From db7e4c9143a371f624358e8cd21a8c182f4583ed Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Do=C4=9Fukan=20=C3=96ks=C3=BCz?= Date: Fri, 6 Nov 2020 18:51:13 +0300 Subject: [PATCH] Initial commit --- README.md | 5 + client | 1 + server/.editorconfig | 15 + server/.env.example | 47 + server/.gitattributes | 5 + server/.gitignore | 12 + server/.styleci.yml | 13 + server/README.md | 61 + server/app/Console/Kernel.php | 41 + server/app/Exceptions/Handler.php | 37 + server/app/Http/Controllers/Controller.php | 13 + server/app/Http/Kernel.php | 66 + server/app/Http/Middleware/Authenticate.php | 21 + server/app/Http/Middleware/EncryptCookies.php | 17 + .../PreventRequestsDuringMaintenance.php | 17 + .../Middleware/RedirectIfAuthenticated.php | 32 + server/app/Http/Middleware/TrimStrings.php | 18 + server/app/Http/Middleware/TrustHosts.php | 20 + server/app/Http/Middleware/TrustProxies.php | 23 + .../app/Http/Middleware/VerifyCsrfToken.php | 17 + server/app/Models/User.php | 43 + server/app/Providers/AppServiceProvider.php | 28 + server/app/Providers/AuthServiceProvider.php | 30 + .../Providers/BroadcastServiceProvider.php | 21 + server/app/Providers/EventServiceProvider.php | 32 + server/app/Providers/RouteServiceProvider.php | 63 + server/artisan | 53 + server/bootstrap/app.php | 55 + server/bootstrap/cache/.gitignore | 2 + server/composer.json | 61 + server/composer.lock | 7263 +++++++++++++++ server/config/app.php | 232 + server/config/auth.php | 117 + server/config/broadcasting.php | 59 + server/config/cache.php | 104 + server/config/cors.php | 34 + server/config/database.php | 147 + server/config/filesystems.php | 85 + server/config/hashing.php | 52 + server/config/logging.php | 104 + server/config/mail.php | 110 + server/config/queue.php | 89 + server/config/services.php | 33 + server/config/session.php | 201 + server/config/view.php | 36 + server/database/.gitignore | 2 + server/database/factories/UserFactory.php | 33 + .../2014_10_12_000000_create_users_table.php | 36 + ...12_100000_create_password_resets_table.php | 32 + ..._08_19_000000_create_failed_jobs_table.php | 36 + server/database/seeders/DatabaseSeeder.php | 18 + server/package.json | 19 + server/phpunit.xml | 31 + server/public/.htaccess | 21 + server/public/favicon.ico | 0 server/public/index.php | 55 + server/public/robots.txt | 2 + server/public/web.config | 28 + server/resources/css/app.css | 0 server/resources/js/app.js | 1 + server/resources/js/bootstrap.js | 28 + server/resources/lang/en/auth.php | 19 + server/resources/lang/en/pagination.php | 19 + server/resources/lang/en/passwords.php | 22 + server/resources/lang/en/validation.php | 152 + server/resources/views/welcome.blade.php | 132 + server/routes/api.php | 19 + server/routes/channels.php | 18 + server/routes/console.php | 19 + server/routes/web.php | 18 + server/server.php | 21 + server/storage/app/.gitignore | 3 + server/storage/app/public/.gitignore | 2 + server/storage/framework/.gitignore | 9 + server/storage/framework/cache/.gitignore | 3 + .../storage/framework/cache/data/.gitignore | 2 + server/storage/framework/sessions/.gitignore | 2 + server/storage/framework/testing/.gitignore | 2 + server/storage/framework/views/.gitignore | 2 + server/storage/logs/.gitignore | 2 + server/tests/CreatesApplication.php | 22 + server/tests/Feature/ExampleTest.php | 21 + server/tests/TestCase.php | 10 + server/tests/Unit/ExampleTest.php | 18 + server/webpack.mix.js | 17 + socket/node_modules/accepts/HISTORY.md | 236 + socket/node_modules/accepts/LICENSE | 23 + socket/node_modules/accepts/README.md | 142 + socket/node_modules/accepts/index.js | 238 + socket/node_modules/accepts/package.json | 87 + socket/node_modules/base64id/CHANGELOG.md | 16 + socket/node_modules/base64id/LICENSE | 22 + socket/node_modules/base64id/README.md | 18 + socket/node_modules/base64id/lib/base64id.js | 103 + socket/node_modules/base64id/package.json | 48 + .../node_modules/component-emitter/History.md | 75 + socket/node_modules/component-emitter/LICENSE | 24 + .../node_modules/component-emitter/Readme.md | 74 + .../node_modules/component-emitter/index.js | 175 + .../component-emitter/package.json | 56 + socket/node_modules/cookie/HISTORY.md | 128 + socket/node_modules/cookie/LICENSE | 24 + socket/node_modules/cookie/README.md | 257 + socket/node_modules/cookie/index.js | 202 + socket/node_modules/cookie/package.json | 78 + socket/node_modules/cors/CONTRIBUTING.md | 33 + socket/node_modules/cors/HISTORY.md | 58 + socket/node_modules/cors/LICENSE | 22 + socket/node_modules/cors/README.md | 243 + socket/node_modules/cors/lib/index.js | 238 + socket/node_modules/cors/package.json | 77 + socket/node_modules/debug/CHANGELOG.md | 395 + socket/node_modules/debug/LICENSE | 19 + socket/node_modules/debug/README.md | 455 + socket/node_modules/debug/dist/debug.js | 912 ++ socket/node_modules/debug/package.json | 104 + socket/node_modules/debug/src/browser.js | 264 + socket/node_modules/debug/src/common.js | 266 + socket/node_modules/debug/src/index.js | 10 + socket/node_modules/debug/src/node.js | 257 + .../engine.io-parser/CHANGELOG.md | 89 + socket/node_modules/engine.io-parser/LICENSE | 22 + .../node_modules/engine.io-parser/Readme.md | 158 + .../engine.io-parser/lib/commons.js | 21 + .../lib/decodePacket.browser.js | 57 + .../engine.io-parser/lib/decodePacket.js | 51 + .../lib/encodePacket.browser.js | 46 + .../engine.io-parser/lib/encodePacket.js | 27 + .../engine.io-parser/lib/index.js | 42 + .../engine.io-parser/package.json | 76 + socket/node_modules/engine.io/CHANGELOG.md | 148 + socket/node_modules/engine.io/LICENSE | 19 + socket/node_modules/engine.io/README.md | 562 ++ .../node_modules/engine.io/lib/engine.io.js | 127 + socket/node_modules/engine.io/lib/server.js | 585 ++ socket/node_modules/engine.io/lib/socket.js | 499 + .../node_modules/engine.io/lib/transport.js | 107 + .../engine.io/lib/transports/index.js | 31 + .../engine.io/lib/transports/polling-jsonp.js | 58 + .../engine.io/lib/transports/polling.js | 374 + .../engine.io/lib/transports/websocket.js | 117 + socket/node_modules/engine.io/package.json | 95 + socket/node_modules/mime-db/HISTORY.md | 446 + socket/node_modules/mime-db/LICENSE | 22 + socket/node_modules/mime-db/README.md | 102 + socket/node_modules/mime-db/db.json | 8176 +++++++++++++++++ socket/node_modules/mime-db/index.js | 11 + socket/node_modules/mime-db/package.json | 102 + socket/node_modules/mime-types/HISTORY.md | 333 + socket/node_modules/mime-types/LICENSE | 23 + socket/node_modules/mime-types/README.md | 123 + socket/node_modules/mime-types/index.js | 188 + socket/node_modules/mime-types/package.json | 87 + socket/node_modules/ms/index.js | 162 + socket/node_modules/ms/license.md | 21 + socket/node_modules/ms/package.json | 69 + socket/node_modules/ms/readme.md | 60 + socket/node_modules/negotiator/HISTORY.md | 103 + socket/node_modules/negotiator/LICENSE | 24 + socket/node_modules/negotiator/README.md | 203 + socket/node_modules/negotiator/index.js | 124 + socket/node_modules/negotiator/lib/charset.js | 169 + .../node_modules/negotiator/lib/encoding.js | 184 + .../node_modules/negotiator/lib/language.js | 179 + .../node_modules/negotiator/lib/mediaType.js | 294 + socket/node_modules/negotiator/package.json | 84 + socket/node_modules/object-assign/index.js | 90 + socket/node_modules/object-assign/license | 21 + .../node_modules/object-assign/package.json | 74 + socket/node_modules/object-assign/readme.md | 61 + .../socket.io-adapter/CHANGELOG.md | 47 + socket/node_modules/socket.io-adapter/LICENSE | 20 + .../node_modules/socket.io-adapter/Readme.md | 23 + .../socket.io-adapter/dist/index.d.ts | 82 + .../socket.io-adapter/dist/index.js | 163 + .../socket.io-adapter/package.json | 58 + .../socket.io-parser/CHANGELOG.md | 67 + socket/node_modules/socket.io-parser/LICENSE | 20 + .../node_modules/socket.io-parser/Readme.md | 73 + .../socket.io-parser/dist/binary.d.ts | 20 + .../socket.io-parser/dist/binary.js | 80 + .../socket.io-parser/dist/index.d.ts | 72 + .../socket.io-parser/dist/index.js | 280 + .../socket.io-parser/dist/is-binary.d.ts | 7 + .../socket.io-parser/dist/is-binary.js | 55 + .../socket.io-parser/package.json | 75 + socket/node_modules/socket.io/CHANGELOG.md | 262 + socket/node_modules/socket.io/LICENSE | 22 + socket/node_modules/socket.io/Readme.md | 258 + .../socket.io/client-dist/socket.io.js | 6161 +++++++++++++ .../socket.io/client-dist/socket.io.js.map | 1 + .../socket.io/client-dist/socket.io.min.js | 7 + .../client-dist/socket.io.min.js.map | 1 + .../client-dist/socket.io.msgpack.min.js | 7 + .../client-dist/socket.io.msgpack.min.js.map | 1 + .../node_modules/socket.io/dist/client.d.ts | 108 + socket/node_modules/socket.io/dist/client.js | 254 + socket/node_modules/socket.io/dist/index.d.ts | 351 + socket/node_modules/socket.io/dist/index.js | 445 + .../socket.io/dist/namespace.d.ts | 135 + .../node_modules/socket.io/dist/namespace.js | 252 + .../socket.io/dist/parent-namespace.d.ts | 9 + .../socket.io/dist/parent-namespace.js | 36 + .../node_modules/socket.io/dist/socket.d.ts | 297 + socket/node_modules/socket.io/dist/socket.js | 492 + socket/node_modules/socket.io/package.json | 114 + socket/node_modules/socket.io/wrapper.mjs | 3 + socket/node_modules/vary/HISTORY.md | 39 + socket/node_modules/vary/LICENSE | 22 + socket/node_modules/vary/README.md | 101 + socket/node_modules/vary/index.js | 149 + socket/node_modules/vary/package.json | 78 + socket/node_modules/ws/LICENSE | 21 + socket/node_modules/ws/README.md | 496 + socket/node_modules/ws/browser.js | 8 + socket/node_modules/ws/index.js | 10 + socket/node_modules/ws/lib/buffer-util.js | 129 + socket/node_modules/ws/lib/constants.js | 10 + socket/node_modules/ws/lib/event-target.js | 177 + socket/node_modules/ws/lib/extension.js | 223 + socket/node_modules/ws/lib/limiter.js | 54 + .../node_modules/ws/lib/permessage-deflate.js | 512 ++ socket/node_modules/ws/lib/receiver.js | 507 + socket/node_modules/ws/lib/sender.js | 392 + socket/node_modules/ws/lib/stream.js | 164 + socket/node_modules/ws/lib/validation.js | 30 + .../node_modules/ws/lib/websocket-server.js | 404 + socket/node_modules/ws/lib/websocket.js | 905 ++ socket/node_modules/ws/package.json | 91 + socket/package-lock.json | 133 + socket/package.json | 14 + 231 files changed, 45683 insertions(+) create mode 100644 README.md create mode 160000 client create mode 100644 server/.editorconfig create mode 100644 server/.env.example create mode 100644 server/.gitattributes create mode 100644 server/.gitignore create mode 100644 server/.styleci.yml create mode 100644 server/README.md create mode 100644 server/app/Console/Kernel.php create mode 100644 server/app/Exceptions/Handler.php create mode 100644 server/app/Http/Controllers/Controller.php create mode 100644 server/app/Http/Kernel.php create mode 100644 server/app/Http/Middleware/Authenticate.php create mode 100644 server/app/Http/Middleware/EncryptCookies.php create mode 100644 server/app/Http/Middleware/PreventRequestsDuringMaintenance.php create mode 100644 server/app/Http/Middleware/RedirectIfAuthenticated.php create mode 100644 server/app/Http/Middleware/TrimStrings.php create mode 100644 server/app/Http/Middleware/TrustHosts.php create mode 100644 server/app/Http/Middleware/TrustProxies.php create mode 100644 server/app/Http/Middleware/VerifyCsrfToken.php create mode 100644 server/app/Models/User.php create mode 100644 server/app/Providers/AppServiceProvider.php create mode 100644 server/app/Providers/AuthServiceProvider.php create mode 100644 server/app/Providers/BroadcastServiceProvider.php create mode 100644 server/app/Providers/EventServiceProvider.php create mode 100644 server/app/Providers/RouteServiceProvider.php create mode 100755 server/artisan create mode 100644 server/bootstrap/app.php create mode 100644 server/bootstrap/cache/.gitignore create mode 100644 server/composer.json create mode 100644 server/composer.lock create mode 100644 server/config/app.php create mode 100644 server/config/auth.php create mode 100644 server/config/broadcasting.php create mode 100644 server/config/cache.php create mode 100644 server/config/cors.php create mode 100644 server/config/database.php create mode 100644 server/config/filesystems.php create mode 100644 server/config/hashing.php create mode 100644 server/config/logging.php create mode 100644 server/config/mail.php create mode 100644 server/config/queue.php create mode 100644 server/config/services.php create mode 100644 server/config/session.php create mode 100644 server/config/view.php create mode 100644 server/database/.gitignore create mode 100644 server/database/factories/UserFactory.php create mode 100644 server/database/migrations/2014_10_12_000000_create_users_table.php create mode 100644 server/database/migrations/2014_10_12_100000_create_password_resets_table.php create mode 100644 server/database/migrations/2019_08_19_000000_create_failed_jobs_table.php create mode 100644 server/database/seeders/DatabaseSeeder.php create mode 100644 server/package.json create mode 100644 server/phpunit.xml create mode 100644 server/public/.htaccess create mode 100644 server/public/favicon.ico create mode 100644 server/public/index.php create mode 100644 server/public/robots.txt create mode 100644 server/public/web.config create mode 100644 server/resources/css/app.css create mode 100644 server/resources/js/app.js create mode 100644 server/resources/js/bootstrap.js create mode 100644 server/resources/lang/en/auth.php create mode 100644 server/resources/lang/en/pagination.php create mode 100644 server/resources/lang/en/passwords.php create mode 100644 server/resources/lang/en/validation.php create mode 100644 server/resources/views/welcome.blade.php create mode 100644 server/routes/api.php create mode 100644 server/routes/channels.php create mode 100644 server/routes/console.php create mode 100644 server/routes/web.php create mode 100644 server/server.php create mode 100644 server/storage/app/.gitignore create mode 100644 server/storage/app/public/.gitignore create mode 100644 server/storage/framework/.gitignore create mode 100644 server/storage/framework/cache/.gitignore create mode 100644 server/storage/framework/cache/data/.gitignore create mode 100644 server/storage/framework/sessions/.gitignore create mode 100644 server/storage/framework/testing/.gitignore create mode 100644 server/storage/framework/views/.gitignore create mode 100644 server/storage/logs/.gitignore create mode 100644 server/tests/CreatesApplication.php create mode 100644 server/tests/Feature/ExampleTest.php create mode 100644 server/tests/TestCase.php create mode 100644 server/tests/Unit/ExampleTest.php create mode 100644 server/webpack.mix.js create mode 100644 socket/node_modules/accepts/HISTORY.md create mode 100644 socket/node_modules/accepts/LICENSE create mode 100644 socket/node_modules/accepts/README.md create mode 100644 socket/node_modules/accepts/index.js create mode 100644 socket/node_modules/accepts/package.json create mode 100644 socket/node_modules/base64id/CHANGELOG.md create mode 100644 socket/node_modules/base64id/LICENSE create mode 100644 socket/node_modules/base64id/README.md create mode 100644 socket/node_modules/base64id/lib/base64id.js create mode 100644 socket/node_modules/base64id/package.json create mode 100644 socket/node_modules/component-emitter/History.md create mode 100644 socket/node_modules/component-emitter/LICENSE create mode 100644 socket/node_modules/component-emitter/Readme.md create mode 100644 socket/node_modules/component-emitter/index.js create mode 100644 socket/node_modules/component-emitter/package.json create mode 100644 socket/node_modules/cookie/HISTORY.md create mode 100644 socket/node_modules/cookie/LICENSE create mode 100644 socket/node_modules/cookie/README.md create mode 100644 socket/node_modules/cookie/index.js create mode 100644 socket/node_modules/cookie/package.json create mode 100644 socket/node_modules/cors/CONTRIBUTING.md create mode 100644 socket/node_modules/cors/HISTORY.md create mode 100644 socket/node_modules/cors/LICENSE create mode 100644 socket/node_modules/cors/README.md create mode 100644 socket/node_modules/cors/lib/index.js create mode 100644 socket/node_modules/cors/package.json create mode 100644 socket/node_modules/debug/CHANGELOG.md create mode 100644 socket/node_modules/debug/LICENSE create mode 100644 socket/node_modules/debug/README.md create mode 100644 socket/node_modules/debug/dist/debug.js create mode 100644 socket/node_modules/debug/package.json create mode 100644 socket/node_modules/debug/src/browser.js create mode 100644 socket/node_modules/debug/src/common.js create mode 100644 socket/node_modules/debug/src/index.js create mode 100644 socket/node_modules/debug/src/node.js create mode 100644 socket/node_modules/engine.io-parser/CHANGELOG.md create mode 100644 socket/node_modules/engine.io-parser/LICENSE create mode 100644 socket/node_modules/engine.io-parser/Readme.md create mode 100644 socket/node_modules/engine.io-parser/lib/commons.js create mode 100644 socket/node_modules/engine.io-parser/lib/decodePacket.browser.js create mode 100644 socket/node_modules/engine.io-parser/lib/decodePacket.js create mode 100644 socket/node_modules/engine.io-parser/lib/encodePacket.browser.js create mode 100644 socket/node_modules/engine.io-parser/lib/encodePacket.js create mode 100644 socket/node_modules/engine.io-parser/lib/index.js create mode 100644 socket/node_modules/engine.io-parser/package.json create mode 100644 socket/node_modules/engine.io/CHANGELOG.md create mode 100644 socket/node_modules/engine.io/LICENSE create mode 100644 socket/node_modules/engine.io/README.md create mode 100644 socket/node_modules/engine.io/lib/engine.io.js create mode 100644 socket/node_modules/engine.io/lib/server.js create mode 100644 socket/node_modules/engine.io/lib/socket.js create mode 100644 socket/node_modules/engine.io/lib/transport.js create mode 100644 socket/node_modules/engine.io/lib/transports/index.js create mode 100644 socket/node_modules/engine.io/lib/transports/polling-jsonp.js create mode 100644 socket/node_modules/engine.io/lib/transports/polling.js create mode 100644 socket/node_modules/engine.io/lib/transports/websocket.js create mode 100644 socket/node_modules/engine.io/package.json create mode 100644 socket/node_modules/mime-db/HISTORY.md create mode 100644 socket/node_modules/mime-db/LICENSE create mode 100644 socket/node_modules/mime-db/README.md create mode 100644 socket/node_modules/mime-db/db.json create mode 100644 socket/node_modules/mime-db/index.js create mode 100644 socket/node_modules/mime-db/package.json create mode 100644 socket/node_modules/mime-types/HISTORY.md create mode 100644 socket/node_modules/mime-types/LICENSE create mode 100644 socket/node_modules/mime-types/README.md create mode 100644 socket/node_modules/mime-types/index.js create mode 100644 socket/node_modules/mime-types/package.json create mode 100644 socket/node_modules/ms/index.js create mode 100644 socket/node_modules/ms/license.md create mode 100644 socket/node_modules/ms/package.json create mode 100644 socket/node_modules/ms/readme.md create mode 100644 socket/node_modules/negotiator/HISTORY.md create mode 100644 socket/node_modules/negotiator/LICENSE create mode 100644 socket/node_modules/negotiator/README.md create mode 100644 socket/node_modules/negotiator/index.js create mode 100644 socket/node_modules/negotiator/lib/charset.js create mode 100644 socket/node_modules/negotiator/lib/encoding.js create mode 100644 socket/node_modules/negotiator/lib/language.js create mode 100644 socket/node_modules/negotiator/lib/mediaType.js create mode 100644 socket/node_modules/negotiator/package.json create mode 100644 socket/node_modules/object-assign/index.js create mode 100644 socket/node_modules/object-assign/license create mode 100644 socket/node_modules/object-assign/package.json create mode 100644 socket/node_modules/object-assign/readme.md create mode 100644 socket/node_modules/socket.io-adapter/CHANGELOG.md create mode 100644 socket/node_modules/socket.io-adapter/LICENSE create mode 100644 socket/node_modules/socket.io-adapter/Readme.md create mode 100644 socket/node_modules/socket.io-adapter/dist/index.d.ts create mode 100644 socket/node_modules/socket.io-adapter/dist/index.js create mode 100644 socket/node_modules/socket.io-adapter/package.json create mode 100644 socket/node_modules/socket.io-parser/CHANGELOG.md create mode 100644 socket/node_modules/socket.io-parser/LICENSE create mode 100644 socket/node_modules/socket.io-parser/Readme.md create mode 100644 socket/node_modules/socket.io-parser/dist/binary.d.ts create mode 100644 socket/node_modules/socket.io-parser/dist/binary.js create mode 100644 socket/node_modules/socket.io-parser/dist/index.d.ts create mode 100644 socket/node_modules/socket.io-parser/dist/index.js create mode 100644 socket/node_modules/socket.io-parser/dist/is-binary.d.ts create mode 100644 socket/node_modules/socket.io-parser/dist/is-binary.js create mode 100644 socket/node_modules/socket.io-parser/package.json create mode 100644 socket/node_modules/socket.io/CHANGELOG.md create mode 100644 socket/node_modules/socket.io/LICENSE create mode 100644 socket/node_modules/socket.io/Readme.md create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.js create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.js.map create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.min.js create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.min.js.map create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.msgpack.min.js create mode 100644 socket/node_modules/socket.io/client-dist/socket.io.msgpack.min.js.map create mode 100644 socket/node_modules/socket.io/dist/client.d.ts create mode 100644 socket/node_modules/socket.io/dist/client.js create mode 100644 socket/node_modules/socket.io/dist/index.d.ts create mode 100644 socket/node_modules/socket.io/dist/index.js create mode 100644 socket/node_modules/socket.io/dist/namespace.d.ts create mode 100644 socket/node_modules/socket.io/dist/namespace.js create mode 100644 socket/node_modules/socket.io/dist/parent-namespace.d.ts create mode 100644 socket/node_modules/socket.io/dist/parent-namespace.js create mode 100644 socket/node_modules/socket.io/dist/socket.d.ts create mode 100644 socket/node_modules/socket.io/dist/socket.js create mode 100644 socket/node_modules/socket.io/package.json create mode 100644 socket/node_modules/socket.io/wrapper.mjs create mode 100644 socket/node_modules/vary/HISTORY.md create mode 100644 socket/node_modules/vary/LICENSE create mode 100644 socket/node_modules/vary/README.md create mode 100644 socket/node_modules/vary/index.js create mode 100644 socket/node_modules/vary/package.json create mode 100644 socket/node_modules/ws/LICENSE create mode 100644 socket/node_modules/ws/README.md create mode 100644 socket/node_modules/ws/browser.js create mode 100644 socket/node_modules/ws/index.js create mode 100644 socket/node_modules/ws/lib/buffer-util.js create mode 100644 socket/node_modules/ws/lib/constants.js create mode 100644 socket/node_modules/ws/lib/event-target.js create mode 100644 socket/node_modules/ws/lib/extension.js create mode 100644 socket/node_modules/ws/lib/limiter.js create mode 100644 socket/node_modules/ws/lib/permessage-deflate.js create mode 100644 socket/node_modules/ws/lib/receiver.js create mode 100644 socket/node_modules/ws/lib/sender.js create mode 100644 socket/node_modules/ws/lib/stream.js create mode 100644 socket/node_modules/ws/lib/validation.js create mode 100644 socket/node_modules/ws/lib/websocket-server.js create mode 100644 socket/node_modules/ws/lib/websocket.js create mode 100644 socket/node_modules/ws/package.json create mode 100644 socket/package-lock.json create mode 100644 socket/package.json diff --git a/README.md b/README.md new file mode 100644 index 0000000..cc21aaf --- /dev/null +++ b/README.md @@ -0,0 +1,5 @@ +# COLLABORATIVE DOCUMENT EDITOR +This projects main goal is making people edit their files online collaboratively. + +https://dogukan.dev +me@dogukan.dev diff --git a/client b/client new file mode 160000 index 0000000..df30219 --- /dev/null +++ b/client @@ -0,0 +1 @@ +Subproject commit df30219e2cf87e62c8e2460500a9bea62e13ac4a diff --git a/server/.editorconfig b/server/.editorconfig new file mode 100644 index 0000000..6537ca4 --- /dev/null +++ b/server/.editorconfig @@ -0,0 +1,15 @@ +root = true + +[*] +charset = utf-8 +end_of_line = lf +insert_final_newline = true +indent_style = space +indent_size = 4 +trim_trailing_whitespace = true + +[*.md] +trim_trailing_whitespace = false + +[*.{yml,yaml}] +indent_size = 2 diff --git a/server/.env.example b/server/.env.example new file mode 100644 index 0000000..7dc51e1 --- /dev/null +++ b/server/.env.example @@ -0,0 +1,47 @@ +APP_NAME=Laravel +APP_ENV=local +APP_KEY= +APP_DEBUG=true +APP_URL=http://localhost + +LOG_CHANNEL=stack +LOG_LEVEL=debug + +DB_CONNECTION=mysql +DB_HOST=127.0.0.1 +DB_PORT=3306 +DB_DATABASE=laravel +DB_USERNAME=root +DB_PASSWORD= + +BROADCAST_DRIVER=log +CACHE_DRIVER=file +QUEUE_CONNECTION=sync +SESSION_DRIVER=file +SESSION_LIFETIME=120 + +REDIS_HOST=127.0.0.1 +REDIS_PASSWORD=null +REDIS_PORT=6379 + +MAIL_MAILER=smtp +MAIL_HOST=smtp.mailtrap.io +MAIL_PORT=2525 +MAIL_USERNAME=null +MAIL_PASSWORD=null +MAIL_ENCRYPTION=null +MAIL_FROM_ADDRESS=null +MAIL_FROM_NAME="${APP_NAME}" + +AWS_ACCESS_KEY_ID= +AWS_SECRET_ACCESS_KEY= +AWS_DEFAULT_REGION=us-east-1 +AWS_BUCKET= + +PUSHER_APP_ID= +PUSHER_APP_KEY= +PUSHER_APP_SECRET= +PUSHER_APP_CLUSTER=mt1 + +MIX_PUSHER_APP_KEY="${PUSHER_APP_KEY}" +MIX_PUSHER_APP_CLUSTER="${PUSHER_APP_CLUSTER}" diff --git a/server/.gitattributes b/server/.gitattributes new file mode 100644 index 0000000..967315d --- /dev/null +++ b/server/.gitattributes @@ -0,0 +1,5 @@ +* text=auto +*.css linguist-vendored +*.scss linguist-vendored +*.js linguist-vendored +CHANGELOG.md export-ignore diff --git a/server/.gitignore b/server/.gitignore new file mode 100644 index 0000000..0f7df0f --- /dev/null +++ b/server/.gitignore @@ -0,0 +1,12 @@ +/node_modules +/public/hot +/public/storage +/storage/*.key +/vendor +.env +.env.backup +.phpunit.result.cache +Homestead.json +Homestead.yaml +npm-debug.log +yarn-error.log diff --git a/server/.styleci.yml b/server/.styleci.yml new file mode 100644 index 0000000..9231873 --- /dev/null +++ b/server/.styleci.yml @@ -0,0 +1,13 @@ +php: + preset: laravel + disabled: + - no_unused_imports + finder: + not-name: + - index.php + - server.php +js: + finder: + not-name: + - webpack.mix.js +css: true diff --git a/server/README.md b/server/README.md new file mode 100644 index 0000000..2f7ddcc --- /dev/null +++ b/server/README.md @@ -0,0 +1,61 @@ +

+ +

+Build Status +Total Downloads +Latest Stable Version +License +

+ +## About Laravel + +Laravel is a web application framework with expressive, elegant syntax. We believe development must be an enjoyable and creative experience to be truly fulfilling. Laravel takes the pain out of development by easing common tasks used in many web projects, such as: + +- [Simple, fast routing engine](https://laravel.com/docs/routing). +- [Powerful dependency injection container](https://laravel.com/docs/container). +- Multiple back-ends for [session](https://laravel.com/docs/session) and [cache](https://laravel.com/docs/cache) storage. +- Expressive, intuitive [database ORM](https://laravel.com/docs/eloquent). +- Database agnostic [schema migrations](https://laravel.com/docs/migrations). +- [Robust background job processing](https://laravel.com/docs/queues). +- [Real-time event broadcasting](https://laravel.com/docs/broadcasting). + +Laravel is accessible, powerful, and provides tools required for large, robust applications. + +## Learning Laravel + +Laravel has the most extensive and thorough [documentation](https://laravel.com/docs) and video tutorial library of all modern web application frameworks, making it a breeze to get started with the framework. + +If you don't feel like reading, [Laracasts](https://laracasts.com) can help. Laracasts contains over 1500 video tutorials on a range of topics including Laravel, modern PHP, unit testing, and JavaScript. Boost your skills by digging into our comprehensive video library. + +## Laravel Sponsors + +We would like to extend our thanks to the following sponsors for funding Laravel development. If you are interested in becoming a sponsor, please visit the Laravel [Patreon page](https://patreon.com/taylorotwell). + +### Premium Partners + +- **[Vehikl](https://vehikl.com/)** +- **[Tighten Co.](https://tighten.co)** +- **[Kirschbaum Development Group](https://kirschbaumdevelopment.com)** +- **[64 Robots](https://64robots.com)** +- **[Cubet Techno Labs](https://cubettech.com)** +- **[Cyber-Duck](https://cyber-duck.co.uk)** +- **[Many](https://www.many.co.uk)** +- **[Webdock, Fast VPS Hosting](https://www.webdock.io/en)** +- **[DevSquad](https://devsquad.com)** +- **[OP.GG](https://op.gg)** + +## Contributing + +Thank you for considering contributing to the Laravel framework! The contribution guide can be found in the [Laravel documentation](https://laravel.com/docs/contributions). + +## Code of Conduct + +In order to ensure that the Laravel community is welcoming to all, please review and abide by the [Code of Conduct](https://laravel.com/docs/contributions#code-of-conduct). + +## Security Vulnerabilities + +If you discover a security vulnerability within Laravel, please send an e-mail to Taylor Otwell via [taylor@laravel.com](mailto:taylor@laravel.com). All security vulnerabilities will be promptly addressed. + +## License + +The Laravel framework is open-sourced software licensed under the [MIT license](https://opensource.org/licenses/MIT). diff --git a/server/app/Console/Kernel.php b/server/app/Console/Kernel.php new file mode 100644 index 0000000..69914e9 --- /dev/null +++ b/server/app/Console/Kernel.php @@ -0,0 +1,41 @@ +command('inspire')->hourly(); + } + + /** + * Register the commands for the application. + * + * @return void + */ + protected function commands() + { + $this->load(__DIR__.'/Commands'); + + require base_path('routes/console.php'); + } +} diff --git a/server/app/Exceptions/Handler.php b/server/app/Exceptions/Handler.php new file mode 100644 index 0000000..7e40d73 --- /dev/null +++ b/server/app/Exceptions/Handler.php @@ -0,0 +1,37 @@ + [ + \App\Http\Middleware\EncryptCookies::class, + \Illuminate\Cookie\Middleware\AddQueuedCookiesToResponse::class, + \Illuminate\Session\Middleware\StartSession::class, + // \Illuminate\Session\Middleware\AuthenticateSession::class, + \Illuminate\View\Middleware\ShareErrorsFromSession::class, + \App\Http\Middleware\VerifyCsrfToken::class, + \Illuminate\Routing\Middleware\SubstituteBindings::class, + ], + + 'api' => [ + 'throttle:api', + \Illuminate\Routing\Middleware\SubstituteBindings::class, + ], + ]; + + /** + * The application's route middleware. + * + * These middleware may be assigned to groups or used individually. + * + * @var array + */ + protected $routeMiddleware = [ + 'auth' => \App\Http\Middleware\Authenticate::class, + 'auth.basic' => \Illuminate\Auth\Middleware\AuthenticateWithBasicAuth::class, + 'cache.headers' => \Illuminate\Http\Middleware\SetCacheHeaders::class, + 'can' => \Illuminate\Auth\Middleware\Authorize::class, + 'guest' => \App\Http\Middleware\RedirectIfAuthenticated::class, + 'password.confirm' => \Illuminate\Auth\Middleware\RequirePassword::class, + 'signed' => \Illuminate\Routing\Middleware\ValidateSignature::class, + 'throttle' => \Illuminate\Routing\Middleware\ThrottleRequests::class, + 'verified' => \Illuminate\Auth\Middleware\EnsureEmailIsVerified::class, + ]; +} diff --git a/server/app/Http/Middleware/Authenticate.php b/server/app/Http/Middleware/Authenticate.php new file mode 100644 index 0000000..704089a --- /dev/null +++ b/server/app/Http/Middleware/Authenticate.php @@ -0,0 +1,21 @@ +expectsJson()) { + return route('login'); + } + } +} diff --git a/server/app/Http/Middleware/EncryptCookies.php b/server/app/Http/Middleware/EncryptCookies.php new file mode 100644 index 0000000..033136a --- /dev/null +++ b/server/app/Http/Middleware/EncryptCookies.php @@ -0,0 +1,17 @@ +check()) { + return redirect(RouteServiceProvider::HOME); + } + } + + return $next($request); + } +} diff --git a/server/app/Http/Middleware/TrimStrings.php b/server/app/Http/Middleware/TrimStrings.php new file mode 100644 index 0000000..5a50e7b --- /dev/null +++ b/server/app/Http/Middleware/TrimStrings.php @@ -0,0 +1,18 @@ +allSubdomainsOfApplicationUrl(), + ]; + } +} diff --git a/server/app/Http/Middleware/TrustProxies.php b/server/app/Http/Middleware/TrustProxies.php new file mode 100644 index 0000000..14befce --- /dev/null +++ b/server/app/Http/Middleware/TrustProxies.php @@ -0,0 +1,23 @@ + 'datetime', + ]; +} diff --git a/server/app/Providers/AppServiceProvider.php b/server/app/Providers/AppServiceProvider.php new file mode 100644 index 0000000..ee8ca5b --- /dev/null +++ b/server/app/Providers/AppServiceProvider.php @@ -0,0 +1,28 @@ + 'App\Policies\ModelPolicy', + ]; + + /** + * Register any authentication / authorization services. + * + * @return void + */ + public function boot() + { + $this->registerPolicies(); + + // + } +} diff --git a/server/app/Providers/BroadcastServiceProvider.php b/server/app/Providers/BroadcastServiceProvider.php new file mode 100644 index 0000000..395c518 --- /dev/null +++ b/server/app/Providers/BroadcastServiceProvider.php @@ -0,0 +1,21 @@ + [ + SendEmailVerificationNotification::class, + ], + ]; + + /** + * Register any events for your application. + * + * @return void + */ + public function boot() + { + // + } +} diff --git a/server/app/Providers/RouteServiceProvider.php b/server/app/Providers/RouteServiceProvider.php new file mode 100644 index 0000000..3bd3c81 --- /dev/null +++ b/server/app/Providers/RouteServiceProvider.php @@ -0,0 +1,63 @@ +configureRateLimiting(); + + $this->routes(function () { + Route::prefix('api') + ->middleware('api') + ->namespace($this->namespace) + ->group(base_path('routes/api.php')); + + Route::middleware('web') + ->namespace($this->namespace) + ->group(base_path('routes/web.php')); + }); + } + + /** + * Configure the rate limiters for the application. + * + * @return void + */ + protected function configureRateLimiting() + { + RateLimiter::for('api', function (Request $request) { + return Limit::perMinute(60)->by(optional($request->user())->id ?: $request->ip()); + }); + } +} diff --git a/server/artisan b/server/artisan new file mode 100755 index 0000000..5c23e2e --- /dev/null +++ b/server/artisan @@ -0,0 +1,53 @@ +#!/usr/bin/env php +make(Illuminate\Contracts\Console\Kernel::class); + +$status = $kernel->handle( + $input = new Symfony\Component\Console\Input\ArgvInput, + new Symfony\Component\Console\Output\ConsoleOutput +); + +/* +|-------------------------------------------------------------------------- +| Shutdown The Application +|-------------------------------------------------------------------------- +| +| Once Artisan has finished running, we will fire off the shutdown events +| so that any final work may be done by the application before we shut +| down the process. This is the last thing to happen to the request. +| +*/ + +$kernel->terminate($input, $status); + +exit($status); diff --git a/server/bootstrap/app.php b/server/bootstrap/app.php new file mode 100644 index 0000000..037e17d --- /dev/null +++ b/server/bootstrap/app.php @@ -0,0 +1,55 @@ +singleton( + Illuminate\Contracts\Http\Kernel::class, + App\Http\Kernel::class +); + +$app->singleton( + Illuminate\Contracts\Console\Kernel::class, + App\Console\Kernel::class +); + +$app->singleton( + Illuminate\Contracts\Debug\ExceptionHandler::class, + App\Exceptions\Handler::class +); + +/* +|-------------------------------------------------------------------------- +| Return The Application +|-------------------------------------------------------------------------- +| +| This script returns the application instance. The instance is given to +| the calling script so we can separate the building of the instances +| from the actual running of the application and sending responses. +| +*/ + +return $app; diff --git a/server/bootstrap/cache/.gitignore b/server/bootstrap/cache/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/bootstrap/cache/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/composer.json b/server/composer.json new file mode 100644 index 0000000..9d06962 --- /dev/null +++ b/server/composer.json @@ -0,0 +1,61 @@ +{ + "name": "laravel/laravel", + "type": "project", + "description": "The Laravel Framework.", + "keywords": [ + "framework", + "laravel" + ], + "license": "MIT", + "require": { + "php": "^7.3|^8.0", + "fideloper/proxy": "^4.4", + "fruitcake/laravel-cors": "^2.0", + "guzzlehttp/guzzle": "^7.0.1", + "laravel/framework": "^8.12", + "laravel/tinker": "^2.5" + }, + "require-dev": { + "facade/ignition": "^2.5", + "fakerphp/faker": "^1.9.1", + "mockery/mockery": "^1.4.2", + "nunomaduro/collision": "^5.0", + "phpunit/phpunit": "^9.3.3" + }, + "config": { + "optimize-autoloader": true, + "preferred-install": "dist", + "sort-packages": true + }, + "extra": { + "laravel": { + "dont-discover": [] + } + }, + "autoload": { + "psr-4": { + "App\\": "app/", + "Database\\Factories\\": "database/factories/", + "Database\\Seeders\\": "database/seeders/" + } + }, + "autoload-dev": { + "psr-4": { + "Tests\\": "tests/" + } + }, + "minimum-stability": "dev", + "prefer-stable": true, + "scripts": { + "post-autoload-dump": [ + "Illuminate\\Foundation\\ComposerScripts::postAutoloadDump", + "@php artisan package:discover --ansi" + ], + "post-root-package-install": [ + "@php -r \"file_exists('.env') || copy('.env.example', '.env');\"" + ], + "post-create-project-cmd": [ + "@php artisan key:generate --ansi" + ] + } +} diff --git a/server/composer.lock b/server/composer.lock new file mode 100644 index 0000000..a9838ff --- /dev/null +++ b/server/composer.lock @@ -0,0 +1,7263 @@ +{ + "_readme": [ + "This file locks the dependencies of your project to a known state", + "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", + "This file is @generated automatically" + ], + "content-hash": "fac753ae2702317b354e7eb283f28cbc", + "packages": [ + { + "name": "asm89/stack-cors", + "version": "v2.0.2", + "source": { + "type": "git", + "url": "https://github.com/asm89/stack-cors.git", + "reference": "8d8f88b3b3830916be94292c1fbce84433efb1aa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/asm89/stack-cors/zipball/8d8f88b3b3830916be94292c1fbce84433efb1aa", + "reference": "8d8f88b3b3830916be94292c1fbce84433efb1aa", + "shasum": "" + }, + "require": { + "php": "^7.0|^8.0", + "symfony/http-foundation": "~2.7|~3.0|~4.0|~5.0", + "symfony/http-kernel": "~2.7|~3.0|~4.0|~5.0" + }, + "require-dev": { + "phpunit/phpunit": "^6|^7|^8|^9", + "squizlabs/php_codesniffer": "^3.