From d983a6f71fa6e4acb763a23c8bc75f30d44c42a4 Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Thu, 11 Dec 2025 07:39:02 +0100 Subject: [PATCH 01/17] Working on ISO standard for IDocTags Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 92 +++++++++++++++++++++++++++ 1 file changed, 92 insertions(+) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 7990f4cd..222000ab 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -49,6 +49,98 @@ DOCTAGS_VERSION: Final = "1.0.0" +class IDocTagsRootToken(str, Enum): + """Root-level document tag tokens.""" + DOCTAG = "doctag" + + +class IDocTagsSpecialToken(str, Enum): + """Special control tokens for breaks, metadata, and time.""" + PAGE_BREAK = "page_break" + TIME_BREAK = "time_break" + METADATA = "metadata" + # Geometric + LOCATION = "location" + # Temporal + HOUR = "hour" + MINUTE = "minute" + SECOND = "second" + CENTISECOND = "centisecond" + + +class IDocTagsGroupToken(str, Enum): + """Grouping tokens for sections and lists.""" + SECTION = "section" + LIST = "list" + GROUP = "group" + + +class IDocTagsSemanticToken(str, Enum): + """Semantic content tokens (headings, text, media, etc.).""" + HEADING = "heading" + TEXT = "text" + CAPTION = "caption" + FOOTNOTE = "footnote" + PAGE_HEADER = "page_header" + PAGE_FOOTER = "page_footer" + WATERMARK = "watermark" + PICTURE = "picture" + FORM = "form" + FORMULA = "formula" + CODE = "code" + LIST_ITEM = "list_item" + CHECKBOX = "checkbox" + + +class IDocTagsFormattingToken(str, Enum): + """Inline formatting tokens.""" + BOLD = "bold" + ITALIC = "italic" + STRIKETHROUGH = "strikethrough" + SUPERSCRIPT = "superscript" + SUBSCRIPT = "subscript" + RTL = "rtl" + INLINE_FORMULA = "inline_formula" + INLINE_CODE = "inline_code" + INLINE_PICTURE = "inline_picture" + BR = "br" + + +class IDocTagsContinuationToken(str, Enum): + """Continuation tokens for threading.""" + THREAD = "thread" + H_THREAD = "h_thread" + + +class IDocTagsContentToken(str, Enum): + """Content-related tokens and data carriers.""" + MARKER = "marker" + FACETS = "facets" + # Binary data tokens + BASE64 = "base64" + URI = "uri" + + +class IDocTagsStructureToken(str, Enum): + """Structural tokens for OTSL and form fields.""" + # OTSL Structural tokens + OTSL = "otsl" + FCEL = "fcel" + ECEL = "ecel" + CHED = "ched" + RHED = "rhed" + CORN = "corn" + SROW = "srow" + LCEL = "lcel" + UCEL = "ucel" + XCEL = "xcel" + NL = "nl" + # Form structural tokens + KEY = "key" + IMPLICIT_KEY = "implicit_key" + VALUE = "value" + + class IDocTagsTableToken(str, Enum): """Class to represent an LLM friendly representation of a Table.""" From 4de44f1a9949c22e4578547b30e26d0d181a84ac Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Thu, 11 Dec 2025 07:57:39 +0100 Subject: [PATCH 02/17] fixed the pre-commit, still tons of work to do Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 8 ++++++++ 1 file changed, 8 insertions(+) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 222000ab..497bd558 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -51,11 +51,13 @@ class IDocTagsRootToken(str, Enum): """Root-level document tag tokens.""" + DOCTAG = "doctag" class IDocTagsSpecialToken(str, Enum): """Special control tokens for breaks, metadata, and time.""" + PAGE_BREAK = "page_break" TIME_BREAK = "time_break" METADATA = "metadata" @@ -70,6 +72,7 @@ class IDocTagsSpecialToken(str, Enum): class IDocTagsGroupToken(str, Enum): """Grouping tokens for sections and lists.""" + SECTION = "section" LIST = "list" GROUP = "group" @@ -77,6 +80,7 @@ class IDocTagsGroupToken(str, Enum): class IDocTagsSemanticToken(str, Enum): """Semantic content tokens (headings, text, media, etc.).""" + HEADING = "heading" TEXT = "text" CAPTION = "caption" @@ -94,6 +98,7 @@ class IDocTagsSemanticToken(str, Enum): class IDocTagsFormattingToken(str, Enum): """Inline formatting tokens.""" + BOLD = "bold" ITALIC = "italic" STRIKETHROUGH = "strikethrough" @@ -108,12 +113,14 @@ class IDocTagsFormattingToken(str, Enum): class IDocTagsContinuationToken(str, Enum): """Continuation tokens for threading.""" + THREAD = "thread" H_THREAD = "h_thread" class IDocTagsContentToken(str, Enum): """Content-related tokens and data carriers.""" + MARKER = "marker" FACETS = "facets" # Binary data tokens @@ -123,6 +130,7 @@ class IDocTagsContentToken(str, Enum): class IDocTagsStructureToken(str, Enum): """Structural tokens for OTSL and form fields.""" + # OTSL Structural tokens OTSL = "otsl" FCEL = "fcel" From 6a4653df002d045b8af9906a292b9ddf639c5475 Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Thu, 11 Dec 2025 13:21:34 +0100 Subject: [PATCH 03/17] updated idoctag token class Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 477 +++++++++++++++++--------- 1 file changed, 311 insertions(+), 166 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 497bd558..e90f3106 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -1,7 +1,7 @@ """Define classes for DocTags serialization.""" from enum import Enum -from typing import Any, Final, Optional, Tuple +from typing import Any, Final, Optional from xml.dom.minidom import parseString from pydantic import BaseModel @@ -41,46 +41,130 @@ TabularChartMetaField, ) from docling_core.types.doc.labels import DocItemLabel -from docling_core.types.doc.tokens import ( - _CodeLanguageToken, - _PictureClassificationToken, -) DOCTAGS_VERSION: Final = "1.0.0" -class IDocTagsRootToken(str, Enum): - """Root-level document tag tokens.""" +class IDocTagsCategory(str, Enum): + """IDocTagsCtegory. + + DocTags defines the following categories of elements: - DOCTAG = "doctag" + - **root**: Elements that establish document scope such as `doctag` + - **special**: Elements that establish document pagination, such `page_break`, and `time_break`. + - **geometric**: Elements that capture geometric position as normalized coordinates/bounding boxes (via repeated `location`) anchoring block-level content to the page. + - **temporal**: Elements that capture temporal positions using `` for a timestamp and a double timestamp for time intervals. + - **semantic**: Block-level elements that convey document meaning (e.g., titles, paragraphs, captions, lists, forms, tables, formulas, code, pictures), optionally preceded by location tokens. + - **formatting**: Inline elements that modify textual presentation within semantic content (e.g., `bold`, `italic`, `strikethrough`, `superscript`, `subscript`, `rtl`, `inline class="formula|code|picture"`, `br`). + - **grouping**: Elements that organize semantic blocks into logical hierarchies and composites (e.g., `section`, `list`, `group type=*`) and never carry location tokens. + - **structural**: Sequence tokens that define internal structure for complex constructs (primarily OTSL table layout: `otsl`, `fcel`, `ecel`, `lcel`, `ucel`, `xcel`, `nl`, `ched`, `rhed`, `corn`, `srow`; and form parts like `key`/`value`). + - **content**: Lightweight content helpers used inside semantic blocks for explicit payload and annotations (e.g., `marker`). + - **binary data**: Elements that embed or reference non-text payloads for media—either inline as `base64` or via `uri`—allowed under `picture`, `inline class="picture"`, or at page level. + - **metadata**: Elements that provide metadata about the document or its components, contained within `head` and `meta` respectively. + - **continuation** tokens: Markers that indicate content spanning pages or table boundaries (e.g., `thread`, `h_thread`, each with a required `id` attribute) to stitch split content (e.g., across columns or pages). + """ + ROOT = "root" + SPECIAL = "special" + METADATA = "metadata" + GEOMETRIC = "geometric" + TEMPORAL = "temporal" + SEMANTIC = "semantic" + FORMATTING = "formatting" + GROUPING = "grouping" + STRUCTURAL = "structural" + CONTENT = "content" + BINARY_DATA = "binary_data" + CONTINUATION = "continuation" -class IDocTagsSpecialToken(str, Enum): - """Special control tokens for breaks, metadata, and time.""" +class IDocTagsToken(str, Enum): + """IDocTagsToken. + + This class implements the tokens from the Token table, + + | # | Category | Token | Self-Closing [Yes/No] | Parametrized [Yes/No] | Attributes | Description | + |---|----------|-------|-----------------------|-----------------------|------------|-------------| + | 1 | Root Elements | `doctag` | No | Yes | `version` | Root container; optional semantic version `version`. | + | 2 | Special Elements | `page_break` | Yes | No | — | Page delimiter. | + | 3 | | `time_break` | Yes | No | — | Temporal segment delimiter. | + | 4 | Metadata Containers | `head` | No | No | — | Document-level metadata container. | + | 5 | | `meta` | No | No | — | Component-level metadata container. | + | 6 | Geometric Tokens | `location` | Yes | Yes | `value`, `resolution?` | Geometric coordinate; `value` in [0, res]; optional `resolution`. | + | 7 | Temmporal Tokens | `hour` | Yes | Yes | `value` | Hours component; `value` in [0, 99]. | + | 8 | | `minute` | Yes | Yes | `value` | Minutes component; `value` in [0, 59]. | + | 9 | | `second` | Yes | Yes | `value` | Seconds component; `value` in [0, 59]. | + | 10 | | `centisecond` | Yes | Yes | `value` | Centiseconds component; `value` in [0, 99]. | + | 11 | Semantic Tokens | `title` | No | No | — | Document or section title (content). | + | 12 | | `heading` | No | Yes | `level` | Section header; `level` (N ≥ 1). | + | 13 | | `text` | No | No | — | Generic text content. | + | 14 | | `caption` | No | No | — | Caption for floating/grouped elements. | + | 15 | | `footnote` | No | No | — | Footnote content. | + | 16 | | `page_header` | No | No | — | Page header content. | + | 17 | | `page_footer` | No | No | — | Page footer content. | + | 18 | | `watermark` | No | No | — | Watermark indicator or content. | + | 19 | | `picture` | No | No | — | Block image/graphic; at most one of `base64`/`uri`; may include `meta` for classification; `otsl` may encode chart data. | + | 20 | | `form` | No | No | — | Form structure container. | + | 21 | | `formula` | No | No | — | Mathematical expression block. | + | 22 | | `code` | No | No | — | Code block. | + | 23 | | `list_text` | No | No | — | List item content. | + | 24 | | `checkbox` | No | Yes | `selected` | Checkbox item; optional `selected` in {`true`,`false`} defaults to `false`. | + | 25 | | `form_item` | No | No | — | Form item; exactly one `key`; one or more of `value`/`checkbox`/`marker`/`hint`. | + | 26 | | `form_heading` | No | Yes | `level?` | Form header; optional `level` (N ≥ 1). | + | 27 | | `form_text` | No | No | — | Form text block. | + | 28 | | `hint` | No | No | — | Hint for a fillable field (format/example/description). | + | 29 | Grouping Tokens | `section` | No | Yes | `level` | Document section; `level` (N ≥ 1). | + | 30 | | `list` | No | Yes | `ordered` | List container; optional `ordered` in {`true`,`false`} defaults to `false`. | + | 31 | | `group` | No | Yes | `type?` | Generic group; no `location` tokens; associates composite content (e.g., captions/footnotes). | + | 32 | | `floating_group` | No | Yes | `class` in {`table`,`picture`,`form`,`code`} | Floating container that groups a floating component with its caption, footnotes, and metadata; no `location` tokens. | + | 33 | Formatting Tokens | `bold` | No | No | — | Bold text. | + | 34 | | `italic` | No | No | — | Italic text. | + | 35 | | `strikethrough` | No | No | — | Strike-through text. | + | 36 | | `superscript` | No | No | — | Superscript text. | + | 37 | | `subscript` | No | No | — | Subscript text. | + | 38 | | `rtl` | No | No | — | Right-to-left text direction. | + | 39 | | `inline` | No | Yes | `class` in {`formula`,`code`,`picture`} | Inline content; if `class="picture"`, may include one of `base64` or `uri`. | + | 40 | | `br` | Yes | No | — | Line break. | + | 41 | Structural Tokens (OTSL) | `otsl` | No | No | — | Table structure container. | + | 42 | | `fcel` | Yes | No | — | New cell with content. | + | 43 | | `ecel` | Yes | No | — | New cell without content. | + | 44 | | `ched` | Yes | No | — | Column header cell. | + | 45 | | `rhed` | Yes | No | — | Row header cell. | + | 46 | | `corn` | Yes | No | — | Corner header cell. | + | 47 | | `srow` | Yes | No | — | Section row separator cell. | + | 48 | | `lcel` | Yes | No | — | Merge with left neighbor (horizontal span). | + | 49 | | `ucel` | Yes | No | — | Merge with upper neighbor (vertical span). | + | 50 | | `xcel` | Yes | No | — | Merge with left and upper neighbors (2D span). | + | 51 | | `nl` | Yes | No | — | New line (row separator). | + | 52 | Continuation Tokens | `thread` | Yes | Yes | `id` | Continuation marker for split content; reuse same `id` across parts. | + | 53 | | `h_thread` | Yes | Yes | `id` | Horizontal stitching marker for split tables; reuse same `id`. | + | 54 | Binary Data Tokens | `base64` | No | No | — | Embedded binary data (base64). | + | 55 | | `uri` | No | No | — | External resource reference. | + | 56 | Content Tokens | `marker` | No | No | — | List/form marker content. | + | 57 | | `facets` | No | No | — | Container for application-specific derived properties. | + | 58 | Structural Tokens (Form) | `key` | No | No | — | Form item key (child of `form_item`). | + | 59 | | `value` | No | No | — | Form item value (child of `form_item`). | + """ + + # Root and metadata + DOCUMENT = "doctag" + VERSION = "version" + HEAD = "head" + META = "meta" + + # Special PAGE_BREAK = "page_break" TIME_BREAK = "time_break" - METADATA = "metadata" - # Geometric + + # Geometric and temporal LOCATION = "location" - # Temporal HOUR = "hour" MINUTE = "minute" SECOND = "second" CENTISECOND = "centisecond" - -class IDocTagsGroupToken(str, Enum): - """Grouping tokens for sections and lists.""" - - SECTION = "section" - LIST = "list" - GROUP = "group" - - -class IDocTagsSemanticToken(str, Enum): - """Semantic content tokens (headings, text, media, etc.).""" - + # Semantic + TITLE = "title" HEADING = "heading" TEXT = "text" CAPTION = "caption" @@ -90,49 +174,37 @@ class IDocTagsSemanticToken(str, Enum): WATERMARK = "watermark" PICTURE = "picture" FORM = "form" + FORM_ITEM = "form_item" + FORM_HEADING = "form_heading" + FORM_TEXT = "form_text" + HINT = "hint" FORMULA = "formula" CODE = "code" + LIST_TEXT = "list_text" LIST_ITEM = "list_item" CHECKBOX = "checkbox" + OTSL = "otsl" # this will take care of the structure in the table. + # Grouping + SECTION = "section" + LIST = "list" + GROUP = "group" + FLOATING_GROUP = "floating_group" + ORDERED_LIST = "ordered_list" + UNORDERED_LIST = "unordered_list" -class IDocTagsFormattingToken(str, Enum): - """Inline formatting tokens.""" - + # Formatting BOLD = "bold" ITALIC = "italic" STRIKETHROUGH = "strikethrough" SUPERSCRIPT = "superscript" SUBSCRIPT = "subscript" RTL = "rtl" - INLINE_FORMULA = "inline_formula" - INLINE_CODE = "inline_code" - INLINE_PICTURE = "inline_picture" + INLINE = "inline" BR = "br" - -class IDocTagsContinuationToken(str, Enum): - """Continuation tokens for threading.""" - - THREAD = "thread" - H_THREAD = "h_thread" - - -class IDocTagsContentToken(str, Enum): - """Content-related tokens and data carriers.""" - - MARKER = "marker" - FACETS = "facets" - # Binary data tokens - BASE64 = "base64" - URI = "uri" - - -class IDocTagsStructureToken(str, Enum): - """Structural tokens for OTSL and form fields.""" - - # OTSL Structural tokens - OTSL = "otsl" + # Structural + # -- Tables FCEL = "fcel" ECEL = "ecel" CHED = "ched" @@ -143,150 +215,223 @@ class IDocTagsStructureToken(str, Enum): UCEL = "ucel" XCEL = "xcel" NL = "nl" - # Form structural tokens + # -- Forms KEY = "key" IMPLICIT_KEY = "implicit_key" VALUE = "value" + # Continuation + THREAD = "thread" + H_THREAD = "h_thread" -class IDocTagsTableToken(str, Enum): - """Class to represent an LLM friendly representation of a Table.""" - - CELL_LABEL_COLUMN_HEADER = "" - CELL_LABEL_ROW_HEADER = "" - CELL_LABEL_SECTION_HEADER = "" - CELL_LABEL_DATA = "" + # Binary data / content helpers + BASE64 = "base64" + URI = "uri" + MARKER = "marker" + FACETS = "facets" - OTSL_ECEL = "" # empty cell - OTSL_FCEL = "" # cell with content - OTSL_LCEL = "" # left looking cell, - OTSL_UCEL = "" # up looking cell, - OTSL_XCEL = "" # 2d extension cell (cross cell), - OTSL_NL = "" # new line, - OTSL_CHED = "" # - column header cell, - OTSL_RHED = "" # - row header cell, - OTSL_SROW = "" # - section row cell + # Allowed attributes per token + ALLOWED_ATTRIBUTES: dict["IDocTagsToken", set[str]] = { + LOCATION: {"value", "resolution"}, + HOUR: {"value"}, + MINUTE: {"value"}, + SECOND: {"value"}, + CENTISECOND: {"value"}, + HEADING: {"level"}, + FORM_HEADING: {"level"}, + CHECKBOX: {"selected"}, + SECTION: {"level"}, + LIST: {"ordered"}, + GROUP: {"type"}, + FLOATING_GROUP: {"class"}, + INLINE: {"class"}, + THREAD: {"id"}, + H_THREAD: {"id"}, + } + + # Allowed values for specific attributes (enumerations) + # Structure: token -> attribute name -> set of allowed string values + ALLOWED_ATTRIBUTE_VALUES: dict["IDocTagsToken", dict[str, set[str]]] = { + # Grouping and inline enumerations + LIST: {"ordered": {"true", "false"}}, + CHECKBOX: {"selected": {"true", "false"}}, + INLINE: {"class": {"formula", "code", "picture"}}, + FLOATING_GROUP: { + "class": {"document_index", "table", "picture", "form", "code"} + }, + # Other attributes (e.g., level, type, id) are not enumerated here + } + + ALLOWED_ATTRIBUTE_RANGE: dict["IDocTagsToken", dict[str, tuple[int, int]]] = { + # Geometric: value in [0, res]; resolution optional. + # Keep conservative defaults aligned with existing usage. + LOCATION: { + "value": (0, 512), + "resolution": (512, 512), + }, + # Temporal components + HOUR: {"value": (0, 99)}, + MINUTE: {"value": (0, 59)}, + SECOND: {"value": (0, 59)}, + CENTISECOND: {"value": (0, 99)}, + # Levels (N ≥ 1) + HEADING: {"level": (1, 6)}, + FORM_HEADING: {"level": (1, 6)}, + SECTION: {"level": (1, 6)}, + # Continuation markers + THREAD: {"id": (1, 10)}, + H_THREAD: {"id": (1, 10)}, + } + + # Self-closing tokens map + IS_SELFCLOSING: dict["IDocTagsToken", bool] = { + PAGE_BREAK: True, + TIME_BREAK: True, + LOCATION: True, + HOUR: True, + MINUTE: True, + SECOND: True, + CENTISECOND: True, + BR: True, + # OTSL structural tokens are emitted as self-closing markers + FCEL: True, + ECEL: True, + CHED: True, + RHED: True, + CORN: True, + SROW: True, + LCEL: True, + UCEL: True, + XCEL: True, + NL: True, + # Continuation markers + THREAD: True, + H_THREAD: True, + } @classmethod - def get_special_tokens( - cls, - ): - """Return all table-related special tokens. + def create_threading_token(cls, *, id: str, horizontal: bool = False) -> str: + """Create a continuation threading token. - Includes the opening/closing OTSL tags and each enum token value. + Emits `` or `` depending on + the `horizontal` flag. Validates required attributes against the + class schema and basic value sanity. """ - special_tokens: list[str] = ["", ""] - for token in cls: - special_tokens.append(f"{token.value}") + token = cls.H_THREAD if horizontal else cls.THREAD + # Ensure the required attribute is declared for this token + assert "id" in cls.ALLOWED_ATTRIBUTES.get(token, set()) - return special_tokens + lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[token]["id"] + if not (lo <= level <= hi): + raise ValueError(f"level must be in [{lo}, {hi}]") + return f'<{token.value} id="{id}"/>' -class IDocTagsToken(str, Enum): - """IDocTagsToken.""" + @classmethod + def create_heading_token(cls, *, level: int, closing: bool = False) -> str: + """Create a heading tag with validated level. - _LOC_PREFIX = "loc_" - _SECTION_HEADER_PREFIX = "section_header_level_" + When `closing` is False, emits an opening tag with level attribute. + When `closing` is True, emits the corresponding closing tag. + """ + lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[cls.HEADING]["level"] + if not (lo <= level <= hi): + raise ValueError(f"level must be in [{lo}, {hi}]") - DOCUMENT = "doctag" - VERSION = "version" + if closing: + return f"" + return f'<{cls.HEADING.value} level="{level}">' - OTSL = "otsl" - ORDERED_LIST = "ordered_list" - UNORDERED_LIST = "unordered_list" + @classmethod + def create_location_token(cls, *, value: int, resolution: int = 512) -> str: + """Create a location token with value and resolution. - PAGE_BREAK = "page_break" + Validates both attributes using the configured ranges and ensures + `value` lies within [0, resolution]. Always emits the resolution + attribute for explicitness. + """ + range_map = cls.ALLOWED_ATTRIBUTE_RANGE[cls.LOCATION] + # Validate resolution if a constraint exists + r_lo, r_hi = range_map.get("resolution", (resolution, resolution)) + if not (r_lo <= resolution <= r_hi): + raise ValueError(f"resolution must be in [{r_lo}, {r_hi}]") - CAPTION = "caption" - FOOTNOTE = "footnote" - FORMULA = "formula" - LIST_ITEM = "list_item" - PAGE_FOOTER = "page_footer" - PAGE_HEADER = "page_header" - PICTURE = "picture" - SECTION_HEADER = "section_header" - TABLE = "table" - TEXT = "text" - TITLE = "title" - DOCUMENT_INDEX = "document_index" - CODE = "code" - CHECKBOX_SELECTED = "checkbox_selected" - CHECKBOX_UNSELECTED = "checkbox_unselected" - FORM = "form" - EMPTY_VALUE = "empty_value" # used for empty value fields in fillable forms + v_lo, v_hi = range_map["value"] + if not (v_lo <= value <= v_hi): + raise ValueError(f"value must be in [{v_lo}, {v_hi}]") + if not (0 <= value <= resolution): + raise ValueError("value must be in [0, resolution]") + + return f'<{cls.LOCATION.value} value="{value}" resolution="{resolution}"/>' @classmethod def get_special_tokens( cls, *, - page_dimension: Tuple[int, int] = (500, 500), include_location_tokens: bool = True, - include_code_class: bool = False, - include_picture_class: bool = False, - ): - """Function to get all special document tokens.""" + include_temporal_tokens: bool = True, + ) -> list[str]: + """Return all DocTags special tokens. + + Rules: + - If a token has attributes, do not emit a bare opening tag without attributes. + - Respect `include_location_tokens` and `include_temporal_tokens` to limit + generation of location and time-related tokens. + - Emit self-closing tokens as `` when they have no attributes. + - Emit non-self-closing tokens as paired `` and `` when they + have no attributes. + """ special_tokens: list[str] = [] - for token in cls: - if not token.value.endswith("_"): - special_tokens.append(f"<{token.value}>") - special_tokens.append(f"") - - for i in range(6): - special_tokens += [ - f"<{IDocTagsToken._SECTION_HEADER_PREFIX.value}{i}>", - f"", - ] - special_tokens.extend(IDocTagsTableToken.get_special_tokens()) + temporal_tokens = {cls.HOUR, cls.MINUTE, cls.SECOND, cls.CENTISECOND} - if include_picture_class: - special_tokens.extend([t.value for t in _PictureClassificationToken]) + for token in cls: + # Optional gating for location/temporal tokens + if not include_location_tokens and token is cls.LOCATION: + continue + if not include_temporal_tokens and token in temporal_tokens: + continue - if include_code_class: - special_tokens.extend([t.value for t in _CodeLanguageToken]) + name = token.value + is_selfclosing = bool(cls.IS_SELFCLOSING.get(token, False)) + + # Attribute-aware emission + attrs = cls.ALLOWED_ATTRIBUTES.get(token, set()) + if attrs: + # Enumerated attribute values + enum_map = cls.ALLOWED_ATTRIBUTE_VALUES.get(token, {}) + for attr_name, allowed_vals in enum_map.items(): + for v in sorted(allowed_vals): + if is_selfclosing: + special_tokens.append(f'<{name} {attr_name}="{v}"/>') + else: + special_tokens.append(f'<{name} {attr_name}="{v}">') + special_tokens.append(f"") + + # Ranged attribute values (emit a conservative, complete range) + range_map = cls.ALLOWED_ATTRIBUTE_RANGE.get(token, {}) + for attr_name, (lo, hi) in range_map.items(): + # Keep the list size reasonable by skipping optional resolution enumeration + if token is cls.LOCATION and attr_name == "resolution": + continue + for v in range(lo, hi + 1): + if is_selfclosing: + special_tokens.append(f'<{name} {attr_name}="{v}"/>') + else: + special_tokens.append(f'<{name} {attr_name}="{v}">') + special_tokens.append(f"") + # Do not emit a bare tag for attribute-bearing tokens + continue - if include_location_tokens: - # Adding dynamically generated location-tokens - for i in range(0, max(page_dimension[0], page_dimension[1])): - special_tokens.append(f"<{IDocTagsToken._LOC_PREFIX.value}{i}/>") + # Tokens without attributes + if is_selfclosing: + special_tokens.append(f"<{name}/>") + else: + special_tokens.append(f"<{name}>") + special_tokens.append(f"") return special_tokens - @classmethod - def create_token_name_from_doc_item_label(cls, label: str, level: int = 1) -> str: - """Get token corresponding to passed doc item label.""" - doc_token_by_item_label = { - DocItemLabel.CAPTION: IDocTagsToken.CAPTION, - DocItemLabel.FOOTNOTE: IDocTagsToken.FOOTNOTE, - DocItemLabel.FORMULA: IDocTagsToken.FORMULA, - DocItemLabel.LIST_ITEM: IDocTagsToken.LIST_ITEM, - DocItemLabel.PAGE_FOOTER: IDocTagsToken.PAGE_FOOTER, - DocItemLabel.PAGE_HEADER: IDocTagsToken.PAGE_HEADER, - DocItemLabel.PICTURE: IDocTagsToken.PICTURE, - DocItemLabel.TABLE: IDocTagsToken.TABLE, - DocItemLabel.TEXT: IDocTagsToken.TEXT, - DocItemLabel.TITLE: IDocTagsToken.TITLE, - DocItemLabel.DOCUMENT_INDEX: IDocTagsToken.DOCUMENT_INDEX, - DocItemLabel.CODE: IDocTagsToken.CODE, - DocItemLabel.CHECKBOX_SELECTED: IDocTagsToken.CHECKBOX_SELECTED, - DocItemLabel.CHECKBOX_UNSELECTED: IDocTagsToken.CHECKBOX_UNSELECTED, - DocItemLabel.FORM: IDocTagsToken.FORM, - # Fallback mappings for labels without dedicated tokens in IDocTagsToken - DocItemLabel.KEY_VALUE_REGION: IDocTagsToken.TEXT, - DocItemLabel.PARAGRAPH: IDocTagsToken.TEXT, - DocItemLabel.REFERENCE: IDocTagsToken.TEXT, - DocItemLabel.CHART: IDocTagsToken.PICTURE, - } - - res: str - if label == DocItemLabel.SECTION_HEADER: - res = f"{IDocTagsToken._SECTION_HEADER_PREFIX}{level}" - else: - try: - res = doc_token_by_item_label[DocItemLabel(label)].value - except KeyError as e: - raise RuntimeError(f"Unexpected DocItemLabel: {label}") from e - return res class IDocTagsParams(DocTagsParams): From b7c641d2747dc116f86db8d4c03161e7f3305049 Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Thu, 11 Dec 2025 17:48:53 +0100 Subject: [PATCH 04/17] need to start fixing the bugs and add proper tests for idoctags Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 364 ++++++++++++++++++-------- 1 file changed, 251 insertions(+), 113 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index e90f3106..3f1680bb 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -1,7 +1,7 @@ """Define classes for DocTags serialization.""" from enum import Enum -from typing import Any, Final, Optional +from typing import Any, ClassVar, Final, Optional from xml.dom.minidom import parseString from pydantic import BaseModel @@ -40,7 +40,6 @@ TableData, TabularChartMetaField, ) -from docling_core.types.doc.labels import DocItemLabel DOCTAGS_VERSION: Final = "1.0.0" @@ -50,18 +49,41 @@ class IDocTagsCategory(str, Enum): DocTags defines the following categories of elements: - - **root**: Elements that establish document scope such as `doctag` - - **special**: Elements that establish document pagination, such `page_break`, and `time_break`. - - **geometric**: Elements that capture geometric position as normalized coordinates/bounding boxes (via repeated `location`) anchoring block-level content to the page. - - **temporal**: Elements that capture temporal positions using `` for a timestamp and a double timestamp for time intervals. - - **semantic**: Block-level elements that convey document meaning (e.g., titles, paragraphs, captions, lists, forms, tables, formulas, code, pictures), optionally preceded by location tokens. - - **formatting**: Inline elements that modify textual presentation within semantic content (e.g., `bold`, `italic`, `strikethrough`, `superscript`, `subscript`, `rtl`, `inline class="formula|code|picture"`, `br`). - - **grouping**: Elements that organize semantic blocks into logical hierarchies and composites (e.g., `section`, `list`, `group type=*`) and never carry location tokens. - - **structural**: Sequence tokens that define internal structure for complex constructs (primarily OTSL table layout: `otsl`, `fcel`, `ecel`, `lcel`, `ucel`, `xcel`, `nl`, `ched`, `rhed`, `corn`, `srow`; and form parts like `key`/`value`). - - **content**: Lightweight content helpers used inside semantic blocks for explicit payload and annotations (e.g., `marker`). - - **binary data**: Elements that embed or reference non-text payloads for media—either inline as `base64` or via `uri`—allowed under `picture`, `inline class="picture"`, or at page level. - - **metadata**: Elements that provide metadata about the document or its components, contained within `head` and `meta` respectively. - - **continuation** tokens: Markers that indicate content spanning pages or table boundaries (e.g., `thread`, `h_thread`, each with a required `id` attribute) to stitch split content (e.g., across columns or pages). + - **root**: Elements that establish document scope such as + `doctag`. + - **special**: Elements that establish document pagination, such as + `page_break`, and `time_break`. + - **geometric**: Elements that capture geometric position as normalized + coordinates/bounding boxes (via repeated `location`) anchoring + block-level content to the page. + - **temporal**: Elements that capture temporal positions using + `` + and `` for a timestamp and a double + timestamp for time intervals. + - **semantic**: Block-level elements that convey document meaning + (e.g., titles, paragraphs, captions, lists, forms, tables, formulas, + code, pictures), optionally preceded by location tokens. + - **formatting**: Inline elements that modify textual presentation within + semantic content (e.g., `bold`, `italic`, `strikethrough`, + `superscript`, `subscript`, `rtl`, `inline class="formula|code|picture"`, + `br`). + - **grouping**: Elements that organize semantic blocks into logical + hierarchies and composites (e.g., `section`, `list`, `group type=*`) + and never carry location tokens. + - **structural**: Sequence tokens that define internal structure for + complex constructs (primarily OTSL table layout: `otsl`, `fcel`, + `ecel`, `lcel`, `ucel`, `xcel`, `nl`, `ched`, `rhed`, `corn`, `srow`; + and form parts like `key`/`value`). + - **content**: Lightweight content helpers used inside semantic blocks for + explicit payload and annotations (e.g., `marker`). + - **binary data**: Elements that embed or reference non-text payloads for + media—either inline as `base64` or via `uri`—allowed under `picture`, + `inline class="picture"`, or at page level. + - **metadata**: Elements that provide metadata about the document or its + components, contained within `head` and `meta` respectively. + - **continuation** tokens: Markers that indicate content spanning pages or + table boundaries (e.g., `thread`, `h_thread`, each with a required + `id` attribute) to stitch split content (e.g., across columns or pages). """ ROOT = "root" @@ -90,7 +112,8 @@ class IDocTagsToken(str, Enum): | 3 | | `time_break` | Yes | No | — | Temporal segment delimiter. | | 4 | Metadata Containers | `head` | No | No | — | Document-level metadata container. | | 5 | | `meta` | No | No | — | Component-level metadata container. | - | 6 | Geometric Tokens | `location` | Yes | Yes | `value`, `resolution?` | Geometric coordinate; `value` in [0, res]; optional `resolution`. | + | 6 | Geometric Tokens | `location` | Yes | Yes | `value`, `resolution?` | + Geometric coordinate; `value` in [0, res]; optional `resolution`. | | 7 | Temmporal Tokens | `hour` | Yes | Yes | `value` | Hours component; `value` in [0, 99]. | | 8 | | `minute` | Yes | Yes | `value` | Minutes component; `value` in [0, 59]. | | 9 | | `second` | Yes | Yes | `value` | Seconds component; `value` in [0, 59]. | @@ -103,27 +126,41 @@ class IDocTagsToken(str, Enum): | 16 | | `page_header` | No | No | — | Page header content. | | 17 | | `page_footer` | No | No | — | Page footer content. | | 18 | | `watermark` | No | No | — | Watermark indicator or content. | - | 19 | | `picture` | No | No | — | Block image/graphic; at most one of `base64`/`uri`; may include `meta` for classification; `otsl` may encode chart data. | + | 19 | | `picture` | No | No | — | + Block image/graphic; at most one of `base64`/`uri`; may include `meta` + for classification; `otsl` may encode chart data. | | 20 | | `form` | No | No | — | Form structure container. | | 21 | | `formula` | No | No | — | Mathematical expression block. | | 22 | | `code` | No | No | — | Code block. | | 23 | | `list_text` | No | No | — | List item content. | - | 24 | | `checkbox` | No | Yes | `selected` | Checkbox item; optional `selected` in {`true`,`false`} defaults to `false`. | - | 25 | | `form_item` | No | No | — | Form item; exactly one `key`; one or more of `value`/`checkbox`/`marker`/`hint`. | + | 24 | | `checkbox` | No | Yes | `selected` | + Checkbox item; optional `selected` in {`true`,`false`} defaults to + `false`. | + | 25 | | `form_item` | No | No | — | + Form item; exactly one `key`; one or more of + `value`/`checkbox`/`marker`/`hint`. | | 26 | | `form_heading` | No | Yes | `level?` | Form header; optional `level` (N ≥ 1). | | 27 | | `form_text` | No | No | — | Form text block. | | 28 | | `hint` | No | No | — | Hint for a fillable field (format/example/description). | | 29 | Grouping Tokens | `section` | No | Yes | `level` | Document section; `level` (N ≥ 1). | - | 30 | | `list` | No | Yes | `ordered` | List container; optional `ordered` in {`true`,`false`} defaults to `false`. | - | 31 | | `group` | No | Yes | `type?` | Generic group; no `location` tokens; associates composite content (e.g., captions/footnotes). | - | 32 | | `floating_group` | No | Yes | `class` in {`table`,`picture`,`form`,`code`} | Floating container that groups a floating component with its caption, footnotes, and metadata; no `location` tokens. | + | 30 | | `list` | No | Yes | `ordered` | + List container; optional `ordered` in {`true`,`false`} defaults to + `false`. | + | 31 | | `group` | No | Yes | `type?` | + Generic group; no `location` tokens; associates composite content + (e.g., captions/footnotes). | + | 32 | | `floating_group` | No | Yes | `class` in {`table`,`picture`,`form`,`code`} | + Floating container that groups a floating component with its caption, + footnotes, and metadata; no `location` tokens. | | 33 | Formatting Tokens | `bold` | No | No | — | Bold text. | | 34 | | `italic` | No | No | — | Italic text. | | 35 | | `strikethrough` | No | No | — | Strike-through text. | | 36 | | `superscript` | No | No | — | Superscript text. | | 37 | | `subscript` | No | No | — | Subscript text. | | 38 | | `rtl` | No | No | — | Right-to-left text direction. | - | 39 | | `inline` | No | Yes | `class` in {`formula`,`code`,`picture`} | Inline content; if `class="picture"`, may include one of `base64` or `uri`. | + | 39 | | `inline` | No | Yes | `class` in {`formula`,`code`,`picture`} | + Inline content; if `class="picture"`, may include one of `base64` or + `uri`. | | 40 | | `br` | Yes | No | — | Line break. | | 41 | Structural Tokens (OTSL) | `otsl` | No | No | — | Table structure container. | | 42 | | `fcel` | Yes | No | — | New cell with content. | @@ -136,7 +173,8 @@ class IDocTagsToken(str, Enum): | 49 | | `ucel` | Yes | No | — | Merge with upper neighbor (vertical span). | | 50 | | `xcel` | Yes | No | — | Merge with left and upper neighbors (2D span). | | 51 | | `nl` | Yes | No | — | New line (row separator). | - | 52 | Continuation Tokens | `thread` | Yes | Yes | `id` | Continuation marker for split content; reuse same `id` across parts. | + | 52 | Continuation Tokens | `thread` | Yes | Yes | `id` | + Continuation marker for split content; reuse same `id` across parts. | | 53 | | `h_thread` | Yes | Yes | `id` | Horizontal stitching marker for split tables; reuse same `id`. | | 54 | Binary Data Tokens | `base64` | No | No | — | Embedded binary data (base64). | | 55 | | `uri` | No | No | — | External resource reference. | @@ -181,7 +219,7 @@ class IDocTagsToken(str, Enum): FORMULA = "formula" CODE = "code" LIST_TEXT = "list_text" - LIST_ITEM = "list_item" + # LIST_ITEM = "list_item" CHECKBOX = "checkbox" OTSL = "otsl" # this will take care of the structure in the table. @@ -190,8 +228,8 @@ class IDocTagsToken(str, Enum): LIST = "list" GROUP = "group" FLOATING_GROUP = "floating_group" - ORDERED_LIST = "ordered_list" - UNORDERED_LIST = "unordered_list" + # ORDERED_LIST = "ordered_list" + # UNORDERED_LIST = "unordered_list" # Formatting BOLD = "bold" @@ -230,83 +268,165 @@ class IDocTagsToken(str, Enum): MARKER = "marker" FACETS = "facets" - # Allowed attributes per token - ALLOWED_ATTRIBUTES: dict["IDocTagsToken", set[str]] = { - LOCATION: {"value", "resolution"}, - HOUR: {"value"}, - MINUTE: {"value"}, - SECOND: {"value"}, - CENTISECOND: {"value"}, - HEADING: {"level"}, - FORM_HEADING: {"level"}, - CHECKBOX: {"selected"}, - SECTION: {"level"}, - LIST: {"ordered"}, - GROUP: {"type"}, - FLOATING_GROUP: {"class"}, - INLINE: {"class"}, - THREAD: {"id"}, - H_THREAD: {"id"}, + +class IDocTagsTableToken(str, Enum): + """Serialized OTSL table tokens used in DocTags output.""" + + OTSL_ECEL = f"<{IDocTagsToken.ECEL.value}/>" # empty cell + OTSL_FCEL = f"<{IDocTagsToken.FCEL.value}/>" # cell with content + OTSL_LCEL = f"<{IDocTagsToken.LCEL.value}/>" # left looking cell, + OTSL_UCEL = f"<{IDocTagsToken.UCEL.value}/>" # up looking cell, + OTSL_XCEL = f"<{IDocTagsToken.XCEL.value}/>" # 2d extension cell (cross cell), + OTSL_NL = f"<{IDocTagsToken.NL.value}/>" # new line, + OTSL_CHED = f"<{IDocTagsToken.CHED.value}/>" # - column header cell, + OTSL_RHED = f"<{IDocTagsToken.RHED.value}/>" # - row header cell, + OTSL_SROW = f"<{IDocTagsToken.SROW.value}/>" # - section row cell + + +class IDocTagsAttributeKey(str, Enum): + """Attribute keys allowed on DocTags tokens.""" + + VERSION = "version" + VALUE = "value" + RESOLUTION = "resolution" + LEVEL = "level" + SELECTED = "selected" + ORDERED = "ordered" + TYPE = "type" + CLASS = "class" + ID = "id" + + +class IDocTagsAttributeValue(str, Enum): + """Enumerated values for specific DocTags attributes.""" + + # Generic boolean-like values + TRUE = "true" + FALSE = "false" + + # Inline class values + FORMULA = "formula" + CODE = "code" + PICTURE = "picture" + + # Floating group class values + DOCUMENT_INDEX = "document_index" + TABLE = "table" + FORM = "form" + + +class IDocTagsVocabulary(BaseModel): + """IDocTagsVocabulary.""" + + # Allowed attributes per token (defined outside the Enum to satisfy mypy) + ALLOWED_ATTRIBUTES: ClassVar[dict[IDocTagsToken, set["IDocTagsAttributeKey"]]] = { + IDocTagsToken.LOCATION: { + IDocTagsAttributeKey.VALUE, + IDocTagsAttributeKey.RESOLUTION, + }, + IDocTagsToken.HOUR: {IDocTagsAttributeKey.VALUE}, + IDocTagsToken.MINUTE: {IDocTagsAttributeKey.VALUE}, + IDocTagsToken.SECOND: {IDocTagsAttributeKey.VALUE}, + IDocTagsToken.CENTISECOND: {IDocTagsAttributeKey.VALUE}, + IDocTagsToken.HEADING: {IDocTagsAttributeKey.LEVEL}, + IDocTagsToken.FORM_HEADING: {IDocTagsAttributeKey.LEVEL}, + IDocTagsToken.CHECKBOX: {IDocTagsAttributeKey.SELECTED}, + IDocTagsToken.SECTION: {IDocTagsAttributeKey.LEVEL}, + IDocTagsToken.LIST: {IDocTagsAttributeKey.ORDERED}, + IDocTagsToken.GROUP: {IDocTagsAttributeKey.TYPE}, + IDocTagsToken.FLOATING_GROUP: {IDocTagsAttributeKey.CLASS}, + IDocTagsToken.INLINE: {IDocTagsAttributeKey.CLASS}, + IDocTagsToken.THREAD: {IDocTagsAttributeKey.ID}, + IDocTagsToken.H_THREAD: {IDocTagsAttributeKey.ID}, } # Allowed values for specific attributes (enumerations) # Structure: token -> attribute name -> set of allowed string values - ALLOWED_ATTRIBUTE_VALUES: dict["IDocTagsToken", dict[str, set[str]]] = { + ALLOWED_ATTRIBUTE_VALUES: ClassVar[ + dict[ + IDocTagsToken, + dict["IDocTagsAttributeKey", set["IDocTagsAttributeValue"]], + ] + ] = { # Grouping and inline enumerations - LIST: {"ordered": {"true", "false"}}, - CHECKBOX: {"selected": {"true", "false"}}, - INLINE: {"class": {"formula", "code", "picture"}}, - FLOATING_GROUP: { - "class": {"document_index", "table", "picture", "form", "code"} + IDocTagsToken.LIST: { + IDocTagsAttributeKey.ORDERED: { + IDocTagsAttributeValue.TRUE, + IDocTagsAttributeValue.FALSE, + } + }, + IDocTagsToken.CHECKBOX: { + IDocTagsAttributeKey.SELECTED: { + IDocTagsAttributeValue.TRUE, + IDocTagsAttributeValue.FALSE, + } + }, + IDocTagsToken.INLINE: { + IDocTagsAttributeKey.CLASS: { + IDocTagsAttributeValue.FORMULA, + IDocTagsAttributeValue.CODE, + IDocTagsAttributeValue.PICTURE, + } + }, + IDocTagsToken.FLOATING_GROUP: { + IDocTagsAttributeKey.CLASS: { + IDocTagsAttributeValue.DOCUMENT_INDEX, + IDocTagsAttributeValue.TABLE, + IDocTagsAttributeValue.PICTURE, + IDocTagsAttributeValue.FORM, + IDocTagsAttributeValue.CODE, + } }, # Other attributes (e.g., level, type, id) are not enumerated here } - ALLOWED_ATTRIBUTE_RANGE: dict["IDocTagsToken", dict[str, tuple[int, int]]] = { + ALLOWED_ATTRIBUTE_RANGE: ClassVar[ + dict[IDocTagsToken, dict["IDocTagsAttributeKey", tuple[int, int]]] + ] = { # Geometric: value in [0, res]; resolution optional. # Keep conservative defaults aligned with existing usage. - LOCATION: { - "value": (0, 512), - "resolution": (512, 512), + IDocTagsToken.LOCATION: { + IDocTagsAttributeKey.VALUE: (0, 512), + IDocTagsAttributeKey.RESOLUTION: (512, 512), }, # Temporal components - HOUR: {"value": (0, 99)}, - MINUTE: {"value": (0, 59)}, - SECOND: {"value": (0, 59)}, - CENTISECOND: {"value": (0, 99)}, + IDocTagsToken.HOUR: {IDocTagsAttributeKey.VALUE: (0, 99)}, + IDocTagsToken.MINUTE: {IDocTagsAttributeKey.VALUE: (0, 59)}, + IDocTagsToken.SECOND: {IDocTagsAttributeKey.VALUE: (0, 59)}, + IDocTagsToken.CENTISECOND: {IDocTagsAttributeKey.VALUE: (0, 99)}, # Levels (N ≥ 1) - HEADING: {"level": (1, 6)}, - FORM_HEADING: {"level": (1, 6)}, - SECTION: {"level": (1, 6)}, - # Continuation markers - THREAD: {"id": (1, 10)}, - H_THREAD: {"id": (1, 10)}, + IDocTagsToken.HEADING: {IDocTagsAttributeKey.LEVEL: (1, 6)}, + IDocTagsToken.FORM_HEADING: {IDocTagsAttributeKey.LEVEL: (1, 6)}, + IDocTagsToken.SECTION: {IDocTagsAttributeKey.LEVEL: (1, 6)}, + # Continuation markers (id length constraints) + IDocTagsToken.THREAD: {IDocTagsAttributeKey.ID: (1, 10)}, + IDocTagsToken.H_THREAD: {IDocTagsAttributeKey.ID: (1, 10)}, } # Self-closing tokens map - IS_SELFCLOSING: dict["IDocTagsToken", bool] = { - PAGE_BREAK: True, - TIME_BREAK: True, - LOCATION: True, - HOUR: True, - MINUTE: True, - SECOND: True, - CENTISECOND: True, - BR: True, + IS_SELFCLOSING: ClassVar[dict[IDocTagsToken, bool]] = { + IDocTagsToken.PAGE_BREAK: True, + IDocTagsToken.TIME_BREAK: True, + IDocTagsToken.LOCATION: True, + IDocTagsToken.HOUR: True, + IDocTagsToken.MINUTE: True, + IDocTagsToken.SECOND: True, + IDocTagsToken.CENTISECOND: True, + IDocTagsToken.BR: True, # OTSL structural tokens are emitted as self-closing markers - FCEL: True, - ECEL: True, - CHED: True, - RHED: True, - CORN: True, - SROW: True, - LCEL: True, - UCEL: True, - XCEL: True, - NL: True, + IDocTagsToken.FCEL: True, + IDocTagsToken.ECEL: True, + IDocTagsToken.CHED: True, + IDocTagsToken.RHED: True, + IDocTagsToken.CORN: True, + IDocTagsToken.SROW: True, + IDocTagsToken.LCEL: True, + IDocTagsToken.UCEL: True, + IDocTagsToken.XCEL: True, + IDocTagsToken.NL: True, # Continuation markers - THREAD: True, - H_THREAD: True, + IDocTagsToken.THREAD: True, + IDocTagsToken.H_THREAD: True, } @classmethod @@ -317,15 +437,17 @@ def create_threading_token(cls, *, id: str, horizontal: bool = False) -> str: the `horizontal` flag. Validates required attributes against the class schema and basic value sanity. """ - token = cls.H_THREAD if horizontal else cls.THREAD + token = IDocTagsToken.H_THREAD if horizontal else IDocTagsToken.THREAD # Ensure the required attribute is declared for this token - assert "id" in cls.ALLOWED_ATTRIBUTES.get(token, set()) + assert IDocTagsAttributeKey.ID in cls.ALLOWED_ATTRIBUTES.get(token, set()) - lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[token]["id"] - if not (lo <= level <= hi): - raise ValueError(f"level must be in [{lo}, {hi}]") + # Validate id length if a range is specified + lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[token][IDocTagsAttributeKey.ID] + length = len(id) + if not (lo <= length <= hi): + raise ValueError(f"id length must be in [{lo}, {hi}]") - return f'<{token.value} id="{id}"/>' + return f'<{token.value} {IDocTagsAttributeKey.ID.value}="{id}"/>' @classmethod def create_heading_token(cls, *, level: int, closing: bool = False) -> str: @@ -334,13 +456,15 @@ def create_heading_token(cls, *, level: int, closing: bool = False) -> str: When `closing` is False, emits an opening tag with level attribute. When `closing` is True, emits the corresponding closing tag. """ - lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[cls.HEADING]["level"] + lo, hi = cls.ALLOWED_ATTRIBUTE_RANGE[IDocTagsToken.HEADING][ + IDocTagsAttributeKey.LEVEL + ] if not (lo <= level <= hi): raise ValueError(f"level must be in [{lo}, {hi}]") if closing: - return f"" - return f'<{cls.HEADING.value} level="{level}">' + return f"" + return f'<{IDocTagsToken.HEADING.value} {IDocTagsAttributeKey.LEVEL.value}="{level}">' @classmethod def create_location_token(cls, *, value: int, resolution: int = 512) -> str: @@ -350,19 +474,25 @@ def create_location_token(cls, *, value: int, resolution: int = 512) -> str: `value` lies within [0, resolution]. Always emits the resolution attribute for explicitness. """ - range_map = cls.ALLOWED_ATTRIBUTE_RANGE[cls.LOCATION] + range_map = cls.ALLOWED_ATTRIBUTE_RANGE[IDocTagsToken.LOCATION] # Validate resolution if a constraint exists - r_lo, r_hi = range_map.get("resolution", (resolution, resolution)) + r_lo, r_hi = range_map.get( + IDocTagsAttributeKey.RESOLUTION, (resolution, resolution) + ) if not (r_lo <= resolution <= r_hi): raise ValueError(f"resolution must be in [{r_lo}, {r_hi}]") - v_lo, v_hi = range_map["value"] + v_lo, v_hi = range_map[IDocTagsAttributeKey.VALUE] if not (v_lo <= value <= v_hi): raise ValueError(f"value must be in [{v_lo}, {v_hi}]") if not (0 <= value <= resolution): raise ValueError("value must be in [0, resolution]") - return f'<{cls.LOCATION.value} value="{value}" resolution="{resolution}"/>' + return ( + f"<{IDocTagsToken.LOCATION.value} " + f'{IDocTagsAttributeKey.VALUE.value}="{value}" ' + f'{IDocTagsAttributeKey.RESOLUTION.value}="{resolution}"/>' + ) @classmethod def get_special_tokens( @@ -383,11 +513,16 @@ def get_special_tokens( """ special_tokens: list[str] = [] - temporal_tokens = {cls.HOUR, cls.MINUTE, cls.SECOND, cls.CENTISECOND} + temporal_tokens = { + IDocTagsToken.HOUR, + IDocTagsToken.MINUTE, + IDocTagsToken.SECOND, + IDocTagsToken.CENTISECOND, + } - for token in cls: + for token in IDocTagsToken: # Optional gating for location/temporal tokens - if not include_location_tokens and token is cls.LOCATION: + if not include_location_tokens and token is IDocTagsToken.LOCATION: continue if not include_temporal_tokens and token in temporal_tokens: continue @@ -401,24 +536,31 @@ def get_special_tokens( # Enumerated attribute values enum_map = cls.ALLOWED_ATTRIBUTE_VALUES.get(token, {}) for attr_name, allowed_vals in enum_map.items(): - for v in sorted(allowed_vals): + for v in sorted(allowed_vals, key=lambda x: x.value): if is_selfclosing: - special_tokens.append(f'<{name} {attr_name}="{v}"/>') + special_tokens.append( + f'<{name} {attr_name.value}="{v.value}"/>' + ) else: - special_tokens.append(f'<{name} {attr_name}="{v}">') + special_tokens.append( + f'<{name} {attr_name.value}="{v.value}">' + ) special_tokens.append(f"") # Ranged attribute values (emit a conservative, complete range) range_map = cls.ALLOWED_ATTRIBUTE_RANGE.get(token, {}) for attr_name, (lo, hi) in range_map.items(): # Keep the list size reasonable by skipping optional resolution enumeration - if token is cls.LOCATION and attr_name == "resolution": + if ( + token is IDocTagsToken.LOCATION + and attr_name is IDocTagsAttributeKey.RESOLUTION + ): continue - for v in range(lo, hi + 1): + for n in range(lo, hi + 1): if is_selfclosing: - special_tokens.append(f'<{name} {attr_name}="{v}"/>') + special_tokens.append(f'<{name} {attr_name.value}="{n}"/>') else: - special_tokens.append(f'<{name} {attr_name}="{v}">') + special_tokens.append(f'<{name} {attr_name.value}="{n}">') special_tokens.append(f"") # Do not emit a bare tag for attribute-bearing tokens continue @@ -433,7 +575,6 @@ def get_special_tokens( return special_tokens - class IDocTagsParams(DocTagsParams): """DocTags-specific serialization parameters.""" @@ -661,7 +802,6 @@ def serialize( """Serializes the passed item.""" params = DocTagsParams(**kwargs) res_parts: list[SerializationResult] = [] - is_chart = False if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): @@ -704,10 +844,8 @@ def serialize( text_res = "".join([r.text for r in res_parts]) if text_res: - token = IDocTagsToken.create_token_name_from_doc_item_label( - label=DocItemLabel.CHART if is_chart else DocItemLabel.PICTURE, - ) - text_res = _wrap(text=text_res, wrap_tag=token) + text_res = _wrap(text=text_res, wrap_tag=IDocTagsToken.PICTURE) + return create_ser_result(text=text_res, span_source=res_parts) From 312ebe9fa03edd7a91a7c2ff54df0cdebe2835db Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 05:43:32 +0100 Subject: [PATCH 05/17] fixed the tests Signed-off-by: Peter Staar --- test/data/doc/dummy_doc_with_meta.gt.idt.xml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/test/data/doc/dummy_doc_with_meta.gt.idt.xml b/test/data/doc/dummy_doc_with_meta.gt.idt.xml index 2d6b544b..60c5fc7c 100644 --- a/test/data/doc/dummy_doc_with_meta.gt.idt.xml +++ b/test/data/doc/dummy_doc_with_meta.gt.idt.xml @@ -11,7 +11,7 @@ DocLayNet: A Large Human-Annotated Dataset for Document-Layout Analysis - + ... Bar chart @@ -29,7 +29,7 @@ Figure 1: Four examples of complex page layouts across different document categories - + From 0e6173c585383ea6d787e6c7c13b6d74f47a672b Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 09:54:01 +0100 Subject: [PATCH 06/17] refactored the testing for dcotags and idoctags Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 279 ++++++++++++++++-- test/data/doc/ddoc_0.v0.gt.idt | 250 ++++++++++++++++ test/data/doc/ddoc_0.v1.gt.idt | 205 +++++++++++++ test/data/doc/ddoc_0.v2.gt.idt | 1 + test/data/doc/dummy_doc_with_meta.gt.idt.xml | 49 +-- test/test_serialization.py | 98 +----- ...ession.py => test_serialization_doctag.py} | 50 +++- test/test_serialization_idoctag.py | 180 +++++++++++ 8 files changed, 964 insertions(+), 148 deletions(-) create mode 100644 test/data/doc/ddoc_0.v0.gt.idt create mode 100644 test/data/doc/ddoc_0.v1.gt.idt create mode 100644 test/data/doc/ddoc_0.v2.gt.idt rename test/{test_doctags_content_suppression.py => test_serialization_doctag.py} (60%) create mode 100644 test/test_serialization_idoctag.py diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 3f1680bb..6a3388be 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -1,5 +1,6 @@ """Define classes for DocTags serialization.""" +import re from enum import Enum from typing import Any, ClassVar, Final, Optional from xml.dom.minidom import parseString @@ -16,13 +17,10 @@ SerializationResult, ) from docling_core.transforms.serializer.common import create_ser_result -from docling_core.transforms.serializer.doctags import ( +from docling_core.transforms.serializer.doctags import ( # DocTagsPictureSerializer,; DocTagsTableSerializer,; _wrap, DocTagsDocSerializer, DocTagsParams, - DocTagsPictureSerializer, - DocTagsTableSerializer, _get_delim, - _wrap, ) from docling_core.types.doc import ( BaseMeta, @@ -38,12 +36,22 @@ PictureItem, SummaryMetaField, TableData, + TableItem, TabularChartMetaField, ) DOCTAGS_VERSION: Final = "1.0.0" +def _wrap(text: str, wrap_tag: str) -> str: + return f"<{wrap_tag}>{text}" + + +def _wrap_token(*, text: str, open_token: str) -> str: + close_token = IDocTagsVocabulary.create_closing_token(token=open_token) + return f"{open_token}{text}{close_token}" + + class IDocTagsCategory(str, Enum): """IDocTagsCtegory. @@ -186,7 +194,6 @@ class IDocTagsToken(str, Enum): # Root and metadata DOCUMENT = "doctag" - VERSION = "version" HEAD = "head" META = "meta" @@ -320,6 +327,9 @@ class IDocTagsVocabulary(BaseModel): # Allowed attributes per token (defined outside the Enum to satisfy mypy) ALLOWED_ATTRIBUTES: ClassVar[dict[IDocTagsToken, set["IDocTagsAttributeKey"]]] = { + IDocTagsToken.DOCUMENT: { + IDocTagsAttributeKey.VERSION, + }, IDocTagsToken.LOCATION: { IDocTagsAttributeKey.VALUE, IDocTagsAttributeKey.RESOLUTION, @@ -429,6 +439,70 @@ class IDocTagsVocabulary(BaseModel): IDocTagsToken.H_THREAD: True, } + @classmethod + def create_closing_token(cls, *, token: str) -> str: + r"""Create a closing tag from an opening tag string. + + Example: "" -> "" + Validates the tag and ensures it is not self-closing. + If `token` is already a valid closing tag, it is returned unchanged. + """ + if not isinstance(token, str) or not token.strip(): + raise ValueError("token must be a non-empty string") + + s = token.strip() + + # Already a closing tag: validate and return as-is + if s.startswith("$", s) + if not m_close: + raise ValueError("invalid closing tag format") + name = m_close.group(1) + try: + IDocTagsToken(name) + except ValueError: + raise ValueError(f"unknown token '{name}'") + return s + + # Extract tag name from an opening tag while dropping attributes + m = re.match(r"^<\s*([a-zA-Z_][\w\-]*)\b[^>]*?(/?)\s*>$", s) + if not m: + raise ValueError("invalid opening tag format") + + name, trailing_slash = m.group(1), m.group(2) + + # Validate the tag name against known tokens + try: + tok_enum = IDocTagsToken(name) + except ValueError: + raise ValueError(f"unknown token '{name}'") + + # Disallow explicit self-closing markup or inherently self-closing tokens + if trailing_slash == "/": + raise ValueError(f"token '{name}' is self-closing; no closing tag") + if cls.IS_SELFCLOSING.get(tok_enum, False): + raise ValueError(f"token '{name}' is self-closing; no closing tag") + + return f"" + + @classmethod + def create_doctag_root( + cls, *, version: str = DOCTAGS_VERSION, closing: bool = False + ) -> str: + """Create the document root tag. + + - When `closing` is True, returns the closing root tag. + - When a `version` is provided, includes it as an attribute. + - Otherwise returns a bare opening root tag. + """ + if closing: + return f"" + elif version: + return f'<{IDocTagsToken.DOCUMENT.value} {IDocTagsAttributeKey.VERSION.value}="{version}">' + else: + # Version attribute is optional; emit bare root tag when not provided + return f"<{IDocTagsToken.DOCUMENT.value}>" + @classmethod def create_threading_token(cls, *, id: str, horizontal: bool = False) -> str: """Create a continuation threading token. @@ -449,6 +523,40 @@ class schema and basic value sanity. return f'<{token.value} {IDocTagsAttributeKey.ID.value}="{id}"/>' + @classmethod + def create_floating_group_token( + cls, *, value: IDocTagsAttributeValue, closing: bool = False + ) -> str: + """Create a floating group tag. + + - When `closing` is True, returns the closing tag. + - Otherwise returns an opening tag with a class attribute derived from `value`. + """ + if closing: + return f"" + else: + return f'<{IDocTagsToken.FLOATING_GROUP.value} {IDocTagsAttributeKey.CLASS.value}="{value.value}">' + + @classmethod + def create_list_token(cls, *, ordered: bool, closing: bool = False) -> str: + """Create a list tag. + + - When `closing` is True, returns the closing tag. + - Otherwise returns an opening tag with an `ordered` boolean attribute. + """ + if closing: + return f"" + elif ordered: + return ( + f"<{IDocTagsToken.LIST.value} " + f'{IDocTagsAttributeKey.ORDERED.value}="{IDocTagsAttributeValue.TRUE.value}">' + ) + else: + return ( + f"<{IDocTagsToken.LIST.value} " + f'{IDocTagsAttributeKey.ORDERED.value}="{IDocTagsAttributeValue.FALSE.value}">' + ) + @classmethod def create_heading_token(cls, *, level: int, closing: bool = False) -> str: """Create a heading tag with validated level. @@ -580,6 +688,12 @@ class IDocTagsParams(DocTagsParams): do_self_closing: bool = True pretty_indentation: Optional[str] = 2 * " " + # When True, convert any self-closing form of non-self-closing tokens + # (e.g., ) into expanded pairs () + # after pretty-printing. This prevents XML pretty-printers from + # collapsing empty elements that must not be self-closing according + # to the IDocTags vocabulary. + preserve_empty_non_selfclosing: bool = True class IDocTagsListSerializer(BaseModel, BaseListSerializer): @@ -622,8 +736,8 @@ def serialize( params = IDocTagsParams(**kwargs) # Build list children explicitly. Requirements: - # 1) / can be children of lists. - # 2) Do NOT wrap nested lists into , even if they are + # 1) can be children of lists. + # 2) Do NOT wrap nested lists into , even if they are # children of a ListItem in the logical structure. # 3) Still ensure structural wrappers are preserved even when # content is suppressed (e.g., add_content=False). @@ -669,15 +783,15 @@ def serialize( **kwargs, ) item_results.append(child_res) - # Wrap the content into , without any nested list content. + # Wrap the content into , without any nested list content. child_text_wrapped = _wrap( text=f"{child_res.text}", - wrap_tag=IDocTagsToken.LIST_ITEM.value, + wrap_tag=IDocTagsToken.LIST_TEXT.value, ) child_results_wrapped.append(child_text_wrapped) - # After the , append any nested lists (children of this ListItem) - # as siblings at the same level (not wrapped in ). + # After the , append any nested lists (children of this ListItem) + # as siblings at the same level (not wrapped in ). for subref in child.children: sub = subref.resolve(doc) if ( @@ -701,12 +815,12 @@ def serialize( if child_results_wrapped: text_res = delim.join(child_results_wrapped) text_res = f"{text_res}{delim}" - wrap_tag = ( - IDocTagsToken.ORDERED_LIST.value + open_token = ( + IDocTagsVocabulary.create_list_token(ordered=True) if item.first_item_is_enumerated(doc) - else IDocTagsToken.UNORDERED_LIST.value + else IDocTagsVocabulary.create_list_token(ordered=False) ) - text_res = _wrap(text=text_res, wrap_tag=wrap_tag) + text_res = _wrap_token(text=text_res, open_token=open_token) else: text_res = "" return create_ser_result(text=text_res, span_source=item_results) @@ -787,7 +901,7 @@ def _serialize_meta_field(self, meta: BaseMeta, name: str) -> Optional[str]: return None -class IDocTagsPictureSerializer(DocTagsPictureSerializer): +class IDocTagsPictureSerializer(BasePictureSerializer): """DocTags-specific picture item serializer.""" @override @@ -800,9 +914,22 @@ def serialize( **kwargs: Any, ) -> SerializationResult: """Serializes the passed item.""" - params = DocTagsParams(**kwargs) + params = IDocTagsParams(**kwargs) + + open_token: str = IDocTagsVocabulary.create_floating_group_token( + value=IDocTagsAttributeValue.PICTURE + ) + close_token: str = IDocTagsVocabulary.create_floating_group_token( + value=IDocTagsAttributeValue.PICTURE, closing=True + ) + res_parts: list[SerializationResult] = [] + if params.add_caption: + cap_res = doc_serializer.serialize_captions(item=item, **kwargs) + if cap_res.text: + res_parts.append(cap_res) + if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): if item.meta: @@ -837,31 +964,104 @@ def serialize( body += otsl_content res_parts.append(create_ser_result(text=body, span_source=item)) - if params.add_caption: - cap_res = doc_serializer.serialize_captions(item=item, **kwargs) - if cap_res.text: - res_parts.append(cap_res) - text_res = "".join([r.text for r in res_parts]) if text_res: - text_res = _wrap(text=text_res, wrap_tag=IDocTagsToken.PICTURE) + text_res = ( + open_token + + _wrap(text=text_res, wrap_tag=IDocTagsToken.PICTURE.value) + + close_token + ) return create_ser_result(text=text_res, span_source=res_parts) -class IDocTagsTableSerializer(DocTagsTableSerializer): +class IDocTagsTableSerializer(BaseTableSerializer): """DocTags-specific table item serializer.""" def _get_table_token(self) -> Any: return IDocTagsTableToken + @override + def serialize( + self, + *, + item: TableItem, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + visited: Optional[set[str]] = None, + **kwargs: Any, + ) -> SerializationResult: + """Serializes the passed item.""" + params = IDocTagsParams(**kwargs) + + # FIXME: we might need to check the label to distinguish between TABLE and DOCUMENT_INDEX label + open_token: str = IDocTagsVocabulary.create_floating_group_token( + value=IDocTagsAttributeValue.TABLE + ) + close_token: str = IDocTagsVocabulary.create_floating_group_token( + value=IDocTagsAttributeValue.TABLE, closing=True + ) + + res_parts: list[SerializationResult] = [] + + if params.add_caption: + cap_res = doc_serializer.serialize_captions(item=item, **kwargs) + if cap_res.text: + res_parts.append(cap_res) + + if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): + + if params.add_location: + loc_text = item.get_location_tokens( + doc=doc, + xsize=params.xsize, + ysize=params.ysize, + self_closing=params.do_self_closing, + ) + res_parts.append(create_ser_result(text=loc_text, span_source=item)) + + otsl_text = item.export_to_otsl( + doc=doc, + add_cell_location=params.add_table_cell_location, + # Suppress cell text when global content is disabled + add_cell_text=(params.add_table_cell_text and params.add_content), + xsize=params.xsize, + ysize=params.ysize, + visited=visited, + table_token=self._get_table_token(), + ) + res_parts.append(create_ser_result(text=otsl_text, span_source=item)) + + text_res = "".join([r.text for r in res_parts]) + if text_res: + text_res = ( + open_token + + _wrap(text=text_res, wrap_tag=IDocTagsToken.OTSL.value) + + close_token + ) + + return create_ser_result(text=text_res, span_source=res_parts) + class IDocTagsDocSerializer(DocTagsDocSerializer): """DocTags document serializer.""" + # text_serializer: BaseTextSerializer = DocTagsTextSerializer() + table_serializer: BaseTableSerializer = IDocTagsTableSerializer() picture_serializer: BasePictureSerializer = IDocTagsPictureSerializer() + # key_value_serializer: BaseKeyValueSerializer = DocTagsKeyValueSerializer() + # form_serializer: BaseFormSerializer = DocTagsFormSerializer() + # fallback_serializer: BaseFallbackSerializer = DocTagsFallbackSerializer() + + list_serializer: BaseListSerializer = IDocTagsListSerializer() + # inline_serializer: BaseInlineSerializer = DocTagsInlineSerializer() + + # annotation_serializer: BaseAnnotationSerializer = DocTagsAnnotationSerializer() + + # picture_serializer: BasePictureSerializer = IDocTagsPictureSerializer() meta_serializer: BaseMetaSerializer = IDocTagsMetaSerializer() - table_serializer: BaseTableSerializer = IDocTagsTableSerializer() + # table_serializer: BaseTableSerializer = IDocTagsTableSerializer() + params: IDocTagsParams = IDocTagsParams() @override @@ -877,6 +1077,10 @@ def serialize_doc( ) -> SerializationResult: """DocTags-specific document serializer.""" delim = _get_delim(params=self.params) + + open_token: str = IDocTagsVocabulary.create_doctag_root() + close_token: str = IDocTagsVocabulary.create_doctag_root(closing=True) + text_res = delim.join([p.text for p in parts if p.text]) if self.params.add_page_break: @@ -884,19 +1088,42 @@ def serialize_doc( for full_match, _, _ in self._get_page_breaks(text=text_res): text_res = text_res.replace(full_match, page_sep) + """ tmp = f"<{IDocTagsToken.DOCUMENT.value}>" tmp += f"<{IDocTagsToken.VERSION.value}>{DOCTAGS_VERSION}" tmp += f"{text_res}" tmp += f"" + """ - text_res = tmp + text_res = f"{open_token}{text_res}{close_token}" if self.params.pretty_indentation and ( my_root := parseString(text_res).documentElement ): + # Pretty-print using minidom. This may collapse empty elements + # into self-closing tags. We optionally expand back non-self-closing + # tokens to preserve the IDocTags contract. text_res = my_root.toprettyxml(indent=self.params.pretty_indentation) text_res = "\n".join( [line for line in text_res.split("\n") if line.strip()] ) + if self.params.preserve_empty_non_selfclosing: + # Expand self-closing forms for tokens that are not allowed + # to be self-closing according to the vocabulary. + # Example: -> + non_selfclosing = [ + tok + for tok in IDocTagsToken + if not IDocTagsVocabulary.IS_SELFCLOSING.get(tok, False) + ] + + def _expand_tag(text: str, name: str) -> str: + # Match or + pattern = rf"<\s*{name}(\s[^>]*)?/\s*>" + return re.sub(pattern, rf"<{name}\1>", text) + + for tok in non_selfclosing: + text_res = _expand_tag(text_res, tok.value) + return create_ser_result(text=text_res, span_source=parts) diff --git a/test/data/doc/ddoc_0.v0.gt.idt b/test/data/doc/ddoc_0.v0.gt.idt new file mode 100644 index 00000000..92d55617 --- /dev/null +++ b/test/data/doc/ddoc_0.v0.gt.idt @@ -0,0 +1,250 @@ + + + + + + + ndbinfo_select_all - Select From ndbinfo Tables + + + + + + + + + Default Value + + 1 + + + Minimum Value + + 0 + + + Maximum Value + + MAX_INT + + + + + + + + + This option sets the number of times to execute the select. Use --delay to set the time between loops. + + + + + + + + • --ndb-connectstring + + + + + + + + + + Command-Line Format + + --ndb-connectstring=connection-string + + + Type + + String + + + Default Value + + [none] + + + + + + + + + Set connect string for connecting to ndb_mgmd. Syntax: "[nodeid=id;][host=]hostname[:port]". Overrides entries in NDB_CONNECTSTRING and my.cnf. + + + + + + + + • --ndb-mgmd-host + + + + + + + + + + Command-Line Format + + --ndb-mgmd-host=connection-string + + + Type + + String + + + Default Value + + [none] + + + + + + + + + Same as --ndb-connectstring . + + + + + + + + • --ndb-nodeid + + + + + + + + + + Command-Line Format + + --ndb-nodeid=# + + + Type + + Integer + + + Default Value + + [none] + + + + + + + + + Set node ID for this node, overriding any ID set by --ndb-connectstring. + + + + + + + + • --ndb-optimized-node-selection + + + + + + + + + + Command-Line Format + + --ndb-optimized-node-selection + + + + + + + + + Enable optimizations for selection of nodes for transactions. Enabled by default; use --skip-ndb- optimized-node-selection to disable. + + + + + + + + • --no-defaults + + + + + + + + + + Command-Line Format + + --no-defaults + + + + + + + + + Do not read default options from any option file other than login file. + + + + + + + + • --print-defaults + + + + + + + + + + Command-Line Format + + --print-defaults + + + + + + + + + Print program argument list and exit. + + + + + + + 4253 + + diff --git a/test/data/doc/ddoc_0.v1.gt.idt b/test/data/doc/ddoc_0.v1.gt.idt new file mode 100644 index 00000000..280232f6 --- /dev/null +++ b/test/data/doc/ddoc_0.v1.gt.idt @@ -0,0 +1,205 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/test/data/doc/ddoc_0.v2.gt.idt b/test/data/doc/ddoc_0.v2.gt.idt new file mode 100644 index 00000000..c4bddde7 --- /dev/null +++ b/test/data/doc/ddoc_0.v2.gt.idt @@ -0,0 +1 @@ + diff --git a/test/data/doc/dummy_doc_with_meta.gt.idt.xml b/test/data/doc/dummy_doc_with_meta.gt.idt.xml index 60c5fc7c..6a41b774 100644 --- a/test/data/doc/dummy_doc_with_meta.gt.idt.xml +++ b/test/data/doc/dummy_doc_with_meta.gt.idt.xml @@ -1,5 +1,4 @@ - - 1.0.0 + <meta> <summary>This is a title.</summary> @@ -11,29 +10,33 @@ <loc_46/> DocLayNet: A Large Human-Annotated Dataset for Document-Layout Analysis - - - ... - Bar chart - CC1=NNC(C2=CN3C=CN=C3C(CC3=CC(F)=CC(F)=C3)=N2)=N1 - {'myanalysis': {'prediction': 'abc'}, 'something_else': {'text': 'aaa'}} - - - - - - + + + + + + + + Figure 1: Four examples of complex page layouts across different document categories + + + ... + Bar chart + CC1=NNC(C2=CN3C=CN=C3C(CC3=CC(F)=CC(F)=C3)=N2)=N1 + {'myanalysis': {'prediction': 'abc'}, 'something_else': {'text': 'aaa'}} + + + + + + + + + - Figure 1: Four examples of complex page layouts across different document categories - - - - - - - - + + diff --git a/test/test_serialization.py b/test/test_serialization.py index a783c410..e211d3ac 100644 --- a/test/test_serialization.py +++ b/test/test_serialization.py @@ -4,12 +4,7 @@ import pytest -from docling_core.experimental.idoctags import IDocTagsDocSerializer, IDocTagsParams from docling_core.transforms.serializer.common import _DEFAULT_LABELS -from docling_core.transforms.serializer.doctags import ( - DocTagsDocSerializer, - DocTagsParams, -) from docling_core.transforms.serializer.html import ( HTMLDocSerializer, HTMLOutputStyle, @@ -51,7 +46,7 @@ def _normalize_quotes(s: str) -> str: expected = _normalize_quotes(expected) actual = _normalize_quotes(actual) - assert expected == actual + assert actual == expected # =============================== @@ -559,94 +554,3 @@ def test_html_inline_and_formatting(): ser = HTMLDocSerializer(doc=doc) actual = ser.serialize().text verify(exp_file=src.with_suffix(".gt.html"), actual=actual) - - -# =============================== -# DocTags tests -# =============================== - - -def test_doctags_inline_loc_tags(): - src = Path("./test/data/doc/2408.09869v3_enriched.json") - doc = DoclingDocument.load_from_json(src) - - ser = DocTagsDocSerializer(doc=doc) - actual = ser.serialize().text - verify(exp_file=src.with_suffix(".out.dt"), actual=actual) - - -def test_doctags_rich_table(rich_table_doc): - exp_file = Path("./test/data/doc/rich_table.out.dt") - - ser = DocTagsDocSerializer(doc=rich_table_doc) - actual = ser.serialize().text - verify(exp_file=exp_file, actual=actual) - - -def test_doctags_inline_and_formatting(): - src = Path("./test/data/doc/inline_and_formatting.yaml") - doc = DoclingDocument.load_from_yaml(src) - - ser = DocTagsDocSerializer(doc=doc) - actual = ser.serialize().text - verify(exp_file=src.with_suffix(".gt.dt"), actual=actual) - - -def test_doctags_meta(): - src = Path("./test/data/doc/dummy_doc_with_meta.yaml") - doc = DoclingDocument.load_from_yaml(src) - - ser = DocTagsDocSerializer(doc=doc) - actual = ser.serialize().text - verify(exp_file=src.with_suffix(".gt.dt"), actual=actual) - - -# =============================== -# IDocTags tests -# =============================== - - -def test_idoctags(): - src = Path("./test/data/doc/ddoc_0.json") - doc = DoclingDocument.load_from_json(src) - - if True: - # Human readable, indented and with content - params = IDocTagsParams() - params.add_content = True - - ser = IDocTagsDocSerializer(doc=doc, params=params) - actual = ser.serialize().text - - verify(exp_file=src.with_suffix(".v0.gt.dt"), actual=actual) - - if True: - # Human readable, indented but without content - params = IDocTagsParams() - params.add_content = False - - ser = IDocTagsDocSerializer(doc=doc, params=params) - actual = ser.serialize().text - - verify(exp_file=src.with_suffix(".v1.gt.dt"), actual=actual) - - if True: - # Machine readable, not indented and without content - params = IDocTagsParams() - params.pretty_indentation = "" - params.add_content = False - params.mode = DocTagsParams.Mode.MINIFIED - - ser = IDocTagsDocSerializer(doc=doc, params=params) - actual = ser.serialize().text - - verify(exp_file=src.with_suffix(".v2.gt.dt"), actual=actual) - - -def test_idoctags_meta(): - src = Path("./test/data/doc/dummy_doc_with_meta.yaml") - doc = DoclingDocument.load_from_yaml(src) - - ser = IDocTagsDocSerializer(doc=doc) - actual = ser.serialize().text - verify(exp_file=src.with_suffix(".gt.idt.xml"), actual=actual) diff --git a/test/test_doctags_content_suppression.py b/test/test_serialization_doctag.py similarity index 60% rename from test/test_doctags_content_suppression.py rename to test/test_serialization_doctag.py index 1a6cf4b2..45d0c983 100644 --- a/test/test_doctags_content_suppression.py +++ b/test/test_serialization_doctag.py @@ -1,10 +1,21 @@ +"""Test serialization.""" + +from pathlib import Path + from docling_core.transforms.serializer.doctags import ( DocTagsDocSerializer, DocTagsParams, ) +from docling_core.types.doc import DoclingDocument from docling_core.types.doc.document import DoclingDocument, TableData from docling_core.types.doc.labels import DocItemLabel +from .test_serialization import verify + +# =============================== +# DocTags tests +# =============================== + def serialize_doctags(doc: DoclingDocument, **param_overrides) -> str: params = DocTagsParams(**param_overrides) @@ -53,10 +64,10 @@ def test_list_items_not_double_wrapped_when_no_content(): doc.add_list_item("Item B", parent=lst) txt = serialize_doctags(doc, add_content=True) - print(f"txt with content:\n{txt}") + # print(f"txt with content:\n{txt}") txt = serialize_doctags(doc, add_content=False) - print(f"txt without content:\n{txt}") + # print(f"txt without content:\n{txt}") # No nested assert "" not in txt @@ -64,3 +75,38 @@ def test_list_items_not_double_wrapped_when_no_content(): # Should still have exactly two opening list_item wrappers (for the two items) # Note: other occurrences could appear in location tokens etc., so be conservative assert txt.count("") >= 2 + + +def test_doctags_inline_loc_tags(): + src = Path("./test/data/doc/2408.09869v3_enriched.json") + doc = DoclingDocument.load_from_json(src) + + ser = DocTagsDocSerializer(doc=doc) + actual = ser.serialize().text + verify(exp_file=src.with_suffix(".out.dt"), actual=actual) + + +def test_doctags_rich_table(rich_table_doc): + exp_file = Path("./test/data/doc/rich_table.out.dt") + + ser = DocTagsDocSerializer(doc=rich_table_doc) + actual = ser.serialize().text + verify(exp_file=exp_file, actual=actual) + + +def test_doctags_inline_and_formatting(): + src = Path("./test/data/doc/inline_and_formatting.yaml") + doc = DoclingDocument.load_from_yaml(src) + + ser = DocTagsDocSerializer(doc=doc) + actual = ser.serialize().text + verify(exp_file=src.with_suffix(".gt.dt"), actual=actual) + + +def test_doctags_meta(): + src = Path("./test/data/doc/dummy_doc_with_meta.yaml") + doc = DoclingDocument.load_from_yaml(src) + + ser = DocTagsDocSerializer(doc=doc) + actual = ser.serialize().text + verify(exp_file=src.with_suffix(".gt.dt"), actual=actual) diff --git a/test/test_serialization_idoctag.py b/test/test_serialization_idoctag.py new file mode 100644 index 00000000..b5776e8e --- /dev/null +++ b/test/test_serialization_idoctag.py @@ -0,0 +1,180 @@ +"""Unit tests for IDocTags create_closing_token helper.""" + +from pathlib import Path + +import pytest + +from docling_core.experimental.idoctags import ( + IDocTagsDocSerializer, + IDocTagsParams, + IDocTagsVocabulary, +) +from docling_core.transforms.serializer.doctags import DocTagsParams +from docling_core.types.doc import DocItemLabel, DoclingDocument, TableData + +from .test_serialization import verify + +# =============================== +# IDocTags unit-tests +# =============================== + + +def test_create_closing_token_from_opening_tag_simple(): + assert IDocTagsVocabulary.create_closing_token(token="") == "" + assert ( + IDocTagsVocabulary.create_closing_token(token='\n ') + == "" + ) + assert ( + IDocTagsVocabulary.create_closing_token(token=' ') + == "" + ) + # Inline with attribute + assert ( + IDocTagsVocabulary.create_closing_token(token=' ') + == "" + ) + + +def test_create_closing_token_returns_existing_closing(): + assert IDocTagsVocabulary.create_closing_token(token="") == "" + + +@pytest.mark.parametrize( + "bad", + [ + "
