Syntax.ImportDefaultSpecifier; + this.local = local; + } + return ImportDefaultSpecifier; + }()); + exports.ImportDefaultSpecifier = ImportDefaultSpecifier; + var ImportNamespaceSpecifier = (function () { + function ImportNamespaceSpecifier(local) { + this.type = syntax_1.Syntax.ImportNamespaceSpecifier; + this.local = local; + } + return ImportNamespaceSpecifier; + }()); + exports.ImportNamespaceSpecifier = ImportNamespaceSpecifier; + var ImportSpecifier = (function () { + function ImportSpecifier(local, imported) { + this.type = syntax_1.Syntax.ImportSpecifier; + this.local = local; + this.imported = imported; + } + return ImportSpecifier; + }()); + exports.ImportSpecifier = ImportSpecifier; + var LabeledStatement = (function () { + function LabeledStatement(label, body) { + this.type = syntax_1.Syntax.LabeledStatement; + this.label = label; + this.body = body; + } + return LabeledStatement; + }()); + exports.LabeledStatement = LabeledStatement; + var Literal = (function () { + function Literal(value, raw) { + this.type = syntax_1.Syntax.Literal; + this.value = value; + this.raw = raw; + } + return Literal; + }()); + exports.Literal = Literal; + var MetaProperty = (function () { + function MetaProperty(meta, property) { + this.type = syntax_1.Syntax.MetaProperty; + this.meta = meta; + this.property = property; + } + return MetaProperty; + }()); + exports.MetaProperty = MetaProperty; + var MethodDefinition = (function () { + function MethodDefinition(key, computed, value, kind, isStatic) { + this.type = syntax_1.Syntax.MethodDefinition; + this.key = key; + this.computed = computed; + this.value = value; + this.kind = kind; + this.static = isStatic; + } + return MethodDefinition; + }()); + exports.MethodDefinition = MethodDefinition; + var Module = (function () { + function Module(body) { + this.type = syntax_1.Syntax.Program; + this.body = body; + this.sourceType = 'module'; + } + return Module; + }()); + exports.Module = Module; + var NewExpression = (function () { + function NewExpression(callee, args) { + this.type = syntax_1.Syntax.NewExpression; + this.callee = callee; + this.arguments = args; + } + return NewExpression; + }()); + exports.NewExpression = NewExpression; + var ObjectExpression = (function () { + function ObjectExpression(properties) { + this.type = syntax_1.Syntax.ObjectExpression; + this.properties = properties; + } + return ObjectExpression; + }()); + exports.ObjectExpression = ObjectExpression; + var ObjectPattern = (function () { + function ObjectPattern(properties) { + this.type = syntax_1.Syntax.ObjectPattern; + this.properties = properties; + } + return ObjectPattern; + }()); + exports.ObjectPattern = ObjectPattern; + var Property = (function () { + function Property(kind, key, computed, value, method, shorthand) { + this.type = syntax_1.Syntax.Property; + this.key = key; + this.computed = computed; + this.value = value; + this.kind = kind; + this.method = method; + this.shorthand = shorthand; + } + return Property; + }()); + exports.Property = Property; + var RegexLiteral = (function () { + function RegexLiteral(value, raw, pattern, flags) { + this.type = syntax_1.Syntax.Literal; + this.value = value; + this.raw = raw; + this.regex = { pattern: pattern, flags: flags }; + } + return RegexLiteral; + }()); + exports.RegexLiteral = RegexLiteral; + var RestElement = (function () { + function RestElement(argument) { + this.type = syntax_1.Syntax.RestElement; + this.argument = argument; + } + return RestElement; + }()); + exports.RestElement = RestElement; + var ReturnStatement = (function () { + function ReturnStatement(argument) { + this.type = syntax_1.Syntax.ReturnStatement; + this.argument = argument; + } + return ReturnStatement; + }()); + exports.ReturnStatement = ReturnStatement; + var Script = (function () { + function Script(body) { + this.type = syntax_1.Syntax.Program; + this.body = body; + this.sourceType = 'script'; + } + return Script; + }()); + exports.Script = Script; + var SequenceExpression = (function () { + function SequenceExpression(expressions) { + this.type = syntax_1.Syntax.SequenceExpression; + this.expressions = expressions; + } + return SequenceExpression; + }()); + exports.SequenceExpression = SequenceExpression; + var SpreadElement = (function () { + function SpreadElement(argument) { + this.type = syntax_1.Syntax.SpreadElement; + this.argument = argument; + } + return SpreadElement; + }()); + exports.SpreadElement = SpreadElement; + var StaticMemberExpression = (function () { + function StaticMemberExpression(object, property) { + this.type = syntax_1.Syntax.MemberExpression; + this.computed = false; + this.object = object; + this.property = property; + } + return StaticMemberExpression; + }()); + exports.StaticMemberExpression = StaticMemberExpression; + var Super = (function () { + function Super() { + this.type = syntax_1.Syntax.Super; + } + return Super; + }()); + exports.Super = Super; + var SwitchCase = (function () { + function SwitchCase(test, consequent) { + this.type = syntax_1.Syntax.SwitchCase; + this.test = test; + this.consequent = consequent; + } + return SwitchCase; + }()); + exports.SwitchCase = SwitchCase; + var SwitchStatement = (function () { + function SwitchStatement(discriminant, cases) { + this.type = syntax_1.Syntax.SwitchStatement; + this.discriminant = discriminant; + this.cases = cases; + } + return SwitchStatement; + }()); + exports.SwitchStatement = SwitchStatement; + var TaggedTemplateExpression = (function () { + function TaggedTemplateExpression(tag, quasi) { + this.type = syntax_1.Syntax.TaggedTemplateExpression; + this.tag = tag; + this.quasi = quasi; + } + return TaggedTemplateExpression; + }()); + exports.TaggedTemplateExpression = TaggedTemplateExpression; + var TemplateElement = (function () { + function TemplateElement(value, tail) { + this.type = syntax_1.Syntax.TemplateElement; + this.value = value; + this.tail = tail; + } + return TemplateElement; + }()); + exports.TemplateElement = TemplateElement; + var TemplateLiteral = (function () { + function TemplateLiteral(quasis, expressions) { + this.type = syntax_1.Syntax.TemplateLiteral; + this.quasis = quasis; + this.expressions = expressions; + } + return TemplateLiteral; + }()); + exports.TemplateLiteral = TemplateLiteral; + var ThisExpression = (function () { + function ThisExpression() { + this.type = syntax_1.Syntax.ThisExpression; + } + return ThisExpression; + }()); + exports.ThisExpression = ThisExpression; + var ThrowStatement = (function () { + function ThrowStatement(argument) { + this.type = syntax_1.Syntax.ThrowStatement; + this.argument = argument; + } + return ThrowStatement; + }()); + exports.ThrowStatement = ThrowStatement; + var TryStatement = (function () { + function TryStatement(block, handler, finalizer) { + this.type = syntax_1.Syntax.TryStatement; + this.block = block; + this.handler = handler; + this.finalizer = finalizer; + } + return TryStatement; + }()); + exports.TryStatement = TryStatement; + var UnaryExpression = (function () { + function UnaryExpression(operator, argument) { + this.type = syntax_1.Syntax.UnaryExpression; + this.operator = operator; + this.argument = argument; + this.prefix = true; + } + return UnaryExpression; + }()); + exports.UnaryExpression = UnaryExpression; + var UpdateExpression = (function () { + function UpdateExpression(operator, argument, prefix) { + this.type = syntax_1.Syntax.UpdateExpression; + this.operator = operator; + this.argument = argument; + this.prefix = prefix; + } + return UpdateExpression; + }()); + exports.UpdateExpression = UpdateExpression; + var VariableDeclaration = (function () { + function VariableDeclaration(declarations, kind) { + this.type = syntax_1.Syntax.VariableDeclaration; + this.declarations = declarations; + this.kind = kind; + } + return VariableDeclaration; + }()); + exports.VariableDeclaration = VariableDeclaration; + var VariableDeclarator = (function () { + function VariableDeclarator(id, init) { + this.type = syntax_1.Syntax.VariableDeclarator; + this.id = id; + this.init = init; + } + return VariableDeclarator; + }()); + exports.VariableDeclarator = VariableDeclarator; + var WhileStatement = (function () { + function WhileStatement(test, body) { + this.type = syntax_1.Syntax.WhileStatement; + this.test = test; + this.body = body; + } + return WhileStatement; + }()); + exports.WhileStatement = WhileStatement; + var WithStatement = (function () { + function WithStatement(object, body) { + this.type = syntax_1.Syntax.WithStatement; + this.object = object; + this.body = body; + } + return WithStatement; + }()); + exports.WithStatement = WithStatement; + var YieldExpression = (function () { + function YieldExpression(argument, delegate) { + this.type = syntax_1.Syntax.YieldExpression; + this.argument = argument; + this.delegate = delegate; + } + return YieldExpression; + }()); + exports.YieldExpression = YieldExpression; + + +/***/ }, +/* 8 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + var assert_1 = __webpack_require__(9); + var error_handler_1 = __webpack_require__(10); + var messages_1 = __webpack_require__(11); + var Node = __webpack_require__(7); + var scanner_1 = __webpack_require__(12); + var syntax_1 = __webpack_require__(2); + var token_1 = __webpack_require__(13); + var ArrowParameterPlaceHolder = 'ArrowParameterPlaceHolder'; + var Parser = (function () { + function Parser(code, options, delegate) { + if (options === void 0) { options = {}; } + this.config = { + range: (typeof options.range === 'boolean') && options.range, + loc: (typeof options.loc === 'boolean') && options.loc, + source: null, + tokens: (typeof options.tokens === 'boolean') && options.tokens, + comment: (typeof options.comment === 'boolean') && options.comment, + tolerant: (typeof options.tolerant === 'boolean') && options.tolerant + }; + if (this.config.loc && options.source && options.source !== null) { + this.config.source = String(options.source); + } + this.delegate = delegate; + this.errorHandler = new error_handler_1.ErrorHandler(); + this.errorHandler.tolerant = this.config.tolerant; + this.scanner = new scanner_1.Scanner(code, this.errorHandler); + this.scanner.trackComment = this.config.comment; + this.operatorPrecedence = { + ')': 0, + ';': 0, + ',': 0, + '=': 0, + ']': 0, + '||': 1, + '&&': 2, + '|': 3, + '^': 4, + '&': 5, + '==': 6, + '!=': 6, + '===': 6, + '!==': 6, + '<': 7, + '>': 7, + '<=': 7, + '>=': 7, + '<<': 8, + '>>': 8, + '>>>': 8, + '+': 9, + '-': 9, + '*': 11, + '/': 11, + '%': 11 + }; + this.lookahead = { + type: 2 /* EOF */, + value: '', + lineNumber: this.scanner.lineNumber, + lineStart: 0, + start: 0, + end: 0 + }; + this.hasLineTerminator = false; + this.context = { + isModule: false, + await: false, + allowIn: true, + allowStrictDirective: true, + allowYield: true, + firstCoverInitializedNameError: null, + isAssignmentTarget: false, + isBindingElement: false, + inFunctionBody: false, + inIteration: false, + inSwitch: false, + labelSet: {}, + strict: false + }; + this.tokens = []; + this.startMarker = { + index: 0, + line: this.scanner.lineNumber, + column: 0 + }; + this.lastMarker = { + index: 0, + line: this.scanner.lineNumber, + column: 0 + }; + this.nextToken(); + this.lastMarker = { + index: this.scanner.index, + line: this.scanner.lineNumber, + column: this.scanner.index - this.scanner.lineStart + }; + } + Parser.prototype.throwError = function (messageFormat) { + var values = []; + for (var _i = 1; _i < arguments.length; _i++) { + values[_i - 1] = arguments[_i]; + } + var args = Array.prototype.slice.call(arguments, 1); + var msg = messageFormat.replace(/%(\d)/g, function (whole, idx) { + assert_1.assert(idx < args.length, 'Message reference must be in range'); + return args[idx]; + }); + var index = this.lastMarker.index; + var line = this.lastMarker.line; + var column = this.lastMarker.column + 1; + throw this.errorHandler.createError(index, line, column, msg); + }; + Parser.prototype.tolerateError = function (messageFormat) { + var values = []; + for (var _i = 1; _i < arguments.length; _i++) { + values[_i - 1] = arguments[_i]; + } + var args = Array.prototype.slice.call(arguments, 1); + var msg = messageFormat.replace(/%(\d)/g, function (whole, idx) { + assert_1.assert(idx < args.length, 'Message reference must be in range'); + return args[idx]; + }); + var index = this.lastMarker.index; + var line = this.scanner.lineNumber; + var column = this.lastMarker.column + 1; + this.errorHandler.tolerateError(index, line, column, msg); + }; + // Throw an exception because of the token. + Parser.prototype.unexpectedTokenError = function (token, message) { + var msg = message || messages_1.Messages.UnexpectedToken; + var value; + if (token) { + if (!message) { + msg = (token.type === 2 /* EOF */) ? messages_1.Messages.UnexpectedEOS : + (token.type === 3 /* Identifier */) ? messages_1.Messages.UnexpectedIdentifier : + (token.type === 6 /* NumericLiteral */) ? messages_1.Messages.UnexpectedNumber : + (token.type === 8 /* StringLiteral */) ? messages_1.Messages.UnexpectedString : + (token.type === 10 /* Template */) ? messages_1.Messages.UnexpectedTemplate : + messages_1.Messages.UnexpectedToken; + if (token.type === 4 /* Keyword */) { + if (this.scanner.isFutureReservedWord(token.value)) { + msg = messages_1.Messages.UnexpectedReserved; + } + else if (this.context.strict && this.scanner.isStrictModeReservedWord(token.value)) { + msg = messages_1.Messages.StrictReservedWord; + } + } + } + value = token.value; + } + else { + value = 'ILLEGAL'; + } + msg = msg.replace('%0', value); + if (token && typeof token.lineNumber === 'number') { + var index = token.start; + var line = token.lineNumber; + var lastMarkerLineStart = this.lastMarker.index - this.lastMarker.column; + var column = token.start - lastMarkerLineStart + 1; + return this.errorHandler.createError(index, line, column, msg); + } + else { + var index = this.lastMarker.index; + var line = this.lastMarker.line; + var column = this.lastMarker.column + 1; + return this.errorHandler.createError(index, line, column, msg); + } + }; + Parser.prototype.throwUnexpectedToken = function (token, message) { + throw this.unexpectedTokenError(token, message); + }; + Parser.prototype.tolerateUnexpectedToken = function (token, message) { + this.errorHandler.tolerate(this.unexpectedTokenError(token, message)); + }; + Parser.prototype.collectComments = function () { + if (!this.config.comment) { + this.scanner.scanComments(); + } + else { + var comments = this.scanner.scanComments(); + if (comments.length > 0 && this.delegate) { + for (var i = 0; i < comments.length; ++i) { + var e = comments[i]; + var node = void 0; + node = { + type: e.multiLine ? 'BlockComment' : 'LineComment', + value: this.scanner.source.slice(e.slice[0], e.slice[1]) + }; + if (this.config.range) { + node.range = e.range; + } + if (this.config.loc) { + node.loc = e.loc; + } + var metadata = { + start: { + line: e.loc.start.line, + column: e.loc.start.column, + offset: e.range[0] + }, + end: { + line: e.loc.end.line, + column: e.loc.end.column, + offset: e.range[1] + } + }; + this.delegate(node, metadata); + } + } + } + }; + // From internal representation to an external structure + Parser.prototype.getTokenRaw = function (token) { + return this.scanner.source.slice(token.start, token.end); + }; + Parser.prototype.convertToken = function (token) { + var t = { + type: token_1.TokenName[token.type], + value: this.getTokenRaw(token) + }; + if (this.config.range) { + t.range = [token.start, token.end]; + } + if (this.config.loc) { + t.loc = { + start: { + line: this.startMarker.line, + column: this.startMarker.column + }, + end: { + line: this.scanner.lineNumber, + column: this.scanner.index - this.scanner.lineStart + } + }; + } + if (token.type === 9 /* RegularExpression */) { + var pattern = token.pattern; + var flags = token.flags; + t.regex = { pattern: pattern, flags: flags }; + } + return t; + }; + Parser.prototype.nextToken = function () { + var token = this.lookahead; + this.lastMarker.index = this.scanner.index; + this.lastMarker.line = this.scanner.lineNumber; + this.lastMarker.column = this.scanner.index - this.scanner.lineStart; + this.collectComments(); + if (this.scanner.index !