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "psr-4": { + "Asm89\\Stack\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Alexander", + "email": "iam.asm89@gmail.com" + } + ], + "description": "Cross-origin resource sharing library and stack middleware", + "homepage": "https://github.com/asm89/stack-cors", + "keywords": [ + "cors", + "stack" + ], + "support": { + "issues": "https://github.com/asm89/stack-cors/issues", + "source": "https://github.com/asm89/stack-cors/tree/v2.0.2" + }, + "time": "2020-10-29T16:03:21+00:00" + }, + { + "name": "brick/math", + "version": "0.9.1", + "source": { + "type": "git", + "url": "https://github.com/brick/math.git", + "reference": "283a40c901101e66de7061bd359252c013dcc43c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/brick/math/zipball/283a40c901101e66de7061bd359252c013dcc43c", + "reference": "283a40c901101e66de7061bd359252c013dcc43c", + "shasum": "" + }, + "require": { + "ext-json": "*", + "php": "^7.1|^8.0" + }, + "require-dev": { + "php-coveralls/php-coveralls": "^2.2", + "phpunit/phpunit": "^7.5.15|^8.5", + "vimeo/psalm": "^3.5" + }, + "type": "library", + "autoload": { + "psr-4": { + "Brick\\Math\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Arbitrary-precision arithmetic library", + "keywords": [ + "Arbitrary-precision", + "BigInteger", + "BigRational", + "arithmetic", + "bigdecimal", + "bignum", + "brick", + "math" + ], + "support": { + "issues": "https://github.com/brick/math/issues", + "source": "https://github.com/brick/math/tree/master" + }, + "funding": [ + { + "url": "https://tidelift.com/funding/github/packagist/brick/math", + "type": "tidelift" + } + ], + "time": "2020-08-18T23:57:15+00:00" + }, + { + "name": "dnoegel/php-xdg-base-dir", + "version": "v0.1.1", + "source": { + "type": "git", + "url": "https://github.com/dnoegel/php-xdg-base-dir.git", + "reference": "8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/dnoegel/php-xdg-base-dir/zipball/8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd", + "reference": "8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd", + "shasum": "" + }, + "require": { + "php": ">=5.3.2" + }, + "require-dev": { + "phpunit/phpunit": "~7.0|~6.0|~5.0|~4.8.35" + }, + "type": "library", + "autoload": { + "psr-4": { + "XdgBaseDir\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "implementation of xdg base directory specification for php", + "support": { + "issues": "https://github.com/dnoegel/php-xdg-base-dir/issues", + "source": "https://github.com/dnoegel/php-xdg-base-dir/tree/v0.1.1" + }, + "time": "2019-12-04T15:06:13+00:00" + }, + { + "name": "doctrine/inflector", + "version": "2.0.3", + "source": { + "type": "git", + "url": "https://github.com/doctrine/inflector.git", + "reference": "9cf661f4eb38f7c881cac67c75ea9b00bf97b210" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/inflector/zipball/9cf661f4eb38f7c881cac67c75ea9b00bf97b210", + "reference": "9cf661f4eb38f7c881cac67c75ea9b00bf97b210", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "require-dev": { + "doctrine/coding-standard": "^7.0", + "phpstan/phpstan": "^0.11", + "phpstan/phpstan-phpunit": "^0.11", + "phpstan/phpstan-strict-rules": "^0.11", + "phpunit/phpunit": "^7.0 || ^8.0 || ^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Doctrine\\Inflector\\": "lib/Doctrine/Inflector" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Guilherme Blanco", + "email": "guilhermeblanco@gmail.com" + }, + { + "name": "Roman Borschel", + "email": "roman@code-factory.org" + }, + { + "name": "Benjamin Eberlei", + "email": "kontakt@beberlei.de" + }, + { + "name": "Jonathan Wage", + "email": "jonwage@gmail.com" + }, + { + "name": "Johannes Schmitt", + "email": "schmittjoh@gmail.com" + } + ], + "description": "PHP Doctrine Inflector is a small library that can perform string manipulations with regard to upper/lowercase and singular/plural forms of words.", + "homepage": "https://www.doctrine-project.org/projects/inflector.html", + "keywords": [ + "inflection", + "inflector", + "lowercase", + "manipulation", + "php", + "plural", + "singular", + "strings", + "uppercase", + "words" + ], + "support": { + "issues": "https://github.com/doctrine/inflector/issues", + "source": "https://github.com/doctrine/inflector/tree/2.0.x" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finflector", + "type": "tidelift" + } + ], + "time": "2020-05-29T15:13:26+00:00" + }, + { + "name": "doctrine/lexer", + "version": "1.2.1", + "source": { + "type": "git", + "url": "https://github.com/doctrine/lexer.git", + "reference": "e864bbf5904cb8f5bb334f99209b48018522f042" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/lexer/zipball/e864bbf5904cb8f5bb334f99209b48018522f042", + "reference": "e864bbf5904cb8f5bb334f99209b48018522f042", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "require-dev": { + "doctrine/coding-standard": "^6.0", + "phpstan/phpstan": "^0.11.8", + "phpunit/phpunit": "^8.2" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.2.x-dev" + } + }, + "autoload": { + "psr-4": { + "Doctrine\\Common\\Lexer\\": "lib/Doctrine/Common/Lexer" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Guilherme Blanco", + "email": "guilhermeblanco@gmail.com" + }, + { + "name": "Roman Borschel", + "email": "roman@code-factory.org" + }, + { + "name": "Johannes Schmitt", + "email": "schmittjoh@gmail.com" + } + ], + "description": "PHP Doctrine Lexer parser library that can be used in Top-Down, Recursive Descent Parsers.", + "homepage": "https://www.doctrine-project.org/projects/lexer.html", + "keywords": [ + "annotations", + "docblock", + "lexer", + "parser", + "php" + ], + "support": { + "issues": "https://github.com/doctrine/lexer/issues", + "source": "https://github.com/doctrine/lexer/tree/1.2.1" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Flexer", + "type": "tidelift" + } + ], + "time": "2020-05-25T17:44:05+00:00" + }, + { + "name": "dragonmantank/cron-expression", + "version": "v3.0.2", + "source": { + "type": "git", + "url": "https://github.com/dragonmantank/cron-expression.git", + "reference": "48212cdc0a79051d50d7fc2f0645c5a321caf926" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/48212cdc0a79051d50d7fc2f0645c5a321caf926", + "reference": "48212cdc0a79051d50d7fc2f0645c5a321caf926", + "shasum": "" + }, + "require": { + "php": "^7.1|^8.0" + }, + "replace": { + "mtdowling/cron-expression": "^1.0" + }, + "require-dev": { + "phpstan/phpstan": "^0.11|^0.12", + "phpunit/phpunit": "^7.0|^8.0|^9.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Cron\\": "src/Cron/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Chris Tankersley", + "email": "chris@ctankersley.com", + "homepage": "https://github.com/dragonmantank" + } + ], + "description": "CRON for PHP: Calculate the next or previous run date and determine if a CRON expression is due", + "keywords": [ + "cron", + "schedule" + ], + "support": { + "issues": "https://github.com/dragonmantank/cron-expression/issues", + "source": "https://github.com/dragonmantank/cron-expression/tree/v3.0.2" + }, + "funding": [ + { + "url": "https://github.com/dragonmantank", + "type": "github" + } + ], + "time": "2020-10-13T01:26:01+00:00" + }, + { + "name": "egulias/email-validator", + "version": "2.1.23", + "source": { + "type": "git", + "url": "https://github.com/egulias/EmailValidator.git", + "reference": "5fa792ad1853ae2bc60528dd3e5cbf4542d3c1df" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/5fa792ad1853ae2bc60528dd3e5cbf4542d3c1df", + "reference": "5fa792ad1853ae2bc60528dd3e5cbf4542d3c1df", + "shasum": "" + }, + "require": { + "doctrine/lexer": "^1.0.1", + "php": ">=5.5", + "symfony/polyfill-intl-idn": "^1.10" + }, + "require-dev": { + "dominicsayers/isemail": "^3.0.7", + "phpunit/phpunit": "^4.8.36|^7.5.15", + "satooshi/php-coveralls": "^1.0.1" + }, + "suggest": { + "ext-intl": "PHP Internationalization Libraries are required to use the SpoofChecking validation" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Egulias\\EmailValidator\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Eduardo Gulias Davis" + } + ], + "description": "A library for validating emails against several RFCs", + "homepage": "https://github.com/egulias/EmailValidator", + "keywords": [ + "email", + "emailvalidation", + "emailvalidator", + "validation", + "validator" + ], + "support": { + "issues": "https://github.com/egulias/EmailValidator/issues", + "source": "https://github.com/egulias/EmailValidator/tree/2.1.23" + }, + "time": "2020-10-31T20:37:35+00:00" + }, + { + "name": "fideloper/proxy", + "version": "4.4.1", + "source": { + "type": "git", + "url": "https://github.com/fideloper/TrustedProxy.git", + "reference": "c073b2bd04d1c90e04dc1b787662b558dd65ade0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/fideloper/TrustedProxy/zipball/c073b2bd04d1c90e04dc1b787662b558dd65ade0", + "reference": "c073b2bd04d1c90e04dc1b787662b558dd65ade0", + "shasum": "" + }, + "require": { + "illuminate/contracts": "^5.0|^6.0|^7.0|^8.0|^9.0", + "php": ">=5.4.0" + }, + "require-dev": { + "illuminate/http": "^5.0|^6.0|^7.0|^8.0|^9.0", + "mockery/mockery": "^1.0", + "phpunit/phpunit": "^6.0" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "Fideloper\\Proxy\\TrustedProxyServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Fideloper\\Proxy\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Chris Fidao", + "email": "fideloper@gmail.com" + } + ], + "description": "Set trusted proxies for Laravel", + "keywords": [ + "load balancing", + "proxy", + "trusted proxy" + ], + "support": { + "issues": "https://github.com/fideloper/TrustedProxy/issues", + "source": "https://github.com/fideloper/TrustedProxy/tree/4.4.1" + }, + "time": "2020-10-22T13:48:01+00:00" + }, + { + "name": "fruitcake/laravel-cors", + "version": "v2.0.3", + "source": { + "type": "git", + "url": "https://github.com/fruitcake/laravel-cors.git", + "reference": "01de0fe5f71c70d1930ee9a80385f9cc28e0f63a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/fruitcake/laravel-cors/zipball/01de0fe5f71c70d1930ee9a80385f9cc28e0f63a", + "reference": "01de0fe5f71c70d1930ee9a80385f9cc28e0f63a", + "shasum": "" + }, + "require": { + "asm89/stack-cors": "^2.0.1", + "illuminate/contracts": "^6|^7|^8|^9", + "illuminate/support": "^6|^7|^8|^9", + "php": ">=7.2", + "symfony/http-foundation": "^4|^5", + "symfony/http-kernel": "^4.3.4|^5" + }, + "require-dev": { + "laravel/framework": "^6|^7|^8", + "orchestra/testbench-dusk": "^4|^5|^6", + "phpunit/phpunit": "^6|^7|^8", + "squizlabs/php_codesniffer": "^3.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + }, + "laravel": { + "providers": [ + "Fruitcake\\Cors\\CorsServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Fruitcake\\Cors\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fruitcake", + "homepage": "https://fruitcake.nl" + }, + { + "name": "Barry vd. Heuvel", + "email": "barryvdh@gmail.com" + } + ], + "description": "Adds CORS (Cross-Origin Resource Sharing) headers support in your Laravel application", + "keywords": [ + "api", + "cors", + "crossdomain", + "laravel" + ], + "support": { + "issues": "https://github.com/fruitcake/laravel-cors/issues", + "source": "https://github.com/fruitcake/laravel-cors/tree/v2.0.3" + }, + "funding": [ + { + "url": "https://github.com/barryvdh", + "type": "github" + } + ], + "time": "2020-10-22T13:57:20+00:00" + }, + { + "name": "graham-campbell/result-type", + "version": "v1.0.1", + "source": { + "type": "git", + "url": "https://github.com/GrahamCampbell/Result-Type.git", + "reference": "7e279d2cd5d7fbb156ce46daada972355cea27bb" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/7e279d2cd5d7fbb156ce46daada972355cea27bb", + "reference": "7e279d2cd5d7fbb156ce46daada972355cea27bb", + "shasum": "" + }, + "require": { + "php": "^7.0|^8.0", + "phpoption/phpoption": "^1.7.3" + }, + "require-dev": { + "phpunit/phpunit": "^6.5|^7.5|^8.5|^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "psr-4": { + "GrahamCampbell\\ResultType\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "graham@alt-three.com" + } + ], + "description": "An Implementation Of The Result Type", + "keywords": [ + "Graham Campbell", + "GrahamCampbell", + "Result Type", + "Result-Type", + "result" + ], + "support": { + "issues": "https://github.com/GrahamCampbell/Result-Type/issues", + "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.0.1" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/graham-campbell/result-type", + "type": "tidelift" + } + ], + "time": "2020-04-13T13:17:36+00:00" + }, + { + "name": "guzzlehttp/guzzle", + "version": "7.2.0", + "source": { + "type": "git", + "url": "https://github.com/guzzle/guzzle.git", + "reference": "0aa74dfb41ae110835923ef10a9d803a22d50e79" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/guzzle/zipball/0aa74dfb41ae110835923ef10a9d803a22d50e79", + "reference": "0aa74dfb41ae110835923ef10a9d803a22d50e79", + "shasum": "" + }, + "require": { + "ext-json": "*", + "guzzlehttp/promises": "^1.4", + "guzzlehttp/psr7": "^1.7", + "php": "^7.2.5 || ^8.0", + "psr/http-client": "^1.0" + }, + "provide": { + "psr/http-client-implementation": "1.0" + }, + "require-dev": { + "ext-curl": "*", + "php-http/client-integration-tests": "^3.0", + "phpunit/phpunit": "^8.5.5 || ^9.3.5", + "psr/log": "^1.1" + }, + "suggest": { + "ext-curl": "Required for CURL handler support", + "ext-intl": "Required for Internationalized Domain Name (IDN) support", + "psr/log": "Required for using the Log middleware" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "7.1-dev" + } + }, + "autoload": { + "psr-4": { + "GuzzleHttp\\": "src/" + }, + "files": [ + "src/functions_include.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "Márk Sági-Kazár", + "email": "mark.sagikazar@gmail.com", + "homepage": "https://sagikazarmark.hu" + } + ], + "description": "Guzzle is a PHP HTTP client library", + "homepage": "http://guzzlephp.org/", + "keywords": [ + "client", + "curl", + "framework", + "http", + "http client", + "psr-18", + "psr-7", + "rest", + "web service" + ], + "support": { + "issues": "https://github.com/guzzle/guzzle/issues", + "source": "https://github.com/guzzle/guzzle/tree/7.2.0" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://github.com/Nyholm", + "type": "github" + }, + { + "url": "https://github.com/alexeyshockov", + "type": "github" + }, + { + "url": "https://github.com/gmponos", + "type": "github" + } + ], + "time": "2020-10-10T11:47:56+00:00" + }, + { + "name": "guzzlehttp/promises", + "version": "1.4.0", + "source": { + "type": "git", + "url": "https://github.com/guzzle/promises.git", + "reference": "60d379c243457e073cff02bc323a2a86cb355631" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/promises/zipball/60d379c243457e073cff02bc323a2a86cb355631", + "reference": "60d379c243457e073cff02bc323a2a86cb355631", + "shasum": "" + }, + "require": { + "php": ">=5.5" + }, + "require-dev": { + "symfony/phpunit-bridge": "^4.4 || ^5.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.4-dev" + } + }, + "autoload": { + "psr-4": { + "GuzzleHttp\\Promise\\": "src/" + }, + "files": [ + "src/functions_include.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + } + ], + "description": "Guzzle promises library", + "keywords": [ + "promise" + ], + "support": { + "issues": "https://github.com/guzzle/promises/issues", + "source": "https://github.com/guzzle/promises/tree/1.4.0" + }, + "time": "2020-09-30T07:37:28+00:00" + }, + { + "name": "guzzlehttp/psr7", + "version": "1.7.0", + "source": { + "type": "git", + "url": "https://github.com/guzzle/psr7.git", + "reference": "53330f47520498c0ae1f61f7e2c90f55690c06a3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/psr7/zipball/53330f47520498c0ae1f61f7e2c90f55690c06a3", + "reference": "53330f47520498c0ae1f61f7e2c90f55690c06a3", + "shasum": "" + }, + "require": { + "php": ">=5.4.0", + "psr/http-message": "~1.0", + "ralouphie/getallheaders": "^2.0.5 || ^3.0.0" + }, + "provide": { + "psr/http-message-implementation": "1.0" + }, + "require-dev": { + "ext-zlib": "*", + "phpunit/phpunit": "~4.8.36 || ^5.7.27 || ^6.5.14 || ^7.5.20 || ^8.5.8 || ^9.3.10" + }, + "suggest": { + "laminas/laminas-httphandlerrunner": "Emit PSR-7 responses" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.7-dev" + } + }, + "autoload": { + "psr-4": { + "GuzzleHttp\\Psr7\\": "src/" + }, + "files": [ + "src/functions_include.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "Tobias Schultze", + "homepage": "https://github.com/Tobion" + } + ], + "description": "PSR-7 message implementation that also provides common utility methods", + "keywords": [ + "http", + "message", + "psr-7", + "request", + "response", + "stream", + "uri", + "url" + ], + "support": { + "issues": "https://github.com/guzzle/psr7/issues", + "source": "https://github.com/guzzle/psr7/tree/1.7.0" + }, + "time": "2020-09-30T07:37:11+00:00" + }, + { + "name": "laravel/framework", + "version": "v8.13.0", + "source": { + "type": "git", + "url": "https://github.com/laravel/framework.git", + "reference": "37a0abd4f3dbc51e2256296b45f8be72c8fe2196" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/framework/zipball/37a0abd4f3dbc51e2256296b45f8be72c8fe2196", + "reference": "37a0abd4f3dbc51e2256296b45f8be72c8fe2196", + "shasum": "" + }, + "require": { + "doctrine/inflector": "^1.4|^2.0", + "dragonmantank/cron-expression": "^3.0.2", + "egulias/email-validator": "^2.1.10", + "ext-json": "*", + "ext-mbstring": "*", + "ext-openssl": "*", + "league/commonmark": "^1.3", + "league/flysystem": "^1.1", + "monolog/monolog": "^2.0", + "nesbot/carbon": "^2.31", + "opis/closure": "^3.6", + "php": "^7.3|^8.0", + "psr/container": "^1.0", + "psr/simple-cache": "^1.0", + "ramsey/uuid": "^4.0", + "swiftmailer/swiftmailer": "^6.0", + "symfony/console": "^5.1", + "symfony/error-handler": "^5.1", + "symfony/finder": "^5.1", + "symfony/http-foundation": "^5.1", + "symfony/http-kernel": "^5.1", + "symfony/mime": "^5.1", + "symfony/process": "^5.1", + "symfony/routing": "^5.1", + "symfony/var-dumper": "^5.1", + "tijsverkoyen/css-to-inline-styles": "^2.2.2", + "vlucas/phpdotenv": "^5.2", + "voku/portable-ascii": "^1.4.8" + }, + "conflict": { + "tightenco/collect": "<5.5.33" + }, + "provide": { + "psr/container-implementation": "1.0" + }, + "replace": { + "illuminate/auth": "self.version", + "illuminate/broadcasting": "self.version", + "illuminate/bus": "self.version", + "illuminate/cache": "self.version", + "illuminate/collections": "self.version", + "illuminate/config": "self.version", + "illuminate/console": "self.version", + "illuminate/container": "self.version", + "illuminate/contracts": "self.version", + "illuminate/cookie": "self.version", + "illuminate/database": "self.version", + "illuminate/encryption": "self.version", + "illuminate/events": "self.version", + "illuminate/filesystem": "self.version", + "illuminate/hashing": "self.version", + "illuminate/http": "self.version", + "illuminate/log": "self.version", + "illuminate/macroable": "self.version", + "illuminate/mail": "self.version", + "illuminate/notifications": "self.version", + "illuminate/pagination": "self.version", + "illuminate/pipeline": "self.version", + "illuminate/queue": "self.version", + "illuminate/redis": "self.version", + "illuminate/routing": "self.version", + "illuminate/session": "self.version", + "illuminate/support": "self.version", + "illuminate/testing": "self.version", + "illuminate/translation": "self.version", + "illuminate/validation": "self.version", + "illuminate/view": "self.version" + }, + "require-dev": { + "aws/aws-sdk-php": "^3.0", + "doctrine/dbal": "^2.6", + "filp/whoops": "^2.8", + "guzzlehttp/guzzle": "^6.5.5|^7.0.1", + "league/flysystem-cached-adapter": "^1.0", + "mockery/mockery": "^1.4.2", + "orchestra/testbench-core": "^6.5", + "pda/pheanstalk": "^4.0", + "phpunit/phpunit": "^8.5.8|^9.3.3", + "predis/predis": "^1.1.1", + "symfony/cache": "^5.1" + }, + "suggest": { + "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage and SES mail driver (^3.0).", + "doctrine/dbal": "Required to rename columns and drop SQLite columns (^2.6).", + "ext-ftp": "Required to use the Flysystem FTP driver.", + "ext-gd": "Required to use Illuminate\\Http\\Testing\\FileFactory::image().", + "ext-memcached": "Required to use the memcache cache driver.", + "ext-pcntl": "Required to use all features of the queue worker.", + "ext-posix": "Required to use all features of the queue worker.", + "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0).", + "fakerphp/faker": "Required to use the eloquent factory builder (^1.9.1).", + "filp/whoops": "Required for friendly error pages in development (^2.8).", + "guzzlehttp/guzzle": "Required to use the HTTP Client, Mailgun mail driver and the ping methods on schedules (^6.5.5|^7.0.1).", + "laravel/tinker": "Required to use the tinker console command (^2.0).", + "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^1.0).", + "league/flysystem-cached-adapter": "Required to use the Flysystem cache (^1.0).", + "league/flysystem-sftp": "Required to use the Flysystem SFTP driver (^1.0).", + "mockery/mockery": "Required to use mocking (^1.4.2).", + "nyholm/psr7": "Required to use PSR-7 bridging features (^1.2).", + "pda/pheanstalk": "Required to use the beanstalk queue driver (^4.0).", + "phpunit/phpunit": "Required to use assertions and run tests (^8.5.8|^9.3.3).", + "predis/predis": "Required to use the predis connector (^1.1.2).", + "psr/http-message": "Required to allow Storage::put to accept a StreamInterface (^1.0).", + "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (^4.0).", + "symfony/cache": "Required to PSR-6 cache bridge (^5.1).", + "symfony/filesystem": "Required to enable support for relative symbolic links (^5.1).", + "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^2.0).", + "wildbit/swiftmailer-postmark": "Required to use Postmark mail driver (^3.0)." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "8.x-dev" + } + }, + "autoload": { + "files": [ + "src/Illuminate/Collections/helpers.php", + "src/Illuminate/Events/functions.php", + "src/Illuminate/Foundation/helpers.php", + "src/Illuminate/Support/helpers.php" + ], + "psr-4": { + "Illuminate\\": "src/Illuminate/", + "Illuminate\\Support\\": [ + "src/Illuminate/Macroable/", + "src/Illuminate/Collections/" + ] + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "The Laravel Framework.", + "homepage": "https://laravel.com", + "keywords": [ + "framework", + "laravel" + ], + "support": { + "issues": "https://github.com/laravel/framework/issues", + "source": "https://github.com/laravel/framework" + }, + "time": "2020-11-03T14:13:19+00:00" + }, + { + "name": "laravel/tinker", + "version": "v2.5.0", + "source": { + "type": "git", + "url": "https://github.com/laravel/tinker.git", + "reference": "45884b526e10a88a1b179fa1a1a24d5468c668c2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/tinker/zipball/45884b526e10a88a1b179fa1a1a24d5468c668c2", + "reference": "45884b526e10a88a1b179fa1a1a24d5468c668c2", + "shasum": "" + }, + "require": { + "illuminate/console": "^6.0|^7.0|^8.0", + "illuminate/contracts": "^6.0|^7.0|^8.0", + "illuminate/support": "^6.0|^7.0|^8.0", + "php": "^7.2.5|^8.0", + "psy/psysh": "^0.10.4", + "symfony/var-dumper": "^4.3.4|^5.0" + }, + "require-dev": { + "mockery/mockery": "~1.3.3|^1.4.2", + "phpunit/phpunit": "^8.5.8|^9.3.3" + }, + "suggest": { + "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0)." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.x-dev" + }, + "laravel": { + "providers": [ + "Laravel\\Tinker\\TinkerServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Laravel\\Tinker\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "Powerful REPL for the Laravel framework.", + "keywords": [ + "REPL", + "Tinker", + "laravel", + "psysh" + ], + "support": { + "issues": "https://github.com/laravel/tinker/issues", + "source": "https://github.com/laravel/tinker/tree/v2.5.0" + }, + "time": "2020-10-29T13:07:12+00:00" + }, + { + "name": "league/commonmark", + "version": "1.5.7", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/commonmark.git", + "reference": "11df9b36fd4f1d2b727a73bf14931d81373b9a54" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/11df9b36fd4f1d2b727a73bf14931d81373b9a54", + "reference": "11df9b36fd4f1d2b727a73bf14931d81373b9a54", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "php": "^7.1 || ^8.0" + }, + "conflict": { + "scrutinizer/ocular": "1.7.*" + }, + "require-dev": { + "cebe/markdown": "~1.0", + "commonmark/commonmark.js": "0.29.2", + "erusev/parsedown": "~1.0", + "ext-json": "*", + "github/gfm": "0.29.0", + "michelf/php-markdown": "~1.4", + "mikehaertl/php-shellcommand": "^1.4", + "phpstan/phpstan": "^0.12", + "phpunit/phpunit": "^7.5 || ^8.5 || ^9.2", + "scrutinizer/ocular": "^1.5", + "symfony/finder": "^4.2" + }, + "bin": [ + "bin/commonmark" + ], + "type": "library", + "autoload": { + "psr-4": { + "League\\CommonMark\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Colin O'Dell", + "email": "colinodell@gmail.com", + "homepage": "https://www.colinodell.com", + "role": "Lead Developer" + } + ], + "description": "Highly-extensible PHP Markdown parser which fully supports the CommonMark spec and Github-Flavored Markdown (GFM)", + "homepage": "https://commonmark.thephpleague.com", + "keywords": [ + "commonmark", + "flavored", + "gfm", + "github", + "github-flavored", + "markdown", + "md", + "parser" + ], + "support": { + "docs": "https://commonmark.thephpleague.com/", + "issues": "https://github.com/thephpleague/commonmark/issues", + "rss": "https://github.com/thephpleague/commonmark/releases.atom", + "source": "https://github.com/thephpleague/commonmark" + }, + "funding": [ + { + "url": "https://enjoy.gitstore.app/repositories/thephpleague/commonmark", + "type": "custom" + }, + { + "url": "https://www.colinodell.com/sponsor", + "type": "custom" + }, + { + "url": "https://www.paypal.me/colinpodell/10.00", + "type": "custom" + }, + { + "url": "https://github.com/colinodell", + "type": "github" + }, + { + "url": "https://www.patreon.com/colinodell", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/league/commonmark", + "type": "tidelift" + } + ], + "time": "2020-10-31T13:49:32+00:00" + }, + { + "name": "league/flysystem", + "version": "1.1.3", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/flysystem.git", + "reference": "9be3b16c877d477357c015cec057548cf9b2a14a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/9be3b16c877d477357c015cec057548cf9b2a14a", + "reference": "9be3b16c877d477357c015cec057548cf9b2a14a", + "shasum": "" + }, + "require": { + "ext-fileinfo": "*", + "league/mime-type-detection": "^1.3", + "php": "^7.2.5 || ^8.0" + }, + "conflict": { + "league/flysystem-sftp": "<1.0.6" + }, + "require-dev": { + "phpspec/prophecy": "^1.11.1", + "phpunit/phpunit": "^8.5.8" + }, + "suggest": { + "ext-fileinfo": "Required for MimeType", + "ext-ftp": "Allows you to use FTP server storage", + "ext-openssl": "Allows you to use FTPS server storage", + "league/flysystem-aws-s3-v2": "Allows you to use S3 storage with AWS SDK v2", + "league/flysystem-aws-s3-v3": "Allows you to use S3 storage with AWS SDK v3", + "league/flysystem-azure": "Allows you to use Windows Azure Blob storage", + "league/flysystem-cached-adapter": "Flysystem adapter decorator for metadata caching", + "league/flysystem-eventable-filesystem": "Allows you to use EventableFilesystem", + "league/flysystem-rackspace": "Allows you to use Rackspace Cloud Files", + "league/flysystem-sftp": "Allows you to use SFTP server storage via phpseclib", + "league/flysystem-webdav": "Allows you to use WebDAV storage", + "league/flysystem-ziparchive": "Allows you to use ZipArchive adapter", + "spatie/flysystem-dropbox": "Allows you to use Dropbox storage", + "srmklive/flysystem-dropbox-v2": "Allows you to use Dropbox storage for PHP 5 applications" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.1-dev" + } + }, + "autoload": { + "psr-4": { + "League\\Flysystem\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Frank de Jonge", + "email": "info@frenky.net" + } + ], + "description": "Filesystem abstraction: Many filesystems, one API.", + "keywords": [ + "Cloud Files", + "WebDAV", + "abstraction", + "aws", + "cloud", + "copy.com", + "dropbox", + "file systems", + "files", + "filesystem", + "filesystems", + "ftp", + "rackspace", + "remote", + "s3", + "sftp", + "storage" + ], + "support": { + "issues": "https://github.com/thephpleague/flysystem/issues", + "source": "https://github.com/thephpleague/flysystem/tree/1.x" + }, + "funding": [ + { + "url": "https://offset.earth/frankdejonge", + "type": "other" + } + ], + "time": "2020-08-23T07:39:11+00:00" + }, + { + "name": "league/mime-type-detection", + "version": "1.5.1", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/mime-type-detection.git", + "reference": "353f66d7555d8a90781f6f5e7091932f9a4250aa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/353f66d7555d8a90781f6f5e7091932f9a4250aa", + "reference": "353f66d7555d8a90781f6f5e7091932f9a4250aa", + "shasum": "" + }, + "require": { + "ext-fileinfo": "*", + "php": "^7.2 || ^8.0" + }, + "require-dev": { + "phpstan/phpstan": "^0.12.36", + "phpunit/phpunit": "^8.5.8" + }, + "type": "library", + "autoload": { + "psr-4": { + "League\\MimeTypeDetection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Frank de Jonge", + "email": "info@frankdejonge.nl" + } + ], + "description": "Mime-type detection for Flysystem", + "support": { + "issues": "https://github.com/thephpleague/mime-type-detection/issues", + "source": "https://github.com/thephpleague/mime-type-detection/tree/1.5.1" + }, + "funding": [ + { + "url": "https://github.com/frankdejonge", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/league/flysystem", + "type": "tidelift" + } + ], + "time": "2020-10-18T11:50:25+00:00" + }, + { + "name": "monolog/monolog", + "version": "2.1.1", + "source": { + "type": "git", + "url": "https://github.com/Seldaek/monolog.git", + "reference": "f9eee5cec93dfb313a38b6b288741e84e53f02d5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/f9eee5cec93dfb313a38b6b288741e84e53f02d5", + "reference": "f9eee5cec93dfb313a38b6b288741e84e53f02d5", + "shasum": "" + }, + "require": { + "php": ">=7.2", + "psr/log": "^1.0.1" + }, + "provide": { + "psr/log-implementation": "1.0.0" + }, + "require-dev": { + "aws/aws-sdk-php": "^2.4.9 || ^3.0", + "doctrine/couchdb": "~1.0@dev", + "elasticsearch/elasticsearch": "^6.0", + "graylog2/gelf-php": "^1.4.2", + "php-amqplib/php-amqplib": "~2.4", + "php-console/php-console": "^3.1.3", + "php-parallel-lint/php-parallel-lint": "^1.0", + "phpspec/prophecy": "^1.6.1", + "phpunit/phpunit": "^8.5", + "predis/predis": "^1.1", + "rollbar/rollbar": "^1.3", + "ruflin/elastica": ">=0.90 <3.0", + "swiftmailer/swiftmailer": "^5.3|^6.0" + }, + "suggest": { + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-mbstring": "Allow to work properly with unicode symbols", + "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)", + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)", + "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "php-console/php-console": "Allow sending log messages to Google Chrome", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.x-dev" + } + }, + "autoload": { + "psr-4": { + "Monolog\\": "src/Monolog" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "http://seld.be" + } + ], + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "homepage": "http://github.com/Seldaek/monolog", + "keywords": [ + "log", + "logging", + "psr-3" + ], + "support": { + "issues": "https://github.com/Seldaek/monolog/issues", + "source": "https://github.com/Seldaek/monolog/tree/2.1.1" + }, + "funding": [ + { + "url": "https://github.com/Seldaek", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/monolog/monolog", + "type": "tidelift" + } + ], + "time": "2020-07-23T08:41:23+00:00" + }, + { + "name": "nesbot/carbon", + "version": "2.41.5", + "source": { + "type": "git", + "url": "https://github.com/briannesbitt/Carbon.git", + "reference": "c4a9caf97cfc53adfc219043bcecf42bc663acee" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/c4a9caf97cfc53adfc219043bcecf42bc663acee", + "reference": "c4a9caf97cfc53adfc219043bcecf42bc663acee", + "shasum": "" + }, + "require": { + "ext-json": "*", + "php": "^7.1.8 || ^8.0", + "symfony/polyfill-mbstring": "^1.0", + "symfony/translation": "^3.4 || ^4.0 || ^5.0" + }, + "require-dev": { + "doctrine/orm": "^2.7", + "friendsofphp/php-cs-fixer": "^2.14 || ^3.0", + "kylekatarnls/multi-tester": "^2.0", + "phpmd/phpmd": "^2.9", + "phpstan/extension-installer": "^1.0", + "phpstan/phpstan": "^0.12.35", + "phpunit/phpunit": "^7.5 || ^8.0", + "squizlabs/php_codesniffer": "^3.4" + }, + "bin": [ + "bin/carbon" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.x-dev", + "dev-3.x": "3.x-dev" + }, + "laravel": { + "providers": [ + "Carbon\\Laravel\\ServiceProvider" + ] + }, + "phpstan": { + "includes": [ + "extension.neon" + ] + } + }, + "autoload": { + "psr-4": { + "Carbon\\": "src/Carbon/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Brian Nesbitt", + "email": "brian@nesbot.com", + "homepage": "http://nesbot.com" + }, + { + "name": "kylekatarnls", + "homepage": "http://github.com/kylekatarnls" + } + ], + "description": "An API extension for DateTime that supports 281 different languages.", + "homepage": "http://carbon.nesbot.com", + "keywords": [ + "date", + "datetime", + "time" + ], + "support": { + "issues": "https://github.com/briannesbitt/Carbon/issues", + "source": "https://github.com/briannesbitt/Carbon" + }, + "funding": [ + { + "url": "https://opencollective.com/Carbon", + "type": "open_collective" + }, + { + "url": "https://tidelift.com/funding/github/packagist/nesbot/carbon", + "type": "tidelift" + } + ], + "time": "2020-10-23T06:02:30+00:00" + }, + { + "name": "nikic/php-parser", + "version": "v4.10.2", + "source": { + "type": "git", + "url": "https://github.com/nikic/PHP-Parser.git", + "reference": "658f1be311a230e0907f5dfe0213742aff0596de" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/658f1be311a230e0907f5dfe0213742aff0596de", + "reference": "658f1be311a230e0907f5dfe0213742aff0596de", + "shasum": "" + }, + "require": { + "ext-tokenizer": "*", + "php": ">=7.0" + }, + "require-dev": { + "ircmaxell/php-yacc": "^0.0.7", + "phpunit/phpunit": "^6.5 || ^7.0 || ^8.0 || ^9.0" + }, + "bin": [ + "bin/php-parse" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.9-dev" + } + }, + "autoload": { + "psr-4": { + "PhpParser\\": "lib/PhpParser" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Nikita Popov" + } + ], + "description": "A PHP parser written in PHP", + "keywords": [ + "parser", + "php" + ], + "support": { + "issues": "https://github.com/nikic/PHP-Parser/issues", + "source": "https://github.com/nikic/PHP-Parser/tree/v4.10.2" + }, + "time": "2020-09-26T10:30:38+00:00" + }, + { + "name": "opis/closure", + "version": "3.6.0", + "source": { + "type": "git", + "url": "https://github.com/opis/closure.git", + "reference": "c547f8262a5fa9ff507bd06cc394067b83a75085" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/opis/closure/zipball/c547f8262a5fa9ff507bd06cc394067b83a75085", + "reference": "c547f8262a5fa9ff507bd06cc394067b83a75085", + "shasum": "" + }, + "require": { + "php": "^5.4 || ^7.0 || ^8.0" + }, + "require-dev": { + "jeremeamia/superclosure": "^2.0", + "phpunit/phpunit": "^4.0 || ^5.0 || ^6.0 || ^7.0 || ^8.0 || ^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.6.x-dev" + } + }, + "autoload": { + "psr-4": { + "Opis\\Closure\\": "src/" + }, + "files": [ + "functions.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Marius Sarca", + "email": "marius.sarca@gmail.com" + }, + { + "name": "Sorin Sarca", + "email": "sarca_sorin@hotmail.com" + } + ], + "description": "A library that can be used to serialize closures (anonymous functions) and arbitrary objects.", + "homepage": "https://opis.io/closure", + "keywords": [ + "anonymous functions", + "closure", + "function", + "serializable", + "serialization", + "serialize" + ], + "support": { + "issues": "https://github.com/opis/closure/issues", + "source": "https://github.com/opis/closure/tree/3.6.0" + }, + "time": "2020-10-11T21:42:15+00:00" + }, + { + "name": "phpoption/phpoption", + "version": "1.7.5", + "source": { + "type": "git", + "url": "https://github.com/schmittjoh/php-option.git", + "reference": "994ecccd8f3283ecf5ac33254543eb0ac946d525" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/994ecccd8f3283ecf5ac33254543eb0ac946d525", + "reference": "994ecccd8f3283ecf5ac33254543eb0ac946d525", + "shasum": "" + }, + "require": { + "php": "^5.5.9 || ^7.0 || ^8.0" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.4.1", + "phpunit/phpunit": "^4.8.35 || ^5.7.27 || ^6.5.6 || ^7.0 || ^8.0 || ^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.7-dev" + } + }, + "autoload": { + "psr-4": { + "PhpOption\\": "src/PhpOption/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "Apache-2.0" + ], + "authors": [ + { + "name": "Johannes M. Schmitt", + "email": "schmittjoh@gmail.com" + }, + { + "name": "Graham Campbell", + "email": "graham@alt-three.com" + } + ], + "description": "Option Type for PHP", + "keywords": [ + "language", + "option", + "php", + "type" + ], + "support": { + "issues": "https://github.com/schmittjoh/php-option/issues", + "source": "https://github.com/schmittjoh/php-option/tree/1.7.5" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/phpoption/phpoption", + "type": "tidelift" + } + ], + "time": "2020-07-20T17:29:33+00:00" + }, + { + "name": "psr/container", + "version": "1.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/container.git", + "reference": "b7ce3b176482dbbc1245ebf52b181af44c2cf55f" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/container/zipball/b7ce3b176482dbbc1245ebf52b181af44c2cf55f", + "reference": "b7ce3b176482dbbc1245ebf52b181af44c2cf55f", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Container\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common Container Interface (PHP FIG PSR-11)", + "homepage": "https://github.com/php-fig/container", + "keywords": [ + "PSR-11", + "container", + "container-interface", + "container-interop", + "psr" + ], + "support": { + "issues": "https://github.com/php-fig/container/issues", + "source": "https://github.com/php-fig/container/tree/master" + }, + "time": "2017-02-14T16:28:37+00:00" + }, + { + "name": "psr/event-dispatcher", + "version": "1.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/event-dispatcher.git", + "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/event-dispatcher/zipball/dbefd12671e8a14ec7f180cab83036ed26714bb0", + "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0", + "shasum": "" + }, + "require": { + "php": ">=7.2.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\EventDispatcher\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Standard interfaces for event handling.", + "keywords": [ + "events", + "psr", + "psr-14" + ], + "support": { + "issues": "https://github.com/php-fig/event-dispatcher/issues", + "source": "https://github.com/php-fig/event-dispatcher/tree/1.0.0" + }, + "time": "2019-01-08T18:20:26+00:00" + }, + { + "name": "psr/http-client", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-client.git", + "reference": "2dfb5f6c5eff0e91e20e913f8c5452ed95b86621" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-client/zipball/2dfb5f6c5eff0e91e20e913f8c5452ed95b86621", + "reference": "2dfb5f6c5eff0e91e20e913f8c5452ed95b86621", + "shasum": "" + }, + "require": { + "php": "^7.0 || ^8.0", + "psr/http-message": "^1.