", + '', + '', + '', + ], +) +def test_create_closing_token_rejects_self_closing(bad): + with pytest.raises(ValueError): + IDocTagsVocabulary.create_closing_token(token=bad) + + +@pytest.mark.parametrize( + "bad", + [ + "text", # not a tag + "", # self-closing form of non-self-closing token + "", # malformed closing + "", # unknown token + ], +) +def test_create_closing_token_invalid_inputs(bad): + with pytest.raises(ValueError): + IDocTagsVocabulary.create_closing_token(token=bad) + + +# =============================== +# IDocTags tests +# =============================== + + +def serialize_idoctags(doc: DoclingDocument, **param_overrides) -> str: + params = IDocTagsParams(**param_overrides) + ser = IDocTagsDocSerializer(doc=doc, params=params) + return ser.serialize().text + + +def test_no_content_suppresses_caption_and_table_cell_text(): + doc = DoclingDocument(name="t") + + # Add a caption text item + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Table Caption Text") + + # Build a 2x2 table with header row and data row + td = TableData(num_rows=0, num_cols=2) + td.add_row(["H1", "H2"]) # header + td.add_row(["C1", "C2"]) # data + doc.add_table(data=td, caption=cap) + + txt = serialize_idoctags(doc, add_content=False) + + # Caption text suppressed + assert "Table Caption Text" not in txt + + # No table cell text + for cell_text in ["H1", "H2", "C1", "C2"]: + assert cell_text not in txt + + # OTSL structural tokens should remain + assert "" in txt and "" in txt + + +def test_no_content_suppresses_figure_caption_text(): + doc = DoclingDocument(name="t") + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Figure Caption Text") + doc.add_picture(caption=cap) + + txt = serialize_idoctags(doc, add_content=False) + assert "Figure Caption Text" not in txt + + +def test_list_items_not_double_wrapped_when_no_content(): + doc = DoclingDocument(name="t") + lst = doc.add_list_group() + doc.add_list_item("Item A", parent=lst) + doc.add_list_item("Item B", parent=lst) + + txt = serialize_idoctags(doc, add_content=True) + # print(f"txt with content:\n{txt}") + + txt = serialize_idoctags(doc, add_content=False) + # print(f"txt without content:\n{txt}") + + # No nested + assert "" not in txt + + # Should still have exactly two opening list_text wrappers (for the two items) + # Note: other occurrences could appear in location tokens etc., so be conservative + assert txt.count("") >= 2 + + +def test_idoctags(): + src = Path("./test/data/doc/ddoc_0.json") + doc = DoclingDocument.load_from_json(src) + + if True: + # Human readable, indented and with content + params = IDocTagsParams() + params.add_content = True + + ser = IDocTagsDocSerializer(doc=doc, params=params) + actual = ser.serialize().text + + verify(exp_file=src.with_suffix(".v0.gt.idt"), actual=actual) + + if True: + # Human readable, indented but without content + params = IDocTagsParams() + params.add_content = False + + ser = IDocTagsDocSerializer(doc=doc, params=params) + actual = ser.serialize().text + + verify(exp_file=src.with_suffix(".v1.gt.idt"), actual=actual) + + if True: + # Machine readable, not indented and without content + params = IDocTagsParams() + params.pretty_indentation = "" + params.add_content = False + params.mode = DocTagsParams.Mode.MINIFIED + + ser = IDocTagsDocSerializer(doc=doc, params=params) + actual = ser.serialize().text + + verify(exp_file=src.with_suffix(".v2.gt.idt"), actual=actual) + + +def test_idoctags_meta(): + src = Path("./test/data/doc/dummy_doc_with_meta.yaml") + doc = DoclingDocument.load_from_yaml(src) + + ser = IDocTagsDocSerializer(doc=doc) + actual = ser.serialize().text + verify(exp_file=src.with_suffix(".gt.idt.xml"), actual=actual) From 607441e48138d73019a0715851eded5c45e56e8f Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 10:43:33 +0100 Subject: [PATCH 07/17] updating the location tokens in idoctags Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 201 +++++++++++++++++-- test/data/doc/ddoc_0.v0.gt.idt | 176 ++++++++-------- test/data/doc/ddoc_0.v1.gt.idt | 176 ++++++++-------- test/data/doc/ddoc_0.v2.gt.idt | 2 +- test/data/doc/dummy_doc_with_meta.gt.idt.xml | 32 +-- 5 files changed, 381 insertions(+), 206 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 6a3388be..07e61663 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -14,6 +14,7 @@ BaseMetaSerializer, BasePictureSerializer, BaseTableSerializer, + BaseTextSerializer, SerializationResult, ) from docling_core.transforms.serializer.common import create_ser_result @@ -24,9 +25,12 @@ ) from docling_core.types.doc import ( BaseMeta, + CodeItem, DescriptionMetaField, DocItem, DoclingDocument, + FloatingItem, + InlineGroup, ListGroup, ListItem, MetaFieldName, @@ -34,11 +38,14 @@ NodeItem, PictureClassificationMetaField, PictureItem, + SectionHeaderItem, SummaryMetaField, TableData, TableItem, TabularChartMetaField, + TextItem, ) +from docling_core.types.doc.tokens import DocumentToken DOCTAGS_VERSION: Final = "1.0.0" @@ -52,6 +59,61 @@ def _wrap_token(*, text: str, open_token: str) -> str: return f"{open_token}{text}{close_token}" +def _quantize_to_resolution(value: float, resolution: int) -> int: + """Quantize normalized value in [0,1] to [0,resolution].""" + n = int(round(resolution * value)) + if n < 0: + return 0 + if n > resolution: + return resolution + return n + + +def _create_location_tokens_for_bbox( + *, + bbox: tuple[float, float, float, float], + page_w: float, + page_h: float, + xres: int, + yres: int, +) -> str: + """Create four `` tokens for x0,y0,x1,y1 given a bbox.""" + x0 = bbox[0] / page_w + y0 = bbox[1] / page_h + x1 = bbox[2] / page_w + y1 = bbox[3] / page_h + + x0v = _quantize_to_resolution(min(x0, x1), xres) + y0v = _quantize_to_resolution(min(y0, y1), yres) + x1v = _quantize_to_resolution(max(x0, x1), xres) + y1v = _quantize_to_resolution(max(y0, y1), yres) + + return ( + IDocTagsVocabulary.create_location_token(value=x0v, resolution=xres) + + IDocTagsVocabulary.create_location_token(value=y0v, resolution=yres) + + IDocTagsVocabulary.create_location_token(value=x1v, resolution=xres) + + IDocTagsVocabulary.create_location_token(value=y1v, resolution=yres) + ) + + +def _create_location_tokens_for_item( + *, item: "DocItem", doc: "DoclingDocument", xres: int = 512, yres: int = 512 +) -> str: + """Create concatenated `` tokens for an item's provenance.""" + if not getattr(item, "prov", None): + return "" + out: list[str] = [] + for prov in item.prov: + page_w, page_h = doc.pages[prov.page_no].size.as_tuple() + bbox = prov.bbox.to_top_left_origin(page_h).as_tuple() + out.append( + _create_location_tokens_for_bbox( + bbox=bbox, page_w=page_w, page_h=page_h, xres=xres, yres=yres + ) + ) + return "".join(out) + + class IDocTagsCategory(str, Enum): """IDocTagsCtegory. @@ -826,6 +888,101 @@ def serialize( return create_ser_result(text=text_res, span_source=item_results) +class IDocTagsTextSerializer(BaseModel, BaseTextSerializer): + """IDocTags-specific text item serializer using `` tokens.""" + + @override + def serialize( + self, + *, + item: "TextItem", + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + visited: Optional[set[str]] = None, + **kwargs: Any, + ) -> SerializationResult: + """Serialize a ``TextItem`` into IDocTags markup. + + Depending on parameters, emits meta blocks, location tokens, and the + item's textual content (prefixing code language for ``CodeItem``). For + floating items, captions may be appended. The result can be wrapped in a + tag derived from the item's label when applicable. + + Args: + item: The text-like item to serialize. + doc_serializer: The document-level serializer for delegating nested items. + doc: The document used to resolve references and children. + visited: Set of already visited item refs to avoid cycles. + **kwargs: Additional serializer parameters forwarded to ``IDocTagsParams``. + + Returns: + A ``SerializationResult`` with the serialized text and span source. + """ + my_visited = visited if visited is not None else set() + params = IDocTagsParams(**kwargs) + + wrap_tag_token: Optional[str] = ( + DocumentToken.create_token_name_from_doc_item_label( + label=item.label, + **( + {"level": item.level} if isinstance(item, SectionHeaderItem) else {} + ), + ) + ) + wrap_tag: Optional[str] = None if isinstance(item, ListItem) else wrap_tag_token + parts: list[str] = [] + + if item.meta: + meta_res = doc_serializer.serialize_meta(item=item, **kwargs) + if meta_res.text: + parts.append(meta_res.text) + + if params.add_location: + # Use IDocTags `` tokens instead of `` + loc = _create_location_tokens_for_item(item=item, doc=doc) + if loc: + parts.append(loc) + + if params.add_content: + if ( + item.text == "" + and len(item.children) == 1 + and isinstance( + (child_group := item.children[0].resolve(doc)), InlineGroup + ) + ): + ser_res = doc_serializer.serialize(item=child_group, visited=my_visited) + text_part = ser_res.text + else: + text_part = doc_serializer.post_process( + text=item.text, + formatting=item.formatting, + hyperlink=item.hyperlink, + ) + + if isinstance(item, CodeItem): + language_token = DocumentToken.get_code_language_token( + code_language=item.code_language, + self_closing=params.do_self_closing, + ) + text_part = f"{language_token}{text_part}" + else: + text_part = text_part.strip() + + if text_part: + parts.append(text_part) + + if params.add_caption and isinstance(item, FloatingItem): + cap_text = doc_serializer.serialize_captions(item=item, **kwargs).text + if cap_text: + parts.append(cap_text) + + text_res = "".join(parts) + if wrap_tag is not None: + text_res = _wrap(text=text_res, wrap_tag=wrap_tag) + return create_ser_result(text=text_res, span_source=item) + + class IDocTagsMetaSerializer(BaseModel, BaseMetaSerializer): """DocTags-specific meta serializer.""" @@ -939,12 +1096,7 @@ def serialize( body = "" if params.add_location: - body += item.get_location_tokens( - doc=doc, - xsize=params.xsize, - ysize=params.ysize, - self_closing=params.do_self_closing, - ) + body += _create_location_tokens_for_item(item=item, doc=doc) # handle tabular chart data chart_data: Optional[TableData] = None @@ -1012,12 +1164,7 @@ def serialize( if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): if params.add_location: - loc_text = item.get_location_tokens( - doc=doc, - xsize=params.xsize, - ysize=params.ysize, - self_closing=params.do_self_closing, - ) + loc_text = _create_location_tokens_for_item(item=item, doc=doc) res_parts.append(create_ser_result(text=loc_text, span_source=item)) otsl_text = item.export_to_otsl( @@ -1046,7 +1193,7 @@ def serialize( class IDocTagsDocSerializer(DocTagsDocSerializer): """DocTags document serializer.""" - # text_serializer: BaseTextSerializer = DocTagsTextSerializer() + text_serializer: BaseTextSerializer = IDocTagsTextSerializer() table_serializer: BaseTableSerializer = IDocTagsTableSerializer() picture_serializer: BasePictureSerializer = IDocTagsPictureSerializer() # key_value_serializer: BaseKeyValueSerializer = DocTagsKeyValueSerializer() @@ -1068,6 +1215,34 @@ class IDocTagsDocSerializer(DocTagsDocSerializer): def _meta_is_wrapped(self) -> bool: return True + @override + def serialize_captions( + self, + item: FloatingItem, + **kwargs: Any, + ) -> SerializationResult: + """Serialize the item's captions with IDocTags location tokens.""" + params = IDocTagsParams(**kwargs) + results: list[SerializationResult] = [] + if item.captions: + cap_res = super(DocTagsDocSerializer, self).serialize_captions( + item, **kwargs + ) + if cap_res.text and params.add_location: + for caption in item.captions: + if caption.cref not in self.get_excluded_refs(**kwargs): + if isinstance(cap := caption.resolve(self.doc), DocItem): + loc_txt = _create_location_tokens_for_item( + item=cap, doc=self.doc + ) + results.append(create_ser_result(text=loc_txt)) + if cap_res.text and params.add_content: + results.append(cap_res) + text_res = "".join([r.text for r in results]) + if text_res: + text_res = _wrap(text=text_res, wrap_tag=DocumentToken.CAPTION.value) + return create_ser_result(text=text_res, span_source=results) + @override def serialize_doc( self, diff --git a/test/data/doc/ddoc_0.v0.gt.idt b/test/data/doc/ddoc_0.v0.gt.idt index 92d55617..ba2dc6d6 100644 --- a/test/data/doc/ddoc_0.v0.gt.idt +++ b/test/data/doc/ddoc_0.v0.gt.idt @@ -1,17 +1,17 @@ - - - - + + + + ndbinfo_select_all - Select From ndbinfo Tables - - - - + + + + Default Value @@ -30,27 +30,27 @@ - - - - + + + + This option sets the number of times to execute the select. Use --delay to set the time between loops. - - - - + + + + • --ndb-connectstring - - - - + + + + Command-Line Format @@ -69,27 +69,27 @@ - - - - + + + + Set connect string for connecting to ndb_mgmd. Syntax: "[nodeid=id;][host=]hostname[:port]". Overrides entries in NDB_CONNECTSTRING and my.cnf. - - - - + + + + • --ndb-mgmd-host - - - - + + + + Command-Line Format @@ -108,27 +108,27 @@ - - - - + + + + Same as --ndb-connectstring . - - - - + + + + • --ndb-nodeid - - - - + + + + Command-Line Format @@ -147,27 +147,27 @@ - - - - + + + + Set node ID for this node, overriding any ID set by --ndb-connectstring. - - - - + + + + • --ndb-optimized-node-selection - - - - + + + + Command-Line Format @@ -176,27 +176,27 @@ - - - - + + + + Enable optimizations for selection of nodes for transactions. Enabled by default; use --skip-ndb- optimized-node-selection to disable. - - - - + + + + • --no-defaults - - - - + + + + Command-Line Format @@ -205,27 +205,27 @@ - - - - + + + + Do not read default options from any option file other than login file. - - - - + + + + • --print-defaults - - - - + + + + Command-Line Format @@ -234,17 +234,17 @@ - - - - + + + + Print program argument list and exit. - - - - + + + + 4253 diff --git a/test/data/doc/ddoc_0.v1.gt.idt b/test/data/doc/ddoc_0.v1.gt.idt index 280232f6..e7832056 100644 --- a/test/data/doc/ddoc_0.v1.gt.idt +++ b/test/data/doc/ddoc_0.v1.gt.idt @@ -1,16 +1,16 @@ - - - - + + + + - - - - + + + + @@ -23,25 +23,25 @@ - - - - + + + + - - - - + + + + - - - - + + + + @@ -54,25 +54,25 @@ - - - - + + + + - - - - + + + + - - - - + + + + @@ -85,25 +85,25 @@ - - - - + + + + - - - - + + + + - - - - + + + + @@ -116,90 +116,90 @@ - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + - - - - + + + + diff --git a/test/data/doc/ddoc_0.v2.gt.idt b/test/data/doc/ddoc_0.v2.gt.idt index c4bddde7..753602fa 100644 --- a/test/data/doc/ddoc_0.v2.gt.idt +++ b/test/data/doc/ddoc_0.v2.gt.idt @@ -1 +1 @@ - + diff --git a/test/data/doc/dummy_doc_with_meta.gt.idt.xml b/test/data/doc/dummy_doc_with_meta.gt.idt.xml index 6a41b774..525f7222 100644 --- a/test/data/doc/dummy_doc_with_meta.gt.idt.xml +++ b/test/data/doc/dummy_doc_with_meta.gt.idt.xml @@ -4,19 +4,19 @@ This is a title. More stuff here. - - - - + + + + DocLayNet: A Large Human-Annotated Dataset for Document-Layout Analysis - - - - + + + + Figure 1: Four examples of complex page layouts across different document categories @@ -25,18 +25,18 @@ CC1=NNC(C2=CN3C=CN=C3C(CC3=CC(F)=CC(F)=C3)=N2)=N1 {'myanalysis': {'prediction': 'abc'}, 'something_else': {'text': 'aaa'}} - - - - + + + + - - - - + + + + From 77e9914de0565f19d69c143b77443cd34b9d5feb Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 11:07:08 +0100 Subject: [PATCH 08/17] removed the DocumentToken Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 58 ++++++++++++++++++--------- 1 file changed, 39 insertions(+), 19 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 07e61663..3b470cee 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -18,7 +18,7 @@ SerializationResult, ) from docling_core.transforms.serializer.common import create_ser_result -from docling_core.transforms.serializer.doctags import ( # DocTagsPictureSerializer,; DocTagsTableSerializer,; _wrap, +from docling_core.transforms.serializer.doctags import ( DocTagsDocSerializer, DocTagsParams, _get_delim, @@ -45,9 +45,12 @@ TabularChartMetaField, TextItem, ) -from docling_core.types.doc.tokens import DocumentToken + +# Note: Intentionally avoid importing DocumentToken here to ensure +# IDocTags uses only its own token vocabulary. DOCTAGS_VERSION: Final = "1.0.0" +DOCTAGS_RESOLUTION: int = 512 def _wrap(text: str, wrap_tag: str) -> str: @@ -921,15 +924,25 @@ def serialize( my_visited = visited if visited is not None else set() params = IDocTagsParams(**kwargs) - wrap_tag_token: Optional[str] = ( - DocumentToken.create_token_name_from_doc_item_label( - label=item.label, - **( - {"level": item.level} if isinstance(item, SectionHeaderItem) else {} - ), - ) - ) - wrap_tag: Optional[str] = None if isinstance(item, ListItem) else wrap_tag_token + # Determine wrapper open-token for this item using IDocTags vocabulary. + # - ListItem: do not wrap here (list serializer wraps children as ). + # - SectionHeaderItem: use ... . + # - Other text-like items: require a valid IDocTagsToken from the item's label. + # If the label is not a known IDocTags token, raise for explicitness. + wrap_open_token: Optional[str] + if isinstance(item, ListItem): + wrap_open_token = None + elif isinstance(item, SectionHeaderItem): + wrap_open_token = IDocTagsVocabulary.create_heading_token(level=item.level) + else: + label_value = str(item.label) + try: + tok = IDocTagsToken(label_value) + except ValueError: + raise ValueError( + f"Unsupported IDocTags token for label '{label_value}'" + ) + wrap_open_token = f"<{tok.value}>" parts: list[str] = [] if item.meta: @@ -960,12 +973,19 @@ def serialize( hyperlink=item.hyperlink, ) + # For code blocks, preserve language using a lightweight facets marker + # e.g., language=python before the code content. if isinstance(item, CodeItem): - language_token = DocumentToken.get_code_language_token( - code_language=item.code_language, - self_closing=params.do_self_closing, - ) - text_part = f"{language_token}{text_part}" + lang = getattr(item.code_language, "value", str(item.code_language)) + if lang: + parts.append( + _wrap( + text=f"language={lang.lower()}", + wrap_tag=IDocTagsToken.FACETS.value, + ) + ) + # Keep the textual code content as-is + text_part = text_part else: text_part = text_part.strip() @@ -978,8 +998,8 @@ def serialize( parts.append(cap_text) text_res = "".join(parts) - if wrap_tag is not None: - text_res = _wrap(text=text_res, wrap_tag=wrap_tag) + if wrap_open_token is not None: + text_res = _wrap_token(text=text_res, open_token=wrap_open_token) return create_ser_result(text=text_res, span_source=item) @@ -1240,7 +1260,7 @@ def serialize_captions( results.append(cap_res) text_res = "".join([r.text for r in results]) if text_res: - text_res = _wrap(text=text_res, wrap_tag=DocumentToken.CAPTION.value) + text_res = _wrap(text=text_res, wrap_tag=IDocTagsToken.CAPTION.value) return create_ser_result(text=text_res, span_source=results) @override From 98ed500755baa55cdfb29a4e6a4078e562a9860e Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 11:31:00 +0100 Subject: [PATCH 09/17] fixed the idt quot issue Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 42 +++++++++++++-------------- test/test_serialization.py | 4 ++- 2 files changed, 24 insertions(+), 22 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 3b470cee..6dc20154 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -782,8 +782,9 @@ def serialize( This emits list containers (````/````) and serializes children explicitly. Nested ``ListGroup`` items are emitted as - siblings without an enclosing ```` wrapper, while structural - wrappers are still preserved even when content is suppressed. + siblings, and individual list items are not wrapped here. The text + serializer is responsible for wrapping list item content (as + ````), so this serializer remains agnostic of item types. Args: item: The list group to serialize. @@ -807,7 +808,7 @@ def serialize( # 3) Still ensure structural wrappers are preserved even when # content is suppressed (e.g., add_content=False). item_results: list[SerializationResult] = [] - child_results_wrapped: list[str] = [] + child_texts: list[str] = [] excluded = doc_serializer.get_excluded_refs(**kwargs) for child_ref in item.children: @@ -827,7 +828,7 @@ def serialize( **kwargs, ) if sub_res.text: - child_results_wrapped.append(sub_res.text) + child_texts.append(sub_res.text) item_results.append(sub_res) continue @@ -839,7 +840,8 @@ def serialize( my_visited.add(child.self_ref) - # Serialize the list item content (DocTagsTextSerializer will not wrap it) + # Serialize the list item content; wrapping is handled by the text + # serializer (as ), not here. child_res = doc_serializer.serialize( item=child, list_level=list_level + 1, @@ -848,12 +850,8 @@ def serialize( **kwargs, ) item_results.append(child_res) - # Wrap the content into , without any nested list content. - child_text_wrapped = _wrap( - text=f"{child_res.text}", - wrap_tag=IDocTagsToken.LIST_TEXT.value, - ) - child_results_wrapped.append(child_text_wrapped) + if child_res.text: + child_texts.append(child_res.text) # After the , append any nested lists (children of this ListItem) # as siblings at the same level (not wrapped in ). @@ -873,12 +871,12 @@ def serialize( **kwargs, ) if sub_res.text: - child_results_wrapped.append(sub_res.text) + child_texts.append(sub_res.text) item_results.append(sub_res) delim = _get_delim(params=params) - if child_results_wrapped: - text_res = delim.join(child_results_wrapped) + if child_texts: + text_res = delim.join(child_texts) text_res = f"{text_res}{delim}" open_token = ( IDocTagsVocabulary.create_list_token(ordered=True) @@ -925,24 +923,26 @@ def serialize( params = IDocTagsParams(**kwargs) # Determine wrapper open-token for this item using IDocTags vocabulary. - # - ListItem: do not wrap here (list serializer wraps children as ). # - SectionHeaderItem: use ... . - # - Other text-like items: require a valid IDocTagsToken from the item's label. - # If the label is not a known IDocTags token, raise for explicitness. + # - Other text-like items: map the label to an IDocTagsToken; for + # list items, this maps to and keeps the text serializer + # free of type-based special casing. wrap_open_token: Optional[str] - if isinstance(item, ListItem): - wrap_open_token = None - elif isinstance(item, SectionHeaderItem): + if isinstance(item, SectionHeaderItem): wrap_open_token = IDocTagsVocabulary.create_heading_token(level=item.level) + elif isinstance(item, ListItem): + tok = IDocTagsToken.LIST_TEXT + wrap_open_token = f"<{tok.value}>" else: label_value = str(item.label) try: tok = IDocTagsToken(label_value) + wrap_open_token = f"<{tok.value}>" except ValueError: raise ValueError( f"Unsupported IDocTags token for label '{label_value}'" ) - wrap_open_token = f"<{tok.value}>" + parts: list[str] = [] if item.meta: diff --git a/test/test_serialization.py b/test/test_serialization.py index e211d3ac..e687f842 100644 --- a/test/test_serialization.py +++ b/test/test_serialization.py @@ -38,7 +38,9 @@ def verify(exp_file: Path, actual: str): # Normalize platform-dependent quote escaping for DocTags outputs name = exp_file.name - if name.endswith(".dt") or name.endswith(".idt.xml"): + if name.endswith(".dt") or \ + name.endswith(".idt") or \ + name.endswith(".idt.xml"): def _normalize_quotes(s: str) -> str: return s.replace(""", '"').replace(""", '"') From bac016aa2bacc9dfbd979ea590c434400e584fbd Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 11:35:07 +0100 Subject: [PATCH 10/17] reformatted Signed-off-by: Peter Staar --- test/test_serialization.py | 4 +--- 1 file changed, 1 insertion(+), 3 deletions(-) diff --git a/test/test_serialization.py b/test/test_serialization.py index e687f842..dd629130 100644 --- a/test/test_serialization.py +++ b/test/test_serialization.py @@ -38,9 +38,7 @@ def verify(exp_file: Path, actual: str): # Normalize platform-dependent quote escaping for DocTags outputs name = exp_file.name - if name.endswith(".dt") or \ - name.endswith(".idt") or \ - name.endswith(".idt.xml"): + if name.endswith(".dt") or name.endswith(".idt") or name.endswith(".idt.xml"): def _normalize_quotes(s: str) -> str: return s.replace(""", '"').replace(""", '"') From 95b92198820f16f7324284fc02141421097e329f Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 13:25:03 +0100 Subject: [PATCH 11/17] Added IDocTagsSerializationMode Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 210 ++++++++++++++++++++++---- test/test_serialization_idoctag.py | 4 +- 2 files changed, 186 insertions(+), 28 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 6dc20154..b877ff1d 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -9,7 +9,12 @@ from typing_extensions import override from docling_core.transforms.serializer.base import ( + BaseAnnotationSerializer, BaseDocSerializer, + BaseFallbackSerializer, + BaseFormSerializer, + BaseInlineSerializer, + BaseKeyValueSerializer, BaseListSerializer, BaseMetaSerializer, BasePictureSerializer, @@ -17,11 +22,10 @@ BaseTextSerializer, SerializationResult, ) -from docling_core.transforms.serializer.common import create_ser_result -from docling_core.transforms.serializer.doctags import ( - DocTagsDocSerializer, - DocTagsParams, - _get_delim, +from docling_core.transforms.serializer.common import ( + CommonParams, + DocSerializer, + create_ser_result, ) from docling_core.types.doc import ( BaseMeta, @@ -30,7 +34,9 @@ DocItem, DoclingDocument, FloatingItem, + FormItem, InlineGroup, + KeyValueItem, ListGroup, ListItem, MetaFieldName, @@ -748,19 +754,44 @@ def get_special_tokens( return special_tokens -class IDocTagsParams(DocTagsParams): - """DocTags-specific serialization parameters.""" +class IDocTagsSerializationMode(str, Enum): + """Serialization mode for IDocTags output.""" + HUMAN_FRIENDLY = "human_friendly" + LLM_FRIENDLY = "llm_friendly" + + +class IDocTagsParams(CommonParams): + """IDocTags-specific serialization parameters independent of DocTags.""" + + # Geometry & content controls (aligned with DocTags defaults) + xsize: int = 500 + ysize: int = 500 + add_location: bool = True + add_caption: bool = True + add_content: bool = True + add_table_cell_location: bool = False + add_table_cell_text: bool = True + add_page_break: bool = True + + mode: IDocTagsSerializationMode = IDocTagsSerializationMode.HUMAN_FRIENDLY + + # IDocTags formatting do_self_closing: bool = True pretty_indentation: Optional[str] = 2 * " " - # When True, convert any self-closing form of non-self-closing tokens - # (e.g., ) into expanded pairs () - # after pretty-printing. This prevents XML pretty-printers from - # collapsing empty elements that must not be self-closing according - # to the IDocTags vocabulary. + # Expand self-closing forms of non-self-closing tokens after pretty-printing preserve_empty_non_selfclosing: bool = True +def _get_delim(*, params: IDocTagsParams) -> str: + """Return record delimiter based on IDocTagsSerializationMode.""" + if params.mode == IDocTagsSerializationMode.HUMAN_FRIENDLY: + return "\n" + if params.mode == IDocTagsSerializationMode.LLM_FRIENDLY: + return "" + raise RuntimeError(f"Unknown IDocTags mode: {params.mode}") + + class IDocTagsListSerializer(BaseModel, BaseListSerializer): """DocTags-specific list serializer.""" @@ -1210,24 +1241,148 @@ def serialize( return create_ser_result(text=text_res, span_source=res_parts) -class IDocTagsDocSerializer(DocTagsDocSerializer): - """DocTags document serializer.""" +class IDocTagsInlineSerializer(BaseInlineSerializer): + """Inline serializer emitting IDocTags `` and `` tokens.""" + + @override + def serialize( + self, + *, + item: InlineGroup, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + list_level: int = 0, + visited: Optional[set[str]] = None, + **kwargs: Any, + ) -> SerializationResult: + """Serialize inline content with optional location into IDocTags text.""" + my_visited = visited if visited is not None else set() + params = IDocTagsParams(**kwargs) + parts: list[SerializationResult] = [] + if params.add_location: + # Create a single enclosing bbox over inline children + boxes: list[tuple[float, float, float, float]] = [] + prov_page_w_h: Optional[tuple[float, float, int]] = None + for it, _ in doc.iterate_items(root=item): + if isinstance(it, DocItem) and it.prov: + for prov in it.prov: + page_w, page_h = doc.pages[prov.page_no].size.as_tuple() + boxes.append(prov.bbox.to_top_left_origin(page_h).as_tuple()) + prov_page_w_h = (page_w, page_h, prov.page_no) + if boxes and prov_page_w_h is not None: + x0 = min(b[0] for b in boxes) + y0 = min(b[1] for b in boxes) + x1 = max(b[2] for b in boxes) + y1 = max(b[3] for b in boxes) + page_w, page_h, _ = prov_page_w_h + loc_str = _create_location_tokens_for_bbox( + bbox=(x0, y0, x1, y1), + page_w=page_w, + page_h=page_h, + xres=params.xsize, + yres=params.ysize, + ) + parts.append(create_ser_result(text=loc_str)) + params.add_location = False + parts.extend( + doc_serializer.get_parts( + item=item, + list_level=list_level, + is_inline_scope=True, + visited=my_visited, + **{**kwargs, **params.model_dump()}, + ) + ) + delim = _get_delim(params=params) + text_res = delim.join([p.text for p in parts if p.text]) + if text_res: + text_res = f"{text_res}{delim}" + text_res = _wrap(text=text_res, wrap_tag=IDocTagsToken.INLINE.value) + return create_ser_result(text=text_res, span_source=parts) + + +class IDocTagsFallbackSerializer(BaseFallbackSerializer): + """Fallback serializer concatenating text for list/inline groups.""" + + @override + def serialize( + self, + *, + item: NodeItem, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + **kwargs: Any, + ) -> SerializationResult: + """Serialize unsupported nodes by concatenating their textual parts.""" + if isinstance(item, (ListGroup, InlineGroup)): + parts = doc_serializer.get_parts(item=item, **kwargs) + text_res = "\n".join([p.text for p in parts if p.text]) + return create_ser_result(text=text_res, span_source=parts) + return create_ser_result() + + +class IDocTagsKeyValueSerializer(BaseKeyValueSerializer): + """No-op serializer for key/value items in IDocTags.""" + + @override + def serialize( + self, + *, + item: KeyValueItem, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + **kwargs: Any, + ) -> SerializationResult: + """Return an empty result for key/value items.""" + return create_ser_result() + + +class IDocTagsFormSerializer(BaseFormSerializer): + """No-op serializer for form items in IDocTags.""" + + @override + def serialize( + self, + *, + item: FormItem, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + **kwargs: Any, + ) -> SerializationResult: + """Return an empty result for form items.""" + return create_ser_result() + + +class IDocTagsAnnotationSerializer(BaseAnnotationSerializer): + """No-op annotation serializer; IDocTags relies on meta instead.""" + + @override + def serialize( + self, + *, + item: DocItem, + doc: DoclingDocument, + **kwargs: Any, + ) -> SerializationResult: + """Return an empty result; annotations are handled via meta.""" + return create_ser_result() + + +class IDocTagsDocSerializer(DocSerializer): + """IDocTags document serializer.""" text_serializer: BaseTextSerializer = IDocTagsTextSerializer() table_serializer: BaseTableSerializer = IDocTagsTableSerializer() picture_serializer: BasePictureSerializer = IDocTagsPictureSerializer() - # key_value_serializer: BaseKeyValueSerializer = DocTagsKeyValueSerializer() - # form_serializer: BaseFormSerializer = DocTagsFormSerializer() - # fallback_serializer: BaseFallbackSerializer = DocTagsFallbackSerializer() + key_value_serializer: BaseKeyValueSerializer = IDocTagsKeyValueSerializer() + form_serializer: BaseFormSerializer = IDocTagsFormSerializer() + fallback_serializer: BaseFallbackSerializer = IDocTagsFallbackSerializer() list_serializer: BaseListSerializer = IDocTagsListSerializer() - # inline_serializer: BaseInlineSerializer = DocTagsInlineSerializer() - - # annotation_serializer: BaseAnnotationSerializer = DocTagsAnnotationSerializer() + inline_serializer: BaseInlineSerializer = IDocTagsInlineSerializer() - # picture_serializer: BasePictureSerializer = IDocTagsPictureSerializer() meta_serializer: BaseMetaSerializer = IDocTagsMetaSerializer() - # table_serializer: BaseTableSerializer = IDocTagsTableSerializer() + annotation_serializer: BaseAnnotationSerializer = IDocTagsAnnotationSerializer() params: IDocTagsParams = IDocTagsParams() @@ -1245,9 +1400,7 @@ def serialize_captions( params = IDocTagsParams(**kwargs) results: list[SerializationResult] = [] if item.captions: - cap_res = super(DocTagsDocSerializer, self).serialize_captions( - item, **kwargs - ) + cap_res = super().serialize_captions(item, **kwargs) if cap_res.text and params.add_location: for caption in item.captions: if caption.cref not in self.get_excluded_refs(**kwargs): @@ -1270,7 +1423,7 @@ def serialize_doc( parts: list[SerializationResult], **kwargs: Any, ) -> SerializationResult: - """DocTags-specific document serializer.""" + """Doc-level serialization with IDocTags root wrapper.""" delim = _get_delim(params=self.params) open_token: str = IDocTagsVocabulary.create_doctag_root() @@ -1322,3 +1475,8 @@ def _expand_tag(text: str, name: str) -> str: text_res = _expand_tag(text_res, tok.value) return create_ser_result(text=text_res, span_source=parts) + + @override + def requires_page_break(self): + """Return whether page breaks should be emitted for the document.""" + return self.params.add_page_break diff --git a/test/test_serialization_idoctag.py b/test/test_serialization_idoctag.py index b5776e8e..645881f3 100644 --- a/test/test_serialization_idoctag.py +++ b/test/test_serialization_idoctag.py @@ -7,9 +7,9 @@ from docling_core.experimental.idoctags import ( IDocTagsDocSerializer, IDocTagsParams, + IDocTagsSerializationMode, IDocTagsVocabulary, ) -from docling_core.transforms.serializer.doctags import DocTagsParams from docling_core.types.doc import DocItemLabel, DoclingDocument, TableData from .test_serialization import verify @@ -163,7 +163,7 @@ def test_idoctags(): params = IDocTagsParams() params.pretty_indentation = "" params.add_content = False - params.mode = DocTagsParams.Mode.MINIFIED + params.mode = IDocTagsSerializationMode.LLM_FRIENDLY ser = IDocTagsDocSerializer(doc=doc, params=params) actual = ser.serialize().text From 6d2c7f2426ca4fde503e209045b42cf9e6b2027a Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 14:51:31 +0100 Subject: [PATCH 12/17] working on the deserializer Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 181 +++++++++++++++++++++++++- test/test_deserializer_idoctags.py | 164 +++++++++++++++++++++++ 2 files changed, 338 insertions(+), 7 deletions(-) create mode 100644 test/test_deserializer_idoctags.py diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index b877ff1d..fbc236e9 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -51,6 +51,8 @@ TabularChartMetaField, TextItem, ) +from docling_core.types.doc.labels import DocItemLabel +from docling_core.types.doc.utils import parse_otsl_table_content # Note: Intentionally avoid importing DocumentToken here to ensure # IDocTags uses only its own token vocabulary. @@ -1436,13 +1438,6 @@ def serialize_doc( for full_match, _, _ in self._get_page_breaks(text=text_res): text_res = text_res.replace(full_match, page_sep) - """ - tmp = f"<{IDocTagsToken.DOCUMENT.value}>" - tmp += f"<{IDocTagsToken.VERSION.value}>{DOCTAGS_VERSION}" - tmp += f"{text_res}" - tmp += f"" - """ - text_res = f"{open_token}{text_res}{close_token}" if self.params.pretty_indentation and ( @@ -1480,3 +1475,175 @@ def _expand_tag(text: str, name: str) -> str: def requires_page_break(self): """Return whether page breaks should be emitted for the document.""" return self.params.add_page_break + + +class IDocTagsDocDeserializer(BaseModel): + """IDocTags document deserializer.""" + + def deserialize( + self, + *, + doctags: str, + ) -> DoclingDocument: + root = parseString(doctags).documentElement + if root.tagName != IDocTagsToken.DOCUMENT.value: + candidates = root.getElementsByTagName(IDocTagsToken.DOCUMENT.value) + root = candidates[0] if candidates else root + + doc = DoclingDocument(name="Document") + self._parse_document_root(doc=doc, root=root) + return doc + + # ------------- Core walkers ------------- + def _parse_document_root(self, *, doc: DoclingDocument, root) -> None: + for node in root.childNodes: + if getattr(node, "nodeType", None) == node.ELEMENT_NODE: + self._dispatch_element(doc=doc, el=node, parent=None) + + def _dispatch_element(self, *, doc: DoclingDocument, el, parent) -> None: + name = el.tagName + if name in {IDocTagsToken.TITLE.value, IDocTagsToken.TEXT.value, + IDocTagsToken.CAPTION.value, IDocTagsToken.FOOTNOTE.value, + IDocTagsToken.PAGE_HEADER.value, IDocTagsToken.PAGE_FOOTER.value, + IDocTagsToken.CODE.value, IDocTagsToken.FORMULA.value}: + self._parse_text_like(doc=doc, el=el, parent=parent) + elif name == IDocTagsToken.HEADING.value: + self._parse_heading(doc=doc, el=el, parent=parent) + elif name == IDocTagsToken.LIST.value: + self._parse_list(doc=doc, el=el, parent=parent) + elif name == IDocTagsToken.FLOATING_GROUP.value: + self._parse_floating_group(doc=doc, el=el, parent=parent) + else: + self._walk_children(doc=doc, el=el, parent=parent) + + def _walk_children(self, *, doc: DoclingDocument, el, parent) -> None: + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.ELEMENT_NODE: + # Ignore geometry/meta containers at this level + if node.tagName in {IDocTagsToken.HEAD.value, IDocTagsToken.META.value, + IDocTagsToken.LOCATION.value, IDocTagsToken.PAGE_BREAK.value}: + continue + self._dispatch_element(doc=doc, el=node, parent=parent) + + # ------------- Text blocks ------------- + def _parse_text_like(self, *, doc: DoclingDocument, el, parent) -> None: + text = self._get_text(el) + if not text.strip(): + return + nm = el.tagName + if nm == IDocTagsToken.TITLE.value: + doc.add_title(text=text, parent=parent) + elif nm == IDocTagsToken.TEXT.value: + doc.add_text(label=DocItemLabel.TEXT, text=text, parent=parent) + elif nm == IDocTagsToken.CAPTION.value: + doc.add_text(label=DocItemLabel.CAPTION, text=text, parent=parent) + elif nm == IDocTagsToken.FOOTNOTE.value: + doc.add_text(label=DocItemLabel.FOOTNOTE, text=text, parent=parent) + elif nm == IDocTagsToken.PAGE_HEADER.value: + doc.add_text(label=DocItemLabel.PAGE_HEADER, text=text, parent=parent) + elif nm == IDocTagsToken.PAGE_FOOTER.value: + doc.add_text(label=DocItemLabel.PAGE_FOOTER, text=text, parent=parent) + elif nm == IDocTagsToken.CODE.value: + doc.add_code(text=text, parent=parent) + elif nm == IDocTagsToken.FORMULA.value: + doc.add_formula(text=text, parent=parent) + + def _parse_heading(self, *, doc: DoclingDocument, el, parent) -> None: + lvl_txt = el.getAttribute(IDocTagsAttributeKey.LEVEL.value) or "1" + try: + level = int(lvl_txt) + except Exception: + level = 1 + text = self._get_text(el) + if text.strip(): + doc.add_heading(text=text, level=level, parent=parent) + + def _parse_list(self, *, doc: DoclingDocument, el, parent) -> None: + ordered = (el.getAttribute(IDocTagsAttributeKey.ORDERED.value) == IDocTagsAttributeValue.TRUE.value) + group = doc.add_list_group(parent=parent) + for node in el.childNodes: + if getattr(node, "nodeType", None) != node.ELEMENT_NODE: + continue + if node.tagName == IDocTagsToken.LIST_TEXT.value: + text = self._get_text(node).strip() + if text: + doc.add_list_item(text=text, parent=group, enumerated=ordered) + + # ------------- Floating groups ------------- + def _parse_floating_group(self, *, doc: DoclingDocument, el, parent) -> None: + cls_val = el.getAttribute(IDocTagsAttributeKey.CLASS.value) + if cls_val == IDocTagsAttributeValue.TABLE.value: + self._parse_table_group(doc=doc, el=el, parent=parent) + elif cls_val == IDocTagsAttributeValue.PICTURE.value: + self._parse_picture_group(doc=doc, el=el, parent=parent) + else: + self._walk_children(doc=doc, el=el, parent=parent) + + def _parse_table_group(self, *, doc: DoclingDocument, el, parent) -> None: + caption = self._extract_caption(doc=doc, el=el) + otsl_el = self._first_child(el, IDocTagsToken.OTSL.value) + if otsl_el is None: + doc.add_table(data=TableData(), caption=caption, parent=parent) + return + inner = self._inner_xml(otsl_el) + normalized = self._normalize_otsl_tokens(inner) + td = parse_otsl_table_content(f"{normalized}") + doc.add_table(data=td, caption=caption, parent=parent) + + def _parse_picture_group(self, *, doc: DoclingDocument, el, parent) -> None: + caption = self._extract_caption(doc=doc, el=el) + doc.add_picture(caption=caption, parent=parent) + + # ------------- Helpers ------------- + def _extract_caption(self, *, doc: DoclingDocument, el) -> Optional[TextItem]: + cap_el = self._first_child(el, IDocTagsToken.CAPTION.value) + if cap_el is None: + return None + text = self._get_text(cap_el).strip() + return doc.add_text(label=DocItemLabel.CAPTION, text=text) if text else None + + def _first_child(self, el, tag_name: str): + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.ELEMENT_NODE and node.tagName == tag_name: + return node + return None + + def _inner_xml(self, el) -> str: + parts: list[str] = [] + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.TEXT_NODE: + parts.append(node.data) + elif node.nodeType == node.ELEMENT_NODE: + parts.append(node.toxml()) + return "".join(parts) + + def _normalize_otsl_tokens(self, text: str) -> str: + tokens = [ + IDocTagsToken.FCEL.value, + IDocTagsToken.ECEL.value, + IDocTagsToken.LCEL.value, + IDocTagsToken.UCEL.value, + IDocTagsToken.XCEL.value, + IDocTagsToken.NL.value, + IDocTagsToken.CHED.value, + IDocTagsToken.RHED.value, + IDocTagsToken.SROW.value, + ] + for t in tokens: + text = re.sub(rf"<\s*{t}\s*/>", f"<{t}>", text) + return text + + def _get_text(self, el) -> str: + out: list[str] = [] + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.TEXT_NODE: + out.append(node.data) + elif node.nodeType == node.ELEMENT_NODE: + nm = node.tagName + if nm in {IDocTagsToken.LOCATION.value}: + continue + if nm == IDocTagsToken.BR.value: + out.append("\n") + else: + out.append(self._get_text(node)) + return "".join(out) diff --git a/test/test_deserializer_idoctags.py b/test/test_deserializer_idoctags.py new file mode 100644 index 00000000..cf584efa --- /dev/null +++ b/test/test_deserializer_idoctags.py @@ -0,0 +1,164 @@ +import pytest + +from docling_core.experimental.idoctags import ( + IDocTagsDocDeserializer, + IDocTagsDocSerializer, + IDocTagsParams, +) +from docling_core.types.doc import DocItemLabel, DoclingDocument, TableData + + +def _serialize(doc: DoclingDocument) -> str: + ser = IDocTagsDocSerializer(doc=doc, params=IDocTagsParams()) + return ser.serialize().text + + +def _deserialize(text: str) -> DoclingDocument: + return IDocTagsDocDeserializer().deserialize(doctags=text) + + +def test_roundtrip_text(): + doc = DoclingDocument(name="t") + doc.add_text(label=DocItemLabel.TEXT, text="Hello world") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.TEXT + assert doc2.texts[0].text == "Hello world" + + +def test_roundtrip_title(): + doc = DoclingDocument(name="t") + doc.add_title(text="My Title") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.TITLE + assert doc2.texts[0].text == "My Title" + + +def test_roundtrip_heading(): + doc = DoclingDocument(name="t") + doc.add_heading(text="Section A", level=2) + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + h = doc2.texts[0] + assert h.label == DocItemLabel.SECTION_HEADER and getattr(h, "level", 0) == 2 + assert h.text == "Section A" + + +def test_roundtrip_caption(): + doc = DoclingDocument(name="t") + doc.add_text(label=DocItemLabel.CAPTION, text="Cap text") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.CAPTION + assert doc2.texts[0].text == "Cap text" + + +def test_roundtrip_footnote(): + doc = DoclingDocument(name="t") + doc.add_text(label=DocItemLabel.FOOTNOTE, text="Foot note") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.FOOTNOTE + assert doc2.texts[0].text == "Foot note" + + +def test_roundtrip_page_header(): + doc = DoclingDocument(name="t") + doc.add_text(label=DocItemLabel.PAGE_HEADER, text="Header") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.PAGE_HEADER + assert doc2.texts[0].text == "Header" + + +def test_roundtrip_page_footer(): + doc = DoclingDocument(name="t") + doc.add_text(label=DocItemLabel.PAGE_FOOTER, text="Footer") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.PAGE_FOOTER + assert doc2.texts[0].text == "Footer" + + +def test_roundtrip_code(): + doc = DoclingDocument(name="t") + doc.add_code(text="print('hi')") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.CODE + assert doc2.texts[0].text.strip() == "print('hi')" + + +def test_roundtrip_formula(): + doc = DoclingDocument(name="t") + doc.add_formula(text="E=mc^2") + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.FORMULA + assert doc2.texts[0].text == "E=mc^2" + + +def test_roundtrip_list_unordered(): + doc = DoclingDocument(name="t") + lg = doc.add_list_group() + doc.add_list_item("A", parent=lg, enumerated=False) + doc.add_list_item("B", parent=lg, enumerated=False) + dt = _serialize(doc) + doc2 = _deserialize(dt) + # Ensure group created and items present + assert len(doc2.groups) == 1 + assert len(doc2.texts) == 2 + assert [it.text for it in doc2.texts] == ["A", "B"] + + +def test_roundtrip_list_ordered(): + doc = DoclingDocument(name="t") + lg = doc.add_list_group() + doc.add_list_item("1", parent=lg, enumerated=True) + doc.add_list_item("2", parent=lg, enumerated=True) + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.groups) == 1 + assert len(doc2.texts) == 2 + assert [it.text for it in doc2.texts] == ["1", "2"] + + +def test_roundtrip_picture_with_caption(): + doc = DoclingDocument(name="t") + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Fig 1") + doc.add_picture(caption=cap) + dt = _serialize(doc) + print(dt) + + doc2 = _deserialize(dt) + assert len(doc2.pictures) == 1 + # Caption added as a separate text item referenced by the picture + assert len(doc2.texts) >= 1 + cap_texts = [t for t in doc2.texts if t.label == DocItemLabel.CAPTION] + assert len(cap_texts) == 1 and cap_texts[0].text == "Fig 1" + + +def test_roundtrip_table_simple(): + doc = DoclingDocument(name="t") + td = TableData(num_rows=0, num_cols=2) + td.add_row(["H1", "H2"]) # header row semantics not required here + td.add_row(["C1", "C2"]) # data row + doc.add_table(data=td) + dt = _serialize(doc) + doc2 = _deserialize(dt) + assert len(doc2.tables) == 1 + t2 = doc2.tables[0].data + assert t2.num_rows == 2 and t2.num_cols == 2 + grid_texts = [[cell.text for cell in row] for row in t2.grid] + assert grid_texts == [["H1", "H2"], ["C1", "C2"]] + From 09c4f9a10875a5b22e0a3accb746d0ce4a791b1f Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 15:53:02 +0100 Subject: [PATCH 13/17] fixed the captions for floating items Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 74 +++++++++++++++++++-------- 1 file changed, 52 insertions(+), 22 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index fbc236e9..40af2a19 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -44,6 +44,7 @@ NodeItem, PictureClassificationMetaField, PictureItem, + PictureMeta, SectionHeaderItem, SummaryMetaField, TableData, @@ -1133,18 +1134,22 @@ def serialize( value=IDocTagsAttributeValue.PICTURE, closing=True ) + # Build caption (as a sibling of the picture within the floating_group) res_parts: list[SerializationResult] = [] - + caption_text = "" if params.add_caption: cap_res = doc_serializer.serialize_captions(item=item, **kwargs) if cap_res.text: + caption_text = cap_res.text res_parts.append(cap_res) + # Build picture inner content (meta + body) that will go inside ... + picture_inner_parts: list[str] = [] if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): - if item.meta: meta_res = doc_serializer.serialize_meta(item=item, **kwargs) if meta_res.text: + picture_inner_parts.append(meta_res.text) res_parts.append(meta_res) body = "" @@ -1167,15 +1172,20 @@ def serialize( table_token=IDocTagsTableToken, ) body += otsl_content - res_parts.append(create_ser_result(text=body, span_source=item)) - text_res = "".join([r.text for r in res_parts]) - if text_res: - text_res = ( - open_token - + _wrap(text=text_res, wrap_tag=IDocTagsToken.PICTURE.value) - + close_token - ) + if body: + picture_inner_parts.append(body) + res_parts.append(create_ser_result(text=body, span_source=item)) + + picture_text = "".join(picture_inner_parts) + if picture_text: + picture_text = _wrap(text=picture_text, wrap_tag=IDocTagsToken.PICTURE.value) + + # Compose final structure: []... + composed_inner = f"{caption_text}{picture_text}" + text_res = "" + if composed_inner: + text_res = f"{open_token}{composed_inner}{close_token}" return create_ser_result(text=text_res, span_source=res_parts) @@ -1209,16 +1219,20 @@ def serialize( res_parts: list[SerializationResult] = [] + # Caption as sibling of the OTSL payload within the floating group + caption_text = "" if params.add_caption: cap_res = doc_serializer.serialize_captions(item=item, **kwargs) if cap_res.text: + caption_text = cap_res.text res_parts.append(cap_res) + # Build table payload: location (if any) + otsl content inside ... + otsl_payload = "" if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): - + body = "" if params.add_location: - loc_text = _create_location_tokens_for_item(item=item, doc=doc) - res_parts.append(create_ser_result(text=loc_text, span_source=item)) + body += _create_location_tokens_for_item(item=item, doc=doc) otsl_text = item.export_to_otsl( doc=doc, @@ -1230,15 +1244,15 @@ def serialize( visited=visited, table_token=self._get_table_token(), ) - res_parts.append(create_ser_result(text=otsl_text, span_source=item)) + body += otsl_text + if body: + otsl_payload = _wrap(text=body, wrap_tag=IDocTagsToken.OTSL.value) + res_parts.append(create_ser_result(text=body, span_source=item)) - text_res = "".join([r.text for r in res_parts]) - if text_res: - text_res = ( - open_token - + _wrap(text=text_res, wrap_tag=IDocTagsToken.OTSL.value) - + close_token - ) + composed_inner = f"{caption_text}{otsl_payload}" + text_res = "" + if composed_inner: + text_res = f"{open_token}{composed_inner}{close_token}" return create_ser_result(text=text_res, span_source=res_parts) @@ -1591,8 +1605,24 @@ def _parse_table_group(self, *, doc: DoclingDocument, el, parent) -> None: doc.add_table(data=td, caption=caption, parent=parent) def _parse_picture_group(self, *, doc: DoclingDocument, el, parent) -> None: + # Extract caption from the floating group caption = self._extract_caption(doc=doc, el=el) - doc.add_picture(caption=caption, parent=parent) + + # Create the picture item first, attach caption + pic = doc.add_picture(caption=caption, parent=parent) + + # If there is a child and it contains an , + # parse it as TabularChartMetaField and attach to picture.meta + picture_el = self._first_child(el, IDocTagsToken.PICTURE.value) + if picture_el is not None: + otsl_el = self._first_child(picture_el, IDocTagsToken.OTSL.value) + if otsl_el is not None: + inner = self._inner_xml(otsl_el) + normalized = self._normalize_otsl_tokens(inner) + td = parse_otsl_table_content(f"{normalized}") + if pic.meta is None: + pic.meta = PictureMeta() + pic.meta.tabular_chart = TabularChartMetaField(chart_data=td) # ------------- Helpers ------------- def _extract_caption(self, *, doc: DoclingDocument, el) -> Optional[TextItem]: From 3c706e2c3b3da07f3968ef17f2cd958dcdfb5641 Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 17:05:34 +0100 Subject: [PATCH 14/17] still need to fix some seserialization tests Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 211 ++++++++++++++++++-- test/test_deserializer_idoctags.py | 265 +++++++++++++++++++++++++- 2 files changed, 451 insertions(+), 25 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 40af2a19..2f0df2ca 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -33,6 +33,8 @@ DescriptionMetaField, DocItem, DoclingDocument, + BoundingBox, + ProvenanceItem, FloatingItem, FormItem, InlineGroup, @@ -51,8 +53,10 @@ TableItem, TabularChartMetaField, TextItem, + Size, ) -from docling_core.types.doc.labels import DocItemLabel +from docling_core.types.doc.labels import DocItemLabel, CodeLanguageLabel +from docling_core.types.doc.base import CoordOrigin from docling_core.types.doc.utils import parse_otsl_table_content # Note: Intentionally avoid importing DocumentToken here to ensure @@ -1494,6 +1498,10 @@ def requires_page_break(self): class IDocTagsDocDeserializer(BaseModel): """IDocTags document deserializer.""" + # Internal state used while walking the tree + _page_no: int = 0 + _default_resolution: int = DOCTAGS_RESOLUTION + def deserialize( self, *, @@ -1505,6 +1513,10 @@ def deserialize( root = candidates[0] if candidates else root doc = DoclingDocument(name="Document") + # Initialize with a default page so location tokens can be re‑emitted + self._page_no = 0 + self._default_resolution = DOCTAGS_RESOLUTION + self._ensure_page_exists(doc=doc, page_no=self._page_no, resolution=self._default_resolution) self._parse_document_root(doc=doc, root=root) return doc @@ -1521,6 +1533,10 @@ def _dispatch_element(self, *, doc: DoclingDocument, el, parent) -> None: IDocTagsToken.PAGE_HEADER.value, IDocTagsToken.PAGE_FOOTER.value, IDocTagsToken.CODE.value, IDocTagsToken.FORMULA.value}: self._parse_text_like(doc=doc, el=el, parent=parent) + elif name == IDocTagsToken.PAGE_BREAK.value: + # Start a new page; keep a default square page using the configured resolution + self._page_no += 1 + self._ensure_page_exists(doc=doc, page_no=self._page_no, resolution=self._default_resolution) elif name == IDocTagsToken.HEADING.value: self._parse_heading(doc=doc, el=el, parent=parent) elif name == IDocTagsToken.LIST.value: @@ -1533,34 +1549,98 @@ def _dispatch_element(self, *, doc: DoclingDocument, el, parent) -> None: def _walk_children(self, *, doc: DoclingDocument, el, parent) -> None: for node in el.childNodes: if getattr(node, "nodeType", None) == node.ELEMENT_NODE: - # Ignore geometry/meta containers at this level + # Ignore geometry/meta containers at this level; pass through page breaks if node.tagName in {IDocTagsToken.HEAD.value, IDocTagsToken.META.value, - IDocTagsToken.LOCATION.value, IDocTagsToken.PAGE_BREAK.value}: + IDocTagsToken.LOCATION.value}: continue self._dispatch_element(doc=doc, el=node, parent=parent) # ------------- Text blocks ------------- def _parse_text_like(self, *, doc: DoclingDocument, el, parent) -> None: + # Extract provenance from leading tokens within the element + prov_list = self._extract_provenance(doc=doc, el=el) text = self._get_text(el) - if not text.strip(): + text_stripped = text.strip() + if not text_stripped: return nm = el.tagName if nm == IDocTagsToken.TITLE.value: - doc.add_title(text=text, parent=parent) + item = doc.add_title(text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.TEXT.value: - doc.add_text(label=DocItemLabel.TEXT, text=text, parent=parent) + item = doc.add_text(label=DocItemLabel.TEXT, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.CAPTION.value: - doc.add_text(label=DocItemLabel.CAPTION, text=text, parent=parent) + item = doc.add_text(label=DocItemLabel.CAPTION, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.FOOTNOTE.value: - doc.add_text(label=DocItemLabel.FOOTNOTE, text=text, parent=parent) + item = doc.add_text(label=DocItemLabel.FOOTNOTE, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.PAGE_HEADER.value: - doc.add_text(label=DocItemLabel.PAGE_HEADER, text=text, parent=parent) + item = doc.add_text(label=DocItemLabel.PAGE_HEADER, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.PAGE_FOOTER.value: - doc.add_text(label=DocItemLabel.PAGE_FOOTER, text=text, parent=parent) + item = doc.add_text(label=DocItemLabel.PAGE_FOOTER, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.CODE.value: - doc.add_code(text=text, parent=parent) + # Extract code language from optional language=... + lang_label = CodeLanguageLabel.UNKNOWN + + # Build code text excluding and nodes + parts: list[str] = [] + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.TEXT_NODE: + # Ignore whitespace-only nodes (indentation/newlines from pretty XML) + if node.data.strip(): + parts.append(node.data) + elif getattr(node, "nodeType", None) == node.ELEMENT_NODE: + nm_child = node.tagName + if nm_child == IDocTagsToken.FACETS.value: + # Parse facets content for language key + facets_text = self._get_text(node).strip() + # Accept forms like "language=python" (case-insensitive on value) + if "=" in facets_text: + key, val = facets_text.split("=", 1) + if key.strip().lower() == "language": + val_norm = val.strip().lower() + # Map back to CodeLanguageLabel by value (case-insensitive) + try: + lang_label = next( + lbl for lbl in CodeLanguageLabel if lbl.value.lower() == val_norm + ) + except StopIteration: + lang_label = CodeLanguageLabel.UNKNOWN + # Do not include facets text in code content + continue + if nm_child == IDocTagsToken.LOCATION.value: + # Skip geometry tokens from content + continue + if nm_child == IDocTagsToken.BR.value: + parts.append("\n") + else: + parts.append(self._get_text(node)) + + code_text = "".join(parts) + if not code_text.strip(): + return + item = doc.add_code( + text=code_text, + code_language=lang_label, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) + for p in prov_list[1:]: + item.prov.append(p) elif nm == IDocTagsToken.FORMULA.value: - doc.add_formula(text=text, parent=parent) + item = doc.add_formula(text=text, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) def _parse_heading(self, *, doc: DoclingDocument, el, parent) -> None: lvl_txt = el.getAttribute(IDocTagsAttributeKey.LEVEL.value) or "1" @@ -1568,9 +1648,14 @@ def _parse_heading(self, *, doc: DoclingDocument, el, parent) -> None: level = int(lvl_txt) except Exception: level = 1 + # Extract provenance from heading token (if any) + prov_list = self._extract_provenance(doc=doc, el=el) text = self._get_text(el) - if text.strip(): - doc.add_heading(text=text, level=level, parent=parent) + text_stripped = text.strip() + if text_stripped: + item = doc.add_heading(text=text_stripped, level=level, parent=parent, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) def _parse_list(self, *, doc: DoclingDocument, el, parent) -> None: ordered = (el.getAttribute(IDocTagsAttributeKey.ORDERED.value) == IDocTagsAttributeValue.TRUE.value) @@ -1579,9 +1664,13 @@ def _parse_list(self, *, doc: DoclingDocument, el, parent) -> None: if getattr(node, "nodeType", None) != node.ELEMENT_NODE: continue if node.tagName == IDocTagsToken.LIST_TEXT.value: + # Collect provenance from the wrapper + prov_list = self._extract_provenance(doc=doc, el=node) text = self._get_text(node).strip() if text: - doc.add_list_item(text=text, parent=group, enumerated=ordered) + item = doc.add_list_item(text=text, parent=group, enumerated=ordered, prov=(prov_list[0] if prov_list else None)) + for p in prov_list[1:]: + item.prov.append(p) # ------------- Floating groups ------------- def _parse_floating_group(self, *, doc: DoclingDocument, el, parent) -> None: @@ -1599,21 +1688,43 @@ def _parse_table_group(self, *, doc: DoclingDocument, el, parent) -> None: if otsl_el is None: doc.add_table(data=TableData(), caption=caption, parent=parent) return + # Extract