== this.startMarker.index) { + this.startMarker.index = this.scanner.index; + this.startMarker.line = this.scanner.lineNumber; + this.startMarker.column = this.scanner.index - this.scanner.lineStart; + } + var next = this.scanner.lex(); + this.hasLineTerminator = (token.lineNumber !== next.lineNumber); + if (next && this.context.strict && next.type === 3 /* Identifier */) { + if (this.scanner.isStrictModeReservedWord(next.value)) { + next.type = 4 /* Keyword */; + } + } + this.lookahead = next; + if (this.config.tokens && next.type !== 2 /* EOF */) { + this.tokens.push(this.convertToken(next)); + } + return token; + }; + Parser.prototype.nextRegexToken = function () { + this.collectComments(); + var token = this.scanner.scanRegExp(); + if (this.config.tokens) { + // Pop the previous token, '/' or '/=' + // This is added from the lookahead token. + this.tokens.pop(); + this.tokens.push(this.convertToken(token)); + } + // Prime the next lookahead. + this.lookahead = token; + this.nextToken(); + return token; + }; + Parser.prototype.createNode = function () { + return { + index: this.startMarker.index, + line: this.startMarker.line, + column: this.startMarker.column + }; + }; + Parser.prototype.startNode = function (token, lastLineStart) { + if (lastLineStart === void 0) { lastLineStart = 0; } + var column = token.start - token.lineStart; + var line = token.lineNumber; + if (column < 0) { + column += lastLineStart; + line--; + } + return { + index: token.start, + line: line, + column: column + }; + }; + Parser.prototype.finalize = function (marker, node) { + if (this.config.range) { + node.range = [marker.index, this.lastMarker.index]; + } + if (this.config.loc) { + node.loc = { + start: { + line: marker.line, + column: marker.column, + }, + end: { + line: this.lastMarker.line, + column: this.lastMarker.column + } + }; + if (this.config.source) { + node.loc.source = this.config.source; + } + } + if (this.delegate) { + var metadata = { + start: { + line: marker.line, + column: marker.column, + offset: marker.index + }, + end: { + line: this.lastMarker.line, + column: this.lastMarker.column, + offset: this.lastMarker.index + } + }; + this.delegate(node, metadata); + } + return node; + }; + // Expect the next token to match the specified punctuator. + // If not, an exception will be thrown. + Parser.prototype.expect = function (value) { + var token = this.nextToken(); + if (token.type !== 7 /* Punctuator */ || token.value !== value) { + this.throwUnexpectedToken(token); + } + }; + // Quietly expect a comma when in tolerant mode, otherwise delegates to expect(). + Parser.prototype.expectCommaSeparator = function () { + if (this.config.tolerant) { + var token = this.lookahead; + if (token.type === 7 /* Punctuator */ && token.value === ',') { + this.nextToken(); + } + else if (token.type === 7 /* Punctuator */ && token.value === ';') { + this.nextToken(); + this.tolerateUnexpectedToken(token); + } + else { + this.tolerateUnexpectedToken(token, messages_1.Messages.UnexpectedToken); + } + } + else { + this.expect(','); + } + }; + // Expect the next token to match the specified keyword. + // If not, an exception will be thrown. + Parser.prototype.expectKeyword = function (keyword) { + var token = this.nextToken(); + if (token.type !== 4 /* Keyword */ || token.value !== keyword) { + this.throwUnexpectedToken(token); + } + }; + // Return true if the next token matches the specified punctuator. + Parser.prototype.match = function (value) { + return this.lookahead.type === 7 /* Punctuator */ && this.lookahead.value === value; + }; + // Return true if the next token matches the specified keyword + Parser.prototype.matchKeyword = function (keyword) { + return this.lookahead.type === 4 /* Keyword */ && this.lookahead.value === keyword; + }; + // Return true if the next token matches the specified contextual keyword + // (where an identifier is sometimes a keyword depending on the context) + Parser.prototype.matchContextualKeyword = function (keyword) { + return this.lookahead.type === 3 /* Identifier */ && this.lookahead.value === keyword; + }; + // Return true if the next token is an assignment operator + Parser.prototype.matchAssign = function () { + if (this.lookahead.type !== 7 /* Punctuator */) { + return false; + } + var op = this.lookahead.value; + return op === '=' || + op === '*=' || + op === '**=' || + op === '/=' || + op === '%=' || + op === '+=' || + op === '-=' || + op === '<<=' || + op === '>>=' || + op === '>>>=' || + op === '&=' || + op === '^=' || + op === '|='; + }; + // Cover grammar support. + // + // When an assignment expression position starts with an left parenthesis, the determination of the type + // of the syntax is to be deferred arbitrarily long until the end of the parentheses pair (plus a lookahead) + // or the first comma. This situation also defers the determination of all the expressions nested in the pair. + // + // There are three productions that can be parsed in a parentheses pair that needs to be determined + // after the outermost pair is closed. They are: + // + // 1. AssignmentExpression + // 2. BindingElements + // 3. AssignmentTargets + // + // In order to avoid exponential backtracking, we use two flags to denote if the production can be + // binding element or assignment target. + // + // The three productions have the relationship: + // + // BindingElements ⊆ AssignmentTargets ⊆ AssignmentExpression + // + // with a single exception that CoverInitializedName when used directly in an Expression, generates + // an early error. Therefore, we need the third state, firstCoverInitializedNameError, to track the + // first usage of CoverInitializedName and report it when we reached the end of the parentheses pair. + // + // isolateCoverGrammar function runs the given parser function with a new cover grammar context, and it does not + // effect the current flags. This means the production the parser parses is only used as an expression. Therefore + // the CoverInitializedName check is conducted. + // + // inheritCoverGrammar function runs the given parse function with a new cover grammar context, and it propagates + // the flags outside of the parser. This means the production the parser parses is used as a part of a potential + // pattern. The CoverInitializedName check is deferred. + Parser.prototype.isolateCoverGrammar = function (parseFunction) { + var previousIsBindingElement = this.context.isBindingElement; + var previousIsAssignmentTarget = this.context.isAssignmentTarget; + var previousFirstCoverInitializedNameError = this.context.firstCoverInitializedNameError; + this.context.isBindingElement = true; + this.context.isAssignmentTarget = true; + this.context.firstCoverInitializedNameError = null; + var result = parseFunction.call(this); + if (this.context.firstCoverInitializedNameError !== null) { + this.throwUnexpectedToken(this.context.firstCoverInitializedNameError); + } + this.context.isBindingElement = previousIsBindingElement; + this.context.isAssignmentTarget = previousIsAssignmentTarget; + this.context.firstCoverInitializedNameError = previousFirstCoverInitializedNameError; + return result; + }; + Parser.prototype.inheritCoverGrammar = function (parseFunction) { + var previousIsBindingElement = this.context.isBindingElement; + var previousIsAssignmentTarget = this.context.isAssignmentTarget; + var previousFirstCoverInitializedNameError = this.context.firstCoverInitializedNameError; + this.context.isBindingElement = true; + this.context.isAssignmentTarget = true; + this.context.firstCoverInitializedNameError = null; + var result = parseFunction.call(this); + this.context.isBindingElement = this.context.isBindingElement && previousIsBindingElement; + this.context.isAssignmentTarget = this.context.isAssignmentTarget && previousIsAssignmentTarget; + this.context.firstCoverInitializedNameError = previousFirstCoverInitializedNameError || this.context.firstCoverInitializedNameError; + return result; + }; + Parser.prototype.consumeSemicolon = function () { + if (this.match(';')) { + this.nextToken(); + } + else if (!this.hasLineTerminator) { + if (this.lookahead.type !== 2 /* EOF */ && !this.match('}')) { + this.throwUnexpectedToken(this.lookahead); + } + this.lastMarker.index = this.startMarker.index; + this.lastMarker.line = this.startMarker.line; + this.lastMarker.column = this.startMarker.column; + } + }; + // https://tc39.github.io/ecma262/#sec-primary-expression + Parser.prototype.parsePrimaryExpression = function () { + var node = this.createNode(); + var expr; + var token, raw; + switch (this.lookahead.type) { + case 3 /* Identifier */: + if ((this.context.isModule || this.context.await) && this.lookahead.value === 'await') { + this.tolerateUnexpectedToken(this.lookahead); + } + expr = this.matchAsyncFunction() ? this.parseFunctionExpression() : this.finalize(node, new Node.Identifier(this.nextToken().value)); + break; + case 6 /* NumericLiteral */: + case 8 /* StringLiteral */: + if (this.context.strict && this.lookahead.octal) { + this.tolerateUnexpectedToken(this.lookahead, messages_1.Messages.StrictOctalLiteral); + } + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + token = this.nextToken(); + raw = this.getTokenRaw(token); + expr = this.finalize(node, new Node.Literal(token.value, raw)); + break; + case 1 /* BooleanLiteral */: + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + token = this.nextToken(); + raw = this.getTokenRaw(token); + expr = this.finalize(node, new Node.Literal(token.value === 'true', raw)); + break; + case 5 /* NullLiteral */: + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + token = this.nextToken(); + raw = this.getTokenRaw(token); + expr = this.finalize(node, new Node.Literal(null, raw)); + break; + case 10 /* Template */: + expr = this.parseTemplateLiteral(); + break; + case 7 /* Punctuator */: + switch (this.lookahead.value) { + case '(': + this.context.isBindingElement = false; + expr = this.inheritCoverGrammar(this.parseGroupExpression); + break; + case '[': + expr = this.inheritCoverGrammar(this.parseArrayInitializer); + break; + case '{': + expr = this.inheritCoverGrammar(this.parseObjectInitializer); + break; + case '/': + case '/=': + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + this.scanner.index = this.startMarker.index; + token = this.nextRegexToken(); + raw = this.getTokenRaw(token); + expr = this.finalize(node, new Node.RegexLiteral(token.regex, raw, token.pattern, token.flags)); + break; + default: + expr = this.throwUnexpectedToken(this.nextToken()); + } + break; + case 4 /* Keyword */: + if (!this.context.strict && this.context.allowYield && this.matchKeyword('yield')) { + expr = this.parseIdentifierName(); + } + else if (!this.context.strict && this.matchKeyword('let')) { + expr = this.finalize(node, new Node.Identifier(this.nextToken().value)); + } + else { + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + if (this.matchKeyword('function')) { + expr = this.parseFunctionExpression(); + } + else if (this.matchKeyword('this')) { + this.nextToken(); + expr = this.finalize(node, new Node.ThisExpression()); + } + else if (this.matchKeyword('class')) { + expr = this.parseClassExpression(); + } + else { + expr = this.throwUnexpectedToken(this.nextToken()); + } + } + break; + default: + expr = this.throwUnexpectedToken(this.nextToken()); + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-array-initializer + Parser.prototype.parseSpreadElement = function () { + var node = this.createNode(); + this.expect('...'); + var arg = this.inheritCoverGrammar(this.parseAssignmentExpression); + return this.finalize(node, new Node.SpreadElement(arg)); + }; + Parser.prototype.parseArrayInitializer = function () { + var node = this.createNode(); + var elements = []; + this.expect('['); + while (!this.match(']')) { + if (this.match(',')) { + this.nextToken(); + elements.push(null); + } + else if (this.match('...')) { + var element = this.parseSpreadElement(); + if (!this.match(']')) { + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + this.expect(','); + } + elements.push(element); + } + else { + elements.push(this.inheritCoverGrammar(this.parseAssignmentExpression)); + if (!this.match(']')) { + this.expect(','); + } + } + } + this.expect(']'); + return this.finalize(node, new Node.ArrayExpression(elements)); + }; + // https://tc39.github.io/ecma262/#sec-object-initializer + Parser.prototype.parsePropertyMethod = function (params) { + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + var previousStrict = this.context.strict; + var previousAllowStrictDirective = this.context.allowStrictDirective; + this.context.allowStrictDirective = params.simple; + var body = this.isolateCoverGrammar(this.parseFunctionSourceElements); + if (this.context.strict && params.firstRestricted) { + this.tolerateUnexpectedToken(params.firstRestricted, params.message); + } + if (this.context.strict && params.stricted) { + this.tolerateUnexpectedToken(params.stricted, params.message); + } + this.context.strict = previousStrict; + this.context.allowStrictDirective = previousAllowStrictDirective; + return body; + }; + Parser.prototype.parsePropertyMethodFunction = function () { + var isGenerator = false; + var node = this.createNode(); + var previousAllowYield = this.context.allowYield; + this.context.allowYield = true; + var params = this.parseFormalParameters(); + var method = this.parsePropertyMethod(params); + this.context.allowYield = previousAllowYield; + return this.finalize(node, new Node.FunctionExpression(null, params.params, method, isGenerator)); + }; + Parser.prototype.parsePropertyMethodAsyncFunction = function () { + var node = this.createNode(); + var previousAllowYield = this.context.allowYield; + var previousAwait = this.context.await; + this.context.allowYield = false; + this.context.await = true; + var params = this.parseFormalParameters(); + var method = this.parsePropertyMethod(params); + this.context.allowYield = previousAllowYield; + this.context.await = previousAwait; + return this.finalize(node, new Node.AsyncFunctionExpression(null, params.params, method)); + }; + Parser.prototype.parseObjectPropertyKey = function () { + var node = this.createNode(); + var token = this.nextToken(); + var key; + switch (token.type) { + case 8 /* StringLiteral */: + case 6 /* NumericLiteral */: + if (this.context.strict && token.octal) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictOctalLiteral); + } + var raw = this.getTokenRaw(token); + key = this.finalize(node, new Node.Literal(token.value, raw)); + break; + case 3 /* Identifier */: + case 1 /* BooleanLiteral */: + case 5 /* NullLiteral */: + case 4 /* Keyword */: + key = this.finalize(node, new Node.Identifier(token.value)); + break; + case 7 /* Punctuator */: + if (token.value === '[') { + key = this.isolateCoverGrammar(this.parseAssignmentExpression); + this.expect(']'); + } + else { + key = this.throwUnexpectedToken(token); + } + break; + default: + key = this.throwUnexpectedToken(token); + } + return key; + }; + Parser.prototype.isPropertyKey = function (key, value) { + return (key.type === syntax_1.Syntax.Identifier && key.name === value) || + (key.type === syntax_1.Syntax.Literal && key.value === value); + }; + Parser.prototype.parseObjectProperty = function (hasProto) { + var node = this.createNode(); + var token = this.lookahead; + var kind; + var key = null; + var value = null; + var computed = false; + var method = false; + var shorthand = false; + var isAsync = false; + if (token.type === 3 /* Identifier */) { + var id = token.value; + this.nextToken(); + computed = this.match('['); + isAsync = !this.hasLineTerminator && (id === 'async') && + !this.match(':') && !this.match('(') && !this.match('*') && !this.match(','); + key = isAsync ? this.parseObjectPropertyKey() : this.finalize(node, new Node.Identifier(id)); + } + else if (this.match('*')) { + this.nextToken(); + } + else { + computed = this.match('['); + key = this.parseObjectPropertyKey(); + } + var lookaheadPropertyKey = this.qualifiedPropertyName(this.lookahead); + if (token.type === 3 /* Identifier */ && !isAsync && token.value === 'get' && lookaheadPropertyKey) { + kind = 'get'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + this.context.allowYield = false; + value = this.parseGetterMethod(); + } + else if (token.type === 3 /* Identifier */ && !isAsync && token.value === 'set' && lookaheadPropertyKey) { + kind = 'set'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + value = this.parseSetterMethod(); + } + else if (token.type === 7 /* Punctuator */ && token.value === '*' && lookaheadPropertyKey) { + kind = 'init'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + value = this.parseGeneratorMethod(); + method = true; + } + else { + if (!key) { + this.throwUnexpectedToken(this.lookahead); + } + kind = 'init'; + if (this.match(':') && !isAsync) { + if (!computed && this.isPropertyKey(key, '__proto__')) { + if (hasProto.value) { + this.tolerateError(messages_1.Messages.DuplicateProtoProperty); + } + hasProto.value = true; + } + this.nextToken(); + value = this.inheritCoverGrammar(this.parseAssignmentExpression); + } + else if (this.match('(')) { + value = isAsync ? this.parsePropertyMethodAsyncFunction() : this.parsePropertyMethodFunction(); + method = true; + } + else if (token.type === 3 /* Identifier */) { + var id = this.finalize(node, new Node.Identifier(token.value)); + if (this.match('=')) { + this.context.firstCoverInitializedNameError = this.lookahead; + this.nextToken(); + shorthand = true; + var init = this.isolateCoverGrammar(this.parseAssignmentExpression); + value = this.finalize(node, new Node.AssignmentPattern(id, init)); + } + else { + shorthand = true; + value = id; + } + } + else { + this.throwUnexpectedToken(this.nextToken()); + } + } + return this.finalize(node, new Node.Property(kind, key, computed, value, method, shorthand)); + }; + Parser.prototype.parseObjectInitializer = function () { + var node = this.createNode(); + this.expect('{'); + var properties = []; + var hasProto = { value: false }; + while (!this.match('}')) { + properties.push(this.parseObjectProperty(hasProto)); + if (!this.match('}')) { + this.expectCommaSeparator(); + } + } + this.expect('}'); + return this.finalize(node, new Node.ObjectExpression(properties)); + }; + // https://tc39.github.io/ecma262/#sec-template-literals + Parser.prototype.parseTemplateHead = function () { + assert_1.assert(this.lookahead.head, 'Template literal must start with a template head'); + var node = this.createNode(); + var token = this.nextToken(); + var raw = token.value; + var cooked = token.cooked; + return this.finalize(node, new Node.TemplateElement({ raw: raw, cooked: cooked }, token.tail)); + }; + Parser.prototype.parseTemplateElement = function () { + if (this.lookahead.type !== 10 /* Template */) { + this.throwUnexpectedToken(); + } + var node = this.createNode(); + var token = this.nextToken(); + var raw = token.value; + var cooked = token.cooked; + return this.finalize(node, new Node.TemplateElement({ raw: raw, cooked: cooked }, token.tail)); + }; + Parser.prototype.parseTemplateLiteral = function () { + var node = this.createNode(); + var expressions = []; + var quasis = []; + var quasi = this.parseTemplateHead(); + quasis.push(quasi); + while (!quasi.tail) { + expressions.push(this.parseExpression()); + quasi = this.parseTemplateElement(); + quasis.push(quasi); + } + return this.finalize(node, new Node.TemplateLiteral(quasis, expressions)); + }; + // https://tc39.github.io/ecma262/#sec-grouping-operator + Parser.prototype.reinterpretExpressionAsPattern = function (expr) { + switch (expr.type) { + case syntax_1.Syntax.Identifier: + case syntax_1.Syntax.MemberExpression: + case syntax_1.Syntax.RestElement: + case syntax_1.Syntax.AssignmentPattern: + break; + case syntax_1.Syntax.SpreadElement: + expr.type = syntax_1.Syntax.RestElement; + this.reinterpretExpressionAsPattern(expr.argument); + break; + case syntax_1.Syntax.ArrayExpression: + expr.type = syntax_1.Syntax.ArrayPattern; + for (var i = 0; i < expr.elements.length; i++) { + if (expr.elements[i] !== null) { + this.reinterpretExpressionAsPattern(expr.elements[i]); + } + } + break; + case syntax_1.Syntax.ObjectExpression: + expr.type = syntax_1.Syntax.ObjectPattern; + for (var i = 0; i < expr.properties.length; i++) { + this.reinterpretExpressionAsPattern(expr.properties[i].value); + } + break; + case syntax_1.Syntax.AssignmentExpression: + expr.type = syntax_1.Syntax.AssignmentPattern; + delete expr.operator; + this.reinterpretExpressionAsPattern(expr.left); + break; + default: + // Allow other node type for tolerant parsing. + break; + } + }; + Parser.prototype.parseGroupExpression = function () { + var expr; + this.expect('('); + if (this.match(')')) { + this.nextToken(); + if (!this.match('=>')) { + this.expect('=>'); + } + expr = { + type: ArrowParameterPlaceHolder, + params: [], + async: false + }; + } + else { + var startToken = this.lookahead; + var params = []; + if (this.match('...')) { + expr = this.parseRestElement(params); + this.expect(')'); + if (!this.match('=>')) { + this.expect('=>'); + } + expr = { + type: ArrowParameterPlaceHolder, + params: [expr], + async: false + }; + } + else { + var arrow = false; + this.context.isBindingElement = true; + expr = this.inheritCoverGrammar(this.parseAssignmentExpression); + if (this.match(',')) { + var expressions = []; + this.context.isAssignmentTarget = false; + expressions.push(expr); + while (this.lookahead.type !== 2 /* EOF */) { + if (!this.match(',')) { + break; + } + this.nextToken(); + if (this.match(')')) { + this.nextToken(); + for (var i = 0; i < expressions.length; i++) { + this.reinterpretExpressionAsPattern(expressions[i]); + } + arrow = true; + expr = { + type: ArrowParameterPlaceHolder, + params: expressions, + async: false + }; + } + else if (this.match('...')) { + if (!this.context.isBindingElement) { + this.throwUnexpectedToken(this.lookahead); + } + expressions.push(this.parseRestElement(params)); + this.expect(')'); + if (!this.match('=>')) { + this.expect('=>'); + } + this.context.isBindingElement = false; + for (var i = 0; i < expressions.length; i++) { + this.reinterpretExpressionAsPattern(expressions[i]); + } + arrow = true; + expr = { + type: ArrowParameterPlaceHolder, + params: expressions, + async: false + }; + } + else { + expressions.push(this.inheritCoverGrammar(this.parseAssignmentExpression)); + } + if (arrow) { + break; + } + } + if (!arrow) { + expr = this.finalize(this.startNode(startToken), new Node.SequenceExpression(expressions)); + } + } + if (!arrow) { + this.expect(')'); + if (this.match('=>')) { + if (expr.type === syntax_1.Syntax.Identifier && expr.name === 'yield') { + arrow = true; + expr = { + type: ArrowParameterPlaceHolder, + params: [expr], + async: false + }; + } + if (!arrow) { + if (!this.context.isBindingElement) { + this.throwUnexpectedToken(this.lookahead); + } + if (expr.type === syntax_1.Syntax.SequenceExpression) { + for (var i = 0; i < expr.expressions.length; i++) { + this.reinterpretExpressionAsPattern(expr.expressions[i]); + } + } + else { + this.reinterpretExpressionAsPattern(expr); + } + var parameters = (expr.type === syntax_1.Syntax.SequenceExpression ? expr.expressions : [expr]); + expr = { + type: ArrowParameterPlaceHolder, + params: parameters, + async: false + }; + } + } + this.context.isBindingElement = false; + } + } + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-left-hand-side-expressions + Parser.prototype.parseArguments = function () { + this.expect('('); + var args = []; + if (!this.match(')')) { + while (true) { + var expr = this.match('...') ? this.parseSpreadElement() : + this.isolateCoverGrammar(this.parseAssignmentExpression); + args.push(expr); + if (this.match(')')) { + break; + } + this.expectCommaSeparator(); + if (this.match(')')) { + break; + } + } + } + this.expect(')'); + return args; + }; + Parser.prototype.isIdentifierName = function (token) { + return token.type === 3 /* Identifier */ || + token.type === 4 /* Keyword */ || + token.type === 1 /* BooleanLiteral */ || + token.type === 5 /* NullLiteral */; + }; + Parser.prototype.parseIdentifierName = function () { + var node = this.createNode(); + var token = this.nextToken(); + if (!this.isIdentifierName(token)) { + this.throwUnexpectedToken(token); + } + return this.finalize(node, new Node.Identifier(token.value)); + }; + Parser.prototype.parseNewExpression = function () { + var node = this.createNode(); + var id = this.parseIdentifierName(); + assert_1.assert(id.name === 'new', 'New expression must start with `new`'); + var expr; + if (this.match('.')) { + this.nextToken(); + if (this.lookahead.type === 3 /* Identifier */ && this.context.inFunctionBody && this.lookahead.value === 'target') { + var property = this.parseIdentifierName(); + expr = new Node.MetaProperty(id, property); + } + else { + this.throwUnexpectedToken(this.lookahead); + } + } + else { + var callee = this.isolateCoverGrammar(this.parseLeftHandSideExpression); + var args = this.match('(') ? this.parseArguments() : []; + expr = new Node.NewExpression(callee, args); + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + } + return this.finalize(node, expr); + }; + Parser.prototype.parseAsyncArgument = function () { + var arg = this.parseAssignmentExpression(); + this.context.firstCoverInitializedNameError = null; + return arg; + }; + Parser.prototype.parseAsyncArguments = function () { + this.expect('('); + var args = []; + if (!this.match(')')) { + while (true) { + var expr = this.match('...') ? this.parseSpreadElement() : + this.isolateCoverGrammar(this.parseAsyncArgument); + args.push(expr); + if (this.match(')')) { + break; + } + this.expectCommaSeparator(); + if (this.match(')')) { + break; + } + } + } + this.expect(')'); + return args; + }; + Parser.prototype.parseLeftHandSideExpressionAllowCall = function () { + var startToken = this.lookahead; + var maybeAsync = this.matchContextualKeyword('async'); + var previousAllowIn = this.context.allowIn; + this.context.allowIn = true; + var expr; + if (this.matchKeyword('super') && this.context.inFunctionBody) { + expr = this.createNode(); + this.nextToken(); + expr = this.finalize(expr, new Node.Super()); + if (!this.match('(') && !this.match('.') && !this.match('[')) { + this.throwUnexpectedToken(this.lookahead); + } + } + else { + expr = this.inheritCoverGrammar(this.matchKeyword('new') ? this.parseNewExpression : this.parsePrimaryExpression); + } + while (true) { + if (this.match('.')) { + this.context.isBindingElement = false; + this.context.isAssignmentTarget = true; + this.expect('.'); + var property = this.parseIdentifierName(); + expr = this.finalize(this.startNode(startToken), new Node.StaticMemberExpression(expr, property)); + } + else if (this.match('(')) { + var asyncArrow = maybeAsync && (startToken.lineNumber === this.lookahead.lineNumber); + this.context.isBindingElement = false; + this.context.isAssignmentTarget = false; + var args = asyncArrow ? this.parseAsyncArguments() : this.parseArguments(); + expr = this.finalize(this.startNode(startToken), new Node.CallExpression(expr, args)); + if (asyncArrow && this.match('=>')) { + for (var i = 0; i < args.length; ++i) { + this.reinterpretExpressionAsPattern(args[i]); + } + expr = { + type: ArrowParameterPlaceHolder, + params: args, + async: true + }; + } + } + else if (this.match('[')) { + this.context.isBindingElement = false; + this.context.isAssignmentTarget = true; + this.expect('['); + var property = this.isolateCoverGrammar(this.parseExpression); + this.expect(']'); + expr = this.finalize(this.startNode(startToken), new Node.ComputedMemberExpression(expr, property)); + } + else if (this.lookahead.type === 10 /* Template */ && this.lookahead.head) { + var quasi = this.parseTemplateLiteral(); + expr = this.finalize(this.startNode(startToken), new Node.TaggedTemplateExpression(expr, quasi)); + } + else { + break; + } + } + this.context.allowIn = previousAllowIn; + return expr; + }; + Parser.prototype.parseSuper = function () { + var node = this.createNode(); + this.expectKeyword('super'); + if (!this.match('[') && !this.match('.')) { + this.throwUnexpectedToken(this.lookahead); + } + return this.finalize(node, new Node.Super()); + }; + Parser.prototype.parseLeftHandSideExpression = function () { + assert_1.assert(this.context.allowIn, 'callee of new expression always allow in keyword.'); + var node = this.startNode(this.lookahead); + var expr = (this.matchKeyword('super') && this.context.inFunctionBody) ? this.parseSuper() : + this.inheritCoverGrammar(this.matchKeyword('new') ? this.parseNewExpression : this.parsePrimaryExpression); + while (true) { + if (this.match('[')) { + this.context.isBindingElement = false; + this.context.isAssignmentTarget = true; + this.expect('['); + var property = this.isolateCoverGrammar(this.parseExpression); + this.expect(']'); + expr = this.finalize(node, new Node.ComputedMemberExpression(expr, property)); + } + else if (this.match('.')) { + this.context.isBindingElement = false; + this.context.isAssignmentTarget = true; + this.expect('.'); + var property = this.parseIdentifierName(); + expr = this.finalize(node, new Node.StaticMemberExpression(expr, property)); + } + else if (this.lookahead.type === 10 /* Template */ && this.lookahead.head) { + var quasi = this.parseTemplateLiteral(); + expr = this.finalize(node, new Node.TaggedTemplateExpression(expr, quasi)); + } + else { + break; + } + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-update-expressions + Parser.prototype.parseUpdateExpression = function () { + var expr; + var startToken = this.lookahead; + if (this.match('++') || this.match('--')) { + var node = this.startNode(startToken); + var token = this.nextToken(); + expr = this.inheritCoverGrammar(this.parseUnaryExpression); + if (this.context.strict && expr.type === syntax_1.Syntax.Identifier && this.scanner.isRestrictedWord(expr.name)) { + this.tolerateError(messages_1.Messages.StrictLHSPrefix); + } + if (!this.context.isAssignmentTarget) { + this.tolerateError(messages_1.Messages.InvalidLHSInAssignment); + } + var prefix = true; + expr = this.finalize(node, new Node.UpdateExpression(token.value, expr, prefix)); + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + } + else { + expr = this.inheritCoverGrammar(this.parseLeftHandSideExpressionAllowCall); + if (!this.hasLineTerminator && this.lookahead.type === 7 /* Punctuator */) { + if (this.match('++') || this.match('--')) { + if (this.context.strict && expr.type === syntax_1.Syntax.Identifier && this.scanner.isRestrictedWord(expr.name)) { + this.tolerateError(messages_1.Messages.StrictLHSPostfix); + } + if (!this.context.isAssignmentTarget) { + this.tolerateError(messages_1.Messages.InvalidLHSInAssignment); + } + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + var operator = this.nextToken().value; + var prefix = false; + expr = this.finalize(this.startNode(startToken), new Node.UpdateExpression(operator, expr, prefix)); + } + } + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-unary-operators + Parser.prototype.parseAwaitExpression = function () { + var node = this.createNode(); + this.nextToken(); + var argument = this.parseUnaryExpression(); + return this.finalize(node, new Node.AwaitExpression(argument)); + }; + Parser.prototype.parseUnaryExpression = function () { + var expr; + if (this.match('+') || this.match('-') || this.match('~') || this.match('!') || + this.matchKeyword('delete') || this.matchKeyword('void') || this.matchKeyword('typeof')) { + var node = this.startNode(this.lookahead); + var token = this.nextToken(); + expr = this.inheritCoverGrammar(this.parseUnaryExpression); + expr = this.finalize(node, new Node.UnaryExpression(token.value, expr)); + if (this.context.strict && expr.operator === 'delete' && expr.argument.type === syntax_1.Syntax.Identifier) { + this.tolerateError(messages_1.Messages.StrictDelete); + } + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + } + else if (this.context.await && this.matchContextualKeyword('await')) { + expr = this.parseAwaitExpression(); + } + else { + expr = this.parseUpdateExpression(); + } + return expr; + }; + Parser.prototype.parseExponentiationExpression = function () { + var startToken = this.lookahead; + var expr = this.inheritCoverGrammar(this.parseUnaryExpression); + if (expr.type !