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Client\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP clients", + "homepage": "https://github.com/php-fig/http-client", + "keywords": [ + "http", + "http-client", + "psr", + "psr-18" + ], + "support": { + "source": "https://github.com/php-fig/http-client/tree/master" + }, + "time": "2020-06-29T06:28:15+00:00" + }, + { + "name": "psr/http-message", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-message.git", + "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-message/zipball/f6561bf28d520154e4b0ec72be95418abe6d9363", + "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP messages", + "homepage": "https://github.com/php-fig/http-message", + "keywords": [ + "http", + "http-message", + "psr", + "psr-7", + "request", + "response" + ], + "support": { + "source": "https://github.com/php-fig/http-message/tree/master" + }, + "time": "2016-08-06T14:39:51+00:00" + }, + { + "name": "psr/log", + "version": "1.1.3", + "source": { + "type": "git", + "url": "https://github.com/php-fig/log.git", + "reference": "0f73288fd15629204f9d42b7055f72dacbe811fc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/log/zipball/0f73288fd15629204f9d42b7055f72dacbe811fc", + "reference": "0f73288fd15629204f9d42b7055f72dacbe811fc", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Log\\": "Psr/Log/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for logging libraries", + "homepage": "https://github.com/php-fig/log", + "keywords": [ + "log", + "psr", + "psr-3" + ], + "support": { + "source": "https://github.com/php-fig/log/tree/1.1.3" + }, + "time": "2020-03-23T09:12:05+00:00" + }, + { + "name": "psr/simple-cache", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/simple-cache.git", + "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/408d5eafb83c57f6365a3ca330ff23aa4a5fa39b", + "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\SimpleCache\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interfaces for simple caching", + "keywords": [ + "cache", + "caching", + "psr", + "psr-16", + "simple-cache" + ], + "support": { + "source": "https://github.com/php-fig/simple-cache/tree/master" + }, + "time": "2017-10-23T01:57:42+00:00" + }, + { + "name": "psy/psysh", + "version": "v0.10.4", + "source": { + "type": "git", + "url": "https://github.com/bobthecow/psysh.git", + "reference": "a8aec1b2981ab66882a01cce36a49b6317dc3560" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/bobthecow/psysh/zipball/a8aec1b2981ab66882a01cce36a49b6317dc3560", + "reference": "a8aec1b2981ab66882a01cce36a49b6317dc3560", + "shasum": "" + }, + "require": { + "dnoegel/php-xdg-base-dir": "0.1.*", + "ext-json": "*", + "ext-tokenizer": "*", + "nikic/php-parser": "~4.0|~3.0|~2.0|~1.3", + "php": "^8.0 || ^7.0 || ^5.5.9", + "symfony/console": "~5.0|~4.0|~3.0|^2.4.2|~2.3.10", + "symfony/var-dumper": "~5.0|~4.0|~3.0|~2.7" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.2", + "hoa/console": "3.17.*" + }, + "suggest": { + "ext-pcntl": "Enabling the PCNTL extension makes PsySH a lot happier :)", + "ext-pdo-sqlite": "The doc command requires SQLite to work.", + "ext-posix": "If you have PCNTL, you'll want the POSIX extension as well.", + "ext-readline": "Enables support for arrow-key history navigation, and showing and manipulating command history.", + "hoa/console": "A pure PHP readline implementation. You'll want this if your PHP install doesn't already support readline or libedit." + }, + "bin": [ + "bin/psysh" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "0.10.x-dev" + } + }, + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "Psy\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Justin Hileman", + "email": "justin@justinhileman.info", + "homepage": "http://justinhileman.com" + } + ], + "description": "An interactive shell for modern PHP.", + "homepage": "http://psysh.org", + "keywords": [ + "REPL", + "console", + "interactive", + "shell" + ], + "support": { + "issues": "https://github.com/bobthecow/psysh/issues", + "source": "https://github.com/bobthecow/psysh/tree/master" + }, + "time": "2020-05-03T19:32:03+00:00" + }, + { + "name": "ralouphie/getallheaders", + "version": "3.0.3", + "source": { + "type": "git", + "url": "https://github.com/ralouphie/getallheaders.git", + "reference": "120b605dfeb996808c31b6477290a714d356e822" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822", + "reference": "120b605dfeb996808c31b6477290a714d356e822", + "shasum": "" + }, + "require": { + "php": ">=5.6" + }, + "require-dev": { + "php-coveralls/php-coveralls": "^2.1", + "phpunit/phpunit": "^5 || ^6.5" + }, + "type": "library", + "autoload": { + "files": [ + "src/getallheaders.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ralph Khattar", + "email": "ralph.khattar@gmail.com" + } + ], + "description": "A polyfill for getallheaders.", + "support": { + "issues": "https://github.com/ralouphie/getallheaders/issues", + "source": "https://github.com/ralouphie/getallheaders/tree/develop" + }, + "time": "2019-03-08T08:55:37+00:00" + }, + { + "name": "ramsey/collection", + "version": "1.1.1", + "source": { + "type": "git", + "url": "https://github.com/ramsey/collection.git", + "reference": "24d93aefb2cd786b7edd9f45b554aea20b28b9b1" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ramsey/collection/zipball/24d93aefb2cd786b7edd9f45b554aea20b28b9b1", + "reference": "24d93aefb2cd786b7edd9f45b554aea20b28b9b1", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8" + }, + "require-dev": { + "captainhook/captainhook": "^5.3", + "dealerdirect/phpcodesniffer-composer-installer": "^0.7.0", + "ergebnis/composer-normalize": "^2.6", + "fzaninotto/faker": "^1.5", + "hamcrest/hamcrest-php": "^2", + "jangregor/phpstan-prophecy": "^0.6", + "mockery/mockery": "^1.3", + "phpstan/extension-installer": "^1", + "phpstan/phpstan": "^0.12.32", + "phpstan/phpstan-mockery": "^0.12.5", + "phpstan/phpstan-phpunit": "^0.12.11", + "phpunit/phpunit": "^8.5", + "psy/psysh": "^0.10.4", + "slevomat/coding-standard": "^6.3", + "squizlabs/php_codesniffer": "^3.5", + "vimeo/psalm": "^3.12.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "Ramsey\\Collection\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ben Ramsey", + "email": "ben@benramsey.com", + "homepage": "https://benramsey.com" + } + ], + "description": "A PHP 7.2+ library for representing and manipulating collections.", + "keywords": [ + "array", + "collection", + "hash", + "map", + "queue", + "set" + ], + "support": { + "issues": "https://github.com/ramsey/collection/issues", + "source": "https://github.com/ramsey/collection/tree/1.1.1" + }, + "funding": [ + { + "url": "https://github.com/ramsey", + "type": "github" + } + ], + "time": "2020-09-10T20:58:17+00:00" + }, + { + "name": "ramsey/uuid", + "version": "4.1.1", + "source": { + "type": "git", + "url": "https://github.com/ramsey/uuid.git", + "reference": "cd4032040a750077205918c86049aa0f43d22947" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ramsey/uuid/zipball/cd4032040a750077205918c86049aa0f43d22947", + "reference": "cd4032040a750077205918c86049aa0f43d22947", + "shasum": "" + }, + "require": { + "brick/math": "^0.8 || ^0.9", + "ext-json": "*", + "php": "^7.2 || ^8", + "ramsey/collection": "^1.0", + "symfony/polyfill-ctype": "^1.8" + }, + "replace": { + "rhumsaa/uuid": "self.version" + }, + "require-dev": { + "codeception/aspect-mock": "^3", + "dealerdirect/phpcodesniffer-composer-installer": "^0.6.2 || ^0.7.0", + "doctrine/annotations": "^1.8", + "goaop/framework": "^2", + "mockery/mockery": "^1.3", + "moontoast/math": "^1.1", + "paragonie/random-lib": "^2", + "php-mock/php-mock-mockery": "^1.3", + "php-mock/php-mock-phpunit": "^2.5", + "php-parallel-lint/php-parallel-lint": "^1.1", + "phpbench/phpbench": "^0.17.1", + "phpstan/extension-installer": "^1.0", + "phpstan/phpstan": "^0.12", + "phpstan/phpstan-mockery": "^0.12", + "phpstan/phpstan-phpunit": "^0.12", + "phpunit/phpunit": "^8.5", + "psy/psysh": "^0.10.0", + "slevomat/coding-standard": "^6.0", + "squizlabs/php_codesniffer": "^3.5", + "vimeo/psalm": "3.9.4" + }, + "suggest": { + "ext-bcmath": "Enables faster math with arbitrary-precision integers using BCMath.", + "ext-ctype": "Enables faster processing of character classification using ctype functions.", + "ext-gmp": "Enables faster math with arbitrary-precision integers using GMP.", + "ext-uuid": "Enables the use of PeclUuidTimeGenerator and PeclUuidRandomGenerator.", + "paragonie/random-lib": "Provides RandomLib for use with the RandomLibAdapter", + "ramsey/uuid-doctrine": "Allows the use of Ramsey\\Uuid\\Uuid as Doctrine field type." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.x-dev" + } + }, + "autoload": { + "psr-4": { + "Ramsey\\Uuid\\": "src/" + }, + "files": [ + "src/functions.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "A PHP library for generating and working with universally unique identifiers (UUIDs).", + "homepage": "https://github.com/ramsey/uuid", + "keywords": [ + "guid", + "identifier", + "uuid" + ], + "support": { + "issues": "https://github.com/ramsey/uuid/issues", + "rss": "https://github.com/ramsey/uuid/releases.atom", + "source": "https://github.com/ramsey/uuid" + }, + "funding": [ + { + "url": "https://github.com/ramsey", + "type": "github" + } + ], + "time": "2020-08-18T17:17:46+00:00" + }, + { + "name": "swiftmailer/swiftmailer", + "version": "v6.2.3", + "source": { + "type": "git", + "url": "https://github.com/swiftmailer/swiftmailer.git", + "reference": "149cfdf118b169f7840bbe3ef0d4bc795d1780c9" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/swiftmailer/swiftmailer/zipball/149cfdf118b169f7840bbe3ef0d4bc795d1780c9", + "reference": "149cfdf118b169f7840bbe3ef0d4bc795d1780c9", + "shasum": "" + }, + "require": { + "egulias/email-validator": "~2.0", + "php": ">=7.0.0", + "symfony/polyfill-iconv": "^1.0", + "symfony/polyfill-intl-idn": "^1.10", + "symfony/polyfill-mbstring": "^1.0" + }, + "require-dev": { + "mockery/mockery": "~0.9.1", + "symfony/phpunit-bridge": "^3.4.19|^4.1.8" + }, + "suggest": { + "ext-intl": "Needed to support internationalized email addresses", + "true/punycode": "Needed to support internationalized email addresses, if ext-intl is not installed" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "6.2-dev" + } + }, + "autoload": { + "files": [ + "lib/swift_required.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Chris Corbyn" + }, + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + } + ], + "description": "Swiftmailer, free feature-rich PHP mailer", + "homepage": "https://swiftmailer.symfony.com", + "keywords": [ + "email", + "mail", + "mailer" + ], + "support": { + "issues": "https://github.com/swiftmailer/swiftmailer/issues", + "source": "https://github.com/swiftmailer/swiftmailer/tree/v6.2.3" + }, + "time": "2019-11-12T09:31:26+00:00" + }, + { + "name": "symfony/console", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/console.git", + "reference": "e0b2c29c0fa6a69089209bbe8fcff4df2a313d0e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/console/zipball/e0b2c29c0fa6a69089209bbe8fcff4df2a313d0e", + "reference": "e0b2c29c0fa6a69089209bbe8fcff4df2a313d0e", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-mbstring": "~1.0", + "symfony/polyfill-php73": "^1.8", + "symfony/polyfill-php80": "^1.15", + "symfony/service-contracts": "^1.1|^2", + "symfony/string": "^5.1" + }, + "conflict": { + "symfony/dependency-injection": "<4.4", + "symfony/dotenv": "<5.1", + "symfony/event-dispatcher": "<4.4", + "symfony/lock": "<4.4", + "symfony/process": "<4.4" + }, + "provide": { + "psr/log-implementation": "1.0" + }, + "require-dev": { + "psr/log": "~1.0", + "symfony/config": "^4.4|^5.0", + "symfony/dependency-injection": "^4.4|^5.0", + "symfony/event-dispatcher": "^4.4|^5.0", + "symfony/lock": "^4.4|^5.0", + "symfony/process": "^4.4|^5.0", + "symfony/var-dumper": "^4.4|^5.0" + }, + "suggest": { + "psr/log": "For using the console logger", + "symfony/event-dispatcher": "", + "symfony/lock": "", + "symfony/process": "" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Console\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony Console Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/console/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/css-selector", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/css-selector.git", + "reference": "6cbebda22ffc0d4bb8fea0c1311c2ca54c4c8fa0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/css-selector/zipball/6cbebda22ffc0d4bb8fea0c1311c2ca54c4c8fa0", + "reference": "6cbebda22ffc0d4bb8fea0c1311c2ca54c4c8fa0", + "shasum": "" + }, + "require": { + "php": ">=7.2.5" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\CssSelector\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Jean-François Simon", + "email": "jeanfrancois.simon@sensiolabs.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony CssSelector Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/css-selector/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/deprecation-contracts", + "version": "v2.2.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/deprecation-contracts.git", + "reference": "5fa56b4074d1ae755beb55617ddafe6f5d78f665" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/5fa56b4074d1ae755beb55617ddafe6f5d78f665", + "reference": "5fa56b4074d1ae755beb55617ddafe6f5d78f665", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.2-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "files": [ + "function.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "A generic function and convention to trigger deprecation notices", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/deprecation-contracts/tree/master" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-09-07T11:33:47+00:00" + }, + { + "name": "symfony/error-handler", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/error-handler.git", + "reference": "a154f2b12fd1ec708559ba73ed58bd1304e55718" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/error-handler/zipball/a154f2b12fd1ec708559ba73ed58bd1304e55718", + "reference": "a154f2b12fd1ec708559ba73ed58bd1304e55718", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "psr/log": "^1.0", + "symfony/polyfill-php80": "^1.15", + "symfony/var-dumper": "^4.4|^5.0" + }, + "require-dev": { + "symfony/deprecation-contracts": "^2.1", + "symfony/http-kernel": "^4.4|^5.0", + "symfony/serializer": "^4.4|^5.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\ErrorHandler\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony ErrorHandler Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/error-handler/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/event-dispatcher", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/event-dispatcher.git", + "reference": "26f4edae48c913fc183a3da0553fe63bdfbd361a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/26f4edae48c913fc183a3da0553fe63bdfbd361a", + "reference": "26f4edae48c913fc183a3da0553fe63bdfbd361a", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/deprecation-contracts": "^2.1", + "symfony/event-dispatcher-contracts": "^2", + "symfony/polyfill-php80": "^1.15" + }, + "conflict": { + "symfony/dependency-injection": "<4.4" + }, + "provide": { + "psr/event-dispatcher-implementation": "1.0", + "symfony/event-dispatcher-implementation": "2.0" + }, + "require-dev": { + "psr/log": "~1.0", + "symfony/config": "^4.4|^5.0", + "symfony/dependency-injection": "^4.4|^5.0", + "symfony/error-handler": "^4.4|^5.0", + "symfony/expression-language": "^4.4|^5.0", + "symfony/http-foundation": "^4.4|^5.0", + "symfony/service-contracts": "^1.1|^2", + "symfony/stopwatch": "^4.4|^5.0" + }, + "suggest": { + "symfony/dependency-injection": "", + "symfony/http-kernel": "" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\EventDispatcher\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony EventDispatcher Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/event-dispatcher/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/event-dispatcher-contracts", + "version": "v2.2.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/event-dispatcher-contracts.git", + "reference": "0ba7d54483095a198fa51781bc608d17e84dffa2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/0ba7d54483095a198fa51781bc608d17e84dffa2", + "reference": "0ba7d54483095a198fa51781bc608d17e84dffa2", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "psr/event-dispatcher": "^1" + }, + "suggest": { + "symfony/event-dispatcher-implementation": "" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.2-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\EventDispatcher\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to dispatching event", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v2.2.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-09-07T11:33:47+00:00" + }, + { + "name": "symfony/finder", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/finder.git", + "reference": "e70eb5a69c2ff61ea135a13d2266e8914a67b3a0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/finder/zipball/e70eb5a69c2ff61ea135a13d2266e8914a67b3a0", + "reference": "e70eb5a69c2ff61ea135a13d2266e8914a67b3a0", + "shasum": "" + }, + "require": { + "php": ">=7.2.5" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Finder\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony Finder Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/finder/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/http-client-contracts", + "version": "v2.3.1", + "source": { + "type": "git", + "url": "https://github.com/symfony/http-client-contracts.git", + "reference": "41db680a15018f9c1d4b23516059633ce280ca33" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/http-client-contracts/zipball/41db680a15018f9c1d4b23516059633ce280ca33", + "reference": "41db680a15018f9c1d4b23516059633ce280ca33", + "shasum": "" + }, + "require": { + "php": ">=7.2.5" + }, + "suggest": { + "symfony/http-client-implementation": "" + }, + "type": "library", + "extra": { + "branch-version": "2.3", + "branch-alias": { + "dev-main": "2.3-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\HttpClient\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to HTTP clients", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/http-client-contracts/tree/v2.3.1" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-14T17:08:19+00:00" + }, + { + "name": "symfony/http-foundation", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/http-foundation.git", + "reference": "a2860ec970404b0233ab1e59e0568d3277d32b6f" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/http-foundation/zipball/a2860ec970404b0233ab1e59e0568d3277d32b6f", + "reference": "a2860ec970404b0233ab1e59e0568d3277d32b6f", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/deprecation-contracts": "^2.1", + "symfony/polyfill-mbstring": "~1.1", + "symfony/polyfill-php80": "^1.15" + }, + "require-dev": { + "predis/predis": "~1.0", + "symfony/cache": "^4.4|^5.0", + "symfony/expression-language": "^4.4|^5.0", + "symfony/mime": "^4.4|^5.0" + }, + "suggest": { + "symfony/mime": "To use the file extension guesser" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\HttpFoundation\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony HttpFoundation Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/http-foundation/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/http-kernel", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/http-kernel.git", + "reference": "a13b3c4d994a4fd051f4c6800c5e33c9508091dd" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/http-kernel/zipball/a13b3c4d994a4fd051f4c6800c5e33c9508091dd", + "reference": "a13b3c4d994a4fd051f4c6800c5e33c9508091dd", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "psr/log": "~1.0", + "symfony/deprecation-contracts": "^2.1", + "symfony/error-handler": "^4.4|^5.0", + "symfony/event-dispatcher": "^5.0", + "symfony/http-client-contracts": "^1.1|^2", + "symfony/http-foundation": "^4.4|^5.0", + "symfony/polyfill-ctype": "^1.8", + "symfony/polyfill-php73": "^1.9", + "symfony/polyfill-php80": "^1.15" + }, + "conflict": { + "symfony/browser-kit": "<4.4", + "symfony/cache": "<5.0", + "symfony/config": "<5.0", + "symfony/console": "<4.4", + "symfony/dependency-injection": "<4.4", + "symfony/doctrine-bridge": "<5.0", + "symfony/form": "<5.0", + "symfony/http-client": "<5.0", + "symfony/mailer": "<5.0", + "symfony/messenger": "<5.0", + "symfony/translation": "<5.0", + "symfony/twig-bridge": "<5.0", + "symfony/validator": "<5.0", + "twig/twig": "<2.4" + }, + "provide": { + "psr/log-implementation": "1.0" + }, + "require-dev": { + "psr/cache": "~1.0", + "symfony/browser-kit": "^4.4|^5.0", + "symfony/config": "^5.0", + "symfony/console": "^4.4|^5.0", + "symfony/css-selector": "^4.4|^5.0", + "symfony/dependency-injection": "^4.4|^5.0", + "symfony/dom-crawler": "^4.4|^5.0", + "symfony/expression-language": "^4.4|^5.0", + "symfony/finder": "^4.4|^5.0", + "symfony/process": "^4.4|^5.0", + "symfony/routing": "^4.4|^5.0", + "symfony/stopwatch": "^4.4|^5.0", + "symfony/translation": "^4.4|^5.0", + "symfony/translation-contracts": "^1.1|^2", + "twig/twig": "^2.4|^3.0" + }, + "suggest": { + "symfony/browser-kit": "", + "symfony/config": "", + "symfony/console": "", + "symfony/dependency-injection": "" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\HttpKernel\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony HttpKernel Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/http-kernel/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-28T05:55:23+00:00" + }, + { + "name": "symfony/mime", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/mime.git", + "reference": "f5485a92c24d4bcfc2f3fc648744fb398482ff1b" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/mime/zipball/f5485a92c24d4bcfc2f3fc648744fb398482ff1b", + "reference": "f5485a92c24d4bcfc2f3fc648744fb398482ff1b", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-intl-idn": "^1.10", + "symfony/polyfill-mbstring": "^1.0", + "symfony/polyfill-php80": "^1.15" + }, + "conflict": { + "symfony/mailer": "<4.4" + }, + "require-dev": { + "egulias/email-validator": "^2.1.10", + "symfony/dependency-injection": "^4.4|^5.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Mime\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "A library to manipulate MIME messages", + "homepage": "https://symfony.com", + "keywords": [ + "mime", + "mime-type" + ], + "support": { + "source": "https://github.com/symfony/mime/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/polyfill-ctype", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-ctype.git", + "reference": "f4ba089a5b6366e453971d3aad5fe8e897b37f41" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/f4ba089a5b6366e453971d3aad5fe8e897b37f41", + "reference": "f4ba089a5b6366e453971d3aad5fe8e897b37f41", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-ctype": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Ctype\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Gert de Pagter", + "email": "BackEndTea@gmail.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for ctype functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "ctype", + "polyfill", + "portable" + ], + "support": { + "source": "https://github.com/symfony/polyfill-ctype/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-iconv", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-iconv.git", + "reference": "c536646fdb4f29104dd26effc2fdcb9a5b085024" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-iconv/zipball/c536646fdb4f29104dd26effc2fdcb9a5b085024", + "reference": "c536646fdb4f29104dd26effc2fdcb9a5b085024", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-iconv": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Iconv\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for the Iconv extension", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "iconv", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-iconv/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-intl-grapheme", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-grapheme.git", + "reference": "c7cf3f858ec7d70b89559d6e6eb1f7c2517d479c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/c7cf3f858ec7d70b89559d6e6eb1f7c2517d479c", + "reference": "c7cf3f858ec7d70b89559d6e6eb1f7c2517d479c", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Intl\\Grapheme\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's grapheme_* functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "grapheme", + "intl", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-intl-idn", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-idn.git", + "reference": "3b75acd829741c768bc8b1f84eb33265e7cc5117" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/3b75acd829741c768bc8b1f84eb33265e7cc5117", + "reference": "3b75acd829741c768bc8b1f84eb33265e7cc5117", + "shasum": "" + }, + "require": { + "php": ">=7.1", + "symfony/polyfill-intl-normalizer": "^1.10", + "symfony/polyfill-php72": "^1.10" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Intl\\Idn\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Laurent Bassin", + "email": "laurent@bassin.info" + }, + { + "name": "Trevor Rowbotham", + "email": "trevor.rowbotham@pm.me" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's idn_to_ascii and idn_to_utf8 functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "idn", + "intl", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-intl-normalizer", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-normalizer.git", + "reference": "727d1096295d807c309fb01a851577302394c897" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/727d1096295d807c309fb01a851577302394c897", + "reference": "727d1096295d807c309fb01a851577302394c897", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Intl\\Normalizer\\": "" + }, + "files": [ + "bootstrap.php" + ], + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's Normalizer class and related functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "intl", + "normalizer", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-mbstring", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-mbstring.git", + "reference": "39d483bdf39be819deabf04ec872eb0b2410b531" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/39d483bdf39be819deabf04ec872eb0b2410b531", + "reference": "39d483bdf39be819deabf04ec872eb0b2410b531", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-mbstring": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Mbstring\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for the Mbstring extension", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "mbstring", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-php72", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php72.git", + "reference": "cede45fcdfabdd6043b3592e83678e42ec69e930" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php72/zipball/cede45fcdfabdd6043b3592e83678e42ec69e930", + "reference": "cede45fcdfabdd6043b3592e83678e42ec69e930", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Php72\\": "" + }, + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 7.2+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php72/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-php73", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php73.git", + "reference": "8ff431c517be11c78c48a39a66d37431e26a6bed" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php73/zipball/8ff431c517be11c78c48a39a66d37431e26a6bed", + "reference": "8ff431c517be11c78c48a39a66d37431e26a6bed", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Php73\\": "" + }, + "files": [ + "bootstrap.php" + ], + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 7.3+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php73/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/polyfill-php80", + "version": "v1.20.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php80.git", + "reference": "e70aa8b064c5b72d3df2abd5ab1e90464ad009de" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/e70aa8b064c5b72d3df2abd5ab1e90464ad009de", + "reference": "e70aa8b064c5b72d3df2abd5ab1e90464ad009de", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.20-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Polyfill\\Php80\\": "" + }, + "files": [ + "bootstrap.php" + ], + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ion Bazan", + "email": "ion.bazan@gmail.com" + }, + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php80/tree/v1.20.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-23T14:02:19+00:00" + }, + { + "name": "symfony/process", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/process.git", + "reference": "f00872c3f6804150d6a0f73b4151daab96248101" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/process/zipball/f00872c3f6804150d6a0f73b4151daab96248101", + "reference": "f00872c3f6804150d6a0f73b4151daab96248101", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-php80": "^1.15" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Process\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony Process Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/process/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/routing", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/routing.git", + "reference": "d6ceee2a37b61b41079005207bf37746d1bfe71f" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/routing/zipball/d6ceee2a37b61b41079005207bf37746d1bfe71f", + "reference": "d6ceee2a37b61b41079005207bf37746d1bfe71f", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/deprecation-contracts": "^2.1", + "symfony/polyfill-php80": "^1.15" + }, + "conflict": { + "symfony/config": "<5.0", + "symfony/dependency-injection": "<4.4", + "symfony/yaml": "<4.4" + }, + "require-dev": { + "doctrine/annotations": "~1.2", + "psr/log": "~1.0", + "symfony/config": "^5.0", + "symfony/dependency-injection": "^4.4|^5.0", + "symfony/expression-language": "^4.4|^5.0", + "symfony/http-foundation": "^4.4|^5.0", + "symfony/yaml": "^4.4|^5.0" + }, + "suggest": { + "doctrine/annotations": "For using the annotation loader", + "symfony/config": "For using the all-in-one router or any loader", + "symfony/expression-language": "For using expression matching", + "symfony/http-foundation": "For using a Symfony Request object", + "symfony/yaml": "For using the YAML loader" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Routing\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony Routing Component", + "homepage": "https://symfony.com", + "keywords": [ + "router", + "routing", + "uri", + "url" + ], + "support": { + "source": "https://github.com/symfony/routing/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/service-contracts", + "version": "v2.2.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/service-contracts.git", + "reference": "d15da7ba4957ffb8f1747218be9e1a121fd298a1" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/service-contracts/zipball/d15da7ba4957ffb8f1747218be9e1a121fd298a1", + "reference": "d15da7ba4957ffb8f1747218be9e1a121fd298a1", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "psr/container": "^1.0" + }, + "suggest": { + "symfony/service-implementation": "" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.2-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\Service\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to writing services", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/service-contracts/tree/master" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-09-07T11:33:47+00:00" + }, + { + "name": "symfony/string", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/string.git", + "reference": "a97573e960303db71be0dd8fda9be3bca5e0feea" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/string/zipball/a97573e960303db71be0dd8fda9be3bca5e0feea", + "reference": "a97573e960303db71be0dd8fda9be3bca5e0feea", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-ctype": "~1.8", + "symfony/polyfill-intl-grapheme": "~1.0", + "symfony/polyfill-intl-normalizer": "~1.0", + "symfony/polyfill-mbstring": "~1.0", + "symfony/polyfill-php80": "~1.15" + }, + "require-dev": { + "symfony/error-handler": "^4.4|^5.0", + "symfony/http-client": "^4.4|^5.0", + "symfony/translation-contracts": "^1.1|^2", + "symfony/var-exporter": "^4.4|^5.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\String\\": "" + }, + "files": [ + "Resources/functions.php" + ], + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony String component", + "homepage": "https://symfony.com", + "keywords": [ + "grapheme", + "i18n", + "string", + "unicode", + "utf-8", + "utf8" + ], + "support": { + "source": "https://github.com/symfony/string/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/translation", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/translation.git", + "reference": "27980838fd261e04379fa91e94e81e662fe5a1b6" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/translation/zipball/27980838fd261e04379fa91e94e81e662fe5a1b6", + "reference": "27980838fd261e04379fa91e94e81e662fe5a1b6", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-mbstring": "~1.0", + "symfony/polyfill-php80": "^1.15", + "symfony/translation-contracts": "^2" + }, + "conflict": { + "symfony/config": "<4.4", + "symfony/dependency-injection": "<5.0", + "symfony/http-kernel": "<5.0", + "symfony/twig-bundle": "<5.0", + "symfony/yaml": "<4.4" + }, + "provide": { + "symfony/translation-implementation": "2.0" + }, + "require-dev": { + "psr/log": "~1.0", + "symfony/config": "^4.4|^5.0", + "symfony/console": "^4.4|^5.0", + "symfony/dependency-injection": "^5.0", + "symfony/finder": "^4.4|^5.0", + "symfony/http-kernel": "^5.0", + "symfony/intl": "^4.4|^5.0", + "symfony/service-contracts": "^1.1.2|^2", + "symfony/yaml": "^4.4|^5.0" + }, + "suggest": { + "psr/log-implementation": "To use logging capability in translator", + "symfony/config": "", + "symfony/yaml": "" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Translation\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony Translation Component", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/translation/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-24T12:01:57+00:00" + }, + { + "name": "symfony/translation-contracts", + "version": "v2.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/translation-contracts.git", + "reference": "e2eaa60b558f26a4b0354e1bbb25636efaaad105" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/e2eaa60b558f26a4b0354e1bbb25636efaaad105", + "reference": "e2eaa60b558f26a4b0354e1bbb25636efaaad105", + "shasum": "" + }, + "require": { + "php": ">=7.2.5" + }, + "suggest": { + "symfony/translation-implementation": "" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.3-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\Translation\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to translation", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/translation-contracts/tree/v2.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-09-28T13:05:58+00:00" + }, + { + "name": "symfony/var-dumper", + "version": "v5.1.8", + "source": { + "type": "git", + "url": "https://github.com/symfony/var-dumper.git", + "reference": "4e13f3fcefb1fcaaa5efb5403581406f4e840b9a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/var-dumper/zipball/4e13f3fcefb1fcaaa5efb5403581406f4e840b9a", + "reference": "4e13f3fcefb1fcaaa5efb5403581406f4e840b9a", + "shasum": "" + }, + "require": { + "php": ">=7.2.5", + "symfony/polyfill-mbstring": "~1.0", + "symfony/polyfill-php80": "^1.15" + }, + "conflict": { + "phpunit/phpunit": "<5.4.3", + "symfony/console": "<4.4" + }, + "require-dev": { + "ext-iconv": "*", + "symfony/console": "^4.4|^5.0", + "symfony/process": "^4.4|^5.0", + "twig/twig": "^2.4|^3.0" + }, + "suggest": { + "ext-iconv": "To convert non-UTF-8 strings to UTF-8 (or symfony/polyfill-iconv in case ext-iconv cannot be used).", + "ext-intl": "To show region name in time zone dump", + "symfony/console": "To use the ServerDumpCommand and/or the bin/var-dump-server script" + }, + "bin": [ + "Resources/bin/var-dump-server" + ], + "type": "library", + "autoload": { + "files": [ + "Resources/functions/dump.php" + ], + "psr-4": { + "Symfony\\Component\\VarDumper\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony mechanism for exploring and dumping PHP variables", + "homepage": "https://symfony.com", + "keywords": [ + "debug", + "dump" + ], + "support": { + "source": "https://github.com/symfony/var-dumper/tree/v5.1.8" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2020-10-27T10:11:13+00:00" + }, + { + "name": "tijsverkoyen/css-to-inline-styles", + "version": "2.2.3", + "source": { + "type": "git", + "url": "https://github.com/tijsverkoyen/CssToInlineStyles.git", + "reference": "b43b05cf43c1b6d849478965062b6ef73e223bb5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/b43b05cf43c1b6d849478965062b6ef73e223bb5", + "reference": "b43b05cf43c1b6d849478965062b6ef73e223bb5", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-libxml": "*", + "php": "^5.5 || ^7.0 || ^8.0", + "symfony/css-selector": "^2.7 || ^3.0 || ^4.0 || ^5.0" + }, + "require-dev": { + "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0 || ^7.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.2.x-dev" + } + }, + "autoload": { + "psr-4": { + "TijsVerkoyen\\CssToInlineStyles\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Tijs Verkoyen", + "email": "css_to_inline_styles@verkoyen.eu", + "role": "Developer" + } + ], + "description": "CssToInlineStyles is a class that enables you to convert HTML-pages/files into HTML-pages/files with inline styles. This is very useful when you're sending emails.", + "homepage": "https://github.com/tijsverkoyen/CssToInlineStyles", + "support": { + "issues": "https://github.com/tijsverkoyen/CssToInlineStyles/issues", + "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/2.2.3" + }, + "time": "2020-07-13T06:12:54+00:00" + }, + { + "name": "vlucas/phpdotenv", + "version": "v5.2.0", + "source": { + "type": "git", + "url": "https://github.com/vlucas/phpdotenv.git", + "reference": "fba64139db67123c7a57072e5f8d3db10d160b66" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/fba64139db67123c7a57072e5f8d3db10d160b66", + "reference": "fba64139db67123c7a57072e5f8d3db10d160b66", + "shasum": "" + }, + "require": { + "ext-pcre": "*", + "graham-campbell/result-type": "^1.0.1", + "php": "^7.1.3 || ^8.0", + "phpoption/phpoption": "^1.7.4", + "symfony/polyfill-ctype": "^1.17", + "symfony/polyfill-mbstring": "^1.17", + "symfony/polyfill-php80": "^1.17" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.4.1", + "ext-filter": "*", + "phpunit/phpunit": "^7.5.20 || ^8.5.2 || ^9.0" + }, + "suggest": { + "ext-filter": "Required to use the boolean validator." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.2-dev" + } + }, + "autoload": { + "psr-4": { + "Dotenv\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "graham@alt-three.com", + "homepage": "https://gjcampbell.co.uk/" + }, + { + "name": "Vance Lucas", + "email": "vance@vancelucas.com", + "homepage": "https://vancelucas.com/" + } + ], + "description": "Loads environment variables from `.env` to `getenv()`, `$_ENV` and `$_SERVER` automagically.", + "keywords": [ + "dotenv", + "env", + "environment" + ], + "support": { + "issues": "https://github.com/vlucas/phpdotenv/issues", + "source": "https://github.com/vlucas/phpdotenv/tree/v5.2.0" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/vlucas/phpdotenv", + "type": "tidelift" + } + ], + "time": "2020-09-14T15:57:31+00:00" + }, + { + "name": "voku/portable-ascii", + "version": "1.5.3", + "source": { + "type": "git", + "url": "https://github.com/voku/portable-ascii.git", + "reference": "25bcbf01678930251fd572891447d9e318a6e2b8" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/voku/portable-ascii/zipball/25bcbf01678930251fd572891447d9e318a6e2b8", + "reference": "25bcbf01678930251fd572891447d9e318a6e2b8", + "shasum": "" + }, + "require": { + "php": ">=7.0.0" + }, + "require-dev": { + "phpunit/phpunit": "~6.0 || ~7.0" + }, + "suggest": { + "ext-intl": "Use Intl for transliterator_transliterate() support" + }, + "type": "library", + "autoload": { + "psr-4": { + "voku\\": "src/voku/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Lars Moelleken", + "homepage": "http://www.moelleken.org/" + } + ], + "description": "Portable ASCII library - performance optimized (ascii) string functions for php.", + "homepage": "https://github.com/voku/portable-ascii", + "keywords": [ + "ascii", + "clean", + "php" + ], + "support": { + "issues": "https://github.com/voku/portable-ascii/issues", + "source": "https://github.com/voku/portable-ascii/tree/master" + }, + "funding": [ + { + "url": "https://www.paypal.me/moelleken", + "type": "custom" + }, + { + "url": "https://github.com/voku", + "type": "github" + }, + { + "url": "https://opencollective.com/portable-ascii", + "type": "open_collective" + }, + { + "url": "https://www.patreon.com/voku", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/voku/portable-ascii", + "type": "tidelift" + } + ], + "time": "2020-07-22T23:32:04+00:00" + } + ], + "packages-dev": [ + { + "name": "doctrine/instantiator", + "version": "1.3.1", + "source": { + "type": "git", + "url": "https://github.com/doctrine/instantiator.git", + "reference": "f350df0268e904597e3bd9c4685c53e0e333feea" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/instantiator/zipball/f350df0268e904597e3bd9c4685c53e0e333feea", + "reference": "f350df0268e904597e3bd9c4685c53e0e333feea", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "require-dev": { + "doctrine/coding-standard": "^6.0", + "ext-pdo": "*", + "ext-phar": "*", + "phpbench/phpbench": "^0.13", + "phpstan/phpstan-phpunit": "^0.11", + "phpstan/phpstan-shim": "^0.11", + "phpunit/phpunit": "^7.