table provenance from leading tokens + tbl_provs = self._extract_provenance(doc=doc, el=otsl_el) inner = self._inner_xml(otsl_el) + # Remove any location tokens from the OTSL content before parsing + inner = re.sub(r"<\s*location\b[^>]*/\s*>", "", inner) normalized = self._normalize_otsl_tokens(inner) td = parse_otsl_table_content(f"{normalized}") - doc.add_table(data=td, caption=caption, parent=parent) + tbl = doc.add_table( + data=td, + caption=caption, + parent=parent, + prov=(tbl_provs[0] if tbl_provs else None), + ) + for p in tbl_provs[1:]: + tbl.prov.append(p) def _parse_picture_group(self, *, doc: DoclingDocument, el, parent) -> None: # Extract caption from the floating group caption = self._extract_caption(doc=doc, el=el) - # Create the picture item first, attach caption - pic = doc.add_picture(caption=caption, parent=parent) + # Extract provenance from the block (locations appear inside it) + prov_list: list[ProvenanceItem] = [] + picture_el = self._first_child(el, IDocTagsToken.PICTURE.value) + if picture_el is not None: + prov_list = self._extract_provenance(doc=doc, el=picture_el) + + # Create the picture item first, attach caption and provenance + pic = doc.add_picture( + caption=caption, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) + for p in prov_list[1:]: + pic.prov.append(p) # If there is a child and it contains an , # parse it as TabularChartMetaField and attach to picture.meta - picture_el = self._first_child(el, IDocTagsToken.PICTURE.value) if picture_el is not None: otsl_el = self._first_child(picture_el, IDocTagsToken.OTSL.value) if otsl_el is not None: @@ -1630,7 +1741,17 @@ def _extract_caption(self, *, doc: DoclingDocument, el) -> Optional[TextItem]: if cap_el is None: return None text = self._get_text(cap_el).strip() - return doc.add_text(label=DocItemLabel.CAPTION, text=text) if text else None + if not text: + return None + prov_list = self._extract_provenance(doc=doc, el=cap_el) + item = doc.add_text( + label=DocItemLabel.CAPTION, + text=text, + prov=(prov_list[0] if prov_list else None), + ) + for p in prov_list[1:]: + item.prov.append(p) + return item def _first_child(self, el, tag_name: str): for node in el.childNodes: @@ -1667,7 +1788,9 @@ def _get_text(self, el) -> str: out: list[str] = [] for node in el.childNodes: if getattr(node, "nodeType", None) == node.TEXT_NODE: - out.append(node.data) + # Skip pure indentation/pretty-print whitespace + if node.data.strip(): + out.append(node.data) elif node.nodeType == node.ELEMENT_NODE: nm = node.tagName if nm in {IDocTagsToken.LOCATION.value}: @@ -1677,3 +1800,49 @@ def _get_text(self, el) -> str: else: out.append(self._get_text(node)) return "".join(out) + + # --------- Location helpers --------- + def _ensure_page_exists(self, *, doc: DoclingDocument, page_no: int, resolution: int) -> None: + # If the page already exists, do nothing; otherwise add with a square size based on resolution + if page_no not in doc.pages: + doc.add_page(page_no=page_no, size=Size(width=resolution, height=resolution)) + + def _extract_provenance(self, *, doc: DoclingDocument, el) -> list[ProvenanceItem]: + # Collect immediate child tokens in groups of 4 + values: list[int] = [] + res_for_group: Optional[int] = None + provs: list[ProvenanceItem] = [] + + for node in el.childNodes: + if getattr(node, "nodeType", None) != node.ELEMENT_NODE: + continue + if node.tagName != IDocTagsToken.LOCATION.value: + continue + try: + v = int(node.getAttribute(IDocTagsAttributeKey.VALUE.value) or "0") + except Exception: + v = 0 + try: + r = int(node.getAttribute(IDocTagsAttributeKey.RESOLUTION.value) or str(self._default_resolution)) + except Exception: + r = self._default_resolution + values.append(v) + # For a group, remember the last seen resolution + res_for_group = r + if len(values) == 4: + # Ensure page exists (and set consistent default size for this page) + self._ensure_page_exists( + doc=doc, page_no=self._page_no, resolution=res_for_group or self._default_resolution + ) + l = float(min(values[0], values[2])) + t = float(min(values[1], values[3])) + rgt = float(max(values[0], values[2])) + btm = float(max(values[1], values[3])) + bbox = BoundingBox.from_tuple((l, t, rgt, btm), origin=CoordOrigin.TOPLEFT) + provs.append( + ProvenanceItem(page_no=self._page_no, bbox=bbox, charspan=(0, 0)) + ) + values = [] + res_for_group = None + + return provs diff --git a/test/test_deserializer_idoctags.py b/test/test_deserializer_idoctags.py index cf584efa..67b99c6d 100644 --- a/test/test_deserializer_idoctags.py +++ b/test/test_deserializer_idoctags.py @@ -5,7 +5,15 @@ IDocTagsDocSerializer, IDocTagsParams, ) -from docling_core.types.doc import DocItemLabel, DoclingDocument, TableData +from docling_core.types.doc import ( + BoundingBox, + DocItemLabel, + DoclingDocument, + ProvenanceItem, + Size, + TableData, +) +from docling_core.types.doc.labels import CodeLanguageLabel def _serialize(doc: DoclingDocument) -> str: @@ -17,10 +25,23 @@ def _deserialize(text: str) -> DoclingDocument: return IDocTagsDocDeserializer().deserialize(doctags=text) +def _add_default_page(doc: DoclingDocument): + doc.add_page(page_no=0, size=Size(width=1000, height=1000)) + + +def _default_prov() -> ProvenanceItem: + return ProvenanceItem( + page_no=0, + bbox=BoundingBox(l=100, t=100, r=300, b=200), + charspan=(0, 0), + ) + + def test_roundtrip_text(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.TEXT, text="Hello world") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TEXT @@ -31,6 +52,7 @@ def test_roundtrip_title(): doc = DoclingDocument(name="t") doc.add_title(text="My Title") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TITLE @@ -41,6 +63,7 @@ def test_roundtrip_heading(): doc = DoclingDocument(name="t") doc.add_heading(text="Section A", level=2) dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 h = doc2.texts[0] @@ -52,6 +75,7 @@ def test_roundtrip_caption(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.CAPTION, text="Cap text") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CAPTION @@ -62,6 +86,7 @@ def test_roundtrip_footnote(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.FOOTNOTE, text="Foot note") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FOOTNOTE @@ -72,6 +97,7 @@ def test_roundtrip_page_header(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.PAGE_HEADER, text="Header") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_HEADER @@ -82,6 +108,7 @@ def test_roundtrip_page_footer(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.PAGE_FOOTER, text="Footer") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_FOOTER @@ -90,18 +117,21 @@ def test_roundtrip_page_footer(): def test_roundtrip_code(): doc = DoclingDocument(name="t") - doc.add_code(text="print('hi')") + doc.add_code(text="print('hi')", code_language=CodeLanguageLabel.PYTHON) dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CODE assert doc2.texts[0].text.strip() == "print('hi')" + assert getattr(doc2.texts[0], "code_language", None) == CodeLanguageLabel.PYTHON def test_roundtrip_formula(): doc = DoclingDocument(name="t") doc.add_formula(text="E=mc^2") dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FORMULA @@ -114,6 +144,7 @@ def test_roundtrip_list_unordered(): doc.add_list_item("A", parent=lg, enumerated=False) doc.add_list_item("B", parent=lg, enumerated=False) dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) # Ensure group created and items present assert len(doc2.groups) == 1 @@ -127,6 +158,7 @@ def test_roundtrip_list_ordered(): doc.add_list_item("1", parent=lg, enumerated=True) doc.add_list_item("2", parent=lg, enumerated=True) dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.groups) == 1 assert len(doc2.texts) == 2 @@ -138,8 +170,7 @@ def test_roundtrip_picture_with_caption(): cap = doc.add_text(label=DocItemLabel.CAPTION, text="Fig 1") doc.add_picture(caption=cap) dt = _serialize(doc) - print(dt) - + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.pictures) == 1 # Caption added as a separate text item referenced by the picture @@ -155,6 +186,7 @@ def test_roundtrip_table_simple(): td.add_row(["C1", "C2"]) # data row doc.add_table(data=td) dt = _serialize(doc) + print("\n",dt) doc2 = _deserialize(dt) assert len(doc2.tables) == 1 t2 = doc2.tables[0].data @@ -162,3 +194,228 @@ def test_roundtrip_table_simple(): grid_texts = [[cell.text for cell in row] for row in t2.grid] assert grid_texts == [["H1", "H2"], ["C1", "C2"]] + +def test_roundtrip_table_with_caption(): + doc = DoclingDocument(name="t") + # Create a caption and a simple 2x2 table + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Tbl 1") + td = TableData(num_rows=0, num_cols=2) + td.add_row(["H1", "H2"]) # header row + td.add_row(["C1", "C2"]) # data row + doc.add_table(data=td, caption=cap) + + dt = _serialize(doc) + print(dt) + doc2 = _deserialize(dt) + + # One table reconstructed with same grid + assert len(doc2.tables) == 1 + t2 = doc2.tables[0] + assert t2.data.num_rows == 2 and t2.data.num_cols == 2 + grid_texts = [[cell.text for cell in row] for row in t2.data.grid] + assert grid_texts == [["H1", "H2"], ["C1", "C2"]] + + # Caption preserved and linked to the table + assert len(t2.captions) == 1 + cap_item = t2.captions[0].resolve(doc2) + assert cap_item.label == DocItemLabel.CAPTION and cap_item.text == "Tbl 1" + + +def test_roundtrip_text_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_text(label=DocItemLabel.TEXT, text="Hello world", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + dt2 = _serialize(doc2) + print("\n", dt2) + print(f"`{doc2.texts[0].text}`") + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.TEXT + assert doc2.texts[0].text == "Hello world" + + +def test_roundtrip_title_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_title(text="My Title", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.TITLE + assert doc2.texts[0].text == "My Title" + + +def test_roundtrip_heading_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_heading(text="Section A", level=2, prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + h = doc2.texts[0] + assert h.label == DocItemLabel.SECTION_HEADER and getattr(h, "level", 0) == 2 + assert h.text == "Section A" + + +def test_roundtrip_caption_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_text(label=DocItemLabel.CAPTION, text="Cap text", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.CAPTION + assert doc2.texts[0].text == "Cap text" + + +def test_roundtrip_footnote_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_text(label=DocItemLabel.FOOTNOTE, text="Foot note", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.FOOTNOTE + assert doc2.texts[0].text == "Foot note" + + +def test_roundtrip_page_header_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_text(label=DocItemLabel.PAGE_HEADER, text="Header", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.PAGE_HEADER + assert doc2.texts[0].text == "Header" + + +def test_roundtrip_page_footer_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_text(label=DocItemLabel.PAGE_FOOTER, text="Footer", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.PAGE_FOOTER + assert doc2.texts[0].text == "Footer" + + +def test_roundtrip_code_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_code( + text="print('hi')", code_language=CodeLanguageLabel.PYTHON, prov=_default_prov() + ) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.CODE + assert doc2.texts[0].text.strip() == "print('hi')" + assert getattr(doc2.texts[0], "code_language", None) == CodeLanguageLabel.PYTHON + + +def test_roundtrip_formula_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + doc.add_formula(text="E=mc^2", prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.texts) == 1 + assert doc2.texts[0].label == DocItemLabel.FORMULA + assert doc2.texts[0].text == "E=mc^2" + + +def test_roundtrip_list_unordered_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + lg = doc.add_list_group() + prov = _default_prov() + doc.add_list_item("A", parent=lg, enumerated=False, prov=prov) + doc.add_list_item("B", parent=lg, enumerated=False, prov=prov) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.groups) == 1 + assert len(doc2.texts) == 2 + assert [it.text for it in doc2.texts] == ["A", "B"] + + +def test_roundtrip_list_ordered_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + lg = doc.add_list_group() + prov = _default_prov() + doc.add_list_item("1", parent=lg, enumerated=True, prov=prov) + doc.add_list_item("2", parent=lg, enumerated=True, prov=prov) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.groups) == 1 + assert len(doc2.texts) == 2 + assert [it.text for it in doc2.texts] == ["1", "2"] + + +def test_roundtrip_picture_with_caption_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Fig 1", prov=_default_prov()) + doc.add_picture(caption=cap, prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.pictures) == 1 + assert len(doc2.texts) >= 1 + cap_texts = [t for t in doc2.texts if t.label == DocItemLabel.CAPTION] + assert len(cap_texts) == 1 and cap_texts[0].text == "Fig 1" + + +def test_roundtrip_table_simple_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + td = TableData(num_rows=0, num_cols=2) + td.add_row(["H1", "H2"]) # header row semantics not required here + td.add_row(["C1", "C2"]) # data row + doc.add_table(data=td, prov=_default_prov()) + dt = _serialize(doc) + print("\n", dt) + doc2 = _deserialize(dt) + assert len(doc2.tables) == 1 + t2 = doc2.tables[0].data + assert t2.num_rows == 2 and t2.num_cols == 2 + grid_texts = [[cell.text for cell in row] for row in t2.grid] + assert grid_texts == [["H1", "H2"], ["C1", "C2"]] + + +def test_roundtrip_table_with_caption_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Tbl 1", prov=_default_prov()) + td = TableData(num_rows=0, num_cols=2) + td.add_row(["H1", "H2"]) # header row + td.add_row(["C1", "C2"]) # data row + doc.add_table(data=td, caption=cap, prov=_default_prov()) + + dt = _serialize(doc) + print(dt) + doc2 = _deserialize(dt) + + assert len(doc2.tables) == 1 + t2 = doc2.tables[0] + assert t2.data.num_rows == 2 and t2.data.num_cols == 2 + grid_texts = [[cell.text for cell in row] for row in t2.data.grid] + assert grid_texts == [["H1", "H2"], ["C1", "C2"]] + + assert len(t2.captions) == 1 + cap_item = t2.captions[0].resolve(doc2) + assert cap_item.label == DocItemLabel.CAPTION and cap_item.text == "Tbl 1" From 75c92f801431324d60c3f98ff000a125373049ec Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Fri, 12 Dec 2025 17:23:40 +0100 Subject: [PATCH 15/17] finally all is working and reformatted Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 257 ++++++++++++------- test/data/doc/dummy_doc_with_meta.gt.idt.xml | 14 +- test/test_deserializer_idoctags.py | 97 ++++--- 3 files changed, 232 insertions(+), 136 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 2f0df2ca..62278560 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -2,8 +2,8 @@ import re from enum import Enum -from typing import Any, ClassVar, Final, Optional -from xml.dom.minidom import parseString +from typing import Any, ClassVar, Final, Optional, cast +from xml.dom.minidom import Element, parseString from pydantic import BaseModel from typing_extensions import override @@ -29,12 +29,11 @@ ) from docling_core.types.doc import ( BaseMeta, + BoundingBox, CodeItem, DescriptionMetaField, DocItem, DoclingDocument, - BoundingBox, - ProvenanceItem, FloatingItem, FormItem, InlineGroup, @@ -47,16 +46,17 @@ PictureClassificationMetaField, PictureItem, PictureMeta, + ProvenanceItem, SectionHeaderItem, + Size, SummaryMetaField, TableData, TableItem, TabularChartMetaField, TextItem, - Size, ) -from docling_core.types.doc.labels import DocItemLabel, CodeLanguageLabel from docling_core.types.doc.base import CoordOrigin +from docling_core.types.doc.labels import CodeLanguageLabel, DocItemLabel from docling_core.types.doc.utils import parse_otsl_table_content # Note: Intentionally avoid importing DocumentToken here to ensure @@ -1183,9 +1183,12 @@ def serialize( picture_text = "".join(picture_inner_parts) if picture_text: - picture_text = _wrap(text=picture_text, wrap_tag=IDocTagsToken.PICTURE.value) + picture_text = _wrap( + text=picture_text, wrap_tag=IDocTagsToken.PICTURE.value + ) - # Compose final structure: []... + # Compose final structure for picture group: + # [] ... composed_inner = f"{caption_text}{picture_text}" text_res = "" if composed_inner: @@ -1507,16 +1510,30 @@ def deserialize( *, doctags: str, ) -> DoclingDocument: - root = parseString(doctags).documentElement + """Deserialize DocTags XML into a DoclingDocument. + + Args: + doctags: DocTags XML string to parse. + + Returns: + A populated `DoclingDocument` parsed from the input. + """ + root_node = parseString(doctags).documentElement + if root_node is None: + raise ValueError("Invalid DocTags XML: missing documentElement") + root: Element = cast(Element, root_node) if root.tagName != IDocTagsToken.DOCUMENT.value: candidates = root.getElementsByTagName(IDocTagsToken.DOCUMENT.value) - root = candidates[0] if candidates else root + if candidates: + root = cast(Element, candidates[0]) doc = DoclingDocument(name="Document") # Initialize with a default page so location tokens can be re‑emitted self._page_no = 0 self._default_resolution = DOCTAGS_RESOLUTION - self._ensure_page_exists(doc=doc, page_no=self._page_no, resolution=self._default_resolution) + self._ensure_page_exists( + doc=doc, page_no=self._page_no, resolution=self._default_resolution + ) self._parse_document_root(doc=doc, root=root) return doc @@ -1528,15 +1545,23 @@ def _parse_document_root(self, *, doc: DoclingDocument, root) -> None: def _dispatch_element(self, *, doc: DoclingDocument, el, parent) -> None: name = el.tagName - if name in {IDocTagsToken.TITLE.value, IDocTagsToken.TEXT.value, - IDocTagsToken.CAPTION.value, IDocTagsToken.FOOTNOTE.value, - IDocTagsToken.PAGE_HEADER.value, IDocTagsToken.PAGE_FOOTER.value, - IDocTagsToken.CODE.value, IDocTagsToken.FORMULA.value}: + if name in { + IDocTagsToken.TITLE.value, + IDocTagsToken.TEXT.value, + IDocTagsToken.CAPTION.value, + IDocTagsToken.FOOTNOTE.value, + IDocTagsToken.PAGE_HEADER.value, + IDocTagsToken.PAGE_FOOTER.value, + IDocTagsToken.CODE.value, + IDocTagsToken.FORMULA.value, + }: self._parse_text_like(doc=doc, el=el, parent=parent) elif name == IDocTagsToken.PAGE_BREAK.value: # Start a new page; keep a default square page using the configured resolution self._page_no += 1 - self._ensure_page_exists(doc=doc, page_no=self._page_no, resolution=self._default_resolution) + self._ensure_page_exists( + doc=doc, page_no=self._page_no, resolution=self._default_resolution + ) elif name == IDocTagsToken.HEADING.value: self._parse_heading(doc=doc, el=el, parent=parent) elif name == IDocTagsToken.LIST.value: @@ -1550,83 +1575,27 @@ def _walk_children(self, *, doc: DoclingDocument, el, parent) -> None: for node in el.childNodes: if getattr(node, "nodeType", None) == node.ELEMENT_NODE: # Ignore geometry/meta containers at this level; pass through page breaks - if node.tagName in {IDocTagsToken.HEAD.value, IDocTagsToken.META.value, - IDocTagsToken.LOCATION.value}: + if node.tagName in { + IDocTagsToken.HEAD.value, + IDocTagsToken.META.value, + IDocTagsToken.LOCATION.value, + }: continue self._dispatch_element(doc=doc, el=node, parent=parent) # ------------- Text blocks ------------- def _parse_text_like(self, *, doc: DoclingDocument, el, parent) -> None: - # Extract provenance from leading tokens within the element + """Parse text-like tokens (title, text, caption, footnotes, code, formula).""" prov_list = self._extract_provenance(doc=doc, el=el) - text = self._get_text(el) - text_stripped = text.strip() - if not text_stripped: + text = self._get_text(el).strip() + if not text: return + nm = el.tagName - if nm == IDocTagsToken.TITLE.value: - item = doc.add_title(text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.TEXT.value: - item = doc.add_text(label=DocItemLabel.TEXT, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.CAPTION.value: - item = doc.add_text(label=DocItemLabel.CAPTION, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.FOOTNOTE.value: - item = doc.add_text(label=DocItemLabel.FOOTNOTE, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.PAGE_HEADER.value: - item = doc.add_text(label=DocItemLabel.PAGE_HEADER, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.PAGE_FOOTER.value: - item = doc.add_text(label=DocItemLabel.PAGE_FOOTER, text=text_stripped, parent=parent, prov=(prov_list[0] if prov_list else None)) - for p in prov_list[1:]: - item.prov.append(p) - elif nm == IDocTagsToken.CODE.value: - # Extract code language from optional language=... - lang_label = CodeLanguageLabel.UNKNOWN - - # Build code text excluding and nodes - parts: list[str] = [] - for node in el.childNodes: - if getattr(node, "nodeType", None) == node.TEXT_NODE: - # Ignore whitespace-only nodes (indentation/newlines from pretty XML) - if node.data.strip(): - parts.append(node.data) - elif getattr(node, "nodeType", None) == node.ELEMENT_NODE: - nm_child = node.tagName - if nm_child == IDocTagsToken.FACETS.value: - # Parse facets content for language key - facets_text = self._get_text(node).strip() - # Accept forms like "language=python" (case-insensitive on value) - if "=" in facets_text: - key, val = facets_text.split("=", 1) - if key.strip().lower() == "language": - val_norm = val.strip().lower() - # Map back to CodeLanguageLabel by value (case-insensitive) - try: - lang_label = next( - lbl for lbl in CodeLanguageLabel if lbl.value.lower() == val_norm - ) - except StopIteration: - lang_label = CodeLanguageLabel.UNKNOWN - # Do not include facets text in code content - continue - if nm_child == IDocTagsToken.LOCATION.value: - # Skip geometry tokens from content - continue - if nm_child == IDocTagsToken.BR.value: - parts.append("\n") - else: - parts.append(self._get_text(node)) - code_text = "".join(parts) + # Handle code separately (language + content extraction) + if nm == IDocTagsToken.CODE.value: + code_text, lang_label = self._extract_code_content_and_language(el) if not code_text.strip(): return item = doc.add_code( @@ -1637,10 +1606,81 @@ def _parse_text_like(self, *, doc: DoclingDocument, el, parent) -> None: ) for p in prov_list[1:]: item.prov.append(p) - elif nm == IDocTagsToken.FORMULA.value: - item = doc.add_formula(text=text, parent=parent, prov=(prov_list[0] if prov_list else None)) + return + + # Map text-like tokens to text item labels + text_label_map = { + IDocTagsToken.TEXT.value: DocItemLabel.TEXT, + IDocTagsToken.CAPTION.value: DocItemLabel.CAPTION, + IDocTagsToken.FOOTNOTE.value: DocItemLabel.FOOTNOTE, + IDocTagsToken.PAGE_HEADER.value: DocItemLabel.PAGE_HEADER, + IDocTagsToken.PAGE_FOOTER.value: DocItemLabel.PAGE_FOOTER, + } + + if nm in text_label_map: + item = doc.add_text( + label=text_label_map[nm], + text=text, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) for p in prov_list[1:]: item.prov.append(p) + return + + if nm == IDocTagsToken.TITLE.value: + item = doc.add_title( + text=text, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) + for p in prov_list[1:]: + item.prov.append(p) + return + + if nm == IDocTagsToken.FORMULA.value: + item = doc.add_formula( + text=text, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) + for p in prov_list[1:]: + item.prov.append(p) + return + + def _extract_code_content_and_language(self, el) -> tuple[str, CodeLanguageLabel]: + """Extract code content and language from a element.""" + lang_label = CodeLanguageLabel.UNKNOWN + parts: list[str] = [] + for node in el.childNodes: + if getattr(node, "nodeType", None) == node.TEXT_NODE: + if node.data.strip(): + parts.append(node.data) + elif getattr(node, "nodeType", None) == node.ELEMENT_NODE: + nm_child = node.tagName + if nm_child == IDocTagsToken.FACETS.value: + facets_text = self._get_text(node).strip() + if "=" in facets_text: + key, val = facets_text.split("=", 1) + if key.strip().lower() == "language": + val_norm = val.strip().lower() + try: + lang_label = next( + lbl + for lbl in CodeLanguageLabel + if lbl.value.lower() == val_norm + ) + except StopIteration: + lang_label = CodeLanguageLabel.UNKNOWN + continue + if nm_child == IDocTagsToken.LOCATION.value: + continue + if nm_child == IDocTagsToken.BR.value: + parts.append("\n") + else: + parts.append(self._get_text(node)) + + return "".join(parts), lang_label def _parse_heading(self, *, doc: DoclingDocument, el, parent) -> None: lvl_txt = el.getAttribute(IDocTagsAttributeKey.LEVEL.value) or "1" @@ -1653,12 +1693,20 @@ def _parse_heading(self, *, doc: DoclingDocument, el, parent) -> None: text = self._get_text(el) text_stripped = text.strip() if text_stripped: - item = doc.add_heading(text=text_stripped, level=level, parent=parent, prov=(prov_list[0] if prov_list else None)) + item = doc.add_heading( + text=text_stripped, + level=level, + parent=parent, + prov=(prov_list[0] if prov_list else None), + ) for p in prov_list[1:]: item.prov.append(p) def _parse_list(self, *, doc: DoclingDocument, el, parent) -> None: - ordered = (el.getAttribute(IDocTagsAttributeKey.ORDERED.value) == IDocTagsAttributeValue.TRUE.value) + ordered = ( + el.getAttribute(IDocTagsAttributeKey.ORDERED.value) + == IDocTagsAttributeValue.TRUE.value + ) group = doc.add_list_group(parent=parent) for node in el.childNodes: if getattr(node, "nodeType", None) != node.ELEMENT_NODE: @@ -1668,7 +1716,12 @@ def _parse_list(self, *, doc: DoclingDocument, el, parent) -> None: prov_list = self._extract_provenance(doc=doc, el=node) text = self._get_text(node).strip() if text: - item = doc.add_list_item(text=text, parent=group, enumerated=ordered, prov=(prov_list[0] if prov_list else None)) + item = doc.add_list_item( + text=text, + parent=group, + enumerated=ordered, + prov=(prov_list[0] if prov_list else None), + ) for p in prov_list[1:]: item.prov.append(p) @@ -1755,7 +1808,10 @@ def _extract_caption(self, *, doc: DoclingDocument, el) -> Optional[TextItem]: def _first_child(self, el, tag_name: str): for node in el.childNodes: - if getattr(node, "nodeType", None) == node.ELEMENT_NODE and node.tagName == tag_name: + if ( + getattr(node, "nodeType", None) == node.ELEMENT_NODE + and node.tagName == tag_name + ): return node return None @@ -1802,10 +1858,14 @@ def _get_text(self, el) -> str: return "".join(out) # --------- Location helpers --------- - def _ensure_page_exists(self, *, doc: DoclingDocument, page_no: int, resolution: int) -> None: + def _ensure_page_exists( + self, *, doc: DoclingDocument, page_no: int, resolution: int + ) -> None: # If the page already exists, do nothing; otherwise add with a square size based on resolution if page_no not in doc.pages: - doc.add_page(page_no=page_no, size=Size(width=resolution, height=resolution)) + doc.add_page( + page_no=page_no, size=Size(width=resolution, height=resolution) + ) def _extract_provenance(self, *, doc: DoclingDocument, el) -> list[ProvenanceItem]: # Collect immediate child tokens in groups of 4 @@ -1823,7 +1883,10 @@ def _extract_provenance(self, *, doc: DoclingDocument, el) -> list[ProvenanceIte except Exception: v = 0 try: - r = int(node.getAttribute(IDocTagsAttributeKey.RESOLUTION.value) or str(self._default_resolution)) + r = int( + node.getAttribute(IDocTagsAttributeKey.RESOLUTION.value) + or str(self._default_resolution) + ) except Exception: r = self._default_resolution values.append(v) @@ -1832,13 +1895,17 @@ def _extract_provenance(self, *, doc: DoclingDocument, el) -> list[ProvenanceIte if len(values) == 4: # Ensure page exists (and set consistent default size for this page) self._ensure_page_exists( - doc=doc, page_no=self._page_no, resolution=res_for_group or self._default_resolution + doc=doc, + page_no=self._page_no, + resolution=res_for_group or self._default_resolution, ) l = float(min(values[0], values[2])) t = float(min(values[1], values[3])) rgt = float(max(values[0], values[2])) btm = float(max(values[1], values[3])) - bbox = BoundingBox.from_tuple((l, t, rgt, btm), origin=CoordOrigin.TOPLEFT) + bbox = BoundingBox.from_tuple( + (l, t, rgt, btm), origin=CoordOrigin.TOPLEFT + ) provs.append( ProvenanceItem(page_no=self._page_no, bbox=bbox, charspan=(0, 0)) ) diff --git a/test/data/doc/dummy_doc_with_meta.gt.idt.xml b/test/data/doc/dummy_doc_with_meta.gt.idt.xml index 525f7222..d40943b9 100644 --- a/test/data/doc/dummy_doc_with_meta.gt.idt.xml +++ b/test/data/doc/dummy_doc_with_meta.gt.idt.xml @@ -11,14 +11,14 @@ DocLayNet: A Large Human-Annotated Dataset for Document-Layout Analysis + + + + + + Figure 1: Four examples of complex page layouts across different document categories + - - - - - - Figure 1: Four examples of complex page layouts across different document categories - ... Bar chart diff --git a/test/test_deserializer_idoctags.py b/test/test_deserializer_idoctags.py index 67b99c6d..a6d09f19 100644 --- a/test/test_deserializer_idoctags.py +++ b/test/test_deserializer_idoctags.py @@ -1,5 +1,3 @@ -import pytest - from docling_core.experimental.idoctags import ( IDocTagsDocDeserializer, IDocTagsDocSerializer, @@ -15,6 +13,8 @@ ) from docling_core.types.doc.labels import CodeLanguageLabel +DO_PRINT: bool = False + def _serialize(doc: DoclingDocument) -> str: ser = IDocTagsDocSerializer(doc=doc, params=IDocTagsParams()) @@ -41,7 +41,8 @@ def test_roundtrip_text(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.TEXT, text="Hello world") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TEXT @@ -52,7 +53,8 @@ def test_roundtrip_title(): doc = DoclingDocument(name="t") doc.add_title(text="My Title") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TITLE @@ -63,7 +65,8 @@ def test_roundtrip_heading(): doc = DoclingDocument(name="t") doc.add_heading(text="Section A", level=2) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 h = doc2.texts[0] @@ -75,7 +78,8 @@ def test_roundtrip_caption(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.CAPTION, text="Cap text") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CAPTION @@ -86,7 +90,8 @@ def test_roundtrip_footnote(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.FOOTNOTE, text="Foot note") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FOOTNOTE @@ -97,7 +102,8 @@ def test_roundtrip_page_header(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.PAGE_HEADER, text="Header") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_HEADER @@ -108,7 +114,8 @@ def test_roundtrip_page_footer(): doc = DoclingDocument(name="t") doc.add_text(label=DocItemLabel.PAGE_FOOTER, text="Footer") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_FOOTER @@ -119,7 +126,8 @@ def test_roundtrip_code(): doc = DoclingDocument(name="t") doc.add_code(text="print('hi')", code_language=CodeLanguageLabel.PYTHON) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CODE @@ -131,7 +139,8 @@ def test_roundtrip_formula(): doc = DoclingDocument(name="t") doc.add_formula(text="E=mc^2") dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FORMULA @@ -144,7 +153,8 @@ def test_roundtrip_list_unordered(): doc.add_list_item("A", parent=lg, enumerated=False) doc.add_list_item("B", parent=lg, enumerated=False) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) # Ensure group created and items present assert len(doc2.groups) == 1 @@ -158,7 +168,8 @@ def test_roundtrip_list_ordered(): doc.add_list_item("1", parent=lg, enumerated=True) doc.add_list_item("2", parent=lg, enumerated=True) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.groups) == 1 assert len(doc2.texts) == 2 @@ -170,7 +181,8 @@ def test_roundtrip_picture_with_caption(): cap = doc.add_text(label=DocItemLabel.CAPTION, text="Fig 1") doc.add_picture(caption=cap) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.pictures) == 1 # Caption added as a separate text item referenced by the picture @@ -186,7 +198,8 @@ def test_roundtrip_table_simple(): td.add_row(["C1", "C2"]) # data row doc.add_table(data=td) dt = _serialize(doc) - print("\n",dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.tables) == 1 t2 = doc2.tables[0].data @@ -205,9 +218,10 @@ def test_roundtrip_table_with_caption(): doc.add_table(data=td, caption=cap) dt = _serialize(doc) - print(dt) + if DO_PRINT: + print(dt) doc2 = _deserialize(dt) - + # One table reconstructed with same grid assert len(doc2.tables) == 1 t2 = doc2.tables[0] @@ -226,22 +240,25 @@ def test_roundtrip_text_prov(): _add_default_page(doc) doc.add_text(label=DocItemLabel.TEXT, text="Hello world", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) dt2 = _serialize(doc2) - print("\n", dt2) - print(f"`{doc2.texts[0].text}`") + if DO_PRINT: + print("\n", dt2) + print(f"`{doc2.texts[0].text}`") assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TEXT assert doc2.texts[0].text == "Hello world" - + def test_roundtrip_title_prov(): doc = DoclingDocument(name="t") _add_default_page(doc) doc.add_title(text="My Title", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.TITLE @@ -253,7 +270,8 @@ def test_roundtrip_heading_prov(): _add_default_page(doc) doc.add_heading(text="Section A", level=2, prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 h = doc2.texts[0] @@ -266,7 +284,8 @@ def test_roundtrip_caption_prov(): _add_default_page(doc) doc.add_text(label=DocItemLabel.CAPTION, text="Cap text", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CAPTION @@ -278,7 +297,8 @@ def test_roundtrip_footnote_prov(): _add_default_page(doc) doc.add_text(label=DocItemLabel.FOOTNOTE, text="Foot note", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FOOTNOTE @@ -290,7 +310,8 @@ def test_roundtrip_page_header_prov(): _add_default_page(doc) doc.add_text(label=DocItemLabel.PAGE_HEADER, text="Header", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_HEADER @@ -302,7 +323,8 @@ def test_roundtrip_page_footer_prov(): _add_default_page(doc) doc.add_text(label=DocItemLabel.PAGE_FOOTER, text="Footer", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.PAGE_FOOTER @@ -316,7 +338,8 @@ def test_roundtrip_code_prov(): text="print('hi')", code_language=CodeLanguageLabel.PYTHON, prov=_default_prov() ) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.CODE @@ -329,7 +352,8 @@ def test_roundtrip_formula_prov(): _add_default_page(doc) doc.add_formula(text="E=mc^2", prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.texts) == 1 assert doc2.texts[0].label == DocItemLabel.FORMULA @@ -344,7 +368,8 @@ def test_roundtrip_list_unordered_prov(): doc.add_list_item("A", parent=lg, enumerated=False, prov=prov) doc.add_list_item("B", parent=lg, enumerated=False, prov=prov) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.groups) == 1 assert len(doc2.texts) == 2 @@ -359,7 +384,8 @@ def test_roundtrip_list_ordered_prov(): doc.add_list_item("1", parent=lg, enumerated=True, prov=prov) doc.add_list_item("2", parent=lg, enumerated=True, prov=prov) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.groups) == 1 assert len(doc2.texts) == 2 @@ -372,7 +398,8 @@ def test_roundtrip_picture_with_caption_prov(): cap = doc.add_text(label=DocItemLabel.CAPTION, text="Fig 1", prov=_default_prov()) doc.add_picture(caption=cap, prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.pictures) == 1 assert len(doc2.texts) >= 1 @@ -388,7 +415,8 @@ def test_roundtrip_table_simple_prov(): td.add_row(["C1", "C2"]) # data row doc.add_table(data=td, prov=_default_prov()) dt = _serialize(doc) - print("\n", dt) + if DO_PRINT: + print("\n", dt) doc2 = _deserialize(dt) assert len(doc2.tables) == 1 t2 = doc2.tables[0].data @@ -407,7 +435,8 @@ def test_roundtrip_table_with_caption_prov(): doc.add_table(data=td, caption=cap, prov=_default_prov()) dt = _serialize(doc) - print(dt) + if DO_PRINT: + print(dt) doc2 = _deserialize(dt) assert len(doc2.tables) == 1 From 5b9a1dc7dc2eabb1cea8aeea21878fdbd10691c3 Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Sun, 14 Dec 2025 08:31:35 +0100 Subject: [PATCH 16/17] made the OTSL serialization and deserialization self-contained in IDocTags Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 459 ++++++- examples/convert_to_idoctags.py | 430 ++++++ pyproject.toml | 5 +- test/test_deserializer_idoctags.py | 91 +- uv.lock | 1829 ++++++++++++++++++++++++- 5 files changed, 2749 insertions(+), 65 deletions(-) create mode 100644 examples/convert_to_idoctags.py diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index 62278560..d0b55824 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -50,6 +50,7 @@ SectionHeaderItem, Size, SummaryMetaField, + TableCell, TableData, TableItem, TabularChartMetaField, @@ -57,7 +58,6 @@ ) from docling_core.types.doc.base import CoordOrigin from docling_core.types.doc.labels import CodeLanguageLabel, DocItemLabel -from docling_core.types.doc.utils import parse_otsl_table_content # Note: Intentionally avoid importing DocumentToken here to ensure # IDocTags uses only its own token vocabulary. @@ -113,7 +113,11 @@ def _create_location_tokens_for_bbox( def _create_location_tokens_for_item( - *, item: "DocItem", doc: "DoclingDocument", xres: int = 512, yres: int = 512 + *, + item: "DocItem", + doc: "DoclingDocument", + xres: int = DOCTAGS_RESOLUTION, + yres: int = DOCTAGS_RESOLUTION, ) -> str: """Create concatenated `` tokens for an item's provenance.""" if not getattr(item, "prov", None): @@ -354,20 +358,6 @@ class IDocTagsToken(str, Enum): FACETS = "facets" -class IDocTagsTableToken(str, Enum): - """Serialized OTSL table tokens used in DocTags output.""" - - OTSL_ECEL = f"<{IDocTagsToken.ECEL.value}/>" # empty cell - OTSL_FCEL = f"<{IDocTagsToken.FCEL.value}/>" # cell with content - OTSL_LCEL = f"<{IDocTagsToken.LCEL.value}/>" # left looking cell, - OTSL_UCEL = f"<{IDocTagsToken.UCEL.value}/>" # up looking cell, - OTSL_XCEL = f"<{IDocTagsToken.XCEL.value}/>" # 2d extension cell (cross cell), - OTSL_NL = f"<{IDocTagsToken.NL.value}/>" # new line, - OTSL_CHED = f"<{IDocTagsToken.CHED.value}/>" # - column header cell, - OTSL_RHED = f"<{IDocTagsToken.RHED.value}/>" # - row header cell, - OTSL_SROW = f"<{IDocTagsToken.SROW.value}/>" # - section row cell - - class IDocTagsAttributeKey(str, Enum): """Attribute keys allowed on DocTags tokens.""" @@ -474,8 +464,8 @@ class IDocTagsVocabulary(BaseModel): # Geometric: value in [0, res]; resolution optional. # Keep conservative defaults aligned with existing usage. IDocTagsToken.LOCATION: { - IDocTagsAttributeKey.VALUE: (0, 512), - IDocTagsAttributeKey.RESOLUTION: (512, 512), + IDocTagsAttributeKey.VALUE: (0, DOCTAGS_RESOLUTION), + IDocTagsAttributeKey.RESOLUTION: (DOCTAGS_RESOLUTION, DOCTAGS_RESOLUTION), }, # Temporal components IDocTagsToken.HOUR: {IDocTagsAttributeKey.VALUE: (0, 99)}, @@ -653,7 +643,9 @@ def create_heading_token(cls, *, level: int, closing: bool = False) -> str: return f'<{IDocTagsToken.HEADING.value} {IDocTagsAttributeKey.LEVEL.value}="{level}">' @classmethod - def create_location_token(cls, *, value: int, resolution: int = 512) -> str: + def create_location_token( + cls, *, value: int, resolution: int = DOCTAGS_RESOLUTION + ) -> str: """Create a location token with value and resolution. Validates both attributes using the configured ranges and ensures @@ -666,13 +658,13 @@ def create_location_token(cls, *, value: int, resolution: int = 512) -> str: IDocTagsAttributeKey.RESOLUTION, (resolution, resolution) ) if not (r_lo <= resolution <= r_hi): - raise ValueError(f"resolution must be in [{r_lo}, {r_hi}]") + raise ValueError(f"resolution: {resolution} must be in [{r_lo}, {r_hi}]") v_lo, v_hi = range_map[IDocTagsAttributeKey.VALUE] if not (v_lo <= value <= v_hi): - raise ValueError(f"value must be in [{v_lo}, {v_hi}]") + raise ValueError(f"value: {value} must be in [{v_lo}, {v_hi}]") if not (0 <= value <= resolution): - raise ValueError("value must be in [0, resolution]") + raise ValueError(f"value: {value} must be in [0, {resolution}]") return ( f"<{IDocTagsToken.LOCATION.value} " @@ -760,6 +752,82 @@ def get_special_tokens( return special_tokens + @classmethod + def create_selfclosing_token( + cls, + *, + token: IDocTagsToken, + attrs: Optional[dict["IDocTagsAttributeKey", Any]] = None, + ) -> str: + """Create a self-closing token with optional attributes (default None). + + - Validates the token is declared self-closing. + - Validates provided attributes against ``ALLOWED_ATTRIBUTES`` and + ``ALLOWED_ATTRIBUTE_VALUES`` or ``ALLOWED_ATTRIBUTE_RANGE`` when present. + """ + if not cls.IS_SELFCLOSING.get(token, False): + raise ValueError(f"token '{token.value}' is not self-closing") + + # No attributes requested + if not attrs: + return f"<{token.value}/>" + + # Validate attribute keys + allowed_keys = cls.ALLOWED_ATTRIBUTES.get(token, set()) + for k in attrs.keys(): + if k not in allowed_keys: + raise ValueError( + f"attribute '{getattr(k, 'value', str(k))}' not allowed on '{token.value}'" + ) + + # Validate values either via enumerations or numeric ranges + enum_map = cls.ALLOWED_ATTRIBUTE_VALUES.get(token, {}) + range_map = cls.ALLOWED_ATTRIBUTE_RANGE.get(token, {}) + + def _coerce_value(val: Any) -> str: + # Accept enums or native scalars; stringify for emission + if isinstance(val, Enum): + return val.value # type: ignore[attr-defined] + return str(val) + + parts: list[str] = [] + for k, v in attrs.items(): + # Enumerated allowed values + if k in enum_map: + allowed = enum_map[k] + # Accept either the enum or its string representation + v_norm = v.value if isinstance(v, Enum) else str(v) + allowed_strs = {a.value for a in allowed} + if v_norm not in allowed_strs: + raise ValueError( + f"invalid value '{v_norm}' for '{k.value}' on '{token.value}'" + ) + parts.append(f'{k.value}="{v_norm}"') + continue + + # Ranged numeric values + if k in range_map: + lo, hi = range_map[k] + try: + v_num = int(v) + except Exception: + raise ValueError( + f"attribute '{k.value}' on '{token.value}' must be an integer" + ) + if not (lo <= v_num <= hi): + raise ValueError( + f"attribute '{k.value}' must be in [{lo}, {hi}] for '{token.value}'" + ) + parts.append(f'{k.value}="{v_num}"') + continue + + # Free-form attribute without specific constraints + parts.append(f'{k.value}="{_coerce_value(v)}"') + + # Assemble tag + attrs_text = " ".join(parts) + return f"<{token.value} {attrs_text}/>" + class IDocTagsSerializationMode(str, Enum): """Serialization mode for IDocTags output.""" @@ -772,13 +840,12 @@ class IDocTagsParams(CommonParams): """IDocTags-specific serialization parameters independent of DocTags.""" # Geometry & content controls (aligned with DocTags defaults) - xsize: int = 500 - ysize: int = 500 + xsize: int = DOCTAGS_RESOLUTION + ysize: int = DOCTAGS_RESOLUTION add_location: bool = True add_caption: bool = True add_content: bool = True add_table_cell_location: bool = False - add_table_cell_text: bool = True add_page_break: bool = True mode: IDocTagsSerializationMode = IDocTagsSerializationMode.HUMAN_FRIENDLY @@ -1167,13 +1234,19 @@ def serialize( if chart_data and chart_data.table_cells: temp_doc = DoclingDocument(name="temp") temp_table = temp_doc.add_table(data=chart_data) - otsl_content = temp_table.export_to_otsl( - temp_doc, - add_cell_location=False, - # Suppress chart cell text if global content is off - add_cell_text=params.add_content, - self_closing=params.do_self_closing, - table_token=IDocTagsTableToken, + # Reuse the IDocTags table emission for chart data + params_chart = IDocTagsParams( + **{ + **params.model_dump(), + "add_table_cell_location": False, + } + ) + otsl_content = IDocTagsTableSerializer()._emit_otsl( + item=temp_table, # type: ignore[arg-type] + doc_serializer=doc_serializer, + doc=temp_doc, + params=params_chart, + **kwargs, ) body += otsl_content @@ -1200,8 +1273,145 @@ def serialize( class IDocTagsTableSerializer(BaseTableSerializer): """DocTags-specific table item serializer.""" - def _get_table_token(self) -> Any: - return IDocTagsTableToken + # _get_table_token no longer needed; OTSL tokens are emitted via vocabulary + + def _emit_otsl( + self, + *, + item: TableItem, + doc_serializer: BaseDocSerializer, + doc: DoclingDocument, + params: "IDocTagsParams", + **kwargs: Any, + ) -> str: + """Emit OTSL payload using IDocTags tokens and location semantics. + + Raises ValueError when per-cell location is requested but the + document/page context is unavailable. + """ + if not item.data or not item.data.table_cells: + return "" + + nrows, ncols = item.data.num_rows, item.data.num_cols + + # If per-cell location is requested and any cell has a bbox, we + # require page context from the table provenance and document pages. + need_cell_loc = params.add_table_cell_location and any( + (c.bbox is not None) for row in item.data.grid for c in row + ) + + if params.add_table_cell_location and (not need_cell_loc): + raise ValueError("Missing cell-locations in the table-grid.") + + page_no = 0 + if need_cell_loc: + if not item.prov: + raise ValueError( + "Per-cell location requested but table has no provenance (page_no)." + ) + page_no = item.prov[0].page_no + if not doc.pages or page_no not in doc.pages: + raise ValueError( + f"Per-cell location requested but no page info for page {page_no}." + ) + page_w, page_h = doc.pages[page_no].size.as_tuple() + if page_w <= 0 or page_h <= 0: + raise ValueError( + f"Invalid page size ({page_w}, {page_h}) for page {page_no}." + ) + else: + # Defaults will not be used unless a bbox is present and + # add_table_cell_location is true + page_w, page_h = (1.0, 1.0) + + parts: list[str] = [] + for i in range(nrows): + for j in range(ncols): + cell = item.data.grid[i][j] + content = cell._get_text( + doc=doc, doc_serializer=doc_serializer, **kwargs + ).strip() + + rowspan, rowstart = cell.row_span, cell.start_row_offset_idx + colspan, colstart = cell.col_span, cell.start_col_offset_idx + + # Optional per-cell location + cell_loc = "" + if params.add_table_cell_location: + + if cell.bbox is None: + raise ValueError("Missing cell-bbox in the table-grid.") + + bbox = cell.bbox.to_top_left_origin(page_h).as_tuple() + cell_loc = _create_location_tokens_for_bbox( + bbox=bbox, + page_w=page_w, + page_h=page_h, + xres=params.xsize, + yres=params.ysize, + ) + + if rowstart == i and colstart == j: + if content: + if cell.column_header: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.CHED + ) + ) + elif cell.row_header: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.RHED + ) + ) + elif cell.row_section: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.SROW + ) + ) + else: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.FCEL + ) + ) + + if params.add_table_cell_location: + parts.append(cell_loc) + if params.add_content: + parts.append(content) + else: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.ECEL + ) + ) + elif rowstart != i and colspan == 1: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.UCEL + ) + ) + elif colstart != j and rowspan == 1: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.LCEL + ) + ) + else: + parts.append( + IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.XCEL + ) + ) + + parts.append( + IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.NL) + ) + + return "".join(parts) @override def serialize( @@ -1234,22 +1444,22 @@ def serialize( caption_text = cap_res.text res_parts.append(cap_res) - # Build table payload: location (if any) + otsl content inside ... + # Build table payload: location (if any) + OTSL content inside ... otsl_payload = "" if item.self_ref not in doc_serializer.get_excluded_refs(**kwargs): body = "" if params.add_location: - body += _create_location_tokens_for_item(item=item, doc=doc) + body += _create_location_tokens_for_item( + item=item, doc=doc, xres=params.xsize, yres=params.ysize + ) - otsl_text = item.export_to_otsl( + otsl_text = self._emit_otsl( + item=item, + doc_serializer=doc_serializer, doc=doc, - add_cell_location=params.add_table_cell_location, - # Suppress cell text when global content is disabled - add_cell_text=(params.add_table_cell_text and params.add_content), - xsize=params.xsize, - ysize=params.ysize, + params=params, visited=visited, - table_token=self._get_table_token(), + **kwargs, ) body += otsl_text if body: @@ -1455,7 +1665,10 @@ def serialize_doc( text_res = delim.join([p.text for p in parts if p.text]) if self.params.add_page_break: - page_sep = f"<{IDocTagsToken.PAGE_BREAK.value}{'/' if self.params.do_self_closing else ''}>" + # Always emit well‑formed page breaks using the vocabulary + page_sep = IDocTagsVocabulary.create_selfclosing_token( + token=IDocTagsToken.PAGE_BREAK + ) for full_match, _, _ in self._get_page_breaks(text=text_res): text_res = text_res.replace(full_match, page_sep) @@ -1746,8 +1959,7 @@ def _parse_table_group(self, *, doc: DoclingDocument, el, parent) -> None: inner = self._inner_xml(otsl_el) # Remove any location tokens from the OTSL content before parsing inner = re.sub(r"<\s*location\b[^>]*/\s*>", "", inner) - normalized = self._normalize_otsl_tokens(inner) - td = parse_otsl_table_content(f"{normalized}") + td = self._parse_otsl_table_content(f"{inner}") tbl = doc.add_table( data=td, caption=caption, @@ -1782,8 +1994,7 @@ def _parse_picture_group(self, *, doc: DoclingDocument, el, parent) -> None: otsl_el = self._first_child(picture_el, IDocTagsToken.OTSL.value) if otsl_el is not None: inner = self._inner_xml(otsl_el) - normalized = self._normalize_otsl_tokens(inner) - td = parse_otsl_table_content(f"{normalized}") + td = self._parse_otsl_table_content(f"{inner}") if pic.meta is None: pic.meta = PictureMeta() pic.meta.tabular_chart = TabularChartMetaField(chart_data=td) @@ -1824,21 +2035,149 @@ def _inner_xml(self, el) -> str: parts.append(node.toxml()) return "".join(parts) - def _normalize_otsl_tokens(self, text: str) -> str: + # --------- OTSL table parsing (inlined) --------- + def _otsl_extract_tokens_and_text(self, s: str) -> tuple[list[str], list[str]]: + """Extract OTSL structural tokens and interleaved text. + + Strips the outer wrapper and ignores location tokens (expected + to be removed before). + """ + pattern = r"(<[^>]+>)" + tokens = re.findall(pattern, s) + # Drop the wrapper tags tokens = [ - IDocTagsToken.FCEL.value, - IDocTagsToken.ECEL.value, - IDocTagsToken.LCEL.value, - IDocTagsToken.UCEL.value, - IDocTagsToken.XCEL.value, - IDocTagsToken.NL.value, - IDocTagsToken.CHED.value, - IDocTagsToken.RHED.value, - IDocTagsToken.SROW.value, + t + for t in tokens + if t + not in [ + f"<{IDocTagsToken.OTSL.value}>", + f"", + ] + ] + + parts = re.split(pattern, s) + parts = [ + p + for p in parts + if p.strip() + and p + not in [ + f"<{IDocTagsToken.OTSL.value}>", + f"", + ] ] + return tokens, parts + + def _otsl_parse_texts( + self, texts: list[str], tokens: list[str] + ) -> tuple[list[TableCell], list[list[str]]]: + """Parse OTSL interleaved texts+tokens into TableCell list and row tokens.""" + # Token strings used in the stream (normalized to ) + + fcel = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.FCEL) + ecel = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.ECEL) + lcel = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.LCEL) + ucel = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.UCEL) + xcel = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.XCEL) + nl = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.NL) + ched = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.CHED) + rhed = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.RHED) + srow = IDocTagsVocabulary.create_selfclosing_token(token=IDocTagsToken.SROW) + + # Clean tokens to only structural OTSL markers + clean_tokens: list[str] = [] for t in tokens: - text = re.sub(rf"<\s*{t}\s*/>", f"<{t}>", text) - return text + if t in [ecel, fcel, lcel, ucel, xcel, nl, ched, rhed, srow]: + clean_tokens.append(t) + tokens = clean_tokens + + # Split into rows by NL markers while keeping segments + split_row_tokens = [ + list(group) + for is_sep, group in __import__("itertools").groupby( + tokens, lambda z: z == nl + ) + if not is_sep + ] + + table_cells: list[TableCell] = [] + r_idx = 0 + c_idx = 0 + + def count_right(rows: list[list[str]], c: int, r: int, which: list[str]) -> int: + span = 0 + j = c + while j < len(rows[r]) and rows[r][j] in which: + j += 1 + span += 1 + return span + + def count_down(rows: list[list[str]], c: int, r: int, which: list[str]) -> int: + span = 0 + i = r + while i < len(rows) and c < len(rows[i]) and rows[i][c] in which: + i += 1 + span += 1 + return span + + for i, t in enumerate(texts): + cell_text = "" + if t in [fcel, ecel, ched, rhed, srow]: + row_span = 1 + col_span = 1 + right_offset = 1 + if t != ecel and (i + 1) < len(texts): + cell_text = texts[i + 1] + right_offset = 2 + + next_right = ( + texts[i + right_offset] if i + right_offset < len(texts) else "" + ) + next_bottom = ( + split_row_tokens[r_idx + 1][c_idx] + if (r_idx + 1) < len(split_row_tokens) + and c_idx < len(split_row_tokens[r_idx + 1]) + else "" + ) + + if next_right in [lcel, xcel]: + col_span += count_right( + split_row_tokens, c_idx + 1, r_idx, [lcel, xcel] + ) + if next_bottom in [ucel, xcel]: + row_span += count_down( + split_row_tokens, c_idx, r_idx + 1, [ucel, xcel] + ) + + table_cells.append( + TableCell( + text=cell_text.strip(), + row_span=row_span, + col_span=col_span, + start_row_offset_idx=r_idx, + end_row_offset_idx=r_idx + row_span, + start_col_offset_idx=c_idx, + end_col_offset_idx=c_idx + col_span, + ) + ) + + if t in [fcel, ecel, ched, rhed, srow, lcel, ucel, xcel]: + c_idx += 1 + if t == nl: + r_idx += 1 + c_idx = 0 + + return table_cells, split_row_tokens + + def _parse_otsl_table_content(self, otsl_content: str) -> TableData: + """Parse OTSL content into TableData (inlined from utils).""" + tokens, mixed = self._otsl_extract_tokens_and_text(otsl_content) + table_cells, split_rows = self._otsl_parse_texts(mixed, tokens) + return TableData( + num_rows=len(split_rows), + num_cols=(max(len(r) for r in split_rows) if split_rows else 0), + table_cells=table_cells, + ) def _get_text(self, el) -> str: out: list[str] = [] diff --git a/examples/convert_to_idoctags.py b/examples/convert_to_idoctags.py new file mode 100644 index 00000000..64749223 --- /dev/null +++ b/examples/convert_to_idoctags.py @@ -0,0 +1,430 @@ +import os +import json +import glob +import argparse +from pathlib import Path +from typing import Sequence, Dict, Any, Optional +from collections import Counter +from io import BytesIO + +from PIL import Image as PILImage + +from datasets import load_dataset +from tqdm import tqdm +from transformers import ( + AutoTokenizer, + PreTrainedTokenizerBase, +) +from docling_core.types.doc import DoclingDocument, ImageRef +from docling_core.types.doc.base import ImageRefMode +from docling_core.experimental.idoctags import ( + IDocTagsSerializationMode, + IDocTagsParams, + IDocTagsVocabulary, + IDocTagsDocSerializer, +) + +import matplotlib.pyplot as plt +import numpy as np + +# In order to download **before** the datasets library, run +# +# HF_HUB_DISABLE_XET=1 hf download --repo-type dataset "docling-project/canva-set-a" +# + +def update_tokenizer(tokenizer: PreTrainedTokenizerBase, verbose: bool = False) -> PreTrainedTokenizerBase: + """Extend tokenizer with IDocTags special tokens. + + Parameters + - tokenizer: base tokenizer to extend + - verbose: print added tokens if True + """ + special_tokens = IDocTagsVocabulary.get_special_tokens() + if verbose: + for i, tok in enumerate(special_tokens): + print(i, "\t", tok) + tokenizer.add_tokens(special_tokens) + if verbose: + print(f"New vocab size: {tokenizer.vocab_size}") + return tokenizer + +def run_dump(cfg: Dict[str, Any]) -> int: + """Dump/serialize documents from a dataset to IDocTags strings/files. + + Config keys (with defaults): + - dataset_name: str ("docling-project/doclaynet-set-a") + - dataset_subset: str ("pdf_train") + - dataset_split: str ("train") + - output_dir: str ("./scratch/idoctags") + - failed_dir: str ("./scratch/idoctags_failed") — where to dump HTML+JSON when serialization fails + - write_outputs: bool (True) — write serialized outputs if True + - variants: list of serialization variants; each item: + {"add_content": bool, "mode": "LLM_FRIENDLY"|"HUMAN_FRIENDLY", "suffix": str} + Defaults to three variants mirroring prior behavior. + """ + dataset_name = cfg.get("dataset_name", "docling-project/doclaynet-set-a") + dataset_subset = cfg.get("dataset_subset", "train") + dataset_split = cfg.get("dataset_split", "train") + output_dir = Path(cfg.get("output_dir", "./scratch/idoctags")) + failed_dir = Path(cfg.get("failed_dir", "./scratch/idoctags_failed")) + pngs_dir = Path(cfg.get("pngs_dir", "./scratch/pngs_dir")) + write_outputs: bool = bool(cfg.get("write_outputs", True)) + + default_variants = [ + {"add_content": False, "mode": "LLM_FRIENDLY", "suffix": "_without"}, + {"add_content": True, "mode": "LLM_FRIENDLY", "suffix": "_with"}, + {"add_content": True, "mode": "HUMAN_FRIENDLY", "suffix": "_with_h"}, + ] + variants = cfg.get("variants", default_variants) + + if write_outputs: + output_dir.mkdir(parents=True, exist_ok=True) + # Create failed dir proactively; also created again on demand in the exception path + failed_dir.mkdir(parents=True, exist_ok=True) + + ds = load_dataset(dataset_name, dataset_subset) + split = ds[dataset_split] + total = len(split) + + errors: list[str] = [] + ok = 0 + + for idx, row in tqdm(enumerate(split), total=total, ncols=128): + text = row.get("GroundTruthDocument", "") + try: + doc = DoclingDocument.model_validate_json(text) + page_images = [ + __ for __ in row["GroundTruthPageImages"] + ] + # page_images[0].show() + + except Exception as exc: + errors.append( + f"Parse error: {exc} for {dataset_name}/{dataset_subset}/{dataset_split} idx={idx}" + ) + continue + + for i, __ in enumerate(page_images, start=1): + doc.pages[i].image = ImageRef.from_pil(__, dpi=140) + # png_path = pngs_dir / f"{idx}_{i}.png" + # __.save(png_path) + + try: + for var in variants: + params = IDocTagsParams() + params.add_content = bool(var.get("add_content", True)) + mode_str = str(var.get("mode", "LLM_FRIENDLY")) + params.mode = ( + IDocTagsSerializationMode.LLM_FRIENDLY + if mode_str == "LLM_FRIENDLY" + else IDocTagsSerializationMode.HUMAN_FRIENDLY + ) + + iser = IDocTagsDocSerializer(doc=doc, params=params) + serialized = iser.serialize().text + + if write_outputs: + suffix = var.get("suffix", "") + out_path = output_dir / f"{idx}{suffix}.idoctags" + with open(out_path, "w", encoding="utf-8") as fw: + fw.write(serialized) + ok += 1 + except Exception as exc: + print(f"exc: {exc}") + # page_images[0].show() + + failed_dir.mkdir(parents=True, exist_ok=True) + # JSON dump of the parsed DoclingDocument + json_path = failed_dir / f"{idx}.json" + print(f"\n\n -> writing {json_path}") + with open(json_path, "w", encoding="utf-8") as fj: + fj.write(doc.model_dump_json(indent=2)) + + try: + # Split-page HTML with layout/images; avoid single-column variant + html_path = failed_dir / f"{idx}_split.html" + print(f"\n\n -> writing {html_path}") + doc.save_as_html( + filename=html_path, + image_mode=ImageRefMode.EMBEDDED, + split_page_view=True, + include_annotations=True, + ) + except Exception as exc2: + print(f"exception: {exc2}") + + print(f"Serialized OK: {ok} / {total}") + if errors: + print("Errors:") + for e in errors: + print(" -", e) + return 0 if ok > 0 and not errors else (0 if ok == total else 1) + + +def run_analyse(cfg: Dict[str, Any]) -> int: + """Analyse token lengths and special-token usage from IDocTags files. + + Config keys (with defaults): + - tokenizer_name: str ("ibm-granite/granite-docling-258M") + - input_glob: str ("./scratch/idoctags/*_with_h.idoctags") + - pair_replace: dict with {"from": "_h", "to": ""} to locate paired files (optional) + - show_plots: bool (True) + - verbose: bool (False) + """ + tokenizer_name = cfg.get("tokenizer_name", "ibm-granite/granite-docling-258M") + input_glob_pat = cfg.get("input_glob", "./scratch/idoctags/*_with_h.idoctags") + pair_replace = cfg.get("pair_replace", {"from": "_h", "to": ""}) + show_plots = bool(cfg.get("show_plots", True)) + verbose = bool(cfg.get("verbose", False)) + + base_tokenizer: PreTrainedTokenizerBase = AutoTokenizer.from_pretrained(tokenizer_name) + ext_tokenizer: PreTrainedTokenizerBase = AutoTokenizer.from_pretrained(tokenizer_name) + ext_tokenizer = update_tokenizer(tokenizer=ext_tokenizer, verbose=verbose) + + filenames = sorted(glob.glob(input_glob_pat)) + if not filenames: + print(f"No files matched pattern: {input_glob_pat}") + return 1 + + base_lengths: list[int] = [] + ext_lengths: list[int] = [] + special_counts: Counter[int] = Counter() + + # Map special tokens to IDs in the extended tokenizer + special_tokens = IDocTagsVocabulary.get_special_tokens() + special_token_ids = {ext_tokenizer.convert_tokens_to_ids(tok) for tok in special_tokens} + + for filename in tqdm(filenames, desc="Analyse", ncols=128): + with open(filename, "r", encoding="utf-8") as fr: + text_h = fr.read() + + paired_name: Optional[str] = None + if isinstance(pair_replace, dict) and pair_replace.get("from") is not None: + paired_name = filename.replace(str(pair_replace.get("from")), str(pair_replace.get("to", ""))) + + text_plain = None + if paired_name and os.path.exists(paired_name): + with open(paired_name, "r", encoding="utf-8") as fr: + text_plain = fr.read() + + # Tokenize and collect lengths + base_tokens_h = base_tokenizer.encode(text_h, add_special_tokens=True) + ext_tokens_h = ext_tokenizer.encode(text_h, add_special_tokens=True) + base_lengths.append(len(base_tokens_h)) + ext_lengths.append(len(ext_tokens_h)) + + # Special token usage on the extended-tokenized sequence of the HF/H text + for tid in ext_tokens_h: + if tid in special_token_ids: + special_counts[tid] += 1 + + # Optionally also include the paired non-human-friendly text lengths + if text_plain is not None: + _ = base_tokenizer.encode(text_plain, add_special_tokens=True) + _e = ext_tokenizer.encode(text_plain, add_special_tokens=True) + base_lengths.append(len(_)) + ext_lengths.append(len(_e)) + for tid in _e: + if tid in special_token_ids: + special_counts[tid] += 1 + + # Report summary + print(f"Files analysed: {len(filenames)}") + print(f"Sequences tokenized (including pairs when available): {len(ext_lengths)}") + if ext_lengths: + arr = np.asarray(ext_lengths) + print( + f"Extended tokenizer lengths — min: {arr.min()}, p50: {np.median(arr)}, p95: {np.percentile(arr,95)}, max: {arr.max()}, mean: {arr.mean():.1f}" + ) + + # Map special IDs back to tokens and show top-k + if special_counts: + id_to_token = {i: ext_tokenizer.convert_ids_to_tokens([i])[0] for i in special_counts.keys()} + total_special = sum(special_counts.values()) + print("Special token usage (top 30):") + for tid, cnt in special_counts.most_common(30): + tok = id_to_token.get(tid, str(tid)) + pct = 100.0 * cnt / total_special if total_special else 0.0 + print(f" - {tok}: {cnt} ({pct:.2f}%)") + + if show_plots: + # Bar chart of top-N special tokens + items = special_counts.most_common(30) + labels = [id_to_token.get(tid, str(tid)) for tid, _ in items] + values = [v for _, v in items] + plt.figure(figsize=(12, 5)) + plt.bar(labels, values, color="#4C78A8") + plt.xticks(rotation=90) + plt.title("Top Special Tokens (by frequency)") + plt.tight_layout() + plt.show() + + # Visualizations for lengths + if show_plots and base_lengths and ext_lengths: + plot_token_histograms(base_lengths, ext_lengths) + plot_token_scatter_with_regression(base_lengths, ext_lengths) + + return 0 + + +def plot_token_histograms( + original_num_tokens: Sequence[int] | np.ndarray, + optimal_num_tokens: Sequence[int] | np.ndarray, + *, + bins: int = 50, + density: bool = False, +) -> None: + """Plot overlapping histograms for original and optimal token counts. + + Parameters + - original_num_tokens: sequence of counts before optimization + - optimal_num_tokens: sequence of counts after optimization + - bins: number of histogram bins + - density: normalize histograms if True + """ + x = np.asarray(original_num_tokens) + y = np.asarray(optimal_num_tokens) + + plt.figure(figsize=(10, 6)) + plt.hist( + x, + bins=bins, + alpha=0.5, + label="Original", + color="#4C78A8", + edgecolor="black", + density=density, + ) + plt.hist( + y, + bins=bins, + alpha=0.5, + label="Optimal", + color="#F58518", + edgecolor="black", + density=density, + ) + plt.xlabel("Number of tokens") + plt.ylabel("Density" if density else "Frequency") + plt.title("Token Count Distributions") + plt.legend() + plt.grid(axis="y", alpha=0.3) + plt.tight_layout() + plt.show() + + +def plot_token_scatter_with_regression( + original_num_tokens: Sequence[int] | np.ndarray, + optimal_num_tokens: Sequence[int] | np.ndarray, +) -> None: + """Scatter plot of original vs optimal tokens with a linear regression line. + + Parameters + - original_num_tokens: x-values + - optimal_num_tokens: y-values + """ + x = np.asarray(original_num_tokens, dtype=float) + y = np.asarray(optimal_num_tokens, dtype=float) + + if x.size == 0 or y.size == 0: + print("No data to plot.") + return + + # Linear regression with numpy polyfit (degree 1) + slope, intercept = np.polyfit(x, y, 1) + y_pred = slope * x + intercept + # Compute R^2 + ss_res = np.sum((y - y_pred) ** 2) + ss_tot = np.sum((y - np.mean(y)) ** 2) + r2 = 1 - ss_res / ss_tot if ss_tot > 0 else float("nan") + + # Prepare line for full x-range + x_line = np.linspace(x.min(), x.max(), 100) + y_line = slope * x_line + intercept + + plt.figure(figsize=(8, 8)) + plt.scatter(x, y, alpha=0.6, color="#4C78A8", label="Documents") + plt.plot(x_line, y_line, color="#E45756", linewidth=2, + label=f"y = {slope:.3f}x + {intercept:.3f} (R²={r2:.3f})") + plt.xlabel("Original tokens") + plt.ylabel("Optimal tokens") + plt.title("Original vs Optimal Tokens with Linear Fit") + plt.grid(alpha=0.3) + plt.legend() + plt.tight_layout() + plt.show() + +def default_config(mode: str) -> Dict[str, Any]: + if mode == "dump": + return { + "dataset_name": "docling-project/doclaynet-set-a", + "dataset_subset": "pdf_train", + "dataset_split": "train", + "output_dir": "./scratch/idoctags", + "failed_dir": "./scratch/idoctags_failed", + "write_outputs": True, + "variants": [ + {"add_content": False, "mode": "LLM_FRIENDLY", "suffix": "_without"}, + {"add_content": True, "mode": "LLM_FRIENDLY", "suffix": "_with"}, + {"add_content": True, "mode": "HUMAN_FRIENDLY", "suffix": "_with_h"}, + ], + } + elif mode == "analyse": + return { + "tokenizer_name": "ibm-granite/granite-docling-258M", + "input_glob": "./scratch/idoctags/*_with_h.idoctags", + "pair_replace": {"from": "_h", "to": ""}, + "show_plots": True, + "verbose": False, + } + else: + raise ValueError(f"Unknown mode for default config: {mode}") + + +def main(argv: Optional[Sequence[str]] = None) -> int: + parser = argparse.ArgumentParser(description="Convert and analyse IDocTags data") + parser.add_argument( + "--mode", + choices=["dump", "analyse"], + required=True, + help="Mode: dump dataset to idoctags or analyse token stats", + ) + parser.add_argument( + "--config", + type=Path, + default=None, + help="Path to JSON config. If omitted, a default config is created for the chosen mode.", + ) + parser.add_argument( + "--write-default-config", + action="store_true", + help="Only write the default config for the selected mode and exit.", + ) + args = parser.parse_args(list(argv) if argv is not None else None) + + cfg_path: Optional[Path] = args.config + cfg: Dict[str, Any] + + if cfg_path is None: + cfg = default_config(args.mode) + out_name = Path(f"idoctags_{args.mode}_config.json") + with open(out_name, "w", encoding="utf-8") as fw: + json.dump(cfg, fw, indent=2) + print(f"Wrote default config to: {out_name.resolve()}") + if args.write_default_config: + return 0 + # proceed using the freshly created config in-memory + else: + with open(cfg_path, "r", encoding="utf-8") as fr: + cfg = json.load(fr) + + if args.mode == "dump": + return run_dump(cfg) + elif args.mode == "analyse": + return run_analyse(cfg) + else: + raise AssertionError("unreachable") + + +if __name__ == "__main__": + raise SystemExit(main()) diff --git a/pyproject.toml b/pyproject.toml index 7c78cd18..caab0684 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -91,7 +91,10 @@ chunking-openai = [ # specific: 'tiktoken (>=0.9.0,<0.13.0)', ] - +examples = [ + "datasets>=4.0.0", + "matplotlib>=3.7.0", +] [dependency-groups] dev = [ "pre-commit~=3.7", diff --git a/test/test_deserializer_idoctags.py b/test/test_deserializer_idoctags.py index a6d09f19..6f014781 100644 --- a/test/test_deserializer_idoctags.py +++ b/test/test_deserializer_idoctags.py @@ -9,6 +9,7 @@ DoclingDocument, ProvenanceItem, Size, + TableCell, TableData, ) from docling_core.types.doc.labels import CodeLanguageLabel @@ -16,8 +17,22 @@ DO_PRINT: bool = False -def _serialize(doc: DoclingDocument) -> str: - ser = IDocTagsDocSerializer(doc=doc, params=IDocTagsParams()) +def _serialize( + doc: DoclingDocument, + add_location: bool = True, + add_content: bool = True, + add_table_cell_location: bool = False, + add_table_cell_text: bool = True, +) -> str: + ser = IDocTagsDocSerializer( + doc=doc, + params=IDocTagsParams( + add_location=add_location, + add_content=add_content, + add_table_cell_location=add_table_cell_location, + add_table_cell_text=add_table_cell_text, + ), + ) return ser.serialize().text @@ -448,3 +463,75 @@ def test_roundtrip_table_with_caption_prov(): assert len(t2.captions) == 1 cap_item = t2.captions[0].resolve(doc2) assert cap_item.label == DocItemLabel.CAPTION and cap_item.text == "Tbl 1" + + +def test_roundtrip_complex_table_with_caption_prov(): + doc = DoclingDocument(name="t") + _add_default_page(doc) + cap = doc.add_text(label=DocItemLabel.CAPTION, text="Tbl 1", prov=_default_prov()) + td = TableData(num_rows=3, num_cols=4) + + cell_0_0 = TableCell( + row_span=1, + col_span=1, + start_row_offset_idx=0, + end_row_offset_idx=1, + start_col_offset_idx=0, + end_col_offset_idx=1, + text="H 0-0", + ) + td.table_cells.append(cell_0_0) + + cell_0_1 = TableCell( + row_span=1, + col_span=3, + start_row_offset_idx=0, + end_row_offset_idx=1, + start_col_offset_idx=1, + end_col_offset_idx=4, + text="H 1-4", + ) + td.table_cells.append(cell_0_1) + + cell_1_0 = TableCell( + row_span=2, + col_span=1, + start_row_offset_idx=1, + end_row_offset_idx=3, + start_col_offset_idx=0, + end_col_offset_idx=1, + text="R 1-3", + ) + td.table_cells.append(cell_1_0) + + cell_1_1 = TableCell( + row_span=2, + col_span=3, + start_row_offset_idx=1, + end_row_offset_idx=3, + start_col_offset_idx=1, + end_col_offset_idx=4, + text="R 2-2", + ) + td.table_cells.append(cell_1_1) + + doc.add_table(data=td, caption=cap, prov=_default_prov()) + + dt = _serialize(doc, add_table_cell_text=True, add_content=True) + if DO_PRINT: + print(dt) + doc2 = _deserialize(dt) + + assert len(doc2.tables) == 1 + t2 = doc2.tables[0] + assert t2.data.num_rows == 3 and t2.data.num_cols == 4 + grid_texts = [[cell.text for cell in row] for row in t2.data.grid] + assert grid_texts == [ + ["H 0-0", "H 1-4", "H 1-4", "H 1-4"], + ["R 1-3", "R 2-2", "R 2-2", "R 2-2"], + ["R 1-3", "R 2-2", "R 2-2", "R 2-2"], + ] + + assert len(t2.captions) == 1 + cap_item = t2.captions[0].resolve(doc2) + assert cap_item.label == DocItemLabel.CAPTION and cap_item.text == "Tbl 1" diff --git a/uv.lock b/uv.lock index 30f766a2..eab3d3d5 100644 --- a/uv.lock +++ b/uv.lock @@ -1,5 +1,5 @@ version = 1 -revision = 3 +revision = 2 requires-python = ">=3.9, <4.0" resolution-markers = [ "python_full_version >= '3.12'", @@ -8,6 +8,165 @@ resolution-markers = [ "python_full_version < '3.10'", ] +[[package]] +name = "aiohappyeyeballs" +version = "2.6.