== syntax_1.Syntax.UnaryExpression && this.match('**')) { + this.nextToken(); + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + var left = expr; + var right = this.isolateCoverGrammar(this.parseExponentiationExpression); + expr = this.finalize(this.startNode(startToken), new Node.BinaryExpression('**', left, right)); + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-exp-operator + // https://tc39.github.io/ecma262/#sec-multiplicative-operators + // https://tc39.github.io/ecma262/#sec-additive-operators + // https://tc39.github.io/ecma262/#sec-bitwise-shift-operators + // https://tc39.github.io/ecma262/#sec-relational-operators + // https://tc39.github.io/ecma262/#sec-equality-operators + // https://tc39.github.io/ecma262/#sec-binary-bitwise-operators + // https://tc39.github.io/ecma262/#sec-binary-logical-operators + Parser.prototype.binaryPrecedence = function (token) { + var op = token.value; + var precedence; + if (token.type === 7 /* Punctuator */) { + precedence = this.operatorPrecedence[op] || 0; + } + else if (token.type === 4 /* Keyword */) { + precedence = (op === 'instanceof' || (this.context.allowIn && op === 'in')) ? 7 : 0; + } + else { + precedence = 0; + } + return precedence; + }; + Parser.prototype.parseBinaryExpression = function () { + var startToken = this.lookahead; + var expr = this.inheritCoverGrammar(this.parseExponentiationExpression); + var token = this.lookahead; + var prec = this.binaryPrecedence(token); + if (prec > 0) { + this.nextToken(); + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + var markers = [startToken, this.lookahead]; + var left = expr; + var right = this.isolateCoverGrammar(this.parseExponentiationExpression); + var stack = [left, token.value, right]; + var precedences = [prec]; + while (true) { + prec = this.binaryPrecedence(this.lookahead); + if (prec <= 0) { + break; + } + // Reduce: make a binary expression from the three topmost entries. + while ((stack.length > 2) && (prec <= precedences[precedences.length - 1])) { + right = stack.pop(); + var operator = stack.pop(); + precedences.pop(); + left = stack.pop(); + markers.pop(); + var node = this.startNode(markers[markers.length - 1]); + stack.push(this.finalize(node, new Node.BinaryExpression(operator, left, right))); + } + // Shift. + stack.push(this.nextToken().value); + precedences.push(prec); + markers.push(this.lookahead); + stack.push(this.isolateCoverGrammar(this.parseExponentiationExpression)); + } + // Final reduce to clean-up the stack. + var i = stack.length - 1; + expr = stack[i]; + var lastMarker = markers.pop(); + while (i > 1) { + var marker = markers.pop(); + var lastLineStart = lastMarker && lastMarker.lineStart; + var node = this.startNode(marker, lastLineStart); + var operator = stack[i - 1]; + expr = this.finalize(node, new Node.BinaryExpression(operator, stack[i - 2], expr)); + i -= 2; + lastMarker = marker; + } + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-conditional-operator + Parser.prototype.parseConditionalExpression = function () { + var startToken = this.lookahead; + var expr = this.inheritCoverGrammar(this.parseBinaryExpression); + if (this.match('?')) { + this.nextToken(); + var previousAllowIn = this.context.allowIn; + this.context.allowIn = true; + var consequent = this.isolateCoverGrammar(this.parseAssignmentExpression); + this.context.allowIn = previousAllowIn; + this.expect(':'); + var alternate = this.isolateCoverGrammar(this.parseAssignmentExpression); + expr = this.finalize(this.startNode(startToken), new Node.ConditionalExpression(expr, consequent, alternate)); + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-assignment-operators + Parser.prototype.checkPatternParam = function (options, param) { + switch (param.type) { + case syntax_1.Syntax.Identifier: + this.validateParam(options, param, param.name); + break; + case syntax_1.Syntax.RestElement: + this.checkPatternParam(options, param.argument); + break; + case syntax_1.Syntax.AssignmentPattern: + this.checkPatternParam(options, param.left); + break; + case syntax_1.Syntax.ArrayPattern: + for (var i = 0; i < param.elements.length; i++) { + if (param.elements[i] !== null) { + this.checkPatternParam(options, param.elements[i]); + } + } + break; + case syntax_1.Syntax.ObjectPattern: + for (var i = 0; i < param.properties.length; i++) { + this.checkPatternParam(options, param.properties[i].value); + } + break; + default: + break; + } + options.simple = options.simple && (param instanceof Node.Identifier); + }; + Parser.prototype.reinterpretAsCoverFormalsList = function (expr) { + var params = [expr]; + var options; + var asyncArrow = false; + switch (expr.type) { + case syntax_1.Syntax.Identifier: + break; + case ArrowParameterPlaceHolder: + params = expr.params; + asyncArrow = expr.async; + break; + default: + return null; + } + options = { + simple: true, + paramSet: {} + }; + for (var i = 0; i < params.length; ++i) { + var param = params[i]; + if (param.type === syntax_1.Syntax.AssignmentPattern) { + if (param.right.type === syntax_1.Syntax.YieldExpression) { + if (param.right.argument) { + this.throwUnexpectedToken(this.lookahead); + } + param.right.type = syntax_1.Syntax.Identifier; + param.right.name = 'yield'; + delete param.right.argument; + delete param.right.delegate; + } + } + else if (asyncArrow && param.type === syntax_1.Syntax.Identifier && param.name === 'await') { + this.throwUnexpectedToken(this.lookahead); + } + this.checkPatternParam(options, param); + params[i] = param; + } + if (this.context.strict || !this.context.allowYield) { + for (var i = 0; i < params.length; ++i) { + var param = params[i]; + if (param.type === syntax_1.Syntax.YieldExpression) { + this.throwUnexpectedToken(this.lookahead); + } + } + } + if (options.message === messages_1.Messages.StrictParamDupe) { + var token = this.context.strict ? options.stricted : options.firstRestricted; + this.throwUnexpectedToken(token, options.message); + } + return { + simple: options.simple, + params: params, + stricted: options.stricted, + firstRestricted: options.firstRestricted, + message: options.message + }; + }; + Parser.prototype.parseAssignmentExpression = function () { + var expr; + if (!this.context.allowYield && this.matchKeyword('yield')) { + expr = this.parseYieldExpression(); + } + else { + var startToken = this.lookahead; + var token = startToken; + expr = this.parseConditionalExpression(); + if (token.type === 3 /* Identifier */ && (token.lineNumber === this.lookahead.lineNumber) && token.value === 'async') { + if (this.lookahead.type === 3 /* Identifier */ || this.matchKeyword('yield')) { + var arg = this.parsePrimaryExpression(); + this.reinterpretExpressionAsPattern(arg); + expr = { + type: ArrowParameterPlaceHolder, + params: [arg], + async: true + }; + } + } + if (expr.type === ArrowParameterPlaceHolder || this.match('=>')) { + // https://tc39.github.io/ecma262/#sec-arrow-function-definitions + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + var isAsync = expr.async; + var list = this.reinterpretAsCoverFormalsList(expr); + if (list) { + if (this.hasLineTerminator) { + this.tolerateUnexpectedToken(this.lookahead); + } + this.context.firstCoverInitializedNameError = null; + var previousStrict = this.context.strict; + var previousAllowStrictDirective = this.context.allowStrictDirective; + this.context.allowStrictDirective = list.simple; + var previousAllowYield = this.context.allowYield; + var previousAwait = this.context.await; + this.context.allowYield = true; + this.context.await = isAsync; + var node = this.startNode(startToken); + this.expect('=>'); + var body = void 0; + if (this.match('{')) { + var previousAllowIn = this.context.allowIn; + this.context.allowIn = true; + body = this.parseFunctionSourceElements(); + this.context.allowIn = previousAllowIn; + } + else { + body = this.isolateCoverGrammar(this.parseAssignmentExpression); + } + var expression = body.type !== syntax_1.Syntax.BlockStatement; + if (this.context.strict && list.firstRestricted) { + this.throwUnexpectedToken(list.firstRestricted, list.message); + } + if (this.context.strict && list.stricted) { + this.tolerateUnexpectedToken(list.stricted, list.message); + } + expr = isAsync ? this.finalize(node, new Node.AsyncArrowFunctionExpression(list.params, body, expression)) : + this.finalize(node, new Node.ArrowFunctionExpression(list.params, body, expression)); + this.context.strict = previousStrict; + this.context.allowStrictDirective = previousAllowStrictDirective; + this.context.allowYield = previousAllowYield; + this.context.await = previousAwait; + } + } + else { + if (this.matchAssign()) { + if (!this.context.isAssignmentTarget) { + this.tolerateError(messages_1.Messages.InvalidLHSInAssignment); + } + if (this.context.strict && expr.type === syntax_1.Syntax.Identifier) { + var id = expr; + if (this.scanner.isRestrictedWord(id.name)) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictLHSAssignment); + } + if (this.scanner.isStrictModeReservedWord(id.name)) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictReservedWord); + } + } + if (!this.match('=')) { + this.context.isAssignmentTarget = false; + this.context.isBindingElement = false; + } + else { + this.reinterpretExpressionAsPattern(expr); + } + token = this.nextToken(); + var operator = token.value; + var right = this.isolateCoverGrammar(this.parseAssignmentExpression); + expr = this.finalize(this.startNode(startToken), new Node.AssignmentExpression(operator, expr, right)); + this.context.firstCoverInitializedNameError = null; + } + } + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-comma-operator + Parser.prototype.parseExpression = function () { + var startToken = this.lookahead; + var expr = this.isolateCoverGrammar(this.parseAssignmentExpression); + if (this.match(',')) { + var expressions = []; + expressions.push(expr); + while (this.lookahead.type !== 2 /* EOF */) { + if (!this.match(',')) { + break; + } + this.nextToken(); + expressions.push(this.isolateCoverGrammar(this.parseAssignmentExpression)); + } + expr = this.finalize(this.startNode(startToken), new Node.SequenceExpression(expressions)); + } + return expr; + }; + // https://tc39.github.io/ecma262/#sec-block + Parser.prototype.parseStatementListItem = function () { + var statement; + this.context.isAssignmentTarget = true; + this.context.isBindingElement = true; + if (this.lookahead.type === 4 /* Keyword */) { + switch (this.lookahead.value) { + case 'export': + if (!this.context.isModule) { + this.tolerateUnexpectedToken(this.lookahead, messages_1.Messages.IllegalExportDeclaration); + } + statement = this.parseExportDeclaration(); + break; + case 'import': + if (!this.context.isModule) { + this.tolerateUnexpectedToken(this.lookahead, messages_1.Messages.IllegalImportDeclaration); + } + statement = this.parseImportDeclaration(); + break; + case 'const': + statement = this.parseLexicalDeclaration({ inFor: false }); + break; + case 'function': + statement = this.parseFunctionDeclaration(); + break; + case 'class': + statement = this.parseClassDeclaration(); + break; + case 'let': + statement = this.isLexicalDeclaration() ? this.parseLexicalDeclaration({ inFor: false }) : this.parseStatement(); + break; + default: + statement = this.parseStatement(); + break; + } + } + else { + statement = this.parseStatement(); + } + return statement; + }; + Parser.prototype.parseBlock = function () { + var node = this.createNode(); + this.expect('{'); + var block = []; + while (true) { + if (this.match('}')) { + break; + } + block.push(this.parseStatementListItem()); + } + this.expect('}'); + return this.finalize(node, new Node.BlockStatement(block)); + }; + // https://tc39.github.io/ecma262/#sec-let-and-const-declarations + Parser.prototype.parseLexicalBinding = function (kind, options) { + var node = this.createNode(); + var params = []; + var id = this.parsePattern(params, kind); + if (this.context.strict && id.type === syntax_1.Syntax.Identifier) { + if (this.scanner.isRestrictedWord(id.name)) { + this.tolerateError(messages_1.Messages.StrictVarName); + } + } + var init = null; + if (kind === 'const') { + if (!this.matchKeyword('in') && !this.matchContextualKeyword('of')) { + if (this.match('=')) { + this.nextToken(); + init = this.isolateCoverGrammar(this.parseAssignmentExpression); + } + else { + this.throwError(messages_1.Messages.DeclarationMissingInitializer, 'const'); + } + } + } + else if ((!options.inFor && id.type !