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.2.x-dev" + } + }, + "autoload": { + "psr-4": { + "Doctrine\\Instantiator\\": "src/Doctrine/Instantiator/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Marco Pivetta", + "email": "ocramius@gmail.com", + "homepage": "http://ocramius.github.com/" + } + ], + "description": "A small, lightweight utility to instantiate objects in PHP without invoking their constructors", + "homepage": "https://www.doctrine-project.org/projects/instantiator.html", + "keywords": [ + "constructor", + "instantiate" + ], + "support": { + "issues": "https://github.com/doctrine/instantiator/issues", + "source": "https://github.com/doctrine/instantiator/tree/1.3.x" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finstantiator", + "type": "tidelift" + } + ], + "time": "2020-05-29T17:27:14+00:00" + }, + { + "name": "facade/flare-client-php", + "version": "1.3.7", + "source": { + "type": "git", + "url": "https://github.com/facade/flare-client-php.git", + "reference": "fd688d3c06658f2b3b5f7bb19f051ee4ddf02492" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/facade/flare-client-php/zipball/fd688d3c06658f2b3b5f7bb19f051ee4ddf02492", + "reference": "fd688d3c06658f2b3b5f7bb19f051ee4ddf02492", + "shasum": "" + }, + "require": { + "facade/ignition-contracts": "~1.0", + "illuminate/pipeline": "^5.5|^6.0|^7.0|^8.0", + "php": "^7.1|^8.0", + "symfony/http-foundation": "^3.3|^4.1|^5.0", + "symfony/mime": "^3.4|^4.0|^5.1", + "symfony/var-dumper": "^3.4|^4.0|^5.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^2.14", + "phpunit/phpunit": "^7.5.16", + "spatie/phpunit-snapshot-assertions": "^2.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "psr-4": { + "Facade\\FlareClient\\": "src" + }, + "files": [ + "src/helpers.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Send PHP errors to Flare", + "homepage": "https://github.com/facade/flare-client-php", + "keywords": [ + "exception", + "facade", + "flare", + "reporting" + ], + "support": { + "issues": "https://github.com/facade/flare-client-php/issues", + "source": "https://github.com/facade/flare-client-php/tree/1.3.7" + }, + "funding": [ + { + "url": "https://github.com/spatie", + "type": "github" + } + ], + "time": "2020-10-21T16:02:39+00:00" + }, + { + "name": "facade/ignition", + "version": "2.5.0", + "source": { + "type": "git", + "url": "https://github.com/facade/ignition.git", + "reference": "81698c5e32837c74abf9bb764ff0c1b3e001afb3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/facade/ignition/zipball/81698c5e32837c74abf9bb764ff0c1b3e001afb3", + "reference": "81698c5e32837c74abf9bb764ff0c1b3e001afb3", + "shasum": "" + }, + "require": { + "ext-json": "*", + "ext-mbstring": "*", + "facade/flare-client-php": "^1.3.7", + "facade/ignition-contracts": "^1.0.2", + "filp/whoops": "^2.4", + "illuminate/support": "^7.0|^8.0", + "monolog/monolog": "^2.0", + "php": "^7.2.5|^8.0", + "symfony/console": "^5.0", + "symfony/var-dumper": "^5.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^2.14", + "mockery/mockery": "^1.3", + "orchestra/testbench": "^5.0|^6.0", + "psalm/plugin-laravel": "^1.2" + }, + "suggest": { + "laravel/telescope": "^3.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.x-dev" + }, + "laravel": { + "providers": [ + "Facade\\Ignition\\IgnitionServiceProvider" + ], + "aliases": { + "Flare": "Facade\\Ignition\\Facades\\Flare" + } + } + }, + "autoload": { + "psr-4": { + "Facade\\Ignition\\": "src" + }, + "files": [ + "src/helpers.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "A beautiful error page for Laravel applications.", + "homepage": "https://github.com/facade/ignition", + "keywords": [ + "error", + "flare", + "laravel", + "page" + ], + "support": { + "docs": "https://flareapp.io/docs/ignition-for-laravel/introduction", + "forum": "https://twitter.com/flareappio", + "issues": "https://github.com/facade/ignition/issues", + "source": "https://github.com/facade/ignition" + }, + "time": "2020-10-27T13:02:22+00:00" + }, + { + "name": "facade/ignition-contracts", + "version": "1.0.2", + "source": { + "type": "git", + "url": "https://github.com/facade/ignition-contracts.git", + "reference": "3c921a1cdba35b68a7f0ccffc6dffc1995b18267" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/facade/ignition-contracts/zipball/3c921a1cdba35b68a7f0ccffc6dffc1995b18267", + "reference": "3c921a1cdba35b68a7f0ccffc6dffc1995b18267", + "shasum": "" + }, + "require": { + "php": "^7.3|^8.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^v2.15.8", + "phpunit/phpunit": "^9.3.11", + "vimeo/psalm": "^3.17.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "Facade\\IgnitionContracts\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Freek Van der Herten", + "email": "freek@spatie.be", + "homepage": "https://flareapp.io", + "role": "Developer" + } + ], + "description": "Solution contracts for Ignition", + "homepage": "https://github.com/facade/ignition-contracts", + "keywords": [ + "contracts", + "flare", + "ignition" + ], + "support": { + "issues": "https://github.com/facade/ignition-contracts/issues", + "source": "https://github.com/facade/ignition-contracts/tree/1.0.2" + }, + "time": "2020-10-16T08:27:54+00:00" + }, + { + "name": "fakerphp/faker", + "version": "v1.10.1", + "source": { + "type": "git", + "url": "https://github.com/FakerPHP/Faker.git", + "reference": "f2713a5016faaf6ffc60e9d456dedb5ebf0efcae" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/f2713a5016faaf6ffc60e9d456dedb5ebf0efcae", + "reference": "f2713a5016faaf6ffc60e9d456dedb5ebf0efcae", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "conflict": { + "fzaninotto/faker": "*" + }, + "require-dev": { + "ext-intl": "*", + "phpunit/phpunit": "^7.5.20 || ^8.5.8 || ^9.4.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "Faker\\": "src/Faker/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "François Zaninotto" + } + ], + "description": "Faker is a PHP library that generates fake data for you.", + "keywords": [ + "data", + "faker", + "fixtures" + ], + "support": { + "issues": "https://github.com/FakerPHP/Faker/issues", + "source": "https://github.com/FakerPHP/Faker/tree/v1.10.1" + }, + "time": "2020-10-28T09:32:46+00:00" + }, + { + "name": "filp/whoops", + "version": "2.9.1", + "source": { + "type": "git", + "url": "https://github.com/filp/whoops.git", + "reference": "307fb34a5ab697461ec4c9db865b20ff2fd40771" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/filp/whoops/zipball/307fb34a5ab697461ec4c9db865b20ff2fd40771", + "reference": "307fb34a5ab697461ec4c9db865b20ff2fd40771", + "shasum": "" + }, + "require": { + "php": "^5.5.9 || ^7.0 || ^8.0", + "psr/log": "^1.0.1" + }, + "require-dev": { + "mockery/mockery": "^0.9 || ^1.0", + "phpunit/phpunit": "^4.8.36 || ^5.7.27 || ^6.5.14 || ^7.5.20 || ^8.5.8 || ^9.3.3", + "symfony/var-dumper": "^2.6 || ^3.0 || ^4.0 || ^5.0" + }, + "suggest": { + "symfony/var-dumper": "Pretty print complex values better with var-dumper available", + "whoops/soap": "Formats errors as SOAP responses" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.7-dev" + } + }, + "autoload": { + "psr-4": { + "Whoops\\": "src/Whoops/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Filipe Dobreira", + "homepage": "https://github.com/filp", + "role": "Developer" + } + ], + "description": "php error handling for cool kids", + "homepage": "https://filp.github.io/whoops/", + "keywords": [ + "error", + "exception", + "handling", + "library", + "throwable", + "whoops" + ], + "support": { + "issues": "https://github.com/filp/whoops/issues", + "source": "https://github.com/filp/whoops/tree/2.9.1" + }, + "time": "2020-11-01T12:00:00+00:00" + }, + { + "name": "hamcrest/hamcrest-php", + "version": "v2.0.1", + "source": { + "type": "git", + "url": "https://github.com/hamcrest/hamcrest-php.git", + "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", + "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", + "shasum": "" + }, + "require": { + "php": "^5.3|^7.0|^8.0" + }, + "replace": { + "cordoval/hamcrest-php": "*", + "davedevelopment/hamcrest-php": "*", + "kodova/hamcrest-php": "*" + }, + "require-dev": { + "phpunit/php-file-iterator": "^1.4 || ^2.0", + "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.1-dev" + } + }, + "autoload": { + "classmap": [ + "hamcrest" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "description": "This is the PHP port of Hamcrest Matchers", + "keywords": [ + "test" + ], + "support": { + "issues": "https://github.com/hamcrest/hamcrest-php/issues", + "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.0.1" + }, + "time": "2020-07-09T08:09:16+00:00" + }, + { + "name": "mockery/mockery", + "version": "1.4.2", + "source": { + "type": "git", + "url": "https://github.com/mockery/mockery.git", + "reference": "20cab678faed06fac225193be281ea0fddb43b93" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/mockery/mockery/zipball/20cab678faed06fac225193be281ea0fddb43b93", + "reference": "20cab678faed06fac225193be281ea0fddb43b93", + "shasum": "" + }, + "require": { + "hamcrest/hamcrest-php": "^2.0.1", + "lib-pcre": ">=7.0", + "php": "^7.3 || ^8.0" + }, + "conflict": { + "phpunit/phpunit": "<8.0" + }, + "require-dev": { + "phpunit/phpunit": "^8.5 || ^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.4.x-dev" + } + }, + "autoload": { + "psr-0": { + "Mockery": "library/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Pádraic Brady", + "email": "padraic.brady@gmail.com", + "homepage": "http://blog.astrumfutura.com" + }, + { + "name": "Dave Marshall", + "email": "dave.marshall@atstsolutions.co.uk", + "homepage": "http://davedevelopment.co.uk" + } + ], + "description": "Mockery is a simple yet flexible PHP mock object framework", + "homepage": "https://github.com/mockery/mockery", + "keywords": [ + "BDD", + "TDD", + "library", + "mock", + "mock objects", + "mockery", + "stub", + "test", + "test double", + "testing" + ], + "support": { + "issues": "https://github.com/mockery/mockery/issues", + "source": "https://github.com/mockery/mockery/tree/master" + }, + "time": "2020-08-11T18:10:13+00:00" + }, + { + "name": "myclabs/deep-copy", + "version": "1.10.1", + "source": { + "type": "git", + "url": "https://github.com/myclabs/DeepCopy.git", + "reference": "969b211f9a51aa1f6c01d1d2aef56d3bd91598e5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/969b211f9a51aa1f6c01d1d2aef56d3bd91598e5", + "reference": "969b211f9a51aa1f6c01d1d2aef56d3bd91598e5", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "replace": { + "myclabs/deep-copy": "self.version" + }, + "require-dev": { + "doctrine/collections": "^1.0", + "doctrine/common": "^2.6", + "phpunit/phpunit": "^7.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "DeepCopy\\": "src/DeepCopy/" + }, + "files": [ + "src/DeepCopy/deep_copy.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Create deep copies (clones) of your objects", + "keywords": [ + "clone", + "copy", + "duplicate", + "object", + "object graph" + ], + "support": { + "issues": "https://github.com/myclabs/DeepCopy/issues", + "source": "https://github.com/myclabs/DeepCopy/tree/1.x" + }, + "funding": [ + { + "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy", + "type": "tidelift" + } + ], + "time": "2020-06-29T13:22:24+00:00" + }, + { + "name": "nunomaduro/collision", + "version": "v5.1.0", + "source": { + "type": "git", + "url": "https://github.com/nunomaduro/collision.git", + "reference": "7c2b95589bf81e274e61e47f7672a1b2c3e06eaa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nunomaduro/collision/zipball/7c2b95589bf81e274e61e47f7672a1b2c3e06eaa", + "reference": "7c2b95589bf81e274e61e47f7672a1b2c3e06eaa", + "shasum": "" + }, + "require": { + "facade/ignition-contracts": "^1.0", + "filp/whoops": "^2.7.2", + "php": "^7.3 || ^8.0", + "symfony/console": "^5.0" + }, + "require-dev": { + "fideloper/proxy": "^4.4.0", + "friendsofphp/php-cs-fixer": "^2.16.4", + "fruitcake/laravel-cors": "^2.0.1", + "laravel/framework": "^8.0", + "laravel/tinker": "^2.4.1", + "nunomaduro/larastan": "^0.6.2", + "nunomaduro/mock-final-classes": "^1.0", + "orchestra/testbench": "^6.0", + "phpstan/phpstan": "^0.12.36", + "phpunit/phpunit": "^9.3.3" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "NunoMaduro\\Collision\\Adapters\\Laravel\\CollisionServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "NunoMaduro\\Collision\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nuno Maduro", + "email": "enunomaduro@gmail.com" + } + ], + "description": "Cli error handling for console/command-line PHP applications.", + "keywords": [ + "artisan", + "cli", + "command-line", + "console", + "error", + "handling", + "laravel", + "laravel-zero", + "php", + "symfony" + ], + "support": { + "issues": "https://github.com/nunomaduro/collision/issues", + "source": "https://github.com/nunomaduro/collision" + }, + "funding": [ + { + "url": "https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=66BYDWAT92N6L", + "type": "custom" + }, + { + "url": "https://github.com/nunomaduro", + "type": "github" + }, + { + "url": "https://www.patreon.com/nunomaduro", + "type": "patreon" + } + ], + "time": "2020-10-29T14:50:40+00:00" + }, + { + "name": "phar-io/manifest", + "version": "2.0.1", + "source": { + "type": "git", + "url": "https://github.com/phar-io/manifest.git", + "reference": "85265efd3af7ba3ca4b2a2c34dbfc5788dd29133" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/manifest/zipball/85265efd3af7ba3ca4b2a2c34dbfc5788dd29133", + "reference": "85265efd3af7ba3ca4b2a2c34dbfc5788dd29133", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-phar": "*", + "ext-xmlwriter": "*", + "phar-io/version": "^3.0.1", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)", + "support": { + "issues": "https://github.com/phar-io/manifest/issues", + "source": "https://github.com/phar-io/manifest/tree/master" + }, + "time": "2020-06-27T14:33:11+00:00" + }, + { + "name": "phar-io/version", + "version": "3.0.2", + "source": { + "type": "git", + "url": "https://github.com/phar-io/version.git", + "reference": "c6bb6825def89e0a32220f88337f8ceaf1975fa0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/version/zipball/c6bb6825def89e0a32220f88337f8ceaf1975fa0", + "reference": "c6bb6825def89e0a32220f88337f8ceaf1975fa0", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Library for handling version information and constraints", + "support": { + "issues": "https://github.com/phar-io/version/issues", + "source": "https://github.com/phar-io/version/tree/master" + }, + "time": "2020-06-27T14:39:04+00:00" + }, + { + "name": "phpdocumentor/reflection-common", + "version": "2.2.0", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/ReflectionCommon.git", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-2.x": "2.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jaap van Otterdijk", + "email": "opensource@ijaap.nl" + } + ], + "description": "Common reflection classes used by phpdocumentor to reflect the code structure", + "homepage": "http://www.phpdoc.org", + "keywords": [ + "FQSEN", + "phpDocumentor", + "phpdoc", + "reflection", + "static analysis" + ], + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues", + "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x" + }, + "time": "2020-06-27T09:03:43+00:00" + }, + { + "name": "phpdocumentor/reflection-docblock", + "version": "5.2.2", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git", + "reference": "069a785b2141f5bcf49f3e353548dc1cce6df556" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/069a785b2141f5bcf49f3e353548dc1cce6df556", + "reference": "069a785b2141f5bcf49f3e353548dc1cce6df556", + "shasum": "" + }, + "require": { + "ext-filter": "*", + "php": "^7.2 || ^8.0", + "phpdocumentor/reflection-common": "^2.2", + "phpdocumentor/type-resolver": "^1.3", + "webmozart/assert": "^1.9.1" + }, + "require-dev": { + "mockery/mockery": "~1.3.2" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + }, + { + "name": "Jaap van Otterdijk", + "email": "account@ijaap.nl" + } + ], + "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.", + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionDocBlock/issues", + "source": "https://github.com/phpDocumentor/ReflectionDocBlock/tree/master" + }, + "time": "2020-09-03T19:13:55+00:00" + }, + { + "name": "phpdocumentor/type-resolver", + "version": "1.4.0", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/TypeResolver.git", + "reference": "6a467b8989322d92aa1c8bf2bebcc6e5c2ba55c0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/6a467b8989322d92aa1c8bf2bebcc6e5c2ba55c0", + "reference": "6a467b8989322d92aa1c8bf2bebcc6e5c2ba55c0", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0", + "phpdocumentor/reflection-common": "^2.0" + }, + "require-dev": { + "ext-tokenizer": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-1.x": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + } + ], + "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names", + "support": { + "issues": "https://github.com/phpDocumentor/TypeResolver/issues", + "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.4.0" + }, + "time": "2020-09-17T18:55:26+00:00" + }, + { + "name": "phpspec/prophecy", + "version": "1.12.1", + "source": { + "type": "git", + "url": "https://github.com/phpspec/prophecy.git", + "reference": "8ce87516be71aae9b956f81906aaf0338e0d8a2d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpspec/prophecy/zipball/8ce87516be71aae9b956f81906aaf0338e0d8a2d", + "reference": "8ce87516be71aae9b956f81906aaf0338e0d8a2d", + "shasum": "" + }, + "require": { + "doctrine/instantiator": "^1.2", + "php": "^7.2 || ~8.0, <8.1", + "phpdocumentor/reflection-docblock": "^5.2", + "sebastian/comparator": "^3.0 || ^4.0", + "sebastian/recursion-context": "^3.0 || ^4.0" + }, + "require-dev": { + "phpspec/phpspec": "^6.0", + "phpunit/phpunit": "^8.0 || ^9.0 <9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.11.x-dev" + } + }, + "autoload": { + "psr-4": { + "Prophecy\\": "src/Prophecy" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Konstantin Kudryashov", + "email": "ever.zet@gmail.com", + "homepage": "http://everzet.com" + }, + { + "name": "Marcello Duarte", + "email": "marcello.duarte@gmail.com" + } + ], + "description": "Highly opinionated mocking framework for PHP 5.3+", + "homepage": "https://github.com/phpspec/prophecy", + "keywords": [ + "Double", + "Dummy", + "fake", + "mock", + "spy", + "stub" + ], + "support": { + "issues": "https://github.com/phpspec/prophecy/issues", + "source": "https://github.com/phpspec/prophecy/tree/1.12.1" + }, + "time": "2020-09-29T09:10:42+00:00" + }, + { + "name": "phpunit/php-code-coverage", + "version": "9.2.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-code-coverage.git", + "reference": "6b20e2055f7c29b56cb3870b3de7cc463d7add41" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/6b20e2055f7c29b56cb3870b3de7cc463d7add41", + "reference": "6b20e2055f7c29b56cb3870b3de7cc463d7add41", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-libxml": "*", + "ext-xmlwriter": "*", + "nikic/php-parser": "^4.10.2", + "php": ">=7.3", + "phpunit/php-file-iterator": "^3.0.3", + "phpunit/php-text-template": "^2.0.2", + "sebastian/code-unit-reverse-lookup": "^2.0.2", + "sebastian/complexity": "^2.0", + "sebastian/environment": "^5.1.2", + "sebastian/lines-of-code": "^1.0", + "sebastian/version": "^3.0.1", + "theseer/tokenizer": "^1.2.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-pcov": "*", + "ext-xdebug": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "9.2-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.", + "homepage": "https://github.com/sebastianbergmann/php-code-coverage", + "keywords": [ + "coverage", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues", + "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/9.2.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-30T10:46:41+00:00" + }, + { + "name": "phpunit/php-file-iterator", + "version": "3.0.5", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-file-iterator.git", + "reference": "aa4be8575f26070b100fccb67faabb28f21f66f8" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/aa4be8575f26070b100fccb67faabb28f21f66f8", + "reference": "aa4be8575f26070b100fccb67faabb28f21f66f8", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "FilterIterator implementation that filters files based on a list of suffixes.", + "homepage": "https://github.com/sebastianbergmann/php-file-iterator/", + "keywords": [ + "filesystem", + "iterator" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues", + "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/3.0.5" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:57:25+00:00" + }, + { + "name": "phpunit/php-invoker", + "version": "3.1.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-invoker.git", + "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/5a10147d0aaf65b58940a0b72f71c9ac0423cc67", + "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "ext-pcntl": "*", + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-pcntl": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Invoke callables with a timeout", + "homepage": "https://github.com/sebastianbergmann/php-invoker/", + "keywords": [ + "process" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-invoker/issues", + "source": "https://github.com/sebastianbergmann/php-invoker/tree/3.1.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:58:55+00:00" + }, + { + "name": "phpunit/php-text-template", + "version": "2.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-text-template.git", + "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28", + "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Simple template engine.", + "homepage": "https://github.com/sebastianbergmann/php-text-template/", + "keywords": [ + "template" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-text-template/issues", + "source": "https://github.com/sebastianbergmann/php-text-template/tree/2.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T05:33:50+00:00" + }, + { + "name": "phpunit/php-timer", + "version": "5.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-timer.git", + "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2", + "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Utility class for timing", + "homepage": "https://github.com/sebastianbergmann/php-timer/", + "keywords": [ + "timer" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-timer/issues", + "source": "https://github.com/sebastianbergmann/php-timer/tree/5.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:16:10+00:00" + }, + { + "name": "phpunit/phpunit", + "version": "9.4.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/phpunit.git", + "reference": "3866b2eeeed21b1b099c4bc0b7a1690ac6fd5baa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/3866b2eeeed21b1b099c4bc0b7a1690ac6fd5baa", + "reference": "3866b2eeeed21b1b099c4bc0b7a1690ac6fd5baa", + "shasum": "" + }, + "require": { + "doctrine/instantiator": "^1.3.1", + "ext-dom": "*", + "ext-json": "*", + "ext-libxml": "*", + "ext-mbstring": "*", + "ext-xml": "*", + "ext-xmlwriter": "*", + "myclabs/deep-copy": "^1.10.1", + "phar-io/manifest": "^2.0.1", + "phar-io/version": "^3.0.2", + "php": ">=7.3", + "phpspec/prophecy": "^1.12.1", + "phpunit/php-code-coverage": "^9.2", + "phpunit/php-file-iterator": "^3.0.5", + "phpunit/php-invoker": "^3.1.1", + "phpunit/php-text-template": "^2.0.3", + "phpunit/php-timer": "^5.0.2", + "sebastian/cli-parser": "^1.0.1", + "sebastian/code-unit": "^1.0.6", + "sebastian/comparator": "^4.0.5", + "sebastian/diff": "^4.0.3", + "sebastian/environment": "^5.1.3", + "sebastian/exporter": "^4.0.3", + "sebastian/global-state": "^5.0.1", + "sebastian/object-enumerator": "^4.0.3", + "sebastian/resource-operations": "^3.0.3", + "sebastian/type": "^2.3", + "sebastian/version": "^3.0.2" + }, + "require-dev": { + "ext-pdo": "*", + "phpspec/prophecy-phpunit": "^2.0.1" + }, + "suggest": { + "ext-soap": "*", + "ext-xdebug": "*" + }, + "bin": [ + "phpunit" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "9.4-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ], + "files": [ + "src/Framework/Assert/Functions.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "The PHP Unit Testing framework.", + "homepage": "https://phpunit.de/", + "keywords": [ + "phpunit", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/phpunit/issues", + "source": "https://github.com/sebastianbergmann/phpunit/tree/9.4.2" + }, + "funding": [ + { + "url": "https://phpunit.de/donate.html", + "type": "custom" + }, + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-19T09:23:29+00:00" + }, + { + "name": "sebastian/cli-parser", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/cli-parser.git", + "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/442e7c7e687e42adc03470c7b668bc4b2402c0b2", + "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for parsing CLI options", + "homepage": "https://github.com/sebastianbergmann/cli-parser", + "support": { + "issues": "https://github.com/sebastianbergmann/cli-parser/issues", + "source": "https://github.com/sebastianbergmann/cli-parser/tree/1.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:08:49+00:00" + }, + { + "name": "sebastian/code-unit", + "version": "1.0.8", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit.git", + "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/1fc9f64c0927627ef78ba436c9b17d967e68e120", + "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the PHP code units", + "homepage": "https://github.com/sebastianbergmann/code-unit", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit/issues", + "source": "https://github.com/sebastianbergmann/code-unit/tree/1.0.8" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:08:54+00:00" + }, + { + "name": "sebastian/code-unit-reverse-lookup", + "version": "2.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git", + "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5", + "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Looks up which function or method a line of code belongs to", + "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues", + "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/2.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:30:19+00:00" + }, + { + "name": "sebastian/comparator", + "version": "4.0.6", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/comparator.git", + "reference": "55f4261989e546dc112258c7a75935a81a7ce382" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/55f4261989e546dc112258c7a75935a81a7ce382", + "reference": "55f4261989e546dc112258c7a75935a81a7ce382", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/diff": "^4.0", + "sebastian/exporter": "^4.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@2bepublished.at" + } + ], + "description": "Provides the functionality to compare PHP values for equality", + "homepage": "https://github.com/sebastianbergmann/comparator", + "keywords": [ + "comparator", + "compare", + "equality" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/comparator/issues", + "source": "https://github.com/sebastianbergmann/comparator/tree/4.0.6" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T15:49:45+00:00" + }, + { + "name": "sebastian/complexity", + "version": "2.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/complexity.git", + "reference": "739b35e53379900cc9ac327b2147867b8b6efd88" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/739b35e53379900cc9ac327b2147867b8b6efd88", + "reference": "739b35e53379900cc9ac327b2147867b8b6efd88", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.7", + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for calculating the complexity of PHP code units", + "homepage": "https://github.com/sebastianbergmann/complexity", + "support": { + "issues": "https://github.com/sebastianbergmann/complexity/issues", + "source": "https://github.com/sebastianbergmann/complexity/tree/2.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T15:52:27+00:00" + }, + { + "name": "sebastian/diff", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/diff.git", + "reference": "3461e3fccc7cfdfc2720be910d3bd73c69be590d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/3461e3fccc7cfdfc2720be910d3bd73c69be590d", + "reference": "3461e3fccc7cfdfc2720be910d3bd73c69be590d", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3", + "symfony/process": "^4.2 || ^5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Kore Nordmann", + "email": "mail@kore-nordmann.de" + } + ], + "description": "Diff implementation", + "homepage": "https://github.com/sebastianbergmann/diff", + "keywords": [ + "diff", + "udiff", + "unidiff", + "unified diff" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/diff/issues", + "source": "https://github.com/sebastianbergmann/diff/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:10:38+00:00" + }, + { + "name": "sebastian/environment", + "version": "5.1.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/environment.git", + "reference": "388b6ced16caa751030f6a69e588299fa09200ac" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/388b6ced16caa751030f6a69e588299fa09200ac", + "reference": "388b6ced16caa751030f6a69e588299fa09200ac", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-posix": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Provides functionality to handle HHVM/PHP environments", + "homepage": "http://www.github.com/sebastianbergmann/environment", + "keywords": [ + "Xdebug", + "environment", + "hhvm" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/environment/issues", + "source": "https://github.com/sebastianbergmann/environment/tree/5.1.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:52:38+00:00" + }, + { + "name": "sebastian/exporter", + "version": "4.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/exporter.git", + "reference": "d89cc98761b8cb5a1a235a6b703ae50d34080e65" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/d89cc98761b8cb5a1a235a6b703ae50d34080e65", + "reference": "d89cc98761b8cb5a1a235a6b703ae50d34080e65", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "ext-mbstring": "*", + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Provides the functionality to export PHP variables for visualization", + "homepage": "http://www.github.com/sebastianbergmann/exporter", + "keywords": [ + "export", + "exporter" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/exporter/issues", + "source": "https://github.com/sebastianbergmann/exporter/tree/4.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:24:23+00:00" + }, + { + "name": "sebastian/global-state", + "version": "5.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/global-state.git", + "reference": "a90ccbddffa067b51f574dea6eb25d5680839455" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/a90ccbddffa067b51f574dea6eb25d5680839455", + "reference": "a90ccbddffa067b51f574dea6eb25d5680839455", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/object-reflector": "^2.0", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "ext-dom": "*", + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-uopz": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Snapshotting of global state", + "homepage": "http://www.github.com/sebastianbergmann/global-state", + "keywords": [ + "global state" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/global-state/issues", + "source": "https://github.com/sebastianbergmann/global-state/tree/5.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T15:55:19+00:00" + }, + { + "name": "sebastian/lines-of-code", + "version": "1.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/lines-of-code.git", + "reference": "acf76492a65401babcf5283296fa510782783a7a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/acf76492a65401babcf5283296fa510782783a7a", + "reference": "acf76492a65401babcf5283296fa510782783a7a", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.6", + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for counting the lines of code in PHP source code", + "homepage": "https://github.com/sebastianbergmann/lines-of-code", + "support": { + "issues": "https://github.com/sebastianbergmann/lines-of-code/issues", + "source": "https://github.com/sebastianbergmann/lines-of-code/tree/1.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T17:03:56+00:00" + }, + { + "name": "sebastian/object-enumerator", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-enumerator.git", + "reference": "5c9eeac41b290a3712d88851518825ad78f45c71" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/5c9eeac41b290a3712d88851518825ad78f45c71", + "reference": "5c9eeac41b290a3712d88851518825ad78f45c71", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/object-reflector": "^2.0", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Traverses array structures and object graphs to enumerate all referenced objects", + "homepage": "https://github.com/sebastianbergmann/object-enumerator/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-enumerator/issues", + "source": "https://github.com/sebastianbergmann/object-enumerator/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:12:34+00:00" + }, + { + "name": "sebastian/object-reflector", + "version": "2.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-reflector.git", + "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/b4f479ebdbf63ac605d183ece17d8d7fe49c15c7", + "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Allows reflection of object attributes, including inherited and non-public ones", + "homepage": "https://github.com/sebastianbergmann/object-reflector/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-reflector/issues", + "source": "https://github.com/sebastianbergmann/object-reflector/tree/2.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:14:26+00:00" + }, + { + "name": "sebastian/recursion-context", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/recursion-context.git", + "reference": "cd9d8cf3c5804de4341c283ed787f099f5506172" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/cd9d8cf3c5804de4341c283ed787f099f5506172", + "reference": "cd9d8cf3c5804de4341c283ed787f099f5506172", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + } + ], + "description": "Provides functionality to recursively process PHP variables", + "homepage": "http://www.github.com/sebastianbergmann/recursion-context", + "support": { + "issues": "https://github.com/sebastianbergmann/recursion-context/issues", + "source": "https://github.com/sebastianbergmann/recursion-context/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:17:30+00:00" + }, + { + "name": "sebastian/resource-operations", + "version": "3.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/resource-operations.git", + "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/resource-operations/zipball/0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8", + "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Provides a list of PHP built-in functions that operate on resources", + "homepage": "https://www.github.com/sebastianbergmann/resource-operations", + "support": { + "issues": "https://github.com/sebastianbergmann/resource-operations/issues", + "source": "https://github.com/sebastianbergmann/resource-operations/tree/3.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:45:17+00:00" + }, + { + "name": "sebastian/type", + "version": "2.3.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/type.git", + "reference": "81cd61ab7bbf2de744aba0ea61fae32f721df3d2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/81cd61ab7bbf2de744aba0ea61fae32f721df3d2", + "reference": "81cd61ab7bbf2de744aba0ea61fae32f721df3d2", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.3-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the types of the PHP type system", + "homepage": "https://github.com/sebastianbergmann/type", + "support": { + "issues": "https://github.com/sebastianbergmann/type/issues", + "source": "https://github.com/sebastianbergmann/type/tree/2.3.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:18:59+00:00" + }, + { + "name": "sebastian/version", + "version": "3.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/version.git", + "reference": "c6c1022351a901512170118436c764e473f6de8c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c6c1022351a901512170118436c764e473f6de8c", + "reference": "c6c1022351a901512170118436c764e473f6de8c", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that helps with managing the version number of Git-hosted PHP projects", + "homepage": "https://github.com/sebastianbergmann/version", + "support": { + "issues": "https://github.com/sebastianbergmann/version/issues", + "source": "https://github.com/sebastianbergmann/version/tree/3.