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/26/30/f84a107a9c4331c14b2b586036f40965c128aa4fee4dda5d3d51cb14ad54/aiohappyeyeballs-2.6.1.tar.gz", hash = "sha256:c3f9d0113123803ccadfdf3f0faa505bc78e6a72d1cc4806cbd719826e943558", size = 22760, upload-time = "2025-03-12T01:42:48.764Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0f/15/5bf3b99495fb160b63f95972b81750f18f7f4e02ad051373b669d17d44f2/aiohappyeyeballs-2.6.1-py3-none-any.whl", hash = "sha256:f349ba8f4b75cb25c99c5c2d84e997e485204d2902a9597802b0371f09331fb8", size = 15265, upload-time = "2025-03-12T01:42:47.083Z" }, +] + +[[package]] +name = "aiohttp" +version = "3.13.2" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "aiohappyeyeballs" }, + { name = "aiosignal" }, + { name = "async-timeout", marker = "python_full_version < '3.11'" }, + { name = "attrs" }, + { name = "frozenlist" }, + { name = "multidict" }, + { name = "propcache" }, + { name = "yarl" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/1c/ce/3b83ebba6b3207a7135e5fcaba49706f8a4b6008153b4e30540c982fae26/aiohttp-3.13.2.tar.gz", hash = "sha256:40176a52c186aefef6eb3cad2cdd30cd06e3afbe88fe8ab2af9c0b90f228daca", size = 7837994, upload-time = "2025-10-28T20:59:39.937Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6d/34/939730e66b716b76046dedfe0842995842fa906ccc4964bba414ff69e429/aiohttp-3.13.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:2372b15a5f62ed37789a6b383ff7344fc5b9f243999b0cd9b629d8bc5f5b4155", size = 736471, upload-time = "2025-10-28T20:55:27.924Z" }, + { url = "https://files.pythonhosted.org/packages/fd/cf/dcbdf2df7f6ca72b0bb4c0b4509701f2d8942cf54e29ca197389c214c07f/aiohttp-3.13.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:e7f8659a48995edee7229522984bd1009c1213929c769c2daa80b40fe49a180c", size = 493985, upload-time = "2025-10-28T20:55:29.456Z" }, + { url = "https://files.pythonhosted.org/packages/9d/87/71c8867e0a1d0882dcbc94af767784c3cb381c1c4db0943ab4aae4fed65e/aiohttp-3.13.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:939ced4a7add92296b0ad38892ce62b98c619288a081170695c6babe4f50e636", size = 489274, upload-time = "2025-10-28T20:55:31.134Z" }, + { url = "https://files.pythonhosted.org/packages/38/0f/46c24e8dae237295eaadd113edd56dee96ef6462adf19b88592d44891dc5/aiohttp-3.13.2-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6315fb6977f1d0dd41a107c527fee2ed5ab0550b7d885bc15fee20ccb17891da", size = 1668171, upload-time = "2025-10-28T20:55:36.065Z" }, + { url = "https://files.pythonhosted.org/packages/eb/c6/4cdfb4440d0e28483681a48f69841fa5e39366347d66ef808cbdadddb20e/aiohttp-3.13.2-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:6e7352512f763f760baaed2637055c49134fd1d35b37c2dedfac35bfe5cf8725", size = 1636036, upload-time = "2025-10-28T20:55:37.576Z" }, + { url = "https://files.pythonhosted.org/packages/84/37/8708cf678628216fb678ab327a4e1711c576d6673998f4f43e86e9ae90dd/aiohttp-3.13.2-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:e09a0a06348a2dd73e7213353c90d709502d9786219f69b731f6caa0efeb46f5", size = 1727975, upload-time = "2025-10-28T20:55:39.457Z" }, + { url = "https://files.pythonhosted.org/packages/e6/2e/3ebfe12fdcb9b5f66e8a0a42dffcd7636844c8a018f261efb2419f68220b/aiohttp-3.13.2-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a09a6d073fb5789456545bdee2474d14395792faa0527887f2f4ec1a486a59d3", size = 1815823, upload-time = "2025-10-28T20:55:40.958Z" }, + { url = "https://files.pythonhosted.org/packages/a1/4f/ca2ef819488cbb41844c6cf92ca6dd15b9441e6207c58e5ae0e0fc8d70ad/aiohttp-3.13.2-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b59d13c443f8e049d9e94099c7e412e34610f1f49be0f230ec656a10692a5802", size = 1669374, upload-time = "2025-10-28T20:55:42.745Z" }, + { url = "https://files.pythonhosted.org/packages/f8/fe/1fe2e1179a0d91ce09c99069684aab619bf2ccde9b20bd6ca44f8837203e/aiohttp-3.13.2-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:20db2d67985d71ca033443a1ba2001c4b5693fe09b0e29f6d9358a99d4d62a8a", size = 1555315, upload-time = "2025-10-28T20:55:44.264Z" }, + { url = "https://files.pythonhosted.org/packages/5a/2b/f3781899b81c45d7cbc7140cddb8a3481c195e7cbff8e36374759d2ab5a5/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:960c2fc686ba27b535f9fd2b52d87ecd7e4fd1cf877f6a5cba8afb5b4a8bd204", size = 1639140, upload-time = "2025-10-28T20:55:46.626Z" }, + { url = "https://files.pythonhosted.org/packages/72/27/c37e85cd3ece6f6c772e549bd5a253d0c122557b25855fb274224811e4f2/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:6c00dbcf5f0d88796151e264a8eab23de2997c9303dd7c0bf622e23b24d3ce22", size = 1645496, upload-time = "2025-10-28T20:55:48.933Z" }, + { url = "https://files.pythonhosted.org/packages/66/20/3af1ab663151bd3780b123e907761cdb86ec2c4e44b2d9b195ebc91fbe37/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:fed38a5edb7945f4d1bcabe2fcd05db4f6ec7e0e82560088b754f7e08d93772d", size = 1697625, upload-time = "2025-10-28T20:55:50.377Z" }, + { url = "https://files.pythonhosted.org/packages/95/eb/ae5cab15efa365e13d56b31b0d085a62600298bf398a7986f8388f73b598/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:b395bbca716c38bef3c764f187860e88c724b342c26275bc03e906142fc5964f", size = 1542025, upload-time = "2025-10-28T20:55:51.861Z" }, + { url = "https://files.pythonhosted.org/packages/e9/2d/1683e8d67ec72d911397fe4e575688d2a9b8f6a6e03c8fdc9f3fd3d4c03f/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:204ffff2426c25dfda401ba08da85f9c59525cdc42bda26660463dd1cbcfec6f", size = 1714918, upload-time = "2025-10-28T20:55:53.515Z" }, + { url = "https://files.pythonhosted.org/packages/99/a2/ffe8e0e1c57c5e542d47ffa1fcf95ef2b3ea573bf7c4d2ee877252431efc/aiohttp-3.13.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:05c4dd3c48fb5f15db31f57eb35374cb0c09afdde532e7fb70a75aede0ed30f6", size = 1656113, upload-time = "2025-10-28T20:55:55.438Z" }, + { url = "https://files.pythonhosted.org/packages/0d/42/d511aff5c3a2b06c09d7d214f508a4ad8ac7799817f7c3d23e7336b5e896/aiohttp-3.13.2-cp310-cp310-win32.whl", hash = "sha256:e574a7d61cf10351d734bcddabbe15ede0eaa8a02070d85446875dc11189a251", size = 432290, upload-time = "2025-10-28T20:55:56.96Z" }, + { url = "https://files.pythonhosted.org/packages/8b/ea/1c2eb7098b5bad4532994f2b7a8228d27674035c9b3234fe02c37469ef14/aiohttp-3.13.2-cp310-cp310-win_amd64.whl", hash = "sha256:364f55663085d658b8462a1c3f17b2b84a5c2e1ba858e1b79bff7b2e24ad1514", size = 455075, upload-time = "2025-10-28T20:55:58.373Z" }, + { url = "https://files.pythonhosted.org/packages/35/74/b321e7d7ca762638cdf8cdeceb39755d9c745aff7a64c8789be96ddf6e96/aiohttp-3.13.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:4647d02df098f6434bafd7f32ad14942f05a9caa06c7016fdcc816f343997dd0", size = 743409, upload-time = "2025-10-28T20:56:00.354Z" }, + { url = "https://files.pythonhosted.org/packages/99/3d/91524b905ec473beaf35158d17f82ef5a38033e5809fe8742e3657cdbb97/aiohttp-3.13.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:e3403f24bcb9c3b29113611c3c16a2a447c3953ecf86b79775e7be06f7ae7ccb", size = 497006, upload-time = "2025-10-28T20:56:01.85Z" }, + { url = "https://files.pythonhosted.org/packages/eb/d3/7f68bc02a67716fe80f063e19adbd80a642e30682ce74071269e17d2dba1/aiohttp-3.13.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:43dff14e35aba17e3d6d5ba628858fb8cb51e30f44724a2d2f0c75be492c55e9", size = 493195, upload-time = "2025-10-28T20:56:03.314Z" }, + { url = "https://files.pythonhosted.org/packages/98/31/913f774a4708775433b7375c4f867d58ba58ead833af96c8af3621a0d243/aiohttp-3.13.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e2a9ea08e8c58bb17655630198833109227dea914cd20be660f52215f6de5613", size = 1747759, upload-time = "2025-10-28T20:56:04.904Z" }, + { url = "https://files.pythonhosted.org/packages/e8/63/04efe156f4326f31c7c4a97144f82132c3bb21859b7bb84748d452ccc17c/aiohttp-3.13.2-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:53b07472f235eb80e826ad038c9d106c2f653584753f3ddab907c83f49eedead", size = 1704456, upload-time = "2025-10-28T20:56:06.986Z" }, + { url = "https://files.pythonhosted.org/packages/8e/02/4e16154d8e0a9cf4ae76f692941fd52543bbb148f02f098ca73cab9b1c1b/aiohttp-3.13.2-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:e736c93e9c274fce6419af4aac199984d866e55f8a4cec9114671d0ea9688780", size = 1807572, upload-time = "2025-10-28T20:56:08.558Z" }, + { url = "https://files.pythonhosted.org/packages/34/58/b0583defb38689e7f06798f0285b1ffb3a6fb371f38363ce5fd772112724/aiohttp-3.13.2-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:ff5e771f5dcbc81c64898c597a434f7682f2259e0cd666932a913d53d1341d1a", size = 1895954, upload-time = "2025-10-28T20:56:10.545Z" }, + { url = "https://files.pythonhosted.org/packages/6b/f3/083907ee3437425b4e376aa58b2c915eb1a33703ec0dc30040f7ae3368c6/aiohttp-3.13.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a3b6fb0c207cc661fa0bf8c66d8d9b657331ccc814f4719468af61034b478592", size = 1747092, upload-time = "2025-10-28T20:56:12.118Z" }, + { url = "https://files.pythonhosted.org/packages/ac/61/98a47319b4e425cc134e05e5f3fc512bf9a04bf65aafd9fdcda5d57ec693/aiohttp-3.13.2-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:97a0895a8e840ab3520e2288db7cace3a1981300d48babeb50e7425609e2e0ab", size = 1606815, upload-time = "2025-10-28T20:56:14.191Z" }, + { url = "https://files.pythonhosted.org/packages/97/4b/e78b854d82f66bb974189135d31fce265dee0f5344f64dd0d345158a5973/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9e8f8afb552297aca127c90cb840e9a1d4bfd6a10d7d8f2d9176e1acc69bad30", size = 1723789, upload-time = "2025-10-28T20:56:16.101Z" }, + { url = "https://files.pythonhosted.org/packages/ed/fc/9d2ccc794fc9b9acd1379d625c3a8c64a45508b5091c546dea273a41929e/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:ed2f9c7216e53c3df02264f25d824b079cc5914f9e2deba94155190ef648ee40", size = 1718104, upload-time = "2025-10-28T20:56:17.655Z" }, + { url = "https://files.pythonhosted.org/packages/66/65/34564b8765ea5c7d79d23c9113135d1dd3609173da13084830f1507d56cf/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:99c5280a329d5fa18ef30fd10c793a190d996567667908bef8a7f81f8202b948", size = 1785584, upload-time = "2025-10-28T20:56:19.238Z" }, + { url = "https://files.pythonhosted.org/packages/30/be/f6a7a426e02fc82781afd62016417b3948e2207426d90a0e478790d1c8a4/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:2ca6ffef405fc9c09a746cb5d019c1672cd7f402542e379afc66b370833170cf", size = 1595126, upload-time = "2025-10-28T20:56:20.836Z" }, + { url = "https://files.pythonhosted.org/packages/e5/c7/8e22d5d28f94f67d2af496f14a83b3c155d915d1fe53d94b66d425ec5b42/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:47f438b1a28e926c37632bff3c44df7d27c9b57aaf4e34b1def3c07111fdb782", size = 1800665, upload-time = "2025-10-28T20:56:22.922Z" }, + { url = "https://files.pythonhosted.org/packages/d1/11/91133c8b68b1da9fc16555706aa7276fdf781ae2bb0876c838dd86b8116e/aiohttp-3.13.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:9acda8604a57bb60544e4646a4615c1866ee6c04a8edef9b8ee6fd1d8fa2ddc8", size = 1739532, upload-time = "2025-10-28T20:56:25.924Z" }, + { url = "https://files.pythonhosted.org/packages/17/6b/3747644d26a998774b21a616016620293ddefa4d63af6286f389aedac844/aiohttp-3.13.2-cp311-cp311-win32.whl", hash = "sha256:868e195e39b24aaa930b063c08bb0c17924899c16c672a28a65afded9c46c6ec", size = 431876, upload-time = "2025-10-28T20:56:27.524Z" }, + { url = "https://files.pythonhosted.org/packages/c3/63/688462108c1a00eb9f05765331c107f95ae86f6b197b865d29e930b7e462/aiohttp-3.13.2-cp311-cp311-win_amd64.whl", hash = "sha256:7fd19df530c292542636c2a9a85854fab93474396a52f1695e799186bbd7f24c", size = 456205, upload-time = "2025-10-28T20:56:29.062Z" }, + { url = "https://files.pythonhosted.org/packages/29/9b/01f00e9856d0a73260e86dd8ed0c2234a466c5c1712ce1c281548df39777/aiohttp-3.13.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:b1e56bab2e12b2b9ed300218c351ee2a3d8c8fdab5b1ec6193e11a817767e47b", size = 737623, upload-time = "2025-10-28T20:56:30.797Z" }, + { url = "https://files.pythonhosted.org/packages/5a/1b/4be39c445e2b2bd0aab4ba736deb649fabf14f6757f405f0c9685019b9e9/aiohttp-3.13.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:364e25edaabd3d37b1db1f0cbcee8c73c9a3727bfa262b83e5e4cf3489a2a9dc", size = 492664, upload-time = "2025-10-28T20:56:32.708Z" }, + { url = "https://files.pythonhosted.org/packages/28/66/d35dcfea8050e131cdd731dff36434390479b4045a8d0b9d7111b0a968f1/aiohttp-3.13.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:c5c94825f744694c4b8db20b71dba9a257cd2ba8e010a803042123f3a25d50d7", size = 491808, upload-time = "2025-10-28T20:56:34.57Z" }, + { url = "https://files.pythonhosted.org/packages/00/29/8e4609b93e10a853b65f8291e64985de66d4f5848c5637cddc70e98f01f8/aiohttp-3.13.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ba2715d842ffa787be87cbfce150d5e88c87a98e0b62e0f5aa489169a393dbbb", size = 1738863, upload-time = "2025-10-28T20:56:36.377Z" }, + { url = "https://files.pythonhosted.org/packages/9d/fa/4ebdf4adcc0def75ced1a0d2d227577cd7b1b85beb7edad85fcc87693c75/aiohttp-3.13.2-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:585542825c4bc662221fb257889e011a5aa00f1ae4d75d1d246a5225289183e3", size = 1700586, upload-time = "2025-10-28T20:56:38.034Z" }, + { url = "https://files.pythonhosted.org/packages/da/04/73f5f02ff348a3558763ff6abe99c223381b0bace05cd4530a0258e52597/aiohttp-3.13.2-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:39d02cb6025fe1aabca329c5632f48c9532a3dabccd859e7e2f110668972331f", size = 1768625, upload-time = "2025-10-28T20:56:39.75Z" }, + { url = "https://files.pythonhosted.org/packages/f8/49/a825b79ffec124317265ca7d2344a86bcffeb960743487cb11988ffb3494/aiohttp-3.13.2-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:e67446b19e014d37342f7195f592a2a948141d15a312fe0e700c2fd2f03124f6", size = 1867281, upload-time = "2025-10-28T20:56:41.471Z" }, + { url = "https://files.pythonhosted.org/packages/b9/48/adf56e05f81eac31edcfae45c90928f4ad50ef2e3ea72cb8376162a368f8/aiohttp-3.13.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4356474ad6333e41ccefd39eae869ba15a6c5299c9c01dfdcfdd5c107be4363e", size = 1752431, upload-time = "2025-10-28T20:56:43.162Z" }, + { url = "https://files.pythonhosted.org/packages/30/ab/593855356eead019a74e862f21523db09c27f12fd24af72dbc3555b9bfd9/aiohttp-3.13.2-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:eeacf451c99b4525f700f078becff32c32ec327b10dcf31306a8a52d78166de7", size = 1562846, upload-time = "2025-10-28T20:56:44.85Z" }, + { url = "https://files.pythonhosted.org/packages/39/0f/9f3d32271aa8dc35036e9668e31870a9d3b9542dd6b3e2c8a30931cb27ae/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d8a9b889aeabd7a4e9af0b7f4ab5ad94d42e7ff679aaec6d0db21e3b639ad58d", size = 1699606, upload-time = "2025-10-28T20:56:46.519Z" }, + { url = "https://files.pythonhosted.org/packages/2c/3c/52d2658c5699b6ef7692a3f7128b2d2d4d9775f2a68093f74bca06cf01e1/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:fa89cb11bc71a63b69568d5b8a25c3ca25b6d54c15f907ca1c130d72f320b76b", size = 1720663, upload-time = "2025-10-28T20:56:48.528Z" }, + { url = "https://files.pythonhosted.org/packages/9b/d4/8f8f3ff1fb7fb9e3f04fcad4e89d8a1cd8fc7d05de67e3de5b15b33008ff/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:8aa7c807df234f693fed0ecd507192fc97692e61fee5702cdc11155d2e5cadc8", size = 1737939, upload-time = "2025-10-28T20:56:50.77Z" }, + { url = "https://files.pythonhosted.org/packages/03/d3/ddd348f8a27a634daae39a1b8e291ff19c77867af438af844bf8b7e3231b/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:9eb3e33fdbe43f88c3c75fa608c25e7c47bbd80f48d012763cb67c47f39a7e16", size = 1555132, upload-time = "2025-10-28T20:56:52.568Z" }, + { url = "https://files.pythonhosted.org/packages/39/b8/46790692dc46218406f94374903ba47552f2f9f90dad554eed61bfb7b64c/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:9434bc0d80076138ea986833156c5a48c9c7a8abb0c96039ddbb4afc93184169", size = 1764802, upload-time = "2025-10-28T20:56:54.292Z" }, + { url = "https://files.pythonhosted.org/packages/ba/e4/19ce547b58ab2a385e5f0b8aa3db38674785085abcf79b6e0edd1632b12f/aiohttp-3.13.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ff15c147b2ad66da1f2cbb0622313f2242d8e6e8f9b79b5206c84523a4473248", size = 1719512, upload-time = "2025-10-28T20:56:56.428Z" }, + { url = "https://files.pythonhosted.org/packages/70/30/6355a737fed29dcb6dfdd48682d5790cb5eab050f7b4e01f49b121d3acad/aiohttp-3.13.2-cp312-cp312-win32.whl", hash = "sha256:27e569eb9d9e95dbd55c0fc3ec3a9335defbf1d8bc1d20171a49f3c4c607b93e", size = 426690, upload-time = "2025-10-28T20:56:58.736Z" }, + { url = "https://files.pythonhosted.org/packages/0a/0d/b10ac09069973d112de6ef980c1f6bb31cb7dcd0bc363acbdad58f927873/aiohttp-3.13.2-cp312-cp312-win_amd64.whl", hash = "sha256:8709a0f05d59a71f33fd05c17fc11fcb8c30140506e13c2f5e8ee1b8964e1b45", size = 453465, upload-time = "2025-10-28T20:57:00.795Z" }, + { url = "https://files.pythonhosted.org/packages/bf/78/7e90ca79e5aa39f9694dcfd74f4720782d3c6828113bb1f3197f7e7c4a56/aiohttp-3.13.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:7519bdc7dfc1940d201651b52bf5e03f5503bda45ad6eacf64dda98be5b2b6be", size = 732139, upload-time = "2025-10-28T20:57:02.455Z" }, + { url = "https://files.pythonhosted.org/packages/db/ed/1f59215ab6853fbaa5c8495fa6cbc39edfc93553426152b75d82a5f32b76/aiohttp-3.13.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:088912a78b4d4f547a1f19c099d5a506df17eacec3c6f4375e2831ec1d995742", size = 490082, upload-time = "2025-10-28T20:57:04.784Z" }, + { url = "https://files.pythonhosted.org/packages/68/7b/fe0fe0f5e05e13629d893c760465173a15ad0039c0a5b0d0040995c8075e/aiohttp-3.13.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5276807b9de9092af38ed23ce120539ab0ac955547b38563a9ba4f5b07b95293", size = 489035, upload-time = "2025-10-28T20:57:06.894Z" }, + { url = "https://files.pythonhosted.org/packages/d2/04/db5279e38471b7ac801d7d36a57d1230feeee130bbe2a74f72731b23c2b1/aiohttp-3.13.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1237c1375eaef0db4dcd7c2559f42e8af7b87ea7d295b118c60c36a6e61cb811", size = 1720387, upload-time = "2025-10-28T20:57:08.685Z" }, + { url = "https://files.pythonhosted.org/packages/31/07/8ea4326bd7dae2bd59828f69d7fdc6e04523caa55e4a70f4a8725a7e4ed2/aiohttp-3.13.2-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:96581619c57419c3d7d78703d5b78c1e5e5fc0172d60f555bdebaced82ded19a", size = 1688314, upload-time = "2025-10-28T20:57:10.693Z" }, + { url = "https://files.pythonhosted.org/packages/48/ab/3d98007b5b87ffd519d065225438cc3b668b2f245572a8cb53da5dd2b1bc/aiohttp-3.13.2-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a2713a95b47374169409d18103366de1050fe0ea73db358fc7a7acb2880422d4", size = 1756317, upload-time = "2025-10-28T20:57:12.563Z" }, + { url = "https://files.pythonhosted.org/packages/97/3d/801ca172b3d857fafb7b50c7c03f91b72b867a13abca982ed6b3081774ef/aiohttp-3.13.2-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:228a1cd556b3caca590e9511a89444925da87d35219a49ab5da0c36d2d943a6a", size = 1858539, upload-time = "2025-10-28T20:57:14.623Z" }, + { url = "https://files.pythonhosted.org/packages/f7/0d/4764669bdf47bd472899b3d3db91fffbe925c8e3038ec591a2fd2ad6a14d/aiohttp-3.13.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ac6cde5fba8d7d8c6ac963dbb0256a9854e9fafff52fbcc58fdf819357892c3e", size = 1739597, upload-time = "2025-10-28T20:57:16.399Z" }, + { url = "https://files.pythonhosted.org/packages/c4/52/7bd3c6693da58ba16e657eb904a5b6decfc48ecd06e9ac098591653b1566/aiohttp-3.13.2-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:f2bef8237544f4e42878c61cef4e2839fee6346dc60f5739f876a9c50be7fcdb", size = 1555006, upload-time = "2025-10-28T20:57:18.288Z" }, + { url = "https://files.pythonhosted.org/packages/48/30/9586667acec5993b6f41d2ebcf96e97a1255a85f62f3c653110a5de4d346/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:16f15a4eac3bc2d76c45f7ebdd48a65d41b242eb6c31c2245463b40b34584ded", size = 1683220, upload-time = "2025-10-28T20:57:20.241Z" }, + { url = "https://files.pythonhosted.org/packages/71/01/3afe4c96854cfd7b30d78333852e8e851dceaec1c40fd00fec90c6402dd2/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:bb7fb776645af5cc58ab804c58d7eba545a97e047254a52ce89c157b5af6cd0b", size = 1712570, upload-time = "2025-10-28T20:57:22.253Z" }, + { url = "https://files.pythonhosted.org/packages/11/2c/22799d8e720f4697a9e66fd9c02479e40a49de3de2f0bbe7f9f78a987808/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:e1b4951125ec10c70802f2cb09736c895861cd39fd9dcb35107b4dc8ae6220b8", size = 1733407, upload-time = "2025-10-28T20:57:24.37Z" }, + { url = "https://files.pythonhosted.org/packages/34/cb/90f15dd029f07cebbd91f8238a8b363978b530cd128488085b5703683594/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:550bf765101ae721ee1d37d8095f47b1f220650f85fe1af37a90ce75bab89d04", size = 1550093, upload-time = "2025-10-28T20:57:26.257Z" }, + { url = "https://files.pythonhosted.org/packages/69/46/12dce9be9d3303ecbf4d30ad45a7683dc63d90733c2d9fe512be6716cd40/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:fe91b87fc295973096251e2d25a811388e7d8adf3bd2b97ef6ae78bc4ac6c476", size = 1758084, upload-time = "2025-10-28T20:57:28.349Z" }, + { url = "https://files.pythonhosted.org/packages/f9/c8/0932b558da0c302ffd639fc6362a313b98fdf235dc417bc2493da8394df7/aiohttp-3.13.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:e0c8e31cfcc4592cb200160344b2fb6ae0f9e4effe06c644b5a125d4ae5ebe23", size = 1716987, upload-time = "2025-10-28T20:57:30.233Z" }, + { url = "https://files.pythonhosted.org/packages/5d/8b/f5bd1a75003daed099baec373aed678f2e9b34f2ad40d85baa1368556396/aiohttp-3.13.2-cp313-cp313-win32.whl", hash = "sha256:0740f31a60848d6edb296a0df827473eede90c689b8f9f2a4cdde74889eb2254", size = 425859, upload-time = "2025-10-28T20:57:32.105Z" }, + { url = "https://files.pythonhosted.org/packages/5d/28/a8a9fc6957b2cee8902414e41816b5ab5536ecf43c3b1843c10e82c559b2/aiohttp-3.13.2-cp313-cp313-win_amd64.whl", hash = "sha256:a88d13e7ca367394908f8a276b89d04a3652044612b9a408a0bb22a5ed976a1a", size = 452192, upload-time = "2025-10-28T20:57:34.166Z" }, + { url = "https://files.pythonhosted.org/packages/9b/36/e2abae1bd815f01c957cbf7be817b3043304e1c87bad526292a0410fdcf9/aiohttp-3.13.2-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:2475391c29230e063ef53a66669b7b691c9bfc3f1426a0f7bcdf1216bdbac38b", size = 735234, upload-time = "2025-10-28T20:57:36.415Z" }, + { url = "https://files.pythonhosted.org/packages/ca/e3/1ee62dde9b335e4ed41db6bba02613295a0d5b41f74a783c142745a12763/aiohttp-3.13.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:f33c8748abef4d8717bb20e8fb1b3e07c6adacb7fd6beaae971a764cf5f30d61", size = 490733, upload-time = "2025-10-28T20:57:38.205Z" }, + { url = "https://files.pythonhosted.org/packages/1a/aa/7a451b1d6a04e8d15a362af3e9b897de71d86feac3babf8894545d08d537/aiohttp-3.13.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:ae32f24bbfb7dbb485a24b30b1149e2f200be94777232aeadba3eecece4d0aa4", size = 491303, upload-time = "2025-10-28T20:57:40.122Z" }, + { url = "https://files.pythonhosted.org/packages/57/1e/209958dbb9b01174870f6a7538cd1f3f28274fdbc88a750c238e2c456295/aiohttp-3.13.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d7f02042c1f009ffb70067326ef183a047425bb2ff3bc434ead4dd4a4a66a2b", size = 1717965, upload-time = "2025-10-28T20:57:42.28Z" }, + { url = "https://files.pythonhosted.org/packages/08/aa/6a01848d6432f241416bc4866cae8dc03f05a5a884d2311280f6a09c73d6/aiohttp-3.13.2-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:93655083005d71cd6c072cdab54c886e6570ad2c4592139c3fb967bfc19e4694", size = 1667221, upload-time = "2025-10-28T20:57:44.869Z" }, + { url = "https://files.pythonhosted.org/packages/87/4f/36c1992432d31bbc789fa0b93c768d2e9047ec8c7177e5cd84ea85155f36/aiohttp-3.13.2-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:0db1e24b852f5f664cd728db140cf11ea0e82450471232a394b3d1a540b0f906", size = 1757178, upload-time = "2025-10-28T20:57:47.216Z" }, + { url = "https://files.pythonhosted.org/packages/ac/b4/8e940dfb03b7e0f68a82b88fd182b9be0a65cb3f35612fe38c038c3112cf/aiohttp-3.13.2-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:b009194665bcd128e23eaddef362e745601afa4641930848af4c8559e88f18f9", size = 1838001, upload-time = "2025-10-28T20:57:49.337Z" }, + { url = "https://files.pythonhosted.org/packages/d7/ef/39f3448795499c440ab66084a9db7d20ca7662e94305f175a80f5b7e0072/aiohttp-3.13.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c038a8fdc8103cd51dbd986ecdce141473ffd9775a7a8057a6ed9c3653478011", size = 1716325, upload-time = "2025-10-28T20:57:51.327Z" }, + { url = "https://files.pythonhosted.org/packages/d7/51/b311500ffc860b181c05d91c59a1313bdd05c82960fdd4035a15740d431e/aiohttp-3.13.2-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:66bac29b95a00db411cd758fea0e4b9bdba6d549dfe333f9a945430f5f2cc5a6", size = 1547978, upload-time = "2025-10-28T20:57:53.554Z" }, + { url = "https://files.pythonhosted.org/packages/31/64/b9d733296ef79815226dab8c586ff9e3df41c6aff2e16c06697b2d2e6775/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:4ebf9cfc9ba24a74cf0718f04aac2a3bbe745902cc7c5ebc55c0f3b5777ef213", size = 1682042, upload-time = "2025-10-28T20:57:55.617Z" }, + { url = "https://files.pythonhosted.org/packages/3f/30/43d3e0f9d6473a6db7d472104c4eff4417b1e9df01774cb930338806d36b/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:a4b88ebe35ce54205c7074f7302bd08a4cb83256a3e0870c72d6f68a3aaf8e49", size = 1680085, upload-time = "2025-10-28T20:57:57.59Z" }, + { url = "https://files.pythonhosted.org/packages/16/51/c709f352c911b1864cfd1087577760ced64b3e5bee2aa88b8c0c8e2e4972/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:98c4fb90bb82b70a4ed79ca35f656f4281885be076f3f970ce315402b53099ae", size = 1728238, upload-time = "2025-10-28T20:57:59.525Z" }, + { url = "https://files.pythonhosted.org/packages/19/e2/19bd4c547092b773caeb48ff5ae4b1ae86756a0ee76c16727fcfd281404b/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:ec7534e63ae0f3759df3a1ed4fa6bc8f75082a924b590619c0dd2f76d7043caa", size = 1544395, upload-time = "2025-10-28T20:58:01.914Z" }, + { url = "https://files.pythonhosted.org/packages/cf/87/860f2803b27dfc5ed7be532832a3498e4919da61299b4a1f8eb89b8ff44d/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:5b927cf9b935a13e33644cbed6c8c4b2d0f25b713d838743f8fe7191b33829c4", size = 1742965, upload-time = "2025-10-28T20:58:03.972Z" }, + { url = "https://files.pythonhosted.org/packages/67/7f/db2fc7618925e8c7a601094d5cbe539f732df4fb570740be88ed9e40e99a/aiohttp-3.13.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:88d6c017966a78c5265d996c19cdb79235be5e6412268d7e2ce7dee339471b7a", size = 1697585, upload-time = "2025-10-28T20:58:06.189Z" }, + { url = "https://files.pythonhosted.org/packages/0c/07/9127916cb09bb38284db5036036042b7b2c514c8ebaeee79da550c43a6d6/aiohttp-3.13.2-cp314-cp314-win32.whl", hash = "sha256:f7c183e786e299b5d6c49fb43a769f8eb8e04a2726a2bd5887b98b5cc2d67940", size = 431621, upload-time = "2025-10-28T20:58:08.636Z" }, + { url = "https://files.pythonhosted.org/packages/fb/41/554a8a380df6d3a2bba8a7726429a23f4ac62aaf38de43bb6d6cde7b4d4d/aiohttp-3.13.2-cp314-cp314-win_amd64.whl", hash = "sha256:fe242cd381e0fb65758faf5ad96c2e460df6ee5b2de1072fe97e4127927e00b4", size = 457627, upload-time = "2025-10-28T20:58:11Z" }, + { url = "https://files.pythonhosted.org/packages/c7/8e/3824ef98c039d3951cb65b9205a96dd2b20f22241ee17d89c5701557c826/aiohttp-3.13.2-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:f10d9c0b0188fe85398c61147bbd2a657d616c876863bfeff43376e0e3134673", size = 767360, upload-time = "2025-10-28T20:58:13.358Z" }, + { url = "https://files.pythonhosted.org/packages/a4/0f/6a03e3fc7595421274fa34122c973bde2d89344f8a881b728fa8c774e4f1/aiohttp-3.13.2-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:e7c952aefdf2460f4ae55c5e9c3e80aa72f706a6317e06020f80e96253b1accd", size = 504616, upload-time = "2025-10-28T20:58:15.339Z" }, + { url = "https://files.pythonhosted.org/packages/c6/aa/ed341b670f1bc8a6f2c6a718353d13b9546e2cef3544f573c6a1ff0da711/aiohttp-3.13.2-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c20423ce14771d98353d2e25e83591fa75dfa90a3c1848f3d7c68243b4fbded3", size = 509131, upload-time = "2025-10-28T20:58:17.693Z" }, + { url = "https://files.pythonhosted.org/packages/7f/f0/c68dac234189dae5c4bbccc0f96ce0cc16b76632cfc3a08fff180045cfa4/aiohttp-3.13.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e96eb1a34396e9430c19d8338d2ec33015e4a87ef2b4449db94c22412e25ccdf", size = 1864168, upload-time = "2025-10-28T20:58:20.113Z" }, + { url = "https://files.pythonhosted.org/packages/8f/65/75a9a76db8364b5d0e52a0c20eabc5d52297385d9af9c35335b924fafdee/aiohttp-3.13.2-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:23fb0783bc1a33640036465019d3bba069942616a6a2353c6907d7fe1ccdaf4e", size = 1719200, upload-time = "2025-10-28T20:58:22.583Z" }, + { url = "https://files.pythonhosted.org/packages/f5/55/8df2ed78d7f41d232f6bd3ff866b6f617026551aa1d07e2f03458f964575/aiohttp-3.13.2-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2e1a9bea6244a1d05a4e57c295d69e159a5c50d8ef16aa390948ee873478d9a5", size = 1843497, upload-time = "2025-10-28T20:58:24.672Z" }, + { url = "https://files.pythonhosted.org/packages/e9/e0/94d7215e405c5a02ccb6a35c7a3a6cfff242f457a00196496935f700cde5/aiohttp-3.13.2-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0a3d54e822688b56e9f6b5816fb3de3a3a64660efac64e4c2dc435230ad23bad", size = 1935703, upload-time = "2025-10-28T20:58:26.758Z" }, + { url = "https://files.pythonhosted.org/packages/0b/78/1eeb63c3f9b2d1015a4c02788fb543141aad0a03ae3f7a7b669b2483f8d4/aiohttp-3.13.2-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:7a653d872afe9f33497215745da7a943d1dc15b728a9c8da1c3ac423af35178e", size = 1792738, upload-time = "2025-10-28T20:58:29.787Z" }, + { url = "https://files.pythonhosted.org/packages/41/75/aaf1eea4c188e51538c04cc568040e3082db263a57086ea74a7d38c39e42/aiohttp-3.13.2-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:56d36e80d2003fa3fc0207fac644216d8532e9504a785ef9a8fd013f84a42c61", size = 1624061, upload-time = "2025-10-28T20:58:32.529Z" }, + { url = "https://files.pythonhosted.org/packages/9b/c2/3b6034de81fbcc43de8aeb209073a2286dfb50b86e927b4efd81cf848197/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:78cd586d8331fb8e241c2dd6b2f4061778cc69e150514b39a9e28dd050475661", size = 1789201, upload-time = "2025-10-28T20:58:34.618Z" }, + { url = "https://files.pythonhosted.org/packages/c9/38/c15dcf6d4d890217dae79d7213988f4e5fe6183d43893a9cf2fe9e84ca8d/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:20b10bbfbff766294fe99987f7bb3b74fdd2f1a2905f2562132641ad434dcf98", size = 1776868, upload-time = "2025-10-28T20:58:38.835Z" }, + { url = "https://files.pythonhosted.org/packages/04/75/f74fd178ac81adf4f283a74847807ade5150e48feda6aef024403716c30c/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:9ec49dff7e2b3c85cdeaa412e9d438f0ecd71676fde61ec57027dd392f00c693", size = 1790660, upload-time = "2025-10-28T20:58:41.507Z" }, + { url = "https://files.pythonhosted.org/packages/e7/80/7368bd0d06b16b3aba358c16b919e9c46cf11587dc572091031b0e9e3ef0/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:94f05348c4406450f9d73d38efb41d669ad6cd90c7ee194810d0eefbfa875a7a", size = 1617548, upload-time = "2025-10-28T20:58:43.674Z" }, + { url = "https://files.pythonhosted.org/packages/7d/4b/a6212790c50483cb3212e507378fbe26b5086d73941e1ec4b56a30439688/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:fa4dcb605c6f82a80c7f95713c2b11c3b8e9893b3ebd2bc9bde93165ed6107be", size = 1817240, upload-time = "2025-10-28T20:58:45.787Z" }, + { url = "https://files.pythonhosted.org/packages/ff/f7/ba5f0ba4ea8d8f3c32850912944532b933acbf0f3a75546b89269b9b7dde/aiohttp-3.13.2-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:cf00e5db968c3f67eccd2778574cf64d8b27d95b237770aa32400bd7a1ca4f6c", size = 1762334, upload-time = "2025-10-28T20:58:47.936Z" }, + { url = "https://files.pythonhosted.org/packages/7e/83/1a5a1856574588b1cad63609ea9ad75b32a8353ac995d830bf5da9357364/aiohttp-3.13.2-cp314-cp314t-win32.whl", hash = "sha256:d23b5fe492b0805a50d3371e8a728a9134d8de5447dce4c885f5587294750734", size = 464685, upload-time = "2025-10-28T20:58:50.642Z" }, + { url = "https://files.pythonhosted.org/packages/9f/4d/d22668674122c08f4d56972297c51a624e64b3ed1efaa40187607a7cb66e/aiohttp-3.13.2-cp314-cp314t-win_amd64.whl", hash = "sha256:ff0a7b0a82a7ab905cbda74006318d1b12e37c797eb1b0d4eb3e316cf47f658f", size = 498093, upload-time = "2025-10-28T20:58:52.782Z" }, + { url = "https://files.pythonhosted.org/packages/04/4a/3da532fdf51b5e58fffa1a86d6569184cb1bf4bf81cd4434b6541a8d14fd/aiohttp-3.13.2-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:7fbdf5ad6084f1940ce88933de34b62358d0f4a0b6ec097362dcd3e5a65a4989", size = 739009, upload-time = "2025-10-28T20:58:55.682Z" }, + { url = "https://files.pythonhosted.org/packages/89/74/fefa6f7939cdc1d77e5cad712004e675a8847dccc589dcc3abca7feaed73/aiohttp-3.13.2-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:7c3a50345635a02db61792c85bb86daffac05330f6473d524f1a4e3ef9d0046d", size = 495308, upload-time = "2025-10-28T20:58:58.408Z" }, + { url = "https://files.pythonhosted.org/packages/4e/b4/a0638ae1f12d09a0dc558870968a2f19a1eba1b10ad0a85ef142ddb40b50/aiohttp-3.13.2-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:0e87dff73f46e969af38ab3f7cb75316a7c944e2e574ff7c933bc01b10def7f5", size = 490624, upload-time = "2025-10-28T20:59:00.479Z" }, + { url = "https://files.pythonhosted.org/packages/02/73/361cd4cac9d98a5a4183d1f26faf7b777330f8dba838c5aae2412862bdd0/aiohttp-3.13.2-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2adebd4577724dcae085665f294cc57c8701ddd4d26140504db622b8d566d7aa", size = 1662968, upload-time = "2025-10-28T20:59:03.105Z" }, + { url = "https://files.pythonhosted.org/packages/9e/93/ce2ca7584555a6c7dd78f2e6b539a96c5172d88815e13a05a576e14a5a22/aiohttp-3.13.2-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e036a3a645fe92309ec34b918394bb377950cbb43039a97edae6c08db64b23e2", size = 1627117, upload-time = "2025-10-28T20:59:05.274Z" }, + { url = "https://files.pythonhosted.org/packages/a6/42/7ee0e699111f5fc20a69b3203e8f5d5da0b681f270b90bc088d15e339980/aiohttp-3.13.2-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:23ad365e30108c422d0b4428cf271156dd56790f6dd50d770b8e360e6c5ab2e6", size = 1724037, upload-time = "2025-10-28T20:59:07.522Z" }, + { url = "https://files.pythonhosted.org/packages/66/88/67ad5ff11dd61dd1d7882cda39f085d5fca31cf7e2143f5173429d8a591e/aiohttp-3.13.2-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:1f9b2c2d4b9d958b1f9ae0c984ec1dd6b6689e15c75045be8ccb4011426268ca", size = 1812899, upload-time = "2025-10-28T20:59:11.698Z" }, + { url = "https://files.pythonhosted.org/packages/60/1b/a46f6e1c2a347b9c7a789292279c159b327fadecbf8340f3b05fffff1151/aiohttp-3.13.2-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3a92cf4b9bea33e15ecbaa5c59921be0f23222608143d025c989924f7e3e0c07", size = 1660961, upload-time = "2025-10-28T20:59:14.425Z" }, + { url = "https://files.pythonhosted.org/packages/44/cc/1af9e466eafd9b5d8922238c69aaf95b656137add4c5db65f63ee129bf3c/aiohttp-3.13.2-cp39-cp39-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:070599407f4954021509193404c4ac53153525a19531051661440644728ba9a7", size = 1553851, upload-time = "2025-10-28T20:59:17.044Z" }, + { url = "https://files.pythonhosted.org/packages/e5/d1/9e5f4f40f9d0ee5668e9b5e7ebfb0eaf371cc09da03785decdc5da56f4b3/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:29562998ec66f988d49fb83c9b01694fa927186b781463f376c5845c121e4e0b", size = 1634260, upload-time = "2025-10-28T20:59:19.378Z" }, + { url = "https://files.pythonhosted.org/packages/83/2e/5d065091c4ae8b55a153f458f19308191bad3b62a89496aa081385486338/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:4dd3db9d0f4ebca1d887d76f7cdbcd1116ac0d05a9221b9dad82c64a62578c4d", size = 1639499, upload-time = "2025-10-28T20:59:22.013Z" }, + { url = "https://files.pythonhosted.org/packages/a3/de/58ae6dc73691a51ff16f69a94d13657bf417456fa0fdfed2b59dd6b4c293/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:d7bc4b7f9c4921eba72677cd9fedd2308f4a4ca3e12fab58935295ad9ea98700", size = 1694087, upload-time = "2025-10-28T20:59:24.773Z" }, + { url = "https://files.pythonhosted.org/packages/45/fe/4d9df516268867d83041b6c073ee15cd532dbea58b82d675a7e1cf2ec24c/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_riscv64.whl", hash = "sha256:dacd50501cd017f8cccb328da0c90823511d70d24a323196826d923aad865901", size = 1540532, upload-time = "2025-10-28T20:59:27.982Z" }, + { url = "https://files.pythonhosted.org/packages/24/e7/a802619308232499482bf30b3530efb5d141481cfd61850368350fb1acb5/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:8b2f1414f6a1e0683f212ec80e813f4abef94c739fd090b66c9adf9d2a05feac", size = 1710369, upload-time = "2025-10-28T20:59:30.363Z" }, + { url = "https://files.pythonhosted.org/packages/62/08/e8593f39f025efe96ef59550d17cf097222d84f6f84798bedac5bf037fce/aiohttp-3.13.2-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:04c3971421576ed24c191f610052bcb2f059e395bc2489dd99e397f9bc466329", size = 1649296, upload-time = "2025-10-28T20:59:33.285Z" }, + { url = "https://files.pythonhosted.org/packages/e5/fd/ffbc1b6aa46fc6c284af4a438b2c7eab79af1c8ac4b6d2ced185c17f403e/aiohttp-3.13.2-cp39-cp39-win32.whl", hash = "sha256:9f377d0a924e5cc94dc620bc6366fc3e889586a7f18b748901cf016c916e2084", size = 432980, upload-time = "2025-10-28T20:59:35.515Z" }, + { url = "https://files.pythonhosted.org/packages/ad/a9/d47e7873175a4d8aed425f2cdea2df700b2dd44fac024ffbd83455a69a50/aiohttp-3.13.2-cp39-cp39-win_amd64.whl", hash = "sha256:9c705601e16c03466cb72011bd1af55d68fa65b045356d8f96c216e5f6db0fa5", size = 456021, upload-time = "2025-10-28T20:59:37.659Z" }, +] + +[[package]] +name = "aiosignal" +version = "1.4.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "frozenlist" }, + { name = "typing-extensions", marker = "python_full_version < '3.13'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/61/62/06741b579156360248d1ec624842ad0edf697050bbaf7c3e46394e106ad1/aiosignal-1.4.0.tar.gz", hash = "sha256:f47eecd9468083c2029cc99945502cb7708b082c232f9aca65da147157b251c7", size = 25007, upload-time = "2025-07-03T22:54:43.528Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fb/76/641ae371508676492379f16e2fa48f4e2c11741bd63c48be4b12a6b09cba/aiosignal-1.4.0-py3-none-any.whl", hash = "sha256:053243f8b92b990551949e63930a839ff0cf0b0ebbe0597b0f3fb19e1a0fe82e", size = 7490, upload-time = "2025-07-03T22:54:42.156Z" }, +] + [[package]] name = "annotated-types" version = "0.7.0" @@ -17,6 +176,20 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/78/b6/6307fbef88d9b5ee7421e68d78a9f162e0da4900bc5f5793f6d3d0e34fb8/annotated_types-0.7.0-py3-none-any.whl", hash = "sha256:1f02e8b43a8fbbc3f3e0d4f0f4bfc8131bcb4eebe8849b8e5c773f3a1c582a53", size = 13643, upload-time = "2024-05-20T21:33:24.1Z" }, ] +[[package]] +name = "anyio" +version = "4.12.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "exceptiongroup", marker = "python_full_version < '3.11'" }, + { name = "idna" }, + { name = "typing-extensions", marker = "python_full_version < '3.13'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/16/ce/8a777047513153587e5434fd752e89334ac33e379aa3497db860eeb60377/anyio-4.12.0.tar.gz", hash = "sha256:73c693b567b0c55130c104d0b43a9baf3aa6a31fc6110116509f27bf75e21ec0", size = 228266, upload-time = "2025-11-28T23:37:38.911Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7f/9c/36c5c37947ebfb8c7f22e0eb6e4d188ee2d53aa3880f3f2744fb894f0cb1/anyio-4.12.0-py3-none-any.whl", hash = "sha256:dad2376a628f98eeca4881fc56cd06affd18f659b17a747d3ff0307ced94b1bb", size = 113362, upload-time = "2025-11-28T23:36:57.897Z" }, +] + [[package]] name = "appnope" version = "0.1.4" @@ -35,6 +208,15 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918, upload-time = "2024-11-30T04:30:10.946Z" }, ] +[[package]] +name = "async-timeout" +version = "5.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a5/ae/136395dfbfe00dfc94da3f3e136d0b13f394cba8f4841120e34226265780/async_timeout-5.0.1.tar.gz", hash = "sha256:d9321a7a3d5a6a5e187e824d2fa0793ce379a202935782d555d6e9d2735677d3", size = 9274, upload-time = "2024-11-06T16:41:39.6Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fe/ba/e2081de779ca30d473f21f5b30e0e737c438205440784c7dfc81efc2b029/async_timeout-5.0.1-py3-none-any.whl", hash = "sha256:39e3809566ff85354557ec2398b55e096c8364bacac9405a7a1fa429e77fe76c", size = 6233, upload-time = "2024-11-06T16:41:37.9Z" }, +] + [[package]] name = "attrs" version = "25.4.0" @@ -386,6 +568,240 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/60/97/891a0971e1e4a8c5d2b20bbe0e524dc04548d2307fee33cdeba148fd4fc7/comm-0.2.3-py3-none-any.whl", hash = "sha256:c615d91d75f7f04f095b30d1c1711babd43bdc6419c1be9886a85f2f4e489417", size = 7294, upload-time = "2025-07-25T14:02:02.896Z" }, ] +[[package]] +name = "contourpy" +version = "1.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "numpy", version = "2.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/f5/f6/31a8f28b4a2a4fa0e01085e542f3081ab0588eff8e589d39d775172c9792/contourpy-1.3.0.tar.gz", hash = "sha256:7ffa0db17717a8ffb127efd0c95a4362d996b892c2904db72428d5b52e1938a4", size = 13464370, upload-time = "2024-08-27T21:00:03.328Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6c/e0/be8dcc796cfdd96708933e0e2da99ba4bb8f9b2caa9d560a50f3f09a65f3/contourpy-1.3.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:880ea32e5c774634f9fcd46504bf9f080a41ad855f4fef54f5380f5133d343c7", size = 265366, upload-time = "2024-08-27T20:50:09.947Z" }, + { url = "https://files.pythonhosted.org/packages/50/d6/c953b400219443535d412fcbbc42e7a5e823291236bc0bb88936e3cc9317/contourpy-1.3.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:76c905ef940a4474a6289c71d53122a4f77766eef23c03cd57016ce19d0f7b42", size = 249226, upload-time = "2024-08-27T20:50:16.1Z" }, + { url = "https://files.pythonhosted.org/packages/6f/b4/6fffdf213ffccc28483c524b9dad46bb78332851133b36ad354b856ddc7c/contourpy-1.3.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:92f8557cbb07415a4d6fa191f20fd9d2d9eb9c0b61d1b2f52a8926e43c6e9af7", size = 308460, upload-time = "2024-08-27T20:50:22.536Z" }, + { url = "https://files.pythonhosted.org/packages/cf/6c/118fc917b4050f0afe07179a6dcbe4f3f4ec69b94f36c9e128c4af480fb8/contourpy-1.3.0-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:36f965570cff02b874773c49bfe85562b47030805d7d8360748f3eca570f4cab", size = 347623, upload-time = "2024-08-27T20:50:28.806Z" }, + { url = "https://files.pythonhosted.org/packages/f9/a4/30ff110a81bfe3abf7b9673284d21ddce8cc1278f6f77393c91199da4c90/contourpy-1.3.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:cacd81e2d4b6f89c9f8a5b69b86490152ff39afc58a95af002a398273e5ce589", size = 317761, upload-time = "2024-08-27T20:50:35.126Z" }, + { url = "https://files.pythonhosted.org/packages/99/e6/d11966962b1aa515f5586d3907ad019f4b812c04e4546cc19ebf62b5178e/contourpy-1.3.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:69375194457ad0fad3a839b9e29aa0b0ed53bb54db1bfb6c3ae43d111c31ce41", size = 322015, upload-time = "2024-08-27T20:50:40.318Z" }, + { url = "https://files.pythonhosted.org/packages/4d/e3/182383743751d22b7b59c3c753277b6aee3637049197624f333dac5b4c80/contourpy-1.3.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:7a52040312b1a858b5e31ef28c2e865376a386c60c0e248370bbea2d3f3b760d", size = 1262672, upload-time = "2024-08-27T20:50:55.643Z" }, + { url = "https://files.pythonhosted.org/packages/78/53/974400c815b2e605f252c8fb9297e2204347d1755a5374354ee77b1ea259/contourpy-1.3.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:3faeb2998e4fcb256542e8a926d08da08977f7f5e62cf733f3c211c2a5586223", size = 1321688, upload-time = "2024-08-27T20:51:11.293Z" }, + { url = "https://files.pythonhosted.org/packages/52/29/99f849faed5593b2926a68a31882af98afbeac39c7fdf7de491d9c85ec6a/contourpy-1.3.0-cp310-cp310-win32.whl", hash = "sha256:36e0cff201bcb17a0a8ecc7f454fe078437fa6bda730e695a92f2d9932bd507f", size = 171145, upload-time = "2024-08-27T20:51:15.2Z" }, + { url = "https://files.pythonhosted.org/packages/a9/97/3f89bba79ff6ff2b07a3cbc40aa693c360d5efa90d66e914f0ff03b95ec7/contourpy-1.3.0-cp310-cp310-win_amd64.whl", hash = "sha256:87ddffef1dbe5e669b5c2440b643d3fdd8622a348fe1983fad7a0f0ccb1cd67b", size = 216019, upload-time = "2024-08-27T20:51:19.365Z" }, + { url = "https://files.pythonhosted.org/packages/b3/1f/9375917786cb39270b0ee6634536c0e22abf225825602688990d8f5c6c19/contourpy-1.3.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0fa4c02abe6c446ba70d96ece336e621efa4aecae43eaa9b030ae5fb92b309ad", size = 266356, upload-time = "2024-08-27T20:51:24.146Z" }, + { url = "https://files.pythonhosted.org/packages/05/46/9256dd162ea52790c127cb58cfc3b9e3413a6e3478917d1f811d420772ec/contourpy-1.3.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:834e0cfe17ba12f79963861e0f908556b2cedd52e1f75e6578801febcc6a9f49", size = 250915, upload-time = "2024-08-27T20:51:28.683Z" }, + { url = "https://files.pythonhosted.org/packages/e1/5d/3056c167fa4486900dfbd7e26a2fdc2338dc58eee36d490a0ed3ddda5ded/contourpy-1.3.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:dbc4c3217eee163fa3984fd1567632b48d6dfd29216da3ded3d7b844a8014a66", size = 310443, upload-time = "2024-08-27T20:51:33.675Z" }, + { url = "https://files.pythonhosted.org/packages/ca/c2/1a612e475492e07f11c8e267ea5ec1ce0d89971be496c195e27afa97e14a/contourpy-1.3.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:4865cd1d419e0c7a7bf6de1777b185eebdc51470800a9f42b9e9decf17762081", size = 348548, upload-time = "2024-08-27T20:51:39.322Z" }, + { url = "https://files.pythonhosted.org/packages/45/cf/2c2fc6bb5874158277b4faf136847f0689e1b1a1f640a36d76d52e78907c/contourpy-1.3.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:303c252947ab4b14c08afeb52375b26781ccd6a5ccd81abcdfc1fafd14cf93c1", size = 319118, upload-time = "2024-08-27T20:51:44.717Z" }, + { url = "https://files.pythonhosted.org/packages/03/33/003065374f38894cdf1040cef474ad0546368eea7e3a51d48b8a423961f8/contourpy-1.3.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:637f674226be46f6ba372fd29d9523dd977a291f66ab2a74fbeb5530bb3f445d", size = 323162, upload-time = "2024-08-27T20:51:49.683Z" }, + { url = "https://files.pythonhosted.org/packages/42/80/e637326e85e4105a802e42959f56cff2cd39a6b5ef68d5d9aee3ea5f0e4c/contourpy-1.3.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:76a896b2f195b57db25d6b44e7e03f221d32fe318d03ede41f8b4d9ba1bff53c", size = 1265396, upload-time = "2024-08-27T20:52:04.926Z" }, + { url = "https://files.pythonhosted.org/packages/7c/3b/8cbd6416ca1bbc0202b50f9c13b2e0b922b64be888f9d9ee88e6cfabfb51/contourpy-1.3.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e1fd23e9d01591bab45546c089ae89d926917a66dceb3abcf01f6105d927e2cb", size = 1324297, upload-time = "2024-08-27T20:52:21.843Z" }, + { url = "https://files.pythonhosted.org/packages/4d/2c/021a7afaa52fe891f25535506cc861c30c3c4e5a1c1ce94215e04b293e72/contourpy-1.3.0-cp311-cp311-win32.whl", hash = "sha256:d402880b84df3bec6eab53cd0cf802cae6a2ef9537e70cf75e91618a3801c20c", size = 171808, upload-time = "2024-08-27T20:52:25.163Z" }, + { url = "https://files.pythonhosted.org/packages/8d/2f/804f02ff30a7fae21f98198828d0857439ec4c91a96e20cf2d6c49372966/contourpy-1.3.0-cp311-cp311-win_amd64.whl", hash = "sha256:6cb6cc968059db9c62cb35fbf70248f40994dfcd7aa10444bbf8b3faeb7c2d67", size = 217181, upload-time = "2024-08-27T20:52:29.13Z" }, + { url = "https://files.pythonhosted.org/packages/c9/92/8e0bbfe6b70c0e2d3d81272b58c98ac69ff1a4329f18c73bd64824d8b12e/contourpy-1.3.0-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:570ef7cf892f0afbe5b2ee410c507ce12e15a5fa91017a0009f79f7d93a1268f", size = 267838, upload-time = "2024-08-27T20:52:33.911Z" }, + { url = "https://files.pythonhosted.org/packages/e3/04/33351c5d5108460a8ce6d512307690b023f0cfcad5899499f5c83b9d63b1/contourpy-1.3.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:da84c537cb8b97d153e9fb208c221c45605f73147bd4cadd23bdae915042aad6", size = 251549, upload-time = "2024-08-27T20:52:39.179Z" }, + { url = "https://files.pythonhosted.org/packages/51/3d/aa0fe6ae67e3ef9f178389e4caaaa68daf2f9024092aa3c6032e3d174670/contourpy-1.3.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0be4d8425bfa755e0fd76ee1e019636ccc7c29f77a7c86b4328a9eb6a26d0639", size = 303177, upload-time = "2024-08-27T20:52:44.789Z" }, + { url = "https://files.pythonhosted.org/packages/56/c3/c85a7e3e0cab635575d3b657f9535443a6f5d20fac1a1911eaa4bbe1aceb/contourpy-1.3.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9c0da700bf58f6e0b65312d0a5e695179a71d0163957fa381bb3c1f72972537c", size = 341735, upload-time = "2024-08-27T20:52:51.05Z" }, + { url = "https://files.pythonhosted.org/packages/dd/8d/20f7a211a7be966a53f474bc90b1a8202e9844b3f1ef85f3ae45a77151ee/contourpy-1.3.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:eb8b141bb00fa977d9122636b16aa67d37fd40a3d8b52dd837e536d64b9a4d06", size = 314679, upload-time = "2024-08-27T20:52:58.473Z" }, + { url = "https://files.pythonhosted.org/packages/6e/be/524e377567defac0e21a46e2a529652d165fed130a0d8a863219303cee18/contourpy-1.3.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3634b5385c6716c258d0419c46d05c8aa7dc8cb70326c9a4fb66b69ad2b52e09", size = 320549, upload-time = "2024-08-27T20:53:06.593Z" }, + { url = "https://files.pythonhosted.org/packages/0f/96/fdb2552a172942d888915f3a6663812e9bc3d359d53dafd4289a0fb462f0/contourpy-1.3.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:0dce35502151b6bd35027ac39ba6e5a44be13a68f55735c3612c568cac3805fd", size = 1263068, upload-time = "2024-08-27T20:53:23.442Z" }, + { url = "https://files.pythonhosted.org/packages/2a/25/632eab595e3140adfa92f1322bf8915f68c932bac468e89eae9974cf1c00/contourpy-1.3.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:aea348f053c645100612b333adc5983d87be69acdc6d77d3169c090d3b01dc35", size = 1322833, upload-time = "2024-08-27T20:53:39.243Z" }, + { url = "https://files.pythonhosted.org/packages/73/e3/69738782e315a1d26d29d71a550dbbe3eb6c653b028b150f70c1a5f4f229/contourpy-1.3.0-cp312-cp312-win32.whl", hash = "sha256:90f73a5116ad1ba7174341ef3ea5c3150ddf20b024b98fb0c3b29034752c8aeb", size = 172681, upload-time = "2024-08-27T20:53:43.05Z" }, + { url = "https://files.pythonhosted.org/packages/0c/89/9830ba00d88e43d15e53d64931e66b8792b46eb25e2050a88fec4a0df3d5/contourpy-1.3.0-cp312-cp312-win_amd64.whl", hash = "sha256:b11b39aea6be6764f84360fce6c82211a9db32a7c7de8fa6dd5397cf1d079c3b", size = 218283, upload-time = "2024-08-27T20:53:47.232Z" }, + { url = "https://files.pythonhosted.org/packages/53/a1/d20415febfb2267af2d7f06338e82171824d08614084714fb2c1dac9901f/contourpy-1.3.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:3e1c7fa44aaae40a2247e2e8e0627f4bea3dd257014764aa644f319a5f8600e3", size = 267879, upload-time = "2024-08-27T20:53:51.597Z" }, + { url = "https://files.pythonhosted.org/packages/aa/45/5a28a3570ff6218d8bdfc291a272a20d2648104815f01f0177d103d985e1/contourpy-1.3.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:364174c2a76057feef647c802652f00953b575723062560498dc7930fc9b1cb7", size = 251573, upload-time = "2024-08-27T20:53:55.659Z" }, + { url = "https://files.pythonhosted.org/packages/39/1c/d3f51540108e3affa84f095c8b04f0aa833bb797bc8baa218a952a98117d/contourpy-1.3.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:32b238b3b3b649e09ce9aaf51f0c261d38644bdfa35cbaf7b263457850957a84", size = 303184, upload-time = "2024-08-27T20:54:00.225Z" }, + { url = "https://files.pythonhosted.org/packages/00/56/1348a44fb6c3a558c1a3a0cd23d329d604c99d81bf5a4b58c6b71aab328f/contourpy-1.3.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d51fca85f9f7ad0b65b4b9fe800406d0d77017d7270d31ec3fb1cc07358fdea0", size = 340262, upload-time = "2024-08-27T20:54:05.234Z" }, + { url = "https://files.pythonhosted.org/packages/2b/23/00d665ba67e1bb666152131da07e0f24c95c3632d7722caa97fb61470eca/contourpy-1.3.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:732896af21716b29ab3e988d4ce14bc5133733b85956316fb0c56355f398099b", size = 313806, upload-time = "2024-08-27T20:54:09.889Z" }, + { url = "https://files.pythonhosted.org/packages/5a/42/3cf40f7040bb8362aea19af9a5fb7b32ce420f645dd1590edcee2c657cd5/contourpy-1.3.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d73f659398a0904e125280836ae6f88ba9b178b2fed6884f3b1f95b989d2c8da", size = 319710, upload-time = "2024-08-27T20:54:14.536Z" }, + { url = "https://files.pythonhosted.org/packages/05/32/f3bfa3fc083b25e1a7ae09197f897476ee68e7386e10404bdf9aac7391f0/contourpy-1.3.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:c6c7c2408b7048082932cf4e641fa3b8ca848259212f51c8c59c45aa7ac18f14", size = 1264107, upload-time = "2024-08-27T20:54:29.735Z" }, + { url = "https://files.pythonhosted.org/packages/1c/1e/1019d34473a736664f2439542b890b2dc4c6245f5c0d8cdfc0ccc2cab80c/contourpy-1.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f317576606de89da6b7e0861cf6061f6146ead3528acabff9236458a6ba467f8", size = 1322458, upload-time = "2024-08-27T20:54:45.507Z" }, + { url = "https://files.pythonhosted.org/packages/22/85/4f8bfd83972cf8909a4d36d16b177f7b8bdd942178ea4bf877d4a380a91c/contourpy-1.3.0-cp313-cp313-win32.whl", hash = "sha256:31cd3a85dbdf1fc002280c65caa7e2b5f65e4a973fcdf70dd2fdcb9868069294", size = 172643, upload-time = "2024-08-27T20:55:52.754Z" }, + { url = "https://files.pythonhosted.org/packages/cc/4a/fb3c83c1baba64ba90443626c228ca14f19a87c51975d3b1de308dd2cf08/contourpy-1.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:4553c421929ec95fb07b3aaca0fae668b2eb5a5203d1217ca7c34c063c53d087", size = 218301, upload-time = "2024-08-27T20:55:56.509Z" }, + { url = "https://files.pythonhosted.org/packages/76/65/702f4064f397821fea0cb493f7d3bc95a5d703e20954dce7d6d39bacf378/contourpy-1.3.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:345af746d7766821d05d72cb8f3845dfd08dd137101a2cb9b24de277d716def8", size = 278972, upload-time = "2024-08-27T20:54:50.347Z" }, + { url = "https://files.pythonhosted.org/packages/80/85/21f5bba56dba75c10a45ec00ad3b8190dbac7fd9a8a8c46c6116c933e9cf/contourpy-1.3.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3bb3808858a9dc68f6f03d319acd5f1b8a337e6cdda197f02f4b8ff67ad2057b", size = 263375, upload-time = "2024-08-27T20:54:54.909Z" }, + { url = "https://files.pythonhosted.org/packages/0a/64/084c86ab71d43149f91ab3a4054ccf18565f0a8af36abfa92b1467813ed6/contourpy-1.3.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:420d39daa61aab1221567b42eecb01112908b2cab7f1b4106a52caaec8d36973", size = 307188, upload-time = "2024-08-27T20:55:00.184Z" }, + { url = "https://files.pythonhosted.org/packages/3d/ff/d61a4c288dc42da0084b8d9dc2aa219a850767165d7d9a9c364ff530b509/contourpy-1.3.0-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:4d63ee447261e963af02642ffcb864e5a2ee4cbfd78080657a9880b8b1868e18", size = 345644, upload-time = "2024-08-27T20:55:05.673Z" }, + { url = "https://files.pythonhosted.org/packages/ca/aa/00d2313d35ec03f188e8f0786c2fc61f589306e02fdc158233697546fd58/contourpy-1.3.0-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:167d6c890815e1dac9536dca00828b445d5d0df4d6a8c6adb4a7ec3166812fa8", size = 317141, upload-time = "2024-08-27T20:55:11.047Z" }, + { url = "https://files.pythonhosted.org/packages/8d/6a/b5242c8cb32d87f6abf4f5e3044ca397cb1a76712e3fa2424772e3ff495f/contourpy-1.3.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:710a26b3dc80c0e4febf04555de66f5fd17e9cf7170a7b08000601a10570bda6", size = 323469, upload-time = "2024-08-27T20:55:15.914Z" }, + { url = "https://files.pythonhosted.org/packages/6f/a6/73e929d43028a9079aca4bde107494864d54f0d72d9db508a51ff0878593/contourpy-1.3.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:75ee7cb1a14c617f34a51d11fa7524173e56551646828353c4af859c56b766e2", size = 1260894, upload-time = "2024-08-27T20:55:31.553Z" }, + { url = "https://files.pythonhosted.org/packages/2b/1e/1e726ba66eddf21c940821df8cf1a7d15cb165f0682d62161eaa5e93dae1/contourpy-1.3.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:33c92cdae89ec5135d036e7218e69b0bb2851206077251f04a6c4e0e21f03927", size = 1314829, upload-time = "2024-08-27T20:55:47.837Z" }, + { url = "https://files.pythonhosted.org/packages/b3/e3/b9f72758adb6ef7397327ceb8b9c39c75711affb220e4f53c745ea1d5a9a/contourpy-1.3.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:a11077e395f67ffc2c44ec2418cfebed032cd6da3022a94fc227b6faf8e2acb8", size = 265518, upload-time = "2024-08-27T20:56:01.333Z" }, + { url = "https://files.pythonhosted.org/packages/ec/22/19f5b948367ab5260fb41d842c7a78dae645603881ea6bc39738bcfcabf6/contourpy-1.3.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:e8134301d7e204c88ed7ab50028ba06c683000040ede1d617298611f9dc6240c", size = 249350, upload-time = "2024-08-27T20:56:05.432Z" }, + { url = "https://files.pythonhosted.org/packages/26/76/0c7d43263dd00ae21a91a24381b7e813d286a3294d95d179ef3a7b9fb1d7/contourpy-1.3.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e12968fdfd5bb45ffdf6192a590bd8ddd3ba9e58360b29683c6bb71a7b41edca", size = 309167, upload-time = "2024-08-27T20:56:10.034Z" }, + { url = "https://files.pythonhosted.org/packages/96/3b/cadff6773e89f2a5a492c1a8068e21d3fccaf1a1c1df7d65e7c8e3ef60ba/contourpy-1.3.0-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:fd2a0fc506eccaaa7595b7e1418951f213cf8255be2600f1ea1b61e46a60c55f", size = 348279, upload-time = "2024-08-27T20:56:15.41Z" }, + { url = "https://files.pythonhosted.org/packages/e1/86/158cc43aa549d2081a955ab11c6bdccc7a22caacc2af93186d26f5f48746/contourpy-1.3.0-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4cfb5c62ce023dfc410d6059c936dcf96442ba40814aefbfa575425a3a7f19dc", size = 318519, upload-time = "2024-08-27T20:56:21.813Z" }, + { url = "https://files.pythonhosted.org/packages/05/11/57335544a3027e9b96a05948c32e566328e3a2f84b7b99a325b7a06d2b06/contourpy-1.3.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:68a32389b06b82c2fdd68276148d7b9275b5f5cf13e5417e4252f6d1a34f72a2", size = 321922, upload-time = "2024-08-27T20:56:26.983Z" }, + { url = "https://files.pythonhosted.org/packages/0b/e3/02114f96543f4a1b694333b92a6dcd4f8eebbefcc3a5f3bbb1316634178f/contourpy-1.3.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:94e848a6b83da10898cbf1311a815f770acc9b6a3f2d646f330d57eb4e87592e", size = 1258017, upload-time = "2024-08-27T20:56:42.246Z" }, + { url = "https://files.pythonhosted.org/packages/f3/3b/bfe4c81c6d5881c1c643dde6620be0b42bf8aab155976dd644595cfab95c/contourpy-1.3.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:d78ab28a03c854a873787a0a42254a0ccb3cb133c672f645c9f9c8f3ae9d0800", size = 1316773, upload-time = "2024-08-27T20:56:58.58Z" }, + { url = "https://files.pythonhosted.org/packages/f1/17/c52d2970784383cafb0bd918b6fb036d98d96bbf0bc1befb5d1e31a07a70/contourpy-1.3.0-cp39-cp39-win32.whl", hash = "sha256:81cb5ed4952aae6014bc9d0421dec7c5835c9c8c31cdf51910b708f548cf58e5", size = 171353, upload-time = "2024-08-27T20:57:02.718Z" }, + { url = "https://files.pythonhosted.org/packages/53/23/db9f69676308e094d3c45f20cc52e12d10d64f027541c995d89c11ad5c75/contourpy-1.3.0-cp39-cp39-win_amd64.whl", hash = "sha256:14e262f67bd7e6eb6880bc564dcda30b15e351a594657e55b7eec94b6ef72843", size = 211817, upload-time = "2024-08-27T20:57:06.328Z" }, + { url = "https://files.pythonhosted.org/packages/d1/09/60e486dc2b64c94ed33e58dcfb6f808192c03dfc5574c016218b9b7680dc/contourpy-1.3.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:fe41b41505a5a33aeaed2a613dccaeaa74e0e3ead6dd6fd3a118fb471644fd6c", size = 261886, upload-time = "2024-08-27T20:57:10.863Z" }, + { url = "https://files.pythonhosted.org/packages/19/20/b57f9f7174fcd439a7789fb47d764974ab646fa34d1790551de386457a8e/contourpy-1.3.0-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:eca7e17a65f72a5133bdbec9ecf22401c62bcf4821361ef7811faee695799779", size = 311008, upload-time = "2024-08-27T20:57:15.588Z" }, + { url = "https://files.pythonhosted.org/packages/74/fc/5040d42623a1845d4f17a418e590fd7a79ae8cb2bad2b2f83de63c3bdca4/contourpy-1.3.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:1ec4dc6bf570f5b22ed0d7efba0dfa9c5b9e0431aeea7581aa217542d9e809a4", size = 215690, upload-time = "2024-08-27T20:57:19.321Z" }, + { url = "https://files.pythonhosted.org/packages/2b/24/dc3dcd77ac7460ab7e9d2b01a618cb31406902e50e605a8d6091f0a8f7cc/contourpy-1.3.0-pp39-pypy39_pp73-macosx_10_15_x86_64.whl", hash = "sha256:00ccd0dbaad6d804ab259820fa7cb0b8036bda0686ef844d24125d8287178ce0", size = 261894, upload-time = "2024-08-27T20:57:23.873Z" }, + { url = "https://files.pythonhosted.org/packages/b1/db/531642a01cfec39d1682e46b5457b07cf805e3c3c584ec27e2a6223f8f6c/contourpy-1.3.0-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8ca947601224119117f7c19c9cdf6b3ab54c5726ef1d906aa4a69dfb6dd58102", size = 311099, upload-time = "2024-08-27T20:57:28.58Z" }, + { url = "https://files.pythonhosted.org/packages/38/1e/94bda024d629f254143a134eead69e21c836429a2a6ce82209a00ddcb79a/contourpy-1.3.0-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:c6ec93afeb848a0845a18989da3beca3eec2c0f852322efe21af1931147d12cb", size = 215838, upload-time = "2024-08-27T20:57:32.913Z" }, +] + +[[package]] +name = "contourpy" +version = "1.3.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.10.*'", +] +dependencies = [ + { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.10.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/66/54/eb9bfc647b19f2009dd5c7f5ec51c4e6ca831725f1aea7a993034f483147/contourpy-1.3.2.tar.gz", hash = "sha256:b6945942715a034c671b7fc54f9588126b0b8bf23db2696e3ca8328f3ff0ab54", size = 13466130, upload-time = "2025-04-15T17:47:53.79Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/12/a3/da4153ec8fe25d263aa48c1a4cbde7f49b59af86f0b6f7862788c60da737/contourpy-1.3.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ba38e3f9f330af820c4b27ceb4b9c7feee5fe0493ea53a8720f4792667465934", size = 268551, upload-time = "2025-04-15T17:34:46.581Z" }, + { url = "https://files.pythonhosted.org/packages/2f/6c/330de89ae1087eb622bfca0177d32a7ece50c3ef07b28002de4757d9d875/contourpy-1.3.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:dc41ba0714aa2968d1f8674ec97504a8f7e334f48eeacebcaa6256213acb0989", size = 253399, upload-time = "2025-04-15T17:34:51.427Z" }, + { url = "https://files.pythonhosted.org/packages/c1/bd/20c6726b1b7f81a8bee5271bed5c165f0a8e1f572578a9d27e2ccb763cb2/contourpy-1.3.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9be002b31c558d1ddf1b9b415b162c603405414bacd6932d031c5b5a8b757f0d", size = 312061, upload-time = "2025-04-15T17:34:55.961Z" }, + { url = "https://files.pythonhosted.org/packages/22/fc/a9665c88f8a2473f823cf1ec601de9e5375050f1958cbb356cdf06ef1ab6/contourpy-1.3.2-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:8d2e74acbcba3bfdb6d9d8384cdc4f9260cae86ed9beee8bd5f54fee49a430b9", size = 351956, upload-time = "2025-04-15T17:35:00.992Z" }, + { url = "https://files.pythonhosted.org/packages/25/eb/9f0a0238f305ad8fb7ef42481020d6e20cf15e46be99a1fcf939546a177e/contourpy-1.3.