== syntax_1.Syntax.Identifier) || this.match('=')) { + this.expect('='); + init = this.isolateCoverGrammar(this.parseAssignmentExpression); + } + return this.finalize(node, new Node.VariableDeclarator(id, init)); + }; + Parser.prototype.parseBindingList = function (kind, options) { + var list = [this.parseLexicalBinding(kind, options)]; + while (this.match(',')) { + this.nextToken(); + list.push(this.parseLexicalBinding(kind, options)); + } + return list; + }; + Parser.prototype.isLexicalDeclaration = function () { + var state = this.scanner.saveState(); + this.scanner.scanComments(); + var next = this.scanner.lex(); + this.scanner.restoreState(state); + return (next.type === 3 /* Identifier */) || + (next.type === 7 /* Punctuator */ && next.value === '[') || + (next.type === 7 /* Punctuator */ && next.value === '{') || + (next.type === 4 /* Keyword */ && next.value === 'let') || + (next.type === 4 /* Keyword */ && next.value === 'yield'); + }; + Parser.prototype.parseLexicalDeclaration = function (options) { + var node = this.createNode(); + var kind = this.nextToken().value; + assert_1.assert(kind === 'let' || kind === 'const', 'Lexical declaration must be either let or const'); + var declarations = this.parseBindingList(kind, options); + this.consumeSemicolon(); + return this.finalize(node, new Node.VariableDeclaration(declarations, kind)); + }; + // https://tc39.github.io/ecma262/#sec-destructuring-binding-patterns + Parser.prototype.parseBindingRestElement = function (params, kind) { + var node = this.createNode(); + this.expect('...'); + var arg = this.parsePattern(params, kind); + return this.finalize(node, new Node.RestElement(arg)); + }; + Parser.prototype.parseArrayPattern = function (params, kind) { + var node = this.createNode(); + this.expect('['); + var elements = []; + while (!this.match(']')) { + if (this.match(',')) { + this.nextToken(); + elements.push(null); + } + else { + if (this.match('...')) { + elements.push(this.parseBindingRestElement(params, kind)); + break; + } + else { + elements.push(this.parsePatternWithDefault(params, kind)); + } + if (!this.match(']')) { + this.expect(','); + } + } + } + this.expect(']'); + return this.finalize(node, new Node.ArrayPattern(elements)); + }; + Parser.prototype.parsePropertyPattern = function (params, kind) { + var node = this.createNode(); + var computed = false; + var shorthand = false; + var method = false; + var key; + var value; + if (this.lookahead.type === 3 /* Identifier */) { + var keyToken = this.lookahead; + key = this.parseVariableIdentifier(); + var init = this.finalize(node, new Node.Identifier(keyToken.value)); + if (this.match('=')) { + params.push(keyToken); + shorthand = true; + this.nextToken(); + var expr = this.parseAssignmentExpression(); + value = this.finalize(this.startNode(keyToken), new Node.AssignmentPattern(init, expr)); + } + else if (!this.match(':')) { + params.push(keyToken); + shorthand = true; + value = init; + } + else { + this.expect(':'); + value = this.parsePatternWithDefault(params, kind); + } + } + else { + computed = this.match('['); + key = this.parseObjectPropertyKey(); + this.expect(':'); + value = this.parsePatternWithDefault(params, kind); + } + return this.finalize(node, new Node.Property('init', key, computed, value, method, shorthand)); + }; + Parser.prototype.parseObjectPattern = function (params, kind) { + var node = this.createNode(); + var properties = []; + this.expect('{'); + while (!this.match('}')) { + properties.push(this.parsePropertyPattern(params, kind)); + if (!this.match('}')) { + this.expect(','); + } + } + this.expect('}'); + return this.finalize(node, new Node.ObjectPattern(properties)); + }; + Parser.prototype.parsePattern = function (params, kind) { + var pattern; + if (this.match('[')) { + pattern = this.parseArrayPattern(params, kind); + } + else if (this.match('{')) { + pattern = this.parseObjectPattern(params, kind); + } + else { + if (this.matchKeyword('let') && (kind === 'const' || kind === 'let')) { + this.tolerateUnexpectedToken(this.lookahead, messages_1.Messages.LetInLexicalBinding); + } + params.push(this.lookahead); + pattern = this.parseVariableIdentifier(kind); + } + return pattern; + }; + Parser.prototype.parsePatternWithDefault = function (params, kind) { + var startToken = this.lookahead; + var pattern = this.parsePattern(params, kind); + if (this.match('=')) { + this.nextToken(); + var previousAllowYield = this.context.allowYield; + this.context.allowYield = true; + var right = this.isolateCoverGrammar(this.parseAssignmentExpression); + this.context.allowYield = previousAllowYield; + pattern = this.finalize(this.startNode(startToken), new Node.AssignmentPattern(pattern, right)); + } + return pattern; + }; + // https://tc39.github.io/ecma262/#sec-variable-statement + Parser.prototype.parseVariableIdentifier = function (kind) { + var node = this.createNode(); + var token = this.nextToken(); + if (token.type === 4 /* Keyword */ && token.value === 'yield') { + if (this.context.strict) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictReservedWord); + } + else if (!this.context.allowYield) { + this.throwUnexpectedToken(token); + } + } + else if (token.type !== 3 /* Identifier */) { + if (this.context.strict && token.type === 4 /* Keyword */ && this.scanner.isStrictModeReservedWord(token.value)) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictReservedWord); + } + else { + if (this.context.strict || token.value !== 'let' || kind !== 'var') { + this.throwUnexpectedToken(token); + } + } + } + else if ((this.context.isModule || this.context.await) && token.type === 3 /* Identifier */ && token.value === 'await') { + this.tolerateUnexpectedToken(token); + } + return this.finalize(node, new Node.Identifier(token.value)); + }; + Parser.prototype.parseVariableDeclaration = function (options) { + var node = this.createNode(); + var params = []; + var id = this.parsePattern(params, 'var'); + if (this.context.strict && id.type === syntax_1.Syntax.Identifier) { + if (this.scanner.isRestrictedWord(id.name)) { + this.tolerateError(messages_1.Messages.StrictVarName); + } + } + var init = null; + if (this.match('=')) { + this.nextToken(); + init = this.isolateCoverGrammar(this.parseAssignmentExpression); + } + else if (id.type !== syntax_1.Syntax.Identifier && !options.inFor) { + this.expect('='); + } + return this.finalize(node, new Node.VariableDeclarator(id, init)); + }; + Parser.prototype.parseVariableDeclarationList = function (options) { + var opt = { inFor: options.inFor }; + var list = []; + list.push(this.parseVariableDeclaration(opt)); + while (this.match(',')) { + this.nextToken(); + list.push(this.parseVariableDeclaration(opt)); + } + return list; + }; + Parser.prototype.parseVariableStatement = function () { + var node = this.createNode(); + this.expectKeyword('var'); + var declarations = this.parseVariableDeclarationList({ inFor: false }); + this.consumeSemicolon(); + return this.finalize(node, new Node.VariableDeclaration(declarations, 'var')); + }; + // https://tc39.github.io/ecma262/#sec-empty-statement + Parser.prototype.parseEmptyStatement = function () { + var node = this.createNode(); + this.expect(';'); + return this.finalize(node, new Node.EmptyStatement()); + }; + // https://tc39.github.io/ecma262/#sec-expression-statement + Parser.prototype.parseExpressionStatement = function () { + var node = this.createNode(); + var expr = this.parseExpression(); + this.consumeSemicolon(); + return this.finalize(node, new Node.ExpressionStatement(expr)); + }; + // https://tc39.github.io/ecma262/#sec-if-statement + Parser.prototype.parseIfClause = function () { + if (this.context.strict && this.matchKeyword('function')) { + this.tolerateError(messages_1.Messages.StrictFunction); + } + return this.parseStatement(); + }; + Parser.prototype.parseIfStatement = function () { + var node = this.createNode(); + var consequent; + var alternate = null; + this.expectKeyword('if'); + this.expect('('); + var test = this.parseExpression(); + if (!this.match(')') && this.config.tolerant) { + this.tolerateUnexpectedToken(this.nextToken()); + consequent = this.finalize(this.createNode(), new Node.EmptyStatement()); + } + else { + this.expect(')'); + consequent = this.parseIfClause(); + if (this.matchKeyword('else')) { + this.nextToken(); + alternate = this.parseIfClause(); + } + } + return this.finalize(node, new Node.IfStatement(test, consequent, alternate)); + }; + // https://tc39.github.io/ecma262/#sec-do-while-statement + Parser.prototype.parseDoWhileStatement = function () { + var node = this.createNode(); + this.expectKeyword('do'); + var previousInIteration = this.context.inIteration; + this.context.inIteration = true; + var body = this.parseStatement(); + this.context.inIteration = previousInIteration; + this.expectKeyword('while'); + this.expect('('); + var test = this.parseExpression(); + if (!this.match(')') && this.config.tolerant) { + this.tolerateUnexpectedToken(this.nextToken()); + } + else { + this.expect(')'); + if (this.match(';')) { + this.nextToken(); + } + } + return this.finalize(node, new Node.DoWhileStatement(body, test)); + }; + // https://tc39.github.io/ecma262/#sec-while-statement + Parser.prototype.parseWhileStatement = function () { + var node = this.createNode(); + var body; + this.expectKeyword('while'); + this.expect('('); + var test = this.parseExpression(); + if (!this.match(')') && this.config.tolerant) { + this.tolerateUnexpectedToken(this.nextToken()); + body = this.finalize(this.createNode(), new Node.EmptyStatement()); + } + else { + this.expect(')'); + var previousInIteration = this.context.inIteration; + this.context.inIteration = true; + body = this.parseStatement(); + this.context.inIteration = previousInIteration; + } + return this.finalize(node, new Node.WhileStatement(test, body)); + }; + // https://tc39.github.io/ecma262/#sec-for-statement + // https://tc39.github.io/ecma262/#sec-for-in-and-for-of-statements + Parser.prototype.parseForStatement = function () { + var init = null; + var test = null; + var update = null; + var forIn = true; + var left, right; + var node = this.createNode(); + this.expectKeyword('for'); + this.expect('('); + if (this.match(';')) { + this.nextToken(); + } + else { + if (this.matchKeyword('var')) { + init = this.createNode(); + this.nextToken(); + var previousAllowIn = this.context.allowIn; + this.context.allowIn = false; + var declarations = this.parseVariableDeclarationList({ inFor: true }); + this.context.allowIn = previousAllowIn; + if (declarations.length === 1 && this.matchKeyword('in')) { + var decl = declarations[0]; + if (decl.init && (decl.id.type === syntax_1.Syntax.ArrayPattern || decl.id.type === syntax_1.Syntax.ObjectPattern || this.context.strict)) { + this.tolerateError(messages_1.Messages.ForInOfLoopInitializer, 'for-in'); + } + init = this.finalize(init, new Node.VariableDeclaration(declarations, 'var')); + this.nextToken(); + left = init; + right = this.parseExpression(); + init = null; + } + else if (declarations.length === 1 && declarations[0].init === null && this.matchContextualKeyword('of')) { + init = this.finalize(init, new Node.VariableDeclaration(declarations, 'var')); + this.nextToken(); + left = init; + right = this.parseAssignmentExpression(); + init = null; + forIn = false; + } + else { + init = this.finalize(init, new Node.VariableDeclaration(declarations, 'var')); + this.expect(';'); + } + } + else if (this.matchKeyword('const') || this.matchKeyword('let')) { + init = this.createNode(); + var kind = this.nextToken().value; + if (!this.context.strict && this.lookahead.value === 'in') { + init = this.finalize(init, new Node.Identifier(kind)); + this.nextToken(); + left = init; + right = this.parseExpression(); + init = null; + } + else { + var previousAllowIn = this.context.allowIn; + this.context.allowIn = false; + var declarations = this.parseBindingList(kind, { inFor: true }); + this.context.allowIn = previousAllowIn; + if (declarations.length === 1 && declarations[0].init === null && this.matchKeyword('in')) { + init = this.finalize(init, new Node.VariableDeclaration(declarations, kind)); + this.nextToken(); + left = init; + right = this.parseExpression(); + init = null; + } + else if (declarations.length === 1 && declarations[0].init === null && this.matchContextualKeyword('of')) { + init = this.finalize(init, new Node.VariableDeclaration(declarations, kind)); + this.nextToken(); + left = init; + right = this.parseAssignmentExpression(); + init = null; + forIn = false; + } + else { + this.consumeSemicolon(); + init = this.finalize(init, new Node.VariableDeclaration(declarations, kind)); + } + } + } + else { + var initStartToken = this.lookahead; + var previousAllowIn = this.context.allowIn; + this.context.allowIn = false; + init = this.inheritCoverGrammar(this.parseAssignmentExpression); + this.context.allowIn = previousAllowIn; + if (this.matchKeyword('in')) { + if (!this.context.isAssignmentTarget || init.type === syntax_1.Syntax.AssignmentExpression) { + this.tolerateError(messages_1.Messages.InvalidLHSInForIn); + } + this.nextToken(); + this.reinterpretExpressionAsPattern(init); + left = init; + right = this.parseExpression(); + init = null; + } + else if (this.matchContextualKeyword('of')) { + if (!this.context.isAssignmentTarget || init.type === syntax_1.Syntax.AssignmentExpression) { + this.tolerateError(messages_1.Messages.InvalidLHSInForLoop); + } + this.nextToken(); + this.reinterpretExpressionAsPattern(init); + left = init; + right = this.parseAssignmentExpression(); + init = null; + forIn = false; + } + else { + if (this.match(',')) { + var initSeq = [init]; + while (this.match(',')) { + this.nextToken(); + initSeq.push(this.isolateCoverGrammar(this.parseAssignmentExpression)); + } + init = this.finalize(this.startNode(initStartToken), new Node.SequenceExpression(initSeq)); + } + this.expect(';'); + } + } + } + if (typeof left === 'undefined') { + if (!this.match(';')) { + test = this.parseExpression(); + } + this.expect(';'); + if (!this.match(')')) { + update = this.parseExpression(); + } + } + var body; + if (!this.match(')') && this.config.tolerant) { + this.tolerateUnexpectedToken(this.nextToken()); + body = this.finalize(this.createNode(), new Node.EmptyStatement()); + } + else { + this.expect(')'); + var previousInIteration = this.context.inIteration; + this.context.inIteration = true; + body = this.isolateCoverGrammar(this.parseStatement); + this.context.inIteration = previousInIteration; + } + return (typeof left === 'undefined') ? + this.finalize(node, new Node.ForStatement(init, test, update, body)) : + forIn ? this.finalize(node, new Node.ForInStatement(left, right, body)) : + this.finalize(node, new Node.ForOfStatement(left, right, body)); + }; + // https://tc39.github.io/ecma262/#sec-continue-statement + Parser.prototype.parseContinueStatement = function () { + var node = this.createNode(); + this.expectKeyword('continue'); + var label = null; + if (this.lookahead.type === 3 /* Identifier */ && !this.hasLineTerminator) { + var id = this.parseVariableIdentifier(); + label = id; + var key = '$' + id.name; + if (!Object.prototype.hasOwnProperty.call(this.context.labelSet, key)) { + this.throwError(messages_1.Messages.UnknownLabel, id.name); + } + } + this.consumeSemicolon(); + if (label === null && !this.context.inIteration) { + this.throwError(messages_1.Messages.IllegalContinue); + } + return this.finalize(node, new Node.ContinueStatement(label)); + }; + // https://tc39.github.io/ecma262/#sec-break-statement + Parser.prototype.parseBreakStatement = function () { + var node = this.createNode(); + this.expectKeyword('break'); + var label = null; + if (this.lookahead.type === 3 /* Identifier */ && !this.hasLineTerminator) { + var id = this.parseVariableIdentifier(); + var key = '$' + id.name; + if (!Object.prototype.hasOwnProperty.call(this.context.labelSet, key)) { + this.throwError(messages_1.Messages.UnknownLabel, id.name); + } + label = id; + } + this.consumeSemicolon(); + if (label === null && !this.context.inIteration && !this.context.inSwitch) { + this.throwError(messages_1.Messages.IllegalBreak); + } + return this.finalize(node, new Node.BreakStatement(label)); + }; + // https://tc39.github.io/ecma262/#sec-return-statement + Parser.prototype.parseReturnStatement = function () { + if (!this.context.inFunctionBody) { + this.tolerateError(messages_1.Messages.IllegalReturn); + } + var node = this.createNode(); + this.expectKeyword('return'); + var hasArgument = (!this.match(';') && !this.match('}') && + !this.hasLineTerminator && this.lookahead.type !