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:39:44+00:00" + }, + { + "name": "theseer/tokenizer", + "version": "1.2.0", + "source": { + "type": "git", + "url": "https://github.com/theseer/tokenizer.git", + "reference": "75a63c33a8577608444246075ea0af0d052e452a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/theseer/tokenizer/zipball/75a63c33a8577608444246075ea0af0d052e452a", + "reference": "75a63c33a8577608444246075ea0af0d052e452a", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-tokenizer": "*", + "ext-xmlwriter": "*", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + } + ], + "description": "A small library for converting tokenized PHP source code into XML and potentially other formats", + "support": { + "issues": "https://github.com/theseer/tokenizer/issues", + "source": "https://github.com/theseer/tokenizer/tree/master" + }, + "funding": [ + { + "url": "https://github.com/theseer", + "type": "github" + } + ], + "time": "2020-07-12T23:59:07+00:00" + }, + { + "name": "webmozart/assert", + "version": "1.9.1", + "source": { + "type": "git", + "url": "https://github.com/webmozart/assert.git", + "reference": "bafc69caeb4d49c39fd0779086c03a3738cbb389" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/webmozart/assert/zipball/bafc69caeb4d49c39fd0779086c03a3738cbb389", + "reference": "bafc69caeb4d49c39fd0779086c03a3738cbb389", + "shasum": "" + }, + "require": { + "php": "^5.3.3 || ^7.0 || ^8.0", + "symfony/polyfill-ctype": "^1.8" + }, + "conflict": { + "phpstan/phpstan": "<0.12.20", + "vimeo/psalm": "<3.9.1" + }, + "require-dev": { + "phpunit/phpunit": "^4.8.36 || ^7.5.13" + }, + "type": "library", + "autoload": { + "psr-4": { + "Webmozart\\Assert\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Assertions to validate method input/output with nice error messages.", + "keywords": [ + "assert", + "check", + "validate" + ], + "support": { + "issues": "https://github.com/webmozart/assert/issues", + "source": "https://github.com/webmozart/assert/tree/master" + }, + "time": "2020-07-08T17:02:28+00:00" + } + ], + "aliases": [], + "minimum-stability": "dev", + "stability-flags": [], + "prefer-stable": true, + "prefer-lowest": false, + "platform": { + "php": "^7.3|^8.0" + }, + "platform-dev": [], + "plugin-api-version": "2.0.0" +} diff --git a/server/config/app.php b/server/config/app.php new file mode 100644 index 0000000..8409e00 --- /dev/null +++ b/server/config/app.php @@ -0,0 +1,232 @@ + env('APP_NAME', 'Laravel'), + + /* + |-------------------------------------------------------------------------- + | Application Environment + |-------------------------------------------------------------------------- + | + | This value determines the "environment" your application is currently + | running in. This may determine how you prefer to configure various + | services the application utilizes. Set this in your ".env" file. + | + */ + + 'env' => env('APP_ENV', 'production'), + + /* + |-------------------------------------------------------------------------- + | Application Debug Mode + |-------------------------------------------------------------------------- + | + | When your application is in debug mode, detailed error messages with + | stack traces will be shown on every error that occurs within your + | application. If disabled, a simple generic error page is shown. + | + */ + + 'debug' => (bool) env('APP_DEBUG', false), + + /* + |-------------------------------------------------------------------------- + | Application URL + |-------------------------------------------------------------------------- + | + | This URL is used by the console to properly generate URLs when using + | the Artisan command line tool. You should set this to the root of + | your application so that it is used when running Artisan tasks. + | + */ + + 'url' => env('APP_URL', 'http://localhost'), + + 'asset_url' => env('ASSET_URL', null), + + /* + |-------------------------------------------------------------------------- + | Application Timezone + |-------------------------------------------------------------------------- + | + | Here you may specify the default timezone for your application, which + | will be used by the PHP date and date-time functions. We have gone + | ahead and set this to a sensible default for you out of the box. + | + */ + + 'timezone' => 'UTC', + + /* + |-------------------------------------------------------------------------- + | Application Locale Configuration + |-------------------------------------------------------------------------- + | + | The application locale determines the default locale that will be used + | by the translation service provider. You are free to set this value + | to any of the locales which will be supported by the application. + | + */ + + 'locale' => 'en', + + /* + |-------------------------------------------------------------------------- + | Application Fallback Locale + |-------------------------------------------------------------------------- + | + | The fallback locale determines the locale to use when the current one + | is not available. You may change the value to correspond to any of + | the language folders that are provided through your application. + | + */ + + 'fallback_locale' => 'en', + + /* + |-------------------------------------------------------------------------- + | Faker Locale + |-------------------------------------------------------------------------- + | + | This locale will be used by the Faker PHP library when generating fake + | data for your database seeds. For example, this will be used to get + | localized telephone numbers, street address information and more. + | + */ + + 'faker_locale' => 'en_US', + + /* + |-------------------------------------------------------------------------- + | Encryption Key + |-------------------------------------------------------------------------- + | + | This key is used by the Illuminate encrypter service and should be set + | to a random, 32 character string, otherwise these encrypted strings + | will not be safe. Please do this before deploying an application! + | + */ + + 'key' => env('APP_KEY'), + + 'cipher' => 'AES-256-CBC', + + /* + |-------------------------------------------------------------------------- + | Autoloaded Service Providers + |-------------------------------------------------------------------------- + | + | The service providers listed here will be automatically loaded on the + | request to your application. Feel free to add your own services to + | this array to grant expanded functionality to your applications. + | + */ + + 'providers' => [ + + /* + * Laravel Framework Service Providers... + */ + Illuminate\Auth\AuthServiceProvider::class, + Illuminate\Broadcasting\BroadcastServiceProvider::class, + Illuminate\Bus\BusServiceProvider::class, + Illuminate\Cache\CacheServiceProvider::class, + Illuminate\Foundation\Providers\ConsoleSupportServiceProvider::class, + Illuminate\Cookie\CookieServiceProvider::class, + Illuminate\Database\DatabaseServiceProvider::class, + Illuminate\Encryption\EncryptionServiceProvider::class, + Illuminate\Filesystem\FilesystemServiceProvider::class, + Illuminate\Foundation\Providers\FoundationServiceProvider::class, + Illuminate\Hashing\HashServiceProvider::class, + Illuminate\Mail\MailServiceProvider::class, + Illuminate\Notifications\NotificationServiceProvider::class, + Illuminate\Pagination\PaginationServiceProvider::class, + Illuminate\Pipeline\PipelineServiceProvider::class, + Illuminate\Queue\QueueServiceProvider::class, + Illuminate\Redis\RedisServiceProvider::class, + Illuminate\Auth\Passwords\PasswordResetServiceProvider::class, + Illuminate\Session\SessionServiceProvider::class, + Illuminate\Translation\TranslationServiceProvider::class, + Illuminate\Validation\ValidationServiceProvider::class, + Illuminate\View\ViewServiceProvider::class, + + /* + * Package Service Providers... + */ + + /* + * Application Service Providers... + */ + App\Providers\AppServiceProvider::class, + App\Providers\AuthServiceProvider::class, + // App\Providers\BroadcastServiceProvider::class, + App\Providers\EventServiceProvider::class, + App\Providers\RouteServiceProvider::class, + + ], + + /* + |-------------------------------------------------------------------------- + | Class Aliases + |-------------------------------------------------------------------------- + | + | This array of class aliases will be registered when this application + | is started. However, feel free to register as many as you wish as + | the aliases are "lazy" loaded so they don't hinder performance. + | + */ + + 'aliases' => [ + + 'App' => Illuminate\Support\Facades\App::class, + 'Arr' => Illuminate\Support\Arr::class, + 'Artisan' => Illuminate\Support\Facades\Artisan::class, + 'Auth' => Illuminate\Support\Facades\Auth::class, + 'Blade' => Illuminate\Support\Facades\Blade::class, + 'Broadcast' => Illuminate\Support\Facades\Broadcast::class, + 'Bus' => Illuminate\Support\Facades\Bus::class, + 'Cache' => Illuminate\Support\Facades\Cache::class, + 'Config' => Illuminate\Support\Facades\Config::class, + 'Cookie' => Illuminate\Support\Facades\Cookie::class, + 'Crypt' => Illuminate\Support\Facades\Crypt::class, + 'DB' => Illuminate\Support\Facades\DB::class, + 'Eloquent' => Illuminate\Database\Eloquent\Model::class, + 'Event' => Illuminate\Support\Facades\Event::class, + 'File' => Illuminate\Support\Facades\File::class, + 'Gate' => Illuminate\Support\Facades\Gate::class, + 'Hash' => Illuminate\Support\Facades\Hash::class, + 'Http' => Illuminate\Support\Facades\Http::class, + 'Lang' => Illuminate\Support\Facades\Lang::class, + 'Log' => Illuminate\Support\Facades\Log::class, + 'Mail' => Illuminate\Support\Facades\Mail::class, + 'Notification' => Illuminate\Support\Facades\Notification::class, + 'Password' => Illuminate\Support\Facades\Password::class, + 'Queue' => Illuminate\Support\Facades\Queue::class, + 'Redirect' => Illuminate\Support\Facades\Redirect::class, + 'Redis' => Illuminate\Support\Facades\Redis::class, + 'Request' => Illuminate\Support\Facades\Request::class, + 'Response' => Illuminate\Support\Facades\Response::class, + 'Route' => Illuminate\Support\Facades\Route::class, + 'Schema' => Illuminate\Support\Facades\Schema::class, + 'Session' => Illuminate\Support\Facades\Session::class, + 'Storage' => Illuminate\Support\Facades\Storage::class, + 'Str' => Illuminate\Support\Str::class, + 'URL' => Illuminate\Support\Facades\URL::class, + 'Validator' => Illuminate\Support\Facades\Validator::class, + 'View' => Illuminate\Support\Facades\View::class, + + ], + +]; diff --git a/server/config/auth.php b/server/config/auth.php new file mode 100644 index 0000000..ba1a4d8 --- /dev/null +++ b/server/config/auth.php @@ -0,0 +1,117 @@ + [ + 'guard' => 'web', + 'passwords' => 'users', + ], + + /* + |-------------------------------------------------------------------------- + | Authentication Guards + |-------------------------------------------------------------------------- + | + | Next, you may define every authentication guard for your application. + | Of course, a great default configuration has been defined for you + | here which uses session storage and the Eloquent user provider. + | + | All authentication drivers have a user provider. This defines how the + | users are actually retrieved out of your database or other storage + | mechanisms used by this application to persist your user's data. + | + | Supported: "session", "token" + | + */ + + 'guards' => [ + 'web' => [ + 'driver' => 'session', + 'provider' => 'users', + ], + + 'api' => [ + 'driver' => 'token', + 'provider' => 'users', + 'hash' => false, + ], + ], + + /* + |-------------------------------------------------------------------------- + | User Providers + |-------------------------------------------------------------------------- + | + | All authentication drivers have a user provider. This defines how the + | users are actually retrieved out of your database or other storage + | mechanisms used by this application to persist your user's data. + | + | If you have multiple user tables or models you may configure multiple + | sources which represent each model / table. These sources may then + | be assigned to any extra authentication guards you have defined. + | + | Supported: "database", "eloquent" + | + */ + + 'providers' => [ + 'users' => [ + 'driver' => 'eloquent', + 'model' => App\Models\User::class, + ], + + // 'users' => [ + // 'driver' => 'database', + // 'table' => 'users', + // ], + ], + + /* + |-------------------------------------------------------------------------- + | Resetting Passwords + |-------------------------------------------------------------------------- + | + | You may specify multiple password reset configurations if you have more + | than one user table or model in the application and you want to have + | separate password reset settings based on the specific user types. + | + | The expire time is the number of minutes that the reset token should be + | considered valid. This security feature keeps tokens short-lived so + | they have less time to be guessed. You may change this as needed. + | + */ + + 'passwords' => [ + 'users' => [ + 'provider' => 'users', + 'table' => 'password_resets', + 'expire' => 60, + 'throttle' => 60, + ], + ], + + /* + |-------------------------------------------------------------------------- + | Password Confirmation Timeout + |-------------------------------------------------------------------------- + | + | Here you may define the amount of seconds before a password confirmation + | times out and the user is prompted to re-enter their password via the + | confirmation screen. By default, the timeout lasts for three hours. + | + */ + + 'password_timeout' => 10800, + +]; diff --git a/server/config/broadcasting.php b/server/config/broadcasting.php new file mode 100644 index 0000000..3bba110 --- /dev/null +++ b/server/config/broadcasting.php @@ -0,0 +1,59 @@ + env('BROADCAST_DRIVER', 'null'), + + /* + |-------------------------------------------------------------------------- + | Broadcast Connections + |-------------------------------------------------------------------------- + | + | Here you may define all of the broadcast connections that will be used + | to broadcast events to other systems or over websockets. Samples of + | each available type of connection are provided inside this array. + | + */ + + 'connections' => [ + + 'pusher' => [ + 'driver' => 'pusher', + 'key' => env('PUSHER_APP_KEY'), + 'secret' => env('PUSHER_APP_SECRET'), + 'app_id' => env('PUSHER_APP_ID'), + 'options' => [ + 'cluster' => env('PUSHER_APP_CLUSTER'), + 'useTLS' => true, + ], + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'default', + ], + + 'log' => [ + 'driver' => 'log', + ], + + 'null' => [ + 'driver' => 'null', + ], + + ], + +]; diff --git a/server/config/cache.php b/server/config/cache.php new file mode 100644 index 0000000..4f41fdf --- /dev/null +++ b/server/config/cache.php @@ -0,0 +1,104 @@ + env('CACHE_DRIVER', 'file'), + + /* + |-------------------------------------------------------------------------- + | Cache Stores + |-------------------------------------------------------------------------- + | + | Here you may define all of the cache "stores" for your application as + | well as their drivers. You may even define multiple stores for the + | same cache driver to group types of items stored in your caches. + | + */ + + 'stores' => [ + + 'apc' => [ + 'driver' => 'apc', + ], + + 'array' => [ + 'driver' => 'array', + 'serialize' => false, + ], + + 'database' => [ + 'driver' => 'database', + 'table' => 'cache', + 'connection' => null, + ], + + 'file' => [ + 'driver' => 'file', + 'path' => storage_path('framework/cache/data'), + ], + + 'memcached' => [ + 'driver' => 'memcached', + 'persistent_id' => env('MEMCACHED_PERSISTENT_ID'), + 'sasl' => [ + env('MEMCACHED_USERNAME'), + env('MEMCACHED_PASSWORD'), + ], + 'options' => [ + // Memcached::OPT_CONNECT_TIMEOUT => 2000, + ], + 'servers' => [ + [ + 'host' => env('MEMCACHED_HOST', '127.0.0.1'), + 'port' => env('MEMCACHED_PORT', 11211), + 'weight' => 100, + ], + ], + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'cache', + ], + + 'dynamodb' => [ + 'driver' => 'dynamodb', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + 'table' => env('DYNAMODB_CACHE_TABLE', 'cache'), + 'endpoint' => env('DYNAMODB_ENDPOINT'), + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Cache Key Prefix + |-------------------------------------------------------------------------- + | + | When utilizing a RAM based store such as APC or Memcached, there might + | be other applications utilizing the same cache. So, we'll specify a + | value to get prefixed to all our keys so we can avoid collisions. + | + */ + + 'prefix' => env('CACHE_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_cache'), + +]; diff --git a/server/config/cors.php b/server/config/cors.php new file mode 100644 index 0000000..558369d --- /dev/null +++ b/server/config/cors.php @@ -0,0 +1,34 @@ + ['api/*'], + + 'allowed_methods' => ['*'], + + 'allowed_origins' => ['*'], + + 'allowed_origins_patterns' => [], + + 'allowed_headers' => ['*'], + + 'exposed_headers' => [], + + 'max_age' => 0, + + 'supports_credentials' => false, + +]; diff --git a/server/config/database.php b/server/config/database.php new file mode 100644 index 0000000..b42d9b3 --- /dev/null +++ b/server/config/database.php @@ -0,0 +1,147 @@ + env('DB_CONNECTION', 'mysql'), + + /* + |-------------------------------------------------------------------------- + | Database Connections + |-------------------------------------------------------------------------- + | + | Here are each of the database connections setup for your application. + | Of course, examples of configuring each database platform that is + | supported by Laravel is shown below to make development simple. + | + | + | All database work in Laravel is done through the PHP PDO facilities + | so make sure you have the driver for your particular database of + | choice installed on your machine before you begin development. + | + */ + + 'connections' => [ + + 'sqlite' => [ + 'driver' => 'sqlite', + 'url' => env('DATABASE_URL'), + 'database' => env('DB_DATABASE', database_path('database.sqlite')), + 'prefix' => '', + 'foreign_key_constraints' => env('DB_FOREIGN_KEYS', true), + ], + + 'mysql' => [ + 'driver' => 'mysql', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', '127.0.0.1'), + 'port' => env('DB_PORT', '3306'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'unix_socket' => env('DB_SOCKET', ''), + 'charset' => 'utf8mb4', + 'collation' => 'utf8mb4_unicode_ci', + 'prefix' => '', + 'prefix_indexes' => true, + 'strict' => true, + 'engine' => null, + 'options' => extension_loaded('pdo_mysql') ? array_filter([ + PDO::MYSQL_ATTR_SSL_CA => env('MYSQL_ATTR_SSL_CA'), + ]) : [], + ], + + 'pgsql' => [ + 'driver' => 'pgsql', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', '127.0.0.1'), + 'port' => env('DB_PORT', '5432'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'charset' => 'utf8', + 'prefix' => '', + 'prefix_indexes' => true, + 'schema' => 'public', + 'sslmode' => 'prefer', + ], + + 'sqlsrv' => [ + 'driver' => 'sqlsrv', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', 'localhost'), + 'port' => env('DB_PORT', '1433'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'charset' => 'utf8', + 'prefix' => '', + 'prefix_indexes' => true, + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Migration Repository Table + |-------------------------------------------------------------------------- + | + | This table keeps track of all the migrations that have already run for + | your application. Using this information, we can determine which of + | the migrations on disk haven't actually been run in the database. + | + */ + + 'migrations' => 'migrations', + + /* + |-------------------------------------------------------------------------- + | Redis Databases + |-------------------------------------------------------------------------- + | + | Redis is an open source, fast, and advanced key-value store that also + | provides a richer body of commands than a typical key-value system + | such as APC or Memcached. Laravel makes it easy to dig right in. + | + */ + + 'redis' => [ + + 'client' => env('REDIS_CLIENT', 'phpredis'), + + 'options' => [ + 'cluster' => env('REDIS_CLUSTER', 'redis'), + 'prefix' => env('REDIS_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_database_'), + ], + + 'default' => [ + 'url' => env('REDIS_URL'), + 'host' => env('REDIS_HOST', '127.0.0.1'), + 'password' => env('REDIS_PASSWORD', null), + 'port' => env('REDIS_PORT', '6379'), + 'database' => env('REDIS_DB', '0'), + ], + + 'cache' => [ + 'url' => env('REDIS_URL'), + 'host' => env('REDIS_HOST', '127.0.0.1'), + 'password' => env('REDIS_PASSWORD', null), + 'port' => env('REDIS_PORT', '6379'), + 'database' => env('REDIS_CACHE_DB', '1'), + ], + + ], + +]; diff --git a/server/config/filesystems.php b/server/config/filesystems.php new file mode 100644 index 0000000..94c8112 --- /dev/null +++ b/server/config/filesystems.php @@ -0,0 +1,85 @@ + env('FILESYSTEM_DRIVER', 'local'), + + /* + |-------------------------------------------------------------------------- + | Default Cloud Filesystem Disk + |-------------------------------------------------------------------------- + | + | Many applications store files both locally and in the cloud. For this + | reason, you may specify a default "cloud" driver here. This driver + | will be bound as the Cloud disk implementation in the container. + | + */ + + 'cloud' => env('FILESYSTEM_CLOUD', 's3'), + + /* + |-------------------------------------------------------------------------- + | Filesystem Disks + |-------------------------------------------------------------------------- + | + | Here you may configure as many filesystem "disks" as you wish, and you + | may even configure multiple disks of the same driver. Defaults have + | been setup for each driver as an example of the required options. + | + | Supported Drivers: "local", "ftp", "sftp", "s3" + | + */ + + 'disks' => [ + + 'local' => [ + 'driver' => 'local', + 'root' => storage_path('app'), + ], + + 'public' => [ + 'driver' => 'local', + 'root' => storage_path('app/public'), + 'url' => env('APP_URL').'/storage', + 'visibility' => 'public', + ], + + 's3' => [ + 'driver' => 's3', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION'), + 'bucket' => env('AWS_BUCKET'), + 'url' => env('AWS_URL'), + 'endpoint' => env('AWS_ENDPOINT'), + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Symbolic Links + |-------------------------------------------------------------------------- + | + | Here you may configure the symbolic links that will be created when the + | `storage:link` Artisan command is executed. The array keys should be + | the locations of the links and the values should be their targets. + | + */ + + 'links' => [ + public_path('storage') => storage_path('app/public'), + ], + +]; diff --git a/server/config/hashing.php b/server/config/hashing.php new file mode 100644 index 0000000..8425770 --- /dev/null +++ b/server/config/hashing.php @@ -0,0 +1,52 @@ + 'bcrypt', + + /* + |-------------------------------------------------------------------------- + | Bcrypt Options + |-------------------------------------------------------------------------- + | + | Here you may specify the configuration options that should be used when + | passwords are hashed using the Bcrypt algorithm. This will allow you + | to control the amount of time it takes to hash the given password. + | + */ + + 'bcrypt' => [ + 'rounds' => env('BCRYPT_ROUNDS', 10), + ], + + /* + |-------------------------------------------------------------------------- + | Argon Options + |-------------------------------------------------------------------------- + | + | Here you may specify the configuration options that should be used when + | passwords are hashed using the Argon algorithm. These will allow you + | to control the amount of time it takes to hash the given password. + | + */ + + 'argon' => [ + 'memory' => 1024, + 'threads' => 2, + 'time' => 2, + ], + +]; diff --git a/server/config/logging.php b/server/config/logging.php new file mode 100644 index 0000000..6aa77fe --- /dev/null +++ b/server/config/logging.php @@ -0,0 +1,104 @@ + env('LOG_CHANNEL', 'stack'), + + /* + |-------------------------------------------------------------------------- + | Log Channels + |-------------------------------------------------------------------------- + | + | Here you may configure the log channels for your application. Out of + | the box, Laravel uses the Monolog PHP logging library. This gives + | you a variety of powerful log handlers / formatters to utilize. + | + | Available Drivers: "single", "daily", "slack", "syslog", + | "errorlog", "monolog", + | "custom", "stack" + | + */ + + 'channels' => [ + 'stack' => [ + 'driver' => 'stack', + 'channels' => ['single'], + 'ignore_exceptions' => false, + ], + + 'single' => [ + 'driver' => 'single', + 'path' => storage_path('logs/laravel.log'), + 'level' => env('LOG_LEVEL', 'debug'), + ], + + 'daily' => [ + 'driver' => 'daily', + 'path' => storage_path('logs/laravel.log'), + 'level' => env('LOG_LEVEL', 'debug'), + 'days' => 14, + ], + + 'slack' => [ + 'driver' => 'slack', + 'url' => env('LOG_SLACK_WEBHOOK_URL'), + 'username' => 'Laravel Log', + 'emoji' => ':boom:', + 'level' => env('LOG_LEVEL', 'critical'), + ], + + 'papertrail' => [ + 'driver' => 'monolog', + 'level' => env('LOG_LEVEL', 'debug'), + 'handler' => SyslogUdpHandler::class, + 'handler_with' => [ + 'host' => env('PAPERTRAIL_URL'), + 'port' => env('PAPERTRAIL_PORT'), + ], + ], + + 'stderr' => [ + 'driver' => 'monolog', + 'handler' => StreamHandler::class, + 'formatter' => env('LOG_STDERR_FORMATTER'), + 'with' => [ + 'stream' => 'php://stderr', + ], + ], + + 'syslog' => [ + 'driver' => 'syslog', + 'level' => env('LOG_LEVEL', 'debug'), + ], + + 'errorlog' => [ + 'driver' => 'errorlog', + 'level' => env('LOG_LEVEL', 'debug'), + ], + + 'null' => [ + 'driver' => 'monolog', + 'handler' => NullHandler::class, + ], + + 'emergency' => [ + 'path' => storage_path('logs/laravel.log'), + ], + ], + +]; diff --git a/server/config/mail.php b/server/config/mail.php new file mode 100644 index 0000000..54299aa --- /dev/null +++ b/server/config/mail.php @@ -0,0 +1,110 @@ + env('MAIL_MAILER', 'smtp'), + + /* + |-------------------------------------------------------------------------- + | Mailer Configurations + |-------------------------------------------------------------------------- + | + | Here you may configure all of the mailers used by your application plus + | their respective settings. Several examples have been configured for + | you and you are free to add your own as your application requires. + | + | Laravel supports a variety of mail "transport" drivers to be used while + | sending an e-mail. You will specify which one you are using for your + | mailers below. You are free to add additional mailers as required. + | + | Supported: "smtp", "sendmail", "mailgun", "ses", + | "postmark", "log", "array" + | + */ + + 'mailers' => [ + 'smtp' => [ + 'transport' => 'smtp', + 'host' => env('MAIL_HOST', 'smtp.mailgun.org'), + 'port' => env('MAIL_PORT', 587), + 'encryption' => env('MAIL_ENCRYPTION', 'tls'), + 'username' => env('MAIL_USERNAME'), + 'password' => env('MAIL_PASSWORD'), + 'timeout' => null, + 'auth_mode' => null, + ], + + 'ses' => [ + 'transport' => 'ses', + ], + + 'mailgun' => [ + 'transport' => 'mailgun', + ], + + 'postmark' => [ + 'transport' => 'postmark', + ], + + 'sendmail' => [ + 'transport' => 'sendmail', + 'path' => '/usr/sbin/sendmail -bs', + ], + + 'log' => [ + 'transport' => 'log', + 'channel' => env('MAIL_LOG_CHANNEL'), + ], + + 'array' => [ + 'transport' => 'array', + ], + ], + + /* + |-------------------------------------------------------------------------- + | Global "From" Address + |-------------------------------------------------------------------------- + | + | You may wish for all e-mails sent by your application to be sent from + | the same address. Here, you may specify a name and address that is + | used globally for all e-mails that are sent by your application. + | + */ + + 'from' => [ + 'address' => env('MAIL_FROM_ADDRESS', 'hello@example.com'), + 'name' => env('MAIL_FROM_NAME', 'Example'), + ], + + /* + |-------------------------------------------------------------------------- + | Markdown Mail Settings + |-------------------------------------------------------------------------- + | + | If you are using Markdown based email rendering, you may configure your + | theme and component paths here, allowing you to customize the design + | of the emails. Or, you may simply stick with the Laravel defaults! + | + */ + + 'markdown' => [ + 'theme' => 'default', + + 'paths' => [ + resource_path('views/vendor/mail'), + ], + ], + +]; diff --git a/server/config/queue.php b/server/config/queue.php new file mode 100644 index 0000000..1222296 --- /dev/null +++ b/server/config/queue.php @@ -0,0 +1,89 @@ + env('QUEUE_CONNECTION', 'sync'), + + /* + |-------------------------------------------------------------------------- + | Queue Connections + |-------------------------------------------------------------------------- + | + | Here you may configure the connection information for each server that + | is used by your application. A default configuration has been added + | for each back-end shipped with Laravel. You are free to add more. + | + | Drivers: "sync", "database", "beanstalkd", "sqs", "redis", "null" + | + */ + + 'connections' => [ + + 'sync' => [ + 'driver' => 'sync', + ], + + 'database' => [ + 'driver' => 'database', + 'table' => 'jobs', + 'queue' => 'default', + 'retry_after' => 90, + ], + + 'beanstalkd' => [ + 'driver' => 'beanstalkd', + 'host' => 'localhost', + 'queue' => 'default', + 'retry_after' => 90, + 'block_for' => 0, + ], + + 'sqs' => [ + 'driver' => 'sqs', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'prefix' => env('SQS_PREFIX', 'https://sqs.us-east-1.amazonaws.com/your-account-id'), + 'queue' => env('SQS_QUEUE', 'your-queue-name'), + 'suffix' => env('SQS_SUFFIX'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'default', + 'queue' => env('REDIS_QUEUE', 'default'), + 'retry_after' => 90, + 'block_for' => null, + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Failed Queue Jobs + |-------------------------------------------------------------------------- + | + | These options configure the behavior of failed queue job logging so you + | can control which database and table are used to store the jobs that + | have failed. You may change them to any database / table you wish. + | + */ + + 'failed' => [ + 'driver' => env('QUEUE_FAILED_DRIVER', 'database-uuids'), + 'database' => env('DB_CONNECTION', 'mysql'), + 'table' => 'failed_jobs', + ], + +]; diff --git a/server/config/services.php b/server/config/services.php new file mode 100644 index 0000000..2a1d616 --- /dev/null +++ b/server/config/services.php @@ -0,0 +1,33 @@ + [ + 'domain' => env('MAILGUN_DOMAIN'), + 'secret' => env('MAILGUN_SECRET'), + 'endpoint' => env('MAILGUN_ENDPOINT', 'api.mailgun.net'), + ], + + 'postmark' => [ + 'token' => env('POSTMARK_TOKEN'), + ], + + 'ses' => [ + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + ], + +]; diff --git a/server/config/session.php b/server/config/session.php new file mode 100644 index 0000000..4e0f66c --- /dev/null +++ b/server/config/session.php @@ -0,0 +1,201 @@ + env('SESSION_DRIVER', 'file'), + + /* + |-------------------------------------------------------------------------- + | Session Lifetime + |-------------------------------------------------------------------------- + | + | Here you may specify the number of minutes that you wish the session + | to be allowed to remain idle before it expires. If you want them + | to immediately expire on the browser closing, set that option. + | + */ + + 'lifetime' => env('SESSION_LIFETIME', 120), + + 'expire_on_close' => false, + + /* + |-------------------------------------------------------------------------- + | Session Encryption + |-------------------------------------------------------------------------- + | + | This option allows you to easily specify that all of your session data + | should be encrypted before it is stored. All encryption will be run + | automatically by Laravel and you can use the Session like normal. + | + */ + + 'encrypt' => false, + + /* + |-------------------------------------------------------------------------- + | Session File Location + |-------------------------------------------------------------------------- + | + | When using the native session driver, we need a location where session + | files may be stored. A default has been set for you but a different + | location may be specified. This is only needed for file sessions. + | + */ + + 'files' => storage_path('framework/sessions'), + + /* + |-------------------------------------------------------------------------- + | Session Database Connection + |-------------------------------------------------------------------------- + | + | When using the "database" or "redis" session drivers, you may specify a + | connection that should be used to manage these sessions. This should + | correspond to a connection in your database configuration options. + | + */ + + 'connection' => env('SESSION_CONNECTION', null), + + /* + |-------------------------------------------------------------------------- + | Session Database Table + |-------------------------------------------------------------------------- + | + | When using the "database" session driver, you may specify the table we + | should use to manage the sessions. Of course, a sensible default is + | provided for you; however, you are free to change this as needed. + | + */ + + 'table' => 'sessions', + + /* + |-------------------------------------------------------------------------- + | Session Cache Store + |-------------------------------------------------------------------------- + | + | While using one of the framework's cache driven session backends you may + | list a cache store that should be used for these sessions. This value + | must match with one of the application's configured cache "stores". + | + | Affects: "apc", "dynamodb", "memcached", "redis" + | + */ + + 'store' => env('SESSION_STORE', null), + + /* + |-------------------------------------------------------------------------- + | Session Sweeping Lottery + |-------------------------------------------------------------------------- + | + | Some session drivers must manually sweep their storage location to get + | rid of old sessions from storage. Here are the chances that it will + | happen on a given request. By default, the odds are 2 out of 100. + | + */ + + 'lottery' => [2, 100], + + /* + |-------------------------------------------------------------------------- + | Session Cookie Name + |-------------------------------------------------------------------------- + | + | Here you may change the name of the cookie used to identify a session + | instance by ID. The name specified here will get used every time a + | new session cookie is created by the framework for every driver. + | + */ + + 'cookie' => env( + 'SESSION_COOKIE', + Str::slug(env('APP_NAME', 'laravel'), '_').'_session' + ), + + /* + |-------------------------------------------------------------------------- + | Session Cookie Path + |-------------------------------------------------------------------------- + | + | The session cookie path determines the path for which the cookie will + | be regarded as available. Typically, this will be the root path of + | your application but you are free to change this when necessary. + | + */ + + 'path' => '/', + + /* + |-------------------------------------------------------------------------- + | Session Cookie Domain + |-------------------------------------------------------------------------- + | + | Here you may change the domain of the cookie used to identify a session + | in your application. This will determine which domains the cookie is + | available to in your application. A sensible default has been set. + | + */ + + 'domain' => env('SESSION_DOMAIN', null), + + /* + |-------------------------------------------------------------------------- + | HTTPS Only Cookies + |-------------------------------------------------------------------------- + | + | By setting this option to true, session cookies will only be sent back + | to the server if the browser has a HTTPS connection. This will keep + | the cookie from being sent to you if it can not be done securely. + | + */ + + 'secure' => env('SESSION_SECURE_COOKIE'), + + /* + |-------------------------------------------------------------------------- + | HTTP Access Only + |-------------------------------------------------------------------------- + | + | Setting this value to true will prevent JavaScript from accessing the + | value of the cookie and the cookie will only be accessible through + | the HTTP protocol. You are free to modify this option if needed. + | + */ + + 'http_only' => true, + + /* + |-------------------------------------------------------------------------- + | Same-Site Cookies + |-------------------------------------------------------------------------- + | + | This option determines how your cookies behave when cross-site requests + | take place, and can be used to mitigate CSRF attacks. By default, we + | will set this value to "lax" since this is a secure default value. + | + | Supported: "lax", "strict", "none", null + | + */ + + 'same_site' => 'lax', + +]; diff --git a/server/config/view.php b/server/config/view.php new file mode 100644 index 0000000..22b8a18 --- /dev/null +++ b/server/config/view.php @@ -0,0 +1,36 @@ + [ + resource_path('views'), + ], + + /* + |-------------------------------------------------------------------------- + | Compiled View Path + |-------------------------------------------------------------------------- + | + | This option determines where all the compiled Blade templates will be + | stored for your application. Typically, this is within the storage + | directory. However, as usual, you are free to change this value. + | + */ + + 'compiled' => env( + 'VIEW_COMPILED_PATH', + realpath(storage_path('framework/views')) + ), + +]; diff --git a/server/database/.gitignore b/server/database/.gitignore new file mode 100644 index 0000000..97fc976 --- /dev/null +++ b/server/database/.gitignore @@ -0,0 +1,2 @@ +*.sqlite +*.sqlite-journal diff --git a/server/database/factories/UserFactory.php b/server/database/factories/UserFactory.php new file mode 100644 index 0000000..bdea1a3 --- /dev/null +++ b/server/database/factories/UserFactory.php @@ -0,0 +1,33 @@ + $this->faker->name, + 'email' => $this->faker->unique()->safeEmail, + 'email_verified_at' => now(), + 'password' => '$2y$10$92IXUNpkjO0rOQ5byMi.Ye4oKoEa3Ro9llC/.og/at2.uheWG/igi', // password + 'remember_token' => Str::random(10), + ]; + } +} diff --git a/server/database/migrations/2014_10_12_000000_create_users_table.php b/server/database/migrations/2014_10_12_000000_create_users_table.php new file mode 100644 index 0000000..621a24e --- /dev/null +++ b/server/database/migrations/2014_10_12_000000_create_users_table.php @@ -0,0 +1,36 @@ +id(); + $table->string('name'); + $table->string('email')->unique(); + $table->timestamp('email_verified_at')->nullable(); + $table->string('password'); + $table->rememberToken(); + $table->timestamps(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::dropIfExists('users'); + } +} diff --git a/server/database/migrations/2014_10_12_100000_create_password_resets_table.php b/server/database/migrations/2014_10_12_100000_create_password_resets_table.php new file mode 100644 index 0000000..0ee0a36 --- /dev/null +++ b/server/database/migrations/2014_10_12_100000_create_password_resets_table.php @@ -0,0 +1,32 @@ +string('email')->index(); + $table->string('token'); + $table->timestamp('created_at')->nullable(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::dropIfExists('password_resets'); + } +} diff --git a/server/database/migrations/2019_08_19_000000_create_failed_jobs_table.php b/server/database/migrations/2019_08_19_000000_create_failed_jobs_table.php new file mode 100644 index 0000000..6aa6d74 --- /dev/null +++ b/server/database/migrations/2019_08_19_000000_create_failed_jobs_table.php @@ -0,0 +1,36 @@ +id(); + $table->string('uuid')->unique(); + $table->text('connection'); + $table->text('queue'); + $table->longText('payload'); + $table->longText('exception'); + $table->timestamp('failed_at')->useCurrent(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::dropIfExists('failed_jobs'); + } +} diff --git a/server/database/seeders/DatabaseSeeder.php b/server/database/seeders/DatabaseSeeder.php new file mode 100644 index 0000000..57b73b5 --- /dev/null +++ b/server/database/seeders/DatabaseSeeder.php @@ -0,0 +1,18 @@ +create(); + } +} diff --git a/server/package.json b/server/package.json new file mode 100644 index 0000000..2aefa8f --- /dev/null +++ b/server/package.json @@ -0,0 +1,19 @@ +{ + "private": true, + "scripts": { + "dev": "npm run development", + "development": "cross-env NODE_ENV=development node_modules/webpack/bin/webpack.js --progress --config=node_modules/laravel-mix/setup/webpack.config.js", + "watch": "npm run development -- --watch", + "watch-poll": "npm run watch -- --watch-poll", + "hot": "cross-env NODE_ENV=development node_modules/webpack-dev-server/bin/webpack-dev-server.js --inline --hot --disable-host-check --config=node_modules/laravel-mix/setup/webpack.config.js", + "prod": "npm run production", + "production": "cross-env NODE_ENV=production node_modules/webpack/bin/webpack.js --no-progress --config=node_modules/laravel-mix/setup/webpack.config.js" + }, + "devDependencies": { + "axios": "^0.19", + "cross-env": "^7.0", + "laravel-mix": "^5.0.1", + "lodash": "^4.17.19", + "resolve-url-loader": "^3.1.0" + } +} diff --git a/server/phpunit.xml b/server/phpunit.xml new file mode 100644 index 0000000..4ae4d97 --- /dev/null +++ b/server/phpunit.xml @@ -0,0 +1,31 @@ + + + + + ./tests/Unit + + + ./tests/Feature + + + + + ./app + + + + + + + + + + + + + + diff --git a/server/public/.htaccess b/server/public/.htaccess new file mode 100644 index 0000000..3aec5e2 --- /dev/null +++ b/server/public/.htaccess @@ -0,0 +1,21 @@ + + + Options -MultiViews -Indexes + + + RewriteEngine On + + # Handle Authorization Header + RewriteCond %{HTTP:Authorization} . + RewriteRule .* - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}] + + # Redirect Trailing Slashes If Not A Folder... + RewriteCond %{REQUEST_FILENAME} !-d + RewriteCond %{REQUEST_URI} (.+)/$ + RewriteRule ^ %1 [L,R=301] + + # Send Requests To Front Controller... + RewriteCond %{REQUEST_FILENAME} !-d + RewriteCond %{REQUEST_FILENAME} !-f + RewriteRule ^ index.php [L] + diff --git a/server/public/favicon.ico b/server/public/favicon.ico new file mode 100644 index 0000000..e69de29 diff --git a/server/public/index.php b/server/public/index.php new file mode 100644 index 0000000..a8137b1 --- /dev/null +++ b/server/public/index.php @@ -0,0 +1,55 @@ +make(Kernel::class); + +$response = tap($kernel->handle( + $request = Request::capture() +))->send(); + +$kernel->terminate($request, $response); diff --git a/server/public/robots.txt b/server/public/robots.txt new file mode 100644 index 0000000..eb05362 --- /dev/null +++ b/server/public/robots.txt @@ -0,0 +1,2 @@ +User-agent: * +Disallow: diff --git a/server/public/web.config b/server/public/web.config new file mode 100644 index 0000000..d3711d7 --- /dev/null +++ b/server/public/web.config @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/server/resources/css/app.css b/server/resources/css/app.css new file mode 100644 index 0000000..e69de29 diff --git a/server/resources/js/app.js b/server/resources/js/app.js new file mode 100644 index 0000000..40c55f6 --- /dev/null +++ b/server/resources/js/app.js @@ -0,0 +1 @@ +require('./bootstrap'); diff --git a/server/resources/js/bootstrap.js b/server/resources/js/bootstrap.js new file mode 100644 index 0000000..6922577 --- /dev/null +++ b/server/resources/js/bootstrap.js @@ -0,0 +1,28 @@ +window._ = require('lodash'); + +/** + * We'll load the axios HTTP library which allows us to easily issue requests + * to our Laravel back-end. This library automatically handles sending the + * CSRF token as a header based on the value of the "XSRF" token cookie. + */ + +window.axios = require('axios'); + +window.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest'; + +/** + * Echo exposes an expressive API for subscribing to channels and listening + * for events that are broadcast by Laravel. Echo and event broadcasting + * allows your team to easily build robust real-time web applications. + */ + +// import Echo from 'laravel-echo'; + +// window.Pusher = require('pusher-js'); + +// window.Echo = new Echo({ +// broadcaster: 'pusher', +// key: process.env.MIX_PUSHER_APP_KEY, +// cluster: process.env.MIX_PUSHER_APP_CLUSTER, +// forceTLS: true +// }); diff --git a/server/resources/lang/en/auth.php b/server/resources/lang/en/auth.php new file mode 100644 index 0000000..e5506df --- /dev/null +++ b/server/resources/lang/en/auth.php @@ -0,0 +1,19 @@ + 'These credentials do not match our records.', + 'throttle' => 'Too many login attempts. Please try again in :seconds seconds.', + +]; diff --git a/server/resources/lang/en/pagination.php b/server/resources/lang/en/pagination.php new file mode 100644 index 0000000..d481411 --- /dev/null +++ b/server/resources/lang/en/pagination.php @@ -0,0 +1,19 @@ + '« Previous', + 'next' => 'Next »', + +]; diff --git a/server/resources/lang/en/passwords.php b/server/resources/lang/en/passwords.php new file mode 100644 index 0000000..2345a56 --- /dev/null +++ b/server/resources/lang/en/passwords.php @@ -0,0 +1,22 @@ + 'Your password has been reset!', + 'sent' => 'We have emailed your password reset link!', + 'throttled' => 'Please wait before retrying.', + 'token' => 'This password reset token is invalid.', + 'user' => "We can't find a user with that email address.", + +]; diff --git a/server/resources/lang/en/validation.php b/server/resources/lang/en/validation.php new file mode 100644 index 0000000..2e2820b --- /dev/null +++ b/server/resources/lang/en/validation.php @@ -0,0 +1,152 @@ + 'The :attribute must be accepted.', + 'active_url' => 'The :attribute is not a valid URL.', + 'after' => 'The :attribute must be a date after :date.', + 'after_or_equal' => 'The :attribute must be a date after or equal to :date.', + 'alpha' => 'The :attribute may only contain letters.', + 'alpha_dash' => 'The :attribute may only contain letters, numbers, dashes and underscores.', + 'alpha_num' => 'The :attribute may only contain letters and numbers.', + 'array' => 'The :attribute must be an array.', + 'before' => 'The :attribute must be a date before :date.', + 'before_or_equal' => 'The :attribute must be a date before or equal to :date.', + 'between' => [ + 'numeric' => 'The :attribute must be between :min and :max.', + 'file' => 'The :attribute must be between :min and :max kilobytes.', + 'string' => 'The :attribute must be between :min and :max characters.', + 'array' => 'The :attribute must have between :min and :max items.', + ], + 'boolean' => 'The :attribute field must be true or false.', + 'confirmed' => 'The :attribute confirmation does not match.', + 'date' => 'The :attribute is not a valid date.', + 'date_equals' => 'The :attribute must be a date equal to :date.', + 'date_format' => 'The :attribute does not match the format :format.', + 'different' => 'The :attribute and :other must be different.', + 'digits' => 'The :attribute must be :digits digits.', + 'digits_between' => 'The :attribute must be between :min and :max digits.', + 'dimensions' => 'The :attribute has invalid image dimensions.', + 'distinct' => 'The :attribute field has a duplicate value.', + 'email' => 'The :attribute must be a valid email address.', + 'ends_with' => 'The :attribute must end with one of the following: :values.', + 'exists' => 'The selected :attribute is invalid.', + 'file' => 'The :attribute must be a file.', + 'filled' => 'The :attribute field must have a value.', + 'gt' => [ + 'numeric' => 'The :attribute must be greater than :value.', + 'file' => 'The :attribute must be greater than :value kilobytes.', + 'string' => 'The :attribute must be greater than :value characters.', + 'array' => 'The :attribute must have more than :value items.', + ], + 'gte' => [ + 'numeric' => 'The :attribute must be greater than or equal :value.', + 'file' => 'The :attribute must be greater than or equal :value kilobytes.', + 'string' => 'The :attribute must be greater than or equal :value characters.', + 'array' => 'The :attribute must have :value items or more.', + ], + 'image' => 'The :attribute must be an image.', + 'in' => 'The selected :attribute is invalid.', + 'in_array' => 'The :attribute field does not exist in :other.', + 'integer' => 'The :attribute must be an integer.', + 'ip' => 'The :attribute must be a valid IP address.', + 'ipv4' => 'The :attribute must be a valid IPv4 address.', + 'ipv6' => 'The :attribute must be a valid IPv6 address.', + 'json' => 'The :attribute must be a valid JSON string.', + 'lt' => [ + 'numeric' => 'The :attribute must be less than :value.', + 'file' => 'The :attribute must be less than :value kilobytes.', + 'string' => 'The :attribute must be less than :value characters.', + 'array' => 'The :attribute must have less than :value items.', + ], + 'lte' => [ + 'numeric' => 'The :attribute must be less than or equal :value.', + 'file' => 'The :attribute must be less than or equal :value kilobytes.', + 'string' => 'The :attribute must be less than or equal :value characters.', + 'array' => 'The :attribute must not have more than :value items.', + ], + 'max' => [ + 'numeric' => 'The :attribute may not be greater than :max.', + 'file' => 'The :attribute may not be greater than :max kilobytes.', + 'string' => 'The :attribute may not be greater than :max characters.', + 'array' => 'The :attribute may not have more than :max items.', + ], + 'mimes' => 'The :attribute must be a file of type: :values.', + 'mimetypes' => 'The :attribute must be a file of type: :values.', + 'min' => [ + 'numeric' => 'The :attribute must be at least :min.', + 'file' => 'The :attribute must be at least :min kilobytes.', + 'string' => 'The :attribute must be at least :min characters.', + 'array' => 'The :attribute must have at least :min items.', + ], + 'multiple_of' => 'The :attribute must be a multiple of :value', + 'not_in' => 'The selected :attribute is invalid.', + 'not_regex' => 'The :attribute format is invalid.', + 'numeric' => 'The :attribute must be a number.', + 'password' => 'The password is incorrect.', + 'present' => 'The :attribute field must be present.', + 'regex' => 'The :attribute format is invalid.', + 'required' => 'The :attribute field is required.', + 'required_if' => 'The :attribute field is required when :other is :value.', + 'required_unless' => 'The :attribute field is required unless :other is in :values.', + 'required_with' => 'The :attribute field is required when :values is present.', + 'required_with_all' => 'The :attribute field is required when :values are present.', + 'required_without' => 'The :attribute field is required when :values is not present.', + 'required_without_all' => 'The :attribute field is required when none of :values are present.', + 'same' => 'The :attribute and :other must match.', + 'size' => [ + 'numeric' => 'The :attribute must be :size.', + 'file' => 'The :attribute must be :size kilobytes.', + 'string' => 'The :attribute must be :size characters.', + 'array' => 'The :attribute must contain :size items.', + ], + 'starts_with' => 'The :attribute must start with one of the following: :values.', + 'string' => 'The :attribute must be a string.', + 'timezone' => 'The :attribute must be a valid zone.', + 'unique' => 'The :attribute has already been taken.', + 'uploaded' => 'The :attribute failed to upload.', + 'url' => 'The :attribute format is invalid.', + 'uuid' => 'The :attribute must be a valid UUID.', + + /* + |-------------------------------------------------------------------------- + | Custom Validation Language Lines + |-------------------------------------------------------------------------- + | + | Here you may specify custom validation messages for attributes using the + | convention "attribute.rule" to name the lines. This makes it quick to + | specify a specific custom language line for a given attribute rule. + | + */ + + 'custom' => [ + 'attribute-name' => [ + 'rule-name' => 'custom-message', + ], + ], + + /* + |-------------------------------------------------------------------------- + | Custom Validation Attributes + |-------------------------------------------------------------------------- + | + | The following language lines are used to swap our attribute placeholder + | with something more reader friendly such as "E-Mail Address" instead + | of "email". This simply helps us make our message more expressive. + | + */ + + 'attributes' => [], + +]; diff --git a/server/resources/views/welcome.blade.php b/server/resources/views/welcome.blade.php new file mode 100644 index 0000000..ed7110b --- /dev/null +++ b/server/resources/views/welcome.blade.php @@ -0,0 +1,132 @@ + + + + + + + Laravel + + + + + + + + + + +
+ @if (Route::has('login')) + + @endif + +
+
+ + + + + +
+ +
+
+
+
+ +
Documentation
+
+ +
+
+ Laravel has wonderful, thorough documentation covering every aspect of the framework. Whether you are new to the framework or have previous experience with Laravel, we recommend reading all of the documentation from beginning to end. +
+
+
+ +
+
+ +
Laracasts
+
+ +
+
+ Laracasts offers thousands of video tutorials on Laravel, PHP, and JavaScript development. Check them out, see for yourself, and massively level up your development skills in the process. +
+
+
+ +
+
+ +
Laravel News
+
+ +
+
+ Laravel News is a community driven portal and newsletter aggregating all of the latest and most important news in the Laravel ecosystem, including new package releases and tutorials. +
+
+
+ +
+
+ +
Vibrant Ecosystem
+
+ +
+
+ Laravel's robust library of first-party tools and libraries, such as Forge, Vapor, Nova, and Envoyer help you take your projects to the next level. Pair them with powerful open source libraries like Cashier, Dusk, Echo, Horizon, Sanctum, Telescope, and more. +
+
+
+
+
+ +
+
+
+ + + + + + Shop + + + + + + + + Sponsor + +
+
+ +
+ Laravel v{{ Illuminate\Foundation\Application::VERSION }} (PHP v{{ PHP_VERSION }}) +
+
+
+
+ + diff --git a/server/routes/api.php b/server/routes/api.php new file mode 100644 index 0000000..bcb8b18 --- /dev/null +++ b/server/routes/api.php @@ -0,0 +1,19 @@ +get('/user', function (Request $request) { + return $request->user(); +}); diff --git a/server/routes/channels.php b/server/routes/channels.php new file mode 100644 index 0000000..5d451e1 --- /dev/null +++ b/server/routes/channels.php @@ -0,0 +1,18 @@ +id === (int) $id; +}); diff --git a/server/routes/console.php b/server/routes/console.php new file mode 100644 index 0000000..e05f4c9 --- /dev/null +++ b/server/routes/console.php @@ -0,0 +1,19 @@ +comment(Inspiring::quote()); +})->purpose('Display an inspiring quote'); diff --git a/server/routes/web.php b/server/routes/web.php new file mode 100644 index 0000000..b130397 --- /dev/null +++ b/server/routes/web.php @@ -0,0 +1,18 @@ + + */ + +$uri = urldecode( + parse_url($_SERVER['REQUEST_URI'], PHP_URL_PATH) +); + +// This file allows us to emulate Apache's "mod_rewrite" functionality from the +// built-in PHP web server. This provides a convenient way to test a Laravel +// application without having installed a "real" web server software here. +if ($uri !== '/' && file_exists(__DIR__.'/public'.$uri)) { + return false; +} + +require_once __DIR__.'/public/index.php'; diff --git a/server/storage/app/.gitignore b/server/storage/app/.gitignore new file mode 100644 index 0000000..8f4803c --- /dev/null +++ b/server/storage/app/.gitignore @@ -0,0 +1,3 @@ +* +!public/ +!.gitignore diff --git a/server/storage/app/public/.gitignore b/server/storage/app/public/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/app/public/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/storage/framework/.gitignore b/server/storage/framework/.gitignore new file mode 100644 index 0000000..05c4471 --- /dev/null +++ b/server/storage/framework/.gitignore @@ -0,0 +1,9 @@ +compiled.php +config.php +down +events.scanned.php +maintenance.php +routes.php +routes.scanned.php +schedule-* +services.json diff --git a/server/storage/framework/cache/.gitignore b/server/storage/framework/cache/.gitignore new file mode 100644 index 0000000..01e4a6c --- /dev/null +++ b/server/storage/framework/cache/.gitignore @@ -0,0 +1,3 @@ +* +!data/ +!.gitignore diff --git a/server/storage/framework/cache/data/.gitignore b/server/storage/framework/cache/data/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/framework/cache/data/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/storage/framework/sessions/.gitignore b/server/storage/framework/sessions/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/framework/sessions/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/storage/framework/testing/.gitignore b/server/storage/framework/testing/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/framework/testing/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/storage/framework/views/.gitignore b/server/storage/framework/views/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/framework/views/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/storage/logs/.gitignore b/server/storage/logs/.gitignore new file mode 100644 index 0000000..d6b7ef3 --- /dev/null +++ b/server/storage/logs/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/server/tests/CreatesApplication.php b/server/tests/CreatesApplication.php new file mode 100644 index 0000000..547152f --- /dev/null +++ b/server/tests/CreatesApplication.php @@ -0,0 +1,22 @@ +make(Kernel::class)->bootstrap(); + + return $app; + } +} diff --git a/server/tests/Feature/ExampleTest.php b/server/tests/Feature/ExampleTest.php new file mode 100644 index 0000000..cdb5111 --- /dev/null +++ b/server/tests/Feature/ExampleTest.php @@ -0,0 +1,21 @@ +get('/'); + + $response->assertStatus(200); + } +} diff --git a/server/tests/TestCase.php b/server/tests/TestCase.php new file mode 100644 index 0000000..2932d4a --- /dev/null +++ b/server/tests/TestCase.php @@ -0,0 +1,10 @@ +assertTrue(true); + } +} diff --git a/server/webpack.mix.js b/server/webpack.mix.js new file mode 100644 index 0000000..2a22dc1 --- /dev/null +++ b/server/webpack.mix.js @@ -0,0 +1,17 @@ +const mix = require('laravel-mix'); + +/* + |-------------------------------------------------------------------------- + | Mix Asset Management + |-------------------------------------------------------------------------- + | + | Mix provides a clean, fluent API for defining some Webpack build steps + | for your Laravel applications. By default, we are compiling the CSS + | file for the application as well as bundling up all the JS files. + | + */ + +mix.js('resources/js/app.js', 'public/js') + .postCss('resources/css/app.css', 'public/css', [ + // + ]); diff --git a/socket/node_modules/accepts/HISTORY.md b/socket/node_modules/accepts/HISTORY.md new file mode 100644 index 0000000..0bf0417 --- /dev/null +++ b/socket/node_modules/accepts/HISTORY.md @@ -0,0 +1,236 @@ +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/socket/node_modules/accepts/LICENSE b/socket/node_modules/accepts/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/socket/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/socket/node_modules/accepts/README.md b/socket/node_modules/accepts/README.md new file mode 100644 index 0000000..66a2f54 --- /dev/null +++ b/socket/node_modules/accepts/README.md @@ -0,0 +1,142 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + + + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts +[travis-image]: https://badgen.net/travis/jshttp/accepts/master +[travis-url]: https://travis-ci.org/jshttp/accepts diff --git a/socket/node_modules/accepts/index.js b/socket/node_modules/accepts/index.js new file mode 100644 index 0000000..e9b2f63 --- /dev/null +++ b/socket/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/socket/node_modules/accepts/package.json b/socket/node_modules/accepts/package.json new file mode 100644 index 0000000..3c615c8 --- /dev/null +++ b/socket/node_modules/accepts/package.json @@ -0,0 +1,87 @@ +{ + "_from": "accepts@~1.3.4", + "_id": "accepts@1.3.7", + "_inBundle": false, + "_integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.4", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.4", + "saveSpec": null, + "fetchSpec": "~1.3.4" + }, + "_requiredBy": [ + "/engine.io", + "/socket.io" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "_shasum": "531bc726517a3b2b41f850021c6cc15eaab507cd", + "_spec": "accepts@~1.3.4", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/socket.io", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.3.7" +} diff --git a/socket/node_modules/base64id/CHANGELOG.md b/socket/node_modules/base64id/CHANGELOG.md new file mode 100644 index 0000000..b2b8332 --- /dev/null +++ b/socket/node_modules/base64id/CHANGELOG.md @@ -0,0 +1,16 @@ +# [2.0.0](https://github.com/faeldt/base64id/compare/1.0.0...2.0.0) (2019-05-27) + + +### Code Refactoring + +* **buffer:** replace deprecated Buffer constructor usage ([#11](https://github.com/faeldt/base64id/issues/11)) ([ccfba54](https://github.com/faeldt/base64id/commit/ccfba54)) + + +### BREAKING CHANGES + +* **buffer:** drop support for Node.js ≤ 4.4.x and 5.0.0 - 5.9.x + +See: https://nodejs.org/en/docs/guides/buffer-constructor-deprecation/ + + + diff --git a/socket/node_modules/base64id/LICENSE b/socket/node_modules/base64id/LICENSE new file mode 100644 index 0000000..0d03c83 --- /dev/null +++ b/socket/node_modules/base64id/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2012-2016 Kristian Faeldt + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/socket/node_modules/base64id/README.md b/socket/node_modules/base64id/README.md new file mode 100644 index 0000000..17689e6 --- /dev/null +++ b/socket/node_modules/base64id/README.md @@ -0,0 +1,18 @@ +base64id +======== + +Node.js module that generates a base64 id. + +Uses crypto.randomBytes when available, falls back to unsafe methods for node.js <= 0.4. + +To increase performance, random bytes are buffered to minimize the number of synchronous calls to crypto.randomBytes. + +## Installation + + $ npm install base64id + +## Usage + + var base64id = require('base64id'); + + var id = base64id.generateId(); diff --git a/socket/node_modules/base64id/lib/base64id.js b/socket/node_modules/base64id/lib/base64id.js new file mode 100644 index 0000000..15afe74 --- /dev/null +++ b/socket/node_modules/base64id/lib/base64id.js @@ -0,0 +1,103 @@ +/*! + * base64id v0.1.0 + */ + +/** + * Module dependencies + */ + +var crypto = require('crypto'); + +/** + * Constructor + */ + +var Base64Id = function() { }; + +/** + * Get random bytes + * + * Uses a buffer if available, falls back to crypto.randomBytes + */ + +Base64Id.prototype.getRandomBytes = function(bytes) { + + var BUFFER_SIZE = 4096 + var self = this; + + bytes = bytes || 12; + + if (bytes > BUFFER_SIZE) { + return crypto.randomBytes(bytes); + } + + var bytesInBuffer = parseInt(BUFFER_SIZE/bytes); + var threshold = parseInt(bytesInBuffer*0.85); + + if (!threshold) { + return crypto.randomBytes(bytes); + } + + if (this.bytesBufferIndex == null) { + this.bytesBufferIndex = -1; + } + + if (this.bytesBufferIndex == bytesInBuffer) { + this.bytesBuffer = null; + this.bytesBufferIndex = -1; + } + + // No buffered bytes available or index above threshold + if (this.bytesBufferIndex == -1 || this.bytesBufferIndex > threshold) { + + if (!this.isGeneratingBytes) { + this.isGeneratingBytes = true; + crypto.randomBytes(BUFFER_SIZE, function(err, bytes) { + self.bytesBuffer = bytes; + self.bytesBufferIndex = 0; + self.isGeneratingBytes = false; + }); + } + + // Fall back to sync call when no buffered bytes are available + if (this.bytesBufferIndex == -1) { + return crypto.randomBytes(bytes); + } + } + + var result = this.bytesBuffer.slice(bytes*this.bytesBufferIndex, bytes*(this.bytesBufferIndex+1)); + this.bytesBufferIndex++; + + return result; +} + +/** + * Generates a base64 id + * + * (Original version from socket.io ) + */ + +Base64Id.prototype.generateId = function () { + var rand = Buffer.alloc(15); // multiple of 3 for base64 + if (!rand.writeInt32BE) { + return Math.abs(Math.random() * Math.random() * Date.now() | 0).toString() + + Math.abs(Math.random() * Math.random() * Date.now() | 0).toString(); + } + this.sequenceNumber = (this.sequenceNumber + 1) | 0; + rand.writeInt32BE(this.sequenceNumber, 11); + if (crypto.randomBytes) { + this.getRandomBytes(12).copy(rand); + } else { + // not secure for node 0.4 + [0, 4, 8].forEach(function(i) { + rand.writeInt32BE(Math.random() * Math.pow(2, 32) | 0, i); + }); + } + return rand.toString('base64').replace(/\//g, '_').replace(/\+/g, '-'); +}; + +/** + * Export + */ + +exports = module.exports = new Base64Id(); diff --git a/socket/node_modules/base64id/package.json b/socket/node_modules/base64id/package.json new file mode 100644 index 0000000..c3c834a --- /dev/null +++ b/socket/node_modules/base64id/package.json @@ -0,0 +1,48 @@ +{ + "_from": "base64id@~2.0.0", + "_id": "base64id@2.0.0", + "_inBundle": false, + "_integrity": "sha512-lGe34o6EHj9y3Kts9R4ZYs/Gr+6N7MCaMlIFA3F1R2O5/m7K06AxfSeO5530PEERE6/WyEg3lsuyw4GHlPZHog==", + "_location": "/base64id", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "base64id@~2.0.0", + "name": "base64id", + "escapedName": "base64id", + "rawSpec": "~2.0.0", + "saveSpec": null, + "fetchSpec": "~2.0.0" + }, + "_requiredBy": [ + "/engine.io", + "/socket.io" + ], + "_resolved": "https://registry.npmjs.org/base64id/-/base64id-2.0.0.tgz", + "_shasum": "2770ac6bc47d312af97a8bf9a634342e0cd25cb6", + "_spec": "base64id@~2.0.0", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/socket.io", + "author": { + "name": "Kristian Faeldt", + "email": "faeldt_kristian@cyberagent.co.jp" + }, + "bugs": { + "url": "https://github.com/faeldt/base64id/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Generates a base64 id", + "engines": { + "node": "^4.5.0 || >= 5.9" + }, + "homepage": "https://github.com/faeldt/base64id#readme", + "license": "MIT", + "main": "./lib/base64id.js", + "name": "base64id", + "repository": { + "type": "git", + "url": "git+https://github.com/faeldt/base64id.git" + }, + "version": "2.0.0" +} diff --git a/socket/node_modules/component-emitter/History.md b/socket/node_modules/component-emitter/History.md new file mode 100644 index 0000000..e9fb4bc --- /dev/null +++ b/socket/node_modules/component-emitter/History.md @@ -0,0 +1,75 @@ + +1.3.0 / 2018-04-15 +================== + + * removed bower support + * expose emitter on `exports` + * prevent de-optimization from using `arguments` + +1.2.1 / 2016-04-18 +================== + + * enable client side use + +1.2.0 / 2014-02-12 +================== + + * prefix events with `$` to support object prototype method names + +1.1.3 / 2014-06-20 +================== + + * republish for npm + * add LICENSE file + +1.1.2 / 2014-02-10 +================== + + * package: rename to "component-emitter" + * package: update "main" and "component" fields + * Add license to Readme (same format as the other components) + * created .npmignore + * travis stuff + +1.1.1 / 2013-12-01 +================== + + * fix .once adding .on to the listener + * docs: Emitter#off() + * component: add `.repo` prop + +1.1.0 / 2013-10-20 +================== + + * add `.addEventListener()` and `.removeEventListener()` aliases + +1.0.1 / 2013-06-27 +================== + + * add support for legacy ie + +1.0.0 / 2013-02-26 +================== + + * add `.off()` support for removing all listeners + +0.0.6 / 2012-10-08 +================== + + * add `this._callbacks` initialization to prevent funky gotcha + +0.0.5 / 2012-09-07 +================== + + * fix `Emitter.call(this)` usage + +0.0.3 / 2012-07-11 +================== + + * add `.listeners()` + * rename `.has()` to `.hasListeners()` + +0.0.2 / 2012-06-28 +================== + + * fix `.off()` with `.once()`-registered callbacks diff --git a/socket/node_modules/component-emitter/LICENSE b/socket/node_modules/component-emitter/LICENSE new file mode 100644 index 0000000..de51692 --- /dev/null +++ b/socket/node_modules/component-emitter/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2014 Component contributors + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/socket/node_modules/component-emitter/Readme.md b/socket/node_modules/component-emitter/Readme.md new file mode 100644 index 0000000..0f3f9b9 --- /dev/null +++ b/socket/node_modules/component-emitter/Readme.md @@ -0,0 +1,74 @@ +# Emitter [![Build Status](https://travis-ci.org/component/emitter.png)](https://travis-ci.org/component/emitter) + + Event emitter component. + +## Installation + +``` +$ component install component/emitter +``` + +## API + +### Emitter(obj) + + The `Emitter` may also be used as a mixin. For example + a "plain" object may become an emitter, or you may + extend an existing prototype. + + As an `Emitter` instance: + +```js +var Emitter = require('emitter'); +var emitter = new Emitter; +emitter.emit('something'); +``` + + As a mixin: + +```js +var Emitter = require('emitter'); +var user = { name: 'tobi' }; +Emitter(user); + +user.emit('im a user'); +``` + + As a prototype mixin: + +```js +var Emitter = require('emitter'); +Emitter(User.prototype); +``` + +### Emitter#on(event, fn) + + Register an `event` handler `fn`. + +### Emitter#once(event, fn) + + Register a single-shot `event` handler `fn`, + removed immediately after it is invoked the + first time. + +### Emitter#off(event, fn) + + * Pass `event` and `fn` to remove a listener. + * Pass `event` to remove all listeners on that event. + * Pass nothing to remove all listeners on all events. + +### Emitter#emit(event, ...) + + Emit an `event` with variable option args. + +### Emitter#listeners(event) + + Return an array of callbacks, or an empty array. + +### Emitter#hasListeners(event) + + Check if this emitter has `event` handlers. + +## License + +MIT diff --git a/socket/node_modules/component-emitter/index.js b/socket/node_modules/component-emitter/index.js new file mode 100644 index 0000000..6d7ed0a --- /dev/null +++ b/socket/node_modules/component-emitter/index.js @@ -0,0 +1,175 @@ + +/** + * Expose `Emitter`. + */ + +if (typeof module !== 'undefined') { + module.exports = Emitter; +} + +/** + * Initialize a new `Emitter`. + * + * @api public + */ + +function Emitter(obj) { + if (obj) return mixin(obj); +}; + +/** + * Mixin the emitter properties. + * + * @param {Object} obj + * @return {Object} + * @api private + */ + +function mixin(obj) { + for (var key in Emitter.prototype) { + obj[key] = Emitter.prototype[key]; + } + return obj; +} + +/** + * Listen on the given `event` with `fn`. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.on = +Emitter.prototype.addEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + (this._callbacks['$' + event] = this._callbacks['$' + event] || []) + .push(fn); + return this; +}; + +/** + * Adds an `event` listener that will be invoked a single + * time then automatically removed. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.once = function(event, fn){ + function on() { + this.off(event, on); + fn.apply(this, arguments); + } + + on.fn = fn; + this.on(event, on); + return this; +}; + +/** + * Remove the given callback for `event` or all + * registered callbacks. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.off = +Emitter.prototype.removeListener = +Emitter.prototype.removeAllListeners = +Emitter.prototype.removeEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + + // all + if (0 == arguments.length) { + this._callbacks = {}; + return this; + } + + // specific event + var callbacks = this._callbacks['$' + event]; + if (!callbacks) return this; + + // remove all handlers + if (1 == arguments.length) { + delete this._callbacks['$' + event]; + return this; + } + + // remove specific handler + var cb; + for (var i = 0; i < callbacks.length; i++) { + cb = callbacks[i]; + if (cb === fn || cb.fn === fn) { + callbacks.splice(i, 1); + break; + } + } + + // Remove event specific arrays for event types that no + // one is subscribed for to avoid memory leak. + if (callbacks.length === 0) { + delete this._callbacks['$' + event]; + } + + return this; +}; + +/** + * Emit `event` with the given args. + * + * @param {String} event + * @param {Mixed} ... + * @return {Emitter} + */ + +Emitter.prototype.emit = function(event){ + this._callbacks = this._callbacks || {}; + + var args = new Array(arguments.length - 1) + , callbacks = this._callbacks['$' + event]; + + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + + if (callbacks) { + callbacks = callbacks.slice(0); + for (var i = 0, len = callbacks.length; i < len; ++i) { + callbacks[i].apply(this, args); + } + } + + return this; +}; + +/** + * Return array of callbacks for `event`. + * + * @param {String} event + * @return {Array} + * @api public + */ + +Emitter.prototype.listeners = function(event){ + this._callbacks = this._callbacks || {}; + return this._callbacks['$' + event] || []; +}; + +/** + * Check if this emitter has `event` handlers. + * + * @param {String} event + * @return {Boolean} + * @api public + */ + +Emitter.prototype.hasListeners = function(event){ + return !! this.listeners(event).length; +}; diff --git a/socket/node_modules/component-emitter/package.json b/socket/node_modules/component-emitter/package.json new file mode 100644 index 0000000..5a4ebfd --- /dev/null +++ b/socket/node_modules/component-emitter/package.json @@ -0,0 +1,56 @@ +{ + "_from": "component-emitter@~1.3.0", + "_id": "component-emitter@1.3.0", + "_inBundle": false, + "_integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==", + "_location": "/component-emitter", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "component-emitter@~1.3.0", + "name": "component-emitter", + "escapedName": "component-emitter", + "rawSpec": "~1.3.0", + "saveSpec": null, + "fetchSpec": "~1.3.0" + }, + "_requiredBy": [ + "/socket.io-parser" + ], + "_resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", + "_shasum": "16e4070fba8ae29b679f2215853ee181ab2eabc0", + "_spec": "component-emitter@~1.3.0", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/socket.io-parser", + "bugs": { + "url": "https://github.com/component/emitter/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "emitter/index.js": "index.js" + } + }, + "deprecated": false, + "description": "Event emitter", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/component/emitter#readme", + "license": "MIT", + "main": "index.js", + "name": "component-emitter", + "repository": { + "type": "git", + "url": "git+https://github.com/component/emitter.git" + }, + "scripts": { + "test": "make test" + }, + "version": "1.3.0" +} diff --git a/socket/node_modules/cookie/HISTORY.md b/socket/node_modules/cookie/HISTORY.md new file mode 100644 index 0000000..ce080e0 --- /dev/null +++ b/socket/node_modules/cookie/HISTORY.md @@ -0,0 +1,128 @@ +0.4.1 / 2020-04-21 +================== + + * Fix `maxAge` option to reject invalid values + +0.4.0 / 2019-05-15 +================== + + * Add `SameSite=None` support + +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/socket/node_modules/cookie/LICENSE b/socket/node_modules/cookie/LICENSE new file mode 100644 index 0000000..058b6b4 --- /dev/null +++ b/socket/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/socket/node_modules/cookie/README.md b/socket/node_modules/cookie/README.md new file mode 100644 index 0000000..18b2c2c --- /dev/null +++ b/socket/node_modules/cookie/README.md @@ -0,0 +1,257 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-03-4.1.2.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-03-4.1.2.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end('