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:e259bced5549ac64410162adc973c5e2fb77f04df4a439d00b478e57a0e65512", size = 320872, upload-time = "2025-04-15T17:35:06.177Z" }, + { url = "https://files.pythonhosted.org/packages/32/5c/1ee32d1c7956923202f00cf8d2a14a62ed7517bdc0ee1e55301227fc273c/contourpy-1.3.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ad687a04bc802cbe8b9c399c07162a3c35e227e2daccf1668eb1f278cb698631", size = 325027, upload-time = "2025-04-15T17:35:11.244Z" }, + { url = "https://files.pythonhosted.org/packages/83/bf/9baed89785ba743ef329c2b07fd0611d12bfecbedbdd3eeecf929d8d3b52/contourpy-1.3.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:cdd22595308f53ef2f891040ab2b93d79192513ffccbd7fe19be7aa773a5e09f", size = 1306641, upload-time = "2025-04-15T17:35:26.701Z" }, + { url = "https://files.pythonhosted.org/packages/d4/cc/74e5e83d1e35de2d28bd97033426b450bc4fd96e092a1f7a63dc7369b55d/contourpy-1.3.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b4f54d6a2defe9f257327b0f243612dd051cc43825587520b1bf74a31e2f6ef2", size = 1374075, upload-time = "2025-04-15T17:35:43.204Z" }, + { url = "https://files.pythonhosted.org/packages/0c/42/17f3b798fd5e033b46a16f8d9fcb39f1aba051307f5ebf441bad1ecf78f8/contourpy-1.3.2-cp310-cp310-win32.whl", hash = "sha256:f939a054192ddc596e031e50bb13b657ce318cf13d264f095ce9db7dc6ae81c0", size = 177534, upload-time = "2025-04-15T17:35:46.554Z" }, + { url = "https://files.pythonhosted.org/packages/54/ec/5162b8582f2c994721018d0c9ece9dc6ff769d298a8ac6b6a652c307e7df/contourpy-1.3.2-cp310-cp310-win_amd64.whl", hash = "sha256:c440093bbc8fc21c637c03bafcbef95ccd963bc6e0514ad887932c18ca2a759a", size = 221188, upload-time = "2025-04-15T17:35:50.064Z" }, + { url = "https://files.pythonhosted.org/packages/b3/b9/ede788a0b56fc5b071639d06c33cb893f68b1178938f3425debebe2dab78/contourpy-1.3.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:6a37a2fb93d4df3fc4c0e363ea4d16f83195fc09c891bc8ce072b9d084853445", size = 269636, upload-time = "2025-04-15T17:35:54.473Z" }, + { url = "https://files.pythonhosted.org/packages/e6/75/3469f011d64b8bbfa04f709bfc23e1dd71be54d05b1b083be9f5b22750d1/contourpy-1.3.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:b7cd50c38f500bbcc9b6a46643a40e0913673f869315d8e70de0438817cb7773", size = 254636, upload-time = "2025-04-15T17:35:58.283Z" }, + { url = "https://files.pythonhosted.org/packages/8d/2f/95adb8dae08ce0ebca4fd8e7ad653159565d9739128b2d5977806656fcd2/contourpy-1.3.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d6658ccc7251a4433eebd89ed2672c2ed96fba367fd25ca9512aa92a4b46c4f1", size = 313053, upload-time = "2025-04-15T17:36:03.235Z" }, + { url = "https://files.pythonhosted.org/packages/c3/a6/8ccf97a50f31adfa36917707fe39c9a0cbc24b3bbb58185577f119736cc9/contourpy-1.3.2-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:70771a461aaeb335df14deb6c97439973d253ae70660ca085eec25241137ef43", size = 352985, upload-time = "2025-04-15T17:36:08.275Z" }, + { url = "https://files.pythonhosted.org/packages/1d/b6/7925ab9b77386143f39d9c3243fdd101621b4532eb126743201160ffa7e6/contourpy-1.3.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:65a887a6e8c4cd0897507d814b14c54a8c2e2aa4ac9f7686292f9769fcf9a6ab", size = 323750, upload-time = "2025-04-15T17:36:13.29Z" }, + { url = "https://files.pythonhosted.org/packages/c2/f3/20c5d1ef4f4748e52d60771b8560cf00b69d5c6368b5c2e9311bcfa2a08b/contourpy-1.3.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3859783aefa2b8355697f16642695a5b9792e7a46ab86da1118a4a23a51a33d7", size = 326246, upload-time = "2025-04-15T17:36:18.329Z" }, + { url = "https://files.pythonhosted.org/packages/8c/e5/9dae809e7e0b2d9d70c52b3d24cba134dd3dad979eb3e5e71f5df22ed1f5/contourpy-1.3.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:eab0f6db315fa4d70f1d8ab514e527f0366ec021ff853d7ed6a2d33605cf4b83", size = 1308728, upload-time = "2025-04-15T17:36:33.878Z" }, + { url = "https://files.pythonhosted.org/packages/e2/4a/0058ba34aeea35c0b442ae61a4f4d4ca84d6df8f91309bc2d43bb8dd248f/contourpy-1.3.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:d91a3ccc7fea94ca0acab82ceb77f396d50a1f67412efe4c526f5d20264e6ecd", size = 1375762, upload-time = "2025-04-15T17:36:51.295Z" }, + { url = "https://files.pythonhosted.org/packages/09/33/7174bdfc8b7767ef2c08ed81244762d93d5c579336fc0b51ca57b33d1b80/contourpy-1.3.2-cp311-cp311-win32.whl", hash = "sha256:1c48188778d4d2f3d48e4643fb15d8608b1d01e4b4d6b0548d9b336c28fc9b6f", size = 178196, upload-time = "2025-04-15T17:36:55.002Z" }, + { url = "https://files.pythonhosted.org/packages/5e/fe/4029038b4e1c4485cef18e480b0e2cd2d755448bb071eb9977caac80b77b/contourpy-1.3.2-cp311-cp311-win_amd64.whl", hash = "sha256:5ebac872ba09cb8f2131c46b8739a7ff71de28a24c869bcad554477eb089a878", size = 222017, upload-time = "2025-04-15T17:36:58.576Z" }, + { url = "https://files.pythonhosted.org/packages/34/f7/44785876384eff370c251d58fd65f6ad7f39adce4a093c934d4a67a7c6b6/contourpy-1.3.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:4caf2bcd2969402bf77edc4cb6034c7dd7c0803213b3523f111eb7460a51b8d2", size = 271580, upload-time = "2025-04-15T17:37:03.105Z" }, + { url = "https://files.pythonhosted.org/packages/93/3b/0004767622a9826ea3d95f0e9d98cd8729015768075d61f9fea8eeca42a8/contourpy-1.3.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:82199cb78276249796419fe36b7386bd8d2cc3f28b3bc19fe2454fe2e26c4c15", size = 255530, upload-time = "2025-04-15T17:37:07.026Z" }, + { url = "https://files.pythonhosted.org/packages/e7/bb/7bd49e1f4fa805772d9fd130e0d375554ebc771ed7172f48dfcd4ca61549/contourpy-1.3.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:106fab697af11456fcba3e352ad50effe493a90f893fca6c2ca5c033820cea92", size = 307688, upload-time = "2025-04-15T17:37:11.481Z" }, + { url = "https://files.pythonhosted.org/packages/fc/97/e1d5dbbfa170725ef78357a9a0edc996b09ae4af170927ba8ce977e60a5f/contourpy-1.3.2-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d14f12932a8d620e307f715857107b1d1845cc44fdb5da2bc8e850f5ceba9f87", size = 347331, upload-time = "2025-04-15T17:37:18.212Z" }, + { url = "https://files.pythonhosted.org/packages/6f/66/e69e6e904f5ecf6901be3dd16e7e54d41b6ec6ae3405a535286d4418ffb4/contourpy-1.3.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:532fd26e715560721bb0d5fc7610fce279b3699b018600ab999d1be895b09415", size = 318963, upload-time = "2025-04-15T17:37:22.76Z" }, + { url = "https://files.pythonhosted.org/packages/a8/32/b8a1c8965e4f72482ff2d1ac2cd670ce0b542f203c8e1d34e7c3e6925da7/contourpy-1.3.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f26b383144cf2d2c29f01a1e8170f50dacf0eac02d64139dcd709a8ac4eb3cfe", size = 323681, upload-time = "2025-04-15T17:37:33.001Z" }, + { url = "https://files.pythonhosted.org/packages/30/c6/12a7e6811d08757c7162a541ca4c5c6a34c0f4e98ef2b338791093518e40/contourpy-1.3.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:c49f73e61f1f774650a55d221803b101d966ca0c5a2d6d5e4320ec3997489441", size = 1308674, upload-time = "2025-04-15T17:37:48.64Z" }, + { url = "https://files.pythonhosted.org/packages/2a/8a/bebe5a3f68b484d3a2b8ffaf84704b3e343ef1addea528132ef148e22b3b/contourpy-1.3.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:3d80b2c0300583228ac98d0a927a1ba6a2ba6b8a742463c564f1d419ee5b211e", size = 1380480, upload-time = "2025-04-15T17:38:06.7Z" }, + { url = "https://files.pythonhosted.org/packages/34/db/fcd325f19b5978fb509a7d55e06d99f5f856294c1991097534360b307cf1/contourpy-1.3.2-cp312-cp312-win32.whl", hash = "sha256:90df94c89a91b7362e1142cbee7568f86514412ab8a2c0d0fca72d7e91b62912", size = 178489, upload-time = "2025-04-15T17:38:10.338Z" }, + { url = "https://files.pythonhosted.org/packages/01/c8/fadd0b92ffa7b5eb5949bf340a63a4a496a6930a6c37a7ba0f12acb076d6/contourpy-1.3.2-cp312-cp312-win_amd64.whl", hash = "sha256:8c942a01d9163e2e5cfb05cb66110121b8d07ad438a17f9e766317bcb62abf73", size = 223042, upload-time = "2025-04-15T17:38:14.239Z" }, + { url = "https://files.pythonhosted.org/packages/2e/61/5673f7e364b31e4e7ef6f61a4b5121c5f170f941895912f773d95270f3a2/contourpy-1.3.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:de39db2604ae755316cb5967728f4bea92685884b1e767b7c24e983ef5f771cb", size = 271630, upload-time = "2025-04-15T17:38:19.142Z" }, + { url = "https://files.pythonhosted.org/packages/ff/66/a40badddd1223822c95798c55292844b7e871e50f6bfd9f158cb25e0bd39/contourpy-1.3.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:3f9e896f447c5c8618f1edb2bafa9a4030f22a575ec418ad70611450720b5b08", size = 255670, upload-time = "2025-04-15T17:38:23.688Z" }, + { url = "https://files.pythonhosted.org/packages/1e/c7/cf9fdee8200805c9bc3b148f49cb9482a4e3ea2719e772602a425c9b09f8/contourpy-1.3.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:71e2bd4a1c4188f5c2b8d274da78faab884b59df20df63c34f74aa1813c4427c", size = 306694, upload-time = "2025-04-15T17:38:28.238Z" }, + { url = "https://files.pythonhosted.org/packages/dd/e7/ccb9bec80e1ba121efbffad7f38021021cda5be87532ec16fd96533bb2e0/contourpy-1.3.2-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:de425af81b6cea33101ae95ece1f696af39446db9682a0b56daaa48cfc29f38f", size = 345986, upload-time = "2025-04-15T17:38:33.502Z" }, + { url = "https://files.pythonhosted.org/packages/dc/49/ca13bb2da90391fa4219fdb23b078d6065ada886658ac7818e5441448b78/contourpy-1.3.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:977e98a0e0480d3fe292246417239d2d45435904afd6d7332d8455981c408b85", size = 318060, upload-time = "2025-04-15T17:38:38.672Z" }, + { url = "https://files.pythonhosted.org/packages/c8/65/5245ce8c548a8422236c13ffcdcdada6a2a812c361e9e0c70548bb40b661/contourpy-1.3.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:434f0adf84911c924519d2b08fc10491dd282b20bdd3fa8f60fd816ea0b48841", size = 322747, upload-time = "2025-04-15T17:38:43.712Z" }, + { url = "https://files.pythonhosted.org/packages/72/30/669b8eb48e0a01c660ead3752a25b44fdb2e5ebc13a55782f639170772f9/contourpy-1.3.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:c66c4906cdbc50e9cba65978823e6e00b45682eb09adbb78c9775b74eb222422", size = 1308895, upload-time = "2025-04-15T17:39:00.224Z" }, + { url = "https://files.pythonhosted.org/packages/05/5a/b569f4250decee6e8d54498be7bdf29021a4c256e77fe8138c8319ef8eb3/contourpy-1.3.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8b7fc0cd78ba2f4695fd0a6ad81a19e7e3ab825c31b577f384aa9d7817dc3bef", size = 1379098, upload-time = "2025-04-15T17:43:29.649Z" }, + { url = "https://files.pythonhosted.org/packages/19/ba/b227c3886d120e60e41b28740ac3617b2f2b971b9f601c835661194579f1/contourpy-1.3.2-cp313-cp313-win32.whl", hash = "sha256:15ce6ab60957ca74cff444fe66d9045c1fd3e92c8936894ebd1f3eef2fff075f", size = 178535, upload-time = "2025-04-15T17:44:44.532Z" }, + { url = "https://files.pythonhosted.org/packages/12/6e/2fed56cd47ca739b43e892707ae9a13790a486a3173be063681ca67d2262/contourpy-1.3.2-cp313-cp313-win_amd64.whl", hash = "sha256:e1578f7eafce927b168752ed7e22646dad6cd9bca673c60bff55889fa236ebf9", size = 223096, upload-time = "2025-04-15T17:44:48.194Z" }, + { url = "https://files.pythonhosted.org/packages/54/4c/e76fe2a03014a7c767d79ea35c86a747e9325537a8b7627e0e5b3ba266b4/contourpy-1.3.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:0475b1f6604896bc7c53bb070e355e9321e1bc0d381735421a2d2068ec56531f", size = 285090, upload-time = "2025-04-15T17:43:34.084Z" }, + { url = "https://files.pythonhosted.org/packages/7b/e2/5aba47debd55d668e00baf9651b721e7733975dc9fc27264a62b0dd26eb8/contourpy-1.3.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:c85bb486e9be652314bb5b9e2e3b0d1b2e643d5eec4992c0fbe8ac71775da739", size = 268643, upload-time = "2025-04-15T17:43:38.626Z" }, + { url = "https://files.pythonhosted.org/packages/a1/37/cd45f1f051fe6230f751cc5cdd2728bb3a203f5619510ef11e732109593c/contourpy-1.3.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:745b57db7758f3ffc05a10254edd3182a2a83402a89c00957a8e8a22f5582823", size = 310443, upload-time = "2025-04-15T17:43:44.522Z" }, + { url = "https://files.pythonhosted.org/packages/8b/a2/36ea6140c306c9ff6dd38e3bcec80b3b018474ef4d17eb68ceecd26675f4/contourpy-1.3.2-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:970e9173dbd7eba9b4e01aab19215a48ee5dd3f43cef736eebde064a171f89a5", size = 349865, upload-time = "2025-04-15T17:43:49.545Z" }, + { url = "https://files.pythonhosted.org/packages/95/b7/2fc76bc539693180488f7b6cc518da7acbbb9e3b931fd9280504128bf956/contourpy-1.3.2-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:c6c4639a9c22230276b7bffb6a850dfc8258a2521305e1faefe804d006b2e532", size = 321162, upload-time = "2025-04-15T17:43:54.203Z" }, + { url = "https://files.pythonhosted.org/packages/f4/10/76d4f778458b0aa83f96e59d65ece72a060bacb20cfbee46cf6cd5ceba41/contourpy-1.3.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:cc829960f34ba36aad4302e78eabf3ef16a3a100863f0d4eeddf30e8a485a03b", size = 327355, upload-time = "2025-04-15T17:44:01.025Z" }, + { url = "https://files.pythonhosted.org/packages/43/a3/10cf483ea683f9f8ab096c24bad3cce20e0d1dd9a4baa0e2093c1c962d9d/contourpy-1.3.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:d32530b534e986374fc19eaa77fcb87e8a99e5431499949b828312bdcd20ac52", size = 1307935, upload-time = "2025-04-15T17:44:17.322Z" }, + { url = "https://files.pythonhosted.org/packages/78/73/69dd9a024444489e22d86108e7b913f3528f56cfc312b5c5727a44188471/contourpy-1.3.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:e298e7e70cf4eb179cc1077be1c725b5fd131ebc81181bf0c03525c8abc297fd", size = 1372168, upload-time = "2025-04-15T17:44:33.43Z" }, + { url = "https://files.pythonhosted.org/packages/0f/1b/96d586ccf1b1a9d2004dd519b25fbf104a11589abfd05484ff12199cca21/contourpy-1.3.2-cp313-cp313t-win32.whl", hash = "sha256:d0e589ae0d55204991450bb5c23f571c64fe43adaa53f93fc902a84c96f52fe1", size = 189550, upload-time = "2025-04-15T17:44:37.092Z" }, + { url = "https://files.pythonhosted.org/packages/b0/e6/6000d0094e8a5e32ad62591c8609e269febb6e4db83a1c75ff8868b42731/contourpy-1.3.2-cp313-cp313t-win_amd64.whl", hash = "sha256:78e9253c3de756b3f6a5174d024c4835acd59eb3f8e2ca13e775dbffe1558f69", size = 238214, upload-time = "2025-04-15T17:44:40.827Z" }, + { url = "https://files.pythonhosted.org/packages/33/05/b26e3c6ecc05f349ee0013f0bb850a761016d89cec528a98193a48c34033/contourpy-1.3.2-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:fd93cc7f3139b6dd7aab2f26a90dde0aa9fc264dbf70f6740d498a70b860b82c", size = 265681, upload-time = "2025-04-15T17:44:59.314Z" }, + { url = "https://files.pythonhosted.org/packages/2b/25/ac07d6ad12affa7d1ffed11b77417d0a6308170f44ff20fa1d5aa6333f03/contourpy-1.3.2-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:107ba8a6a7eec58bb475329e6d3b95deba9440667c4d62b9b6063942b61d7f16", size = 315101, upload-time = "2025-04-15T17:45:04.165Z" }, + { url = "https://files.pythonhosted.org/packages/8f/4d/5bb3192bbe9d3f27e3061a6a8e7733c9120e203cb8515767d30973f71030/contourpy-1.3.2-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:ded1706ed0c1049224531b81128efbd5084598f18d8a2d9efae833edbd2b40ad", size = 220599, upload-time = "2025-04-15T17:45:08.456Z" }, + { url = "https://files.pythonhosted.org/packages/ff/c0/91f1215d0d9f9f343e4773ba6c9b89e8c0cc7a64a6263f21139da639d848/contourpy-1.3.2-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:5f5964cdad279256c084b69c3f412b7801e15356b16efa9d78aa974041903da0", size = 266807, upload-time = "2025-04-15T17:45:15.535Z" }, + { url = "https://files.pythonhosted.org/packages/d4/79/6be7e90c955c0487e7712660d6cead01fa17bff98e0ea275737cc2bc8e71/contourpy-1.3.2-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:49b65a95d642d4efa8f64ba12558fcb83407e58a2dfba9d796d77b63ccfcaff5", size = 318729, upload-time = "2025-04-15T17:45:20.166Z" }, + { url = "https://files.pythonhosted.org/packages/87/68/7f46fb537958e87427d98a4074bcde4b67a70b04900cfc5ce29bc2f556c1/contourpy-1.3.2-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:8c5acb8dddb0752bf252e01a3035b21443158910ac16a3b0d20e7fed7d534ce5", size = 221791, upload-time = "2025-04-15T17:45:24.794Z" }, +] + +[[package]] +name = "contourpy" +version = "1.3.3" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +dependencies = [ + { name = "numpy", version = "2.3.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/58/01/1253e6698a07380cd31a736d248a3f2a50a7c88779a1813da27503cadc2a/contourpy-1.3.3.tar.gz", hash = "sha256:083e12155b210502d0bca491432bb04d56dc3432f95a979b429f2848c3dbe880", size = 13466174, upload-time = "2025-07-26T12:03:12.549Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/91/2e/c4390a31919d8a78b90e8ecf87cd4b4c4f05a5b48d05ec17db8e5404c6f4/contourpy-1.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:709a48ef9a690e1343202916450bc48b9e51c049b089c7f79a267b46cffcdaa1", size = 288773, upload-time = "2025-07-26T12:01:02.277Z" }, + { url = "https://files.pythonhosted.org/packages/0d/44/c4b0b6095fef4dc9c420e041799591e3b63e9619e3044f7f4f6c21c0ab24/contourpy-1.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:23416f38bfd74d5d28ab8429cc4d63fa67d5068bd711a85edb1c3fb0c3e2f381", size = 270149, upload-time = "2025-07-26T12:01:04.072Z" }, + { url = "https://files.pythonhosted.org/packages/30/2e/dd4ced42fefac8470661d7cb7e264808425e6c5d56d175291e93890cce09/contourpy-1.3.3-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:929ddf8c4c7f348e4c0a5a3a714b5c8542ffaa8c22954862a46ca1813b667ee7", size = 329222, upload-time = "2025-07-26T12:01:05.688Z" }, + { url = "https://files.pythonhosted.org/packages/f2/74/cc6ec2548e3d276c71389ea4802a774b7aa3558223b7bade3f25787fafc2/contourpy-1.3.3-cp311-cp311-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:9e999574eddae35f1312c2b4b717b7885d4edd6cb46700e04f7f02db454e67c1", size = 377234, upload-time = "2025-07-26T12:01:07.054Z" }, + { url = "https://files.pythonhosted.org/packages/03/b3/64ef723029f917410f75c09da54254c5f9ea90ef89b143ccadb09df14c15/contourpy-1.3.3-cp311-cp311-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0bf67e0e3f482cb69779dd3061b534eb35ac9b17f163d851e2a547d56dba0a3a", size = 380555, upload-time = "2025-07-26T12:01:08.801Z" }, + { url = "https://files.pythonhosted.org/packages/5f/4b/6157f24ca425b89fe2eb7e7be642375711ab671135be21e6faa100f7448c/contourpy-1.3.3-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:51e79c1f7470158e838808d4a996fa9bac72c498e93d8ebe5119bc1e6becb0db", size = 355238, upload-time = "2025-07-26T12:01:10.319Z" }, + { url = "https://files.pythonhosted.org/packages/98/56/f914f0dd678480708a04cfd2206e7c382533249bc5001eb9f58aa693e200/contourpy-1.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:598c3aaece21c503615fd59c92a3598b428b2f01bfb4b8ca9c4edeecc2438620", size = 1326218, upload-time = "2025-07-26T12:01:12.659Z" }, + { url = "https://files.pythonhosted.org/packages/fb/d7/4a972334a0c971acd5172389671113ae82aa7527073980c38d5868ff1161/contourpy-1.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:322ab1c99b008dad206d406bb61d014cf0174df491ae9d9d0fac6a6fda4f977f", size = 1392867, upload-time = "2025-07-26T12:01:15.533Z" }, + { url = "https://files.pythonhosted.org/packages/75/3e/f2cc6cd56dc8cff46b1a56232eabc6feea52720083ea71ab15523daab796/contourpy-1.3.3-cp311-cp311-win32.whl", hash = "sha256:fd907ae12cd483cd83e414b12941c632a969171bf90fc937d0c9f268a31cafff", size = 183677, upload-time = "2025-07-26T12:01:17.088Z" }, + { url = "https://files.pythonhosted.org/packages/98/4b/9bd370b004b5c9d8045c6c33cf65bae018b27aca550a3f657cdc99acdbd8/contourpy-1.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:3519428f6be58431c56581f1694ba8e50626f2dd550af225f82fb5f5814d2a42", size = 225234, upload-time = "2025-07-26T12:01:18.256Z" }, + { url = "https://files.pythonhosted.org/packages/d9/b6/71771e02c2e004450c12b1120a5f488cad2e4d5b590b1af8bad060360fe4/contourpy-1.3.3-cp311-cp311-win_arm64.whl", hash = "sha256:15ff10bfada4bf92ec8b31c62bf7c1834c244019b4a33095a68000d7075df470", size = 193123, upload-time = "2025-07-26T12:01:19.848Z" }, + { url = "https://files.pythonhosted.org/packages/be/45/adfee365d9ea3d853550b2e735f9d66366701c65db7855cd07621732ccfc/contourpy-1.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:b08a32ea2f8e42cf1d4be3169a98dd4be32bafe4f22b6c4cb4ba810fa9e5d2cb", size = 293419, upload-time = "2025-07-26T12:01:21.16Z" }, + { url = "https://files.pythonhosted.org/packages/53/3e/405b59cfa13021a56bba395a6b3aca8cec012b45bf177b0eaf7a202cde2c/contourpy-1.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:556dba8fb6f5d8742f2923fe9457dbdd51e1049c4a43fd3986a0b14a1d815fc6", size = 273979, upload-time = "2025-07-26T12:01:22.448Z" }, + { url = "https://files.pythonhosted.org/packages/d4/1c/a12359b9b2ca3a845e8f7f9ac08bdf776114eb931392fcad91743e2ea17b/contourpy-1.3.3-cp312-cp312-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92d9abc807cf7d0e047b95ca5d957cf4792fcd04e920ca70d48add15c1a90ea7", size = 332653, upload-time = "2025-07-26T12:01:24.155Z" }, + { url = "https://files.pythonhosted.org/packages/63/12/897aeebfb475b7748ea67b61e045accdfcf0d971f8a588b67108ed7f5512/contourpy-1.3.3-cp312-cp312-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b2e8faa0ed68cb29af51edd8e24798bb661eac3bd9f65420c1887b6ca89987c8", size = 379536, upload-time = "2025-07-26T12:01:25.91Z" }, + { url = "https://files.pythonhosted.org/packages/43/8a/a8c584b82deb248930ce069e71576fc09bd7174bbd35183b7943fb1064fd/contourpy-1.3.3-cp312-cp312-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:626d60935cf668e70a5ce6ff184fd713e9683fb458898e4249b63be9e28286ea", size = 384397, upload-time = "2025-07-26T12:01:27.152Z" }, + { url = "https://files.pythonhosted.org/packages/cc/8f/ec6289987824b29529d0dfda0d74a07cec60e54b9c92f3c9da4c0ac732de/contourpy-1.3.3-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4d00e655fcef08aba35ec9610536bfe90267d7ab5ba944f7032549c55a146da1", size = 362601, upload-time = "2025-07-26T12:01:28.808Z" }, + { url = "https://files.pythonhosted.org/packages/05/0a/a3fe3be3ee2dceb3e615ebb4df97ae6f3828aa915d3e10549ce016302bd1/contourpy-1.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:451e71b5a7d597379ef572de31eeb909a87246974d960049a9848c3bc6c41bf7", size = 1331288, upload-time = "2025-07-26T12:01:31.198Z" }, + { url = "https://files.pythonhosted.org/packages/33/1d/acad9bd4e97f13f3e2b18a3977fe1b4a37ecf3d38d815333980c6c72e963/contourpy-1.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:459c1f020cd59fcfe6650180678a9993932d80d44ccde1fa1868977438f0b411", size = 1403386, upload-time = "2025-07-26T12:01:33.947Z" }, + { url = "https://files.pythonhosted.org/packages/cf/8f/5847f44a7fddf859704217a99a23a4f6417b10e5ab1256a179264561540e/contourpy-1.3.3-cp312-cp312-win32.whl", hash = "sha256:023b44101dfe49d7d53932be418477dba359649246075c996866106da069af69", size = 185018, upload-time = "2025-07-26T12:01:35.64Z" }, + { url = "https://files.pythonhosted.org/packages/19/e8/6026ed58a64563186a9ee3f29f41261fd1828f527dd93d33b60feca63352/contourpy-1.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:8153b8bfc11e1e4d75bcb0bff1db232f9e10b274e0929de9d608027e0d34ff8b", size = 226567, upload-time = "2025-07-26T12:01:36.804Z" }, + { url = "https://files.pythonhosted.org/packages/d1/e2/f05240d2c39a1ed228d8328a78b6f44cd695f7ef47beb3e684cf93604f86/contourpy-1.3.3-cp312-cp312-win_arm64.whl", hash = "sha256:07ce5ed73ecdc4a03ffe3e1b3e3c1166db35ae7584be76f65dbbe28a7791b0cc", size = 193655, upload-time = "2025-07-26T12:01:37.999Z" }, + { url = "https://files.pythonhosted.org/packages/68/35/0167aad910bbdb9599272bd96d01a9ec6852f36b9455cf2ca67bd4cc2d23/contourpy-1.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:177fb367556747a686509d6fef71d221a4b198a3905fe824430e5ea0fda54eb5", size = 293257, upload-time = "2025-07-26T12:01:39.367Z" }, + { url = "https://files.pythonhosted.org/packages/96/e4/7adcd9c8362745b2210728f209bfbcf7d91ba868a2c5f40d8b58f54c509b/contourpy-1.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d002b6f00d73d69333dac9d0b8d5e84d9724ff9ef044fd63c5986e62b7c9e1b1", size = 274034, upload-time = "2025-07-26T12:01:40.645Z" }, + { url = "https://files.pythonhosted.org/packages/73/23/90e31ceeed1de63058a02cb04b12f2de4b40e3bef5e082a7c18d9c8ae281/contourpy-1.3.3-cp313-cp313-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:348ac1f5d4f1d66d3322420f01d42e43122f43616e0f194fc1c9f5d830c5b286", size = 334672, upload-time = "2025-07-26T12:01:41.942Z" }, + { url = "https://files.pythonhosted.org/packages/ed/93/b43d8acbe67392e659e1d984700e79eb67e2acb2bd7f62012b583a7f1b55/contourpy-1.3.3-cp313-cp313-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:655456777ff65c2c548b7c454af9c6f33f16c8884f11083244b5819cc214f1b5", size = 381234, upload-time = "2025-07-26T12:01:43.499Z" }, + { url = "https://files.pythonhosted.org/packages/46/3b/bec82a3ea06f66711520f75a40c8fc0b113b2a75edb36aa633eb11c4f50f/contourpy-1.3.3-cp313-cp313-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:644a6853d15b2512d67881586bd03f462c7ab755db95f16f14d7e238f2852c67", size = 385169, upload-time = "2025-07-26T12:01:45.219Z" }, + { url = "https://files.pythonhosted.org/packages/4b/32/e0f13a1c5b0f8572d0ec6ae2f6c677b7991fafd95da523159c19eff0696a/contourpy-1.3.3-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4debd64f124ca62069f313a9cb86656ff087786016d76927ae2cf37846b006c9", size = 362859, upload-time = "2025-07-26T12:01:46.519Z" }, + { url = "https://files.pythonhosted.org/packages/33/71/e2a7945b7de4e58af42d708a219f3b2f4cff7386e6b6ab0a0fa0033c49a9/contourpy-1.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a15459b0f4615b00bbd1e91f1b9e19b7e63aea7483d03d804186f278c0af2659", size = 1332062, upload-time = "2025-07-26T12:01:48.964Z" }, + { url = "https://files.pythonhosted.org/packages/12/fc/4e87ac754220ccc0e807284f88e943d6d43b43843614f0a8afa469801db0/contourpy-1.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ca0fdcd73925568ca027e0b17ab07aad764be4706d0a925b89227e447d9737b7", size = 1403932, upload-time = "2025-07-26T12:01:51.979Z" }, + { url = "https://files.pythonhosted.org/packages/a6/2e/adc197a37443f934594112222ac1aa7dc9a98faf9c3842884df9a9d8751d/contourpy-1.3.3-cp313-cp313-win32.whl", hash = "sha256:b20c7c9a3bf701366556e1b1984ed2d0cedf999903c51311417cf5f591d8c78d", size = 185024, upload-time = "2025-07-26T12:01:53.245Z" }, + { url = "https://files.pythonhosted.org/packages/18/0b/0098c214843213759692cc638fce7de5c289200a830e5035d1791d7a2338/contourpy-1.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:1cadd8b8969f060ba45ed7c1b714fe69185812ab43bd6b86a9123fe8f99c3263", size = 226578, upload-time = "2025-07-26T12:01:54.422Z" }, + { url = "https://files.pythonhosted.org/packages/8a/9a/2f6024a0c5995243cd63afdeb3651c984f0d2bc727fd98066d40e141ad73/contourpy-1.3.3-cp313-cp313-win_arm64.whl", hash = "sha256:fd914713266421b7536de2bfa8181aa8c699432b6763a0ea64195ebe28bff6a9", size = 193524, upload-time = "2025-07-26T12:01:55.73Z" }, + { url = "https://files.pythonhosted.org/packages/c0/b3/f8a1a86bd3298513f500e5b1f5fd92b69896449f6cab6a146a5d52715479/contourpy-1.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:88df9880d507169449d434c293467418b9f6cbe82edd19284aa0409e7fdb933d", size = 306730, upload-time = "2025-07-26T12:01:57.051Z" }, + { url = "https://files.pythonhosted.org/packages/3f/11/4780db94ae62fc0c2053909b65dc3246bd7cecfc4f8a20d957ad43aa4ad8/contourpy-1.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:d06bb1f751ba5d417047db62bca3c8fde202b8c11fb50742ab3ab962c81e8216", size = 287897, upload-time = "2025-07-26T12:01:58.663Z" }, + { url = "https://files.pythonhosted.org/packages/ae/15/e59f5f3ffdd6f3d4daa3e47114c53daabcb18574a26c21f03dc9e4e42ff0/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e4e6b05a45525357e382909a4c1600444e2a45b4795163d3b22669285591c1ae", size = 326751, upload-time = "2025-07-26T12:02:00.343Z" }, + { url = "https://files.pythonhosted.org/packages/0f/81/03b45cfad088e4770b1dcf72ea78d3802d04200009fb364d18a493857210/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ab3074b48c4e2cf1a960e6bbeb7f04566bf36b1861d5c9d4d8ac04b82e38ba20", size = 375486, upload-time = "2025-07-26T12:02:02.128Z" }, + { url = "https://files.pythonhosted.org/packages/0c/ba/49923366492ffbdd4486e970d421b289a670ae8cf539c1ea9a09822b371a/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:6c3d53c796f8647d6deb1abe867daeb66dcc8a97e8455efa729516b997b8ed99", size = 388106, upload-time = "2025-07-26T12:02:03.615Z" }, + { url = "https://files.pythonhosted.org/packages/9f/52/5b00ea89525f8f143651f9f03a0df371d3cbd2fccd21ca9b768c7a6500c2/contourpy-1.3.3-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:50ed930df7289ff2a8d7afeb9603f8289e5704755c7e5c3bbd929c90c817164b", size = 352548, upload-time = "2025-07-26T12:02:05.165Z" }, + { url = "https://files.pythonhosted.org/packages/32/1d/a209ec1a3a3452d490f6b14dd92e72280c99ae3d1e73da74f8277d4ee08f/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4feffb6537d64b84877da813a5c30f1422ea5739566abf0bd18065ac040e120a", size = 1322297, upload-time = "2025-07-26T12:02:07.379Z" }, + { url = "https://files.pythonhosted.org/packages/bc/9e/46f0e8ebdd884ca0e8877e46a3f4e633f6c9c8c4f3f6e72be3fe075994aa/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:2b7e9480ffe2b0cd2e787e4df64270e3a0440d9db8dc823312e2c940c167df7e", size = 1391023, upload-time = "2025-07-26T12:02:10.171Z" }, + { url = "https://files.pythonhosted.org/packages/b9/70/f308384a3ae9cd2209e0849f33c913f658d3326900d0ff5d378d6a1422d2/contourpy-1.3.3-cp313-cp313t-win32.whl", hash = "sha256:283edd842a01e3dcd435b1c5116798d661378d83d36d337b8dde1d16a5fc9ba3", size = 196157, upload-time = "2025-07-26T12:02:11.488Z" }, + { url = "https://files.pythonhosted.org/packages/b2/dd/880f890a6663b84d9e34a6f88cded89d78f0091e0045a284427cb6b18521/contourpy-1.3.3-cp313-cp313t-win_amd64.whl", hash = "sha256:87acf5963fc2b34825e5b6b048f40e3635dd547f590b04d2ab317c2619ef7ae8", size = 240570, upload-time = "2025-07-26T12:02:12.754Z" }, + { url = "https://files.pythonhosted.org/packages/80/99/2adc7d8ffead633234817ef8e9a87115c8a11927a94478f6bb3d3f4d4f7d/contourpy-1.3.3-cp313-cp313t-win_arm64.whl", hash = "sha256:3c30273eb2a55024ff31ba7d052dde990d7d8e5450f4bbb6e913558b3d6c2301", size = 199713, upload-time = "2025-07-26T12:02:14.4Z" }, + { url = "https://files.pythonhosted.org/packages/72/8b/4546f3ab60f78c514ffb7d01a0bd743f90de36f0019d1be84d0a708a580a/contourpy-1.3.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fde6c716d51c04b1c25d0b90364d0be954624a0ee9d60e23e850e8d48353d07a", size = 292189, upload-time = "2025-07-26T12:02:16.095Z" }, + { url = "https://files.pythonhosted.org/packages/fd/e1/3542a9cb596cadd76fcef413f19c79216e002623158befe6daa03dbfa88c/contourpy-1.3.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:cbedb772ed74ff5be440fa8eee9bd49f64f6e3fc09436d9c7d8f1c287b121d77", size = 273251, upload-time = "2025-07-26T12:02:17.524Z" }, + { url = "https://files.pythonhosted.org/packages/b1/71/f93e1e9471d189f79d0ce2497007731c1e6bf9ef6d1d61b911430c3db4e5/contourpy-1.3.3-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22e9b1bd7a9b1d652cd77388465dc358dafcd2e217d35552424aa4f996f524f5", size = 335810, upload-time = "2025-07-26T12:02:18.9Z" }, + { url = "https://files.pythonhosted.org/packages/91/f9/e35f4c1c93f9275d4e38681a80506b5510e9327350c51f8d4a5a724d178c/contourpy-1.3.3-cp314-cp314-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a22738912262aa3e254e4f3cb079a95a67132fc5a063890e224393596902f5a4", size = 382871, upload-time = "2025-07-26T12:02:20.418Z" }, + { url = "https://files.pythonhosted.org/packages/b5/71/47b512f936f66a0a900d81c396a7e60d73419868fba959c61efed7a8ab46/contourpy-1.3.3-cp314-cp314-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:afe5a512f31ee6bd7d0dda52ec9864c984ca3d66664444f2d72e0dc4eb832e36", size = 386264, upload-time = "2025-07-26T12:02:21.916Z" }, + { url = "https://files.pythonhosted.org/packages/04/5f/9ff93450ba96b09c7c2b3f81c94de31c89f92292f1380261bd7195bea4ea/contourpy-1.3.3-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f64836de09927cba6f79dcd00fdd7d5329f3fccc633468507079c829ca4db4e3", size = 363819, upload-time = "2025-07-26T12:02:23.759Z" }, + { url = "https://files.pythonhosted.org/packages/3e/a6/0b185d4cc480ee494945cde102cb0149ae830b5fa17bf855b95f2e70ad13/contourpy-1.3.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:1fd43c3be4c8e5fd6e4f2baeae35ae18176cf2e5cced681cca908addf1cdd53b", size = 1333650, upload-time = "2025-07-26T12:02:26.181Z" }, + { url = "https://files.pythonhosted.org/packages/43/d7/afdc95580ca56f30fbcd3060250f66cedbde69b4547028863abd8aa3b47e/contourpy-1.3.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6afc576f7b33cf00996e5c1102dc2a8f7cc89e39c0b55df93a0b78c1bd992b36", size = 1404833, upload-time = "2025-07-26T12:02:28.782Z" }, + { url = "https://files.pythonhosted.org/packages/e2/e2/366af18a6d386f41132a48f033cbd2102e9b0cf6345d35ff0826cd984566/contourpy-1.3.3-cp314-cp314-win32.whl", hash = "sha256:66c8a43a4f7b8df8b71ee1840e4211a3c8d93b214b213f590e18a1beca458f7d", size = 189692, upload-time = "2025-07-26T12:02:30.128Z" }, + { url = "https://files.pythonhosted.org/packages/7d/c2/57f54b03d0f22d4044b8afb9ca0e184f8b1afd57b4f735c2fa70883dc601/contourpy-1.3.3-cp314-cp314-win_amd64.whl", hash = "sha256:cf9022ef053f2694e31d630feaacb21ea24224be1c3ad0520b13d844274614fd", size = 232424, upload-time = "2025-07-26T12:02:31.395Z" }, + { url = "https://files.pythonhosted.org/packages/18/79/a9416650df9b525737ab521aa181ccc42d56016d2123ddcb7b58e926a42c/contourpy-1.3.3-cp314-cp314-win_arm64.whl", hash = "sha256:95b181891b4c71de4bb404c6621e7e2390745f887f2a026b2d99e92c17892339", size = 198300, upload-time = "2025-07-26T12:02:32.956Z" }, + { url = "https://files.pythonhosted.org/packages/1f/42/38c159a7d0f2b7b9c04c64ab317042bb6952b713ba875c1681529a2932fe/contourpy-1.3.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:33c82d0138c0a062380332c861387650c82e4cf1747aaa6938b9b6516762e772", size = 306769, upload-time = "2025-07-26T12:02:34.2Z" }, + { url = "https://files.pythonhosted.org/packages/c3/6c/26a8205f24bca10974e77460de68d3d7c63e282e23782f1239f226fcae6f/contourpy-1.3.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:ea37e7b45949df430fe649e5de8351c423430046a2af20b1c1961cae3afcda77", size = 287892, upload-time = "2025-07-26T12:02:35.807Z" }, + { url = "https://files.pythonhosted.org/packages/66/06/8a475c8ab718ebfd7925661747dbb3c3ee9c82ac834ccb3570be49d129f4/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d304906ecc71672e9c89e87c4675dc5c2645e1f4269a5063b99b0bb29f232d13", size = 326748, upload-time = "2025-07-26T12:02:37.193Z" }, + { url = "https://files.pythonhosted.org/packages/b4/a3/c5ca9f010a44c223f098fccd8b158bb1cb287378a31ac141f04730dc49be/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ca658cd1a680a5c9ea96dc61cdbae1e85c8f25849843aa799dfd3cb370ad4fbe", size = 375554, upload-time = "2025-07-26T12:02:38.894Z" }, + { url = "https://files.pythonhosted.org/packages/80/5b/68bd33ae63fac658a4145088c1e894405e07584a316738710b636c6d0333/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:ab2fd90904c503739a75b7c8c5c01160130ba67944a7b77bbf36ef8054576e7f", size = 388118, upload-time = "2025-07-26T12:02:40.642Z" }, + { url = "https://files.pythonhosted.org/packages/40/52/4c285a6435940ae25d7410a6c36bda5145839bc3f0beb20c707cda18b9d2/contourpy-1.3.3-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b7301b89040075c30e5768810bc96a8e8d78085b47d8be6e4c3f5a0b4ed478a0", size = 352555, upload-time = "2025-07-26T12:02:42.25Z" }, + { url = "https://files.pythonhosted.org/packages/24/ee/3e81e1dd174f5c7fefe50e85d0892de05ca4e26ef1c9a59c2a57e43b865a/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:2a2a8b627d5cc6b7c41a4beff6c5ad5eb848c88255fda4a8745f7e901b32d8e4", size = 1322295, upload-time = "2025-07-26T12:02:44.668Z" }, + { url = "https://files.pythonhosted.org/packages/3c/b2/6d913d4d04e14379de429057cd169e5e00f6c2af3bb13e1710bcbdb5da12/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:fd6ec6be509c787f1caf6b247f0b1ca598bef13f4ddeaa126b7658215529ba0f", size = 1391027, upload-time = "2025-07-26T12:02:47.09Z" }, + { url = "https://files.pythonhosted.org/packages/93/8a/68a4ec5c55a2971213d29a9374913f7e9f18581945a7a31d1a39b5d2dfe5/contourpy-1.3.3-cp314-cp314t-win32.whl", hash = "sha256:e74a9a0f5e3fff48fb5a7f2fd2b9b70a3fe014a67522f79b7cca4c0c7e43c9ae", size = 202428, upload-time = "2025-07-26T12:02:48.691Z" }, + { url = "https://files.pythonhosted.org/packages/fa/96/fd9f641ffedc4fa3ace923af73b9d07e869496c9cc7a459103e6e978992f/contourpy-1.3.3-cp314-cp314t-win_amd64.whl", hash = "sha256:13b68d6a62db8eafaebb8039218921399baf6e47bf85006fd8529f2a08ef33fc", size = 250331, upload-time = "2025-07-26T12:02:50.137Z" }, + { url = "https://files.pythonhosted.org/packages/ae/8c/469afb6465b853afff216f9528ffda78a915ff880ed58813ba4faf4ba0b6/contourpy-1.3.3-cp314-cp314t-win_arm64.whl", hash = "sha256:b7448cb5a725bb1e35ce88771b86fba35ef418952474492cf7c764059933ff8b", size = 203831, upload-time = "2025-07-26T12:02:51.449Z" }, + { url = "https://files.pythonhosted.org/packages/a5/29/8dcfe16f0107943fa92388c23f6e05cff0ba58058c4c95b00280d4c75a14/contourpy-1.3.3-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:cd5dfcaeb10f7b7f9dc8941717c6c2ade08f587be2226222c12b25f0483ed497", size = 278809, upload-time = "2025-07-26T12:02:52.74Z" }, + { url = "https://files.pythonhosted.org/packages/85/a9/8b37ef4f7dafeb335daee3c8254645ef5725be4d9c6aa70b50ec46ef2f7e/contourpy-1.3.3-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:0c1fc238306b35f246d61a1d416a627348b5cf0648648a031e14bb8705fcdfe8", size = 261593, upload-time = "2025-07-26T12:02:54.037Z" }, + { url = "https://files.pythonhosted.org/packages/0a/59/ebfb8c677c75605cc27f7122c90313fd2f375ff3c8d19a1694bda74aaa63/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:70f9aad7de812d6541d29d2bbf8feb22ff7e1c299523db288004e3157ff4674e", size = 302202, upload-time = "2025-07-26T12:02:55.947Z" }, + { url = "https://files.pythonhosted.org/packages/3c/37/21972a15834d90bfbfb009b9d004779bd5a07a0ec0234e5ba8f64d5736f4/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5ed3657edf08512fc3fe81b510e35c2012fbd3081d2e26160f27ca28affec989", size = 329207, upload-time = "2025-07-26T12:02:57.468Z" }, + { url = "https://files.pythonhosted.org/packages/0c/58/bd257695f39d05594ca4ad60df5bcb7e32247f9951fd09a9b8edb82d1daa/contourpy-1.3.3-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:3d1a3799d62d45c18bafd41c5fa05120b96a28079f2393af559b843d1a966a77", size = 225315, upload-time = "2025-07-26T12:02:58.801Z" }, +] + [[package]] name = "coverage" version = "7.10.7" @@ -663,6 +1079,44 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/ba/af/72cd6ef29f9c5f731251acadaeb821559fe25f10852f44a63374c9ca08c1/cryptography-46.0.3-pp311-pypy311_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:94cd0549accc38d1494e1f8de71eca837d0509d0d44bf11d158524b0e12cebf9", size = 4409447, upload-time = "2025-10-15T23:18:24.209Z" }, ] +[[package]] +name = "cycler" +version = "0.12.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a9/95/a3dbbb5028f35eafb79008e7522a75244477d2838f38cbb722248dabc2a8/cycler-0.12.1.tar.gz", hash = "sha256:88bb128f02ba341da8ef447245a9e138fae777f6a23943da4540077d3601eb1c", size = 7615, upload-time = "2023-10-07T05:32:18.335Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e7/05/c19819d5e3d95294a6f5947fb9b9629efb316b96de511b418c53d245aae6/cycler-0.12.1-py3-none-any.whl", hash = "sha256:85cef7cff222d8644161529808465972e51340599459b8ac3ccbac5a854e0d30", size = 8321, upload-time = "2023-10-07T05:32:16.783Z" }, +] + +[[package]] +name = "datasets" +version = "4.4.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "dill" }, + { name = "filelock", version = "3.19.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "filelock", version = "3.20.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "fsspec", extra = ["http"] }, + { name = "httpx" }, + { name = "huggingface-hub" }, + { name = "multiprocess" }, + { name = "numpy", version = "2.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.10.*'" }, + { name = "numpy", version = "2.3.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "packaging" }, + { name = "pandas" }, + { name = "pyarrow", version = "21.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "pyarrow", version = "22.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pyyaml" }, + { name = "requests" }, + { name = "tqdm" }, + { name = "xxhash" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/93/bf/0dae295d6d1ba0b1a200a9dd216838464b5bbd05da01407cb1330b377445/datasets-4.4.1.tar.gz", hash = "sha256:80322699aa8c0bbbdb7caa87906da689c3c2e29523cff698775c67f28fdab1fc", size = 585341, upload-time = "2025-11-05T16:00:38.162Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3b/5e/6f8d874366788ad5d549e9ba258037d974dda6e004843be1bda794571701/datasets-4.4.1-py3-none-any.whl", hash = "sha256:c1163de5211e42546079ab355cc0250c7e6db16eb209ac5ac6252f801f596c44", size = 511591, upload-time = "2025-11-05T16:00:36.365Z" }, +] + [[package]] name = "debugpy" version = "1.8.17" @@ -762,6 +1216,11 @@ chunking-openai = [ { name = "tree-sitter-python" }, { name = "tree-sitter-typescript" }, ] +examples = [ + { name = "datasets" }, + { name = "matplotlib", version = "3.9.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "matplotlib", version = "3.10.8", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, +] [package.dev-dependencies] dev = [ @@ -788,9 +1247,11 @@ dev = [ [package.metadata] requires-dist = [ + { name = "datasets", marker = "extra == 'examples'", specifier = ">=4.0.0" }, { name = "jsonref", specifier = ">=1.1.0,<2.0.0" }, { name = "jsonschema", specifier = ">=4.16.0,<5.0.0" }, { name = "latex2mathml", specifier = ">=3.77.0,<4.0.0" }, + { name = "matplotlib", marker = "extra == 'examples'", specifier = ">=3.7.0" }, { name = "pandas", specifier = ">=2.1.4,<3.0.0" }, { name = "pillow", specifier = ">=10.0.0,<13.0.0" }, { name = "pydantic", specifier = ">=2.6.0,!=2.10.0,!=2.10.1,!=2.10.2,<3.0.0" }, @@ -815,7 +1276,7 @@ requires-dist = [ { name = "typer", specifier = ">=0.12.5,<0.20.0" }, { name = "typing-extensions", specifier = ">=4.12.2,<5.0.0" }, ] -provides-extras = ["chunking", "chunking-openai"] +provides-extras = ["chunking", "chunking-openai", "examples"] [package.metadata.requires-dev] dev = [ @@ -930,6 +1391,273 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/3f/7d/76a278fa43250441ed9300c344f889c7fb1817080c8fb8996b840bf421c2/flake8_docstrings-1.7.0-py2.py3-none-any.whl", hash = "sha256:51f2344026da083fc084166a9353f5082b01f72901df422f74b4d953ae88ac75", size = 4994, upload-time = "2023-01-25T14:27:12.32Z" }, ] +[[package]] +name = "fonttools" +version = "4.60.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/3e/c4/db6a7b5eb0656534c3aa2596c2c5e18830d74f1b9aa5aa8a7dff63a0b11d/fonttools-4.60.2.tar.gz", hash = "sha256:d29552e6b155ebfc685b0aecf8d429cb76c14ab734c22ef5d3dea6fdf800c92c", size = 3562254, upload-time = "2025-12-09T13:38:11.835Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ab/de/9e10a99fb3070accb8884886a41a4ce54e49bf2fa4fc63f48a6cf2061713/fonttools-4.60.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:4e36fadcf7e8ca6e34d490eef86ed638d6fd9c55d2f514b05687622cfc4a7050", size = 2850403, upload-time = "2025-12-09T13:35:53.14Z" }, + { url = "https://files.pythonhosted.org/packages/e4/40/d5b369d1073b134f600a94a287e13b5bdea2191ba6347d813fa3da00e94a/fonttools-4.60.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:6e500fc9c04bee749ceabfc20cb4903f6981c2139050d85720ea7ada61b75d5c", size = 2398629, upload-time = "2025-12-09T13:35:56.471Z" }, + { url = "https://files.pythonhosted.org/packages/7c/b5/123819369aaf99d1e4dc49f1de1925d4edc7379114d15a56a7dd2e9d56e6/fonttools-4.60.2-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22efea5e784e1d1cd8d7b856c198e360a979383ebc6dea4604743b56da1cbc34", size = 4893471, upload-time = "2025-12-09T13:35:58.927Z" }, + { url = "https://files.pythonhosted.org/packages/24/29/f8f8acccb9716b899be4be45e9ce770d6aa76327573863e68448183091b0/fonttools-4.60.2-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:677aa92d84d335e4d301d8ba04afca6f575316bc647b6782cb0921943fcb6343", size = 4854686, upload-time = "2025-12-09T13:36:01.767Z" }, + { url = "https://files.pythonhosted.org/packages/5a/0d/f3f51d7519f44f2dd5c9a60d7cd41185ebcee4348f073e515a3a93af15ff/fonttools-4.60.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:edd49d3defbf35476e78b61ff737ff5efea811acff68d44233a95a5a48252334", size = 4871233, upload-time = "2025-12-09T13:36:06.094Z" }, + { url = "https://files.pythonhosted.org/packages/cc/3f/4d4fd47d3bc40ab4d76718555185f8adffb5602ea572eac4bbf200c47d22/fonttools-4.60.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:126839492b69cecc5baf2bddcde60caab2ffafd867bbae2a88463fce6078ca3a", size = 4988936, upload-time = "2025-12-09T13:36:08.42Z" }, + { url = "https://files.pythonhosted.org/packages/01/6f/83bbdefa43f2c3ae206fd8c4b9a481f3c913eef871b1ce9a453069239e39/fonttools-4.60.2-cp310-cp310-win32.whl", hash = "sha256:ffcab6f5537136046ca902ed2491ab081ba271b07591b916289b7c27ff845f96", size = 2278044, upload-time = "2025-12-09T13:36:10.641Z" }, + { url = "https://files.pythonhosted.org/packages/d4/04/7d9a137e919d6c9ef26704b7f7b2580d9cfc5139597588227aacebc0e3b7/fonttools-4.60.2-cp310-cp310-win_amd64.whl", hash = "sha256:9c68b287c7ffcd29dd83b5f961004b2a54a862a88825d52ea219c6220309ba45", size = 2326522, upload-time = "2025-12-09T13:36:12.981Z" }, + { url = "https://files.pythonhosted.org/packages/e0/80/b7693d37c02417e162cc83cdd0b19a4f58be82c638b5d4ce4de2dae050c4/fonttools-4.60.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:a2aed0a7931401b3875265717a24c726f87ecfedbb7b3426c2ca4d2812e281ae", size = 2847809, upload-time = "2025-12-09T13:36:14.884Z" }, + { url = "https://files.pythonhosted.org/packages/f9/9a/9c2c13bf8a6496ac21607d704e74e9cc68ebf23892cf924c9a8b5c7566b9/fonttools-4.60.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:dea6868e9d2b816c9076cfea77754686f3c19149873bdbc5acde437631c15df1", size = 2397302, upload-time = "2025-12-09T13:36:17.151Z" }, + { url = "https://files.pythonhosted.org/packages/56/f6/ce38ff6b2d2d58f6fd981d32f3942365bfa30eadf2b47d93b2d48bf6097f/fonttools-4.60.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2fa27f34950aa1fe0f0b1abe25eed04770a3b3b34ad94e5ace82cc341589678a", size = 5054418, upload-time = "2025-12-09T13:36:19.062Z" }, + { url = "https://files.pythonhosted.org/packages/88/06/5353bea128ff39e857c31de3dd605725b4add956badae0b31bc9a50d4c8e/fonttools-4.60.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:13a53d479d187b09bfaa4a35ffcbc334fc494ff355f0a587386099cb66674f1e", size = 5031652, upload-time = "2025-12-09T13:36:21.206Z" }, + { url = "https://files.pythonhosted.org/packages/71/05/ebca836437f6ebd57edd6428e7eff584e683ff0556ddb17d62e3b731f46c/fonttools-4.60.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:fac5e921d3bd0ca3bb8517dced2784f0742bc8ca28579a68b139f04ea323a779", size = 5030321, upload-time = "2025-12-09T13:36:23.515Z" }, + { url = "https://files.pythonhosted.org/packages/57/f9/eb9d2a2ce30c99f840c1cc3940729a970923cf39d770caf88909d98d516b/fonttools-4.60.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:648f4f9186fd7f1f3cd57dbf00d67a583720d5011feca67a5e88b3a491952cfb", size = 5154255, upload-time = "2025-12-09T13:36:25.879Z" }, + { url = "https://files.pythonhosted.org/packages/08/a2/088b6ceba8272a9abb629d3c08f9c1e35e5ce42db0ccfe0c1f9f03e60d1d/fonttools-4.60.2-cp311-cp311-win32.whl", hash = "sha256:3274e15fad871bead5453d5ce02658f6d0c7bc7e7021e2a5b8b04e2f9e40da1a", size = 2276300, upload-time = "2025-12-09T13:36:27.772Z" }, + { url = "https://files.pythonhosted.org/packages/de/2f/8e4c3d908cc5dade7bb1316ce48589f6a24460c1056fd4b8db51f1fa309a/fonttools-4.60.2-cp311-cp311-win_amd64.whl", hash = "sha256:91d058d5a483a1525b367803abb69de0923fbd45e1f82ebd000f5c8aa65bc78e", size = 2327574, upload-time = "2025-12-09T13:36:30.89Z" }, + { url = "https://files.pythonhosted.org/packages/c0/30/530c9eddcd1c39219dc0aaede2b5a4c8ab80e0bb88d1b3ffc12944c4aac3/fonttools-4.60.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e0164b7609d2b5c5dd4e044b8085b7bd7ca7363ef8c269a4ab5b5d4885a426b2", size = 2847196, upload-time = "2025-12-09T13:36:33.262Z" }, + { url = "https://files.pythonhosted.org/packages/19/2f/4077a482836d5bbe3bc9dac1c004d02ee227cf04ed62b0a2dfc41d4f0dfd/fonttools-4.60.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:1dd3d9574fc595c1e97faccae0f264dc88784ddf7fbf54c939528378bacc0033", size = 2395842, upload-time = "2025-12-09T13:36:35.47Z" }, + { url = "https://files.pythonhosted.org/packages/dd/05/aae5bb99c5398f8ed4a8b784f023fd9dd3568f0bd5d5b21e35b282550f11/fonttools-4.60.2-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:98d0719f1b11c2817307d2da2e94296a3b2a3503f8d6252a101dca3ee663b917", size = 4949713, upload-time = "2025-12-09T13:36:37.874Z" }, + { url = "https://files.pythonhosted.org/packages/b4/37/49067349fc78ff0efbf09fadefe80ddf41473ca8f8a25400e3770da38328/fonttools-4.60.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9d3ea26957dd07209f207b4fff64c702efe5496de153a54d3b91007ec28904dd", size = 4999907, upload-time = "2025-12-09T13:36:39.853Z" }, + { url = "https://files.pythonhosted.org/packages/16/31/d0f11c758bd0db36b664c92a0f9dfdcc2d7313749aa7d6629805c6946f21/fonttools-4.60.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1ee301273b0850f3a515299f212898f37421f42ff9adfc341702582ca5073c13", size = 4939717, upload-time = "2025-12-09T13:36:43.075Z" }, + { url = "https://files.pythonhosted.org/packages/d9/bc/1cff0d69522e561bf1b99bee7c3911c08c25e919584827c3454a64651ce9/fonttools-4.60.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c6eb4694cc3b9c03b7c01d65a9cf35b577f21aa6abdbeeb08d3114b842a58153", size = 5089205, upload-time = "2025-12-09T13:36:45.468Z" }, + { url = "https://files.pythonhosted.org/packages/05/e6/fb174f0069b7122e19828c551298bfd34fdf9480535d2a6ac2ed37afacd3/fonttools-4.60.2-cp312-cp312-win32.whl", hash = "sha256:57f07b616c69c244cc1a5a51072eeef07dddda5ebef9ca5c6e9cf6d59ae65b70", size = 2264674, upload-time = "2025-12-09T13:36:49.238Z" }, + { url = "https://files.pythonhosted.org/packages/75/57/6552ffd6b582d3e6a9f01780c5275e6dfff1e70ca146101733aa1c12a129/fonttools-4.60.2-cp312-cp312-win_amd64.whl", hash = "sha256:310035802392f1fe5a7cf43d76f6ff4a24c919e4c72c0352e7b8176e2584b8a0", size = 2314701, upload-time = "2025-12-09T13:36:51.09Z" }, + { url = "https://files.pythonhosted.org/packages/2e/e4/8381d0ca6b6c6c484660b03517ec5b5b81feeefca3808726dece36c652a9/fonttools-4.60.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:2bb5fd231e56ccd7403212636dcccffc96c5ae0d6f9e4721fa0a32cb2e3ca432", size = 2842063, upload-time = "2025-12-09T13:36:53.468Z" }, + { url = "https://files.pythonhosted.org/packages/b4/2c/4367117ee8ff4f4374787a1222da0bd413d80cf3522111f727a7b8f80d1d/fonttools-4.60.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:536b5fab7b6fec78ccf59b5c59489189d9d0a8b0d3a77ed1858be59afb096696", size = 2393792, upload-time = "2025-12-09T13:36:55.742Z" }, + { url = "https://files.pythonhosted.org/packages/49/b7/a76b6dffa193869e54e32ca2f9abb0d0e66784bc8a24e6f86eb093015481/fonttools-4.60.2-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:6b9288fc38252ac86a9570f19313ecbc9ff678982e0f27c757a85f1f284d3400", size = 4924020, upload-time = "2025-12-09T13:36:58.229Z" }, + { url = "https://files.pythonhosted.org/packages/bd/4e/0078200e2259f0061c86a74075f507d64c43dd2ab38971956a5c0012d344/fonttools-4.60.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:93fcb420791d839ef592eada2b69997c445d0ce9c969b5190f2e16828ec10607", size = 4980070, upload-time = "2025-12-09T13:37:00.311Z" }, + { url = "https://files.pythonhosted.org/packages/85/1f/d87c85a11cb84852c975251581862681e4a0c1c3bd456c648792203f311b/fonttools-4.60.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:7916a381b094db4052ac284255186aebf74c5440248b78860cb41e300036f598", size = 4921411, upload-time = "2025-12-09T13:37:02.345Z" }, + { url = "https://files.pythonhosted.org/packages/75/c0/7efad650f5ed8e317c2633133ef3c64917e7adf2e4e2940c798f5d57ec6e/fonttools-4.60.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:58c8c393d5e16b15662cfc2d988491940458aa87894c662154f50c7b49440bef", size = 5063465, upload-time = "2025-12-09T13:37:04.836Z" }, + { url = "https://files.pythonhosted.org/packages/18/a8/750518c4f8cdd79393b386bc81226047ade80239e58c6c9f5dbe1fdd8ea1/fonttools-4.60.2-cp313-cp313-win32.whl", hash = "sha256:19c6e0afd8b02008caa0aa08ab896dfce5d0bcb510c49b2c499541d5cb95a963", size = 2263443, upload-time = "2025-12-09T13:37:06.762Z" }, + { url = "https://files.pythonhosted.org/packages/b8/22/026c60376f165981f80a0e90bd98a79ae3334e9d89a3d046c4d2e265c724/fonttools-4.60.2-cp313-cp313-win_amd64.whl", hash = "sha256:6a500dc59e11b2338c2dba1f8cf11a4ae8be35ec24af8b2628b8759a61457b76", size = 2313800, upload-time = "2025-12-09T13:37:08.713Z" }, + { url = "https://files.pythonhosted.org/packages/7e/ab/7cf1f5204e1366ddf9dc5cdc2789b571feb9eebcee0e3463c3f457df5f52/fonttools-4.60.2-cp314-cp314-macosx_10_15_universal2.whl", hash = "sha256:9387c532acbe323bbf2a920f132bce3c408a609d5f9dcfc6532fbc7e37f8ccbb", size = 2841690, upload-time = "2025-12-09T13:37:10.696Z" }, + { url = "https://files.pythonhosted.org/packages/00/3c/0bf83c6f863cc8b934952567fa2bf737cfcec8fc4ffb59b3f93820095f89/fonttools-4.60.2-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:e6f1c824185b5b8fb681297f315f26ae55abb0d560c2579242feea8236b1cfef", size = 2392191, upload-time = "2025-12-09T13:37:12.954Z" }, + { url = "https://files.pythonhosted.org/packages/00/f0/40090d148b8907fbea12e9bdf1ff149f30cdf1769e3b2c3e0dbf5106b88d/fonttools-4.60.2-cp314-cp314-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:55a3129d1e4030b1a30260f1b32fe76781b585fb2111d04a988e141c09eb6403", size = 4873503, upload-time = "2025-12-09T13:37:15.142Z" }, + { url = "https://files.pythonhosted.org/packages/dc/e0/d8b13f99e58b8c293781288ba62fe634f1f0697c9c4c0ae104d3215f3a10/fonttools-4.60.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b196e63753abc33b3b97a6fd6de4b7c4fef5552c0a5ba5e562be214d1e9668e0", size = 4968493, upload-time = "2025-12-09T13:37:18.272Z" }, + { url = "https://files.pythonhosted.org/packages/46/c5/960764d12c92bc225f02401d3067048cb7b282293d9e48e39fe2b0ec38a9/fonttools-4.60.2-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:de76c8d740fb55745f3b154f0470c56db92ae3be27af8ad6c2e88f1458260c9a", size = 4920015, upload-time = "2025-12-09T13:37:20.334Z" }, + { url = "https://files.pythonhosted.org/packages/4b/ab/839d8caf253d1eef3653ef4d34427d0326d17a53efaec9eb04056b670fff/fonttools-4.60.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6ba6303225c95998c9fda2d410aa792c3d2c1390a09df58d194b03e17583fa25", size = 5031165, upload-time = "2025-12-09T13:37:23.57Z" }, + { url = "https://files.pythonhosted.org/packages/de/bf/3bc862796a6841cbe0725bb5512d272239b809dba631a4b0301df885e62d/fonttools-4.60.2-cp314-cp314-win32.whl", hash = "sha256:0a89728ce10d7c816fedaa5380c06d2793e7a8a634d7ce16810e536c22047384", size = 2267526, upload-time = "2025-12-09T13:37:25.821Z" }, + { url = "https://files.pythonhosted.org/packages/fc/a1/c1909cacf00c76dc37b4743451561fbaaf7db4172c22a6d9394081d114c3/fonttools-4.60.2-cp314-cp314-win_amd64.whl", hash = "sha256:fa8446e6ab8bd778b82cb1077058a2addba86f30de27ab9cc18ed32b34bc8667", size = 2319096, upload-time = "2025-12-09T13:37:28.058Z" }, + { url = "https://files.pythonhosted.org/packages/29/b3/f66e71433f08e3a931b2b31a665aeed17fcc5e6911fc73529c70a232e421/fonttools-4.60.2-cp314-cp314t-macosx_10_15_universal2.whl", hash = "sha256:4063bc81ac5a4137642865cb63dd270e37b3cd1f55a07c0d6e41d072699ccca2", size = 2925167, upload-time = "2025-12-09T13:37:30.348Z" }, + { url = "https://files.pythonhosted.org/packages/2e/13/eeb491ff743594bbd0bee6e49422c03a59fe9c49002d3cc60eeb77414285/fonttools-4.60.2-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:ebfdb66fa69732ed604ab8e2a0431e6deff35e933a11d73418cbc7823d03b8e1", size = 2430923, upload-time = "2025-12-09T13:37:32.817Z" }, + { url = "https://files.pythonhosted.org/packages/b2/e5/db609f785e460796e53c4dbc3874a5f4948477f27beceb5e2d24b2537666/fonttools-4.60.2-cp314-cp314t-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:50b10b3b1a72d1d54c61b0e59239e1a94c0958f4a06a1febf97ce75388dd91a4", size = 4877729, upload-time = "2025-12-09T13:37:35.858Z" }, + { url = "https://files.pythonhosted.org/packages/5f/d6/85e4484dd4bfb03fee7bd370d65888cccbd3dee2681ee48c869dd5ccb23f/fonttools-4.60.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:beae16891a13b4a2ddec9b39b4de76092a3025e4d1c82362e3042b62295d5e4d", size = 5096003, upload-time = "2025-12-09T13:37:37.862Z" }, + { url = "https://files.pythonhosted.org/packages/30/49/1a98e44b71030b83d2046f981373b80571868259d98e6dae7bc20099dac6/fonttools-4.60.2-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:522f017fdb3766fd5d2d321774ef351cc6ce88ad4e6ac9efe643e4a2b9d528db", size = 4974410, upload-time = "2025-12-09T13:37:40.166Z" }, + { url = "https://files.pythonhosted.org/packages/42/07/d6f775d950ee8a841012472c7303f8819423d8cc3b4530915de7265ebfa2/fonttools-4.60.2-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:82cceceaf9c09a965a75b84a4b240dd3768e596ffb65ef53852681606fe7c9ba", size = 5002036, upload-time = "2025-12-09T13:37:42.639Z" }, + { url = "https://files.pythonhosted.org/packages/73/f6/ba6458f83ce1a9f8c3b17bd8f7b8a2205a126aac1055796b7e7cfebbd38f/fonttools-4.60.2-cp314-cp314t-win32.whl", hash = "sha256:bbfbc918a75437fe7e6d64d1b1e1f713237df1cf00f3a36dedae910b2ba01cee", size = 2330985, upload-time = "2025-12-09T13:37:45.157Z" }, + { url = "https://files.pythonhosted.org/packages/91/24/fea0ba4d3a32d4ed1103a1098bfd99dc78b5fe3bb97202920744a37b73dc/fonttools-4.60.2-cp314-cp314t-win_amd64.whl", hash = "sha256:0e5cd9b0830f6550d58c84f3ab151a9892b50c4f9d538c5603c0ce6fff2eb3f1", size = 2396226, upload-time = "2025-12-09T13:37:47.355Z" }, + { url = "https://files.pythonhosted.org/packages/55/ae/a6d9446cb258d3fe87e311c2d7bacf8e8da3e5809fbdc3a8306db4f6b14e/fonttools-4.60.2-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:a3c75b8b42f7f93906bdba9eb1197bb76aecbe9a0a7cf6feec75f7605b5e8008", size = 2857184, upload-time = "2025-12-09T13:37:49.96Z" }, + { url = "https://files.pythonhosted.org/packages/3a/f3/1b41d0b6a8b908aa07f652111155dd653ebbf0b3385e66562556c5206685/fonttools-4.60.2-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:0f86c8c37bc0ec0b9c141d5e90c717ff614e93c187f06d80f18c7057097f71bc", size = 2401877, upload-time = "2025-12-09T13:37:52.307Z" }, + { url = "https://files.pythonhosted.org/packages/71/57/048fd781680c38b05c5463657d0d95d5f2391a51972176e175c01de29d42/fonttools-4.60.2-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:fe905403fe59683b0e9a45f234af2866834376b8821f34633b1c76fb731b6311", size = 4878073, upload-time = "2025-12-09T13:37:56.477Z" }, + { url = "https://files.pythonhosted.org/packages/45/bb/363364f052a893cebd3d449588b21244a9d873620fda03ad92702d2e1bc7/fonttools-4.60.2-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:38ce703b60a906e421e12d9e3a7f064883f5e61bb23e8961f4be33cfe578500b", size = 4835385, upload-time = "2025-12-09T13:37:58.882Z" }, + { url = "https://files.pythonhosted.org/packages/1c/38/e392bb930b2436287e6021672345db26441bf1f85f1e98f8b9784334e41d/fonttools-4.60.2-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:9e810c06f3e79185cecf120e58b343ea5a89b54dd695fd644446bcf8c026da5e", size = 4853084, upload-time = "2025-12-09T13:38:01.578Z" }, + { url = "https://files.pythonhosted.org/packages/65/60/0d77faeaecf7a3276a8a6dc49e2274357e6b3ed6a1774e2fdb2a7f142db0/fonttools-4.60.2-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:38faec8cc1d12122599814d15a402183f5123fb7608dac956121e7c6742aebc5", size = 4971144, upload-time = "2025-12-09T13:38:03.748Z" }, + { url = "https://files.pythonhosted.org/packages/ba/c7/6d3ac3afbcd598631bce24c3ecb919e7d0644a82fea8ddc4454312fc0be6/fonttools-4.60.2-cp39-cp39-win32.whl", hash = "sha256:80a45cf7bf659acb7b36578f300231873daba67bd3ca8cce181c73f861f14a37", size = 1499411, upload-time = "2025-12-09T13:38:05.586Z" }, + { url = "https://files.pythonhosted.org/packages/5a/1c/9dedf6420e23f9fa630bb97941839dddd2e1e57d1b2b85a902378dbe0bd2/fonttools-4.60.2-cp39-cp39-win_amd64.whl", hash = "sha256:c355d5972071938e1b1e0f5a1df001f68ecf1a62f34a3407dc8e0beccf052501", size = 1547943, upload-time = "2025-12-09T13:38:07.604Z" }, + { url = "https://files.pythonhosted.org/packages/79/6c/10280af05b44fafd1dff69422805061fa1af29270bc52dce031ac69540bf/fonttools-4.60.2-py3-none-any.whl", hash = "sha256:73cf92eeda67cf6ff10c8af56fc8f4f07c1647d989a979be9e388a49be26552a", size = 1144610, upload-time = "2025-12-09T13:38:09.5Z" }, +] + +[[package]] +name = "fonttools" +version = "4.61.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", + "python_full_version == '3.10.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/ec/ca/cf17b88a8df95691275a3d77dc0a5ad9907f328ae53acbe6795da1b2f5ed/fonttools-4.61.1.tar.gz", hash = "sha256:6675329885c44657f826ef01d9e4fb33b9158e9d93c537d84ad8399539bc6f69", size = 3565756, upload-time = "2025-12-12T17:31:24.246Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5b/94/8a28707adb00bed1bf22dac16ccafe60faf2ade353dcb32c3617ee917307/fonttools-4.61.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c7db70d57e5e1089a274cbb2b1fd635c9a24de809a231b154965d415d6c6d24", size = 2854799, upload-time = "2025-12-12T17:29:27.5Z" }, + { url = "https://files.pythonhosted.org/packages/94/93/c2e682faaa5ee92034818d8f8a8145ae73eb83619600495dcf8503fa7771/fonttools-4.61.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:5fe9fd43882620017add5eabb781ebfbc6998ee49b35bd7f8f79af1f9f99a958", size = 2403032, upload-time = "2025-12-12T17:29:30.115Z" }, + { url = "https://files.pythonhosted.org/packages/f1/62/1748f7e7e1ee41aa52279fd2e3a6d0733dc42a673b16932bad8e5d0c8b28/fonttools-4.61.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d8db08051fc9e7d8bc622f2112511b8107d8f27cd89e2f64ec45e9825e8288da", size = 4897863, upload-time = "2025-12-12T17:29:32.535Z" }, + { url = "https://files.pythonhosted.org/packages/69/69/4ca02ee367d2c98edcaeb83fc278d20972502ee071214ad9d8ca85e06080/fonttools-4.61.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a76d4cb80f41ba94a6691264be76435e5f72f2cb3cab0b092a6212855f71c2f6", size = 4859076, upload-time = "2025-12-12T17:29:34.907Z" }, + { url = "https://files.pythonhosted.org/packages/8c/f5/660f9e3cefa078861a7f099107c6d203b568a6227eef163dd173bfc56bdc/fonttools-4.61.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a13fc8aeb24bad755eea8f7f9d409438eb94e82cf86b08fe77a03fbc8f6a96b1", size = 4875623, upload-time = "2025-12-12T17:29:37.33Z" }, + { url = "https://files.pythonhosted.org/packages/63/d1/9d7c5091d2276ed47795c131c1bf9316c3c1ab2789c22e2f59e0572ccd38/fonttools-4.61.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b846a1fcf8beadeb9ea4f44ec5bdde393e2f1569e17d700bfc49cd69bde75881", size = 4993327, upload-time = "2025-12-12T17:29:39.781Z" }, + { url = "https://files.pythonhosted.org/packages/6f/2d/28def73837885ae32260d07660a052b99f0aa00454867d33745dfe49dbf0/fonttools-4.61.1-cp310-cp310-win32.whl", hash = "sha256:78a7d3ab09dc47ac1a363a493e6112d8cabed7ba7caad5f54dbe2f08676d1b47", size = 1502180, upload-time = "2025-12-12T17:29:42.217Z" }, + { url = "https://files.pythonhosted.org/packages/63/fa/bfdc98abb4dd2bd491033e85e3ba69a2313c850e759a6daa014bc9433b0f/fonttools-4.61.1-cp310-cp310-win_amd64.whl", hash = "sha256:eff1ac3cc66c2ac7cda1e64b4e2f3ffef474b7335f92fc3833fc632d595fcee6", size = 1550654, upload-time = "2025-12-12T17:29:44.564Z" }, + { url = "https://files.pythonhosted.org/packages/69/12/bf9f4eaa2fad039356cc627587e30ed008c03f1cebd3034376b5ee8d1d44/fonttools-4.61.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:c6604b735bb12fef8e0efd5578c9fb5d3d8532d5001ea13a19cddf295673ee09", size = 2852213, upload-time = "2025-12-12T17:29:46.675Z" }, + { url = "https://files.pythonhosted.org/packages/ac/49/4138d1acb6261499bedde1c07f8c2605d1d8f9d77a151e5507fd3ef084b6/fonttools-4.61.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:5ce02f38a754f207f2f06557523cd39a06438ba3aafc0639c477ac409fc64e37", size = 2401689, upload-time = "2025-12-12T17:29:48.769Z" }, + { url = "https://files.pythonhosted.org/packages/e5/fe/e6ce0fe20a40e03aef906af60aa87668696f9e4802fa283627d0b5ed777f/fonttools-4.61.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:77efb033d8d7ff233385f30c62c7c79271c8885d5c9657d967ede124671bbdfb", size = 5058809, upload-time = "2025-12-12T17:29:51.701Z" }, + { url = "https://files.pythonhosted.org/packages/79/61/1ca198af22f7dd22c17ab86e9024ed3c06299cfdb08170640e9996d501a0/fonttools-4.61.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:75c1a6dfac6abd407634420c93864a1e274ebc1c7531346d9254c0d8f6ca00f9", size = 5036039, upload-time = "2025-12-12T17:29:53.659Z" }, + { url = "https://files.pythonhosted.org/packages/99/cc/fa1801e408586b5fce4da9f5455af8d770f4fc57391cd5da7256bb364d38/fonttools-4.61.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:0de30bfe7745c0d1ffa2b0b7048fb7123ad0d71107e10ee090fa0b16b9452e87", size = 5034714, upload-time = "2025-12-12T17:29:55.592Z" }, + { url = "https://files.pythonhosted.org/packages/bf/aa/b7aeafe65adb1b0a925f8f25725e09f078c635bc22754f3fecb7456955b0/fonttools-4.61.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:58b0ee0ab5b1fc9921eccfe11d1435added19d6494dde14e323f25ad2bc30c56", size = 5158648, upload-time = "2025-12-12T17:29:57.861Z" }, + { url = "https://files.pythonhosted.org/packages/99/f9/08ea7a38663328881384c6e7777bbefc46fd7d282adfd87a7d2b84ec9d50/fonttools-4.61.1-cp311-cp311-win32.whl", hash = "sha256:f79b168428351d11e10c5aeb61a74e1851ec221081299f4cf56036a95431c43a", size = 2280681, upload-time = "2025-12-12T17:29:59.943Z" }, + { url = "https://files.pythonhosted.org/packages/07/ad/37dd1ae5fa6e01612a1fbb954f0927681f282925a86e86198ccd7b15d515/fonttools-4.61.1-cp311-cp311-win_amd64.whl", hash = "sha256:fe2efccb324948a11dd09d22136fe2ac8a97d6c1347cf0b58a911dcd529f66b7", size = 2331951, upload-time = "2025-12-12T17:30:02.254Z" }, + { url = "https://files.pythonhosted.org/packages/6f/16/7decaa24a1bd3a70c607b2e29f0adc6159f36a7e40eaba59846414765fd4/fonttools-4.61.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:f3cb4a569029b9f291f88aafc927dd53683757e640081ca8c412781ea144565e", size = 2851593, upload-time = "2025-12-12T17:30:04.225Z" }, + { url = "https://files.pythonhosted.org/packages/94/98/3c4cb97c64713a8cf499b3245c3bf9a2b8fd16a3e375feff2aed78f96259/fonttools-4.61.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:41a7170d042e8c0024703ed13b71893519a1a6d6e18e933e3ec7507a2c26a4b2", size = 2400231, upload-time = "2025-12-12T17:30:06.47Z" }, + { url = "https://files.pythonhosted.org/packages/b7/37/82dbef0f6342eb01f54bca073ac1498433d6ce71e50c3c3282b655733b31/fonttools-4.61.1-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:10d88e55330e092940584774ee5e8a6971b01fc2f4d3466a1d6c158230880796", size = 4954103, upload-time = "2025-12-12T17:30:08.432Z" }, + { url = "https://files.pythonhosted.org/packages/6c/44/f3aeac0fa98e7ad527f479e161aca6c3a1e47bb6996b053d45226fe37bf2/fonttools-4.61.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:15acc09befd16a0fb8a8f62bc147e1a82817542d72184acca9ce6e0aeda9fa6d", size = 5004295, upload-time = "2025-12-12T17:30:10.56Z" }, + { url = "https://files.pythonhosted.org/packages/14/e8/7424ced75473983b964d09f6747fa09f054a6d656f60e9ac9324cf40c743/fonttools-4.61.