== 2 /* EOF */) || + this.lookahead.type === 8 /* StringLiteral */ || + this.lookahead.type === 10 /* Template */; + var argument = hasArgument ? this.parseExpression() : null; + this.consumeSemicolon(); + return this.finalize(node, new Node.ReturnStatement(argument)); + }; + // https://tc39.github.io/ecma262/#sec-with-statement + Parser.prototype.parseWithStatement = function () { + if (this.context.strict) { + this.tolerateError(messages_1.Messages.StrictModeWith); + } + var node = this.createNode(); + var body; + this.expectKeyword('with'); + this.expect('('); + var object = this.parseExpression(); + if (!this.match(')') && this.config.tolerant) { + this.tolerateUnexpectedToken(this.nextToken()); + body = this.finalize(this.createNode(), new Node.EmptyStatement()); + } + else { + this.expect(')'); + body = this.parseStatement(); + } + return this.finalize(node, new Node.WithStatement(object, body)); + }; + // https://tc39.github.io/ecma262/#sec-switch-statement + Parser.prototype.parseSwitchCase = function () { + var node = this.createNode(); + var test; + if (this.matchKeyword('default')) { + this.nextToken(); + test = null; + } + else { + this.expectKeyword('case'); + test = this.parseExpression(); + } + this.expect(':'); + var consequent = []; + while (true) { + if (this.match('}') || this.matchKeyword('default') || this.matchKeyword('case')) { + break; + } + consequent.push(this.parseStatementListItem()); + } + return this.finalize(node, new Node.SwitchCase(test, consequent)); + }; + Parser.prototype.parseSwitchStatement = function () { + var node = this.createNode(); + this.expectKeyword('switch'); + this.expect('('); + var discriminant = this.parseExpression(); + this.expect(')'); + var previousInSwitch = this.context.inSwitch; + this.context.inSwitch = true; + var cases = []; + var defaultFound = false; + this.expect('{'); + while (true) { + if (this.match('}')) { + break; + } + var clause = this.parseSwitchCase(); + if (clause.test === null) { + if (defaultFound) { + this.throwError(messages_1.Messages.MultipleDefaultsInSwitch); + } + defaultFound = true; + } + cases.push(clause); + } + this.expect('}'); + this.context.inSwitch = previousInSwitch; + return this.finalize(node, new Node.SwitchStatement(discriminant, cases)); + }; + // https://tc39.github.io/ecma262/#sec-labelled-statements + Parser.prototype.parseLabelledStatement = function () { + var node = this.createNode(); + var expr = this.parseExpression(); + var statement; + if ((expr.type === syntax_1.Syntax.Identifier) && this.match(':')) { + this.nextToken(); + var id = expr; + var key = '$' + id.name; + if (Object.prototype.hasOwnProperty.call(this.context.labelSet, key)) { + this.throwError(messages_1.Messages.Redeclaration, 'Label', id.name); + } + this.context.labelSet[key] = true; + var body = void 0; + if (this.matchKeyword('class')) { + this.tolerateUnexpectedToken(this.lookahead); + body = this.parseClassDeclaration(); + } + else if (this.matchKeyword('function')) { + var token = this.lookahead; + var declaration = this.parseFunctionDeclaration(); + if (this.context.strict) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictFunction); + } + else if (declaration.generator) { + this.tolerateUnexpectedToken(token, messages_1.Messages.GeneratorInLegacyContext); + } + body = declaration; + } + else { + body = this.parseStatement(); + } + delete this.context.labelSet[key]; + statement = new Node.LabeledStatement(id, body); + } + else { + this.consumeSemicolon(); + statement = new Node.ExpressionStatement(expr); + } + return this.finalize(node, statement); + }; + // https://tc39.github.io/ecma262/#sec-throw-statement + Parser.prototype.parseThrowStatement = function () { + var node = this.createNode(); + this.expectKeyword('throw'); + if (this.hasLineTerminator) { + this.throwError(messages_1.Messages.NewlineAfterThrow); + } + var argument = this.parseExpression(); + this.consumeSemicolon(); + return this.finalize(node, new Node.ThrowStatement(argument)); + }; + // https://tc39.github.io/ecma262/#sec-try-statement + Parser.prototype.parseCatchClause = function () { + var node = this.createNode(); + this.expectKeyword('catch'); + this.expect('('); + if (this.match(')')) { + this.throwUnexpectedToken(this.lookahead); + } + var params = []; + var param = this.parsePattern(params); + var paramMap = {}; + for (var i = 0; i < params.length; i++) { + var key = '$' + params[i].value; + if (Object.prototype.hasOwnProperty.call(paramMap, key)) { + this.tolerateError(messages_1.Messages.DuplicateBinding, params[i].value); + } + paramMap[key] = true; + } + if (this.context.strict && param.type === syntax_1.Syntax.Identifier) { + if (this.scanner.isRestrictedWord(param.name)) { + this.tolerateError(messages_1.Messages.StrictCatchVariable); + } + } + this.expect(')'); + var body = this.parseBlock(); + return this.finalize(node, new Node.CatchClause(param, body)); + }; + Parser.prototype.parseFinallyClause = function () { + this.expectKeyword('finally'); + return this.parseBlock(); + }; + Parser.prototype.parseTryStatement = function () { + var node = this.createNode(); + this.expectKeyword('try'); + var block = this.parseBlock(); + var handler = this.matchKeyword('catch') ? this.parseCatchClause() : null; + var finalizer = this.matchKeyword('finally') ? this.parseFinallyClause() : null; + if (!handler && !finalizer) { + this.throwError(messages_1.Messages.NoCatchOrFinally); + } + return this.finalize(node, new Node.TryStatement(block, handler, finalizer)); + }; + // https://tc39.github.io/ecma262/#sec-debugger-statement + Parser.prototype.parseDebuggerStatement = function () { + var node = this.createNode(); + this.expectKeyword('debugger'); + this.consumeSemicolon(); + return this.finalize(node, new Node.DebuggerStatement()); + }; + // https://tc39.github.io/ecma262/#sec-ecmascript-language-statements-and-declarations + Parser.prototype.parseStatement = function () { + var statement; + switch (this.lookahead.type) { + case 1 /* BooleanLiteral */: + case 5 /* NullLiteral */: + case 6 /* NumericLiteral */: + case 8 /* StringLiteral */: + case 10 /* Template */: + case 9 /* RegularExpression */: + statement = this.parseExpressionStatement(); + break; + case 7 /* Punctuator */: + var value = this.lookahead.value; + if (value === '{') { + statement = this.parseBlock(); + } + else if (value === '(') { + statement = this.parseExpressionStatement(); + } + else if (value === ';') { + statement = this.parseEmptyStatement(); + } + else { + statement = this.parseExpressionStatement(); + } + break; + case 3 /* Identifier */: + statement = this.matchAsyncFunction() ? this.parseFunctionDeclaration() : this.parseLabelledStatement(); + break; + case 4 /* Keyword */: + switch (this.lookahead.value) { + case 'break': + statement = this.parseBreakStatement(); + break; + case 'continue': + statement = this.parseContinueStatement(); + break; + case 'debugger': + statement = this.parseDebuggerStatement(); + break; + case 'do': + statement = this.parseDoWhileStatement(); + break; + case 'for': + statement = this.parseForStatement(); + break; + case 'function': + statement = this.parseFunctionDeclaration(); + break; + case 'if': + statement = this.parseIfStatement(); + break; + case 'return': + statement = this.parseReturnStatement(); + break; + case 'switch': + statement = this.parseSwitchStatement(); + break; + case 'throw': + statement = this.parseThrowStatement(); + break; + case 'try': + statement = this.parseTryStatement(); + break; + case 'var': + statement = this.parseVariableStatement(); + break; + case 'while': + statement = this.parseWhileStatement(); + break; + case 'with': + statement = this.parseWithStatement(); + break; + default: + statement = this.parseExpressionStatement(); + break; + } + break; + default: + statement = this.throwUnexpectedToken(this.lookahead); + } + return statement; + }; + // https://tc39.github.io/ecma262/#sec-function-definitions + Parser.prototype.parseFunctionSourceElements = function () { + var node = this.createNode(); + this.expect('{'); + var body = this.parseDirectivePrologues(); + var previousLabelSet = this.context.labelSet; + var previousInIteration = this.context.inIteration; + var previousInSwitch = this.context.inSwitch; + var previousInFunctionBody = this.context.inFunctionBody; + this.context.labelSet = {}; + this.context.inIteration = false; + this.context.inSwitch = false; + this.context.inFunctionBody = true; + while (this.lookahead.type !== 2 /* EOF */) { + if (this.match('}')) { + break; + } + body.push(this.parseStatementListItem()); + } + this.expect('}'); + this.context.labelSet = previousLabelSet; + this.context.inIteration = previousInIteration; + this.context.inSwitch = previousInSwitch; + this.context.inFunctionBody = previousInFunctionBody; + return this.finalize(node, new Node.BlockStatement(body)); + }; + Parser.prototype.validateParam = function (options, param, name) { + var key = '$' + name; + if (this.context.strict) { + if (this.scanner.isRestrictedWord(name)) { + options.stricted = param; + options.message = messages_1.Messages.StrictParamName; + } + if (Object.prototype.hasOwnProperty.call(options.paramSet, key)) { + options.stricted = param; + options.message = messages_1.Messages.StrictParamDupe; + } + } + else if (!options.firstRestricted) { + if (this.scanner.isRestrictedWord(name)) { + options.firstRestricted = param; + options.message = messages_1.Messages.StrictParamName; + } + else if (this.scanner.isStrictModeReservedWord(name)) { + options.firstRestricted = param; + options.message = messages_1.Messages.StrictReservedWord; + } + else if (Object.prototype.hasOwnProperty.call(options.paramSet, key)) { + options.stricted = param; + options.message = messages_1.Messages.StrictParamDupe; + } + } + /* istanbul ignore next */ + if (typeof Object.defineProperty === 'function') { + Object.defineProperty(options.paramSet, key, { value: true, enumerable: true, writable: true, configurable: true }); + } + else { + options.paramSet[key] = true; + } + }; + Parser.prototype.parseRestElement = function (params) { + var node = this.createNode(); + this.expect('...'); + var arg = this.parsePattern(params); + if (this.match('=')) { + this.throwError(messages_1.Messages.DefaultRestParameter); + } + if (!this.match(')')) { + this.throwError(messages_1.Messages.ParameterAfterRestParameter); + } + return this.finalize(node, new Node.RestElement(arg)); + }; + Parser.prototype.parseFormalParameter = function (options) { + var params = []; + var param = this.match('...') ? this.parseRestElement(params) : this.parsePatternWithDefault(params); + for (var i = 0; i < params.length; i++) { + this.validateParam(options, params[i], params[i].value); + } + options.simple = options.simple && (param instanceof Node.Identifier); + options.params.push(param); + }; + Parser.prototype.parseFormalParameters = function (firstRestricted) { + var options; + options = { + simple: true, + params: [], + firstRestricted: firstRestricted + }; + this.expect('('); + if (!this.match(')')) { + options.paramSet = {}; + while (this.lookahead.type !== 2 /* EOF */) { + this.parseFormalParameter(options); + if (this.match(')')) { + break; + } + this.expect(','); + if (this.match(')')) { + break; + } + } + } + this.expect(')'); + return { + simple: options.simple, + params: options.params, + stricted: options.stricted, + firstRestricted: options.firstRestricted, + message: options.message + }; + }; + Parser.prototype.matchAsyncFunction = function () { + var match = this.matchContextualKeyword('async'); + if (match) { + var state = this.scanner.saveState(); + this.scanner.scanComments(); + var next = this.scanner.lex(); + this.scanner.restoreState(state); + match = (state.lineNumber === next.lineNumber) && (next.type === 4 /* Keyword */) && (next.value === 'function'); + } + return match; + }; + Parser.prototype.parseFunctionDeclaration = function (identifierIsOptional) { + var node = this.createNode(); + var isAsync = this.matchContextualKeyword('async'); + if (isAsync) { + this.nextToken(); + } + this.expectKeyword('function'); + var isGenerator = isAsync ? false : this.match('*'); + if (isGenerator) { + this.nextToken(); + } + var message; + var id = null; + var firstRestricted = null; + if (!identifierIsOptional || !this.match('(')) { + var token = this.lookahead; + id = this.parseVariableIdentifier(); + if (this.context.strict) { + if (this.scanner.isRestrictedWord(token.value)) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictFunctionName); + } + } + else { + if (this.scanner.isRestrictedWord(token.value)) { + firstRestricted = token; + message = messages_1.Messages.StrictFunctionName; + } + else if (this.scanner.isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = messages_1.Messages.StrictReservedWord; + } + } + } + var previousAllowAwait = this.context.await; + var previousAllowYield = this.context.allowYield; + this.context.await = isAsync; + this.context.allowYield = !isGenerator; + var formalParameters = this.parseFormalParameters(firstRestricted); + var params = formalParameters.params; + var stricted = formalParameters.stricted; + firstRestricted = formalParameters.firstRestricted; + if (formalParameters.message) { + message = formalParameters.message; + } + var previousStrict = this.context.strict; + var previousAllowStrictDirective = this.context.allowStrictDirective; + this.context.allowStrictDirective = formalParameters.simple; + var body = this.parseFunctionSourceElements(); + if (this.context.strict && firstRestricted) { + this.throwUnexpectedToken(firstRestricted, message); + } + if (this.context.strict && stricted) { + this.tolerateUnexpectedToken(stricted, message); + } + this.context.strict = previousStrict; + this.context.allowStrictDirective = previousAllowStrictDirective; + this.context.await = previousAllowAwait; + this.context.allowYield = previousAllowYield; + return isAsync ? this.finalize(node, new Node.AsyncFunctionDeclaration(id, params, body)) : + this.finalize(node, new Node.FunctionDeclaration(id, params, body, isGenerator)); + }; + Parser.prototype.parseFunctionExpression = function () { + var node = this.createNode(); + var isAsync = this.matchContextualKeyword('async'); + if (isAsync) { + this.nextToken(); + } + this.expectKeyword('function'); + var isGenerator = isAsync ? false : this.match('*'); + if (isGenerator) { + this.nextToken(); + } + var message; + var id = null; + var firstRestricted; + var previousAllowAwait = this.context.await; + var previousAllowYield = this.context.allowYield; + this.context.await = isAsync; + this.context.allowYield = !isGenerator; + if (!this.match('(')) { + var token = this.lookahead; + id = (!this.context.strict && !isGenerator && this.matchKeyword('yield')) ? this.parseIdentifierName() : this.parseVariableIdentifier(); + if (this.context.strict) { + if (this.scanner.isRestrictedWord(token.value)) { + this.tolerateUnexpectedToken(token, messages_1.Messages.StrictFunctionName); + } + } + else { + if (this.scanner.isRestrictedWord(token.value)) { + firstRestricted = token; + message = messages_1.Messages.StrictFunctionName; + } + else if (this.scanner.isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = messages_1.Messages.StrictReservedWord; + } + } + } + var formalParameters = this.parseFormalParameters(firstRestricted); + var params = formalParameters.params; + var stricted = formalParameters.stricted; + firstRestricted = formalParameters.firstRestricted; + if (formalParameters.message) { + message = formalParameters.message; + } + var previousStrict = this.context.strict; + var previousAllowStrictDirective = this.context.allowStrictDirective; + this.context.allowStrictDirective = formalParameters.simple; + var body = this.parseFunctionSourceElements(); + if (this.context.strict && firstRestricted) { + this.throwUnexpectedToken(firstRestricted, message); + } + if (this.context.strict && stricted) { + this.tolerateUnexpectedToken(stricted, message); + } + this.context.strict = previousStrict; + this.context.allowStrictDirective = previousAllowStrictDirective; + this.context.await = previousAllowAwait; + this.context.allowYield = previousAllowYield; + return isAsync ? this.finalize(node, new Node.AsyncFunctionExpression(id, params, body)) : + this.finalize(node, new Node.FunctionExpression(id, params, body, isGenerator)); + }; + // https://tc39.github.io/ecma262/#sec-directive-prologues-and-the-use-strict-directive + Parser.prototype.parseDirective = function () { + var token = this.lookahead; + var node = this.createNode(); + var expr = this.parseExpression(); + var directive = (expr.type === syntax_1.Syntax.Literal) ? this.getTokenRaw(token).slice(1, -1) : null; + this.consumeSemicolon(); + return this.finalize(node, directive ? new Node.Directive(expr, directive) : new Node.ExpressionStatement(expr)); + }; + Parser.prototype.parseDirectivePrologues = function () { + var firstRestricted = null; + var body = []; + while (true) { + var token = this.lookahead; + if (token.type !