'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.3.1 bench cookie +> node benchmark/index.js + + http_parser@2.8.0 + node@6.14.2 + v8@5.1.281.111 + uv@1.16.1 + zlib@1.2.11 + ares@1.10.1-DEV + icu@58.2 + modules@48 + napi@3 + openssl@1.0.2o + +> node benchmark/parse.js + + cookie.parse + + 6 tests completed. + + simple x 1,200,691 ops/sec ±1.12% (189 runs sampled) + decode x 1,012,994 ops/sec ±0.97% (186 runs sampled) + unquote x 1,074,174 ops/sec ±2.43% (186 runs sampled) + duplicates x 438,424 ops/sec ±2.17% (184 runs sampled) + 10 cookies x 147,154 ops/sec ±1.01% (186 runs sampled) + 100 cookies x 14,274 ops/sec ±1.07% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-03-4.1.2.7] + +[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-version-image]: https://badgen.net/npm/node/cookie +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie +[travis-image]: https://badgen.net/travis/jshttp/cookie/master +[travis-url]: https://travis-ci.org/jshttp/cookie diff --git a/socket/node_modules/cookie/index.js b/socket/node_modules/cookie/index.js new file mode 100644 index 0000000..760f32e --- /dev/null +++ b/socket/node_modules/cookie/index.js @@ -0,0 +1,202 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var decode = decodeURIComponent; +var encode = encodeURIComponent; +var pairSplitRegExp = /; */; + +/** + * RegExp to match field-content in RFC 7230 sec 3.2 + * + * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ] + * field-vchar = VCHAR / obs-text + * obs-text = %x80-FF + */ + +var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + + if (isNaN(maxAge) || !isFinite(maxAge)) { + throw new TypeError('option maxAge is invalid') + } + + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/socket/node_modules/cookie/package.json b/socket/node_modules/cookie/package.json new file mode 100644 index 0000000..1417e90 --- /dev/null +++ b/socket/node_modules/cookie/package.json @@ -0,0 +1,78 @@ +{ + "_from": "cookie@~0.4.1", + "_id": "cookie@0.4.1", + "_inBundle": false, + "_integrity": "sha512-ZwrFkGJxUR3EIoXtO+yVE69Eb7KlixbaeAWfBQB9vVsNn/o+Yw69gBWSSDK825hQNdN+wF8zELf3dFNl/kxkUA==", + "_location": "/cookie", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "cookie@~0.4.1", + "name": "cookie", + "escapedName": "cookie", + "rawSpec": "~0.4.1", + "saveSpec": null, + "fetchSpec": "~0.4.1" + }, + "_requiredBy": [ + "/engine.io" + ], + "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.1.tgz", + "_shasum": "afd713fe26ebd21ba95ceb61f9a8116e50a537d1", + "_spec": "cookie@~0.4.1", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/engine.io", + "author": { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com" + }, + "bugs": { + "url": "https://github.com/jshttp/cookie/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "HTTP server cookie parsing and serialization", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "6.8.0", + "eslint-plugin-markdown": "1.0.2", + "mocha": "7.1.1", + "nyc": "15.0.1" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/cookie#readme", + "keywords": [ + "cookie", + "cookies" + ], + "license": "MIT", + "name": "cookie", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/cookie.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks --ui qunit test/", + "test-ci": "nyc --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "0.4.1" +} diff --git a/socket/node_modules/cors/CONTRIBUTING.md b/socket/node_modules/cors/CONTRIBUTING.md new file mode 100644 index 0000000..591b09a --- /dev/null +++ b/socket/node_modules/cors/CONTRIBUTING.md @@ -0,0 +1,33 @@ +# contributing to `cors` + +CORS is a node.js package for providing a [connect](http://www.senchalabs.org/connect/)/[express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. Learn more about the project in [the README](README.md). + +## The CORS Spec + +[http://www.w3.org/TR/cors/](http://www.w3.org/TR/cors/) + +## Pull Requests Welcome + +* Include `'use strict';` in every javascript file. +* 2 space indentation. +* Please run the testing steps below before submitting. + +## Testing + +```bash +$ npm install +$ npm test +``` + +## Interactive Testing Harness + +[http://node-cors-client.herokuapp.com](http://node-cors-client.herokuapp.com) + +Related git repositories: + +* [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) +* [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) diff --git a/socket/node_modules/cors/HISTORY.md b/socket/node_modules/cors/HISTORY.md new file mode 100644 index 0000000..5762bce --- /dev/null +++ b/socket/node_modules/cors/HISTORY.md @@ -0,0 +1,58 @@ +2.8.5 / 2018-11-04 +================== + + * Fix setting `maxAge` option to `0` + +2.8.4 / 2017-07-12 +================== + + * Work-around Safari bug in default pre-flight response + +2.8.3 / 2017-03-29 +================== + + * Fix error when options delegate missing `methods` option + +2.8.2 / 2017-03-28 +================== + + * Fix error when frozen options are passed + * Send "Vary: Origin" when using regular expressions + * Send "Vary: Access-Control-Request-Headers" when dynamic `allowedHeaders` + +2.8.1 / 2016-09-08 +================== + +This release only changed documentation. + +2.8.0 / 2016-08-23 +================== + + * Add `optionsSuccessStatus` option + +2.7.2 / 2016-08-23 +================== + + * Fix error when Node.js running in strict mode + +2.7.1 / 2015-05-28 +================== + + * Move module into expressjs organization + +2.7.0 / 2015-05-28 +================== + + * Allow array of matching condition as `origin` option + * Allow regular expression as `origin` option + +2.6.1 / 2015-05-28 +================== + + * Update `license` in package.json + +2.6.0 / 2015-04-27 +================== + + * Add `preflightContinue` option + * Fix "Vary: Origin" header added for "*" diff --git a/socket/node_modules/cors/LICENSE b/socket/node_modules/cors/LICENSE new file mode 100644 index 0000000..fd10c84 --- /dev/null +++ b/socket/node_modules/cors/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2013 Troy Goode + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/socket/node_modules/cors/README.md b/socket/node_modules/cors/README.md new file mode 100644 index 0000000..732b847 --- /dev/null +++ b/socket/node_modules/cors/README.md @@ -0,0 +1,243 @@ +# cors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +CORS is a node.js package for providing a [Connect](http://www.senchalabs.org/connect/)/[Express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. + +**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)** + +* [Installation](#installation) +* [Usage](#usage) + * [Simple Usage](#simple-usage-enable-all-cors-requests) + * [Enable CORS for a Single Route](#enable-cors-for-a-single-route) + * [Configuring CORS](#configuring-cors) + * [Configuring CORS Asynchronously](#configuring-cors-asynchronously) + * [Enabling CORS Pre-Flight](#enabling-cors-pre-flight) +* [Configuration Options](#configuration-options) +* [Demo](#demo) +* [License](#license) +* [Author](#author) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cors +``` + +## Usage + +### Simple Usage (Enable *All* CORS Requests) + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.use(cors()) + +app.get('/products/:id', function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Enable CORS for a Single Route + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.get('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a Single Route'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var corsOptions = { + origin: 'http://example.com', + optionsSuccessStatus: 200 // some legacy browsers (IE11, various SmartTVs) choke on 204 +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for only example.com.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS w/ Dynamic Origin + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +If you do not want to block REST tools or server-to-server requests, +add a `!origin` check in the origin function like so: + +```javascript +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1 || !origin) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} +``` + +### Enabling CORS Pre-Flight + +Certain CORS requests are considered 'complex' and require an initial +`OPTIONS` request (called the "pre-flight request"). An example of a +'complex' CORS request is one that uses an HTTP verb other than +GET/HEAD/POST (such as DELETE) or that uses custom headers. To enable +pre-flighting, you must add a new OPTIONS handler for the route you want +to support: + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.options('/products/:id', cors()) // enable pre-flight request for DELETE request +app.del('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +You can also enable pre-flight across-the-board like so: + +```javascript +app.options('*', cors()) // include before other routes +``` + +### Configuring CORS Asynchronously + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptionsDelegate = function (req, callback) { + var corsOptions; + if (whitelist.indexOf(req.header('Origin')) !== -1) { + corsOptions = { origin: true } // reflect (enable) the requested origin in the CORS response + } else { + corsOptions = { origin: false } // disable CORS for this request + } + callback(null, corsOptions) // callback expects two parameters: error and options +} + +app.get('/products/:id', cors(corsOptionsDelegate), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +## Configuration Options + +* `origin`: Configures the **Access-Control-Allow-Origin** CORS header. Possible values: + - `Boolean` - set `origin` to `true` to reflect the [request origin](http://tools.ietf.org/html/draft-abarth-origin-09), as defined by `req.header('Origin')`, or set it to `false` to disable CORS. + - `String` - set `origin` to a specific origin. For example if you set it to `"http://example.com"` only requests from "http://example.com" will be allowed. + - `RegExp` - set `origin` to a regular expression pattern which will be used to test the request origin. If it's a match, the request origin will be reflected. For example the pattern `/example\.com$/` will reflect any request that is coming from an origin ending with "example.com". + - `Array` - set `origin` to an array of valid origins. Each origin can be a `String` or a `RegExp`. For example `["http://example1.com", /\.example2\.com$/]` will accept any request from "http://example1.com" or from a subdomain of "example2.com". + - `Function` - set `origin` to a function implementing some custom logic. The function takes the request origin as the first parameter and a callback (which expects the signature `err [object], allow [bool]`) as the second. +* `methods`: Configures the **Access-Control-Allow-Methods** CORS header. Expects a comma-delimited string (ex: 'GET,PUT,POST') or an array (ex: `['GET', 'PUT', 'POST']`). +* `allowedHeaders`: Configures the **Access-Control-Allow-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Type,Authorization') or an array (ex: `['Content-Type', 'Authorization']`). If not specified, defaults to reflecting the headers specified in the request's **Access-Control-Request-Headers** header. +* `exposedHeaders`: Configures the **Access-Control-Expose-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Range,X-Content-Range') or an array (ex: `['Content-Range', 'X-Content-Range']`). If not specified, no custom headers are exposed. +* `credentials`: Configures the **Access-Control-Allow-Credentials** CORS header. Set to `true` to pass the header, otherwise it is omitted. +* `maxAge`: Configures the **Access-Control-Max-Age** CORS header. Set to an integer to pass the header, otherwise it is omitted. +* `preflightContinue`: Pass the CORS preflight response to the next handler. +* `optionsSuccessStatus`: Provides a status code to use for successful `OPTIONS` requests, since some legacy browsers (IE11, various SmartTVs) choke on `204`. + +The default configuration is the equivalent of: + +```json +{ + "origin": "*", + "methods": "GET,HEAD,PUT,PATCH,POST,DELETE", + "preflightContinue": false, + "optionsSuccessStatus": 204 +} +``` + +For details on the effect of each CORS header, read [this](http://www.html5rocks.com/en/tutorials/cors/) article on HTML5 Rocks. + +## Demo + +A demo that illustrates CORS working (and not working) using jQuery is available here: [http://node-cors-client.herokuapp.com/](http://node-cors-client.herokuapp.com/) + +Code for that demo can be found here: + +* Client: [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) +* Server: [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) + +## Author + +[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com)) + +[coveralls-image]: https://img.shields.io/coveralls/expressjs/cors/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/cors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/cors.svg +[downloads-url]: https://npmjs.org/package/cors +[npm-image]: https://img.shields.io/npm/v/cors.svg +[npm-url]: https://npmjs.org/package/cors +[travis-image]: https://img.shields.io/travis/expressjs/cors/master.svg +[travis-url]: https://travis-ci.org/expressjs/cors diff --git a/socket/node_modules/cors/lib/index.js b/socket/node_modules/cors/lib/index.js new file mode 100644 index 0000000..5475aec --- /dev/null +++ b/socket/node_modules/cors/lib/index.js @@ -0,0 +1,238 @@ +(function () { + + 'use strict'; + + var assign = require('object-assign'); + var vary = require('vary'); + + var defaults = { + origin: '*', + methods: 'GET,HEAD,PUT,PATCH,POST,DELETE', + preflightContinue: false, + optionsSuccessStatus: 204 + }; + + function isString(s) { + return typeof s === 'string' || s instanceof String; + } + + function isOriginAllowed(origin, allowedOrigin) { + if (Array.isArray(allowedOrigin)) { + for (var i = 0; i < allowedOrigin.length; ++i) { + if (isOriginAllowed(origin, allowedOrigin[i])) { + return true; + } + } + return false; + } else if (isString(allowedOrigin)) { + return origin === allowedOrigin; + } else if (allowedOrigin instanceof RegExp) { + return allowedOrigin.test(origin); + } else { + return !!allowedOrigin; + } + } + + function configureOrigin(options, req) { + var requestOrigin = req.headers.origin, + headers = [], + isAllowed; + + if (!options.origin || options.origin === '*') { + // allow any origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: '*' + }]); + } else if (isString(options.origin)) { + // fixed origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: options.origin + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } else { + isAllowed = isOriginAllowed(requestOrigin, options.origin); + // reflect origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: isAllowed ? requestOrigin : false + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } + + return headers; + } + + function configureMethods(options) { + var methods = options.methods; + if (methods.join) { + methods = options.methods.join(','); // .methods is an array, so turn it into a string + } + return { + key: 'Access-Control-Allow-Methods', + value: methods + }; + } + + function configureCredentials(options) { + if (options.credentials === true) { + return { + key: 'Access-Control-Allow-Credentials', + value: 'true' + }; + } + return null; + } + + function configureAllowedHeaders(options, req) { + var allowedHeaders = options.allowedHeaders || options.headers; + var headers = []; + + if (!allowedHeaders) { + allowedHeaders = req.headers['access-control-request-headers']; // .headers wasn't specified, so reflect the request headers + headers.push([{ + key: 'Vary', + value: 'Access-Control-Request-Headers' + }]); + } else if (allowedHeaders.join) { + allowedHeaders = allowedHeaders.join(','); // .headers is an array, so turn it into a string + } + if (allowedHeaders && allowedHeaders.length) { + headers.push([{ + key: 'Access-Control-Allow-Headers', + value: allowedHeaders + }]); + } + + return headers; + } + + function configureExposedHeaders(options) { + var headers = options.exposedHeaders; + if (!headers) { + return null; + } else if (headers.join) { + headers = headers.join(','); // .headers is an array, so turn it into a string + } + if (headers && headers.length) { + return { + key: 'Access-Control-Expose-Headers', + value: headers + }; + } + return null; + } + + function configureMaxAge(options) { + var maxAge = (typeof options.maxAge === 'number' || options.maxAge) && options.maxAge.toString() + if (maxAge && maxAge.length) { + return { + key: 'Access-Control-Max-Age', + value: maxAge + }; + } + return null; + } + + function applyHeaders(headers, res) { + for (var i = 0, n = headers.length; i < n; i++) { + var header = headers[i]; + if (header) { + if (Array.isArray(header)) { + applyHeaders(header, res); + } else if (header.key === 'Vary' && header.value) { + vary(res, header.value); + } else if (header.value) { + res.setHeader(header.key, header.value); + } + } + } + } + + function cors(options, req, res, next) { + var headers = [], + method = req.method && req.method.toUpperCase && req.method.toUpperCase(); + + if (method === 'OPTIONS') { + // preflight + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureMethods(options, req)); + headers.push(configureAllowedHeaders(options, req)); + headers.push(configureMaxAge(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + + if (options.preflightContinue) { + next(); + } else { + // Safari (and potentially other browsers) need content-length 0, + // for 204 or they just hang waiting for a body + res.statusCode = options.optionsSuccessStatus; + res.setHeader('Content-Length', '0'); + res.end(); + } + } else { + // actual response + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + next(); + } + } + + function middlewareWrapper(o) { + // if options are static (either via defaults or custom options passed in), wrap in a function + var optionsCallback = null; + if (typeof o === 'function') { + optionsCallback = o; + } else { + optionsCallback = function (req, cb) { + cb(null, o); + }; + } + + return function corsMiddleware(req, res, next) { + optionsCallback(req, function (err, options) { + if (err) { + next(err); + } else { + var corsOptions = assign({}, defaults, options); + var originCallback = null; + if (corsOptions.origin && typeof corsOptions.origin === 'function') { + originCallback = corsOptions.origin; + } else if (corsOptions.origin) { + originCallback = function (origin, cb) { + cb(null, corsOptions.origin); + }; + } + + if (originCallback) { + originCallback(req.headers.origin, function (err2, origin) { + if (err2 || !origin) { + next(err2); + } else { + corsOptions.origin = origin; + cors(corsOptions, req, res, next); + } + }); + } else { + next(); + } + } + }); + }; + } + + // can pass either an options hash, an options delegate, or nothing + module.exports = middlewareWrapper; + +}()); diff --git a/socket/node_modules/cors/package.json b/socket/node_modules/cors/package.json new file mode 100644 index 0000000..5502ea4 --- /dev/null +++ b/socket/node_modules/cors/package.json @@ -0,0 +1,77 @@ +{ + "_from": "cors@~2.8.5", + "_id": "cors@2.8.5", + "_inBundle": false, + "_integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "_location": "/cors", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "cors@~2.8.5", + "name": "cors", + "escapedName": "cors", + "rawSpec": "~2.8.5", + "saveSpec": null, + "fetchSpec": "~2.8.5" + }, + "_requiredBy": [ + "/engine.io" + ], + "_resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "_shasum": "eac11da51592dd86b9f06f6e7ac293b3df875d29", + "_spec": "cors@~2.8.5", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/engine.io", + "author": { + "name": "Troy Goode", + "email": "troygoode@gmail.com", + "url": "https://github.com/troygoode/" + }, + "bugs": { + "url": "https://github.com/expressjs/cors/issues" + }, + "bundleDependencies": false, + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "deprecated": false, + "description": "Node.js CORS middleware", + "devDependencies": { + "after": "0.8.2", + "eslint": "2.13.1", + "express": "4.16.3", + "mocha": "5.2.0", + "nyc": "13.1.0", + "supertest": "3.3.0" + }, + "engines": { + "node": ">= 0.10" + }, + "files": [ + "lib/index.js", + "CONTRIBUTING.md", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/expressjs/cors#readme", + "keywords": [ + "cors", + "express", + "connect", + "middleware" + ], + "license": "MIT", + "main": "./lib/index.js", + "name": "cors", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/cors.git" + }, + "scripts": { + "lint": "eslint lib test", + "test": "npm run lint && nyc --reporter=html --reporter=text mocha --require test/support/env" + }, + "version": "2.8.5" +} diff --git a/socket/node_modules/debug/CHANGELOG.md b/socket/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..820d21e --- /dev/null +++ b/socket/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/socket/node_modules/debug/LICENSE b/socket/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/socket/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/socket/node_modules/debug/README.md b/socket/node_modules/debug/README.md new file mode 100644 index 0000000..88dae35 --- /dev/null +++ b/socket/node_modules/debug/README.md @@ -0,0 +1,455 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/socket/node_modules/debug/dist/debug.js b/socket/node_modules/debug/dist/debug.js new file mode 100644 index 0000000..89ad0c2 --- /dev/null +++ b/socket/node_modules/debug/dist/debug.js @@ -0,0 +1,912 @@ +"use strict"; + +function _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _nonIterableSpread(); } + +function _nonIterableSpread() { throw new TypeError("Invalid attempt to spread non-iterable instance"); } + +function _iterableToArray(iter) { if (Symbol.iterator in Object(iter) || Object.prototype.toString.call(iter) === "[object Arguments]") return Array.from(iter); } + +function _arrayWithoutHoles(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = new Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } } + +function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); } + +(function (f) { + if ((typeof exports === "undefined" ? "undefined" : _typeof(exports)) === "object" && typeof module !== "undefined") { + module.exports = f(); + } else if (typeof define === "function" && define.amd) { + define([], f); + } else { + var g; + + if (typeof window !== "undefined") { + g = window; + } else if (typeof global !== "undefined") { + g = global; + } else if (typeof self !== "undefined") { + g = self; + } else { + g = this; + } + + g.debug = f(); + } +})(function () { + var define, module, exports; + return function () { + function r(e, n, t) { + function o(i, f) { + if (!n[i]) { + if (!e[i]) { + var c = "function" == typeof require && require; + if (!f && c) return c(i, !0); + if (u) return u(i, !0); + var a = new Error("Cannot find module '" + i + "'"); + throw a.code = "MODULE_NOT_FOUND", a; + } + + var p = n[i] = { + exports: {} + }; + e[i][0].call(p.exports, function (r) { + var n = e[i][1][r]; + return o(n || r); + }, p, p.exports, r, e, n, t); + } + + return n[i].exports; + } + + for (var u = "function" == typeof require && require, i = 0; i < t.length; i++) { + o(t[i]); + } + + return o; + } + + return r; + }()({ + 1: [function (require, module, exports) { + /** + * Helpers. + */ + var s = 1000; + var m = s * 60; + var h = m * 60; + var d = h * 24; + var w = d * 7; + var y = d * 365.25; + /** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + + module.exports = function (val, options) { + options = options || {}; + + var type = _typeof(val); + + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + + throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val)); + }; + /** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + + + function parse(str) { + str = String(str); + + if (str.length > 100) { + return; + } + + var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str); + + if (!match) { + return; + } + + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + + case 'weeks': + case 'week': + case 'w': + return n * w; + + case 'days': + case 'day': + case 'd': + return n * d; + + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + + default: + return undefined; + } + } + /** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + + function fmtShort(ms) { + var msAbs = Math.abs(ms); + + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + + return ms + 'ms'; + } + /** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + + function fmtLong(ms) { + var msAbs = Math.abs(ms); + + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + + return ms + ' ms'; + } + /** + * Pluralization helper. + */ + + + function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); + } + }, {}], + 2: [function (require, module, exports) { + // shim for using process in browser + var process = module.exports = {}; // cached from whatever global is present so that test runners that stub it + // don't break things. But we need to wrap it in a try catch in case it is + // wrapped in strict mode code which doesn't define any globals. It's inside a + // function because try/catches deoptimize in certain engines. + + var cachedSetTimeout; + var cachedClearTimeout; + + function defaultSetTimout() { + throw new Error('setTimeout has not been defined'); + } + + function defaultClearTimeout() { + throw new Error('clearTimeout has not been defined'); + } + + (function () { + try { + if (typeof setTimeout === 'function') { + cachedSetTimeout = setTimeout; + } else { + cachedSetTimeout = defaultSetTimout; + } + } catch (e) { + cachedSetTimeout = defaultSetTimout; + } + + try { + if (typeof clearTimeout === 'function') { + cachedClearTimeout = clearTimeout; + } else { + cachedClearTimeout = defaultClearTimeout; + } + } catch (e) { + cachedClearTimeout = defaultClearTimeout; + } + })(); + + function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + //normal enviroments in sane situations + return setTimeout(fun, 0); + } // if setTimeout wasn't available but was latter defined + + + if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { + cachedSetTimeout = setTimeout; + return setTimeout(fun, 0); + } + + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedSetTimeout(fun, 0); + } catch (e) { + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedSetTimeout.call(null, fun, 0); + } catch (e) { + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error + return cachedSetTimeout.call(this, fun, 0); + } + } + } + + function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + //normal enviroments in sane situations + return clearTimeout(marker); + } // if clearTimeout wasn't available but was latter defined + + + if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { + cachedClearTimeout = clearTimeout; + return clearTimeout(marker); + } + + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedClearTimeout(marker); + } catch (e) { + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedClearTimeout.call(null, marker); + } catch (e) { + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. + // Some versions of I.E. have different rules for clearTimeout vs setTimeout + return cachedClearTimeout.call(this, marker); + } + } + } + + var queue = []; + var draining = false; + var currentQueue; + var queueIndex = -1; + + function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + + draining = false; + + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + + if (queue.length) { + drainQueue(); + } + } + + function drainQueue() { + if (draining) { + return; + } + + var timeout = runTimeout(cleanUpNextTick); + draining = true; + var len = queue.length; + + while (len) { + currentQueue = queue; + queue = []; + + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + + queueIndex = -1; + len = queue.length; + } + + currentQueue = null; + draining = false; + runClearTimeout(timeout); + } + + process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + + queue.push(new Item(fun, args)); + + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } + }; // v8 likes predictible objects + + + function Item(fun, array) { + this.fun = fun; + this.array = array; + } + + Item.prototype.run = function () { + this.fun.apply(null, this.array); + }; + + process.title = 'browser'; + process.browser = true; + process.env = {}; + process.argv = []; + process.version = ''; // empty string to avoid regexp issues + + process.versions = {}; + + function noop() {} + + process.on = noop; + process.addListener = noop; + process.once = noop; + process.off = noop; + process.removeListener = noop; + process.removeAllListeners = noop; + process.emit = noop; + process.prependListener = noop; + process.prependOnceListener = noop; + + process.listeners = function (name) { + return []; + }; + + process.binding = function (name) { + throw new Error('process.binding is not supported'); + }; + + process.cwd = function () { + return '/'; + }; + + process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); + }; + + process.umask = function () { + return 0; + }; + }, {}], + 3: [function (require, module, exports) { + /** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + Object.keys(env).forEach(function (key) { + createDebug[key] = env[key]; + }); + /** + * Active `debug` instances. + */ + + createDebug.instances = []; + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + + createDebug.formatters = {}; + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + + function selectColor(namespace) { + var hash = 0; + + for (var i = 0; i < namespace.length; i++) { + hash = (hash << 5) - hash + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + + createDebug.selectColor = selectColor; + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + + function createDebug(namespace) { + var prevTime; + + function debug() { + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } + + // Disabled? + if (!debug.enabled) { + return; + } + + var self = debug; // Set `diff` timestamp + + var curr = Number(new Date()); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } // Apply any `formatters` transformations + + + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return match; + } + + index++; + var formatter = createDebug.formatters[format]; + + if (typeof formatter === 'function') { + var val = args[index]; + match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format` + + args.splice(index, 1); + index--; + } + + return match; + }); // Apply env-specific formatting (colors, etc.) + + createDebug.formatArgs.call(self, args); + var logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = createDebug.enabled(namespace); + debug.useColors = createDebug.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + debug.extend = extend; // Debug.formatArgs = formatArgs; + // debug.rawLog = rawLog; + // env-specific initialization logic for debug instances + + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + createDebug.instances.push(debug); + return debug; + } + + function destroy() { + var index = createDebug.instances.indexOf(this); + + if (index !== -1) { + createDebug.instances.splice(index, 1); + return true; + } + + return false; + } + + function extend(namespace, delimiter) { + var newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + + + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.names = []; + createDebug.skips = []; + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < createDebug.instances.length; i++) { + var instance = createDebug.instances[i]; + instance.enabled = createDebug.enabled(instance.namespace); + } + } + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + + + function disable() { + var namespaces = [].concat(_toConsumableArray(createDebug.names.map(toNamespace)), _toConsumableArray(createDebug.skips.map(toNamespace).map(function (namespace) { + return '-' + namespace; + }))).join(','); + createDebug.enable(''); + return namespaces; + } + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + + + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + var i; + var len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + + + function toNamespace(regexp) { + return regexp.toString().substring(2, regexp.toString().length - 2).replace(/\.\*\?$/, '*'); + } + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + + + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + + return val; + } + + createDebug.enable(createDebug.load()); + return createDebug; + } + + module.exports = setup; + }, { + "ms": 1 + }], + 4: [function (require, module, exports) { + (function (process) { + /* eslint-env browser */ + + /** + * This is the web browser implementation of `debug()`. + */ + exports.log = log; + exports.formatArgs = formatArgs; + exports.save = save; + exports.load = load; + exports.useColors = useColors; + exports.storage = localstorage(); + /** + * Colors. + */ + + exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33']; + /** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + // eslint-disable-next-line complexity + + function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } // Internet Explorer and Edge do not support colors. + + + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + + + return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773 + typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker + typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/); + } + /** + * Colorize log arguments if enabled. + * + * @api public + */ + + + function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function (match) { + if (match === '%%') { + return; + } + + index++; + + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + args.splice(lastC, 0, c); + } + /** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + + + function log() { + var _console; + + // This hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments); + } + /** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + + + function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) {// Swallow + // XXX (@Qix-) should we be logging these? + } + } + /** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + + + function load() { + var r; + + try { + r = exports.storage.getItem('debug'); + } catch (error) {} // Swallow + // XXX (@Qix-) should we be logging these? + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + + + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; + } + /** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + + + function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) {// Swallow + // XXX (@Qix-) should we be logging these? + } + } + + module.exports = require('./common')(exports); + var formatters = module.exports.formatters; + /** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + + formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } + }; + }).call(this, require('_process')); + }, { + "./common": 3, + "_process": 2 + }] + }, {}, [4])(4); +}); diff --git a/socket/node_modules/debug/package.json b/socket/node_modules/debug/package.json new file mode 100644 index 0000000..6c3c620 --- /dev/null +++ b/socket/node_modules/debug/package.json @@ -0,0 +1,104 @@ +{ + "_from": "debug@~4.1.0", + "_id": "debug@4.1.1", + "_inBundle": false, + "_integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@~4.1.0", + "name": "debug", + "escapedName": "debug", + "rawSpec": "~4.1.0", + "saveSpec": null, + "fetchSpec": "~4.1.0" + }, + "_requiredBy": [ + "/engine.io", + "/socket.io", + "/socket.io-parser" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "_shasum": "3b72260255109c6b589cee050f1d516139664791", + "_spec": "debug@~4.1.0", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/socket.io", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "^2.1.1" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "@babel/cli": "^7.0.0", + "@babel/core": "^7.0.0", + "@babel/preset-env": "^7.0.0", + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.0.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "xo": "^0.23.0" + }, + "files": [ + "src", + "dist/debug.js", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "scripts": { + "build": "npm run build:debug && npm run build:test", + "build:debug": "babel -o dist/debug.js dist/debug.es6.js > dist/debug.js", + "build:test": "babel -d dist test.js", + "clean": "rimraf dist coverage", + "lint": "xo", + "prebuild:debug": "mkdir -p dist && browserify --standalone debug -o dist/debug.es6.js .", + "pretest:browser": "npm run build", + "test": "npm run test:node && npm run test:browser", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls", + "test:node": "istanbul cover _mocha -- test.js" + }, + "unpkg": "./dist/debug.js", + "version": "4.1.1" +} diff --git a/socket/node_modules/debug/src/browser.js b/socket/node_modules/debug/src/browser.js new file mode 100644 index 0000000..5f34c0d --- /dev/null +++ b/socket/node_modules/debug/src/browser.js @@ -0,0 +1,264 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ +function log(...args) { + // This hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return typeof console === 'object' && + console.log && + console.log(...args); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/socket/node_modules/debug/src/common.js b/socket/node_modules/debug/src/common.js new file mode 100644 index 0000000..2f82b8d --- /dev/null +++ b/socket/node_modules/debug/src/common.js @@ -0,0 +1,266 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * Active `debug` instances. + */ + createDebug.instances = []; + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return match; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = createDebug.enabled(namespace); + debug.useColors = createDebug.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + debug.extend = extend; + // Debug.formatArgs = formatArgs; + // debug.rawLog = rawLog; + + // env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + createDebug.instances.push(debug); + + return debug; + } + + function destroy() { + const index = createDebug.instances.indexOf(this); + if (index !== -1) { + createDebug.instances.splice(index, 1); + return true; + } + return false; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + + createDebug.names = []; + createDebug.skips = []; + + let i; + const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + const len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < createDebug.instances.length; i++) { + const instance = createDebug.instances[i]; + instance.enabled = createDebug.enabled(instance.namespace); + } + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names.map(toNamespace), + ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + let i; + let len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + function toNamespace(regexp) { + return regexp.toString() + .substring(2, regexp.toString().length - 2) + .replace(/\.\*\?$/, '*'); + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/socket/node_modules/debug/src/index.js b/socket/node_modules/debug/src/index.js new file mode 100644 index 0000000..bf4c57f --- /dev/null +++ b/socket/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/socket/node_modules/debug/src/node.js b/socket/node_modules/debug/src/node.js new file mode 100644 index 0000000..5e1f154 --- /dev/null +++ b/socket/node_modules/debug/src/node.js @@ -0,0 +1,257 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.format(...