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:e6bcdf33aec38d16508ce61fd81838f24c83c90a1d1b8c68982857038673d6b8", size = 4944109, upload-time = "2025-12-12T17:30:12.874Z" }, + { url = "https://files.pythonhosted.org/packages/c8/8b/6391b257fa3d0b553d73e778f953a2f0154292a7a7a085e2374b111e5410/fonttools-4.61.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:5fade934607a523614726119164ff621e8c30e8fa1ffffbbd358662056ba69f0", size = 5093598, upload-time = "2025-12-12T17:30:15.79Z" }, + { url = "https://files.pythonhosted.org/packages/d9/71/fd2ea96cdc512d92da5678a1c98c267ddd4d8c5130b76d0f7a80f9a9fde8/fonttools-4.61.1-cp312-cp312-win32.whl", hash = "sha256:75da8f28eff26defba42c52986de97b22106cb8f26515b7c22443ebc9c2d3261", size = 2269060, upload-time = "2025-12-12T17:30:18.058Z" }, + { url = "https://files.pythonhosted.org/packages/80/3b/a3e81b71aed5a688e89dfe0e2694b26b78c7d7f39a5ffd8a7d75f54a12a8/fonttools-4.61.1-cp312-cp312-win_amd64.whl", hash = "sha256:497c31ce314219888c0e2fce5ad9178ca83fe5230b01a5006726cdf3ac9f24d9", size = 2319078, upload-time = "2025-12-12T17:30:22.862Z" }, + { url = "https://files.pythonhosted.org/packages/4b/cf/00ba28b0990982530addb8dc3e9e6f2fa9cb5c20df2abdda7baa755e8fe1/fonttools-4.61.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8c56c488ab471628ff3bfa80964372fc13504ece601e0d97a78ee74126b2045c", size = 2846454, upload-time = "2025-12-12T17:30:24.938Z" }, + { url = "https://files.pythonhosted.org/packages/5a/ca/468c9a8446a2103ae645d14fee3f610567b7042aba85031c1c65e3ef7471/fonttools-4.61.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:dc492779501fa723b04d0ab1f5be046797fee17d27700476edc7ee9ae535a61e", size = 2398191, upload-time = "2025-12-12T17:30:27.343Z" }, + { url = "https://files.pythonhosted.org/packages/a3/4b/d67eedaed19def5967fade3297fed8161b25ba94699efc124b14fb68cdbc/fonttools-4.61.1-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:64102ca87e84261419c3747a0d20f396eb024bdbeb04c2bfb37e2891f5fadcb5", size = 4928410, upload-time = "2025-12-12T17:30:29.771Z" }, + { url = "https://files.pythonhosted.org/packages/b0/8d/6fb3494dfe61a46258cd93d979cf4725ded4eb46c2a4ca35e4490d84daea/fonttools-4.61.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4c1b526c8d3f615a7b1867f38a9410849c8f4aef078535742198e942fba0e9bd", size = 4984460, upload-time = "2025-12-12T17:30:32.073Z" }, + { url = "https://files.pythonhosted.org/packages/f7/f1/a47f1d30b3dc00d75e7af762652d4cbc3dff5c2697a0dbd5203c81afd9c3/fonttools-4.61.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:41ed4b5ec103bd306bb68f81dc166e77409e5209443e5773cb4ed837bcc9b0d3", size = 4925800, upload-time = "2025-12-12T17:30:34.339Z" }, + { url = "https://files.pythonhosted.org/packages/a7/01/e6ae64a0981076e8a66906fab01539799546181e32a37a0257b77e4aa88b/fonttools-4.61.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:b501c862d4901792adaec7c25b1ecc749e2662543f68bb194c42ba18d6eec98d", size = 5067859, upload-time = "2025-12-12T17:30:36.593Z" }, + { url = "https://files.pythonhosted.org/packages/73/aa/28e40b8d6809a9b5075350a86779163f074d2b617c15d22343fce81918db/fonttools-4.61.1-cp313-cp313-win32.whl", hash = "sha256:4d7092bb38c53bbc78e9255a59158b150bcdc115a1e3b3ce0b5f267dc35dd63c", size = 2267821, upload-time = "2025-12-12T17:30:38.478Z" }, + { url = "https://files.pythonhosted.org/packages/1a/59/453c06d1d83dc0951b69ef692d6b9f1846680342927df54e9a1ca91c6f90/fonttools-4.61.1-cp313-cp313-win_amd64.whl", hash = "sha256:21e7c8d76f62ab13c9472ccf74515ca5b9a761d1bde3265152a6dc58700d895b", size = 2318169, upload-time = "2025-12-12T17:30:40.951Z" }, + { url = "https://files.pythonhosted.org/packages/32/8f/4e7bf82c0cbb738d3c2206c920ca34ca74ef9dabde779030145d28665104/fonttools-4.61.1-cp314-cp314-macosx_10_15_universal2.whl", hash = "sha256:fff4f534200a04b4a36e7ae3cb74493afe807b517a09e99cb4faa89a34ed6ecd", size = 2846094, upload-time = "2025-12-12T17:30:43.511Z" }, + { url = "https://files.pythonhosted.org/packages/71/09/d44e45d0a4f3a651f23a1e9d42de43bc643cce2971b19e784cc67d823676/fonttools-4.61.1-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:d9203500f7c63545b4ce3799319fe4d9feb1a1b89b28d3cb5abd11b9dd64147e", size = 2396589, upload-time = "2025-12-12T17:30:45.681Z" }, + { url = "https://files.pythonhosted.org/packages/89/18/58c64cafcf8eb677a99ef593121f719e6dcbdb7d1c594ae5a10d4997ca8a/fonttools-4.61.1-cp314-cp314-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:fa646ecec9528bef693415c79a86e733c70a4965dd938e9a226b0fc64c9d2e6c", size = 4877892, upload-time = "2025-12-12T17:30:47.709Z" }, + { url = "https://files.pythonhosted.org/packages/8a/ec/9e6b38c7ba1e09eb51db849d5450f4c05b7e78481f662c3b79dbde6f3d04/fonttools-4.61.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:11f35ad7805edba3aac1a3710d104592df59f4b957e30108ae0ba6c10b11dd75", size = 4972884, upload-time = "2025-12-12T17:30:49.656Z" }, + { url = "https://files.pythonhosted.org/packages/5e/87/b5339da8e0256734ba0dbbf5b6cdebb1dd79b01dc8c270989b7bcd465541/fonttools-4.61.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:b931ae8f62db78861b0ff1ac017851764602288575d65b8e8ff1963fed419063", size = 4924405, upload-time = "2025-12-12T17:30:51.735Z" }, + { url = "https://files.pythonhosted.org/packages/0b/47/e3409f1e1e69c073a3a6fd8cb886eb18c0bae0ee13db2c8d5e7f8495e8b7/fonttools-4.61.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:b148b56f5de675ee16d45e769e69f87623a4944f7443850bf9a9376e628a89d2", size = 5035553, upload-time = "2025-12-12T17:30:54.823Z" }, + { url = "https://files.pythonhosted.org/packages/bf/b6/1f6600161b1073a984294c6c031e1a56ebf95b6164249eecf30012bb2e38/fonttools-4.61.1-cp314-cp314-win32.whl", hash = "sha256:9b666a475a65f4e839d3d10473fad6d47e0a9db14a2f4a224029c5bfde58ad2c", size = 2271915, upload-time = "2025-12-12T17:30:57.913Z" }, + { url = "https://files.pythonhosted.org/packages/52/7b/91e7b01e37cc8eb0e1f770d08305b3655e4f002fc160fb82b3390eabacf5/fonttools-4.61.1-cp314-cp314-win_amd64.whl", hash = "sha256:4f5686e1fe5fce75d82d93c47a438a25bf0d1319d2843a926f741140b2b16e0c", size = 2323487, upload-time = "2025-12-12T17:30:59.804Z" }, + { url = "https://files.pythonhosted.org/packages/39/5c/908ad78e46c61c3e3ed70c3b58ff82ab48437faf84ec84f109592cabbd9f/fonttools-4.61.1-cp314-cp314t-macosx_10_15_universal2.whl", hash = "sha256:e76ce097e3c57c4bcb67c5aa24a0ecdbd9f74ea9219997a707a4061fbe2707aa", size = 2929571, upload-time = "2025-12-12T17:31:02.574Z" }, + { url = "https://files.pythonhosted.org/packages/bd/41/975804132c6dea64cdbfbaa59f3518a21c137a10cccf962805b301ac6ab2/fonttools-4.61.1-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:9cfef3ab326780c04d6646f68d4b4742aae222e8b8ea1d627c74e38afcbc9d91", size = 2435317, upload-time = "2025-12-12T17:31:04.974Z" }, + { url = "https://files.pythonhosted.org/packages/b0/5a/aef2a0a8daf1ebaae4cfd83f84186d4a72ee08fd6a8451289fcd03ffa8a4/fonttools-4.61.1-cp314-cp314t-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:a75c301f96db737e1c5ed5fd7d77d9c34466de16095a266509e13da09751bd19", size = 4882124, upload-time = "2025-12-12T17:31:07.456Z" }, + { url = "https://files.pythonhosted.org/packages/80/33/d6db3485b645b81cea538c9d1c9219d5805f0877fda18777add4671c5240/fonttools-4.61.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:91669ccac46bbc1d09e9273546181919064e8df73488ea087dcac3e2968df9ba", size = 5100391, upload-time = "2025-12-12T17:31:09.732Z" }, + { url = "https://files.pythonhosted.org/packages/6c/d6/675ba631454043c75fcf76f0ca5463eac8eb0666ea1d7badae5fea001155/fonttools-4.61.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:c33ab3ca9d3ccd581d58e989d67554e42d8d4ded94ab3ade3508455fe70e65f7", size = 4978800, upload-time = "2025-12-12T17:31:11.681Z" }, + { url = "https://files.pythonhosted.org/packages/7f/33/d3ec753d547a8d2bdaedd390d4a814e8d5b45a093d558f025c6b990b554c/fonttools-4.61.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:664c5a68ec406f6b1547946683008576ef8b38275608e1cee6c061828171c118", size = 5006426, upload-time = "2025-12-12T17:31:13.764Z" }, + { url = "https://files.pythonhosted.org/packages/b4/40/cc11f378b561a67bea850ab50063366a0d1dd3f6d0a30ce0f874b0ad5664/fonttools-4.61.1-cp314-cp314t-win32.whl", hash = "sha256:aed04cabe26f30c1647ef0e8fbb207516fd40fe9472e9439695f5c6998e60ac5", size = 2335377, upload-time = "2025-12-12T17:31:16.49Z" }, + { url = "https://files.pythonhosted.org/packages/e4/ff/c9a2b66b39f8628531ea58b320d66d951267c98c6a38684daa8f50fb02f8/fonttools-4.61.1-cp314-cp314t-win_amd64.whl", hash = "sha256:2180f14c141d2f0f3da43f3a81bc8aa4684860f6b0e6f9e165a4831f24e6a23b", size = 2400613, upload-time = "2025-12-12T17:31:18.769Z" }, + { url = "https://files.pythonhosted.org/packages/c7/4e/ce75a57ff3aebf6fc1f4e9d508b8e5810618a33d900ad6c19eb30b290b97/fonttools-4.61.1-py3-none-any.whl", hash = "sha256:17d2bf5d541add43822bcf0c43d7d847b160c9bb01d15d5007d84e2217aaa371", size = 1148996, upload-time = "2025-12-12T17:31:21.03Z" }, +] + +[[package]] +name = "frozenlist" +version = "1.8.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/2d/f5/c831fac6cc817d26fd54c7eaccd04ef7e0288806943f7cc5bbf69f3ac1f0/frozenlist-1.8.0.tar.gz", hash = "sha256:3ede829ed8d842f6cd48fc7081d7a41001a56f1f38603f9d49bf3020d59a31ad", size = 45875, upload-time = "2025-10-06T05:38:17.865Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/83/4a/557715d5047da48d54e659203b9335be7bfaafda2c3f627b7c47e0b3aaf3/frozenlist-1.8.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:b37f6d31b3dcea7deb5e9696e529a6aa4a898adc33db82da12e4c60a7c4d2011", size = 86230, upload-time = "2025-10-06T05:35:23.699Z" }, + { url = "https://files.pythonhosted.org/packages/a2/fb/c85f9fed3ea8fe8740e5b46a59cc141c23b842eca617da8876cfce5f760e/frozenlist-1.8.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ef2b7b394f208233e471abc541cc6991f907ffd47dc72584acee3147899d6565", size = 49621, upload-time = "2025-10-06T05:35:25.341Z" }, + { url = "https://files.pythonhosted.org/packages/63/70/26ca3f06aace16f2352796b08704338d74b6d1a24ca38f2771afbb7ed915/frozenlist-1.8.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:a88f062f072d1589b7b46e951698950e7da00442fc1cacbe17e19e025dc327ad", size = 49889, upload-time = "2025-10-06T05:35:26.797Z" }, + { url = "https://files.pythonhosted.org/packages/5d/ed/c7895fd2fde7f3ee70d248175f9b6cdf792fb741ab92dc59cd9ef3bd241b/frozenlist-1.8.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:f57fb59d9f385710aa7060e89410aeb5058b99e62f4d16b08b91986b9a2140c2", size = 219464, upload-time = "2025-10-06T05:35:28.254Z" }, + { url = "https://files.pythonhosted.org/packages/6b/83/4d587dccbfca74cb8b810472392ad62bfa100bf8108c7223eb4c4fa2f7b3/frozenlist-1.8.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:799345ab092bee59f01a915620b5d014698547afd011e691a208637312db9186", size = 221649, upload-time = "2025-10-06T05:35:29.454Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c6/fd3b9cd046ec5fff9dab66831083bc2077006a874a2d3d9247dea93ddf7e/frozenlist-1.8.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:c23c3ff005322a6e16f71bf8692fcf4d5a304aaafe1e262c98c6d4adc7be863e", size = 219188, upload-time = "2025-10-06T05:35:30.951Z" }, + { url = "https://files.pythonhosted.org/packages/ce/80/6693f55eb2e085fc8afb28cf611448fb5b90e98e068fa1d1b8d8e66e5c7d/frozenlist-1.8.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8a76ea0f0b9dfa06f254ee06053d93a600865b3274358ca48a352ce4f0798450", size = 231748, upload-time = "2025-10-06T05:35:32.101Z" }, + { url = "https://files.pythonhosted.org/packages/97/d6/e9459f7c5183854abd989ba384fe0cc1a0fb795a83c033f0571ec5933ca4/frozenlist-1.8.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c7366fe1418a6133d5aa824ee53d406550110984de7637d65a178010f759c6ef", size = 236351, upload-time = "2025-10-06T05:35:33.834Z" }, + { url = "https://files.pythonhosted.org/packages/97/92/24e97474b65c0262e9ecd076e826bfd1d3074adcc165a256e42e7b8a7249/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:13d23a45c4cebade99340c4165bd90eeb4a56c6d8a9d8aa49568cac19a6d0dc4", size = 218767, upload-time = "2025-10-06T05:35:35.205Z" }, + { url = "https://files.pythonhosted.org/packages/ee/bf/dc394a097508f15abff383c5108cb8ad880d1f64a725ed3b90d5c2fbf0bb/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:e4a3408834f65da56c83528fb52ce7911484f0d1eaf7b761fc66001db1646eff", size = 235887, upload-time = "2025-10-06T05:35:36.354Z" }, + { url = "https://files.pythonhosted.org/packages/40/90/25b201b9c015dbc999a5baf475a257010471a1fa8c200c843fd4abbee725/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:42145cd2748ca39f32801dad54aeea10039da6f86e303659db90db1c4b614c8c", size = 228785, upload-time = "2025-10-06T05:35:37.949Z" }, + { url = "https://files.pythonhosted.org/packages/84/f4/b5bc148df03082f05d2dd30c089e269acdbe251ac9a9cf4e727b2dbb8a3d/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:e2de870d16a7a53901e41b64ffdf26f2fbb8917b3e6ebf398098d72c5b20bd7f", size = 230312, upload-time = "2025-10-06T05:35:39.178Z" }, + { url = "https://files.pythonhosted.org/packages/db/4b/87e95b5d15097c302430e647136b7d7ab2398a702390cf4c8601975709e7/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:20e63c9493d33ee48536600d1a5c95eefc870cd71e7ab037763d1fbb89cc51e7", size = 217650, upload-time = "2025-10-06T05:35:40.377Z" }, + { url = "https://files.pythonhosted.org/packages/e5/70/78a0315d1fea97120591a83e0acd644da638c872f142fd72a6cebee825f3/frozenlist-1.8.0-cp310-cp310-win32.whl", hash = "sha256:adbeebaebae3526afc3c96fad434367cafbfd1b25d72369a9e5858453b1bb71a", size = 39659, upload-time = "2025-10-06T05:35:41.863Z" }, + { url = "https://files.pythonhosted.org/packages/66/aa/3f04523fb189a00e147e60c5b2205126118f216b0aa908035c45336e27e4/frozenlist-1.8.0-cp310-cp310-win_amd64.whl", hash = "sha256:667c3777ca571e5dbeb76f331562ff98b957431df140b54c85fd4d52eea8d8f6", size = 43837, upload-time = "2025-10-06T05:35:43.205Z" }, + { url = "https://files.pythonhosted.org/packages/39/75/1135feecdd7c336938bd55b4dc3b0dfc46d85b9be12ef2628574b28de776/frozenlist-1.8.0-cp310-cp310-win_arm64.whl", hash = "sha256:80f85f0a7cc86e7a54c46d99c9e1318ff01f4687c172ede30fd52d19d1da1c8e", size = 39989, upload-time = "2025-10-06T05:35:44.596Z" }, + { url = "https://files.pythonhosted.org/packages/bc/03/077f869d540370db12165c0aa51640a873fb661d8b315d1d4d67b284d7ac/frozenlist-1.8.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:09474e9831bc2b2199fad6da3c14c7b0fbdd377cce9d3d77131be28906cb7d84", size = 86912, upload-time = "2025-10-06T05:35:45.98Z" }, + { url = "https://files.pythonhosted.org/packages/df/b5/7610b6bd13e4ae77b96ba85abea1c8cb249683217ef09ac9e0ae93f25a91/frozenlist-1.8.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:17c883ab0ab67200b5f964d2b9ed6b00971917d5d8a92df149dc2c9779208ee9", size = 50046, upload-time = "2025-10-06T05:35:47.009Z" }, + { url = "https://files.pythonhosted.org/packages/6e/ef/0e8f1fe32f8a53dd26bdd1f9347efe0778b0fddf62789ea683f4cc7d787d/frozenlist-1.8.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:fa47e444b8ba08fffd1c18e8cdb9a75db1b6a27f17507522834ad13ed5922b93", size = 50119, upload-time = "2025-10-06T05:35:48.38Z" }, + { url = "https://files.pythonhosted.org/packages/11/b1/71a477adc7c36e5fb628245dfbdea2166feae310757dea848d02bd0689fd/frozenlist-1.8.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:2552f44204b744fba866e573be4c1f9048d6a324dfe14475103fd51613eb1d1f", size = 231067, upload-time = "2025-10-06T05:35:49.97Z" }, + { url = "https://files.pythonhosted.org/packages/45/7e/afe40eca3a2dc19b9904c0f5d7edfe82b5304cb831391edec0ac04af94c2/frozenlist-1.8.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:957e7c38f250991e48a9a73e6423db1bb9dd14e722a10f6b8bb8e16a0f55f695", size = 233160, upload-time = "2025-10-06T05:35:51.729Z" }, + { url = "https://files.pythonhosted.org/packages/a6/aa/7416eac95603ce428679d273255ffc7c998d4132cfae200103f164b108aa/frozenlist-1.8.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:8585e3bb2cdea02fc88ffa245069c36555557ad3609e83be0ec71f54fd4abb52", size = 228544, upload-time = "2025-10-06T05:35:53.246Z" }, + { url = "https://files.pythonhosted.org/packages/8b/3d/2a2d1f683d55ac7e3875e4263d28410063e738384d3adc294f5ff3d7105e/frozenlist-1.8.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:edee74874ce20a373d62dc28b0b18b93f645633c2943fd90ee9d898550770581", size = 243797, upload-time = "2025-10-06T05:35:54.497Z" }, + { url = "https://files.pythonhosted.org/packages/78/1e/2d5565b589e580c296d3bb54da08d206e797d941a83a6fdea42af23be79c/frozenlist-1.8.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c9a63152fe95756b85f31186bddf42e4c02c6321207fd6601a1c89ebac4fe567", size = 247923, upload-time = "2025-10-06T05:35:55.861Z" }, + { url = "https://files.pythonhosted.org/packages/aa/c3/65872fcf1d326a7f101ad4d86285c403c87be7d832b7470b77f6d2ed5ddc/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:b6db2185db9be0a04fecf2f241c70b63b1a242e2805be291855078f2b404dd6b", size = 230886, upload-time = "2025-10-06T05:35:57.399Z" }, + { url = "https://files.pythonhosted.org/packages/a0/76/ac9ced601d62f6956f03cc794f9e04c81719509f85255abf96e2510f4265/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:f4be2e3d8bc8aabd566f8d5b8ba7ecc09249d74ba3c9ed52e54dc23a293f0b92", size = 245731, upload-time = "2025-10-06T05:35:58.563Z" }, + { url = "https://files.pythonhosted.org/packages/b9/49/ecccb5f2598daf0b4a1415497eba4c33c1e8ce07495eb07d2860c731b8d5/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:c8d1634419f39ea6f5c427ea2f90ca85126b54b50837f31497f3bf38266e853d", size = 241544, upload-time = "2025-10-06T05:35:59.719Z" }, + { url = "https://files.pythonhosted.org/packages/53/4b/ddf24113323c0bbcc54cb38c8b8916f1da7165e07b8e24a717b4a12cbf10/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:1a7fa382a4a223773ed64242dbe1c9c326ec09457e6b8428efb4118c685c3dfd", size = 241806, upload-time = "2025-10-06T05:36:00.959Z" }, + { url = "https://files.pythonhosted.org/packages/a7/fb/9b9a084d73c67175484ba2789a59f8eebebd0827d186a8102005ce41e1ba/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:11847b53d722050808926e785df837353bd4d75f1d494377e59b23594d834967", size = 229382, upload-time = "2025-10-06T05:36:02.22Z" }, + { url = "https://files.pythonhosted.org/packages/95/a3/c8fb25aac55bf5e12dae5c5aa6a98f85d436c1dc658f21c3ac73f9fa95e5/frozenlist-1.8.0-cp311-cp311-win32.whl", hash = "sha256:27c6e8077956cf73eadd514be8fb04d77fc946a7fe9f7fe167648b0b9085cc25", size = 39647, upload-time = "2025-10-06T05:36:03.409Z" }, + { url = "https://files.pythonhosted.org/packages/0a/f5/603d0d6a02cfd4c8f2a095a54672b3cf967ad688a60fb9faf04fc4887f65/frozenlist-1.8.0-cp311-cp311-win_amd64.whl", hash = "sha256:ac913f8403b36a2c8610bbfd25b8013488533e71e62b4b4adce9c86c8cea905b", size = 44064, upload-time = "2025-10-06T05:36:04.368Z" }, + { url = "https://files.pythonhosted.org/packages/5d/16/c2c9ab44e181f043a86f9a8f84d5124b62dbcb3a02c0977ec72b9ac1d3e0/frozenlist-1.8.0-cp311-cp311-win_arm64.whl", hash = "sha256:d4d3214a0f8394edfa3e303136d0575eece0745ff2b47bd2cb2e66dd92d4351a", size = 39937, upload-time = "2025-10-06T05:36:05.669Z" }, + { url = "https://files.pythonhosted.org/packages/69/29/948b9aa87e75820a38650af445d2ef2b6b8a6fab1a23b6bb9e4ef0be2d59/frozenlist-1.8.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:78f7b9e5d6f2fdb88cdde9440dc147259b62b9d3b019924def9f6478be254ac1", size = 87782, upload-time = "2025-10-06T05:36:06.649Z" }, + { url = "https://files.pythonhosted.org/packages/64/80/4f6e318ee2a7c0750ed724fa33a4bdf1eacdc5a39a7a24e818a773cd91af/frozenlist-1.8.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:229bf37d2e4acdaf808fd3f06e854a4a7a3661e871b10dc1f8f1896a3b05f18b", size = 50594, upload-time = "2025-10-06T05:36:07.69Z" }, + { url = "https://files.pythonhosted.org/packages/2b/94/5c8a2b50a496b11dd519f4a24cb5496cf125681dd99e94c604ccdea9419a/frozenlist-1.8.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:f833670942247a14eafbb675458b4e61c82e002a148f49e68257b79296e865c4", size = 50448, upload-time = "2025-10-06T05:36:08.78Z" }, + { url = "https://files.pythonhosted.org/packages/6a/bd/d91c5e39f490a49df14320f4e8c80161cfcce09f1e2cde1edd16a551abb3/frozenlist-1.8.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:494a5952b1c597ba44e0e78113a7266e656b9794eec897b19ead706bd7074383", size = 242411, upload-time = "2025-10-06T05:36:09.801Z" }, + { url = "https://files.pythonhosted.org/packages/8f/83/f61505a05109ef3293dfb1ff594d13d64a2324ac3482be2cedc2be818256/frozenlist-1.8.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:96f423a119f4777a4a056b66ce11527366a8bb92f54e541ade21f2374433f6d4", size = 243014, upload-time = "2025-10-06T05:36:11.394Z" }, + { url = "https://files.pythonhosted.org/packages/d8/cb/cb6c7b0f7d4023ddda30cf56b8b17494eb3a79e3fda666bf735f63118b35/frozenlist-1.8.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3462dd9475af2025c31cc61be6652dfa25cbfb56cbbf52f4ccfe029f38decaf8", size = 234909, upload-time = "2025-10-06T05:36:12.598Z" }, + { url = "https://files.pythonhosted.org/packages/31/c5/cd7a1f3b8b34af009fb17d4123c5a778b44ae2804e3ad6b86204255f9ec5/frozenlist-1.8.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c4c800524c9cd9bac5166cd6f55285957fcfc907db323e193f2afcd4d9abd69b", size = 250049, upload-time = "2025-10-06T05:36:14.065Z" }, + { url = "https://files.pythonhosted.org/packages/c0/01/2f95d3b416c584a1e7f0e1d6d31998c4a795f7544069ee2e0962a4b60740/frozenlist-1.8.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d6a5df73acd3399d893dafc71663ad22534b5aa4f94e8a2fabfe856c3c1b6a52", size = 256485, upload-time = "2025-10-06T05:36:15.39Z" }, + { url = "https://files.pythonhosted.org/packages/ce/03/024bf7720b3abaebcff6d0793d73c154237b85bdf67b7ed55e5e9596dc9a/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:405e8fe955c2280ce66428b3ca55e12b3c4e9c336fb2103a4937e891c69a4a29", size = 237619, upload-time = "2025-10-06T05:36:16.558Z" }, + { url = "https://files.pythonhosted.org/packages/69/fa/f8abdfe7d76b731f5d8bd217827cf6764d4f1d9763407e42717b4bed50a0/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:908bd3f6439f2fef9e85031b59fd4f1297af54415fb60e4254a95f75b3cab3f3", size = 250320, upload-time = "2025-10-06T05:36:17.821Z" }, + { url = "https://files.pythonhosted.org/packages/f5/3c/b051329f718b463b22613e269ad72138cc256c540f78a6de89452803a47d/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:294e487f9ec720bd8ffcebc99d575f7eff3568a08a253d1ee1a0378754b74143", size = 246820, upload-time = "2025-10-06T05:36:19.046Z" }, + { url = "https://files.pythonhosted.org/packages/0f/ae/58282e8f98e444b3f4dd42448ff36fa38bef29e40d40f330b22e7108f565/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:74c51543498289c0c43656701be6b077f4b265868fa7f8a8859c197006efb608", size = 250518, upload-time = "2025-10-06T05:36:20.763Z" }, + { url = "https://files.pythonhosted.org/packages/8f/96/007e5944694d66123183845a106547a15944fbbb7154788cbf7272789536/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:776f352e8329135506a1d6bf16ac3f87bc25b28e765949282dcc627af36123aa", size = 239096, upload-time = "2025-10-06T05:36:22.129Z" }, + { url = "https://files.pythonhosted.org/packages/66/bb/852b9d6db2fa40be96f29c0d1205c306288f0684df8fd26ca1951d461a56/frozenlist-1.8.0-cp312-cp312-win32.whl", hash = "sha256:433403ae80709741ce34038da08511d4a77062aa924baf411ef73d1146e74faf", size = 39985, upload-time = "2025-10-06T05:36:23.661Z" }, + { url = "https://files.pythonhosted.org/packages/b8/af/38e51a553dd66eb064cdf193841f16f077585d4d28394c2fa6235cb41765/frozenlist-1.8.0-cp312-cp312-win_amd64.whl", hash = "sha256:34187385b08f866104f0c0617404c8eb08165ab1272e884abc89c112e9c00746", size = 44591, upload-time = "2025-10-06T05:36:24.958Z" }, + { url = "https://files.pythonhosted.org/packages/a7/06/1dc65480ab147339fecc70797e9c2f69d9cea9cf38934ce08df070fdb9cb/frozenlist-1.8.0-cp312-cp312-win_arm64.whl", hash = "sha256:fe3c58d2f5db5fbd18c2987cba06d51b0529f52bc3a6cdc33d3f4eab725104bd", size = 40102, upload-time = "2025-10-06T05:36:26.333Z" }, + { url = "https://files.pythonhosted.org/packages/2d/40/0832c31a37d60f60ed79e9dfb5a92e1e2af4f40a16a29abcc7992af9edff/frozenlist-1.8.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8d92f1a84bb12d9e56f818b3a746f3efba93c1b63c8387a73dde655e1e42282a", size = 85717, upload-time = "2025-10-06T05:36:27.341Z" }, + { url = "https://files.pythonhosted.org/packages/30/ba/b0b3de23f40bc55a7057bd38434e25c34fa48e17f20ee273bbde5e0650f3/frozenlist-1.8.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:96153e77a591c8adc2ee805756c61f59fef4cf4073a9275ee86fe8cba41241f7", size = 49651, upload-time = "2025-10-06T05:36:28.855Z" }, + { url = "https://files.pythonhosted.org/packages/0c/ab/6e5080ee374f875296c4243c381bbdef97a9ac39c6e3ce1d5f7d42cb78d6/frozenlist-1.8.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f21f00a91358803399890ab167098c131ec2ddd5f8f5fd5fe9c9f2c6fcd91e40", size = 49417, upload-time = "2025-10-06T05:36:29.877Z" }, + { url = "https://files.pythonhosted.org/packages/d5/4e/e4691508f9477ce67da2015d8c00acd751e6287739123113a9fca6f1604e/frozenlist-1.8.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:fb30f9626572a76dfe4293c7194a09fb1fe93ba94c7d4f720dfae3b646b45027", size = 234391, upload-time = "2025-10-06T05:36:31.301Z" }, + { url = "https://files.pythonhosted.org/packages/40/76/c202df58e3acdf12969a7895fd6f3bc016c642e6726aa63bd3025e0fc71c/frozenlist-1.8.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:eaa352d7047a31d87dafcacbabe89df0aa506abb5b1b85a2fb91bc3faa02d822", size = 233048, upload-time = "2025-10-06T05:36:32.531Z" }, + { url = "https://files.pythonhosted.org/packages/f9/c0/8746afb90f17b73ca5979c7a3958116e105ff796e718575175319b5bb4ce/frozenlist-1.8.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:03ae967b4e297f58f8c774c7eabcce57fe3c2434817d4385c50661845a058121", size = 226549, upload-time = "2025-10-06T05:36:33.706Z" }, + { url = "https://files.pythonhosted.org/packages/7e/eb/4c7eefc718ff72f9b6c4893291abaae5fbc0c82226a32dcd8ef4f7a5dbef/frozenlist-1.8.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f6292f1de555ffcc675941d65fffffb0a5bcd992905015f85d0592201793e0e5", size = 239833, upload-time = "2025-10-06T05:36:34.947Z" }, + { url = "https://files.pythonhosted.org/packages/c2/4e/e5c02187cf704224f8b21bee886f3d713ca379535f16893233b9d672ea71/frozenlist-1.8.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29548f9b5b5e3460ce7378144c3010363d8035cea44bc0bf02d57f5a685e084e", size = 245363, upload-time = "2025-10-06T05:36:36.534Z" }, + { url = "https://files.pythonhosted.org/packages/1f/96/cb85ec608464472e82ad37a17f844889c36100eed57bea094518bf270692/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ec3cc8c5d4084591b4237c0a272cc4f50a5b03396a47d9caaf76f5d7b38a4f11", size = 229314, upload-time = "2025-10-06T05:36:38.582Z" }, + { url = "https://files.pythonhosted.org/packages/5d/6f/4ae69c550e4cee66b57887daeebe006fe985917c01d0fff9caab9883f6d0/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:517279f58009d0b1f2e7c1b130b377a349405da3f7621ed6bfae50b10adf20c1", size = 243365, upload-time = "2025-10-06T05:36:40.152Z" }, + { url = "https://files.pythonhosted.org/packages/7a/58/afd56de246cf11780a40a2c28dc7cbabbf06337cc8ddb1c780a2d97e88d8/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:db1e72ede2d0d7ccb213f218df6a078a9c09a7de257c2fe8fcef16d5925230b1", size = 237763, upload-time = "2025-10-06T05:36:41.355Z" }, + { url = "https://files.pythonhosted.org/packages/cb/36/cdfaf6ed42e2644740d4a10452d8e97fa1c062e2a8006e4b09f1b5fd7d63/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:b4dec9482a65c54a5044486847b8a66bf10c9cb4926d42927ec4e8fd5db7fed8", size = 240110, upload-time = "2025-10-06T05:36:42.716Z" }, + { url = "https://files.pythonhosted.org/packages/03/a8/9ea226fbefad669f11b52e864c55f0bd57d3c8d7eb07e9f2e9a0b39502e1/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:21900c48ae04d13d416f0e1e0c4d81f7931f73a9dfa0b7a8746fb2fe7dd970ed", size = 233717, upload-time = "2025-10-06T05:36:44.251Z" }, + { url = "https://files.pythonhosted.org/packages/1e/0b/1b5531611e83ba7d13ccc9988967ea1b51186af64c42b7a7af465dcc9568/frozenlist-1.8.0-cp313-cp313-win32.whl", hash = "sha256:8b7b94a067d1c504ee0b16def57ad5738701e4ba10cec90529f13fa03c833496", size = 39628, upload-time = "2025-10-06T05:36:45.423Z" }, + { url = "https://files.pythonhosted.org/packages/d8/cf/174c91dbc9cc49bc7b7aab74d8b734e974d1faa8f191c74af9b7e80848e6/frozenlist-1.8.0-cp313-cp313-win_amd64.whl", hash = "sha256:878be833caa6a3821caf85eb39c5ba92d28e85df26d57afb06b35b2efd937231", size = 43882, upload-time = "2025-10-06T05:36:46.796Z" }, + { url = "https://files.pythonhosted.org/packages/c1/17/502cd212cbfa96eb1388614fe39a3fc9ab87dbbe042b66f97acb57474834/frozenlist-1.8.0-cp313-cp313-win_arm64.whl", hash = "sha256:44389d135b3ff43ba8cc89ff7f51f5a0bb6b63d829c8300f79a2fe4fe61bcc62", size = 39676, upload-time = "2025-10-06T05:36:47.8Z" }, + { url = "https://files.pythonhosted.org/packages/d2/5c/3bbfaa920dfab09e76946a5d2833a7cbdf7b9b4a91c714666ac4855b88b4/frozenlist-1.8.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:e25ac20a2ef37e91c1b39938b591457666a0fa835c7783c3a8f33ea42870db94", size = 89235, upload-time = "2025-10-06T05:36:48.78Z" }, + { url = "https://files.pythonhosted.org/packages/d2/d6/f03961ef72166cec1687e84e8925838442b615bd0b8854b54923ce5b7b8a/frozenlist-1.8.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:07cdca25a91a4386d2e76ad992916a85038a9b97561bf7a3fd12d5d9ce31870c", size = 50742, upload-time = "2025-10-06T05:36:49.837Z" }, + { url = "https://files.pythonhosted.org/packages/1e/bb/a6d12b7ba4c3337667d0e421f7181c82dda448ce4e7ad7ecd249a16fa806/frozenlist-1.8.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:4e0c11f2cc6717e0a741f84a527c52616140741cd812a50422f83dc31749fb52", size = 51725, upload-time = "2025-10-06T05:36:50.851Z" }, + { url = "https://files.pythonhosted.org/packages/bc/71/d1fed0ffe2c2ccd70b43714c6cab0f4188f09f8a67a7914a6b46ee30f274/frozenlist-1.8.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b3210649ee28062ea6099cfda39e147fa1bc039583c8ee4481cb7811e2448c51", size = 284533, upload-time = "2025-10-06T05:36:51.898Z" }, + { url = "https://files.pythonhosted.org/packages/c9/1f/fb1685a7b009d89f9bf78a42d94461bc06581f6e718c39344754a5d9bada/frozenlist-1.8.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:581ef5194c48035a7de2aefc72ac6539823bb71508189e5de01d60c9dcd5fa65", size = 292506, upload-time = "2025-10-06T05:36:53.101Z" }, + { url = "https://files.pythonhosted.org/packages/e6/3b/b991fe1612703f7e0d05c0cf734c1b77aaf7c7d321df4572e8d36e7048c8/frozenlist-1.8.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3ef2d026f16a2b1866e1d86fc4e1291e1ed8a387b2c333809419a2f8b3a77b82", size = 274161, upload-time = "2025-10-06T05:36:54.309Z" }, + { url = "https://files.pythonhosted.org/packages/ca/ec/c5c618767bcdf66e88945ec0157d7f6c4a1322f1473392319b7a2501ded7/frozenlist-1.8.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5500ef82073f599ac84d888e3a8c1f77ac831183244bfd7f11eaa0289fb30714", size = 294676, upload-time = "2025-10-06T05:36:55.566Z" }, + { url = "https://files.pythonhosted.org/packages/7c/ce/3934758637d8f8a88d11f0585d6495ef54b2044ed6ec84492a91fa3b27aa/frozenlist-1.8.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:50066c3997d0091c411a66e710f4e11752251e6d2d73d70d8d5d4c76442a199d", size = 300638, upload-time = "2025-10-06T05:36:56.758Z" }, + { url = "https://files.pythonhosted.org/packages/fc/4f/a7e4d0d467298f42de4b41cbc7ddaf19d3cfeabaf9ff97c20c6c7ee409f9/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:5c1c8e78426e59b3f8005e9b19f6ff46e5845895adbde20ece9218319eca6506", size = 283067, upload-time = "2025-10-06T05:36:57.965Z" }, + { url = "https://files.pythonhosted.org/packages/dc/48/c7b163063d55a83772b268e6d1affb960771b0e203b632cfe09522d67ea5/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:eefdba20de0d938cec6a89bd4d70f346a03108a19b9df4248d3cf0d88f1b0f51", size = 292101, upload-time = "2025-10-06T05:36:59.237Z" }, + { url = "https://files.pythonhosted.org/packages/9f/d0/2366d3c4ecdc2fd391e0afa6e11500bfba0ea772764d631bbf82f0136c9d/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:cf253e0e1c3ceb4aaff6df637ce033ff6535fb8c70a764a8f46aafd3d6ab798e", size = 289901, upload-time = "2025-10-06T05:37:00.811Z" }, + { url = "https://files.pythonhosted.org/packages/b8/94/daff920e82c1b70e3618a2ac39fbc01ae3e2ff6124e80739ce5d71c9b920/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:032efa2674356903cd0261c4317a561a6850f3ac864a63fc1583147fb05a79b0", size = 289395, upload-time = "2025-10-06T05:37:02.115Z" }, + { url = "https://files.pythonhosted.org/packages/e3/20/bba307ab4235a09fdcd3cc5508dbabd17c4634a1af4b96e0f69bfe551ebd/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:6da155091429aeba16851ecb10a9104a108bcd32f6c1642867eadaee401c1c41", size = 283659, upload-time = "2025-10-06T05:37:03.711Z" }, + { url = "https://files.pythonhosted.org/packages/fd/00/04ca1c3a7a124b6de4f8a9a17cc2fcad138b4608e7a3fc5877804b8715d7/frozenlist-1.8.0-cp313-cp313t-win32.whl", hash = "sha256:0f96534f8bfebc1a394209427d0f8a63d343c9779cda6fc25e8e121b5fd8555b", size = 43492, upload-time = "2025-10-06T05:37:04.915Z" }, + { url = "https://files.pythonhosted.org/packages/59/5e/c69f733a86a94ab10f68e496dc6b7e8bc078ebb415281d5698313e3af3a1/frozenlist-1.8.0-cp313-cp313t-win_amd64.whl", hash = "sha256:5d63a068f978fc69421fb0e6eb91a9603187527c86b7cd3f534a5b77a592b888", size = 48034, upload-time = "2025-10-06T05:37:06.343Z" }, + { url = "https://files.pythonhosted.org/packages/16/6c/be9d79775d8abe79b05fa6d23da99ad6e7763a1d080fbae7290b286093fd/frozenlist-1.8.0-cp313-cp313t-win_arm64.whl", hash = "sha256:bf0a7e10b077bf5fb9380ad3ae8ce20ef919a6ad93b4552896419ac7e1d8e042", size = 41749, upload-time = "2025-10-06T05:37:07.431Z" }, + { url = "https://files.pythonhosted.org/packages/f1/c8/85da824b7e7b9b6e7f7705b2ecaf9591ba6f79c1177f324c2735e41d36a2/frozenlist-1.8.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:cee686f1f4cadeb2136007ddedd0aaf928ab95216e7691c63e50a8ec066336d0", size = 86127, upload-time = "2025-10-06T05:37:08.438Z" }, + { url = "https://files.pythonhosted.org/packages/8e/e8/a1185e236ec66c20afd72399522f142c3724c785789255202d27ae992818/frozenlist-1.8.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:119fb2a1bd47307e899c2fac7f28e85b9a543864df47aa7ec9d3c1b4545f096f", size = 49698, upload-time = "2025-10-06T05:37:09.48Z" }, + { url = "https://files.pythonhosted.org/packages/a1/93/72b1736d68f03fda5fdf0f2180fb6caaae3894f1b854d006ac61ecc727ee/frozenlist-1.8.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:4970ece02dbc8c3a92fcc5228e36a3e933a01a999f7094ff7c23fbd2beeaa67c", size = 49749, upload-time = "2025-10-06T05:37:10.569Z" }, + { url = "https://files.pythonhosted.org/packages/a7/b2/fabede9fafd976b991e9f1b9c8c873ed86f202889b864756f240ce6dd855/frozenlist-1.8.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:cba69cb73723c3f329622e34bdbf5ce1f80c21c290ff04256cff1cd3c2036ed2", size = 231298, upload-time = "2025-10-06T05:37:11.993Z" }, + { url = "https://files.pythonhosted.org/packages/3a/3b/d9b1e0b0eed36e70477ffb8360c49c85c8ca8ef9700a4e6711f39a6e8b45/frozenlist-1.8.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:778a11b15673f6f1df23d9586f83c4846c471a8af693a22e066508b77d201ec8", size = 232015, upload-time = "2025-10-06T05:37:13.194Z" }, + { url = "https://files.pythonhosted.org/packages/dc/94/be719d2766c1138148564a3960fc2c06eb688da592bdc25adcf856101be7/frozenlist-1.8.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:0325024fe97f94c41c08872db482cf8ac4800d80e79222c6b0b7b162d5b13686", size = 225038, upload-time = "2025-10-06T05:37:14.577Z" }, + { url = "https://files.pythonhosted.org/packages/e4/09/6712b6c5465f083f52f50cf74167b92d4ea2f50e46a9eea0523d658454ae/frozenlist-1.8.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:97260ff46b207a82a7567b581ab4190bd4dfa09f4db8a8b49d1a958f6aa4940e", size = 240130, upload-time = "2025-10-06T05:37:15.781Z" }, + { url = "https://files.pythonhosted.org/packages/f8/d4/cd065cdcf21550b54f3ce6a22e143ac9e4836ca42a0de1022da8498eac89/frozenlist-1.8.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:54b2077180eb7f83dd52c40b2750d0a9f175e06a42e3213ce047219de902717a", size = 242845, upload-time = "2025-10-06T05:37:17.037Z" }, + { url = "https://files.pythonhosted.org/packages/62/c3/f57a5c8c70cd1ead3d5d5f776f89d33110b1addae0ab010ad774d9a44fb9/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:2f05983daecab868a31e1da44462873306d3cbfd76d1f0b5b69c473d21dbb128", size = 229131, upload-time = "2025-10-06T05:37:18.221Z" }, + { url = "https://files.pythonhosted.org/packages/6c/52/232476fe9cb64f0742f3fde2b7d26c1dac18b6d62071c74d4ded55e0ef94/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:33f48f51a446114bc5d251fb2954ab0164d5be02ad3382abcbfe07e2531d650f", size = 240542, upload-time = "2025-10-06T05:37:19.771Z" }, + { url = "https://files.pythonhosted.org/packages/5f/85/07bf3f5d0fb5414aee5f47d33c6f5c77bfe49aac680bfece33d4fdf6a246/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:154e55ec0655291b5dd1b8731c637ecdb50975a2ae70c606d100750a540082f7", size = 237308, upload-time = "2025-10-06T05:37:20.969Z" }, + { url = "https://files.pythonhosted.org/packages/11/99/ae3a33d5befd41ac0ca2cc7fd3aa707c9c324de2e89db0e0f45db9a64c26/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:4314debad13beb564b708b4a496020e5306c7333fa9a3ab90374169a20ffab30", size = 238210, upload-time = "2025-10-06T05:37:22.252Z" }, + { url = "https://files.pythonhosted.org/packages/b2/60/b1d2da22f4970e7a155f0adde9b1435712ece01b3cd45ba63702aea33938/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:073f8bf8becba60aa931eb3bc420b217bb7d5b8f4750e6f8b3be7f3da85d38b7", size = 231972, upload-time = "2025-10-06T05:37:23.5Z" }, + { url = "https://files.pythonhosted.org/packages/3f/ab/945b2f32de889993b9c9133216c068b7fcf257d8595a0ac420ac8677cab0/frozenlist-1.8.0-cp314-cp314-win32.whl", hash = "sha256:bac9c42ba2ac65ddc115d930c78d24ab8d4f465fd3fc473cdedfccadb9429806", size = 40536, upload-time = "2025-10-06T05:37:25.581Z" }, + { url = "https://files.pythonhosted.org/packages/59/ad/9caa9b9c836d9ad6f067157a531ac48b7d36499f5036d4141ce78c230b1b/frozenlist-1.8.0-cp314-cp314-win_amd64.whl", hash = "sha256:3e0761f4d1a44f1d1a47996511752cf3dcec5bbdd9cc2b4fe595caf97754b7a0", size = 44330, upload-time = "2025-10-06T05:37:26.928Z" }, + { url = "https://files.pythonhosted.org/packages/82/13/e6950121764f2676f43534c555249f57030150260aee9dcf7d64efda11dd/frozenlist-1.8.0-cp314-cp314-win_arm64.whl", hash = "sha256:d1eaff1d00c7751b7c6662e9c5ba6eb2c17a2306ba5e2a37f24ddf3cc953402b", size = 40627, upload-time = "2025-10-06T05:37:28.075Z" }, + { url = "https://files.pythonhosted.org/packages/c0/c7/43200656ecc4e02d3f8bc248df68256cd9572b3f0017f0a0c4e93440ae23/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d3bb933317c52d7ea5004a1c442eef86f426886fba134ef8cf4226ea6ee1821d", size = 89238, upload-time = "2025-10-06T05:37:29.373Z" }, + { url = "https://files.pythonhosted.org/packages/d1/29/55c5f0689b9c0fb765055629f472c0de484dcaf0acee2f7707266ae3583c/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8009897cdef112072f93a0efdce29cd819e717fd2f649ee3016efd3cd885a7ed", size = 50738, upload-time = "2025-10-06T05:37:30.792Z" }, + { url = "https://files.pythonhosted.org/packages/ba/7d/b7282a445956506fa11da8c2db7d276adcbf2b17d8bb8407a47685263f90/frozenlist-1.8.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2c5dcbbc55383e5883246d11fd179782a9d07a986c40f49abe89ddf865913930", size = 51739, upload-time = "2025-10-06T05:37:32.127Z" }, + { url = "https://files.pythonhosted.org/packages/62/1c/3d8622e60d0b767a5510d1d3cf21065b9db874696a51ea6d7a43180a259c/frozenlist-1.8.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:39ecbc32f1390387d2aa4f5a995e465e9e2f79ba3adcac92d68e3e0afae6657c", size = 284186, upload-time = "2025-10-06T05:37:33.21Z" }, + { url = "https://files.pythonhosted.org/packages/2d/14/aa36d5f85a89679a85a1d44cd7a6657e0b1c75f61e7cad987b203d2daca8/frozenlist-1.8.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92db2bf818d5cc8d9c1f1fc56b897662e24ea5adb36ad1f1d82875bd64e03c24", size = 292196, upload-time = "2025-10-06T05:37:36.107Z" }, + { url = "https://files.pythonhosted.org/packages/05/23/6bde59eb55abd407d34f77d39a5126fb7b4f109a3f611d3929f14b700c66/frozenlist-1.8.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:2dc43a022e555de94c3b68a4ef0b11c4f747d12c024a520c7101709a2144fb37", size = 273830, upload-time = "2025-10-06T05:37:37.663Z" }, + { url = "https://files.pythonhosted.org/packages/d2/3f/22cff331bfad7a8afa616289000ba793347fcd7bc275f3b28ecea2a27909/frozenlist-1.8.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb89a7f2de3602cfed448095bab3f178399646ab7c61454315089787df07733a", size = 294289, upload-time = "2025-10-06T05:37:39.261Z" }, + { url = "https://files.pythonhosted.org/packages/a4/89/5b057c799de4838b6c69aa82b79705f2027615e01be996d2486a69ca99c4/frozenlist-1.8.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:33139dc858c580ea50e7e60a1b0ea003efa1fd42e6ec7fdbad78fff65fad2fd2", size = 300318, upload-time = "2025-10-06T05:37:43.213Z" }, + { url = "https://files.pythonhosted.org/packages/30/de/2c22ab3eb2a8af6d69dc799e48455813bab3690c760de58e1bf43b36da3e/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:168c0969a329b416119507ba30b9ea13688fafffac1b7822802537569a1cb0ef", size = 282814, upload-time = "2025-10-06T05:37:45.337Z" }, + { url = "https://files.pythonhosted.org/packages/59/f7/970141a6a8dbd7f556d94977858cfb36fa9b66e0892c6dd780d2219d8cd8/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:28bd570e8e189d7f7b001966435f9dac6718324b5be2990ac496cf1ea9ddb7fe", size = 291762, upload-time = "2025-10-06T05:37:46.657Z" }, + { url = "https://files.pythonhosted.org/packages/c1/15/ca1adae83a719f82df9116d66f5bb28bb95557b3951903d39135620ef157/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:b2a095d45c5d46e5e79ba1e5b9cb787f541a8dee0433836cea4b96a2c439dcd8", size = 289470, upload-time = "2025-10-06T05:37:47.946Z" }, + { url = "https://files.pythonhosted.org/packages/ac/83/dca6dc53bf657d371fbc88ddeb21b79891e747189c5de990b9dfff2ccba1/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:eab8145831a0d56ec9c4139b6c3e594c7a83c2c8be25d5bcf2d86136a532287a", size = 289042, upload-time = "2025-10-06T05:37:49.499Z" }, + { url = "https://files.pythonhosted.org/packages/96/52/abddd34ca99be142f354398700536c5bd315880ed0a213812bc491cff5e4/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:974b28cf63cc99dfb2188d8d222bc6843656188164848c4f679e63dae4b0708e", size = 283148, upload-time = "2025-10-06T05:37:50.745Z" }, + { url = "https://files.pythonhosted.org/packages/af/d3/76bd4ed4317e7119c2b7f57c3f6934aba26d277acc6309f873341640e21f/frozenlist-1.8.0-cp314-cp314t-win32.whl", hash = "sha256:342c97bf697ac5480c0a7ec73cd700ecfa5a8a40ac923bd035484616efecc2df", size = 44676, upload-time = "2025-10-06T05:37:52.222Z" }, + { url = "https://files.pythonhosted.org/packages/89/76/c615883b7b521ead2944bb3480398cbb07e12b7b4e4d073d3752eb721558/frozenlist-1.8.0-cp314-cp314t-win_amd64.whl", hash = "sha256:06be8f67f39c8b1dc671f5d83aaefd3358ae5cdcf8314552c57e7ed3e6475bdd", size = 49451, upload-time = "2025-10-06T05:37:53.425Z" }, + { url = "https://files.pythonhosted.org/packages/e0/a3/5982da14e113d07b325230f95060e2169f5311b1017ea8af2a29b374c289/frozenlist-1.8.0-cp314-cp314t-win_arm64.whl", hash = "sha256:102e6314ca4da683dca92e3b1355490fed5f313b768500084fbe6371fddfdb79", size = 42507, upload-time = "2025-10-06T05:37:54.513Z" }, + { url = "https://files.pythonhosted.org/packages/c2/59/ae5cdac87a00962122ea37bb346d41b66aec05f9ce328fa2b9e216f8967b/frozenlist-1.8.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:d8b7138e5cd0647e4523d6685b0eac5d4be9a184ae9634492f25c6eb38c12a47", size = 86967, upload-time = "2025-10-06T05:37:55.607Z" }, + { url = "https://files.pythonhosted.org/packages/8a/10/17059b2db5a032fd9323c41c39e9d1f5f9d0c8f04d1e4e3e788573086e61/frozenlist-1.8.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:a6483e309ca809f1efd154b4d37dc6d9f61037d6c6a81c2dc7a15cb22c8c5dca", size = 49984, upload-time = "2025-10-06T05:37:57.049Z" }, + { url = "https://files.pythonhosted.org/packages/4b/de/ad9d82ca8e5fa8f0c636e64606553c79e2b859ad253030b62a21fe9986f5/frozenlist-1.8.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:1b9290cf81e95e93fdf90548ce9d3c1211cf574b8e3f4b3b7cb0537cf2227068", size = 50240, upload-time = "2025-10-06T05:37:58.145Z" }, + { url = "https://files.pythonhosted.org/packages/4e/45/3dfb7767c2a67d123650122b62ce13c731b6c745bc14424eea67678b508c/frozenlist-1.8.0-cp39-cp39-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:59a6a5876ca59d1b63af8cd5e7ffffb024c3dc1e9cf9301b21a2e76286505c95", size = 219472, upload-time = "2025-10-06T05:37:59.239Z" }, + { url = "https://files.pythonhosted.org/packages/0b/bf/5bf23d913a741b960d5c1dac7c1985d8a2a1d015772b2d18ea168b08e7ff/frozenlist-1.8.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6dc4126390929823e2d2d9dc79ab4046ed74680360fc5f38b585c12c66cdf459", size = 221531, upload-time = "2025-10-06T05:38:00.521Z" }, + { url = "https://files.pythonhosted.org/packages/d0/03/27ec393f3b55860859f4b74cdc8c2a4af3dbf3533305e8eacf48a4fd9a54/frozenlist-1.8.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:332db6b2563333c5671fecacd085141b5800cb866be16d5e3eb15a2086476675", size = 219211, upload-time = "2025-10-06T05:38:01.842Z" }, + { url = "https://files.pythonhosted.org/packages/3a/ad/0fd00c404fa73fe9b169429e9a972d5ed807973c40ab6b3cf9365a33d360/frozenlist-1.8.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:9ff15928d62a0b80bb875655c39bf517938c7d589554cbd2669be42d97c2cb61", size = 231775, upload-time = "2025-10-06T05:38:03.384Z" }, + { url = "https://files.pythonhosted.org/packages/8a/c3/86962566154cb4d2995358bc8331bfc4ea19d07db1a96f64935a1607f2b6/frozenlist-1.8.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7bf6cdf8e07c8151fba6fe85735441240ec7f619f935a5205953d58009aef8c6", size = 236631, upload-time = "2025-10-06T05:38:04.609Z" }, + { url = "https://files.pythonhosted.org/packages/ea/9e/6ffad161dbd83782d2c66dc4d378a9103b31770cb1e67febf43aea42d202/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:48e6d3f4ec5c7273dfe83ff27c91083c6c9065af655dc2684d2c200c94308bb5", size = 218632, upload-time = "2025-10-06T05:38:05.917Z" }, + { url = "https://files.pythonhosted.org/packages/58/b2/4677eee46e0a97f9b30735e6ad0bf6aba3e497986066eb68807ac85cf60f/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:1a7607e17ad33361677adcd1443edf6f5da0ce5e5377b798fba20fae194825f3", size = 235967, upload-time = "2025-10-06T05:38:07.614Z" }, + { url = "https://files.pythonhosted.org/packages/05/f3/86e75f8639c5a93745ca7addbbc9de6af56aebb930d233512b17e46f6493/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:5a3a935c3a4e89c733303a2d5a7c257ea44af3a56c8202df486b7f5de40f37e1", size = 228799, upload-time = "2025-10-06T05:38:08.845Z" }, + { url = "https://files.pythonhosted.org/packages/30/00/39aad3a7f0d98f5eb1d99a3c311215674ed87061aecee7851974b335c050/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:940d4a017dbfed9daf46a3b086e1d2167e7012ee297fef9e1c545c4d022f5178", size = 230566, upload-time = "2025-10-06T05:38:10.52Z" }, + { url = "https://files.pythonhosted.org/packages/0d/4d/aa144cac44568d137846ddc4d5210fb5d9719eb1d7ec6fa2728a54b5b94a/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:b9be22a69a014bc47e78072d0ecae716f5eb56c15238acca0f43d6eb8e4a5bda", size = 217715, upload-time = "2025-10-06T05:38:11.832Z" }, + { url = "https://files.pythonhosted.org/packages/64/4c/8f665921667509d25a0dd72540513bc86b356c95541686f6442a3283019f/frozenlist-1.8.0-cp39-cp39-win32.whl", hash = "sha256:1aa77cb5697069af47472e39612976ed05343ff2e84a3dcf15437b232cbfd087", size = 39933, upload-time = "2025-10-06T05:38:13.061Z" }, + { url = "https://files.pythonhosted.org/packages/79/bd/bcc926f87027fad5e59926ff12d136e1082a115025d33c032d1cd69ab377/frozenlist-1.8.0-cp39-cp39-win_amd64.whl", hash = "sha256:7398c222d1d405e796970320036b1b563892b65809d9e5261487bb2c7f7b5c6a", size = 44121, upload-time = "2025-10-06T05:38:14.572Z" }, + { url = "https://files.pythonhosted.org/packages/4c/07/9c2e4eb7584af4b705237b971b89a4155a8e57599c4483a131a39256a9a0/frozenlist-1.8.0-cp39-cp39-win_arm64.whl", hash = "sha256:b4f3b365f31c6cd4af24545ca0a244a53688cad8834e32f56831c4923b50a103", size = 40312, upload-time = "2025-10-06T05:38:15.699Z" }, + { url = "https://files.pythonhosted.org/packages/9a/9a/e35b4a917281c0b8419d4207f4334c8e8c5dbf4f3f5f9ada73958d937dcc/frozenlist-1.8.0-py3-none-any.whl", hash = "sha256:0c18a16eab41e82c295618a77502e17b195883241c563b00f0aa5106fc4eaa0d", size = 13409, upload-time = "2025-10-06T05:38:16.721Z" }, +] + [[package]] name = "fsspec" version = "2025.9.0" @@ -939,6 +1667,11 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/47/71/70db47e4f6ce3e5c37a607355f80da8860a33226be640226ac52cb05ef2e/fsspec-2025.9.0-py3-none-any.whl", hash = "sha256:530dc2a2af60a414a832059574df4a6e10cce927f6f4a78209390fe38955cfb7", size = 199289, upload-time = "2025-09-02T19:10:47.708Z" }, ] +[package.optional-dependencies] +http = [ + { name = "aiohttp" }, +] + [[package]] name = "gitdb" version = "4.0.12" @@ -964,6 +1697,15 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/01/61/d4b89fec821f72385526e1b9d9a3a0385dda4a72b206d28049e2c7cd39b8/gitpython-3.1.45-py3-none-any.whl", hash = "sha256:8908cb2e02fb3b93b7eb0f2827125cb699869470432cc885f019b8fd0fccff77", size = 208168, upload-time = "2025-07-24T03:45:52.517Z" }, ] +[[package]] +name = "h11" +version = "0.16.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250, upload-time = "2025-04-24T03:35:25.427Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515, upload-time = "2025-04-24T03:35:24.344Z" }, +] + [[package]] name = "hf-xet" version = "1.1.10" @@ -979,6 +1721,34 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/ee/0e/471f0a21db36e71a2f1752767ad77e92d8cde24e974e03d662931b1305ec/hf_xet-1.1.10-cp37-abi3-win_amd64.whl", hash = "sha256:5f54b19cc347c13235ae7ee98b330c26dd65ef1df47e5316ffb1e87713ca7045", size = 2804691, upload-time = "2025-09-12T20:10:28.433Z" }, ] +[[package]] +name = "httpcore" +version = "1.0.9" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "certifi" }, + { name = "h11" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484, upload-time = "2025-04-24T22:06:22.219Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784, upload-time = "2025-04-24T22:06:20.566Z" }, +] + +[[package]] +name = "httpx" +version = "0.28.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "anyio" }, + { name = "certifi" }, + { name = "httpcore" }, + { name = "idna" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406, upload-time = "2024-12-06T15:37:23.222Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517, upload-time = "2024-12-06T15:37:21.509Z" }, +] + [[package]] name = "huggingface-hub" version = "0.36.0" @@ -1029,6 +1799,18 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656, upload-time = "2025-04-27T15:29:00.214Z" }, ] +[[package]] +name = "importlib-resources" +version = "6.5.2" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "zipp", marker = "python_full_version < '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/cf/8c/f834fbf984f691b4f7ff60f50b514cc3de5cc08abfc3295564dd89c5e2e7/importlib_resources-6.5.2.tar.gz", hash = "sha256:185f87adef5bcc288449d98fb4fba07cea78bc036455dd44c5fc4a2fe78fed2c", size = 44693, upload-time = "2025-01-03T18:51:56.698Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a4/ed/1f1afb2e9e7f38a545d628f864d562a5ae64fe6f7a10e28ffb9b185b4e89/importlib_resources-6.5.2-py3-none-any.whl", hash = "sha256:789cfdc3ed28c78b67a06acb8126751ced69a3d5f79c095a98298cd8a760ccec", size = 37461, upload-time = "2025-01-03T18:51:54.306Z" }, +] + [[package]] name = "iniconfig" version = "2.1.0" @@ -1368,6 +2150,222 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/d3/32/da7f44bcb1105d3e88a0b74ebdca50c59121d2ddf71c9e34ba47df7f3a56/keyring-25.6.0-py3-none-any.whl", hash = "sha256:552a3f7af126ece7ed5c89753650eec89c7eaae8617d0aa4d9ad2b75111266bd", size = 39085, upload-time = "2024-12-25T15:26:44.377Z" }, ] +[[package]] +name = "kiwisolver" +version = "1.4.7" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/85/4d/2255e1c76304cbd60b48cee302b66d1dde4468dc5b1160e4b7cb43778f2a/kiwisolver-1.4.7.tar.gz", hash = "sha256:9893ff81bd7107f7b685d3017cc6583daadb4fc26e4a888350df530e41980a60", size = 97286, upload-time = "2024-09-04T09:39:44.302Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/97/14/fc943dd65268a96347472b4fbe5dcc2f6f55034516f80576cd0dd3a8930f/kiwisolver-1.4.7-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:8a9c83f75223d5e48b0bc9cb1bf2776cf01563e00ade8775ffe13b0b6e1af3a6", size = 122440, upload-time = "2024-09-04T09:03:44.9Z" }, + { url = "https://files.pythonhosted.org/packages/1e/46/e68fed66236b69dd02fcdb506218c05ac0e39745d696d22709498896875d/kiwisolver-1.4.7-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:58370b1ffbd35407444d57057b57da5d6549d2d854fa30249771775c63b5fe17", size = 65758, upload-time = "2024-09-04T09:03:46.582Z" }, + { url = "https://files.pythonhosted.org/packages/ef/fa/65de49c85838681fc9cb05de2a68067a683717321e01ddafb5b8024286f0/kiwisolver-1.4.7-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:aa0abdf853e09aff551db11fce173e2177d00786c688203f52c87ad7fcd91ef9", size = 64311, upload-time = "2024-09-04T09:03:47.973Z" }, + { url = "https://files.pythonhosted.org/packages/42/9c/cc8d90f6ef550f65443bad5872ffa68f3dee36de4974768628bea7c14979/kiwisolver-1.4.7-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.whl", hash = "sha256:8d53103597a252fb3ab8b5845af04c7a26d5e7ea8122303dd7a021176a87e8b9", size = 1637109, upload-time = "2024-09-04T09:03:49.281Z" }, + { url = "https://files.pythonhosted.org/packages/55/91/0a57ce324caf2ff5403edab71c508dd8f648094b18cfbb4c8cc0fde4a6ac/kiwisolver-1.4.7-cp310-cp310-manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:88f17c5ffa8e9462fb79f62746428dd57b46eb931698e42e990ad63103f35e6c", size = 1617814, upload-time = "2024-09-04T09:03:51.444Z" }, + { url = "https://files.pythonhosted.org/packages/12/5d/c36140313f2510e20207708adf36ae4919416d697ee0236b0ddfb6fd1050/kiwisolver-1.4.7-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:88a9ca9c710d598fd75ee5de59d5bda2684d9db36a9f50b6125eaea3969c2599", size = 1400881, upload-time = "2024-09-04T09:03:53.357Z" }, + { url = "https://files.pythonhosted.org/packages/56/d0/786e524f9ed648324a466ca8df86298780ef2b29c25313d9a4f16992d3cf/kiwisolver-1.4.7-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f4d742cb7af1c28303a51b7a27aaee540e71bb8e24f68c736f6f2ffc82f2bf05", size = 1512972, upload-time = "2024-09-04T09:03:55.082Z" }, + { url = "https://files.pythonhosted.org/packages/67/5a/77851f2f201e6141d63c10a0708e996a1363efaf9e1609ad0441b343763b/kiwisolver-1.4.7-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:e28c7fea2196bf4c2f8d46a0415c77a1c480cc0724722f23d7410ffe9842c407", size = 1444787, upload-time = "2024-09-04T09:03:56.588Z" }, + { url = "https://files.pythonhosted.org/packages/06/5f/1f5eaab84355885e224a6fc8d73089e8713dc7e91c121f00b9a1c58a2195/kiwisolver-1.4.7-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:e968b84db54f9d42046cf154e02911e39c0435c9801681e3fc9ce8a3c4130278", size = 2199212, upload-time = "2024-09-04T09:03:58.557Z" }, + { url = "https://files.pythonhosted.org/packages/b5/28/9152a3bfe976a0ae21d445415defc9d1cd8614b2910b7614b30b27a47270/kiwisolver-1.4.7-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:0c18ec74c0472de033e1bebb2911c3c310eef5649133dd0bedf2a169a1b269e5", size = 2346399, upload-time = "2024-09-04T09:04:00.178Z" }, + { url = "https://files.pythonhosted.org/packages/26/f6/453d1904c52ac3b400f4d5e240ac5fec25263716723e44be65f4d7149d13/kiwisolver-1.4.7-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:8f0ea6da6d393d8b2e187e6a5e3fb81f5862010a40c3945e2c6d12ae45cfb2ad", size = 2308688, upload-time = "2024-09-04T09:04:02.216Z" }, + { url = "https://files.pythonhosted.org/packages/5a/9a/d4968499441b9ae187e81745e3277a8b4d7c60840a52dc9d535a7909fac3/kiwisolver-1.4.7-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:f106407dda69ae456dd1227966bf445b157ccc80ba0dff3802bb63f30b74e895", size = 2445493, upload-time = "2024-09-04T09:04:04.571Z" }, + { url = "https://files.pythonhosted.org/packages/07/c9/032267192e7828520dacb64dfdb1d74f292765f179e467c1cba97687f17d/kiwisolver-1.4.7-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:84ec80df401cfee1457063732d90022f93951944b5b58975d34ab56bb150dfb3", size = 2262191, upload-time = "2024-09-04T09:04:05.969Z" }, + { url = "https://files.pythonhosted.org/packages/6c/ad/db0aedb638a58b2951da46ddaeecf204be8b4f5454df020d850c7fa8dca8/kiwisolver-1.4.7-cp310-cp310-win32.whl", hash = "sha256:71bb308552200fb2c195e35ef05de12f0c878c07fc91c270eb3d6e41698c3bcc", size = 46644, upload-time = "2024-09-04T09:04:07.408Z" }, + { url = "https://files.pythonhosted.org/packages/12/ca/d0f7b7ffbb0be1e7c2258b53554efec1fd652921f10d7d85045aff93ab61/kiwisolver-1.4.7-cp310-cp310-win_amd64.whl", hash = "sha256:44756f9fd339de0fb6ee4f8c1696cfd19b2422e0d70b4cefc1cc7f1f64045a8c", size = 55877, upload-time = "2024-09-04T09:04:08.869Z" }, + { url = "https://files.pythonhosted.org/packages/97/6c/cfcc128672f47a3e3c0d918ecb67830600078b025bfc32d858f2e2d5c6a4/kiwisolver-1.4.7-cp310-cp310-win_arm64.whl", hash = "sha256:78a42513018c41c2ffd262eb676442315cbfe3c44eed82385c2ed043bc63210a", size = 48347, upload-time = "2024-09-04T09:04:10.106Z" }, + { url = "https://files.pythonhosted.org/packages/e9/44/77429fa0a58f941d6e1c58da9efe08597d2e86bf2b2cce6626834f49d07b/kiwisolver-1.4.7-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:d2b0e12a42fb4e72d509fc994713d099cbb15ebf1103545e8a45f14da2dfca54", size = 122442, upload-time = "2024-09-04T09:04:11.432Z" }, + { url = "https://files.pythonhosted.org/packages/e5/20/8c75caed8f2462d63c7fd65e16c832b8f76cda331ac9e615e914ee80bac9/kiwisolver-1.4.7-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:2a8781ac3edc42ea4b90bc23e7d37b665d89423818e26eb6df90698aa2287c95", size = 65762, upload-time = "2024-09-04T09:04:12.468Z" }, + { url = "https://files.pythonhosted.org/packages/f4/98/fe010f15dc7230f45bc4cf367b012d651367fd203caaa992fd1f5963560e/kiwisolver-1.4.7-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:46707a10836894b559e04b0fd143e343945c97fd170d69a2d26d640b4e297935", size = 64319, upload-time = "2024-09-04T09:04:13.635Z" }, + { url = "https://files.pythonhosted.org/packages/8b/1b/b5d618f4e58c0675654c1e5051bcf42c776703edb21c02b8c74135541f60/kiwisolver-1.4.7-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ef97b8df011141c9b0f6caf23b29379f87dd13183c978a30a3c546d2c47314cb", size = 1334260, upload-time = "2024-09-04T09:04:14.878Z" }, + { url = "https://files.pythonhosted.org/packages/b8/01/946852b13057a162a8c32c4c8d2e9ed79f0bb5d86569a40c0b5fb103e373/kiwisolver-1.4.7-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3ab58c12a2cd0fc769089e6d38466c46d7f76aced0a1f54c77652446733d2d02", size = 1426589, upload-time = "2024-09-04T09:04:16.514Z" }, + { url = "https://files.pythonhosted.org/packages/70/d1/c9f96df26b459e15cf8a965304e6e6f4eb291e0f7a9460b4ad97b047561e/kiwisolver-1.4.7-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:803b8e1459341c1bb56d1c5c010406d5edec8a0713a0945851290a7930679b51", size = 1541080, upload-time = "2024-09-04T09:04:18.322Z" }, + { url = "https://files.pythonhosted.org/packages/d3/73/2686990eb8b02d05f3de759d6a23a4ee7d491e659007dd4c075fede4b5d0/kiwisolver-1.4.7-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f9a9e8a507420fe35992ee9ecb302dab68550dedc0da9e2880dd88071c5fb052", size = 1470049, upload-time = "2024-09-04T09:04:20.266Z" }, + { url = "https://files.pythonhosted.org/packages/a7/4b/2db7af3ed3af7c35f388d5f53c28e155cd402a55432d800c543dc6deb731/kiwisolver-1.4.7-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:18077b53dc3bb490e330669a99920c5e6a496889ae8c63b58fbc57c3d7f33a18", size = 1426376, upload-time = "2024-09-04T09:04:22.419Z" }, + { url = "https://files.pythonhosted.org/packages/05/83/2857317d04ea46dc5d115f0df7e676997bbd968ced8e2bd6f7f19cfc8d7f/kiwisolver-1.4.7-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:6af936f79086a89b3680a280c47ea90b4df7047b5bdf3aa5c524bbedddb9e545", size = 2222231, upload-time = "2024-09-04T09:04:24.526Z" }, + { url = "https://files.pythonhosted.org/packages/0d/b5/866f86f5897cd4ab6d25d22e403404766a123f138bd6a02ecb2cdde52c18/kiwisolver-1.4.7-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:3abc5b19d24af4b77d1598a585b8a719beb8569a71568b66f4ebe1fb0449460b", size = 2368634, upload-time = "2024-09-04T09:04:25.899Z" }, + { url = "https://files.pythonhosted.org/packages/c1/ee/73de8385403faba55f782a41260210528fe3273d0cddcf6d51648202d6d0/kiwisolver-1.4.7-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:933d4de052939d90afbe6e9d5273ae05fb836cc86c15b686edd4b3560cc0ee36", size = 2329024, upload-time = "2024-09-04T09:04:28.523Z" }, + { url = "https://files.pythonhosted.org/packages/a1/e7/cd101d8cd2cdfaa42dc06c433df17c8303d31129c9fdd16c0ea37672af91/kiwisolver-1.4.7-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:65e720d2ab2b53f1f72fb5da5fb477455905ce2c88aaa671ff0a447c2c80e8e3", size = 2468484, upload-time = "2024-09-04T09:04:30.547Z" }, + { url = "https://files.pythonhosted.org/packages/e1/72/84f09d45a10bc57a40bb58b81b99d8f22b58b2040c912b7eb97ebf625bf2/kiwisolver-1.4.7-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3bf1ed55088f214ba6427484c59553123fdd9b218a42bbc8c6496d6754b1e523", size = 2284078, upload-time = "2024-09-04T09:04:33.218Z" }, + { url = "https://files.pythonhosted.org/packages/d2/d4/71828f32b956612dc36efd7be1788980cb1e66bfb3706e6dec9acad9b4f9/kiwisolver-1.4.7-cp311-cp311-win32.whl", hash = "sha256:4c00336b9dd5ad96d0a558fd18a8b6f711b7449acce4c157e7343ba92dd0cf3d", size = 46645, upload-time = "2024-09-04T09:04:34.371Z" }, + { url = "https://files.pythonhosted.org/packages/a1/65/d43e9a20aabcf2e798ad1aff6c143ae3a42cf506754bcb6a7ed8259c8425/kiwisolver-1.4.7-cp311-cp311-win_amd64.whl", hash = "sha256:929e294c1ac1e9f615c62a4e4313ca1823ba37326c164ec720a803287c4c499b", size = 56022, upload-time = "2024-09-04T09:04:35.786Z" }, + { url = "https://files.pythonhosted.org/packages/35/b3/9f75a2e06f1b4ca00b2b192bc2b739334127d27f1d0625627ff8479302ba/kiwisolver-1.4.7-cp311-cp311-win_arm64.whl", hash = "sha256:e33e8fbd440c917106b237ef1a2f1449dfbb9b6f6e1ce17c94cd6a1e0d438376", size = 48536, upload-time = "2024-09-04T09:04:37.525Z" }, + { url = "https://files.pythonhosted.org/packages/97/9c/0a11c714cf8b6ef91001c8212c4ef207f772dd84540104952c45c1f0a249/kiwisolver-1.4.7-cp312-cp312-macosx_10_9_universal2.whl", hash = "sha256:5360cc32706dab3931f738d3079652d20982511f7c0ac5711483e6eab08efff2", size = 121808, upload-time = "2024-09-04T09:04:38.637Z" }, + { url = "https://files.pythonhosted.org/packages/f2/d8/0fe8c5f5d35878ddd135f44f2af0e4e1d379e1c7b0716f97cdcb88d4fd27/kiwisolver-1.4.7-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:942216596dc64ddb25adb215c3c783215b23626f8d84e8eff8d6d45c3f29f75a", size = 65531, upload-time = "2024-09-04T09:04:39.694Z" }, + { url = "https://files.pythonhosted.org/packages/80/c5/57fa58276dfdfa612241d640a64ca2f76adc6ffcebdbd135b4ef60095098/kiwisolver-1.4.7-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:48b571ecd8bae15702e4f22d3ff6a0f13e54d3d00cd25216d5e7f658242065ee", size = 63894, upload-time = "2024-09-04T09:04:41.6Z" }, + { url = "https://files.pythonhosted.org/packages/8b/e9/26d3edd4c4ad1c5b891d8747a4f81b1b0aba9fb9721de6600a4adc09773b/kiwisolver-1.4.7-cp312-cp312-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ad42ba922c67c5f219097b28fae965e10045ddf145d2928bfac2eb2e17673640", size = 1369296, upload-time = "2024-09-04T09:04:42.886Z" }, + { url = "https://files.pythonhosted.org/packages/b6/67/3f4850b5e6cffb75ec40577ddf54f7b82b15269cc5097ff2e968ee32ea7d/kiwisolver-1.4.7-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:612a10bdae23404a72941a0fc8fa2660c6ea1217c4ce0dbcab8a8f6543ea9e7f", size = 1461450, upload-time = "2024-09-04T09:04:46.284Z" }, + { url = "https://files.pythonhosted.org/packages/52/be/86cbb9c9a315e98a8dc6b1d23c43cffd91d97d49318854f9c37b0e41cd68/kiwisolver-1.4.7-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9e838bba3a3bac0fe06d849d29772eb1afb9745a59710762e4ba3f4cb8424483", size = 1579168, upload-time = "2024-09-04T09:04:47.91Z" }, + { url = "https://files.pythonhosted.org/packages/0f/00/65061acf64bd5fd34c1f4ae53f20b43b0a017a541f242a60b135b9d1e301/kiwisolver-1.4.7-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:22f499f6157236c19f4bbbd472fa55b063db77a16cd74d49afe28992dff8c258", size = 1507308, upload-time = "2024-09-04T09:04:49.465Z" }, + { url = "https://files.pythonhosted.org/packages/21/e4/c0b6746fd2eb62fe702118b3ca0cb384ce95e1261cfada58ff693aeec08a/kiwisolver-1.4.7-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:693902d433cf585133699972b6d7c42a8b9f8f826ebcaf0132ff55200afc599e", size = 1464186, upload-time = "2024-09-04T09:04:50.949Z" }, + { url = "https://files.pythonhosted.org/packages/0a/0f/529d0a9fffb4d514f2782c829b0b4b371f7f441d61aa55f1de1c614c4ef3/kiwisolver-1.4.7-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:4e77f2126c3e0b0d055f44513ed349038ac180371ed9b52fe96a32aa071a5107", size = 2247877, upload-time = "2024-09-04T09:04:52.388Z" }, + { url = "https://files.pythonhosted.org/packages/d1/e1/66603ad779258843036d45adcbe1af0d1a889a07af4635f8b4ec7dccda35/kiwisolver-1.4.7-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:657a05857bda581c3656bfc3b20e353c232e9193eb167766ad2dc58b56504948", size = 2404204, upload-time = "2024-09-04T09:04:54.385Z" }, + { url = "https://files.pythonhosted.org/packages/8d/61/de5fb1ca7ad1f9ab7970e340a5b833d735df24689047de6ae71ab9d8d0e7/kiwisolver-1.4.7-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:4bfa75a048c056a411f9705856abfc872558e33c055d80af6a380e3658766038", size = 2352461, upload-time = "2024-09-04T09:04:56.307Z" }, + { url = "https://files.pythonhosted.org/packages/ba/d2/0edc00a852e369827f7e05fd008275f550353f1f9bcd55db9363d779fc63/kiwisolver-1.4.7-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:34ea1de54beef1c104422d210c47c7d2a4999bdecf42c7b5718fbe59a4cac383", size = 2501358, upload-time = "2024-09-04T09:04:57.922Z" }, + { url = "https://files.pythonhosted.org/packages/84/15/adc15a483506aec6986c01fb7f237c3aec4d9ed4ac10b756e98a76835933/kiwisolver-1.4.7-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:90da3b5f694b85231cf93586dad5e90e2d71b9428f9aad96952c99055582f520", size = 2314119, upload-time = "2024-09-04T09:04:59.332Z" }, + { url = "https://files.pythonhosted.org/packages/36/08/3a5bb2c53c89660863a5aa1ee236912269f2af8762af04a2e11df851d7b2/kiwisolver-1.4.7-cp312-cp312-win32.whl", hash = "sha256:18e0cca3e008e17fe9b164b55735a325140a5a35faad8de92dd80265cd5eb80b", size = 46367, upload-time = "2024-09-04T09:05:00.804Z" }, + { url = "https://files.pythonhosted.org/packages/19/93/c05f0a6d825c643779fc3c70876bff1ac221f0e31e6f701f0e9578690d70/kiwisolver-1.4.7-cp312-cp312-win_amd64.whl", hash = "sha256:58cb20602b18f86f83a5c87d3ee1c766a79c0d452f8def86d925e6c60fbf7bfb", size = 55884, upload-time = "2024-09-04T09:05:01.924Z" }, + { url = "https://files.pythonhosted.org/packages/d2/f9/3828d8f21b6de4279f0667fb50a9f5215e6fe57d5ec0d61905914f5b6099/kiwisolver-1.4.7-cp312-cp312-win_arm64.whl", hash = "sha256:f5a8b53bdc0b3961f8b6125e198617c40aeed638b387913bf1ce78afb1b0be2a", size = 48528, upload-time = "2024-09-04T09:05:02.983Z" }, + { url = "https://files.pythonhosted.org/packages/c4/06/7da99b04259b0f18b557a4effd1b9c901a747f7fdd84cf834ccf520cb0b2/kiwisolver-1.4.7-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:2e6039dcbe79a8e0f044f1c39db1986a1b8071051efba3ee4d74f5b365f5226e", size = 121913, upload-time = "2024-09-04T09:05:04.072Z" }, + { url = "https://files.pythonhosted.org/packages/97/f5/b8a370d1aa593c17882af0a6f6755aaecd643640c0ed72dcfd2eafc388b9/kiwisolver-1.4.7-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:a1ecf0ac1c518487d9d23b1cd7139a6a65bc460cd101ab01f1be82ecf09794b6", size = 65627, upload-time = "2024-09-04T09:05:05.119Z" }, + { url = "https://files.pythonhosted.org/packages/2a/fc/6c0374f7503522539e2d4d1b497f5ebad3f8ed07ab51aed2af988dd0fb65/kiwisolver-1.4.7-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:7ab9ccab2b5bd5702ab0803676a580fffa2aa178c2badc5557a84cc943fcf750", size = 63888, upload-time = "2024-09-04T09:05:06.191Z" }, + { url = "https://files.pythonhosted.org/packages/bf/3e/0b7172793d0f41cae5c923492da89a2ffcd1adf764c16159ca047463ebd3/kiwisolver-1.4.7-cp313-cp313-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f816dd2277f8d63d79f9c8473a79fe54047bc0467754962840782c575522224d", size = 1369145, upload-time = "2024-09-04T09:05:07.919Z" }, + { url = "https://files.pythonhosted.org/packages/77/92/47d050d6f6aced2d634258123f2688fbfef8ded3c5baf2c79d94d91f1f58/kiwisolver-1.4.7-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cf8bcc23ceb5a1b624572a1623b9f79d2c3b337c8c455405ef231933a10da379", size = 1461448, upload-time = "2024-09-04T09:05:10.01Z" }, + { url = "https://files.pythonhosted.org/packages/9c/1b/8f80b18e20b3b294546a1adb41701e79ae21915f4175f311a90d042301cf/kiwisolver-1.4.7-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:dea0bf229319828467d7fca8c7c189780aa9ff679c94539eed7532ebe33ed37c", size = 1578750, upload-time = "2024-09-04T09:05:11.598Z" }, + { url = "https://files.pythonhosted.org/packages/a4/fe/fe8e72f3be0a844f257cadd72689c0848c6d5c51bc1d60429e2d14ad776e/kiwisolver-1.4.7-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7c06a4c7cf15ec739ce0e5971b26c93638730090add60e183530d70848ebdd34", size = 1507175, upload-time = "2024-09-04T09:05:13.22Z" }, + { url = "https://files.pythonhosted.org/packages/39/fa/cdc0b6105d90eadc3bee525fecc9179e2b41e1ce0293caaf49cb631a6aaf/kiwisolver-1.4.7-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:913983ad2deb14e66d83c28b632fd35ba2b825031f2fa4ca29675e665dfecbe1", size = 1463963, upload-time = "2024-09-04T09:05:15.925Z" }, + { url = "https://files.pythonhosted.org/packages/6e/5c/0c03c4e542720c6177d4f408e56d1c8315899db72d46261a4e15b8b33a41/kiwisolver-1.4.7-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:5337ec7809bcd0f424c6b705ecf97941c46279cf5ed92311782c7c9c2026f07f", size = 2248220, upload-time = "2024-09-04T09:05:17.434Z" }, + { url = "https://files.pythonhosted.org/packages/3d/ee/55ef86d5a574f4e767df7da3a3a7ff4954c996e12d4fbe9c408170cd7dcc/kiwisolver-1.4.7-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:4c26ed10c4f6fa6ddb329a5120ba3b6db349ca192ae211e882970bfc9d91420b", size = 2404463, upload-time = "2024-09-04T09:05:18.997Z" }, + { url = "https://files.pythonhosted.org/packages/0f/6d/73ad36170b4bff4825dc588acf4f3e6319cb97cd1fb3eb04d9faa6b6f212/kiwisolver-1.4.7-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:c619b101e6de2222c1fcb0531e1b17bbffbe54294bfba43ea0d411d428618c27", size = 2352842, upload-time = "2024-09-04T09:05:21.299Z" }, + { url = "https://files.pythonhosted.org/packages/0b/16/fa531ff9199d3b6473bb4d0f47416cdb08d556c03b8bc1cccf04e756b56d/kiwisolver-1.4.7-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:073a36c8273647592ea332e816e75ef8da5c303236ec0167196793eb1e34657a", size = 2501635, upload-time = "2024-09-04T09:05:23.588Z" }, + { url = "https://files.pythonhosted.org/packages/78/7e/aa9422e78419db0cbe75fb86d8e72b433818f2e62e2e394992d23d23a583/kiwisolver-1.4.7-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:3ce6b2b0231bda412463e152fc18335ba32faf4e8c23a754ad50ffa70e4091ee", size = 2314556, upload-time = "2024-09-04T09:05:25.907Z" }, + { url = "https://files.pythonhosted.org/packages/a8/b2/15f7f556df0a6e5b3772a1e076a9d9f6c538ce5f05bd590eca8106508e06/kiwisolver-1.4.7-cp313-cp313-win32.whl", hash = "sha256:f4c9aee212bc89d4e13f58be11a56cc8036cabad119259d12ace14b34476fd07", size = 46364, upload-time = "2024-09-04T09:05:27.184Z" }, + { url = "https://files.pythonhosted.org/packages/0b/db/32e897e43a330eee8e4770bfd2737a9584b23e33587a0812b8e20aac38f7/kiwisolver-1.4.7-cp313-cp313-win_amd64.whl", hash = "sha256:8a3ec5aa8e38fc4c8af308917ce12c536f1c88452ce554027e55b22cbbfbff76", size = 55887, upload-time = "2024-09-04T09:05:28.372Z" }, + { url = "https://files.pythonhosted.org/packages/c8/a4/df2bdca5270ca85fd25253049eb6708d4127be2ed0e5c2650217450b59e9/kiwisolver-1.4.7-cp313-cp313-win_arm64.whl", hash = "sha256:76c8094ac20ec259471ac53e774623eb62e6e1f56cd8690c67ce6ce4fcb05650", size = 48530, upload-time = "2024-09-04T09:05:30.225Z" }, + { url = "https://files.pythonhosted.org/packages/11/88/37ea0ea64512997b13d69772db8dcdc3bfca5442cda3a5e4bb943652ee3e/kiwisolver-1.4.7-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:3f9362ecfca44c863569d3d3c033dbe8ba452ff8eed6f6b5806382741a1334bd", size = 122449, upload-time = "2024-09-04T09:05:55.311Z" }, + { url = "https://files.pythonhosted.org/packages/4e/45/5a5c46078362cb3882dcacad687c503089263c017ca1241e0483857791eb/kiwisolver-1.4.7-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:e8df2eb9b2bac43ef8b082e06f750350fbbaf2887534a5be97f6cf07b19d9583", size = 65757, upload-time = "2024-09-04T09:05:56.906Z" }, + { url = "https://files.pythonhosted.org/packages/8a/be/a6ae58978772f685d48dd2e84460937761c53c4bbd84e42b0336473d9775/kiwisolver-1.4.7-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f32d6edbc638cde7652bd690c3e728b25332acbadd7cad670cc4a02558d9c417", size = 64312, upload-time = "2024-09-04T09:05:58.384Z" }, + { url = "https://files.pythonhosted.org/packages/f4/04/18ef6f452d311e1e1eb180c9bf5589187fa1f042db877e6fe443ef10099c/kiwisolver-1.4.7-cp39-cp39-manylinux_2_12_i686.manylinux2010_i686.whl", hash = "sha256:e2e6c39bd7b9372b0be21456caab138e8e69cc0fc1190a9dfa92bd45a1e6e904", size = 1626966, upload-time = "2024-09-04T09:05:59.855Z" }, + { url = "https://files.pythonhosted.org/packages/21/b1/40655f6c3fa11ce740e8a964fa8e4c0479c87d6a7944b95af799c7a55dfe/kiwisolver-1.4.7-cp39-cp39-manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:dda56c24d869b1193fcc763f1284b9126550eaf84b88bbc7256e15028f19188a", size = 1607044, upload-time = "2024-09-04T09:06:02.16Z" }, + { url = "https://files.pythonhosted.org/packages/fd/93/af67dbcfb9b3323bbd2c2db1385a7139d8f77630e4a37bb945b57188eb2d/kiwisolver-1.4.7-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:79849239c39b5e1fd906556c474d9b0439ea6792b637511f3fe3a41158d89ca8", size = 1391879, upload-time = "2024-09-04T09:06:03.908Z" }, + { url = "https://files.pythonhosted.org/packages/40/6f/d60770ef98e77b365d96061d090c0cd9e23418121c55fff188fa4bdf0b54/kiwisolver-1.4.7-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5e3bc157fed2a4c02ec468de4ecd12a6e22818d4f09cde2c31ee3226ffbefab2", size = 1504751, upload-time = "2024-09-04T09:06:05.58Z" }, + { url = "https://files.pythonhosted.org/packages/fa/3a/5f38667d313e983c432f3fcd86932177519ed8790c724e07d77d1de0188a/kiwisolver-1.4.7-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3da53da805b71e41053dc670f9a820d1157aae77b6b944e08024d17bcd51ef88", size = 1436990, upload-time = "2024-09-04T09:06:08.126Z" }, + { url = "https://files.pythonhosted.org/packages/cb/3b/1520301a47326e6a6043b502647e42892be33b3f051e9791cc8bb43f1a32/kiwisolver-1.4.7-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:8705f17dfeb43139a692298cb6637ee2e59c0194538153e83e9ee0c75c2eddde", size = 2191122, upload-time = "2024-09-04T09:06:10.345Z" }, + { url = "https://files.pythonhosted.org/packages/cf/c4/eb52da300c166239a2233f1f9c4a1b767dfab98fae27681bfb7ea4873cb6/kiwisolver-1.4.7-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:82a5c2f4b87c26bb1a0ef3d16b5c4753434633b83d365cc0ddf2770c93829e3c", size = 2338126, upload-time = "2024-09-04T09:06:12.321Z" }, + { url = "https://files.pythonhosted.org/packages/1a/cb/42b92fd5eadd708dd9107c089e817945500685f3437ce1fd387efebc6d6e/kiwisolver-1.4.7-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:ce8be0466f4c0d585cdb6c1e2ed07232221df101a4c6f28821d2aa754ca2d9e2", size = 2298313, upload-time = "2024-09-04T09:06:14.562Z" }, + { url = "https://files.pythonhosted.org/packages/4f/eb/be25aa791fe5fc75a8b1e0c965e00f942496bc04635c9aae8035f6b76dcd/kiwisolver-1.4.7-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:409afdfe1e2e90e6ee7fc896f3df9a7fec8e793e58bfa0d052c8a82f99c37abb", size = 2437784, upload-time = "2024-09-04T09:06:16.767Z" }, + { url = "https://files.pythonhosted.org/packages/c5/22/30a66be7f3368d76ff95689e1c2e28d382383952964ab15330a15d8bfd03/kiwisolver-1.4.7-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:5b9c3f4ee0b9a439d2415012bd1b1cc2df59e4d6a9939f4d669241d30b414327", size = 2253988, upload-time = "2024-09-04T09:06:18.705Z" }, + { url = "https://files.pythonhosted.org/packages/35/d3/5f2ecb94b5211c8a04f218a76133cc8d6d153b0f9cd0b45fad79907f0689/kiwisolver-1.4.7-cp39-cp39-win32.whl", hash = "sha256:a79ae34384df2b615eefca647a2873842ac3b596418032bef9a7283675962644", size = 46980, upload-time = "2024-09-04T09:06:20.106Z" }, + { url = "https://files.pythonhosted.org/packages/ef/17/cd10d020578764ea91740204edc6b3236ed8106228a46f568d716b11feb2/kiwisolver-1.4.7-cp39-cp39-win_amd64.whl", hash = "sha256:cf0438b42121a66a3a667de17e779330fc0f20b0d97d59d2f2121e182b0505e4", size = 55847, upload-time = "2024-09-04T09:06:21.407Z" }, + { url = "https://files.pythonhosted.org/packages/91/84/32232502020bd78d1d12be7afde15811c64a95ed1f606c10456db4e4c3ac/kiwisolver-1.4.7-cp39-cp39-win_arm64.whl", hash = "sha256:764202cc7e70f767dab49e8df52c7455e8de0df5d858fa801a11aa0d882ccf3f", size = 48494, upload-time = "2024-09-04T09:06:22.648Z" }, + { url = "https://files.pythonhosted.org/packages/ac/59/741b79775d67ab67ced9bb38552da688c0305c16e7ee24bba7a2be253fb7/kiwisolver-1.4.7-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:94252291e3fe68001b1dd747b4c0b3be12582839b95ad4d1b641924d68fd4643", size = 59491, upload-time = "2024-09-04T09:06:24.188Z" }, + { url = "https://files.pythonhosted.org/packages/58/cc/fb239294c29a5656e99e3527f7369b174dd9cc7c3ef2dea7cb3c54a8737b/kiwisolver-1.4.7-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:5b7dfa3b546da08a9f622bb6becdb14b3e24aaa30adba66749d38f3cc7ea9706", size = 57648, upload-time = "2024-09-04T09:06:25.559Z" }, + { url = "https://files.pythonhosted.org/packages/3b/ef/2f009ac1f7aab9f81efb2d837301d255279d618d27b6015780115ac64bdd/kiwisolver-1.4.7-pp310-pypy310_pp73-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:bd3de6481f4ed8b734da5df134cd5a6a64fe32124fe83dde1e5b5f29fe30b1e6", size = 84257, upload-time = "2024-09-04T09:06:27.038Z" }, + { url = "https://files.pythonhosted.org/packages/81/e1/c64f50987f85b68b1c52b464bb5bf73e71570c0f7782d626d1eb283ad620/kiwisolver-1.4.7-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a91b5f9f1205845d488c928e8570dcb62b893372f63b8b6e98b863ebd2368ff2", size = 80906, upload-time = "2024-09-04T09:06:28.48Z" }, + { url = "https://files.pythonhosted.org/packages/fd/71/1687c5c0a0be2cee39a5c9c389e546f9c6e215e46b691d00d9f646892083/kiwisolver-1.4.7-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:40fa14dbd66b8b8f470d5fc79c089a66185619d31645f9b0773b88b19f7223c4", size = 79951, upload-time = "2024-09-04T09:06:29.966Z" }, + { url = "https://files.pythonhosted.org/packages/ea/8b/d7497df4a1cae9367adf21665dd1f896c2a7aeb8769ad77b662c5e2bcce7/kiwisolver-1.4.7-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:eb542fe7933aa09d8d8f9d9097ef37532a7df6497819d16efe4359890a2f417a", size = 55715, upload-time = "2024-09-04T09:06:31.489Z" }, + { url = "https://files.pythonhosted.org/packages/d5/df/ce37d9b26f07ab90880923c94d12a6ff4d27447096b4c849bfc4339ccfdf/kiwisolver-1.4.7-pp39-pypy39_pp73-macosx_10_15_x86_64.whl", hash = "sha256:8b01aac285f91ca889c800042c35ad3b239e704b150cfd3382adfc9dcc780e39", size = 58666, upload-time = "2024-09-04T09:06:43.756Z" }, + { url = "https://files.pythonhosted.org/packages/b0/d3/e4b04f43bc629ac8e186b77b2b1a251cdfa5b7610fa189dc0db622672ce6/kiwisolver-1.4.7-pp39-pypy39_pp73-macosx_11_0_arm64.whl", hash = "sha256:48be928f59a1f5c8207154f935334d374e79f2b5d212826307d072595ad76a2e", size = 57088, upload-time = "2024-09-04T09:06:45.406Z" }, + { url = "https://files.pythonhosted.org/packages/30/1c/752df58e2d339e670a535514d2db4fe8c842ce459776b8080fbe08ebb98e/kiwisolver-1.4.7-pp39-pypy39_pp73-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f37cfe618a117e50d8c240555331160d73d0411422b59b5ee217843d7b693608", size = 84321, upload-time = "2024-09-04T09:06:47.557Z" }, + { url = "https://files.pythonhosted.org/packages/f0/f8/fe6484e847bc6e238ec9f9828089fb2c0bb53f2f5f3a79351fde5b565e4f/kiwisolver-1.4.7-pp39-pypy39_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:599b5c873c63a1f6ed7eead644a8a380cfbdf5db91dcb6f85707aaab213b1674", size = 80776, upload-time = "2024-09-04T09:06:49.235Z" }, + { url = "https://files.pythonhosted.org/packages/9b/57/d7163c0379f250ef763aba85330a19feefb5ce6cb541ade853aaba881524/kiwisolver-1.4.7-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:801fa7802e5cfabe3ab0c81a34c323a319b097dfb5004be950482d882f3d7225", size = 79984, upload-time = "2024-09-04T09:06:51.336Z" }, + { url = "https://files.pythonhosted.org/packages/8c/95/4a103776c265d13b3d2cd24fb0494d4e04ea435a8ef97e1b2c026d43250b/kiwisolver-1.4.7-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:0c6c43471bc764fad4bc99c5c2d6d16a676b1abf844ca7c8702bdae92df01ee0", size = 55811, upload-time = "2024-09-04T09:06:53.078Z" }, +] + +[[package]] +name = "kiwisolver" +version = "1.4.9" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", + "python_full_version == '3.10.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/5c/3c/85844f1b0feb11ee581ac23fe5fce65cd049a200c1446708cc1b7f922875/kiwisolver-1.4.9.tar.gz", hash = "sha256:c3b22c26c6fd6811b0ae8363b95ca8ce4ea3c202d3d0975b2914310ceb1bcc4d", size = 97564, upload-time = "2025-08-10T21:27:49.279Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c6/5d/8ce64e36d4e3aac5ca96996457dcf33e34e6051492399a3f1fec5657f30b/kiwisolver-1.4.9-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:b4b4d74bda2b8ebf4da5bd42af11d02d04428b2c32846e4c2c93219df8a7987b", size = 124159, upload-time = "2025-08-10T21:25:35.472Z" }, + { url = "https://files.pythonhosted.org/packages/96/1e/22f63ec454874378175a5f435d6ea1363dd33fb2af832c6643e4ccea0dc8/kiwisolver-1.4.9-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:fb3b8132019ea572f4611d770991000d7f58127560c4889729248eb5852a102f", size = 66578, upload-time = "2025-08-10T21:25:36.73Z" }, + { url = "https://files.pythonhosted.org/packages/41/4c/1925dcfff47a02d465121967b95151c82d11027d5ec5242771e580e731bd/kiwisolver-1.4.9-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:84fd60810829c27ae375114cd379da1fa65e6918e1da405f356a775d49a62bcf", size = 65312, upload-time = "2025-08-10T21:25:37.658Z" }, + { url = "https://files.pythonhosted.org/packages/d4/42/0f333164e6307a0687d1eb9ad256215aae2f4bd5d28f4653d6cd319a3ba3/kiwisolver-1.4.9-cp310-cp310-manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:b78efa4c6e804ecdf727e580dbb9cba85624d2e1c6b5cb059c66290063bd99a9", size = 1628458, upload-time = "2025-08-10T21:25:39.067Z" }, + { url = "https://files.pythonhosted.org/packages/86/b6/2dccb977d651943995a90bfe3495c2ab2ba5cd77093d9f2318a20c9a6f59/kiwisolver-1.4.9-cp310-cp310-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d4efec7bcf21671db6a3294ff301d2fc861c31faa3c8740d1a94689234d1b415", size = 1225640, upload-time = "2025-08-10T21:25:40.489Z" }, + { url = "https://files.pythonhosted.org/packages/50/2b/362ebd3eec46c850ccf2bfe3e30f2fc4c008750011f38a850f088c56a1c6/kiwisolver-1.4.9-cp310-cp310-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:90f47e70293fc3688b71271100a1a5453aa9944a81d27ff779c108372cf5567b", size = 1244074, upload-time = "2025-08-10T21:25:42.221Z" }, + { url = "https://files.pythonhosted.org/packages/6f/bb/f09a1e66dab8984773d13184a10a29fe67125337649d26bdef547024ed6b/kiwisolver-1.4.9-cp310-cp310-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:8fdca1def57a2e88ef339de1737a1449d6dbf5fab184c54a1fca01d541317154", size = 1293036, upload-time = "2025-08-10T21:25:43.801Z" }, + { url = "https://files.pythonhosted.org/packages/ea/01/11ecf892f201cafda0f68fa59212edaea93e96c37884b747c181303fccd1/kiwisolver-1.4.9-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:9cf554f21be770f5111a1690d42313e140355e687e05cf82cb23d0a721a64a48", size = 2175310, upload-time = "2025-08-10T21:25:45.045Z" }, + { url = "https://files.pythonhosted.org/packages/7f/5f/bfe11d5b934f500cc004314819ea92427e6e5462706a498c1d4fc052e08f/kiwisolver-1.4.9-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:fc1795ac5cd0510207482c3d1d3ed781143383b8cfd36f5c645f3897ce066220", size = 2270943, upload-time = "2025-08-10T21:25:46.393Z" }, + { url = "https://files.pythonhosted.org/packages/3d/de/259f786bf71f1e03e73d87e2db1a9a3bcab64d7b4fd780167123161630ad/kiwisolver-1.4.9-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:ccd09f20ccdbbd341b21a67ab50a119b64a403b09288c27481575105283c1586", size = 2440488, upload-time = "2025-08-10T21:25:48.074Z" }, + { url = "https://files.pythonhosted.org/packages/1b/76/c989c278faf037c4d3421ec07a5c452cd3e09545d6dae7f87c15f54e4edf/kiwisolver-1.4.9-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:540c7c72324d864406a009d72f5d6856f49693db95d1fbb46cf86febef873634", size = 2246787, upload-time = "2025-08-10T21:25:49.442Z" }, + { url = "https://files.pythonhosted.org/packages/a2/55/c2898d84ca440852e560ca9f2a0d28e6e931ac0849b896d77231929900e7/kiwisolver-1.4.9-cp310-cp310-win_amd64.whl", hash = "sha256:ede8c6d533bc6601a47ad4046080d36b8fc99f81e6f1c17b0ac3c2dc91ac7611", size = 73730, upload-time = "2025-08-10T21:25:51.102Z" }, + { url = "https://files.pythonhosted.org/packages/e8/09/486d6ac523dd33b80b368247f238125d027964cfacb45c654841e88fb2ae/kiwisolver-1.4.9-cp310-cp310-win_arm64.whl", hash = "sha256:7b4da0d01ac866a57dd61ac258c5607b4cd677f63abaec7b148354d2b2cdd536", size = 65036, upload-time = "2025-08-10T21:25:52.063Z" }, + { url = "https://files.pythonhosted.org/packages/6f/ab/c80b0d5a9d8a1a65f4f815f2afff9798b12c3b9f31f1d304dd233dd920e2/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:eb14a5da6dc7642b0f3a18f13654847cd8b7a2550e2645a5bda677862b03ba16", size = 124167, upload-time = "2025-08-10T21:25:53.403Z" }, + { url = "https://files.pythonhosted.org/packages/a0/c0/27fe1a68a39cf62472a300e2879ffc13c0538546c359b86f149cc19f6ac3/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:39a219e1c81ae3b103643d2aedb90f1ef22650deb266ff12a19e7773f3e5f089", size = 66579, upload-time = "2025-08-10T21:25:54.79Z" }, + { url = "https://files.pythonhosted.org/packages/31/a2/a12a503ac1fd4943c50f9822678e8015a790a13b5490354c68afb8489814/kiwisolver-1.4.9-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2405a7d98604b87f3fc28b1716783534b1b4b8510d8142adca34ee0bc3c87543", size = 65309, upload-time = "2025-08-10T21:25:55.76Z" }, + { url = "https://files.pythonhosted.org/packages/66/e1/e533435c0be77c3f64040d68d7a657771194a63c279f55573188161e81ca/kiwisolver-1.4.9-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:dc1ae486f9abcef254b5618dfb4113dd49f94c68e3e027d03cf0143f3f772b61", size = 1435596, upload-time = "2025-08-10T21:25:56.861Z" }, + { url = "https://files.pythonhosted.org/packages/67/1e/51b73c7347f9aabdc7215aa79e8b15299097dc2f8e67dee2b095faca9cb0/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8a1f570ce4d62d718dce3f179ee78dac3b545ac16c0c04bb363b7607a949c0d1", size = 1246548, upload-time = "2025-08-10T21:25:58.246Z" }, + { url = "https://files.pythonhosted.org/packages/21/aa/72a1c5d1e430294f2d32adb9542719cfb441b5da368d09d268c7757af46c/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb27e7b78d716c591e88e0a09a2139c6577865d7f2e152488c2cc6257f460872", size = 1263618, upload-time = "2025-08-10T21:25:59.857Z" }, + { url = "https://files.pythonhosted.org/packages/a3/af/db1509a9e79dbf4c260ce0cfa3903ea8945f6240e9e59d1e4deb731b1a40/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:15163165efc2f627eb9687ea5f3a28137217d217ac4024893d753f46bce9de26", size = 1317437, upload-time = "2025-08-10T21:26:01.105Z" }, + { url = "https://files.pythonhosted.org/packages/e0/f2/3ea5ee5d52abacdd12013a94130436e19969fa183faa1e7c7fbc89e9a42f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:bdee92c56a71d2b24c33a7d4c2856bd6419d017e08caa7802d2963870e315028", size = 2195742, upload-time = "2025-08-10T21:26:02.675Z" }, + { url = "https://files.pythonhosted.org/packages/6f/9b/1efdd3013c2d9a2566aa6a337e9923a00590c516add9a1e89a768a3eb2fc/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:412f287c55a6f54b0650bd9b6dce5aceddb95864a1a90c87af16979d37c89771", size = 2290810, upload-time = "2025-08-10T21:26:04.009Z" }, + { url = "https://files.pythonhosted.org/packages/fb/e5/cfdc36109ae4e67361f9bc5b41323648cb24a01b9ade18784657e022e65f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:2c93f00dcba2eea70af2be5f11a830a742fe6b579a1d4e00f47760ef13be247a", size = 2461579, upload-time = "2025-08-10T21:26:05.317Z" }, + { url = "https://files.pythonhosted.org/packages/62/86/b589e5e86c7610842213994cdea5add00960076bef4ae290c5fa68589cac/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f117e1a089d9411663a3207ba874f31be9ac8eaa5b533787024dc07aeb74f464", size = 2268071, upload-time = "2025-08-10T21:26:06.686Z" }, + { url = "https://files.pythonhosted.org/packages/3b/c6/f8df8509fd1eee6c622febe54384a96cfaf4d43bf2ccec7a0cc17e4715c9/kiwisolver-1.4.9-cp311-cp311-win_amd64.whl", hash = "sha256:be6a04e6c79819c9a8c2373317d19a96048e5a3f90bec587787e86a1153883c2", size = 73840, upload-time = "2025-08-10T21:26:07.94Z" }, + { url = "https://files.pythonhosted.org/packages/e2/2d/16e0581daafd147bc11ac53f032a2b45eabac897f42a338d0a13c1e5c436/kiwisolver-1.4.9-cp311-cp311-win_arm64.whl", hash = "sha256:0ae37737256ba2de764ddc12aed4956460277f00c4996d51a197e72f62f5eec7", size = 65159, upload-time = "2025-08-10T21:26:09.048Z" }, + { url = "https://files.pythonhosted.org/packages/86/c9/13573a747838aeb1c76e3267620daa054f4152444d1f3d1a2324b78255b5/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:ac5a486ac389dddcc5bef4f365b6ae3ffff2c433324fb38dd35e3fab7c957999", size = 123686, upload-time = "2025-08-10T21:26:10.034Z" }, + { url = "https://files.pythonhosted.org/packages/51/ea/2ecf727927f103ffd1739271ca19c424d0e65ea473fbaeea1c014aea93f6/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f2ba92255faa7309d06fe44c3a4a97efe1c8d640c2a79a5ef728b685762a6fd2", size = 66460, upload-time = "2025-08-10T21:26:11.083Z" }, + { url = "https://files.pythonhosted.org/packages/5b/5a/51f5464373ce2aeb5194508298a508b6f21d3867f499556263c64c621914/kiwisolver-1.4.9-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:4a2899935e724dd1074cb568ce7ac0dce28b2cd6ab539c8e001a8578eb106d14", size = 64952, upload-time = "2025-08-10T21:26:12.058Z" }, + { url = "https://files.pythonhosted.org/packages/70/90/6d240beb0f24b74371762873e9b7f499f1e02166a2d9c5801f4dbf8fa12e/kiwisolver-1.4.9-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f6008a4919fdbc0b0097089f67a1eb55d950ed7e90ce2cc3e640abadd2757a04", size = 1474756, upload-time = "2025-08-10T21:26:13.096Z" }, + { url = "https://files.pythonhosted.org/packages/12/42/f36816eaf465220f683fb711efdd1bbf7a7005a2473d0e4ed421389bd26c/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:67bb8b474b4181770f926f7b7d2f8c0248cbcb78b660fdd41a47054b28d2a752", size = 1276404, upload-time = "2025-08-10T21:26:14.457Z" }, + { url = "https://files.pythonhosted.org/packages/2e/64/bc2de94800adc830c476dce44e9b40fd0809cddeef1fde9fcf0f73da301f/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2327a4a30d3ee07d2fbe2e7933e8a37c591663b96ce42a00bc67461a87d7df77", size = 1294410, upload-time = "2025-08-10T21:26:15.73Z" }, + { url = "https://files.pythonhosted.org/packages/5f/42/2dc82330a70aa8e55b6d395b11018045e58d0bb00834502bf11509f79091/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7a08b491ec91b1d5053ac177afe5290adacf1f0f6307d771ccac5de30592d198", size = 1343631, upload-time = "2025-08-10T21:26:17.045Z" }, + { url = "https://files.pythonhosted.org/packages/22/fd/f4c67a6ed1aab149ec5a8a401c323cee7a1cbe364381bb6c9c0d564e0e20/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d8fc5c867c22b828001b6a38d2eaeb88160bf5783c6cb4a5e440efc981ce286d", size = 2224963, upload-time = "2025-08-10T21:26:18.737Z" }, + { url = "https://files.pythonhosted.org/packages/45/aa/76720bd4cb3713314677d9ec94dcc21ced3f1baf4830adde5bb9b2430a5f/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:3b3115b2581ea35bb6d1f24a4c90af37e5d9b49dcff267eeed14c3893c5b86ab", size = 2321295, upload-time = "2025-08-10T21:26:20.11Z" }, + { url = "https://files.pythonhosted.org/packages/80/19/d3ec0d9ab711242f56ae0dc2fc5d70e298bb4a1f9dfab44c027668c673a1/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:858e4c22fb075920b96a291928cb7dea5644e94c0ee4fcd5af7e865655e4ccf2", size = 2487987, upload-time = "2025-08-10T21:26:21.49Z" }, + { url = "https://files.pythonhosted.org/packages/39/e9/61e4813b2c97e86b6fdbd4dd824bf72d28bcd8d4849b8084a357bc0dd64d/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ed0fecd28cc62c54b262e3736f8bb2512d8dcfdc2bcf08be5f47f96bf405b145", size = 2291817, upload-time = "2025-08-10T21:26:22.812Z" }, + { url = "https://files.pythonhosted.org/packages/a0/41/85d82b0291db7504da3c2defe35c9a8a5c9803a730f297bd823d11d5fb77/kiwisolver-1.4.9-cp312-cp312-win_amd64.whl", hash = "sha256:f68208a520c3d86ea51acf688a3e3002615a7f0238002cccc17affecc86a8a54", size = 73895, upload-time = "2025-08-10T21:26:24.37Z" }, + { url = "https://files.pythonhosted.org/packages/e2/92/5f3068cf15ee5cb624a0c7596e67e2a0bb2adee33f71c379054a491d07da/kiwisolver-1.4.9-cp312-cp312-win_arm64.whl", hash = "sha256:2c1a4f57df73965f3f14df20b80ee29e6a7930a57d2d9e8491a25f676e197c60", size = 64992, upload-time = "2025-08-10T21:26:25.732Z" }, + { url = "https://files.pythonhosted.org/packages/31/c1/c2686cda909742ab66c7388e9a1a8521a59eb89f8bcfbee28fc980d07e24/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:a5d0432ccf1c7ab14f9949eec60c5d1f924f17c037e9f8b33352fa05799359b8", size = 123681, upload-time = "2025-08-10T21:26:26.725Z" }, + { url = "https://files.pythonhosted.org/packages/ca/f0/f44f50c9f5b1a1860261092e3bc91ecdc9acda848a8b8c6abfda4a24dd5c/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efb3a45b35622bb6c16dbfab491a8f5a391fe0e9d45ef32f4df85658232ca0e2", size = 66464, upload-time = "2025-08-10T21:26:27.733Z" }, + { url = "https://files.pythonhosted.org/packages/2d/7a/9d90a151f558e29c3936b8a47ac770235f436f2120aca41a6d5f3d62ae8d/kiwisolver-1.4.9-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:1a12cf6398e8a0a001a059747a1cbf24705e18fe413bc22de7b3d15c67cffe3f", size = 64961, upload-time = "2025-08-10T21:26:28.729Z" }, + { url = "https://files.pythonhosted.org/packages/e9/e9/f218a2cb3a9ffbe324ca29a9e399fa2d2866d7f348ec3a88df87fc248fc5/kiwisolver-1.4.9-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b67e6efbf68e077dd71d1a6b37e43e1a99d0bff1a3d51867d45ee8908b931098", size = 1474607, upload-time = "2025-08-10T21:26:29.798Z" }, + { url = "https://files.pythonhosted.org/packages/d9/28/aac26d4c882f14de59041636292bc838db8961373825df23b8eeb807e198/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5656aa670507437af0207645273ccdfee4f14bacd7f7c67a4306d0dcaeaf6eed", size = 1276546, upload-time = "2025-08-10T21:26:31.401Z" }, + { url = "https://files.pythonhosted.org/packages/8b/ad/8bfc1c93d4cc565e5069162f610ba2f48ff39b7de4b5b8d93f69f30c4bed/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:bfc08add558155345129c7803b3671cf195e6a56e7a12f3dde7c57d9b417f525", size = 1294482, upload-time = "2025-08-10T21:26:32.721Z" }, + { url = "https://files.pythonhosted.org/packages/da/f1/6aca55ff798901d8ce403206d00e033191f63d82dd708a186e0ed2067e9c/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:40092754720b174e6ccf9e845d0d8c7d8e12c3d71e7fc35f55f3813e96376f78", size = 1343720, upload-time = "2025-08-10T21:26:34.032Z" }, + { url = "https://files.pythonhosted.org/packages/d1/91/eed031876c595c81d90d0f6fc681ece250e14bf6998c3d7c419466b523b7/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:497d05f29a1300d14e02e6441cf0f5ee81c1ff5a304b0d9fb77423974684e08b", size = 2224907, upload-time = "2025-08-10T21:26:35.824Z" }, + { url = "https://files.pythonhosted.org/packages/e9/ec/4d1925f2e49617b9cca9c34bfa11adefad49d00db038e692a559454dfb2e/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:bdd1a81a1860476eb41ac4bc1e07b3f07259e6d55bbf739b79c8aaedcf512799", size = 2321334, upload-time = "2025-08-10T21:26:37.534Z" }, + { url = "https://files.pythonhosted.org/packages/43/cb/450cd4499356f68802750c6ddc18647b8ea01ffa28f50d20598e0befe6e9/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:e6b93f13371d341afee3be9f7c5964e3fe61d5fa30f6a30eb49856935dfe4fc3", size = 2488313, upload-time = "2025-08-10T21:26:39.191Z" }, + { url = "https://files.pythonhosted.org/packages/71/67/fc76242bd99f885651128a5d4fa6083e5524694b7c88b489b1b55fdc491d/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d75aa530ccfaa593da12834b86a0724f58bff12706659baa9227c2ccaa06264c", size = 2291970, upload-time = "2025-08-10T21:26:40.828Z" }, + { url = "https://files.pythonhosted.org/packages/75/bd/f1a5d894000941739f2ae1b65a32892349423ad49c2e6d0771d0bad3fae4/kiwisolver-1.4.9-cp313-cp313-win_amd64.whl", hash = "sha256:dd0a578400839256df88c16abddf9ba14813ec5f21362e1fe65022e00c883d4d", size = 73894, upload-time = "2025-08-10T21:26:42.33Z" }, + { url = "https://files.pythonhosted.org/packages/95/38/dce480814d25b99a391abbddadc78f7c117c6da34be68ca8b02d5848b424/kiwisolver-1.4.9-cp313-cp313-win_arm64.whl", hash = "sha256:d4188e73af84ca82468f09cadc5ac4db578109e52acb4518d8154698d3a87ca2", size = 64995, upload-time = "2025-08-10T21:26:43.889Z" }, + { url = "https://files.pythonhosted.org/packages/e2/37/7d218ce5d92dadc5ebdd9070d903e0c7cf7edfe03f179433ac4d13ce659c/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:5a0f2724dfd4e3b3ac5a82436a8e6fd16baa7d507117e4279b660fe8ca38a3a1", size = 126510, upload-time = "2025-08-10T21:26:44.915Z" }, + { url = "https://files.pythonhosted.org/packages/23/b0/e85a2b48233daef4b648fb657ebbb6f8367696a2d9548a00b4ee0eb67803/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:1b11d6a633e4ed84fc0ddafd4ebfd8ea49b3f25082c04ad12b8315c11d504dc1", size = 67903, upload-time = "2025-08-10T21:26:45.934Z" }, + { url = "https://files.pythonhosted.org/packages/44/98/f2425bc0113ad7de24da6bb4dae1343476e95e1d738be7c04d31a5d037fd/kiwisolver-1.4.9-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:61874cdb0a36016354853593cffc38e56fc9ca5aa97d2c05d3dcf6922cd55a11", size = 66402, upload-time = "2025-08-10T21:26:47.101Z" }, + { url = "https://files.pythonhosted.org/packages/98/d8/594657886df9f34c4177cc353cc28ca7e6e5eb562d37ccc233bff43bbe2a/kiwisolver-1.4.9-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:60c439763a969a6af93b4881db0eed8fadf93ee98e18cbc35bc8da868d0c4f0c", size = 1582135, upload-time = "2025-08-10T21:26:48.665Z" }, + { url = "https://files.pythonhosted.org/packages/5c/c6/38a115b7170f8b306fc929e166340c24958347308ea3012c2b44e7e295db/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92a2f997387a1b79a75e7803aa7ded2cfbe2823852ccf1ba3bcf613b62ae3197", size = 1389409, upload-time = "2025-08-10T21:26:50.335Z" }, + { url = "https://files.pythonhosted.org/packages/bf/3b/e04883dace81f24a568bcee6eb3001da4ba05114afa622ec9b6fafdc1f5e/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a31d512c812daea6d8b3be3b2bfcbeb091dbb09177706569bcfc6240dcf8b41c", size = 1401763, upload-time = "2025-08-10T21:26:51.867Z" }, + { url = "https://files.pythonhosted.org/packages/9f/80/20ace48e33408947af49d7d15c341eaee69e4e0304aab4b7660e234d6288/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:52a15b0f35dad39862d376df10c5230155243a2c1a436e39eb55623ccbd68185", size = 1453643, upload-time = "2025-08-10T21:26:53.592Z" }, + { url = "https://files.pythonhosted.org/packages/64/31/6ce4380a4cd1f515bdda976a1e90e547ccd47b67a1546d63884463c92ca9/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a30fd6fdef1430fd9e1ba7b3398b5ee4e2887783917a687d86ba69985fb08748", size = 2330818, upload-time = "2025-08-10T21:26:55.051Z" }, + { url = "https://files.pythonhosted.org/packages/fa/e9/3f3fcba3bcc7432c795b82646306e822f3fd74df0ee81f0fa067a1f95668/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:cc9617b46837c6468197b5945e196ee9ca43057bb7d9d1ae688101e4e1dddf64", size = 2419963, upload-time = "2025-08-10T21:26:56.421Z" }, + { url = "https://files.pythonhosted.org/packages/99/43/7320c50e4133575c66e9f7dadead35ab22d7c012a3b09bb35647792b2a6d/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:0ab74e19f6a2b027ea4f845a78827969af45ce790e6cb3e1ebab71bdf9f215ff", size = 2594639, upload-time = "2025-08-10T21:26:57.882Z" }, + { url = "https://files.pythonhosted.org/packages/65/d6/17ae4a270d4a987ef8a385b906d2bdfc9fce502d6dc0d3aea865b47f548c/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:dba5ee5d3981160c28d5490f0d1b7ed730c22470ff7f6cc26cfcfaacb9896a07", size = 2391741, upload-time = "2025-08-10T21:26:59.237Z" }, + { url = "https://files.pythonhosted.org/packages/2a/8f/8f6f491d595a9e5912971f3f863d81baddccc8a4d0c3749d6a0dd9ffc9df/kiwisolver-1.4.9-cp313-cp313t-win_arm64.whl", hash = "sha256:0749fd8f4218ad2e851e11cc4dc05c7cbc0cbc4267bdfdb31782e65aace4ee9c", size = 68646, upload-time = "2025-08-10T21:27:00.52Z" }, + { url = "https://files.pythonhosted.org/packages/6b/32/6cc0fbc9c54d06c2969faa9c1d29f5751a2e51809dd55c69055e62d9b426/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:9928fe1eb816d11ae170885a74d074f57af3a0d65777ca47e9aeb854a1fba386", size = 123806, upload-time = "2025-08-10T21:27:01.537Z" }, + { url = "https://files.pythonhosted.org/packages/b2/dd/2bfb1d4a4823d92e8cbb420fe024b8d2167f72079b3bb941207c42570bdf/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:d0005b053977e7b43388ddec89fa567f43d4f6d5c2c0affe57de5ebf290dc552", size = 66605, upload-time = "2025-08-10T21:27:03.335Z" }, + { url = "https://files.pythonhosted.org/packages/f7/69/00aafdb4e4509c2ca6064646cba9cd4b37933898f426756adb2cb92ebbed/kiwisolver-1.4.9-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:2635d352d67458b66fd0667c14cb1d4145e9560d503219034a18a87e971ce4f3", size = 64925, upload-time = "2025-08-10T21:27:04.339Z" }, + { url = "https://files.pythonhosted.org/packages/43/dc/51acc6791aa14e5cb6d8a2e28cefb0dc2886d8862795449d021334c0df20/kiwisolver-1.4.9-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:767c23ad1c58c9e827b649a9ab7809fd5fd9db266a9cf02b0e926ddc2c680d58", size = 1472414, upload-time = "2025-08-10T21:27:05.437Z" }, + { url = "https://files.pythonhosted.org/packages/3d/bb/93fa64a81db304ac8a246f834d5094fae4b13baf53c839d6bb6e81177129/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72d0eb9fba308b8311685c2268cf7d0a0639a6cd027d8128659f72bdd8a024b4", size = 1281272, upload-time = "2025-08-10T21:27:07.063Z" }, + { url = "https://files.pythonhosted.org/packages/70/e6/6df102916960fb8d05069d4bd92d6d9a8202d5a3e2444494e7cd50f65b7a/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f68e4f3eeca8fb22cc3d731f9715a13b652795ef657a13df1ad0c7dc0e9731df", size = 1298578, upload-time = "2025-08-10T21:27:08.452Z" }, + { url = "https://files.pythonhosted.org/packages/7c/47/e142aaa612f5343736b087864dbaebc53ea8831453fb47e7521fa8658f30/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d84cd4061ae292d8ac367b2c3fa3aad11cb8625a95d135fe93f286f914f3f5a6", size = 1345607, upload-time = "2025-08-10T21:27:10.125Z" }, + { url = "https://files.pythonhosted.org/packages/54/89/d641a746194a0f4d1a3670fb900d0dbaa786fb98341056814bc3f058fa52/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:a60ea74330b91bd22a29638940d115df9dc00af5035a9a2a6ad9399ffb4ceca5", size = 2230150, upload-time = "2025-08-10T21:27:11.484Z" }, + { url = "https://files.pythonhosted.org/packages/aa/6b/5ee1207198febdf16ac11f78c5ae40861b809cbe0e6d2a8d5b0b3044b199/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ce6a3a4e106cf35c2d9c4fa17c05ce0b180db622736845d4315519397a77beaf", size = 2325979, upload-time = "2025-08-10T21:27:12.917Z" }, + { url = "https://files.pythonhosted.org/packages/fc/ff/b269eefd90f4ae14dcc74973d5a0f6d28d3b9bb1afd8c0340513afe6b39a/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:77937e5e2a38a7b48eef0585114fe7930346993a88060d0bf886086d2aa49ef5", size = 2491456, upload-time = "2025-08-10T21:27:14.353Z" }, + { url = "https://files.pythonhosted.org/packages/fc/d4/10303190bd4d30de547534601e259a4fbf014eed94aae3e5521129215086/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:24c175051354f4a28c5d6a31c93906dc653e2bf234e8a4bbfb964892078898ce", size = 2294621, upload-time = "2025-08-10T21:27:15.808Z" }, + { url = "https://files.pythonhosted.org/packages/28/e0/a9a90416fce5c0be25742729c2ea52105d62eda6c4be4d803c2a7be1fa50/kiwisolver-1.4.9-cp314-cp314-win_amd64.whl", hash = "sha256:0763515d4df10edf6d06a3c19734e2566368980d21ebec439f33f9eb936c07b7", size = 75417, upload-time = "2025-08-10T21:27:17.436Z" }, + { url = "https://files.pythonhosted.org/packages/1f/10/6949958215b7a9a264299a7db195564e87900f709db9245e4ebdd3c70779/kiwisolver-1.4.9-cp314-cp314-win_arm64.whl", hash = "sha256:0e4e2bf29574a6a7b7f6cb5fa69293b9f96c928949ac4a53ba3f525dffb87f9c", size = 66582, upload-time = "2025-08-10T21:27:18.436Z" }, + { url = "https://files.pythonhosted.org/packages/ec/79/60e53067903d3bc5469b369fe0dfc6b3482e2133e85dae9daa9527535991/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d976bbb382b202f71c67f77b0ac11244021cfa3f7dfd9e562eefcea2df711548", size = 126514, upload-time = "2025-08-10T21:27:19.465Z" }, + { url = "https://files.pythonhosted.org/packages/25/d1/4843d3e8d46b072c12a38c97c57fab4608d36e13fe47d47ee96b4d61ba6f/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2489e4e5d7ef9a1c300a5e0196e43d9c739f066ef23270607d45aba368b91f2d", size = 67905, upload-time = "2025-08-10T21:27:20.51Z" }, + { url = "https://files.pythonhosted.org/packages/8c/ae/29ffcbd239aea8b93108de1278271ae764dfc0d803a5693914975f200596/kiwisolver-1.4.9-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:e2ea9f7ab7fbf18fffb1b5434ce7c69a07582f7acc7717720f1d69f3e806f90c", size = 66399, upload-time = "2025-08-10T21:27:21.496Z" }, + { url = "https://files.pythonhosted.org/packages/a1/ae/d7ba902aa604152c2ceba5d352d7b62106bedbccc8e95c3934d94472bfa3/kiwisolver-1.4.9-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b34e51affded8faee0dfdb705416153819d8ea9250bbbf7ea1b249bdeb5f1122", size = 1582197, upload-time = "2025-08-10T21:27:22.604Z" }, + { url = "https://files.pythonhosted.org/packages/f2/41/27c70d427eddb8bc7e4f16420a20fefc6f480312122a59a959fdfe0445ad/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d8aacd3d4b33b772542b2e01beb50187536967b514b00003bdda7589722d2a64", size = 1390125, upload-time = "2025-08-10T21:27:24.036Z" }, + { url = "https://files.pythonhosted.org/packages/41/42/b3799a12bafc76d962ad69083f8b43b12bf4fe78b097b12e105d75c9b8f1/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:7cf974dd4e35fa315563ac99d6287a1024e4dc2077b8a7d7cd3d2fb65d283134", size = 1402612, upload-time = "2025-08-10T21:27:25.773Z" }, + { url = "https://files.pythonhosted.org/packages/d2/b5/a210ea073ea1cfaca1bb5c55a62307d8252f531beb364e18aa1e0888b5a0/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:85bd218b5ecfbee8c8a82e121802dcb519a86044c9c3b2e4aef02fa05c6da370", size = 1453990, upload-time = "2025-08-10T21:27:27.089Z" }, + { url = "https://files.pythonhosted.org/packages/5f/ce/a829eb8c033e977d7ea03ed32fb3c1781b4fa0433fbadfff29e39c676f32/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:0856e241c2d3df4efef7c04a1e46b1936b6120c9bcf36dd216e3acd84bc4fb21", size = 2331601, upload-time = "2025-08-10T21:27:29.343Z" }, + { url = "https://files.pythonhosted.org/packages/e0/4b/b5e97eb142eb9cd0072dacfcdcd31b1c66dc7352b0f7c7255d339c0edf00/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:9af39d6551f97d31a4deebeac6f45b156f9755ddc59c07b402c148f5dbb6482a", size = 2422041, upload-time = "2025-08-10T21:27:30.754Z" }, + { url = "https://files.pythonhosted.org/packages/40/be/8eb4cd53e1b85ba4edc3a9321666f12b83113a178845593307a3e7891f44/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:bb4ae2b57fc1d8cbd1cf7b1d9913803681ffa903e7488012be5b76dedf49297f", size = 2594897, upload-time = "2025-08-10T21:27:32.803Z" }, + { url = "https://files.pythonhosted.org/packages/99/dd/841e9a66c4715477ea0abc78da039832fbb09dac5c35c58dc4c41a407b8a/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:aedff62918805fb62d43a4aa2ecd4482c380dc76cd31bd7c8878588a61bd0369", size = 2391835, upload-time = "2025-08-10T21:27:34.23Z" }, + { url = "https://files.pythonhosted.org/packages/0c/28/4b2e5c47a0da96896fdfdb006340ade064afa1e63675d01ea5ac222b6d52/kiwisolver-1.4.9-cp314-cp314t-win_amd64.whl", hash = "sha256:1fa333e8b2ce4d9660f2cda9c0e1b6bafcfb2457a9d259faa82289e73ec24891", size = 79988, upload-time = "2025-08-10T21:27:35.587Z" }, + { url = "https://files.pythonhosted.org/packages/80/be/3578e8afd18c88cdf9cb4cffde75a96d2be38c5a903f1ed0ceec061bd09e/kiwisolver-1.4.9-cp314-cp314t-win_arm64.whl", hash = "sha256:4a48a2ce79d65d363597ef7b567ce3d14d68783d2b2263d98db3d9477805ba32", size = 70260, upload-time = "2025-08-10T21:27:36.606Z" }, + { url = "https://files.pythonhosted.org/packages/a2/63/fde392691690f55b38d5dd7b3710f5353bf7a8e52de93a22968801ab8978/kiwisolver-1.4.9-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:4d1d9e582ad4d63062d34077a9a1e9f3c34088a2ec5135b1f7190c07cf366527", size = 60183, upload-time = "2025-08-10T21:27:37.669Z" }, + { url = "https://files.pythonhosted.org/packages/27/b1/6aad34edfdb7cced27f371866f211332bba215bfd918ad3322a58f480d8b/kiwisolver-1.4.9-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:deed0c7258ceb4c44ad5ec7d9918f9f14fd05b2be86378d86cf50e63d1e7b771", size = 58675, upload-time = "2025-08-10T21:27:39.031Z" }, + { url = "https://files.pythonhosted.org/packages/9d/1a/23d855a702bb35a76faed5ae2ba3de57d323f48b1f6b17ee2176c4849463/kiwisolver-1.4.9-pp310-pypy310_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0a590506f303f512dff6b7f75fd2fd18e16943efee932008fe7140e5fa91d80e", size = 80277, upload-time = "2025-08-10T21:27:40.129Z" }, + { url = "https://files.pythonhosted.org/packages/5a/5b/5239e3c2b8fb5afa1e8508f721bb77325f740ab6994d963e61b2b7abcc1e/kiwisolver-1.4.9-pp310-pypy310_pp73-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e09c2279a4d01f099f52d5c4b3d9e208e91edcbd1a175c9662a8b16e000fece9", size = 77994, upload-time = "2025-08-10T21:27:41.181Z" }, + { url = "https://files.pythonhosted.org/packages/f9/1c/5d4d468fb16f8410e596ed0eac02d2c68752aa7dc92997fe9d60a7147665/kiwisolver-1.4.9-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:c9e7cdf45d594ee04d5be1b24dd9d49f3d1590959b2271fb30b5ca2b262c00fb", size = 73744, upload-time = "2025-08-10T21:27:42.254Z" }, + { url = "https://files.pythonhosted.org/packages/a3/0f/36d89194b5a32c054ce93e586d4049b6c2c22887b0eb229c61c68afd3078/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:720e05574713db64c356e86732c0f3c5252818d05f9df320f0ad8380641acea5", size = 60104, upload-time = "2025-08-10T21:27:43.287Z" }, + { url = "https://files.pythonhosted.org/packages/52/ba/4ed75f59e4658fd21fe7dde1fee0ac397c678ec3befba3fe6482d987af87/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:17680d737d5335b552994a2008fab4c851bcd7de33094a82067ef3a576ff02fa", size = 58592, upload-time = "2025-08-10T21:27:44.314Z" }, + { url = "https://files.pythonhosted.org/packages/33/01/a8ea7c5ea32a9b45ceeaee051a04c8ed4320f5add3c51bfa20879b765b70/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:85b5352f94e490c028926ea567fc569c52ec79ce131dadb968d3853e809518c2", size = 80281, upload-time = "2025-08-10T21:27:45.369Z" }, + { url = "https://files.pythonhosted.org/packages/da/e3/dbd2ecdce306f1d07a1aaf324817ee993aab7aee9db47ceac757deabafbe/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:464415881e4801295659462c49461a24fb107c140de781d55518c4b80cb6790f", size = 78009, upload-time = "2025-08-10T21:27:46.376Z" }, + { url = "https://files.pythonhosted.org/packages/da/e9/0d4add7873a73e462aeb45c036a2dead2562b825aa46ba326727b3f31016/kiwisolver-1.4.9-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:fb940820c63a9590d31d88b815e7a3aa5915cad3ce735ab45f0c730b39547de1", size = 73929, upload-time = "2025-08-10T21:27:48.236Z" }, +] + [[package]] name = "latex2mathml" version = "3.78.1" @@ -1409,6 +2407,149 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/94/54/e7d793b573f298e1c9013b8c4dade17d481164aa517d1d7148619c2cedbf/markdown_it_py-4.0.0-py3-none-any.whl", hash = "sha256:87327c59b172c5011896038353a81343b6754500a08cd7a4973bb48c6d578147", size = 87321, upload-time = "2025-08-11T12:57:51.923Z" }, ] +[[package]] +name = "matplotlib" +version = "3.9.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "contourpy", version = "1.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "cycler", marker = "python_full_version < '3.10'" }, + { name = "fonttools", version = "4.60.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "importlib-resources", marker = "python_full_version < '3.10'" }, + { name = "kiwisolver", version = "1.4.7", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "numpy", version = "2.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "packaging", marker = "python_full_version < '3.10'" }, + { name = "pillow", version = "11.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "pyparsing", marker = "python_full_version < '3.10'" }, + { name = "python-dateutil", marker = "python_full_version < '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/df/17/1747b4154034befd0ed33b52538f5eb7752d05bb51c5e2a31470c3bc7d52/matplotlib-3.9.4.tar.gz", hash = "sha256:1e00e8be7393cbdc6fedfa8a6fba02cf3e83814b285db1c60b906a023ba41bc3", size = 36106529, upload-time = "2024-12-13T05:56:34.184Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7e/94/27d2e2c30d54b56c7b764acc1874a909e34d1965a427fc7092bb6a588b63/matplotlib-3.9.4-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:c5fdd7abfb706dfa8d307af64a87f1a862879ec3cd8d0ec8637458f0885b9c50", size = 7885089, upload-time = "2024-12-13T05:54:24.224Z" }, + { url = "https://files.pythonhosted.org/packages/c6/25/828273307e40a68eb8e9df832b6b2aaad075864fdc1de4b1b81e40b09e48/matplotlib-3.9.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:d89bc4e85e40a71d1477780366c27fb7c6494d293e1617788986f74e2a03d7ff", size = 7770600, upload-time = "2024-12-13T05:54:27.214Z" }, + { url = "https://files.pythonhosted.org/packages/f2/65/f841a422ec994da5123368d76b126acf4fc02ea7459b6e37c4891b555b83/matplotlib-3.9.4-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ddf9f3c26aae695c5daafbf6b94e4c1a30d6cd617ba594bbbded3b33a1fcfa26", size = 8200138, upload-time = "2024-12-13T05:54:29.497Z" }, + { url = "https://files.pythonhosted.org/packages/07/06/272aca07a38804d93b6050813de41ca7ab0e29ba7a9dd098e12037c919a9/matplotlib-3.9.4-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:18ebcf248030173b59a868fda1fe42397253f6698995b55e81e1f57431d85e50", size = 8312711, upload-time = "2024-12-13T05:54:34.396Z" }, + { url = "https://files.pythonhosted.org/packages/98/37/f13e23b233c526b7e27ad61be0a771894a079e0f7494a10d8d81557e0e9a/matplotlib-3.9.4-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:974896ec43c672ec23f3f8c648981e8bc880ee163146e0312a9b8def2fac66f5", size = 9090622, upload-time = "2024-12-13T05:54:36.808Z" }, + { url = "https://files.pythonhosted.org/packages/4f/8c/b1f5bd2bd70e60f93b1b54c4d5ba7a992312021d0ddddf572f9a1a6d9348/matplotlib-3.9.4-cp310-cp310-win_amd64.whl", hash = "sha256:4598c394ae9711cec135639374e70871fa36b56afae17bdf032a345be552a88d", size = 7828211, upload-time = "2024-12-13T05:54:40.596Z" }, + { url = "https://files.pythonhosted.org/packages/74/4b/65be7959a8fa118a3929b49a842de5b78bb55475236fcf64f3e308ff74a0/matplotlib-3.9.4-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:d4dd29641d9fb8bc4492420c5480398dd40a09afd73aebe4eb9d0071a05fbe0c", size = 7894430, upload-time = "2024-12-13T05:54:44.049Z" }, + { url = "https://files.pythonhosted.org/packages/e9/18/80f70d91896e0a517b4a051c3fd540daa131630fd75e02e250365353b253/matplotlib-3.9.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:30e5b22e8bcfb95442bf7d48b0d7f3bdf4a450cbf68986ea45fca3d11ae9d099", size = 7780045, upload-time = "2024-12-13T05:54:46.414Z" }, + { url = "https://files.pythonhosted.org/packages/a2/73/ccb381026e3238c5c25c3609ba4157b2d1a617ec98d65a8b4ee4e1e74d02/matplotlib-3.9.4-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2bb0030d1d447fd56dcc23b4c64a26e44e898f0416276cac1ebc25522e0ac249", size = 8209906, upload-time = "2024-12-13T05:54:49.459Z" }, + { url = "https://files.pythonhosted.org/packages/ab/33/1648da77b74741c89f5ea95cbf42a291b4b364f2660b316318811404ed97/matplotlib-3.9.4-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aca90ed222ac3565d2752b83dbb27627480d27662671e4d39da72e97f657a423", size = 8322873, upload-time = "2024-12-13T05:54:53.066Z" }, + { url = "https://files.pythonhosted.org/packages/57/d3/8447ba78bc6593c9044c372d1609f8ea10fb1e071e7a9e0747bea74fc16c/matplotlib-3.9.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:a181b2aa2906c608fcae72f977a4a2d76e385578939891b91c2550c39ecf361e", size = 9099566, upload-time = "2024-12-13T05:54:55.522Z" }, + { url = "https://files.pythonhosted.org/packages/23/e1/4f0e237bf349c02ff9d1b6e7109f1a17f745263809b9714a8576dc17752b/matplotlib-3.9.4-cp311-cp311-win_amd64.whl", hash = "sha256:1f6882828231eca17f501c4dcd98a05abb3f03d157fbc0769c6911fe08b6cfd3", size = 7838065, upload-time = "2024-12-13T05:54:58.337Z" }, + { url = "https://files.pythonhosted.org/packages/1a/2b/c918bf6c19d6445d1cefe3d2e42cb740fb997e14ab19d4daeb6a7ab8a157/matplotlib-3.9.4-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:dfc48d67e6661378a21c2983200a654b72b5c5cdbd5d2cf6e5e1ece860f0cc70", size = 7891131, upload-time = "2024-12-13T05:55:02.837Z" }, + { url = "https://files.pythonhosted.org/packages/c1/e5/b4e8fc601ca302afeeabf45f30e706a445c7979a180e3a978b78b2b681a4/matplotlib-3.9.4-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:47aef0fab8332d02d68e786eba8113ffd6f862182ea2999379dec9e237b7e483", size = 7776365, upload-time = "2024-12-13T05:55:05.158Z" }, + { url = "https://files.pythonhosted.org/packages/99/06/b991886c506506476e5d83625c5970c656a491b9f80161458fed94597808/matplotlib-3.9.4-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:fba1f52c6b7dc764097f52fd9ab627b90db452c9feb653a59945de16752e965f", size = 8200707, upload-time = "2024-12-13T05:55:09.48Z" }, + { url = "https://files.pythonhosted.org/packages/c3/e2/556b627498cb27e61026f2d1ba86a78ad1b836fef0996bef5440e8bc9559/matplotlib-3.9.4-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:173ac3748acaac21afcc3fa1633924609ba1b87749006bc25051c52c422a5d00", size = 8313761, upload-time = "2024-12-13T05:55:12.95Z" }, + { url = "https://files.pythonhosted.org/packages/58/ff/165af33ec766ff818306ea88e91f9f60d2a6ed543be1eb122a98acbf3b0d/matplotlib-3.9.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:320edea0cadc07007765e33f878b13b3738ffa9745c5f707705692df70ffe0e0", size = 9095284, upload-time = "2024-12-13T05:55:16.199Z" }, + { url = "https://files.pythonhosted.org/packages/9f/8b/3d0c7a002db3b1ed702731c2a9a06d78d035f1f2fb0fb936a8e43cc1e9f4/matplotlib-3.9.4-cp312-cp312-win_amd64.whl", hash = "sha256:a4a4cfc82330b27042a7169533da7991e8789d180dd5b3daeaee57d75cd5a03b", size = 7841160, upload-time = "2024-12-13T05:55:19.991Z" }, + { url = "https://files.pythonhosted.org/packages/49/b1/999f89a7556d101b23a2f0b54f1b6e140d73f56804da1398f2f0bc0924bc/matplotlib-3.9.4-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:37eeffeeca3c940985b80f5b9a7b95ea35671e0e7405001f249848d2b62351b6", size = 7891499, upload-time = "2024-12-13T05:55:22.142Z" }, + { url = "https://files.pythonhosted.org/packages/87/7b/06a32b13a684977653396a1bfcd34d4e7539c5d55c8cbfaa8ae04d47e4a9/matplotlib-3.9.4-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:3e7465ac859ee4abcb0d836137cd8414e7bb7ad330d905abced457217d4f0f45", size = 7776802, upload-time = "2024-12-13T05:55:25.947Z" }, + { url = "https://files.pythonhosted.org/packages/65/87/ac498451aff739e515891bbb92e566f3c7ef31891aaa878402a71f9b0910/matplotlib-3.9.4-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f4c12302c34afa0cf061bea23b331e747e5e554b0fa595c96e01c7b75bc3b858", size = 8200802, upload-time = "2024-12-13T05:55:28.461Z" }, + { url = "https://files.pythonhosted.org/packages/f8/6b/9eb761c00e1cb838f6c92e5f25dcda3f56a87a52f6cb8fdfa561e6cf6a13/matplotlib-3.9.4-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2b8c97917f21b75e72108b97707ba3d48f171541a74aa2a56df7a40626bafc64", size = 8313880, upload-time = "2024-12-13T05:55:30.965Z" }, + { url = "https://files.pythonhosted.org/packages/d7/a2/c8eaa600e2085eec7e38cbbcc58a30fc78f8224939d31d3152bdafc01fd1/matplotlib-3.9.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:0229803bd7e19271b03cb09f27db76c918c467aa4ce2ae168171bc67c3f508df", size = 9094637, upload-time = "2024-12-13T05:55:33.701Z" }, + { url = "https://files.pythonhosted.org/packages/71/1f/c6e1daea55b7bfeb3d84c6cb1abc449f6a02b181e7e2a5e4db34c3afb793/matplotlib-3.9.4-cp313-cp313-win_amd64.whl", hash = "sha256:7c0d8ef442ebf56ff5e206f8083d08252ee738e04f3dc88ea882853a05488799", size = 7841311, upload-time = "2024-12-13T05:55:36.737Z" }, + { url = "https://files.pythonhosted.org/packages/c0/3a/2757d3f7d388b14dd48f5a83bea65b6d69f000e86b8f28f74d86e0d375bd/matplotlib-3.9.4-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:a04c3b00066a688834356d196136349cb32f5e1003c55ac419e91585168b88fb", size = 7919989, upload-time = "2024-12-13T05:55:39.024Z" }, + { url = "https://files.pythonhosted.org/packages/24/28/f5077c79a4f521589a37fe1062d6a6ea3534e068213f7357e7cfffc2e17a/matplotlib-3.9.4-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:04c519587f6c210626741a1e9a68eefc05966ede24205db8982841826af5871a", size = 7809417, upload-time = "2024-12-13T05:55:42.412Z" }, + { url = "https://files.pythonhosted.org/packages/36/c8/c523fd2963156692916a8eb7d4069084cf729359f7955cf09075deddfeaf/matplotlib-3.9.4-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:308afbf1a228b8b525fcd5cec17f246bbbb63b175a3ef6eb7b4d33287ca0cf0c", size = 8226258, upload-time = "2024-12-13T05:55:47.259Z" }, + { url = "https://files.pythonhosted.org/packages/f6/88/499bf4b8fa9349b6f5c0cf4cead0ebe5da9d67769129f1b5651e5ac51fbc/matplotlib-3.9.4-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ddb3b02246ddcffd3ce98e88fed5b238bc5faff10dbbaa42090ea13241d15764", size = 8335849, upload-time = "2024-12-13T05:55:49.763Z" }, + { url = "https://files.pythonhosted.org/packages/b8/9f/20a4156b9726188646a030774ee337d5ff695a965be45ce4dbcb9312c170/matplotlib-3.9.4-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:8a75287e9cb9eee48cb79ec1d806f75b29c0fde978cb7223a1f4c5848d696041", size = 9102152, upload-time = "2024-12-13T05:55:51.997Z" }, + { url = "https://files.pythonhosted.org/packages/10/11/237f9c3a4e8d810b1759b67ff2da7c32c04f9c80aa475e7beb36ed43a8fb/matplotlib-3.9.4-cp313-cp313t-win_amd64.whl", hash = "sha256:488deb7af140f0ba86da003e66e10d55ff915e152c78b4b66d231638400b1965", size = 7896987, upload-time = "2024-12-13T05:55:55.941Z" }, + { url = "https://files.pythonhosted.org/packages/56/eb/501b465c9fef28f158e414ea3a417913dc2ac748564c7ed41535f23445b4/matplotlib-3.9.4-cp39-cp39-macosx_10_12_x86_64.whl", hash = "sha256:3c3724d89a387ddf78ff88d2a30ca78ac2b4c89cf37f2db4bd453c34799e933c", size = 7885919, upload-time = "2024-12-13T05:55:59.66Z" }, + { url = "https://files.pythonhosted.org/packages/da/36/236fbd868b6c91309a5206bd90c3f881f4f44b2d997cd1d6239ef652f878/matplotlib-3.9.4-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:d5f0a8430ffe23d7e32cfd86445864ccad141797f7d25b7c41759a5b5d17cfd7", size = 7771486, upload-time = "2024-12-13T05:56:04.264Z" }, + { url = "https://files.pythonhosted.org/packages/e0/4b/105caf2d54d5ed11d9f4335398f5103001a03515f2126c936a752ccf1461/matplotlib-3.9.4-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6bb0141a21aef3b64b633dc4d16cbd5fc538b727e4958be82a0e1c92a234160e", size = 8201838, upload-time = "2024-12-13T05:56:06.792Z" }, + { url = "https://files.pythonhosted.org/packages/5d/a7/bb01188fb4013d34d274caf44a2f8091255b0497438e8b6c0a7c1710c692/matplotlib-3.9.4-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:57aa235109e9eed52e2c2949db17da185383fa71083c00c6c143a60e07e0888c", size = 8314492, upload-time = "2024-12-13T05:56:09.964Z" }, + { url = "https://files.pythonhosted.org/packages/33/19/02e1a37f7141fc605b193e927d0a9cdf9dc124a20b9e68793f4ffea19695/matplotlib-3.9.4-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:b18c600061477ccfdd1e6fd050c33d8be82431700f3452b297a56d9ed7037abb", size = 9092500, upload-time = "2024-12-13T05:56:13.55Z" }, + { url = "https://files.pythonhosted.org/packages/57/68/c2feb4667adbf882ffa4b3e0ac9967f848980d9f8b5bebd86644aa67ce6a/matplotlib-3.9.4-cp39-cp39-win_amd64.whl", hash = "sha256:ef5f2d1b67d2d2145ff75e10f8c008bfbf71d45137c4b648c87193e7dd053eac", size = 7822962, upload-time = "2024-12-13T05:56:16.358Z" }, + { url = "https://files.pythonhosted.org/packages/0c/22/2ef6a364cd3f565442b0b055e0599744f1e4314ec7326cdaaa48a4d864d7/matplotlib-3.9.4-pp39-pypy39_pp73-macosx_10_15_x86_64.whl", hash = "sha256:44e0ed786d769d85bc787b0606a53f2d8d2d1d3c8a2608237365e9121c1a338c", size = 7877995, upload-time = "2024-12-13T05:56:18.805Z" }, + { url = "https://files.pythonhosted.org/packages/87/b8/2737456e566e9f4d94ae76b8aa0d953d9acb847714f9a7ad80184474f5be/matplotlib-3.9.4-pp39-pypy39_pp73-macosx_11_0_arm64.whl", hash = "sha256:09debb9ce941eb23ecdbe7eab972b1c3e0276dcf01688073faff7b0f61d6c6ca", size = 7769300, upload-time = "2024-12-13T05:56:21.315Z" }, + { url = "https://files.pythonhosted.org/packages/b2/1f/e709c6ec7b5321e6568769baa288c7178e60a93a9da9e682b39450da0e29/matplotlib-3.9.4-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:bcc53cf157a657bfd03afab14774d54ba73aa84d42cfe2480c91bd94873952db", size = 8313423, upload-time = "2024-12-13T05:56:26.719Z" }, + { url = "https://files.pythonhosted.org/packages/5e/b6/5a1f868782cd13f053a679984e222007ecff654a9bfbac6b27a65f4eeb05/matplotlib-3.9.4-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:ad45da51be7ad02387801fd154ef74d942f49fe3fcd26a64c94842ba7ec0d865", size = 7854624, upload-time = "2024-12-13T05:56:29.359Z" }, +] + +[[package]] +name = "matplotlib" +version = "3.10.8" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", + "python_full_version == '3.10.*'", +] +dependencies = [ + { name = "contourpy", version = "1.3.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.10.*'" }, + { name = "contourpy", version = "1.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "cycler", marker = "python_full_version >= '3.10'" }, + { name = "fonttools", version = "4.61.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "kiwisolver", version = "1.4.9", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.10.*'" }, + { name = "numpy", version = "2.3.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "packaging", marker = "python_full_version >= '3.10'" }, + { name = "pillow", version = "12.