== 8 /* StringLiteral */) { + break; + } + var statement = this.parseDirective(); + body.push(statement); + var directive = statement.directive; + if (typeof directive !== 'string') { + break; + } + if (directive === 'use strict') { + this.context.strict = true; + if (firstRestricted) { + this.tolerateUnexpectedToken(firstRestricted, messages_1.Messages.StrictOctalLiteral); + } + if (!this.context.allowStrictDirective) { + this.tolerateUnexpectedToken(token, messages_1.Messages.IllegalLanguageModeDirective); + } + } + else { + if (!firstRestricted && token.octal) { + firstRestricted = token; + } + } + } + return body; + }; + // https://tc39.github.io/ecma262/#sec-method-definitions + Parser.prototype.qualifiedPropertyName = function (token) { + switch (token.type) { + case 3 /* Identifier */: + case 8 /* StringLiteral */: + case 1 /* BooleanLiteral */: + case 5 /* NullLiteral */: + case 6 /* NumericLiteral */: + case 4 /* Keyword */: + return true; + case 7 /* Punctuator */: + return token.value === '['; + default: + break; + } + return false; + }; + Parser.prototype.parseGetterMethod = function () { + var node = this.createNode(); + var isGenerator = false; + var previousAllowYield = this.context.allowYield; + this.context.allowYield = !isGenerator; + var formalParameters = this.parseFormalParameters(); + if (formalParameters.params.length > 0) { + this.tolerateError(messages_1.Messages.BadGetterArity); + } + var method = this.parsePropertyMethod(formalParameters); + this.context.allowYield = previousAllowYield; + return this.finalize(node, new Node.FunctionExpression(null, formalParameters.params, method, isGenerator)); + }; + Parser.prototype.parseSetterMethod = function () { + var node = this.createNode(); + var isGenerator = false; + var previousAllowYield = this.context.allowYield; + this.context.allowYield = !isGenerator; + var formalParameters = this.parseFormalParameters(); + if (formalParameters.params.length !== 1) { + this.tolerateError(messages_1.Messages.BadSetterArity); + } + else if (formalParameters.params[0] instanceof Node.RestElement) { + this.tolerateError(messages_1.Messages.BadSetterRestParameter); + } + var method = this.parsePropertyMethod(formalParameters); + this.context.allowYield = previousAllowYield; + return this.finalize(node, new Node.FunctionExpression(null, formalParameters.params, method, isGenerator)); + }; + Parser.prototype.parseGeneratorMethod = function () { + var node = this.createNode(); + var isGenerator = true; + var previousAllowYield = this.context.allowYield; + this.context.allowYield = true; + var params = this.parseFormalParameters(); + this.context.allowYield = false; + var method = this.parsePropertyMethod(params); + this.context.allowYield = previousAllowYield; + return this.finalize(node, new Node.FunctionExpression(null, params.params, method, isGenerator)); + }; + // https://tc39.github.io/ecma262/#sec-generator-function-definitions + Parser.prototype.isStartOfExpression = function () { + var start = true; + var value = this.lookahead.value; + switch (this.lookahead.type) { + case 7 /* Punctuator */: + start = (value === '[') || (value === '(') || (value === '{') || + (value === '+') || (value === '-') || + (value === '!') || (value === '~') || + (value === '++') || (value === '--') || + (value === '/') || (value === '/='); // regular expression literal + break; + case 4 /* Keyword */: + start = (value === 'class') || (value === 'delete') || + (value === 'function') || (value === 'let') || (value === 'new') || + (value === 'super') || (value === 'this') || (value === 'typeof') || + (value === 'void') || (value === 'yield'); + break; + default: + break; + } + return start; + }; + Parser.prototype.parseYieldExpression = function () { + var node = this.createNode(); + this.expectKeyword('yield'); + var argument = null; + var delegate = false; + if (!this.hasLineTerminator) { + var previousAllowYield = this.context.allowYield; + this.context.allowYield = false; + delegate = this.match('*'); + if (delegate) { + this.nextToken(); + argument = this.parseAssignmentExpression(); + } + else if (this.isStartOfExpression()) { + argument = this.parseAssignmentExpression(); + } + this.context.allowYield = previousAllowYield; + } + return this.finalize(node, new Node.YieldExpression(argument, delegate)); + }; + // https://tc39.github.io/ecma262/#sec-class-definitions + Parser.prototype.parseClassElement = function (hasConstructor) { + var token = this.lookahead; + var node = this.createNode(); + var kind = ''; + var key = null; + var value = null; + var computed = false; + var method = false; + var isStatic = false; + var isAsync = false; + if (this.match('*')) { + this.nextToken(); + } + else { + computed = this.match('['); + key = this.parseObjectPropertyKey(); + var id = key; + if (id.name === 'static' && (this.qualifiedPropertyName(this.lookahead) || this.match('*'))) { + token = this.lookahead; + isStatic = true; + computed = this.match('['); + if (this.match('*')) { + this.nextToken(); + } + else { + key = this.parseObjectPropertyKey(); + } + } + if ((token.type === 3 /* Identifier */) && !this.hasLineTerminator && (token.value === 'async')) { + var punctuator = this.lookahead.value; + if (punctuator !== ':' && punctuator !== '(' && punctuator !== '*') { + isAsync = true; + token = this.lookahead; + key = this.parseObjectPropertyKey(); + if (token.type === 3 /* Identifier */ && token.value === 'constructor') { + this.tolerateUnexpectedToken(token, messages_1.Messages.ConstructorIsAsync); + } + } + } + } + var lookaheadPropertyKey = this.qualifiedPropertyName(this.lookahead); + if (token.type === 3 /* Identifier */) { + if (token.value === 'get' && lookaheadPropertyKey) { + kind = 'get'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + this.context.allowYield = false; + value = this.parseGetterMethod(); + } + else if (token.value === 'set' && lookaheadPropertyKey) { + kind = 'set'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + value = this.parseSetterMethod(); + } + } + else if (token.type === 7 /* Punctuator */ && token.value === '*' && lookaheadPropertyKey) { + kind = 'init'; + computed = this.match('['); + key = this.parseObjectPropertyKey(); + value = this.parseGeneratorMethod(); + method = true; + } + if (!kind && key && this.match('(')) { + kind = 'init'; + value = isAsync ? this.parsePropertyMethodAsyncFunction() : this.parsePropertyMethodFunction(); + method = true; + } + if (!kind) { + this.throwUnexpectedToken(this.lookahead); + } + if (kind === 'init') { + kind = 'method'; + } + if (!computed) { + if (isStatic && this.isPropertyKey(key, 'prototype')) { + this.throwUnexpectedToken(token, messages_1.Messages.StaticPrototype); + } + if (!isStatic && this.isPropertyKey(key, 'constructor')) { + if (kind !== 'method' || !method || (value && value.generator)) { + this.throwUnexpectedToken(token, messages_1.Messages.ConstructorSpecialMethod); + } + if (hasConstructor.value) { + this.throwUnexpectedToken(token, messages_1.Messages.DuplicateConstructor); + } + else { + hasConstructor.value = true; + } + kind = 'constructor'; + } + } + return this.finalize(node, new Node.MethodDefinition(key, computed, value, kind, isStatic)); + }; + Parser.prototype.parseClassElementList = function () { + var body = []; + var hasConstructor = { value: false }; + this.expect('{'); + while (!this.match('}')) { + if (this.match(';')) { + this.nextToken(); + } + else { + body.push(this.parseClassElement(hasConstructor)); + } + } + this.expect('}'); + return body; + }; + Parser.prototype.parseClassBody = function () { + var node = this.createNode(); + var elementList = this.parseClassElementList(); + return this.finalize(node, new Node.ClassBody(elementList)); + }; + Parser.prototype.parseClassDeclaration = function (identifierIsOptional) { + var node = this.createNode(); + var previousStrict = this.context.strict; + this.context.strict = true; + this.expectKeyword('class'); + var id = (identifierIsOptional && (this.lookahead.type !== 3 /* Identifier */)) ? null : this.parseVariableIdentifier(); + var superClass = null; + if (this.matchKeyword('extends')) { + this.nextToken(); + superClass = this.isolateCoverGrammar(this.parseLeftHandSideExpressionAllowCall); + } + var classBody = this.parseClassBody(); + this.context.strict = previousStrict; + return this.finalize(node, new Node.ClassDeclaration(id, superClass, classBody)); + }; + Parser.prototype.parseClassExpression = function () { + var node = this.createNode(); + var previousStrict = this.context.strict; + this.context.strict = true; + this.expectKeyword('class'); + var id = (this.lookahead.type === 3 /* Identifier */) ? this.parseVariableIdentifier() : null; + var superClass = null; + if (this.matchKeyword('extends')) { + this.nextToken(); + superClass = this.isolateCoverGrammar(this.parseLeftHandSideExpressionAllowCall); + } + var classBody = this.parseClassBody(); + this.context.strict = previousStrict; + return this.finalize(node, new Node.ClassExpression(id, superClass, classBody)); + }; + // https://tc39.github.io/ecma262/#sec-scripts + // https://tc39.github.io/ecma262/#sec-modules + Parser.prototype.parseModule = function () { + this.context.strict = true; + this.context.isModule = true; + this.scanner.isModule = true; + var node = this.createNode(); + var body = this.parseDirectivePrologues(); + while (this.lookahead.type !== 2 /* EOF */) { + body.push(this.parseStatementListItem()); + } + return this.finalize(node, new Node.Module(body)); + }; + Parser.prototype.parseScript = function () { + var node = this.createNode(); + var body = this.parseDirectivePrologues(); + while (this.lookahead.type !== 2 /* EOF */) { + body.push(this.parseStatementListItem()); + } + return this.finalize(node, new Node.Script(body)); + }; + // https://tc39.github.io/ecma262/#sec-imports + Parser.prototype.parseModuleSpecifier = function () { + var node = this.createNode(); + if (this.lookahead.type !== 8 /* StringLiteral */) { + this.throwError(messages_1.Messages.InvalidModuleSpecifier); + } + var token = this.nextToken(); + var raw = this.getTokenRaw(token); + return this.finalize(node, new Node.Literal(token.value, raw)); + }; + // import {} ...; + Parser.prototype.parseImportSpecifier = function () { + var node = this.createNode(); + var imported; + var local; + if (this.lookahead.type === 3 /* Identifier */) { + imported = this.parseVariableIdentifier(); + local = imported; + if (this.matchContextualKeyword('as')) { + this.nextToken(); + local = this.parseVariableIdentifier(); + } + } + else { + imported = this.parseIdentifierName(); + local = imported; + if (this.matchContextualKeyword('as')) { + this.nextToken(); + local = this.parseVariableIdentifier(); + } + else { + this.throwUnexpectedToken(this.nextToken()); + } + } + return this.finalize(node, new Node.ImportSpecifier(local, imported)); + }; + // {foo, bar as bas} + Parser.prototype.parseNamedImports = function () { + this.expect('{'); + var specifiers = []; + while (!this.match('}')) { + specifiers.push(this.parseImportSpecifier()); + if (!this.match('}')) { + this.expect(','); + } + } + this.expect('}'); + return specifiers; + }; + // import ...; + Parser.prototype.parseImportDefaultSpecifier = function () { + var node = this.createNode(); + var local = this.parseIdentifierName(); + return this.finalize(node, new Node.ImportDefaultSpecifier(local)); + }; + // import <* as foo> ...; + Parser.prototype.parseImportNamespaceSpecifier = function () { + var node = this.createNode(); + this.expect('*'); + if (!this.matchContextualKeyword('as')) { + this.throwError(messages_1.Messages.NoAsAfterImportNamespace); + } + this.nextToken(); + var local = this.parseIdentifierName(); + return this.finalize(node, new Node.ImportNamespaceSpecifier(local)); + }; + Parser.prototype.parseImportDeclaration = function () { + if (this.context.inFunctionBody) { + this.throwError(messages_1.Messages.IllegalImportDeclaration); + } + var node = this.createNode(); + this.expectKeyword('import'); + var src; + var specifiers = []; + if (this.lookahead.type === 8 /* StringLiteral */) { + // import 'foo'; + src = this.parseModuleSpecifier(); + } + else { + if (this.match('{')) { + // import {bar} + specifiers = specifiers.concat(this.parseNamedImports()); + } + else if (this.match('*')) { + // import * as foo + specifiers.push(this.parseImportNamespaceSpecifier()); + } + else if (this.isIdentifierName(this.lookahead) && !this.matchKeyword('default')) { + // import foo + specifiers.push(this.parseImportDefaultSpecifier()); + if (this.match(',')) { + this.nextToken(); + if (this.match('*')) { + // import foo, * as foo + specifiers.push(this.parseImportNamespaceSpecifier()); + } + else if (this.match('{')) { + // import foo, {bar} + specifiers = specifiers.concat(this.parseNamedImports()); + } + else { + this.throwUnexpectedToken(this.lookahead); + } + } + } + else { + this.throwUnexpectedToken(this.nextToken()); + } + if (!this.matchContextualKeyword('from')) { + var message = this.lookahead.value ? messages_1.Messages.UnexpectedToken : messages_1.Messages.MissingFromClause; + this.throwError(message, this.lookahead.value); + } + this.nextToken(); + src = this.parseModuleSpecifier(); + } + this.consumeSemicolon(); + return this.finalize(node, new Node.ImportDeclaration(specifiers, src)); + }; + // https://tc39.github.io/ecma262/#sec-exports + Parser.prototype.parseExportSpecifier = function () { + var node = this.createNode(); + var local = this.parseIdentifierName(); + var exported = local; + if (this.matchContextualKeyword('as')) { + this.nextToken(); + exported = this.parseIdentifierName(); + } + return this.finalize(node, new Node.ExportSpecifier(local, exported)); + }; + Parser.prototype.parseExportDeclaration = function () { + if (this.context.inFunctionBody) { + this.throwError(messages_1.Messages.IllegalExportDeclaration); + } + var node = this.createNode(); + this.expectKeyword('export'); + var exportDeclaration; + if (this.matchKeyword('default')) { + // export default ... + this.nextToken(); + if (this.matchKeyword('function')) { + // export default function foo () {} + // export default function () {} + var declaration = this.parseFunctionDeclaration(true); + exportDeclaration = this.finalize(node, new Node.ExportDefaultDeclaration(declaration)); + } + else if (this.matchKeyword('class')) { + // export default class foo {} + var declaration = this.parseClassDeclaration(true); + exportDeclaration = this.finalize(node, new Node.ExportDefaultDeclaration(declaration)); + } + else if (this.matchContextualKeyword('async')) { + // export default async function f () {} + // export default async function () {} + // export default async x => x + var declaration = this.matchAsyncFunction() ? this.parseFunctionDeclaration(true) : this.parseAssignmentExpression(); + exportDeclaration = this.finalize(node, new Node.ExportDefaultDeclaration(declaration)); + } + else { + if (this.matchContextualKeyword('from')) { + this.throwError(messages_1.Messages.UnexpectedToken, this.lookahead.value); + } + // export default {}; + // export default []; + // export default (1 + 2); + var declaration = this.match('{') ? this.parseObjectInitializer() : + this.match('[') ? this.parseArrayInitializer() : this.parseAssignmentExpression(); + this.consumeSemicolon(); + exportDeclaration = this.finalize(node, new Node.ExportDefaultDeclaration(declaration)); + } + } + else if (this.match('*')) { + // export * from 'foo'; + this.nextToken(); + if (!this.matchContextualKeyword('from')) { + var message = this.lookahead.value ? messages_1.Messages.UnexpectedToken : messages_1.Messages.MissingFromClause; + this.throwError(message, this.lookahead.value); + } + this.nextToken(); + var src = this.parseModuleSpecifier(); + this.consumeSemicolon(); + exportDeclaration = this.finalize(node, new Node.ExportAllDeclaration(src)); + } + else if (this.lookahead.type === 4 /* Keyword */) { + // export var f = 1; + var declaration = void 0; + switch (this.lookahead.value) { + case 'let': + case 'const': + declaration = this.parseLexicalDeclaration({ inFor: false }); + break; + case 'var': + case 'class': + case 'function': + declaration = this.parseStatementListItem(); + break; + default: + this.throwUnexpectedToken(this.lookahead); + } + exportDeclaration = this.finalize(node, new Node.ExportNamedDeclaration(declaration, [], null)); + } + else if (this.matchAsyncFunction()) { + var declaration = this.parseFunctionDeclaration(); + exportDeclaration = this.finalize(node, new Node.ExportNamedDeclaration(declaration, [], null)); + } + else { + var specifiers = []; + var source = null; + var isExportFromIdentifier = false; + this.expect('{'); + while (!this.match('}')) { + isExportFromIdentifier = isExportFromIdentifier || this.matchKeyword('default'); + specifiers.push(this.parseExportSpecifier()); + if (!this.match('}')) { + this.expect(','); + } + } + this.expect('}'); + if (this.matchContextualKeyword('from')) { + // export {default} from 'foo'; + // export {foo} from 'foo'; + this.nextToken(); + source = this.parseModuleSpecifier(); + this.consumeSemicolon(); + } + else if (isExportFromIdentifier) { + // export {default}; // missing fromClause + var message = this.lookahead.value ? messages_1.Messages.UnexpectedToken : messages_1.Messages.MissingFromClause; + this.throwError(message, this.lookahead.value); + } + else { + // export {foo}; + this.consumeSemicolon(); + } + exportDeclaration = this.finalize(node, new Node.ExportNamedDeclaration(null, specifiers, source)); + } + return exportDeclaration; + }; + return Parser; + }()); + exports.Parser = Parser; + + +/***/ }, +/* 9 */ +/***/ function(module, exports) { + + "use strict"; + // Ensure the condition is true, otherwise throw an error. + // This is only to have a better contract semantic, i.e. another safety net + // to catch a logic error. The condition shall be fulfilled in normal case. + // Do NOT use this to enforce a certain condition on any user input. + Object.defineProperty(exports, "__esModule", { value: true }); + function assert(condition, message) { + /* istanbul ignore if */ + if (!condition) { + throw new Error('ASSERT: ' + message); + } + } + exports.assert = assert; + + +/***/ }, +/* 10 */ +/***/ function(module, exports) { + + "use strict"; + /* tslint:disable:max-classes-per-file */ + Object.defineProperty(exports, "__esModule", { value: true }); + var ErrorHandler = (function () { + function ErrorHandler() { + this.errors = []; + this.tolerant = false; + } + ErrorHandler.prototype.recordError = function (error) { + this.errors.push(error); + }; + ErrorHandler.prototype.tolerate = function (error) { + if (this.tolerant) { + this.recordError(error); + } + else { + throw error; + } + }; + ErrorHandler.prototype.constructError = function (msg, column) { + var error = new Error(msg); + try { + throw error; + } + catch (base) { + /* istanbul ignore else */ + if (Object.create && Object.defineProperty) { + error = Object.create(base); + Object.defineProperty(error, 'column', { value: column }); + } + } + /* istanbul ignore next */ + return error; + }; + ErrorHandler.prototype.createError = function (index, line, col, description) { + var msg = 'Line ' + line + ': ' + description; + var error = this.constructError(msg, col); + error.index = index; + error.lineNumber = line; + error.description = description; + return error; + }; + ErrorHandler.prototype.throwError = function (index, line, col, description) { + throw this.createError(index, line, col, description); + }; + ErrorHandler.prototype.tolerateError = function (index, line, col, description) { + var error = this.createError(index, line, col, description); + if (this.tolerant) { + this.recordError(error); + } + else { + throw error; + } + }; + return ErrorHandler; + }()); + exports.ErrorHandler = ErrorHandler; + + +/***/ }, +/* 11 */ +/***/ function(module, exports) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + // Error messages should be identical to V8. + exports.Messages = { + BadGetterArity: 'Getter must not have any formal parameters', + BadSetterArity: 'Setter must have exactly one formal parameter', + BadSetterRestParameter: 'Setter function argument must not be a rest parameter', + ConstructorIsAsync: 'Class constructor may not be an async method', + ConstructorSpecialMethod: 'Class constructor may not be an accessor', + DeclarationMissingInitializer: 'Missing initializer in %0 declaration', + DefaultRestParameter: 'Unexpected token =', + DuplicateBinding: 'Duplicate binding %0', + DuplicateConstructor: 'A class may only have one constructor', + DuplicateProtoProperty: 'Duplicate __proto__ fields are not allowed in object literals', + ForInOfLoopInitializer: '%0 loop variable declaration may not have an initializer', + GeneratorInLegacyContext: 'Generator declarations are not allowed in legacy contexts', + IllegalBreak: 'Illegal break statement', + IllegalContinue: 'Illegal continue statement', + IllegalExportDeclaration: 'Unexpected token', + IllegalImportDeclaration: 'Unexpected token', + IllegalLanguageModeDirective: 'Illegal \'use strict\' directive in function with non-simple parameter list', + IllegalReturn: 'Illegal return statement', + InvalidEscapedReservedWord: 'Keyword must not contain escaped characters', + InvalidHexEscapeSequence: 'Invalid hexadecimal escape sequence', + InvalidLHSInAssignment: 'Invalid left-hand side in assignment', + InvalidLHSInForIn: 'Invalid left-hand side in for-in', + InvalidLHSInForLoop: 'Invalid left-hand side in for-loop', + InvalidModuleSpecifier: 'Unexpected token', + InvalidRegExp: 'Invalid regular expression', + LetInLexicalBinding: 'let is disallowed as a lexically bound name', + MissingFromClause: 'Unexpected token', + MultipleDefaultsInSwitch: 'More than one default clause in switch statement', + NewlineAfterThrow: 'Illegal newline after throw', + NoAsAfterImportNamespace: 'Unexpected token', + NoCatchOrFinally: 'Missing catch or finally after try', + ParameterAfterRestParameter: 'Rest parameter must be last formal parameter', + Redeclaration: '%0 \'%1\' has already been declared', + StaticPrototype: 'Classes may not have static property named prototype', + StrictCatchVariable: 'Catch variable may not be eval or arguments in strict mode', + StrictDelete: 'Delete of an unqualified identifier in strict mode.', + StrictFunction: 'In strict mode code, functions can only be declared at top level or inside a block', + StrictFunctionName: 'Function name may not be eval or arguments in strict mode', + StrictLHSAssignment: 'Assignment to eval or arguments is not allowed in strict mode', + StrictLHSPostfix: 'Postfix increment/decrement may not have eval or arguments operand in strict mode', + StrictLHSPrefix: 'Prefix increment/decrement may not have eval or arguments operand in strict mode', + StrictModeWith: 'Strict mode code may not include a with statement', + StrictOctalLiteral: 'Octal literals are not allowed in strict mode.', + StrictParamDupe: 'Strict mode function may not have duplicate parameter names', + StrictParamName: 'Parameter name eval or arguments is not allowed in strict mode', + StrictReservedWord: 'Use of future reserved word in strict mode', + StrictVarName: 'Variable name may not be eval or arguments in strict mode', + TemplateOctalLiteral: 'Octal literals are not allowed in template strings.', + UnexpectedEOS: 'Unexpected end of input', + UnexpectedIdentifier: 'Unexpected identifier', + UnexpectedNumber: 'Unexpected number', + UnexpectedReserved: 'Unexpected reserved word', + UnexpectedString: 'Unexpected string', + UnexpectedTemplate: 'Unexpected quasi %0', + UnexpectedToken: 'Unexpected token %0', + UnexpectedTokenIllegal: 'Unexpected token ILLEGAL', + UnknownLabel: 'Undefined label \'%0\'', + UnterminatedRegExp: 'Invalid regular expression: missing /' + }; + + +/***/ }, +/* 12 */ +/***/ function(module, exports, __webpack_require__) { + + "use strict"; + Object.defineProperty(exports, "__esModule", { value: true }); + var assert_1 = __webpack_require__(9); + var character_1 = __webpack_require__(4); + var messages_1 = __webpack_require__(11); + function hexValue(ch) { + return '0123456789abcdef'.indexOf(ch.toLowerCase()); + } + function octalValue(ch) { + return '01234567'.indexOf(ch); + } + var Scanner = (function () { + function Scanner(code, handler) { + this.source = code; + this.errorHandler = handler; + this.trackComment = false; + this.isModule = false; + this.length = code.length; + this.index = 0; + this.lineNumber = (code.length > 0) ? 1 : 0; + this.lineStart = 0; + this.curlyStack = []; + } + Scanner.prototype.saveState = function () { + return { + index: this.index, + lineNumber: this.lineNumber, + lineStart: this.lineStart + }; + }; + Scanner.prototype.restoreState = function (state) { + this.index = state.index; + this.lineNumber = state.lineNumber; + this.lineStart = state.lineStart; + }; + Scanner.prototype.eof = function () { + return this.index >= this.length; + }; + Scanner.prototype.throwUnexpectedToken = function (message) { + if (message === void 0) { message = messages_1.Messages.UnexpectedTokenIllegal; } + return this.errorHandler.throwError(this.index, this.lineNumber, this.index - this.lineStart + 1, message); + }; + Scanner.prototype.tolerateUnexpectedToken = function (message) { + if (message === void 0) { message = messages_1.Messages.UnexpectedTokenIllegal; } + this.errorHandler.tolerateError(this.index, this.lineNumber, this.index - this.lineStart + 1, message); + }; + // https://tc39.github.io/ecma262/#sec-comments + Scanner.prototype.skipSingleLineComment = function (offset) { + var comments = []; + var start, loc; + if (this.trackComment) { + comments = []; + start = this.index - offset; + loc = { + start: { + line: this.lineNumber, + column: this.index - this.lineStart - offset + }, + end: {} + }; + } + while (!this.eof()) { + var ch = this.source.charCodeAt(this.index); + ++this.index; + if (character_1.Character.isLineTerminator(ch)) { + if (this.trackComment) { + loc.end = { + line: this.lineNumber, + column: this.index - this.lineStart - 1 + }; + var entry = { + multiLine: false, + slice: [start + offset, this.index - 1], + range: [start, this.index - 1], + loc: loc + }; + comments.push(entry); + } + if (ch === 13 && this.source.charCodeAt(this.index) === 10) { + ++this.index; + } + ++this.lineNumber; + this.lineStart = this.index; + return comments; + } + } + if (this.trackComment) { + loc.end = { + line: this.lineNumber, + column: this.index - this.lineStart + }; + var entry = { + multiLine: false, + slice: [start + offset, this.index], + range: [start, this.index], + loc: loc + }; + comments.push(entry); + } + return comments; + }; + Scanner.prototype.skipMultiLineComment = function () { + var comments = []; + var start, loc; + if (this.trackComment) { + comments = []; + start = this.index - 2; + loc = { + start: { + line: this.lineNumber, + column: this.index - this.lineStart - 2 + }, + end: {} + }; + } + while (!this.eof()) { + var ch = this.source.charCodeAt(this.index); + if (character_1.Character.isLineTerminator(ch)) { + if (ch === 0x0D && this.source.charCodeAt(this.index + 1) === 0x0A) { + ++this.index; + } + ++this.lineNumber; + ++this.index; + this.lineStart = this.index; + } + else if (ch === 0x2A) { + // Block comment ends with '*/'. + if (this.source.charCodeAt(this.index + 1) === 0x2F) { + this.index += 2; + if (this.trackComment) { + loc.end = { + line: this.lineNumber, + column: this.index - this.lineStart + }; + var entry = { + multiLine: true, + slice: [start + 2, this.index - 2], + range: [start, this.index], + loc: loc + }; + comments.push(entry); + } + return comments; + } + ++this.index; + } + else { + ++this.index; + } + } + // Ran off the end of the file - the whole thing is a comment + if (this.trackComment) { + loc.end = { + line: this.lineNumber, + column: this.index - this.lineStart + }; + var entry = { + multiLine: true, + slice: [start + 2, this.index], + range: [start, this.index], + loc: loc + }; + comments.push(entry); + } + this.tolerateUnexpectedToken(); + return comments; + }; + Scanner.prototype.scanComments = function () { + var comments; + if (this.trackComment) { + comments = []; + } + var start = (this.index === 0); + while (!this.eof()) { + var ch = this.source.charCodeAt(this.index); + if (character_1.Character.isWhiteSpace(ch)) { + ++this.index; + } + else if (character_1.Character.isLineTerminator(ch)) { + ++this.index; + if (ch === 0x0D && this.source.charCodeAt(this.index) === 0x0A) { + ++this.index; + } + ++this.lineNumber; + this.lineStart = this.index; + start = true; + } + else if (ch === 0x2F) { + ch = this.source.charCodeAt(this.index + 1); + if (ch === 0x2F) { + this.index += 2; + var comment = this.skipSingleLineComment(2); + if (this.trackComment) { + comments = comments.concat(comment); + } + start = true; + } + else if (ch === 0x2A) { + this.index += 2; + var comment = this.skipMultiLineComment(); + if (this.trackComment) { + comments = comments.concat(comment); + } + } + else { + break; + } + } + else if (start && ch === 0x2D) { + // U+003E is '>' + if ((this.source.charCodeAt(this.index + 1) === 0x2D) && (this.source.charCodeAt(this.index + 2) === 0x3E)) { + // '-->' is a single-line comment + this.index += 3; + var comment = this.skipSingleLineComment(3); + if (this.trackComment) { + comments = comments.concat(comment); + } + } + else { + break; + } + } + else if (ch === 0x3C && !this.isModule) { + if (this.source.slice(this.index + 1, this.index + 4) === '!--') { + this.index += 4; // `