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/socket/node_modules/engine.io-parser/CHANGELOG.md b/socket/node_modules/engine.io-parser/CHANGELOG.md new file mode 100644 index 0000000..2f3fcf6 --- /dev/null +++ b/socket/node_modules/engine.io-parser/CHANGELOG.md @@ -0,0 +1,89 @@ +## [4.0.1](https://github.com/socketio/engine.io-parser/compare/4.0.0...4.0.1) (2020-09-10) + + +### Bug Fixes + +* use a terser-compatible representation of the separator ([886f9ea](https://github.com/socketio/engine.io-parser/commit/886f9ea7c4e717573152c31320f6fb6c6664061b)) + + +# [4.0.0](https://github.com/socketio/engine.io-parser/compare/v4.0.0-alpha.1...4.0.0) (2020-09-08) + +This major release contains the necessary changes for the version 4 of the Engine.IO protocol. More information about the new version can be found [there](https://github.com/socketio/engine.io-protocol#difference-between-v3-and-v4). + +Encoding changes between v3 and v4: + +- encodePacket with string + - input: `{ type: "message", data: "hello" }` + - output in v3: `"4hello"` + - output in v4: `"4hello"` + +- encodePacket with binary + - input: `{ type: 'message', data: }` + - output in v3: `` + - output in v4: `` + +- encodePayload with strings + - input: `[ { type: 'message', data: 'hello' }, { type: 'message', data: '€€€' } ]` + - output in v3: `"6:4hello4:4€€€"` + - output in v4: `"4hello\x1e4€€€"` + +- encodePayload with string and binary + - input: `[ { type: 'message', data: 'hello' }, { type: 'message', data: } ]` + - output in v3: `` + - output in v4: `"4hello\x1ebAQID"` + +Please note that the parser is now dependency-free! This should help reduce the size of the browser bundle. + +### Bug Fixes + +* keep track of the buffer initial length ([8edf2d1](https://github.com/socketio/engine.io-parser/commit/8edf2d1478026da442f519c2d2521af43ba01832)) + + +### Features + +* restore the upgrade mechanism ([6efedfa](https://github.com/socketio/engine.io-parser/commit/6efedfa0f3048506a4ba99e70674ddf4c0732e0c)) + + + +# [4.0.0-alpha.1](https://github.com/socketio/engine.io-parser/compare/v4.0.0-alpha.0...v4.0.0-alpha.1) (2020-05-19) + + +### Features + +* implement the version 4 of the protocol ([cab7db0](https://github.com/socketio/engine.io-parser/commit/cab7db0404e0a69f86a05ececd62c8c31f4d97d5)) + + + +# [4.0.0-alpha.0](https://github.com/socketio/engine.io-parser/compare/2.2.0...v4.0.0-alpha.0) (2020-02-04) + + +### Bug Fixes + +* properly decode binary packets ([5085373](https://github.com/socketio/engine.io-parser/commit/50853738e0c6c16f9cee0d7887651155f4b78240)) + + +### Features + +* remove packet type when encoding binary packets ([a947ae5](https://github.com/socketio/engine.io-parser/commit/a947ae59a2844e4041db58ff36b270d1528b3bee)) + + +### BREAKING CHANGES + +* the packet containing binary data will now be sent without any transformation + +Protocol v3: { type: 'message', data: } => +Protocol v4: { type: 'message', data: } => + + + +# [2.2.0](https://github.com/socketio/engine.io-parser/compare/2.1.3...2.2.0) (2019-09-13) + + +* [refactor] Use `Buffer.allocUnsafe` instead of `new Buffer` (#104) ([aedf8eb](https://github.com/socketio/engine.io-parser/commit/aedf8eb29e8bf6aeb5c6cc68965d986c4c958ae2)), closes [#104](https://github.com/socketio/engine.io-parser/issues/104) + + +### BREAKING CHANGES + +* drop support for Node.js 4 (since Buffer.allocUnsafe was added in v5.10.0) + +Reference: https://nodejs.org/docs/latest/api/buffer.html#buffer_class_method_buffer_allocunsafe_size diff --git a/socket/node_modules/engine.io-parser/LICENSE b/socket/node_modules/engine.io-parser/LICENSE new file mode 100644 index 0000000..d8fdaec --- /dev/null +++ b/socket/node_modules/engine.io-parser/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Guillermo Rauch (@rauchg) + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/socket/node_modules/engine.io-parser/Readme.md b/socket/node_modules/engine.io-parser/Readme.md new file mode 100644 index 0000000..1c878db --- /dev/null +++ b/socket/node_modules/engine.io-parser/Readme.md @@ -0,0 +1,158 @@ + +# engine.io-parser + +[![Build Status](https://secure.travis-ci.org/socketio/engine.io-parser.svg?branch=master)](https://travis-ci.org/socketio/engine.io-parser) +[![NPM version](https://badge.fury.io/js/engine.io-parser.svg)](https://npmjs.com/package/engine.io-parser) + +This is the JavaScript parser for the engine.io protocol encoding, +shared by both +[engine.io-client](https://github.com/socketio/engine.io-client) and +[engine.io](https://github.com/socketio/engine.io). + +## How to use + +### Standalone + +The parser can encode/decode packets, payloads, and payloads as binary +with the following methods: `encodePacket`, `decodePacket`, `encodePayload`, +`decodePayload`. + +Example: + +```js +const parser = require("engine.io-parser"); +const data = Buffer.from([ 1, 2, 3, 4 ]); + +parser.encodePacket({ type: "message", data }, encoded => { + const decodedData = parser.decodePacket(encoded); // decodedData === data +}); +``` + +### With browserify + +Engine.IO Parser is a commonjs module, which means you can include it by using +`require` on the browser and package using [browserify](http://browserify.org/): + +1. install the parser package + + ```shell + npm install engine.io-parser + ``` + +1. write your app code + + ```js + const parser = require("engine.io-parser"); + + const testBuffer = new Int8Array(10); + for (let i = 0; i < testBuffer.length; i++) testBuffer[i] = i; + + const packets = [{ type: "message", data: testBuffer.buffer }, { type: "message", data: "hello" }]; + + parser.encodePayload(packets, encoded => { + parser.decodePayload(encoded, + (packet, index, total) => { + const isLast = index + 1 == total; + if (!isLast) { + const buffer = new Int8Array(packet.data); // testBuffer + } else { + const message = packet.data; // "hello" + } + }); + }); + ``` + +1. build your app bundle + + ```bash + $ browserify app.js > bundle.js + ``` + +1. include on your page + + ```html + + ``` + +## Features + +- Runs on browser and node.js seamlessly +- Runs inside HTML5 WebWorker +- Can encode and decode packets + - Encodes from/to ArrayBuffer or Blob when in browser, and Buffer or ArrayBuffer in Node + +## API + +Note: `cb(type)` means the type is a callback function that contains a parameter of type `type` when called. + +### Node + +- `encodePacket` + - Encodes a packet. + - **Parameters** + - `Object`: the packet to encode, has `type` and `data`. + - `data`: can be a `String`, `Number`, `Buffer`, `ArrayBuffer` + - `Boolean`: binary support + - `Function`: callback, returns the encoded packet (`cb(String)`) +- `decodePacket` + - Decodes a packet. Data also available as an ArrayBuffer if requested. + - Returns data as `String` or (`Blob` on browser, `ArrayBuffer` on Node) + - **Parameters** + - `String` | `ArrayBuffer`: the packet to decode, has `type` and `data` + - `String`: optional, the binary type + +- `encodePayload` + - Encodes multiple messages (payload). + - If any contents are binary, they will be encoded as base64 strings. Base64 + encoded strings are marked with a b before the length specifier + - **Parameters** + - `Array`: an array of packets + - `Function`: callback, returns the encoded payload (`cb(String)`) +- `decodePayload` + - Decodes data when a payload is maybe expected. Possible binary contents are + decoded from their base64 representation. + - **Parameters** + - `String`: the payload + - `Function`: callback, returns (cb(`Object`: packet, `Number`:packet index, `Number`:packet total)) + +## Tests + +Standalone tests can be run with `npm test` which will run the node.js tests. + +Browser tests are run using [zuul](https://github.com/defunctzombie/zuul). +(You must have zuul setup with a saucelabs account.) + +You can run the tests locally using the following command: + +``` +npm run test:browser +``` + +## Support + +The support channels for `engine.io-parser` are the same as `socket.io`: + - irc.freenode.net **#socket.io** + - [Github Discussions](https://github.com/socketio/socket.io/discussions) + - [Website](https://socket.io) + +## Development + +To contribute patches, run tests or benchmarks, make sure to clone the +repository: + +```bash +git clone git://github.com/socketio/engine.io-parser.git +``` + +Then: + +```bash +cd engine.io-parser +npm ci +``` + +See the `Tests` section above for how to run tests before submitting any patches. + +## License + +MIT diff --git a/socket/node_modules/engine.io-parser/lib/commons.js b/socket/node_modules/engine.io-parser/lib/commons.js new file mode 100644 index 0000000..4fcea4c --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/commons.js @@ -0,0 +1,21 @@ +const PACKET_TYPES = Object.create(null); // no Map = no polyfill +PACKET_TYPES["open"] = "0"; +PACKET_TYPES["close"] = "1"; +PACKET_TYPES["ping"] = "2"; +PACKET_TYPES["pong"] = "3"; +PACKET_TYPES["message"] = "4"; +PACKET_TYPES["upgrade"] = "5"; +PACKET_TYPES["noop"] = "6"; + +const PACKET_TYPES_REVERSE = Object.create(null); +Object.keys(PACKET_TYPES).forEach(key => { + PACKET_TYPES_REVERSE[PACKET_TYPES[key]] = key; +}); + +const ERROR_PACKET = { type: "error", data: "parser error" }; + +module.exports = { + PACKET_TYPES, + PACKET_TYPES_REVERSE, + ERROR_PACKET +}; diff --git a/socket/node_modules/engine.io-parser/lib/decodePacket.browser.js b/socket/node_modules/engine.io-parser/lib/decodePacket.browser.js new file mode 100644 index 0000000..06a0081 --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/decodePacket.browser.js @@ -0,0 +1,57 @@ +const { PACKET_TYPES_REVERSE, ERROR_PACKET } = require("./commons"); + +const withNativeArrayBuffer = typeof ArrayBuffer === "function"; + +let base64decoder; +if (withNativeArrayBuffer) { + base64decoder = require("base64-arraybuffer"); +} + +const decodePacket = (encodedPacket, binaryType) => { + if (typeof encodedPacket !== "string") { + return { + type: "message", + data: mapBinary(encodedPacket, binaryType) + }; + } + const type = encodedPacket.charAt(0); + if (type === "b") { + return { + type: "message", + data: decodeBase64Packet(encodedPacket.substring(1), binaryType) + }; + } + const packetType = PACKET_TYPES_REVERSE[type]; + if (!packetType) { + return ERROR_PACKET; + } + return encodedPacket.length > 1 + ? { + type: PACKET_TYPES_REVERSE[type], + data: encodedPacket.substring(1) + } + : { + type: PACKET_TYPES_REVERSE[type] + }; +}; + +const decodeBase64Packet = (data, binaryType) => { + if (base64decoder) { + const decoded = base64decoder.decode(data); + return mapBinary(decoded, binaryType); + } else { + return { base64: true, data }; // fallback for old browsers + } +}; + +const mapBinary = (data, binaryType) => { + switch (binaryType) { + case "blob": + return data instanceof ArrayBuffer ? new Blob([data]) : data; + case "arraybuffer": + default: + return data; // assuming the data is already an ArrayBuffer + } +}; + +module.exports = decodePacket; diff --git a/socket/node_modules/engine.io-parser/lib/decodePacket.js b/socket/node_modules/engine.io-parser/lib/decodePacket.js new file mode 100644 index 0000000..bd47dbd --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/decodePacket.js @@ -0,0 +1,51 @@ +const { PACKET_TYPES_REVERSE, ERROR_PACKET } = require("./commons"); + +const decodePacket = (encodedPacket, binaryType) => { + if (typeof encodedPacket !== "string") { + return { + type: "message", + data: mapBinary(encodedPacket, binaryType) + }; + } + const type = encodedPacket.charAt(0); + if (type === "b") { + const buffer = Buffer.from(encodedPacket.substring(1), "base64"); + return { + type: "message", + data: mapBinary(buffer, binaryType) + }; + } + if (!PACKET_TYPES_REVERSE[type]) { + return ERROR_PACKET; + } + return encodedPacket.length > 1 + ? { + type: PACKET_TYPES_REVERSE[type], + data: encodedPacket.substring(1) + } + : { + type: PACKET_TYPES_REVERSE[type] + }; +}; + +const mapBinary = (data, binaryType) => { + const isBuffer = Buffer.isBuffer(data); + switch (binaryType) { + case "arraybuffer": + return isBuffer ? toArrayBuffer(data) : data; + case "nodebuffer": + default: + return data; // assuming the data is already a Buffer + } +}; + +const toArrayBuffer = buffer => { + const arrayBuffer = new ArrayBuffer(buffer.length); + const view = new Uint8Array(arrayBuffer); + for (let i = 0; i < buffer.length; i++) { + view[i] = buffer[i]; + } + return arrayBuffer; +}; + +module.exports = decodePacket; diff --git a/socket/node_modules/engine.io-parser/lib/encodePacket.browser.js b/socket/node_modules/engine.io-parser/lib/encodePacket.browser.js new file mode 100644 index 0000000..b2287af --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/encodePacket.browser.js @@ -0,0 +1,46 @@ +const { PACKET_TYPES } = require("./commons"); + +const withNativeBlob = + typeof Blob === "function" || + (typeof Blob !== "undefined" && + Object.prototype.toString.call(Blob) === "[object BlobConstructor]"); +const withNativeArrayBuffer = typeof ArrayBuffer === "function"; + +// ArrayBuffer.isView method is not defined in IE10 +const isView = obj => { + return typeof ArrayBuffer.isView === "function" + ? ArrayBuffer.isView(obj) + : obj && obj.buffer instanceof ArrayBuffer; +}; + +const encodePacket = ({ type, data }, supportsBinary, callback) => { + if (withNativeBlob && data instanceof Blob) { + if (supportsBinary) { + return callback(data); + } else { + return encodeBlobAsBase64(data, callback); + } + } else if ( + withNativeArrayBuffer && + (data instanceof ArrayBuffer || isView(data)) + ) { + if (supportsBinary) { + return callback(data instanceof ArrayBuffer ? data : data.buffer); + } else { + return encodeBlobAsBase64(new Blob([data]), callback); + } + } + // plain string + return callback(PACKET_TYPES[type] + (data || "")); +}; + +const encodeBlobAsBase64 = (data, callback) => { + const fileReader = new FileReader(); + fileReader.onload = function() { + const content = fileReader.result.split(",")[1]; + callback("b" + content); + }; + return fileReader.readAsDataURL(data); +}; + +module.exports = encodePacket; diff --git a/socket/node_modules/engine.io-parser/lib/encodePacket.js b/socket/node_modules/engine.io-parser/lib/encodePacket.js new file mode 100644 index 0000000..c4a84ec --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/encodePacket.js @@ -0,0 +1,27 @@ +const { PACKET_TYPES } = require("./commons"); + +const encodePacket = ({ type, data }, supportsBinary, callback) => { + if (data instanceof ArrayBuffer || ArrayBuffer.isView(data)) { + const buffer = toBuffer(data); + return callback(encodeBuffer(buffer, supportsBinary)); + } + // plain string + return callback(PACKET_TYPES[type] + (data || "")); +}; + +const toBuffer = data => { + if (Buffer.isBuffer(data)) { + return data; + } else if (data instanceof ArrayBuffer) { + return Buffer.from(data); + } else { + return Buffer.from(data.buffer, data.byteOffset, data.byteLength); + } +}; + +// only 'message' packets can contain binary, so the type prefix is not needed +const encodeBuffer = (data, supportsBinary) => { + return supportsBinary ? data : "b" + data.toString("base64"); +}; + +module.exports = encodePacket; diff --git a/socket/node_modules/engine.io-parser/lib/index.js b/socket/node_modules/engine.io-parser/lib/index.js new file mode 100644 index 0000000..a412b46 --- /dev/null +++ b/socket/node_modules/engine.io-parser/lib/index.js @@ -0,0 +1,42 @@ +const encodePacket = require("./encodePacket"); +const decodePacket = require("./decodePacket"); + +const SEPARATOR = String.fromCharCode(30); // see https://en.wikipedia.org/wiki/Delimiter#ASCII_delimited_text + +const encodePayload = (packets, callback) => { + // some packets may be added to the array while encoding, so the initial length must be saved + const length = packets.length; + const encodedPackets = new Array(length); + let count = 0; + + packets.forEach((packet, i) => { + // force base64 encoding for binary packets + encodePacket(packet, false, encodedPacket => { + encodedPackets[i] = encodedPacket; + if (++count === length) { + callback(encodedPackets.join(SEPARATOR)); + } + }); + }); +}; + +const decodePayload = (encodedPayload, binaryType) => { + const encodedPackets = encodedPayload.split(SEPARATOR); + const packets = []; + for (let i = 0; i < encodedPackets.length; i++) { + const decodedPacket = decodePacket(encodedPackets[i], binaryType); + packets.push(decodedPacket); + if (decodedPacket.type === "error") { + break; + } + } + return packets; +}; + +module.exports = { + protocol: 4, + encodePacket, + encodePayload, + decodePacket, + decodePayload +}; diff --git a/socket/node_modules/engine.io-parser/package.json b/socket/node_modules/engine.io-parser/package.json new file mode 100644 index 0000000..57a2b1b --- /dev/null +++ b/socket/node_modules/engine.io-parser/package.json @@ -0,0 +1,76 @@ +{ + "_from": "engine.io-parser@~4.0.0", + "_id": "engine.io-parser@4.0.1", + "_inBundle": false, + "_integrity": "sha512-v5aZK1hlckcJDGmHz3W8xvI3NUHYc9t8QtTbqdR5OaH3S9iJZilPubauOm+vLWOMMWzpE3hiq92l9lTAHamRCg==", + "_location": "/engine.io-parser", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "engine.io-parser@~4.0.0", + "name": "engine.io-parser", + "escapedName": "engine.io-parser", + "rawSpec": "~4.0.0", + "saveSpec": null, + "fetchSpec": "~4.0.0" + }, + "_requiredBy": [ + "/engine.io" + ], + "_resolved": "https://registry.npmjs.org/engine.io-parser/-/engine.io-parser-4.0.1.tgz", + "_shasum": "6444c3cf2523ba4fc3bbaedd4fe425e6bcb16479", + "_spec": "engine.io-parser@~4.0.0", + "_where": "/home/divergent/collab-text-editor/socket/node_modules/engine.io", + "browser": { + "./lib/encodePacket.js": "./lib/encodePacket.browser.js", + "./lib/decodePacket.js": "./lib/decodePacket.browser.js" + }, + "bugs": { + "url": "https://github.com/socketio/engine.io-parser/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Parser for the client for the realtime Engine", + "devDependencies": { + "@babel/core": "~7.9.6", + "@babel/preset-env": "~7.9.6", + "babel-eslint": "^10.0.3", + "babelify": "^10.0.0", + "base64-arraybuffer": "0.1.5", + "benchmark": "^2.1.4", + "eslint": "^6.8.0", + "eslint-config-prettier": "^6.9.0", + "expect.js": "0.3.1", + "mocha": "^5.2.0", + "nyc": "~15.0.1", + "prettier": "^1.19.1", + "socket.io-browsers": "^1.0.4", + "zuul": "3.11.1", + "zuul-ngrok": "4.0.0" + }, + "engines": { + "node": ">=8.0.0" + }, + "files": [ + "lib/" + ], + "homepage": "https://github.com/socketio/engine.io-parser", + "license": "MIT", + "main": "lib/index.js", + "name": "engine.io-parser", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/socketio/engine.io-parser.git" + }, + "scripts": { + "format:check": "prettier --check 'lib/**/*.js' 'test/**/*.js'", + "format:fix": "prettier --write 'lib/**/*.js' 'test/**/*.js'", + "lint": "eslint 'lib/**/*.js' 'test/**/*.js'", + "test": "npm run lint && npm run format:check && if test \"$BROWSERS\" = \"1\" ; then npm run test:browser; else npm run test:node; fi", + "test:browser": "zuul test/index.js --no-coverage", + "test:node": "nyc mocha test/index.js" + }, + "version": "4.0.1" +} diff --git a/socket/node_modules/engine.io/CHANGELOG.md b/socket/node_modules/engine.io/CHANGELOG.md new file mode 100644 index 0000000..38cd9a4 --- /dev/null +++ b/socket/node_modules/engine.io/CHANGELOG.md @@ -0,0 +1,148 @@ +## [4.0.1](https://github.com/socketio/engine.io/compare/4.0.0...4.0.1) (2020-10-21) + + +### Bug Fixes + +* do not overwrite CORS headers upon error ([fe093ba](https://github.com/socketio/engine.io/commit/fe093bae1adce99e01dfdd3ce7542957785098b5)) + + + +# [4.0.0](https://github.com/socketio/engine.io/compare/v4.0.0-alpha.1...4.0.0) (2020-09-10) + +More details about this release in the blog post: https://socket.io/blog/engine-io-4-release/ + +### Bug Fixes + +* ignore errors when forcefully closing the socket ([#601](https://github.com/socketio/engine.io/issues/601)) ([dcdbccb](https://github.com/socketio/engine.io/commit/dcdbccb3dd8a7b7db057d23925356034fcd35d48)) +* remove implicit require of uws ([82cdca2](https://github.com/socketio/engine.io/commit/82cdca23bab0ed69b61b60961900d456a3065e6a)) + + +### Features + +* disable perMessageDeflate by default ([078527a](https://github.com/socketio/engine.io/commit/078527a384b70dc46d99083fa218be5d45213e51)) + +#### Links + +- Diff: [v4.0.0-alpha.1...4.0.0](https://github.com/socketio/engine.io/compare/v4.0.0-alpha.1...4.0.0) +- Full diff: [3.4.0...4.0.0](https://github.com/socketio/engine.io/compare/3.4.0...4.0.0) +- Client release: [4.0.0](https://github.com/socketio/engine.io-client/releases/tag/4.0.0) +- ws version: [^7.1.2](https://github.com/websockets/ws/releases/tag/7.1.2) + + +## [3.4.2](https://github.com/socketio/engine.io/compare/3.4.1...3.4.2) (2020-06-04) + + +### Bug Fixes + +* remove explicit require of uws ([85e544a](https://github.com/socketio/engine.io/commit/85e544afd95a5890761a613263a5eba0c9a18a93)) + +#### Links + +- Diff: [3.4.1...3.4.2](https://github.com/socketio/engine.io/compare/3.4.1...3.4.2) +- Client release: - +- ws version: [^7.1.2](https://github.com/websockets/ws/releases/tag/7.1.2) + + + +## [3.4.1](https://github.com/socketio/engine.io/compare/3.4.0...3.4.1) (2020-04-17) + + +### Bug Fixes + +* ignore errors when forcefully closing the socket ([da851ec](https://github.com/socketio/engine.io/commit/da851ec4ec89d96df2ee5c711f328b5d795423e9)) +* use SameSite=Strict by default ([001ca62](https://github.com/socketio/engine.io/commit/001ca62cc4a8f511f3b2fbd9e4493ad274a6a0e5)) + +#### Links + +- Diff: [3.4.0...3.4.1](https://github.com/socketio/engine.io/compare/3.4.0...3.4.1) +- Client release: [3.4.1](https://github.com/socketio/engine.io-client/releases/tag/3.4.1) +- ws version: [^7.1.2](https://github.com/websockets/ws/releases/tag/7.1.2) + + + +# [4.0.0-alpha.1](https://github.com/socketio/engine.io/compare/v4.0.0-alpha.0...v4.0.0-alpha.1) (2020-02-12) + +#### Links + +- Diff: [v4.0.0-alpha.0...v4.0.0-alpha.1](https://github.com/socketio/engine.io-client/compare/v4.0.0-alpha.0...v4.0.0-alpha.1) +- Client release: [v4.0.0-alpha.1](https://github.com/socketio/engine.io-client/releases/tag/v4.0.0-alpha.1) +- ws version: [^7.1.2](https://github.com/websockets/ws/releases/tag/7.1.2) + + + +# [4.0.0-alpha.0](https://github.com/socketio/engine.io/compare/3.4.0...v4.0.0-alpha.0) (2020-02-12) + + +### Features + +* decrease the default value of maxHttpBufferSize ([734f9d1](https://github.com/socketio/engine.io/commit/734f9d1268840722c41219e69eb58318e0b2ac6b)) +* disable cookie by default and add sameSite attribute ([a374471](https://github.com/socketio/engine.io/commit/a374471d06e3681a769766a1d068898182f9305f)), closes [/github.com/jshttp/cookie#options-1](https://github.com//github.com/jshttp/cookie/issues/options-1) +* generateId method can now return a Promise ([f3c291f](https://github.com/socketio/engine.io/commit/f3c291fa613a9d50c924d74293035737fdace4f2)) +* reverse the ping-pong mechanism ([31ff875](https://github.com/socketio/engine.io/commit/31ff87593f231b86dc47ec5761936439ebd53c20)) +* use the cors module to handle cross-origin requests ([61b9492](https://github.com/socketio/engine.io/commit/61b949259ed966ef6fc8bfd61f14d1a2ef06d319)) + + +### BREAKING CHANGES + +* the handlePreflightRequest option is removed by the change. + +Before: + +``` +new Server({ + handlePreflightRequest: (req, res) => { + res.writeHead(200, { + "Access-Control-Allow-Origin": 'https://example.com', + "Access-Control-Allow-Methods": 'GET', + "Access-Control-Allow-Headers": 'Authorization', + "Access-Control-Allow-Credentials": true + }); + res.end(); + } +}) +``` + +After: + +``` +new Server({ + cors: { + origin: "https://example.com", + methods: ["GET"], + allowedHeaders: ["Authorization"], + credentials: true + } +}) +``` +* the syntax has changed from + +``` +new Server({ + cookieName: "test", + cookieHttpOnly: false, + cookiePath: "/custom" +}) +``` + +to + +``` +new Server({ + cookie: { + name: "test", + httpOnly: false, + path: "/custom" + } +}) +``` + +All other options (domain, maxAge, sameSite, ...) are now supported. + +* v3.x clients will not be able to connect anymore (they will send a ping packet and timeout while waiting for a pong packet). + +#### Links + +- Diff: [3.4.0...v4.0.0-alpha.0](https://github.com/socketio/engine.io-client/compare/3.4.0...v4.0.0-alpha.0) +- Client release: [v4.0.0-alpha.0](https://github.com/socketio/engine.io-client/releases/tag/v4.0.0-alpha.0) +- ws version: [^7.1.2](https://github.com/websockets/ws/releases/tag/7.1.2) + diff --git a/socket/node_modules/engine.io/LICENSE b/socket/node_modules/engine.io/LICENSE new file mode 100644 index 0000000..6494c3c --- /dev/null +++ b/socket/node_modules/engine.io/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 Guillermo Rauch + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, +sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or +substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING +BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/socket/node_modules/engine.io/README.md b/socket/node_modules/engine.io/README.md new file mode 100644 index 0000000..97e843c --- /dev/null +++ b/socket/node_modules/engine.io/README.md @@ -0,0 +1,562 @@ + +# Engine.IO: the realtime engine + +[![Build Status](https://travis-ci.org/socketio/engine.io.svg?branch=master)](http://travis-ci.org/socketio/engine.io) +[![NPM version](https://badge.fury.io/js/engine.io.svg)](http://badge.fury.io/js/engine.io) + +`Engine.IO` is the implementation of transport-based +cross-browser/cross-device bi-directional communication layer for +[Socket.IO](http://github.com/socketio/socket.io). + +## How to use + +### Server + +#### (A) Listening on a port + +```js +const engine = require('engine.io'); +const server = engine.listen(80); + +server.on('connection', socket => { + socket.send('utf 8 string'); + socket.send(Buffer.from([0, 1, 2, 3, 4, 5])); // binary data +}); +``` + +#### (B) Intercepting requests for a http.Server + +```js +const engine = require('engine.io'); +const http = require('http').createServer().listen(3000); +const server = engine.attach(http); + +server.on('connection', socket => { + socket.on('message', data => { }); + socket.on('close', () => { }); +}); +``` + +#### (C) Passing in requests + +```js +const engine = require('engine.io'); +const server = new engine.Server(); + +server.on('connection', socket => { + socket.send('hi'); +}); + +// … +httpServer.on('upgrade', (req, socket, head) => { + server.handleUpgrade(req, socket, head); +}); + +httpServer.on('request', (req, res) => { + server.handleRequest(req, res); +}); +``` + +### Client + +```html + + +``` + +For more information on the client refer to the +[engine-client](http://github.com/socketio/engine.io-client) repository. + +## What features does it have? + +- **Maximum reliability**. Connections are established even in the presence of: + - proxies and load balancers. + - personal firewall and antivirus software. + - for more information refer to **Goals** and **Architecture** sections +- **Minimal client size** aided by: + - lazy loading of flash transports. + - lack of redundant transports. +- **Scalable** + - load balancer friendly +- **Future proof** +- **100% Node.JS core style** + - No API sugar (left for higher level projects) + - Written in readable vanilla JavaScript + +## API + +### Server + +

+ +#### Top-level + +These are exposed by `require('engine.io')`: + +##### Events + +- `flush` + - Called when a socket buffer is being flushed. + - **Arguments** + - `Socket`: socket being flushed + - `Array`: write buffer +- `drain` + - Called when a socket buffer is drained + - **Arguments** + - `Socket`: socket being flushed + +##### Properties + +- `protocol` _(Number)_: protocol revision number +- `Server`: Server class constructor +- `Socket`: Socket class constructor +- `Transport` _(Function)_: transport constructor +- `transports` _(Object)_: map of available transports + +##### Methods + +- `()` + - Returns a new `Server` instance. If the first argument is an `http.Server` then the + new `Server` instance will be attached to it. Otherwise, the arguments are passed + directly to the `Server` constructor. + - **Parameters** + - `http.Server`: optional, server to attach to. + - `Object`: optional, options object (see `Server#constructor` api docs below) + + The following are identical ways to instantiate a server and then attach it. + +```js +const httpServer; // previously created with `http.createServer();` from node.js api. + +// create a server first, and then attach +const eioServer = require('engine.io').Server(); +eioServer.attach(httpServer); + +// or call the module as a function to get `Server` +const eioServer = require('engine.io')(); +eioServer.attach(httpServer); + +// immediately attach +const eioServer = require('engine.io')(httpServer); + +// with custom options +const eioServer = require('engine.io')(httpServer, { + maxHttpBufferSize: 1e3 +}); +``` + +- `listen` + - Creates an `http.Server` which listens on the given port and attaches WS + to it. It returns `501 Not Implemented` for regular http requests. + - **Parameters** + - `Number`: port to listen on. + - `Object`: optional, options object + - `Function`: callback for `listen`. + - **Options** + - All options from `Server.attach` method, documented below. + - **Additionally** See Server `constructor` below for options you can pass for creating the new Server + - **Returns** `Server` + +```js +const engine = require('engine.io'); +const server = engine.listen(3000, { + pingTimeout: 2000, + pingInterval: 10000 +}); + +server.on('connection', /* ... */); +``` + +- `attach` + - Captures `upgrade` requests for a `http.Server`. In other words, makes + a regular http.Server WebSocket-compatible. + - **Parameters** + - `http.Server`: server to attach to. + - `Object`: optional, options object + - **Options** + - All options from `Server.attach` method, documented below. + - **Additionally** See Server `constructor` below for options you can pass for creating the new Server + - **Returns** `Server` a new Server instance. + +```js +const engine = require('engine.io'); +const httpServer = require('http').createServer().listen(3000); +const server = engine.attach(httpServer, { + wsEngine: 'uws' // requires having uws as dependency +}); + +server.on('connection', /* ... */); +``` + +#### Server + +The main server/manager. _Inherits from EventEmitter_. + +##### Events + +- `connection` + - Fired when a new connection is established. + - **Arguments** + - `Socket`: a Socket object + +##### Properties + +**Important**: if you plan to use Engine.IO in a scalable way, please +keep in mind the properties below will only reflect the clients connected +to a single process. + +- `clients` _(Object)_: hash of connected clients by id. +- `clientsCount` _(Number)_: number of connected clients. + +##### Methods + +- **constructor** + - Initializes the server + - **Parameters** + - `Object`: optional, options object + - **Options** + - `pingTimeout` (`Number`): how many ms without a pong packet to + consider the connection closed (`5000`) + - `pingInterval` (`Number`): how many ms before sending a new ping + packet (`25000`) + - `upgradeTimeout` (`Number`): how many ms before an uncompleted transport upgrade is cancelled (`10000`) + - `maxHttpBufferSize` (`Number`): how many bytes or characters a message + can be, before closing the session (to avoid DoS). Default + value is `1E6`. + - `allowRequest` (`Function`): A function that receives a given handshake + or upgrade request as its first parameter, and can decide whether to + continue or not. The second argument is a function that needs to be + called with the decided information: `fn(err, success)`, where + `success` is a boolean value where false means that the request is + rejected, and err is an error code. + - `transports` (` String`): transports to allow connections + to (`['polling', 'websocket']`) + - `allowUpgrades` (`Boolean`): whether to allow transport upgrades + (`true`) + - `perMessageDeflate` (`Object|Boolean`): parameters of the WebSocket permessage-deflate extension + (see [ws module](https://github.com/einaros/ws) api docs). Set to `true` to enable. (defaults to `false`) + - `threshold` (`Number`): data is compressed only if the byte size is above this value (`1024`) + - `httpCompression` (`Object|Boolean`): parameters of the http compression for the polling transports + (see [zlib](http://nodejs.org/api/zlib.html#zlib_options) api docs). Set to `false` to disable. (`true`) + - `threshold` (`Number`): data is compressed only if the byte size is above this value (`1024`) + - `cookie` (`Object|Boolean`): configuration of the cookie that + contains the client sid to send as part of handshake response + headers. This cookie might be used for sticky-session. Defaults to not sending any cookie (`false`). + See [here](https://github.com/jshttp/cookie#options-1) for all supported options. + - `wsEngine` (`String`): what WebSocket server implementation to use. Specified module must conform to the `ws` interface (see [ws module api docs](https://github.com/websockets/ws/blob/master/doc/ws.md)). Default value is `ws`. An alternative c++ addon is also available by installing `uws` module. + - `cors` (`Object`): the options that will be forwarded to the cors module. See [there](https://github.com/expressjs/cors#configuration-options) for all available options. Defaults to no CORS allowed. + - `initialPacket` (`Object`): an optional packet which will be concatenated to the handshake packet emitted by Engine.IO. +- `close` + - Closes all clients + - **Returns** `Server` for chaining +- `handleRequest` + - Called internally when a `Engine` request is intercepted. + - **Parameters** + - `http.IncomingMessage`: a node request object + - `http.ServerResponse`: a node response object + - **Returns** `Server` for chaining +- `handleUpgrade` + - Called internally when a `Engine` ws upgrade is intercepted. + - **Parameters** (same as `upgrade` event) + - `http.IncomingMessage`: a node request object + - `net.Stream`: TCP socket for the request + - `Buffer`: legacy tail bytes + - **Returns** `Server` for chaining +- `attach` + - Attach this Server instance to an `http.Server` + - Captures `upgrade` requests for a `http.Server`. In other words, makes + a regular http.Server WebSocket-compatible. + - **Parameters** + - `http.Server`: server to attach to. + - `Object`: optional, options object + - **Options** + - `path` (`String`): name of the path to capture (`/engine.io`). + - `destroyUpgrade` (`Boolean`): destroy unhandled upgrade requests (`true`) + - `destroyUpgradeTimeout` (`Number`): milliseconds after which unhandled requests are ended (`1000`) +- `generateId` + - Generate a socket id. + - Overwrite this method to generate your custom socket id. + - **Parameters** + - `http.IncomingMessage`: a node request object + - **Returns** A socket id for connected client. + +

+ +#### Socket + +A representation of a client. _Inherits from EventEmitter_. + +##### Events + +- `close` + - Fired when the client is disconnected. + - **Arguments** + - `String`: reason for closing + - `Object`: description object (optional) +- `message` + - Fired when the client sends a message. + - **Arguments** + - `String` or `Buffer`: Unicode string or Buffer with binary contents +- `error` + - Fired when an error occurs. + - **Arguments** + - `Error`: error object +- `flush` + - Called when the write buffer is being flushed. + - **Arguments** + - `Array`: write buffer +- `drain` + - Called when the write buffer is drained +- `packet` + - Called when a socket received a packet (`message`, `ping`) + - **Arguments** + - `type`: packet type + - `data`: packet data (if type is message) +- `packetCreate` + - Called before a socket sends a packet (`message`, `ping`) + - **Arguments** + - `type`: packet type + - `data`: packet data (if type is message) + +##### Properties + +- `id` _(String)_: unique identifier +- `server` _(Server)_: engine parent reference +- `request` _(http.IncomingMessage)_: request that originated the Socket +- `upgraded` _(Boolean)_: whether the transport has been upgraded +- `readyState` _(String)_: opening|open|closing|closed +- `transport` _(Transport)_: transport reference + +##### Methods + +- `send`: + - Sends a message, performing `message = toString(arguments[0])` unless + sending binary data, which is sent as is. + - **Parameters** + - `String` | `Buffer` | `ArrayBuffer` | `ArrayBufferView`: a string or any object implementing `toString()`, with outgoing data, or a Buffer or ArrayBuffer with binary data. Also any ArrayBufferView can be sent as is. + - `Object`: optional, options object + - `Function`: optional, a callback executed when the message gets flushed out by the transport + - **Options** + - `compress` (`Boolean`): whether to compress sending data. This option might be ignored and forced to be `true` when using polling. (`true`) + - **Returns** `Socket` for chaining +- `close` + - Disconnects the client + - **Returns** `Socket` for chaining + +### Client + +

+ +Exposed in the `eio` global namespace (in the browser), or by +`require('engine.io-client')` (in Node.JS). + +For the client API refer to the +[engine-client](http://github.com/learnboost/engine.io-client) repository. + +## Debug / logging + +Engine.IO is powered by [debug](http://github.com/visionmedia/debug). +In order to see all the debug output, run your app with the environment variable +`DEBUG` including the desired scope. + +To see the output from all of Engine.IO's debugging scopes you can use: + +``` +DEBUG=engine* node myapp +``` + +## Transports + +- `polling`: XHR / JSONP polling transport. +- `websocket`: WebSocket transport. + +## Plugins + +- [engine.io-conflation](https://github.com/EugenDueck/engine.io-conflation): Makes **conflation and aggregation** of messages straightforward. + +## Support + +The support channels for `engine.io` are the same as `socket.io`: + - irc.freenode.net **#socket.io** + - [Google Groups](http://groups.google.com/group/socket_io) + - [Website](http://socket.io) + +## Development + +To contribute patches, run tests or benchmarks, make sure to clone the +repository: + +``` +git clone git://github.com/LearnBoost/engine.io.git +``` + +Then: + +``` +cd engine.io +npm install +``` + +## Tests + +Tests run with `npm test`. It runs the server tests that are aided by +the usage of `engine.io-client`. + +Make sure `npm install` is run first. + +## Goals + +The main goal of `Engine` is ensuring the most reliable realtime communication. +Unlike the previous Socket.IO core, it always establishes a long-polling +connection first, then tries to upgrade to better transports that are "tested" on +the side. + +During the lifetime of the Socket.IO projects, we've found countless drawbacks +to relying on `HTML5 WebSocket` or `Flash Socket` as the first connection +mechanisms. + +Both are clearly the _right way_ of establishing a bidirectional communication, +with HTML5 WebSocket being the way of the future. However, to answer most business +needs, alternative traditional HTTP 1.1 mechanisms are just as good as delivering +the same solution. + +WebSocket based connections have two fundamental benefits: + +1. **Better server performance** + - _A: Load balancers_
+ Load balancing a long polling connection poses a serious architectural nightmare + since requests can come from any number of open sockets by the user agent, but + they all need to be routed to the process and computer that owns the `Engine` + connection. This negatively impacts RAM and CPU usage. + - _B: Network traffic_
+ WebSocket is designed around the premise that each message frame has to be + surrounded by the least amount of data. In HTTP 1.1 transports, each message + frame is surrounded by HTTP headers and chunked encoding frames. If you try to + send the message _"Hello world"_ with xhr-polling, the message ultimately + becomes larger than if you were to send it with WebSocket. + - _C: Lightweight parser_
+ As an effect of **B**, the server has to do a lot more work to parse the network + data and figure out the message when traditional HTTP requests are used + (as in long polling). This means that another advantage of WebSocket is + less server CPU usage. + +2. **Better user experience** + + Due to the reasons stated in point **1**, the most important effect of being able + to establish a WebSocket connection is raw data transfer speed, which translates + in _some_ cases in better user experience. + + Applications with heavy realtime interaction (such as games) will benefit greatly, + whereas applications like realtime chat (Gmail/Facebook), newsfeeds (Facebook) or + timelines (Twitter) will have negligible user experience improvements. + +Having said this, attempting to establish a WebSocket connection directly so far has +proven problematic: + +1. **Proxies**
+ Many corporate proxies block WebSocket traffic. + +2. **Personal firewall and antivirus software**
+ As a result of our research, we've found that at least 3 personal security + applications block WebSocket traffic. + +3. **Cloud application platforms**
+ Platforms like Heroku or No.de have had trouble keeping up with the fast-paced + nature of the evolution of the WebSocket protocol. Applications therefore end up + inevitably using long polling, but the seamless installation experience of + Socket.IO we strive for (_"require() it and it just works"_) disappears. + +Some of these problems have solutions. In the case of proxies and personal programs, +however, the solutions many times involve upgrading software. Experience has shown +that relying on client software upgrades to deliver a business solution is +fruitless: the very existence of this project has to do with a fragmented panorama +of user agent distribution, with clients connecting with latest versions of the most +modern user agents (Chrome, Firefox and Safari), but others with versions as low as +IE 5.5. + +From the user perspective, an unsuccessful WebSocket connection can translate in +up to at least 10 seconds of waiting for the realtime application to begin +exchanging data. This **perceptively** hurts user experience. + +To summarize, **Engine** focuses on reliability and user experience first, marginal +potential UX improvements and increased server performance second. `Engine` is the +result of all the lessons learned with WebSocket in the wild. + +## Architecture + +The main premise of `Engine`, and the core of its existence, is the ability to +swap transports on the fly. A connection starts as xhr-polling, but it can +switch to WebSocket. + +The central problem this poses is: how do we switch transports without losing +messages? + +`Engine` only switches from polling to another transport in between polling +cycles. Since the server closes the connection after a certain timeout when +there's no activity, and the polling transport implementation buffers messages +in between connections, this ensures no message loss and optimal performance. + +Another benefit of this design is that we workaround almost all the limitations +of **Flash Socket**, such as slow connection times, increased file size (we can +safely lazy load it without hurting user experience), etc. + +## FAQ + +### Can I use engine without Socket.IO ? + +Absolutely. Although the recommended framework for building realtime applications +is Socket.IO, since it provides fundamental features for real-world applications +such as multiplexing, reconnection support, etc. + +`Engine` is to Socket.IO what Connect is to Express. An essential piece for building +realtime frameworks, but something you _probably_ won't be using for building +actual applications. + +### Does the server serve the client? + +No. The main reason is that `Engine` is meant to be bundled with frameworks. +Socket.IO includes `Engine`, therefore serving two clients is not necessary. If +you use Socket.IO, including + +```html +