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pyparsing", marker = "python_full_version >= '3.10'" }, + { name = "python-dateutil", marker = "python_full_version >= '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/8a/76/d3c6e3a13fe484ebe7718d14e269c9569c4eb0020a968a327acb3b9a8fe6/matplotlib-3.10.8.tar.gz", hash = "sha256:2299372c19d56bcd35cf05a2738308758d32b9eaed2371898d8f5bd33f084aa3", size = 34806269, upload-time = "2025-12-10T22:56:51.155Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/58/be/a30bd917018ad220c400169fba298f2bb7003c8ccbc0c3e24ae2aacad1e8/matplotlib-3.10.8-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:00270d217d6b20d14b584c521f810d60c5c78406dc289859776550df837dcda7", size = 8239828, upload-time = "2025-12-10T22:55:02.313Z" }, + { url = "https://files.pythonhosted.org/packages/58/27/ca01e043c4841078e82cf6e80a6993dfecd315c3d79f5f3153afbb8e1ec6/matplotlib-3.10.8-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:37b3c1cc42aa184b3f738cfa18c1c1d72fd496d85467a6cf7b807936d39aa656", size = 8128050, upload-time = "2025-12-10T22:55:04.997Z" }, + { url = "https://files.pythonhosted.org/packages/cb/aa/7ab67f2b729ae6a91bcf9dcac0affb95fb8c56f7fd2b2af894ae0b0cf6fa/matplotlib-3.10.8-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:ee40c27c795bda6a5292e9cff9890189d32f7e3a0bf04e0e3c9430c4a00c37df", size = 8700452, upload-time = "2025-12-10T22:55:07.47Z" }, + { url = "https://files.pythonhosted.org/packages/73/ae/2d5817b0acee3c49b7e7ccfbf5b273f284957cc8e270adf36375db353190/matplotlib-3.10.8-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a48f2b74020919552ea25d222d5cc6af9ca3f4eb43a93e14d068457f545c2a17", size = 9534928, upload-time = "2025-12-10T22:55:10.566Z" }, + { url = "https://files.pythonhosted.org/packages/c9/5b/8e66653e9f7c39cb2e5cab25fce4810daffa2bff02cbf5f3077cea9e942c/matplotlib-3.10.8-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f254d118d14a7f99d616271d6c3c27922c092dac11112670b157798b89bf4933", size = 9586377, upload-time = "2025-12-10T22:55:12.362Z" }, + { url = "https://files.pythonhosted.org/packages/e2/e2/fd0bbadf837f81edb0d208ba8f8cb552874c3b16e27cb91a31977d90875d/matplotlib-3.10.8-cp310-cp310-win_amd64.whl", hash = "sha256:f9b587c9c7274c1613a30afabf65a272114cd6cdbe67b3406f818c79d7ab2e2a", size = 8128127, upload-time = "2025-12-10T22:55:14.436Z" }, + { url = "https://files.pythonhosted.org/packages/f8/86/de7e3a1cdcfc941483af70609edc06b83e7c8a0e0dc9ac325200a3f4d220/matplotlib-3.10.8-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:6be43b667360fef5c754dda5d25a32e6307a03c204f3c0fc5468b78fa87b4160", size = 8251215, upload-time = "2025-12-10T22:55:16.175Z" }, + { url = "https://files.pythonhosted.org/packages/fd/14/baad3222f424b19ce6ad243c71de1ad9ec6b2e4eb1e458a48fdc6d120401/matplotlib-3.10.8-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a2b336e2d91a3d7006864e0990c83b216fcdca64b5a6484912902cef87313d78", size = 8139625, upload-time = "2025-12-10T22:55:17.712Z" }, + { url = "https://files.pythonhosted.org/packages/8f/a0/7024215e95d456de5883e6732e708d8187d9753a21d32f8ddb3befc0c445/matplotlib-3.10.8-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:efb30e3baaea72ce5928e32bab719ab4770099079d66726a62b11b1ef7273be4", size = 8712614, upload-time = "2025-12-10T22:55:20.8Z" }, + { url = "https://files.pythonhosted.org/packages/5a/f4/b8347351da9a5b3f41e26cf547252d861f685c6867d179a7c9d60ad50189/matplotlib-3.10.8-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d56a1efd5bfd61486c8bc968fa18734464556f0fb8e51690f4ac25d85cbbbbc2", size = 9540997, upload-time = "2025-12-10T22:55:23.258Z" }, + { url = "https://files.pythonhosted.org/packages/9e/c0/c7b914e297efe0bc36917bf216b2acb91044b91e930e878ae12981e461e5/matplotlib-3.10.8-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:238b7ce5717600615c895050239ec955d91f321c209dd110db988500558e70d6", size = 9596825, upload-time = "2025-12-10T22:55:25.217Z" }, + { url = "https://files.pythonhosted.org/packages/6f/d3/a4bbc01c237ab710a1f22b4da72f4ff6d77eb4c7735ea9811a94ae239067/matplotlib-3.10.8-cp311-cp311-win_amd64.whl", hash = "sha256:18821ace09c763ec93aef5eeff087ee493a24051936d7b9ebcad9662f66501f9", size = 8135090, upload-time = "2025-12-10T22:55:27.162Z" }, + { url = "https://files.pythonhosted.org/packages/89/dd/a0b6588f102beab33ca6f5218b31725216577b2a24172f327eaf6417d5c9/matplotlib-3.10.8-cp311-cp311-win_arm64.whl", hash = "sha256:bab485bcf8b1c7d2060b4fcb6fc368a9e6f4cd754c9c2fea281f4be21df394a2", size = 8012377, upload-time = "2025-12-10T22:55:29.185Z" }, + { url = "https://files.pythonhosted.org/packages/9e/67/f997cdcbb514012eb0d10cd2b4b332667997fb5ebe26b8d41d04962fa0e6/matplotlib-3.10.8-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:64fcc24778ca0404ce0cb7b6b77ae1f4c7231cdd60e6778f999ee05cbd581b9a", size = 8260453, upload-time = "2025-12-10T22:55:30.709Z" }, + { url = "https://files.pythonhosted.org/packages/7e/65/07d5f5c7f7c994f12c768708bd2e17a4f01a2b0f44a1c9eccad872433e2e/matplotlib-3.10.8-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:b9a5ca4ac220a0cdd1ba6bcba3608547117d30468fefce49bb26f55c1a3d5c58", size = 8148321, upload-time = "2025-12-10T22:55:33.265Z" }, + { url = "https://files.pythonhosted.org/packages/3e/f3/c5195b1ae57ef85339fd7285dfb603b22c8b4e79114bae5f4f0fcf688677/matplotlib-3.10.8-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3ab4aabc72de4ff77b3ec33a6d78a68227bf1123465887f9905ba79184a1cc04", size = 8716944, upload-time = "2025-12-10T22:55:34.922Z" }, + { url = "https://files.pythonhosted.org/packages/00/f9/7638f5cc82ec8a7aa005de48622eecc3ed7c9854b96ba15bd76b7fd27574/matplotlib-3.10.8-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:24d50994d8c5816ddc35411e50a86ab05f575e2530c02752e02538122613371f", size = 9550099, upload-time = "2025-12-10T22:55:36.789Z" }, + { url = "https://files.pythonhosted.org/packages/57/61/78cd5920d35b29fd2a0fe894de8adf672ff52939d2e9b43cb83cd5ce1bc7/matplotlib-3.10.8-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:99eefd13c0dc3b3c1b4d561c1169e65fe47aab7b8158754d7c084088e2329466", size = 9613040, upload-time = "2025-12-10T22:55:38.715Z" }, + { url = "https://files.pythonhosted.org/packages/30/4e/c10f171b6e2f44d9e3a2b96efa38b1677439d79c99357600a62cc1e9594e/matplotlib-3.10.8-cp312-cp312-win_amd64.whl", hash = "sha256:dd80ecb295460a5d9d260df63c43f4afbdd832d725a531f008dad1664f458adf", size = 8142717, upload-time = "2025-12-10T22:55:41.103Z" }, + { url = "https://files.pythonhosted.org/packages/f1/76/934db220026b5fef85f45d51a738b91dea7d70207581063cd9bd8fafcf74/matplotlib-3.10.8-cp312-cp312-win_arm64.whl", hash = "sha256:3c624e43ed56313651bc18a47f838b60d7b8032ed348911c54906b130b20071b", size = 8012751, upload-time = "2025-12-10T22:55:42.684Z" }, + { url = "https://files.pythonhosted.org/packages/3d/b9/15fd5541ef4f5b9a17eefd379356cf12175fe577424e7b1d80676516031a/matplotlib-3.10.8-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:3f2e409836d7f5ac2f1c013110a4d50b9f7edc26328c108915f9075d7d7a91b6", size = 8261076, upload-time = "2025-12-10T22:55:44.648Z" }, + { url = "https://files.pythonhosted.org/packages/8d/a0/2ba3473c1b66b9c74dc7107c67e9008cb1782edbe896d4c899d39ae9cf78/matplotlib-3.10.8-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:56271f3dac49a88d7fca5060f004d9d22b865f743a12a23b1e937a0be4818ee1", size = 8148794, upload-time = "2025-12-10T22:55:46.252Z" }, + { url = "https://files.pythonhosted.org/packages/75/97/a471f1c3eb1fd6f6c24a31a5858f443891d5127e63a7788678d14e249aea/matplotlib-3.10.8-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a0a7f52498f72f13d4a25ea70f35f4cb60642b466cbb0a9be951b5bc3f45a486", size = 8718474, upload-time = "2025-12-10T22:55:47.864Z" }, + { url = "https://files.pythonhosted.org/packages/01/be/cd478f4b66f48256f42927d0acbcd63a26a893136456cd079c0cc24fbabf/matplotlib-3.10.8-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:646d95230efb9ca614a7a594d4fcacde0ac61d25e37dd51710b36477594963ce", size = 9549637, upload-time = "2025-12-10T22:55:50.048Z" }, + { url = "https://files.pythonhosted.org/packages/5d/7c/8dc289776eae5109e268c4fb92baf870678dc048a25d4ac903683b86d5bf/matplotlib-3.10.8-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f89c151aab2e2e23cb3fe0acad1e8b82841fd265379c4cecd0f3fcb34c15e0f6", size = 9613678, upload-time = "2025-12-10T22:55:52.21Z" }, + { url = "https://files.pythonhosted.org/packages/64/40/37612487cc8a437d4dd261b32ca21fe2d79510fe74af74e1f42becb1bdb8/matplotlib-3.10.8-cp313-cp313-win_amd64.whl", hash = "sha256:e8ea3e2d4066083e264e75c829078f9e149fa119d27e19acd503de65e0b13149", size = 8142686, upload-time = "2025-12-10T22:55:54.253Z" }, + { url = "https://files.pythonhosted.org/packages/66/52/8d8a8730e968185514680c2a6625943f70269509c3dcfc0dcf7d75928cb8/matplotlib-3.10.8-cp313-cp313-win_arm64.whl", hash = "sha256:c108a1d6fa78a50646029cb6d49808ff0fc1330fda87fa6f6250c6b5369b6645", size = 8012917, upload-time = "2025-12-10T22:55:56.268Z" }, + { url = "https://files.pythonhosted.org/packages/b5/27/51fe26e1062f298af5ef66343d8ef460e090a27fea73036c76c35821df04/matplotlib-3.10.8-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:ad3d9833a64cf48cc4300f2b406c3d0f4f4724a91c0bd5640678a6ba7c102077", size = 8305679, upload-time = "2025-12-10T22:55:57.856Z" }, + { url = "https://files.pythonhosted.org/packages/2c/1e/4de865bc591ac8e3062e835f42dd7fe7a93168d519557837f0e37513f629/matplotlib-3.10.8-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:eb3823f11823deade26ce3b9f40dcb4a213da7a670013929f31d5f5ed1055b22", size = 8198336, upload-time = "2025-12-10T22:55:59.371Z" }, + { url = "https://files.pythonhosted.org/packages/c6/cb/2f7b6e75fb4dce87ef91f60cac4f6e34f4c145ab036a22318ec837971300/matplotlib-3.10.8-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d9050fee89a89ed57b4fb2c1bfac9a3d0c57a0d55aed95949eedbc42070fea39", size = 8731653, upload-time = "2025-12-10T22:56:01.032Z" }, + { url = "https://files.pythonhosted.org/packages/46/b3/bd9c57d6ba670a37ab31fb87ec3e8691b947134b201f881665b28cc039ff/matplotlib-3.10.8-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b44d07310e404ba95f8c25aa5536f154c0a8ec473303535949e52eb71d0a1565", size = 9561356, upload-time = "2025-12-10T22:56:02.95Z" }, + { url = "https://files.pythonhosted.org/packages/c0/3d/8b94a481456dfc9dfe6e39e93b5ab376e50998cddfd23f4ae3b431708f16/matplotlib-3.10.8-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:0a33deb84c15ede243aead39f77e990469fff93ad1521163305095b77b72ce4a", size = 9614000, upload-time = "2025-12-10T22:56:05.411Z" }, + { url = "https://files.pythonhosted.org/packages/bd/cd/bc06149fe5585ba800b189a6a654a75f1f127e8aab02fd2be10df7fa500c/matplotlib-3.10.8-cp313-cp313t-win_amd64.whl", hash = "sha256:3a48a78d2786784cc2413e57397981fb45c79e968d99656706018d6e62e57958", size = 8220043, upload-time = "2025-12-10T22:56:07.551Z" }, + { url = "https://files.pythonhosted.org/packages/e3/de/b22cf255abec916562cc04eef457c13e58a1990048de0c0c3604d082355e/matplotlib-3.10.8-cp313-cp313t-win_arm64.whl", hash = "sha256:15d30132718972c2c074cd14638c7f4592bd98719e2308bccea40e0538bc0cb5", size = 8062075, upload-time = "2025-12-10T22:56:09.178Z" }, + { url = "https://files.pythonhosted.org/packages/3c/43/9c0ff7a2f11615e516c3b058e1e6e8f9614ddeca53faca06da267c48345d/matplotlib-3.10.8-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:b53285e65d4fa4c86399979e956235deb900be5baa7fc1218ea67fbfaeaadd6f", size = 8262481, upload-time = "2025-12-10T22:56:10.885Z" }, + { url = "https://files.pythonhosted.org/packages/6f/ca/e8ae28649fcdf039fda5ef554b40a95f50592a3c47e6f7270c9561c12b07/matplotlib-3.10.8-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:32f8dce744be5569bebe789e46727946041199030db8aeb2954d26013a0eb26b", size = 8151473, upload-time = "2025-12-10T22:56:12.377Z" }, + { url = "https://files.pythonhosted.org/packages/f1/6f/009d129ae70b75e88cbe7e503a12a4c0670e08ed748a902c2568909e9eb5/matplotlib-3.10.8-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4cf267add95b1c88300d96ca837833d4112756045364f5c734a2276038dae27d", size = 9553896, upload-time = "2025-12-10T22:56:14.432Z" }, + { url = "https://files.pythonhosted.org/packages/f5/26/4221a741eb97967bc1fd5e4c52b9aa5a91b2f4ec05b59f6def4d820f9df9/matplotlib-3.10.8-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2cf5bd12cecf46908f286d7838b2abc6c91cda506c0445b8223a7c19a00df008", size = 9824193, upload-time = "2025-12-10T22:56:16.29Z" }, + { url = "https://files.pythonhosted.org/packages/1f/f3/3abf75f38605772cf48a9daf5821cd4f563472f38b4b828c6fba6fa6d06e/matplotlib-3.10.8-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:41703cc95688f2516b480f7f339d8851a6035f18e100ee6a32bc0b8536a12a9c", size = 9615444, upload-time = "2025-12-10T22:56:18.155Z" }, + { url = "https://files.pythonhosted.org/packages/93/a5/de89ac80f10b8dc615807ee1133cd99ac74082581196d4d9590bea10690d/matplotlib-3.10.8-cp314-cp314-win_amd64.whl", hash = "sha256:83d282364ea9f3e52363da262ce32a09dfe241e4080dcedda3c0db059d3c1f11", size = 8272719, upload-time = "2025-12-10T22:56:20.366Z" }, + { url = "https://files.pythonhosted.org/packages/69/ce/b006495c19ccc0a137b48083168a37bd056392dee02f87dba0472f2797fe/matplotlib-3.10.8-cp314-cp314-win_arm64.whl", hash = "sha256:2c1998e92cd5999e295a731bcb2911c75f597d937341f3030cc24ef2733d78a8", size = 8144205, upload-time = "2025-12-10T22:56:22.239Z" }, + { url = "https://files.pythonhosted.org/packages/68/d9/b31116a3a855bd313c6fcdb7226926d59b041f26061c6c5b1be66a08c826/matplotlib-3.10.8-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:b5a2b97dbdc7d4f353ebf343744f1d1f1cca8aa8bfddb4262fcf4306c3761d50", size = 8305785, upload-time = "2025-12-10T22:56:24.218Z" }, + { url = "https://files.pythonhosted.org/packages/1e/90/6effe8103f0272685767ba5f094f453784057072f49b393e3ea178fe70a5/matplotlib-3.10.8-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:3f5c3e4da343bba819f0234186b9004faba952cc420fbc522dc4e103c1985908", size = 8198361, upload-time = "2025-12-10T22:56:26.787Z" }, + { url = "https://files.pythonhosted.org/packages/d7/65/a73188711bea603615fc0baecca1061429ac16940e2385433cc778a9d8e7/matplotlib-3.10.8-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f62550b9a30afde8c1c3ae450e5eb547d579dd69b25c2fc7a1c67f934c1717a", size = 9561357, upload-time = "2025-12-10T22:56:28.953Z" }, + { url = "https://files.pythonhosted.org/packages/f4/3d/b5c5d5d5be8ce63292567f0e2c43dde9953d3ed86ac2de0a72e93c8f07a1/matplotlib-3.10.8-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:495672de149445ec1b772ff2c9ede9b769e3cb4f0d0aa7fa730d7f59e2d4e1c1", size = 9823610, upload-time = "2025-12-10T22:56:31.455Z" }, + { url = "https://files.pythonhosted.org/packages/4d/4b/e7beb6bbd49f6bae727a12b270a2654d13c397576d25bd6786e47033300f/matplotlib-3.10.8-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:595ba4d8fe983b88f0eec8c26a241e16d6376fe1979086232f481f8f3f67494c", size = 9614011, upload-time = "2025-12-10T22:56:33.85Z" }, + { url = "https://files.pythonhosted.org/packages/7c/e6/76f2813d31f032e65f6f797e3f2f6e4aab95b65015924b1c51370395c28a/matplotlib-3.10.8-cp314-cp314t-win_amd64.whl", hash = "sha256:25d380fe8b1dc32cf8f0b1b448470a77afb195438bafdf1d858bfb876f3edf7b", size = 8362801, upload-time = "2025-12-10T22:56:36.107Z" }, + { url = "https://files.pythonhosted.org/packages/5d/49/d651878698a0b67f23aa28e17f45a6d6dd3d3f933fa29087fa4ce5947b5a/matplotlib-3.10.8-cp314-cp314t-win_arm64.whl", hash = "sha256:113bb52413ea508ce954a02c10ffd0d565f9c3bc7f2eddc27dfe1731e71c7b5f", size = 8192560, upload-time = "2025-12-10T22:56:38.008Z" }, + { url = "https://files.pythonhosted.org/packages/f5/43/31d59500bb950b0d188e149a2e552040528c13d6e3d6e84d0cccac593dcd/matplotlib-3.10.8-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:f97aeb209c3d2511443f8797e3e5a569aebb040d4f8bc79aa3ee78a8fb9e3dd8", size = 8237252, upload-time = "2025-12-10T22:56:39.529Z" }, + { url = "https://files.pythonhosted.org/packages/0c/2c/615c09984f3c5f907f51c886538ad785cf72e0e11a3225de2c0f9442aecc/matplotlib-3.10.8-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:fb061f596dad3a0f52b60dc6a5dec4a0c300dec41e058a7efe09256188d170b7", size = 8124693, upload-time = "2025-12-10T22:56:41.758Z" }, + { url = "https://files.pythonhosted.org/packages/91/e1/2757277a1c56041e1fc104b51a0f7b9a4afc8eb737865d63cababe30bc61/matplotlib-3.10.8-pp310-pypy310_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:12d90df9183093fcd479f4172ac26b322b1248b15729cb57f42f71f24c7e37a3", size = 8702205, upload-time = "2025-12-10T22:56:43.415Z" }, + { url = "https://files.pythonhosted.org/packages/04/30/3afaa31c757f34b7725ab9d2ba8b48b5e89c2019c003e7d0ead143aabc5a/matplotlib-3.10.8-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:6da7c2ce169267d0d066adcf63758f0604aa6c3eebf67458930f9d9b79ad1db1", size = 8249198, upload-time = "2025-12-10T22:56:45.584Z" }, + { url = "https://files.pythonhosted.org/packages/48/2f/6334aec331f57485a642a7c8be03cb286f29111ae71c46c38b363230063c/matplotlib-3.10.8-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:9153c3292705be9f9c64498a8872118540c3f4123d1a1c840172edf262c8be4a", size = 8136817, upload-time = "2025-12-10T22:56:47.339Z" }, + { url = "https://files.pythonhosted.org/packages/73/e4/6d6f14b2a759c622f191b2d67e9075a3f56aaccb3be4bb9bb6890030d0a0/matplotlib-3.10.8-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:1ae029229a57cd1e8fe542485f27e7ca7b23aa9e8944ddb4985d0bc444f1eca2", size = 8713867, upload-time = "2025-12-10T22:56:48.954Z" }, +] + [[package]] name = "matplotlib-inline" version = "0.2.1" @@ -1467,6 +2608,162 @@ dill = [ { name = "multiprocess" }, ] +[[package]] +name = "multidict" +version = "6.7.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", marker = "python_full_version < '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/80/1e/5492c365f222f907de1039b91f922b93fa4f764c713ee858d235495d8f50/multidict-6.7.0.tar.gz", hash = "sha256:c6e99d9a65ca282e578dfea819cfa9c0a62b2499d8677392e09feaf305e9e6f5", size = 101834, upload-time = "2025-10-06T14:52:30.657Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a9/63/7bdd4adc330abcca54c85728db2327130e49e52e8c3ce685cec44e0f2e9f/multidict-6.7.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:9f474ad5acda359c8758c8accc22032c6abe6dc87a8be2440d097785e27a9349", size = 77153, upload-time = "2025-10-06T14:48:26.409Z" }, + { url = "https://files.pythonhosted.org/packages/3f/bb/b6c35ff175ed1a3142222b78455ee31be71a8396ed3ab5280fbe3ebe4e85/multidict-6.7.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:4b7a9db5a870f780220e931d0002bbfd88fb53aceb6293251e2c839415c1b20e", size = 44993, upload-time = "2025-10-06T14:48:28.4Z" }, + { url = "https://files.pythonhosted.org/packages/e0/1f/064c77877c5fa6df6d346e68075c0f6998547afe952d6471b4c5f6a7345d/multidict-6.7.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:03ca744319864e92721195fa28c7a3b2bc7b686246b35e4078c1e4d0eb5466d3", size = 44607, upload-time = "2025-10-06T14:48:29.581Z" }, + { url = "https://files.pythonhosted.org/packages/04/7a/bf6aa92065dd47f287690000b3d7d332edfccb2277634cadf6a810463c6a/multidict-6.7.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f0e77e3c0008bc9316e662624535b88d360c3a5d3f81e15cf12c139a75250046", size = 241847, upload-time = "2025-10-06T14:48:32.107Z" }, + { url = "https://files.pythonhosted.org/packages/94/39/297a8de920f76eda343e4ce05f3b489f0ab3f9504f2576dfb37b7c08ca08/multidict-6.7.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:08325c9e5367aa379a3496aa9a022fe8837ff22e00b94db256d3a1378c76ab32", size = 242616, upload-time = "2025-10-06T14:48:34.054Z" }, + { url = "https://files.pythonhosted.org/packages/39/3a/d0eee2898cfd9d654aea6cb8c4addc2f9756e9a7e09391cfe55541f917f7/multidict-6.7.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e2862408c99f84aa571ab462d25236ef9cb12a602ea959ba9c9009a54902fc73", size = 222333, upload-time = "2025-10-06T14:48:35.9Z" }, + { url = "https://files.pythonhosted.org/packages/05/48/3b328851193c7a4240815b71eea165b49248867bbb6153a0aee227a0bb47/multidict-6.7.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:4d72a9a2d885f5c208b0cb91ff2ed43636bb7e345ec839ff64708e04f69a13cc", size = 253239, upload-time = "2025-10-06T14:48:37.302Z" }, + { url = "https://files.pythonhosted.org/packages/b1/ca/0706a98c8d126a89245413225ca4a3fefc8435014de309cf8b30acb68841/multidict-6.7.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:478cc36476687bac1514d651cbbaa94b86b0732fb6855c60c673794c7dd2da62", size = 251618, upload-time = "2025-10-06T14:48:38.963Z" }, + { url = "https://files.pythonhosted.org/packages/5e/4f/9c7992f245554d8b173f6f0a048ad24b3e645d883f096857ec2c0822b8bd/multidict-6.7.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:6843b28b0364dc605f21481c90fadb5f60d9123b442eb8a726bb74feef588a84", size = 241655, upload-time = "2025-10-06T14:48:40.312Z" }, + { url = "https://files.pythonhosted.org/packages/31/79/26a85991ae67efd1c0b1fc2e0c275b8a6aceeb155a68861f63f87a798f16/multidict-6.7.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:23bfeee5316266e5ee2d625df2d2c602b829435fc3a235c2ba2131495706e4a0", size = 239245, upload-time = "2025-10-06T14:48:41.848Z" }, + { url = "https://files.pythonhosted.org/packages/14/1e/75fa96394478930b79d0302eaf9a6c69f34005a1a5251ac8b9c336486ec9/multidict-6.7.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:680878b9f3d45c31e1f730eef731f9b0bc1da456155688c6745ee84eb818e90e", size = 233523, upload-time = "2025-10-06T14:48:43.749Z" }, + { url = "https://files.pythonhosted.org/packages/b2/5e/085544cb9f9c4ad2b5d97467c15f856df8d9bac410cffd5c43991a5d878b/multidict-6.7.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:eb866162ef2f45063acc7a53a88ef6fe8bf121d45c30ea3c9cd87ce7e191a8d4", size = 243129, upload-time = "2025-10-06T14:48:45.225Z" }, + { url = "https://files.pythonhosted.org/packages/b9/c3/e9d9e2f20c9474e7a8fcef28f863c5cbd29bb5adce6b70cebe8bdad0039d/multidict-6.7.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:df0e3bf7993bdbeca5ac25aa859cf40d39019e015c9c91809ba7093967f7a648", size = 248999, upload-time = "2025-10-06T14:48:46.703Z" }, + { url = "https://files.pythonhosted.org/packages/b5/3f/df171b6efa3239ae33b97b887e42671cd1d94d460614bfb2c30ffdab3b95/multidict-6.7.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:661709cdcd919a2ece2234f9bae7174e5220c80b034585d7d8a755632d3e2111", size = 243711, upload-time = "2025-10-06T14:48:48.146Z" }, + { url = "https://files.pythonhosted.org/packages/3c/2f/9b5564888c4e14b9af64c54acf149263721a283aaf4aa0ae89b091d5d8c1/multidict-6.7.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:096f52730c3fb8ed419db2d44391932b63891b2c5ed14850a7e215c0ba9ade36", size = 237504, upload-time = "2025-10-06T14:48:49.447Z" }, + { url = "https://files.pythonhosted.org/packages/6c/3a/0bd6ca0f7d96d790542d591c8c3354c1e1b6bfd2024d4d92dc3d87485ec7/multidict-6.7.0-cp310-cp310-win32.whl", hash = "sha256:afa8a2978ec65d2336305550535c9c4ff50ee527914328c8677b3973ade52b85", size = 41422, upload-time = "2025-10-06T14:48:50.789Z" }, + { url = "https://files.pythonhosted.org/packages/00/35/f6a637ea2c75f0d3b7c7d41b1189189acff0d9deeb8b8f35536bb30f5e33/multidict-6.7.0-cp310-cp310-win_amd64.whl", hash = "sha256:b15b3afff74f707b9275d5ba6a91ae8f6429c3ffb29bbfd216b0b375a56f13d7", size = 46050, upload-time = "2025-10-06T14:48:51.938Z" }, + { url = "https://files.pythonhosted.org/packages/e7/b8/f7bf8329b39893d02d9d95cf610c75885d12fc0f402b1c894e1c8e01c916/multidict-6.7.0-cp310-cp310-win_arm64.whl", hash = "sha256:4b73189894398d59131a66ff157837b1fafea9974be486d036bb3d32331fdbf0", size = 43153, upload-time = "2025-10-06T14:48:53.146Z" }, + { url = "https://files.pythonhosted.org/packages/34/9e/5c727587644d67b2ed479041e4b1c58e30afc011e3d45d25bbe35781217c/multidict-6.7.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:4d409aa42a94c0b3fa617708ef5276dfe81012ba6753a0370fcc9d0195d0a1fc", size = 76604, upload-time = "2025-10-06T14:48:54.277Z" }, + { url = "https://files.pythonhosted.org/packages/17/e4/67b5c27bd17c085a5ea8f1ec05b8a3e5cba0ca734bfcad5560fb129e70ca/multidict-6.7.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:14c9e076eede3b54c636f8ce1c9c252b5f057c62131211f0ceeec273810c9721", size = 44715, upload-time = "2025-10-06T14:48:55.445Z" }, + { url = "https://files.pythonhosted.org/packages/4d/e1/866a5d77be6ea435711bef2a4291eed11032679b6b28b56b4776ab06ba3e/multidict-6.7.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4c09703000a9d0fa3c3404b27041e574cc7f4df4c6563873246d0e11812a94b6", size = 44332, upload-time = "2025-10-06T14:48:56.706Z" }, + { url = "https://files.pythonhosted.org/packages/31/61/0c2d50241ada71ff61a79518db85ada85fdabfcf395d5968dae1cbda04e5/multidict-6.7.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:a265acbb7bb33a3a2d626afbe756371dce0279e7b17f4f4eda406459c2b5ff1c", size = 245212, upload-time = "2025-10-06T14:48:58.042Z" }, + { url = "https://files.pythonhosted.org/packages/ac/e0/919666a4e4b57fff1b57f279be1c9316e6cdc5de8a8b525d76f6598fefc7/multidict-6.7.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:51cb455de290ae462593e5b1cb1118c5c22ea7f0d3620d9940bf695cea5a4bd7", size = 246671, upload-time = "2025-10-06T14:49:00.004Z" }, + { url = "https://files.pythonhosted.org/packages/a1/cc/d027d9c5a520f3321b65adea289b965e7bcbd2c34402663f482648c716ce/multidict-6.7.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:db99677b4457c7a5c5a949353e125ba72d62b35f74e26da141530fbb012218a7", size = 225491, upload-time = "2025-10-06T14:49:01.393Z" }, + { url = "https://files.pythonhosted.org/packages/75/c4/bbd633980ce6155a28ff04e6a6492dd3335858394d7bb752d8b108708558/multidict-6.7.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f470f68adc395e0183b92a2f4689264d1ea4b40504a24d9882c27375e6662bb9", size = 257322, upload-time = "2025-10-06T14:49:02.745Z" }, + { url = "https://files.pythonhosted.org/packages/4c/6d/d622322d344f1f053eae47e033b0b3f965af01212de21b10bcf91be991fb/multidict-6.7.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0db4956f82723cc1c270de9c6e799b4c341d327762ec78ef82bb962f79cc07d8", size = 254694, upload-time = "2025-10-06T14:49:04.15Z" }, + { url = "https://files.pythonhosted.org/packages/a8/9f/78f8761c2705d4c6d7516faed63c0ebdac569f6db1bef95e0d5218fdc146/multidict-6.7.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3e56d780c238f9e1ae66a22d2adf8d16f485381878250db8d496623cd38b22bd", size = 246715, upload-time = "2025-10-06T14:49:05.967Z" }, + { url = "https://files.pythonhosted.org/packages/78/59/950818e04f91b9c2b95aab3d923d9eabd01689d0dcd889563988e9ea0fd8/multidict-6.7.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9d14baca2ee12c1a64740d4531356ba50b82543017f3ad6de0deb943c5979abb", size = 243189, upload-time = "2025-10-06T14:49:07.37Z" }, + { url = "https://files.pythonhosted.org/packages/7a/3d/77c79e1934cad2ee74991840f8a0110966d9599b3af95964c0cd79bb905b/multidict-6.7.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:295a92a76188917c7f99cda95858c822f9e4aae5824246bba9b6b44004ddd0a6", size = 237845, upload-time = "2025-10-06T14:49:08.759Z" }, + { url = "https://files.pythonhosted.org/packages/63/1b/834ce32a0a97a3b70f86437f685f880136677ac00d8bce0027e9fd9c2db7/multidict-6.7.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:39f1719f57adbb767ef592a50ae5ebb794220d1188f9ca93de471336401c34d2", size = 246374, upload-time = "2025-10-06T14:49:10.574Z" }, + { url = "https://files.pythonhosted.org/packages/23/ef/43d1c3ba205b5dec93dc97f3fba179dfa47910fc73aaaea4f7ceb41cec2a/multidict-6.7.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:0a13fb8e748dfc94749f622de065dd5c1def7e0d2216dba72b1d8069a389c6ff", size = 253345, upload-time = "2025-10-06T14:49:12.331Z" }, + { url = "https://files.pythonhosted.org/packages/6b/03/eaf95bcc2d19ead522001f6a650ef32811aa9e3624ff0ad37c445c7a588c/multidict-6.7.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:e3aa16de190d29a0ea1b48253c57d99a68492c8dd8948638073ab9e74dc9410b", size = 246940, upload-time = "2025-10-06T14:49:13.821Z" }, + { url = "https://files.pythonhosted.org/packages/e8/df/ec8a5fd66ea6cd6f525b1fcbb23511b033c3e9bc42b81384834ffa484a62/multidict-6.7.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:a048ce45dcdaaf1defb76b2e684f997fb5abf74437b6cb7b22ddad934a964e34", size = 242229, upload-time = "2025-10-06T14:49:15.603Z" }, + { url = "https://files.pythonhosted.org/packages/8a/a2/59b405d59fd39ec86d1142630e9049243015a5f5291ba49cadf3c090c541/multidict-6.7.0-cp311-cp311-win32.whl", hash = "sha256:a90af66facec4cebe4181b9e62a68be65e45ac9b52b67de9eec118701856e7ff", size = 41308, upload-time = "2025-10-06T14:49:16.871Z" }, + { url = "https://files.pythonhosted.org/packages/32/0f/13228f26f8b882c34da36efa776c3b7348455ec383bab4a66390e42963ae/multidict-6.7.0-cp311-cp311-win_amd64.whl", hash = "sha256:95b5ffa4349df2887518bb839409bcf22caa72d82beec453216802f475b23c81", size = 46037, upload-time = "2025-10-06T14:49:18.457Z" }, + { url = "https://files.pythonhosted.org/packages/84/1f/68588e31b000535a3207fd3c909ebeec4fb36b52c442107499c18a896a2a/multidict-6.7.0-cp311-cp311-win_arm64.whl", hash = "sha256:329aa225b085b6f004a4955271a7ba9f1087e39dcb7e65f6284a988264a63912", size = 43023, upload-time = "2025-10-06T14:49:19.648Z" }, + { url = "https://files.pythonhosted.org/packages/c2/9e/9f61ac18d9c8b475889f32ccfa91c9f59363480613fc807b6e3023d6f60b/multidict-6.7.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:8a3862568a36d26e650a19bb5cbbba14b71789032aebc0423f8cc5f150730184", size = 76877, upload-time = "2025-10-06T14:49:20.884Z" }, + { url = "https://files.pythonhosted.org/packages/38/6f/614f09a04e6184f8824268fce4bc925e9849edfa654ddd59f0b64508c595/multidict-6.7.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:960c60b5849b9b4f9dcc9bea6e3626143c252c74113df2c1540aebce70209b45", size = 45467, upload-time = "2025-10-06T14:49:22.054Z" }, + { url = "https://files.pythonhosted.org/packages/b3/93/c4f67a436dd026f2e780c433277fff72be79152894d9fc36f44569cab1a6/multidict-6.7.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:2049be98fb57a31b4ccf870bf377af2504d4ae35646a19037ec271e4c07998aa", size = 43834, upload-time = "2025-10-06T14:49:23.566Z" }, + { url = "https://files.pythonhosted.org/packages/7f/f5/013798161ca665e4a422afbc5e2d9e4070142a9ff8905e482139cd09e4d0/multidict-6.7.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:0934f3843a1860dd465d38895c17fce1f1cb37295149ab05cd1b9a03afacb2a7", size = 250545, upload-time = "2025-10-06T14:49:24.882Z" }, + { url = "https://files.pythonhosted.org/packages/71/2f/91dbac13e0ba94669ea5119ba267c9a832f0cb65419aca75549fcf09a3dc/multidict-6.7.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b3e34f3a1b8131ba06f1a73adab24f30934d148afcd5f5de9a73565a4404384e", size = 258305, upload-time = "2025-10-06T14:49:26.778Z" }, + { url = "https://files.pythonhosted.org/packages/ef/b0/754038b26f6e04488b48ac621f779c341338d78503fb45403755af2df477/multidict-6.7.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:efbb54e98446892590dc2458c19c10344ee9a883a79b5cec4bc34d6656e8d546", size = 242363, upload-time = "2025-10-06T14:49:28.562Z" }, + { url = "https://files.pythonhosted.org/packages/87/15/9da40b9336a7c9fa606c4cf2ed80a649dffeb42b905d4f63a1d7eb17d746/multidict-6.7.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a35c5fc61d4f51eb045061e7967cfe3123d622cd500e8868e7c0c592a09fedc4", size = 268375, upload-time = "2025-10-06T14:49:29.96Z" }, + { url = "https://files.pythonhosted.org/packages/82/72/c53fcade0cc94dfaad583105fd92b3a783af2091eddcb41a6d5a52474000/multidict-6.7.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29fe6740ebccba4175af1b9b87bf553e9c15cd5868ee967e010efcf94e4fd0f1", size = 269346, upload-time = "2025-10-06T14:49:31.404Z" }, + { url = "https://files.pythonhosted.org/packages/0d/e2/9baffdae21a76f77ef8447f1a05a96ec4bc0a24dae08767abc0a2fe680b8/multidict-6.7.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:123e2a72e20537add2f33a79e605f6191fba2afda4cbb876e35c1a7074298a7d", size = 256107, upload-time = "2025-10-06T14:49:32.974Z" }, + { url = "https://files.pythonhosted.org/packages/3c/06/3f06f611087dc60d65ef775f1fb5aca7c6d61c6db4990e7cda0cef9b1651/multidict-6.7.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:b284e319754366c1aee2267a2036248b24eeb17ecd5dc16022095e747f2f4304", size = 253592, upload-time = "2025-10-06T14:49:34.52Z" }, + { url = "https://files.pythonhosted.org/packages/20/24/54e804ec7945b6023b340c412ce9c3f81e91b3bf5fa5ce65558740141bee/multidict-6.7.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:803d685de7be4303b5a657b76e2f6d1240e7e0a8aa2968ad5811fa2285553a12", size = 251024, upload-time = "2025-10-06T14:49:35.956Z" }, + { url = "https://files.pythonhosted.org/packages/14/48/011cba467ea0b17ceb938315d219391d3e421dfd35928e5dbdc3f4ae76ef/multidict-6.7.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:c04a328260dfd5db8c39538f999f02779012268f54614902d0afc775d44e0a62", size = 251484, upload-time = "2025-10-06T14:49:37.631Z" }, + { url = "https://files.pythonhosted.org/packages/0d/2f/919258b43bb35b99fa127435cfb2d91798eb3a943396631ef43e3720dcf4/multidict-6.7.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:8a19cdb57cd3df4cd865849d93ee14920fb97224300c88501f16ecfa2604b4e0", size = 263579, upload-time = "2025-10-06T14:49:39.502Z" }, + { url = "https://files.pythonhosted.org/packages/31/22/a0e884d86b5242b5a74cf08e876bdf299e413016b66e55511f7a804a366e/multidict-6.7.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:9b2fd74c52accced7e75de26023b7dccee62511a600e62311b918ec5c168fc2a", size = 259654, upload-time = "2025-10-06T14:49:41.32Z" }, + { url = "https://files.pythonhosted.org/packages/b2/e5/17e10e1b5c5f5a40f2fcbb45953c9b215f8a4098003915e46a93f5fcaa8f/multidict-6.7.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:3e8bfdd0e487acf992407a140d2589fe598238eaeffa3da8448d63a63cd363f8", size = 251511, upload-time = "2025-10-06T14:49:46.021Z" }, + { url = "https://files.pythonhosted.org/packages/e3/9a/201bb1e17e7af53139597069c375e7b0dcbd47594604f65c2d5359508566/multidict-6.7.0-cp312-cp312-win32.whl", hash = "sha256:dd32a49400a2c3d52088e120ee00c1e3576cbff7e10b98467962c74fdb762ed4", size = 41895, upload-time = "2025-10-06T14:49:48.718Z" }, + { url = "https://files.pythonhosted.org/packages/46/e2/348cd32faad84eaf1d20cce80e2bb0ef8d312c55bca1f7fa9865e7770aaf/multidict-6.7.0-cp312-cp312-win_amd64.whl", hash = "sha256:92abb658ef2d7ef22ac9f8bb88e8b6c3e571671534e029359b6d9e845923eb1b", size = 46073, upload-time = "2025-10-06T14:49:50.28Z" }, + { url = "https://files.pythonhosted.org/packages/25/ec/aad2613c1910dce907480e0c3aa306905830f25df2e54ccc9dea450cb5aa/multidict-6.7.0-cp312-cp312-win_arm64.whl", hash = "sha256:490dab541a6a642ce1a9d61a4781656b346a55c13038f0b1244653828e3a83ec", size = 43226, upload-time = "2025-10-06T14:49:52.304Z" }, + { url = "https://files.pythonhosted.org/packages/d2/86/33272a544eeb36d66e4d9a920602d1a2f57d4ebea4ef3cdfe5a912574c95/multidict-6.7.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:bee7c0588aa0076ce77c0ea5d19a68d76ad81fcd9fe8501003b9a24f9d4000f6", size = 76135, upload-time = "2025-10-06T14:49:54.26Z" }, + { url = "https://files.pythonhosted.org/packages/91/1c/eb97db117a1ebe46d457a3d235a7b9d2e6dcab174f42d1b67663dd9e5371/multidict-6.7.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:7ef6b61cad77091056ce0e7ce69814ef72afacb150b7ac6a3e9470def2198159", size = 45117, upload-time = "2025-10-06T14:49:55.82Z" }, + { url = "https://files.pythonhosted.org/packages/f1/d8/6c3442322e41fb1dd4de8bd67bfd11cd72352ac131f6368315617de752f1/multidict-6.7.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:9c0359b1ec12b1d6849c59f9d319610b7f20ef990a6d454ab151aa0e3b9f78ca", size = 43472, upload-time = "2025-10-06T14:49:57.048Z" }, + { url = "https://files.pythonhosted.org/packages/75/3f/e2639e80325af0b6c6febdf8e57cc07043ff15f57fa1ef808f4ccb5ac4cd/multidict-6.7.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:cd240939f71c64bd658f186330603aac1a9a81bf6273f523fca63673cb7378a8", size = 249342, upload-time = "2025-10-06T14:49:58.368Z" }, + { url = "https://files.pythonhosted.org/packages/5d/cc/84e0585f805cbeaa9cbdaa95f9a3d6aed745b9d25700623ac89a6ecff400/multidict-6.7.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a60a4d75718a5efa473ebd5ab685786ba0c67b8381f781d1be14da49f1a2dc60", size = 257082, upload-time = "2025-10-06T14:49:59.89Z" }, + { url = "https://files.pythonhosted.org/packages/b0/9c/ac851c107c92289acbbf5cfb485694084690c1b17e555f44952c26ddc5bd/multidict-6.7.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:53a42d364f323275126aff81fb67c5ca1b7a04fda0546245730a55c8c5f24bc4", size = 240704, upload-time = "2025-10-06T14:50:01.485Z" }, + { url = "https://files.pythonhosted.org/packages/50/cc/5f93e99427248c09da95b62d64b25748a5f5c98c7c2ab09825a1d6af0e15/multidict-6.7.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3b29b980d0ddbecb736735ee5bef69bb2ddca56eff603c86f3f29a1128299b4f", size = 266355, upload-time = "2025-10-06T14:50:02.955Z" }, + { url = "https://files.pythonhosted.org/packages/ec/0c/2ec1d883ceb79c6f7f6d7ad90c919c898f5d1c6ea96d322751420211e072/multidict-6.7.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:f8a93b1c0ed2d04b97a5e9336fd2d33371b9a6e29ab7dd6503d63407c20ffbaf", size = 267259, upload-time = "2025-10-06T14:50:04.446Z" }, + { url = "https://files.pythonhosted.org/packages/c6/2d/f0b184fa88d6630aa267680bdb8623fb69cb0d024b8c6f0d23f9a0f406d3/multidict-6.7.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9ff96e8815eecacc6645da76c413eb3b3d34cfca256c70b16b286a687d013c32", size = 254903, upload-time = "2025-10-06T14:50:05.98Z" }, + { url = "https://files.pythonhosted.org/packages/06/c9/11ea263ad0df7dfabcad404feb3c0dd40b131bc7f232d5537f2fb1356951/multidict-6.7.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:7516c579652f6a6be0e266aec0acd0db80829ca305c3d771ed898538804c2036", size = 252365, upload-time = "2025-10-06T14:50:07.511Z" }, + { url = "https://files.pythonhosted.org/packages/41/88/d714b86ee2c17d6e09850c70c9d310abac3d808ab49dfa16b43aba9d53fd/multidict-6.7.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:040f393368e63fb0f3330e70c26bfd336656bed925e5cbe17c9da839a6ab13ec", size = 250062, upload-time = "2025-10-06T14:50:09.074Z" }, + { url = "https://files.pythonhosted.org/packages/15/fe/ad407bb9e818c2b31383f6131ca19ea7e35ce93cf1310fce69f12e89de75/multidict-6.7.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b3bc26a951007b1057a1c543af845f1c7e3e71cc240ed1ace7bf4484aa99196e", size = 249683, upload-time = "2025-10-06T14:50:10.714Z" }, + { url = "https://files.pythonhosted.org/packages/8c/a4/a89abdb0229e533fb925e7c6e5c40201c2873efebc9abaf14046a4536ee6/multidict-6.7.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:7b022717c748dd1992a83e219587aabe45980d88969f01b316e78683e6285f64", size = 261254, upload-time = "2025-10-06T14:50:12.28Z" }, + { url = "https://files.pythonhosted.org/packages/8d/aa/0e2b27bd88b40a4fb8dc53dd74eecac70edaa4c1dd0707eb2164da3675b3/multidict-6.7.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:9600082733859f00d79dee64effc7aef1beb26adb297416a4ad2116fd61374bd", size = 257967, upload-time = "2025-10-06T14:50:14.16Z" }, + { url = "https://files.pythonhosted.org/packages/d0/8e/0c67b7120d5d5f6d874ed85a085f9dc770a7f9d8813e80f44a9fec820bb7/multidict-6.7.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:94218fcec4d72bc61df51c198d098ce2b378e0ccbac41ddbed5ef44092913288", size = 250085, upload-time = "2025-10-06T14:50:15.639Z" }, + { url = "https://files.pythonhosted.org/packages/ba/55/b73e1d624ea4b8fd4dd07a3bb70f6e4c7c6c5d9d640a41c6ffe5cdbd2a55/multidict-6.7.0-cp313-cp313-win32.whl", hash = "sha256:a37bd74c3fa9d00be2d7b8eca074dc56bd8077ddd2917a839bd989612671ed17", size = 41713, upload-time = "2025-10-06T14:50:17.066Z" }, + { url = "https://files.pythonhosted.org/packages/32/31/75c59e7d3b4205075b4c183fa4ca398a2daf2303ddf616b04ae6ef55cffe/multidict-6.7.0-cp313-cp313-win_amd64.whl", hash = "sha256:30d193c6cc6d559db42b6bcec8a5d395d34d60c9877a0b71ecd7c204fcf15390", size = 45915, upload-time = "2025-10-06T14:50:18.264Z" }, + { url = "https://files.pythonhosted.org/packages/31/2a/8987831e811f1184c22bc2e45844934385363ee61c0a2dcfa8f71b87e608/multidict-6.7.0-cp313-cp313-win_arm64.whl", hash = "sha256:ea3334cabe4d41b7ccd01e4d349828678794edbc2d3ae97fc162a3312095092e", size = 43077, upload-time = "2025-10-06T14:50:19.853Z" }, + { url = "https://files.pythonhosted.org/packages/e8/68/7b3a5170a382a340147337b300b9eb25a9ddb573bcdfff19c0fa3f31ffba/multidict-6.7.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:ad9ce259f50abd98a1ca0aa6e490b58c316a0fce0617f609723e40804add2c00", size = 83114, upload-time = "2025-10-06T14:50:21.223Z" }, + { url = "https://files.pythonhosted.org/packages/55/5c/3fa2d07c84df4e302060f555bbf539310980362236ad49f50eeb0a1c1eb9/multidict-6.7.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:07f5594ac6d084cbb5de2df218d78baf55ef150b91f0ff8a21cc7a2e3a5a58eb", size = 48442, upload-time = "2025-10-06T14:50:22.871Z" }, + { url = "https://files.pythonhosted.org/packages/fc/56/67212d33239797f9bd91962bb899d72bb0f4c35a8652dcdb8ed049bef878/multidict-6.7.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:0591b48acf279821a579282444814a2d8d0af624ae0bc600aa4d1b920b6e924b", size = 46885, upload-time = "2025-10-06T14:50:24.258Z" }, + { url = "https://files.pythonhosted.org/packages/46/d1/908f896224290350721597a61a69cd19b89ad8ee0ae1f38b3f5cd12ea2ac/multidict-6.7.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:749a72584761531d2b9467cfbdfd29487ee21124c304c4b6cb760d8777b27f9c", size = 242588, upload-time = "2025-10-06T14:50:25.716Z" }, + { url = "https://files.pythonhosted.org/packages/ab/67/8604288bbd68680eee0ab568fdcb56171d8b23a01bcd5cb0c8fedf6e5d99/multidict-6.7.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b4c3d199f953acd5b446bf7c0de1fe25d94e09e79086f8dc2f48a11a129cdf1", size = 249966, upload-time = "2025-10-06T14:50:28.192Z" }, + { url = "https://files.pythonhosted.org/packages/20/33/9228d76339f1ba51e3efef7da3ebd91964d3006217aae13211653193c3ff/multidict-6.7.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:9fb0211dfc3b51efea2f349ec92c114d7754dd62c01f81c3e32b765b70c45c9b", size = 228618, upload-time = "2025-10-06T14:50:29.82Z" }, + { url = "https://files.pythonhosted.org/packages/f8/2d/25d9b566d10cab1c42b3b9e5b11ef79c9111eaf4463b8c257a3bd89e0ead/multidict-6.7.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a027ec240fe73a8d6281872690b988eed307cd7d91b23998ff35ff577ca688b5", size = 257539, upload-time = "2025-10-06T14:50:31.731Z" }, + { url = "https://files.pythonhosted.org/packages/b6/b1/8d1a965e6637fc33de3c0d8f414485c2b7e4af00f42cab3d84e7b955c222/multidict-6.7.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1d964afecdf3a8288789df2f5751dc0a8261138c3768d9af117ed384e538fad", size = 256345, upload-time = "2025-10-06T14:50:33.26Z" }, + { url = "https://files.pythonhosted.org/packages/ba/0c/06b5a8adbdeedada6f4fb8d8f193d44a347223b11939b42953eeb6530b6b/multidict-6.7.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:caf53b15b1b7df9fbd0709aa01409000a2b4dd03a5f6f5cc548183c7c8f8b63c", size = 247934, upload-time = "2025-10-06T14:50:34.808Z" }, + { url = "https://files.pythonhosted.org/packages/8f/31/b2491b5fe167ca044c6eb4b8f2c9f3b8a00b24c432c365358eadac5d7625/multidict-6.7.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:654030da3197d927f05a536a66186070e98765aa5142794c9904555d3a9d8fb5", size = 245243, upload-time = "2025-10-06T14:50:36.436Z" }, + { url = "https://files.pythonhosted.org/packages/61/1a/982913957cb90406c8c94f53001abd9eafc271cb3e70ff6371590bec478e/multidict-6.7.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:2090d3718829d1e484706a2f525e50c892237b2bf9b17a79b059cb98cddc2f10", size = 235878, upload-time = "2025-10-06T14:50:37.953Z" }, + { url = "https://files.pythonhosted.org/packages/be/c0/21435d804c1a1cf7a2608593f4d19bca5bcbd7a81a70b253fdd1c12af9c0/multidict-6.7.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:2d2cfeec3f6f45651b3d408c4acec0ebf3daa9bc8a112a084206f5db5d05b754", size = 243452, upload-time = "2025-10-06T14:50:39.574Z" }, + { url = "https://files.pythonhosted.org/packages/54/0a/4349d540d4a883863191be6eb9a928846d4ec0ea007d3dcd36323bb058ac/multidict-6.7.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:4ef089f985b8c194d341eb2c24ae6e7408c9a0e2e5658699c92f497437d88c3c", size = 252312, upload-time = "2025-10-06T14:50:41.612Z" }, + { url = "https://files.pythonhosted.org/packages/26/64/d5416038dbda1488daf16b676e4dbfd9674dde10a0cc8f4fc2b502d8125d/multidict-6.7.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:e93a0617cd16998784bf4414c7e40f17a35d2350e5c6f0bd900d3a8e02bd3762", size = 246935, upload-time = "2025-10-06T14:50:43.972Z" }, + { url = "https://files.pythonhosted.org/packages/9f/8c/8290c50d14e49f35e0bd4abc25e1bc7711149ca9588ab7d04f886cdf03d9/multidict-6.7.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:f0feece2ef8ebc42ed9e2e8c78fc4aa3cf455733b507c09ef7406364c94376c6", size = 243385, upload-time = "2025-10-06T14:50:45.648Z" }, + { url = "https://files.pythonhosted.org/packages/ef/a0/f83ae75e42d694b3fbad3e047670e511c138be747bc713cf1b10d5096416/multidict-6.7.0-cp313-cp313t-win32.whl", hash = "sha256:19a1d55338ec1be74ef62440ca9e04a2f001a04d0cc49a4983dc320ff0f3212d", size = 47777, upload-time = "2025-10-06T14:50:47.154Z" }, + { url = "https://files.pythonhosted.org/packages/dc/80/9b174a92814a3830b7357307a792300f42c9e94664b01dee8e457551fa66/multidict-6.7.0-cp313-cp313t-win_amd64.whl", hash = "sha256:3da4fb467498df97e986af166b12d01f05d2e04f978a9c1c680ea1988e0bc4b6", size = 53104, upload-time = "2025-10-06T14:50:48.851Z" }, + { url = "https://files.pythonhosted.org/packages/cc/28/04baeaf0428d95bb7a7bea0e691ba2f31394338ba424fb0679a9ed0f4c09/multidict-6.7.0-cp313-cp313t-win_arm64.whl", hash = "sha256:b4121773c49a0776461f4a904cdf6264c88e42218aaa8407e803ca8025872792", size = 45503, upload-time = "2025-10-06T14:50:50.16Z" }, + { url = "https://files.pythonhosted.org/packages/e2/b1/3da6934455dd4b261d4c72f897e3a5728eba81db59959f3a639245891baa/multidict-6.7.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3bab1e4aff7adaa34410f93b1f8e57c4b36b9af0426a76003f441ee1d3c7e842", size = 75128, upload-time = "2025-10-06T14:50:51.92Z" }, + { url = "https://files.pythonhosted.org/packages/14/2c/f069cab5b51d175a1a2cb4ccdf7a2c2dabd58aa5bd933fa036a8d15e2404/multidict-6.7.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:b8512bac933afc3e45fb2b18da8e59b78d4f408399a960339598374d4ae3b56b", size = 44410, upload-time = "2025-10-06T14:50:53.275Z" }, + { url = "https://files.pythonhosted.org/packages/42/e2/64bb41266427af6642b6b128e8774ed84c11b80a90702c13ac0a86bb10cc/multidict-6.7.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:79dcf9e477bc65414ebfea98ffd013cb39552b5ecd62908752e0e413d6d06e38", size = 43205, upload-time = "2025-10-06T14:50:54.911Z" }, + { url = "https://files.pythonhosted.org/packages/02/68/6b086fef8a3f1a8541b9236c594f0c9245617c29841f2e0395d979485cde/multidict-6.7.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:31bae522710064b5cbeddaf2e9f32b1abab70ac6ac91d42572502299e9953128", size = 245084, upload-time = "2025-10-06T14:50:56.369Z" }, + { url = "https://files.pythonhosted.org/packages/15/ee/f524093232007cd7a75c1d132df70f235cfd590a7c9eaccd7ff422ef4ae8/multidict-6.7.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4a0df7ff02397bb63e2fd22af2c87dfa39e8c7f12947bc524dbdc528282c7e34", size = 252667, upload-time = "2025-10-06T14:50:57.991Z" }, + { url = "https://files.pythonhosted.org/packages/02/a5/eeb3f43ab45878f1895118c3ef157a480db58ede3f248e29b5354139c2c9/multidict-6.7.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:7a0222514e8e4c514660e182d5156a415c13ef0aabbd71682fc714e327b95e99", size = 233590, upload-time = "2025-10-06T14:50:59.589Z" }, + { url = "https://files.pythonhosted.org/packages/6a/1e/76d02f8270b97269d7e3dbd45644b1785bda457b474315f8cf999525a193/multidict-6.7.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2397ab4daaf2698eb51a76721e98db21ce4f52339e535725de03ea962b5a3202", size = 264112, upload-time = "2025-10-06T14:51:01.183Z" }, + { url = "https://files.pythonhosted.org/packages/76/0b/c28a70ecb58963847c2a8efe334904cd254812b10e535aefb3bcce513918/multidict-6.7.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:8891681594162635948a636c9fe0ff21746aeb3dd5463f6e25d9bea3a8a39ca1", size = 261194, upload-time = "2025-10-06T14:51:02.794Z" }, + { url = "https://files.pythonhosted.org/packages/b4/63/2ab26e4209773223159b83aa32721b4021ffb08102f8ac7d689c943fded1/multidict-6.7.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:18706cc31dbf402a7945916dd5cddf160251b6dab8a2c5f3d6d5a55949f676b3", size = 248510, upload-time = "2025-10-06T14:51:04.724Z" }, + { url = "https://files.pythonhosted.org/packages/93/cd/06c1fa8282af1d1c46fd55c10a7930af652afdce43999501d4d68664170c/multidict-6.7.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:f844a1bbf1d207dd311a56f383f7eda2d0e134921d45751842d8235e7778965d", size = 248395, upload-time = "2025-10-06T14:51:06.306Z" }, + { url = "https://files.pythonhosted.org/packages/99/ac/82cb419dd6b04ccf9e7e61befc00c77614fc8134362488b553402ecd55ce/multidict-6.7.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:d4393e3581e84e5645506923816b9cc81f5609a778c7e7534054091acc64d1c6", size = 239520, upload-time = "2025-10-06T14:51:08.091Z" }, + { url = "https://files.pythonhosted.org/packages/fa/f3/a0f9bf09493421bd8716a362e0cd1d244f5a6550f5beffdd6b47e885b331/multidict-6.7.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:fbd18dc82d7bf274b37aa48d664534330af744e03bccf696d6f4c6042e7d19e7", size = 245479, upload-time = "2025-10-06T14:51:10.365Z" }, + { url = "https://files.pythonhosted.org/packages/8d/01/476d38fc73a212843f43c852b0eee266b6971f0e28329c2184a8df90c376/multidict-6.7.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:b6234e14f9314731ec45c42fc4554b88133ad53a09092cc48a88e771c125dadb", size = 258903, upload-time = "2025-10-06T14:51:12.466Z" }, + { url = "https://files.pythonhosted.org/packages/49/6d/23faeb0868adba613b817d0e69c5f15531b24d462af8012c4f6de4fa8dc3/multidict-6.7.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:08d4379f9744d8f78d98c8673c06e202ffa88296f009c71bbafe8a6bf847d01f", size = 252333, upload-time = "2025-10-06T14:51:14.48Z" }, + { url = "https://files.pythonhosted.org/packages/1e/cc/48d02ac22b30fa247f7dad82866e4b1015431092f4ba6ebc7e77596e0b18/multidict-6.7.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:9fe04da3f79387f450fd0061d4dd2e45a72749d31bf634aecc9e27f24fdc4b3f", size = 243411, upload-time = "2025-10-06T14:51:16.072Z" }, + { url = "https://files.pythonhosted.org/packages/4a/03/29a8bf5a18abf1fe34535c88adbdfa88c9fb869b5a3b120692c64abe8284/multidict-6.7.0-cp314-cp314-win32.whl", hash = "sha256:fbafe31d191dfa7c4c51f7a6149c9fb7e914dcf9ffead27dcfd9f1ae382b3885", size = 40940, upload-time = "2025-10-06T14:51:17.544Z" }, + { url = "https://files.pythonhosted.org/packages/82/16/7ed27b680791b939de138f906d5cf2b4657b0d45ca6f5dd6236fdddafb1a/multidict-6.7.0-cp314-cp314-win_amd64.whl", hash = "sha256:2f67396ec0310764b9222a1728ced1ab638f61aadc6226f17a71dd9324f9a99c", size = 45087, upload-time = "2025-10-06T14:51:18.875Z" }, + { url = "https://files.pythonhosted.org/packages/cd/3c/e3e62eb35a1950292fe39315d3c89941e30a9d07d5d2df42965ab041da43/multidict-6.7.0-cp314-cp314-win_arm64.whl", hash = "sha256:ba672b26069957ee369cfa7fc180dde1fc6f176eaf1e6beaf61fbebbd3d9c000", size = 42368, upload-time = "2025-10-06T14:51:20.225Z" }, + { url = "https://files.pythonhosted.org/packages/8b/40/cd499bd0dbc5f1136726db3153042a735fffd0d77268e2ee20d5f33c010f/multidict-6.7.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:c1dcc7524066fa918c6a27d61444d4ee7900ec635779058571f70d042d86ed63", size = 82326, upload-time = "2025-10-06T14:51:21.588Z" }, + { url = "https://files.pythonhosted.org/packages/13/8a/18e031eca251c8df76daf0288e6790561806e439f5ce99a170b4af30676b/multidict-6.7.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:27e0b36c2d388dc7b6ced3406671b401e84ad7eb0656b8f3a2f46ed0ce483718", size = 48065, upload-time = "2025-10-06T14:51:22.93Z" }, + { url = "https://files.pythonhosted.org/packages/40/71/5e6701277470a87d234e433fb0a3a7deaf3bcd92566e421e7ae9776319de/multidict-6.7.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2a7baa46a22e77f0988e3b23d4ede5513ebec1929e34ee9495be535662c0dfe2", size = 46475, upload-time = "2025-10-06T14:51:24.352Z" }, + { url = "https://files.pythonhosted.org/packages/fe/6a/bab00cbab6d9cfb57afe1663318f72ec28289ea03fd4e8236bb78429893a/multidict-6.7.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:7bf77f54997a9166a2f5675d1201520586439424c2511723a7312bdb4bcc034e", size = 239324, upload-time = "2025-10-06T14:51:25.822Z" }, + { url = "https://files.pythonhosted.org/packages/2a/5f/8de95f629fc22a7769ade8b41028e3e5a822c1f8904f618d175945a81ad3/multidict-6.7.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e011555abada53f1578d63389610ac8a5400fc70ce71156b0aa30d326f1a5064", size = 246877, upload-time = "2025-10-06T14:51:27.604Z" }, + { url = "https://files.pythonhosted.org/packages/23/b4/38881a960458f25b89e9f4a4fdcb02ac101cfa710190db6e5528841e67de/multidict-6.7.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:28b37063541b897fd6a318007373930a75ca6d6ac7c940dbe14731ffdd8d498e", size = 225824, upload-time = "2025-10-06T14:51:29.664Z" }, + { url = "https://files.pythonhosted.org/packages/1e/39/6566210c83f8a261575f18e7144736059f0c460b362e96e9cf797a24b8e7/multidict-6.7.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:05047ada7a2fde2631a0ed706f1fd68b169a681dfe5e4cf0f8e4cb6618bbc2cd", size = 253558, upload-time = "2025-10-06T14:51:31.684Z" }, + { url = "https://files.pythonhosted.org/packages/00/a3/67f18315100f64c269f46e6c0319fa87ba68f0f64f2b8e7fd7c72b913a0b/multidict-6.7.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:716133f7d1d946a4e1b91b1756b23c088881e70ff180c24e864c26192ad7534a", size = 252339, upload-time = "2025-10-06T14:51:33.699Z" }, + { url = "https://files.pythonhosted.org/packages/c8/2a/1cb77266afee2458d82f50da41beba02159b1d6b1f7973afc9a1cad1499b/multidict-6.7.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d1bed1b467ef657f2a0ae62844a607909ef1c6889562de5e1d505f74457d0b96", size = 244895, upload-time = "2025-10-06T14:51:36.189Z" }, + { url = "https://files.pythonhosted.org/packages/dd/72/09fa7dd487f119b2eb9524946ddd36e2067c08510576d43ff68469563b3b/multidict-6.7.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:ca43bdfa5d37bd6aee89d85e1d0831fb86e25541be7e9d376ead1b28974f8e5e", size = 241862, upload-time = "2025-10-06T14:51:41.291Z" }, + { url = "https://files.pythonhosted.org/packages/65/92/bc1f8bd0853d8669300f732c801974dfc3702c3eeadae2f60cef54dc69d7/multidict-6.7.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:44b546bd3eb645fd26fb949e43c02a25a2e632e2ca21a35e2e132c8105dc8599", size = 232376, upload-time = "2025-10-06T14:51:43.55Z" }, + { url = "https://files.pythonhosted.org/packages/09/86/ac39399e5cb9d0c2ac8ef6e10a768e4d3bc933ac808d49c41f9dc23337eb/multidict-6.7.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:a6ef16328011d3f468e7ebc326f24c1445f001ca1dec335b2f8e66bed3006394", size = 240272, upload-time = "2025-10-06T14:51:45.265Z" }, + { url = "https://files.pythonhosted.org/packages/3d/b6/fed5ac6b8563ec72df6cb1ea8dac6d17f0a4a1f65045f66b6d3bf1497c02/multidict-6.7.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:5aa873cbc8e593d361ae65c68f85faadd755c3295ea2c12040ee146802f23b38", size = 248774, upload-time = "2025-10-06T14:51:46.836Z" }, + { url = "https://files.pythonhosted.org/packages/6b/8d/b954d8c0dc132b68f760aefd45870978deec6818897389dace00fcde32ff/multidict-6.7.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:3d7b6ccce016e29df4b7ca819659f516f0bc7a4b3efa3bb2012ba06431b044f9", size = 242731, upload-time = "2025-10-06T14:51:48.541Z" }, + { url = "https://files.pythonhosted.org/packages/16/9d/a2dac7009125d3540c2f54e194829ea18ac53716c61b655d8ed300120b0f/multidict-6.7.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:171b73bd4ee683d307599b66793ac80981b06f069b62eea1c9e29c9241aa66b0", size = 240193, upload-time = "2025-10-06T14:51:50.355Z" }, + { url = "https://files.pythonhosted.org/packages/39/ca/c05f144128ea232ae2178b008d5011d4e2cea86e4ee8c85c2631b1b94802/multidict-6.7.0-cp314-cp314t-win32.whl", hash = "sha256:b2d7f80c4e1fd010b07cb26820aae86b7e73b681ee4889684fb8d2d4537aab13", size = 48023, upload-time = "2025-10-06T14:51:51.883Z" }, + { url = "https://files.pythonhosted.org/packages/ba/8f/0a60e501584145588be1af5cc829265701ba3c35a64aec8e07cbb71d39bb/multidict-6.7.0-cp314-cp314t-win_amd64.whl", hash = "sha256:09929cab6fcb68122776d575e03c6cc64ee0b8fca48d17e135474b042ce515cd", size = 53507, upload-time = "2025-10-06T14:51:53.672Z" }, + { url = "https://files.pythonhosted.org/packages/7f/ae/3148b988a9c6239903e786eac19c889fab607c31d6efa7fb2147e5680f23/multidict-6.7.0-cp314-cp314t-win_arm64.whl", hash = "sha256:cc41db090ed742f32bd2d2c721861725e6109681eddf835d0a82bd3a5c382827", size = 44804, upload-time = "2025-10-06T14:51:55.415Z" }, + { url = "https://files.pythonhosted.org/packages/90/d7/4cf84257902265c4250769ac49f4eaab81c182ee9aff8bf59d2714dbb174/multidict-6.7.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:363eb68a0a59bd2303216d2346e6c441ba10d36d1f9969fcb6f1ba700de7bb5c", size = 77073, upload-time = "2025-10-06T14:51:57.386Z" }, + { url = "https://files.pythonhosted.org/packages/6d/51/194e999630a656e76c2965a1590d12faa5cd528170f2abaa04423e09fe8d/multidict-6.7.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:d874eb056410ca05fed180b6642e680373688efafc7f077b2a2f61811e873a40", size = 44928, upload-time = "2025-10-06T14:51:58.791Z" }, + { url = "https://files.pythonhosted.org/packages/e5/6b/2a195373c33068c9158e0941d0b46cfcc9c1d894ca2eb137d1128081dff0/multidict-6.7.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:8b55d5497b51afdfde55925e04a022f1de14d4f4f25cdfd4f5d9b0aa96166851", size = 44581, upload-time = "2025-10-06T14:52:00.174Z" }, + { url = "https://files.pythonhosted.org/packages/69/7b/7f4f2e644b6978bf011a5fd9a5ebb7c21de3f38523b1f7897d36a1ac1311/multidict-6.7.0-cp39-cp39-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f8e5c0031b90ca9ce555e2e8fd5c3b02a25f14989cbc310701823832c99eb687", size = 239901, upload-time = "2025-10-06T14:52:02.416Z" }, + { url = "https://files.pythonhosted.org/packages/3c/b5/952c72786710a031aa204a9adf7db66d7f97a2c6573889d58b9e60fe6702/multidict-6.7.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9cf41880c991716f3c7cec48e2f19ae4045fc9db5fc9cff27347ada24d710bb5", size = 240534, upload-time = "2025-10-06T14:52:04.105Z" }, + { url = "https://files.pythonhosted.org/packages/f3/ef/109fe1f2471e4c458c74242c7e4a833f2d9fc8a6813cd7ee345b0bad18f9/multidict-6.7.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:8cfc12a8630a29d601f48d47787bd7eb730e475e83edb5d6c5084317463373eb", size = 219545, upload-time = "2025-10-06T14:52:06.208Z" }, + { url = "https://files.pythonhosted.org/packages/42/bd/327d91288114967f9fe90dc53de70aa3fec1b9073e46aa32c4828f771a87/multidict-6.7.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3996b50c3237c4aec17459217c1e7bbdead9a22a0fcd3c365564fbd16439dde6", size = 251187, upload-time = "2025-10-06T14:52:08.049Z" }, + { url = "https://files.pythonhosted.org/packages/f4/13/a8b078ebbaceb7819fd28cd004413c33b98f1b70d542a62e6a00b74fb09f/multidict-6.7.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7f5170993a0dd3ab871c74f45c0a21a4e2c37a2f2b01b5f722a2ad9c6650469e", size = 249379, upload-time = "2025-10-06T14:52:09.831Z" }, + { url = "https://files.pythonhosted.org/packages/e3/6d/ab12e1246be4d65d1f55de1e6f6aaa9b8120eddcfdd1d290439c7833d5ce/multidict-6.7.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ec81878ddf0e98817def1e77d4f50dae5ef5b0e4fe796fae3bd674304172416e", size = 239241, upload-time = "2025-10-06T14:52:11.561Z" }, + { url = "https://files.pythonhosted.org/packages/bb/d7/079a93625208c173b8fa756396814397c0fd9fee61ef87b75a748820b86e/multidict-6.7.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:9281bf5b34f59afbc6b1e477a372e9526b66ca446f4bf62592839c195a718b32", size = 237418, upload-time = "2025-10-06T14:52:13.671Z" }, + { url = "https://files.pythonhosted.org/packages/c9/29/03777c2212274aa9440918d604dc9d6af0e6b4558c611c32c3dcf1a13870/multidict-6.7.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:68af405971779d8b37198726f2b6fe3955db846fee42db7a4286fc542203934c", size = 232987, upload-time = "2025-10-06T14:52:15.708Z" }, + { url = "https://files.pythonhosted.org/packages/d9/00/11188b68d85a84e8050ee34724d6ded19ad03975caebe0c8dcb2829b37bf/multidict-6.7.0-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:3ba3ef510467abb0667421a286dc906e30eb08569365f5cdb131d7aff7c2dd84", size = 240985, upload-time = "2025-10-06T14:52:17.317Z" }, + { url = "https://files.pythonhosted.org/packages/df/0c/12eef6aeda21859c6cdf7d75bd5516d83be3efe3d8cc45fd1a3037f5b9dc/multidict-6.7.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:b61189b29081a20c7e4e0b49b44d5d44bb0dc92be3c6d06a11cc043f81bf9329", size = 246855, upload-time = "2025-10-06T14:52:19.096Z" }, + { url = "https://files.pythonhosted.org/packages/69/f6/076120fd8bb3975f09228e288e08bff6b9f1bfd5166397c7ba284f622ab2/multidict-6.7.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:fb287618b9c7aa3bf8d825f02d9201b2f13078a5ed3b293c8f4d953917d84d5e", size = 241804, upload-time = "2025-10-06T14:52:21.166Z" }, + { url = "https://files.pythonhosted.org/packages/5f/51/41bb950c81437b88a93e6ddfca1d8763569ae861e638442838c4375f7497/multidict-6.7.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:521f33e377ff64b96c4c556b81c55d0cfffb96a11c194fd0c3f1e56f3d8dd5a4", size = 235321, upload-time = "2025-10-06T14:52:23.208Z" }, + { url = "https://files.pythonhosted.org/packages/5a/cf/5bbd31f055199d56c1f6b04bbadad3ccb24e6d5d4db75db774fc6d6674b8/multidict-6.7.0-cp39-cp39-win32.whl", hash = "sha256:ce8fdc2dca699f8dbf055a61d73eaa10482569ad20ee3c36ef9641f69afa8c91", size = 41435, upload-time = "2025-10-06T14:52:24.735Z" }, + { url = "https://files.pythonhosted.org/packages/af/01/547ffe9c2faec91c26965c152f3fea6cff068b6037401f61d310cc861ff4/multidict-6.7.0-cp39-cp39-win_amd64.whl", hash = "sha256:7e73299c99939f089dd9b2120a04a516b95cdf8c1cd2b18c53ebf0de80b1f18f", size = 46193, upload-time = "2025-10-06T14:52:26.101Z" }, + { url = "https://files.pythonhosted.org/packages/27/77/cfa5461d1d2651d6fc24216c92b4a21d4e385a41c46e0d9f3b070675167b/multidict-6.7.0-cp39-cp39-win_arm64.whl", hash = "sha256:6bdce131e14b04fd34a809b6380dbfd826065c3e2fe8a50dbae659fa0c390546", size = 43118, upload-time = "2025-10-06T14:52:27.876Z" }, + { url = "https://files.pythonhosted.org/packages/b7/da/7d22601b625e241d4f23ef1ebff8acfc60da633c9e7e7922e24d10f592b3/multidict-6.7.0-py3-none-any.whl", hash = "sha256:394fc5c42a333c9ffc3e421a4c85e08580d990e08b99f6bf35b4132114c5dcb3", size = 12317, upload-time = "2025-10-06T14:52:29.272Z" }, +] + [[package]] name = "multiprocess" version = "0.70.18" @@ -2256,6 +3553,135 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/84/03/0d3ce49e2505ae70cf43bc5bb3033955d2fc9f932163e84dc0779cc47f48/prompt_toolkit-3.0.52-py3-none-any.whl", hash = "sha256:9aac639a3bbd33284347de5ad8d68ecc044b91a762dc39b7c21095fcd6a19955", size = 391431, upload-time = "2025-08-27T15:23:59.498Z" }, ] +[[package]] +name = "propcache" +version = "0.4.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/9e/da/e9fc233cf63743258bff22b3dfa7ea5baef7b5bc324af47a0ad89b8ffc6f/propcache-0.4.1.tar.gz", hash = "sha256:f48107a8c637e80362555f37ecf49abe20370e557cc4ab374f04ec4423c97c3d", size = 46442, upload-time = "2025-10-08T19:49:02.291Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3c/0e/934b541323035566a9af292dba85a195f7b78179114f2c6ebb24551118a9/propcache-0.4.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c2d1fa3201efaf55d730400d945b5b3ab6e672e100ba0f9a409d950ab25d7db", size = 79534, upload-time = "2025-10-08T19:46:02.083Z" }, + { url = "https://files.pythonhosted.org/packages/a1/6b/db0d03d96726d995dc7171286c6ba9d8d14251f37433890f88368951a44e/propcache-0.4.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:1eb2994229cc8ce7fe9b3db88f5465f5fd8651672840b2e426b88cdb1a30aac8", size = 45526, upload-time = "2025-10-08T19:46:03.884Z" }, + { url = "https://files.pythonhosted.org/packages/e4/c3/82728404aea669e1600f304f2609cde9e665c18df5a11cdd57ed73c1dceb/propcache-0.4.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:66c1f011f45a3b33d7bcb22daed4b29c0c9e2224758b6be00686731e1b46f925", size = 47263, upload-time = "2025-10-08T19:46:05.405Z" }, + { url = "https://files.pythonhosted.org/packages/df/1b/39313ddad2bf9187a1432654c38249bab4562ef535ef07f5eb6eb04d0b1b/propcache-0.4.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9a52009f2adffe195d0b605c25ec929d26b36ef986ba85244891dee3b294df21", size = 201012, upload-time = "2025-10-08T19:46:07.165Z" }, + { url = "https://files.pythonhosted.org/packages/5b/01/f1d0b57d136f294a142acf97f4ed58c8e5b974c21e543000968357115011/propcache-0.4.1-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5d4e2366a9c7b837555cf02fb9be2e3167d333aff716332ef1b7c3a142ec40c5", size = 209491, upload-time = "2025-10-08T19:46:08.909Z" }, + { url = "https://files.pythonhosted.org/packages/a1/c8/038d909c61c5bb039070b3fb02ad5cccdb1dde0d714792e251cdb17c9c05/propcache-0.4.1-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:9d2b6caef873b4f09e26ea7e33d65f42b944837563a47a94719cc3544319a0db", size = 215319, upload-time = "2025-10-08T19:46:10.7Z" }, + { url = "https://files.pythonhosted.org/packages/08/57/8c87e93142b2c1fa2408e45695205a7ba05fb5db458c0bf5c06ba0e09ea6/propcache-0.4.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2b16ec437a8c8a965ecf95739448dd938b5c7f56e67ea009f4300d8df05f32b7", size = 196856, upload-time = "2025-10-08T19:46:12.003Z" }, + { url = "https://files.pythonhosted.org/packages/42/df/5615fec76aa561987a534759b3686008a288e73107faa49a8ae5795a9f7a/propcache-0.4.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:296f4c8ed03ca7476813fe666c9ea97869a8d7aec972618671b33a38a5182ef4", size = 193241, upload-time = "2025-10-08T19:46:13.495Z" }, + { url = "https://files.pythonhosted.org/packages/d5/21/62949eb3a7a54afe8327011c90aca7e03547787a88fb8bd9726806482fea/propcache-0.4.1-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:1f0978529a418ebd1f49dad413a2b68af33f85d5c5ca5c6ca2a3bed375a7ac60", size = 190552, upload-time = "2025-10-08T19:46:14.938Z" }, + { url = "https://files.pythonhosted.org/packages/30/ee/ab4d727dd70806e5b4de96a798ae7ac6e4d42516f030ee60522474b6b332/propcache-0.4.1-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:fd138803047fb4c062b1c1dd95462f5209456bfab55c734458f15d11da288f8f", size = 200113, upload-time = "2025-10-08T19:46:16.695Z" }, + { url = "https://files.pythonhosted.org/packages/8a/0b/38b46208e6711b016aa8966a3ac793eee0d05c7159d8342aa27fc0bc365e/propcache-0.4.1-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:8c9b3cbe4584636d72ff556d9036e0c9317fa27b3ac1f0f558e7e84d1c9c5900", size = 200778, upload-time = "2025-10-08T19:46:18.023Z" }, + { url = "https://files.pythonhosted.org/packages/cf/81/5abec54355ed344476bee711e9f04815d4b00a311ab0535599204eecc257/propcache-0.4.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f93243fdc5657247533273ac4f86ae106cc6445a0efacb9a1bfe982fcfefd90c", size = 193047, upload-time = "2025-10-08T19:46:19.449Z" }, + { url = "https://files.pythonhosted.org/packages/ec/b6/1f237c04e32063cb034acd5f6ef34ef3a394f75502e72703545631ab1ef6/propcache-0.4.1-cp310-cp310-win32.whl", hash = "sha256:a0ee98db9c5f80785b266eb805016e36058ac72c51a064040f2bc43b61101cdb", size = 38093, upload-time = "2025-10-08T19:46:20.643Z" }, + { url = "https://files.pythonhosted.org/packages/a6/67/354aac4e0603a15f76439caf0427781bcd6797f370377f75a642133bc954/propcache-0.4.1-cp310-cp310-win_amd64.whl", hash = "sha256:1cdb7988c4e5ac7f6d175a28a9aa0c94cb6f2ebe52756a3c0cda98d2809a9e37", size = 41638, upload-time = "2025-10-08T19:46:21.935Z" }, + { url = "https://files.pythonhosted.org/packages/e0/e1/74e55b9fd1a4c209ff1a9a824bf6c8b3d1fc5a1ac3eabe23462637466785/propcache-0.4.1-cp310-cp310-win_arm64.whl", hash = "sha256:d82ad62b19645419fe79dd63b3f9253e15b30e955c0170e5cebc350c1844e581", size = 38229, upload-time = "2025-10-08T19:46:23.368Z" }, + { url = "https://files.pythonhosted.org/packages/8c/d4/4e2c9aaf7ac2242b9358f98dccd8f90f2605402f5afeff6c578682c2c491/propcache-0.4.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:60a8fda9644b7dfd5dece8c61d8a85e271cb958075bfc4e01083c148b61a7caf", size = 80208, upload-time = "2025-10-08T19:46:24.597Z" }, + { url = "https://files.pythonhosted.org/packages/c2/21/d7b68e911f9c8e18e4ae43bdbc1e1e9bbd971f8866eb81608947b6f585ff/propcache-0.4.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:c30b53e7e6bda1d547cabb47c825f3843a0a1a42b0496087bb58d8fedf9f41b5", size = 45777, upload-time = "2025-10-08T19:46:25.733Z" }, + { url = "https://files.pythonhosted.org/packages/d3/1d/11605e99ac8ea9435651ee71ab4cb4bf03f0949586246476a25aadfec54a/propcache-0.4.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:6918ecbd897443087a3b7cd978d56546a812517dcaaca51b49526720571fa93e", size = 47647, upload-time = "2025-10-08T19:46:27.304Z" }, + { url = "https://files.pythonhosted.org/packages/58/1a/3c62c127a8466c9c843bccb503d40a273e5cc69838805f322e2826509e0d/propcache-0.4.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3d902a36df4e5989763425a8ab9e98cd8ad5c52c823b34ee7ef307fd50582566", size = 214929, upload-time = "2025-10-08T19:46:28.62Z" }, + { url = "https://files.pythonhosted.org/packages/56/b9/8fa98f850960b367c4b8fe0592e7fc341daa7a9462e925228f10a60cf74f/propcache-0.4.1-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a9695397f85973bb40427dedddf70d8dc4a44b22f1650dd4af9eedf443d45165", size = 221778, upload-time = "2025-10-08T19:46:30.358Z" }, + { url = "https://files.pythonhosted.org/packages/46/a6/0ab4f660eb59649d14b3d3d65c439421cf2f87fe5dd68591cbe3c1e78a89/propcache-0.4.1-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2bb07ffd7eaad486576430c89f9b215f9e4be68c4866a96e97db9e97fead85dc", size = 228144, upload-time = "2025-10-08T19:46:32.607Z" }, + { url = "https://files.pythonhosted.org/packages/52/6a/57f43e054fb3d3a56ac9fc532bc684fc6169a26c75c353e65425b3e56eef/propcache-0.4.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fd6f30fdcf9ae2a70abd34da54f18da086160e4d7d9251f81f3da0ff84fc5a48", size = 210030, upload-time = "2025-10-08T19:46:33.969Z" }, + { url = "https://files.pythonhosted.org/packages/40/e2/27e6feebb5f6b8408fa29f5efbb765cd54c153ac77314d27e457a3e993b7/propcache-0.4.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:fc38cba02d1acba4e2869eef1a57a43dfbd3d49a59bf90dda7444ec2be6a5570", size = 208252, upload-time = "2025-10-08T19:46:35.309Z" }, + { url = "https://files.pythonhosted.org/packages/9e/f8/91c27b22ccda1dbc7967f921c42825564fa5336a01ecd72eb78a9f4f53c2/propcache-0.4.1-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:67fad6162281e80e882fb3ec355398cf72864a54069d060321f6cd0ade95fe85", size = 202064, upload-time = "2025-10-08T19:46:36.993Z" }, + { url = "https://files.pythonhosted.org/packages/f2/26/7f00bd6bd1adba5aafe5f4a66390f243acab58eab24ff1a08bebb2ef9d40/propcache-0.4.1-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:f10207adf04d08bec185bae14d9606a1444715bc99180f9331c9c02093e1959e", size = 212429, upload-time = "2025-10-08T19:46:38.398Z" }, + { url = "https://files.pythonhosted.org/packages/84/89/fd108ba7815c1117ddca79c228f3f8a15fc82a73bca8b142eb5de13b2785/propcache-0.4.1-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:e9b0d8d0845bbc4cfcdcbcdbf5086886bc8157aa963c31c777ceff7846c77757", size = 216727, upload-time = "2025-10-08T19:46:39.732Z" }, + { url = "https://files.pythonhosted.org/packages/79/37/3ec3f7e3173e73f1d600495d8b545b53802cbf35506e5732dd8578db3724/propcache-0.4.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:981333cb2f4c1896a12f4ab92a9cc8f09ea664e9b7dbdc4eff74627af3a11c0f", size = 205097, upload-time = "2025-10-08T19:46:41.025Z" }, + { url = "https://files.pythonhosted.org/packages/61/b0/b2631c19793f869d35f47d5a3a56fb19e9160d3c119f15ac7344fc3ccae7/propcache-0.4.1-cp311-cp311-win32.whl", hash = "sha256:f1d2f90aeec838a52f1c1a32fe9a619fefd5e411721a9117fbf82aea638fe8a1", size = 38084, upload-time = "2025-10-08T19:46:42.693Z" }, + { url = "https://files.pythonhosted.org/packages/f4/78/6cce448e2098e9f3bfc91bb877f06aa24b6ccace872e39c53b2f707c4648/propcache-0.4.1-cp311-cp311-win_amd64.whl", hash = "sha256:364426a62660f3f699949ac8c621aad6977be7126c5807ce48c0aeb8e7333ea6", size = 41637, upload-time = "2025-10-08T19:46:43.778Z" }, + { url = "https://files.pythonhosted.org/packages/9c/e9/754f180cccd7f51a39913782c74717c581b9cc8177ad0e949f4d51812383/propcache-0.4.1-cp311-cp311-win_arm64.whl", hash = "sha256:e53f3a38d3510c11953f3e6a33f205c6d1b001129f972805ca9b42fc308bc239", size = 38064, upload-time = "2025-10-08T19:46:44.872Z" }, + { url = "https://files.pythonhosted.org/packages/a2/0f/f17b1b2b221d5ca28b4b876e8bb046ac40466513960646bda8e1853cdfa2/propcache-0.4.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e153e9cd40cc8945138822807139367f256f89c6810c2634a4f6902b52d3b4e2", size = 80061, upload-time = "2025-10-08T19:46:46.075Z" }, + { url = "https://files.pythonhosted.org/packages/76/47/8ccf75935f51448ba9a16a71b783eb7ef6b9ee60f5d14c7f8a8a79fbeed7/propcache-0.4.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:cd547953428f7abb73c5ad82cbb32109566204260d98e41e5dfdc682eb7f8403", size = 46037, upload-time = "2025-10-08T19:46:47.23Z" }, + { url = "https://files.pythonhosted.org/packages/0a/b6/5c9a0e42df4d00bfb4a3cbbe5cf9f54260300c88a0e9af1f47ca5ce17ac0/propcache-0.4.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:f048da1b4f243fc44f205dfd320933a951b8d89e0afd4c7cacc762a8b9165207", size = 47324, upload-time = "2025-10-08T19:46:48.384Z" }, + { url = "https://files.pythonhosted.org/packages/9e/d3/6c7ee328b39a81ee877c962469f1e795f9db87f925251efeb0545e0020d0/propcache-0.4.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ec17c65562a827bba85e3872ead335f95405ea1674860d96483a02f5c698fa72", size = 225505, upload-time = "2025-10-08T19:46:50.055Z" }, + { url = "https://files.pythonhosted.org/packages/01/5d/1c53f4563490b1d06a684742cc6076ef944bc6457df6051b7d1a877c057b/propcache-0.4.1-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:405aac25c6394ef275dee4c709be43745d36674b223ba4eb7144bf4d691b7367", size = 230242, upload-time = "2025-10-08T19:46:51.815Z" }, + { url = "https://files.pythonhosted.org/packages/20/e1/ce4620633b0e2422207c3cb774a0ee61cac13abc6217763a7b9e2e3f4a12/propcache-0.4.1-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0013cb6f8dde4b2a2f66903b8ba740bdfe378c943c4377a200551ceb27f379e4", size = 238474, upload-time = "2025-10-08T19:46:53.208Z" }, + { url = "https://files.pythonhosted.org/packages/46/4b/3aae6835b8e5f44ea6a68348ad90f78134047b503765087be2f9912140ea/propcache-0.4.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:15932ab57837c3368b024473a525e25d316d8353016e7cc0e5ba9eb343fbb1cf", size = 221575, upload-time = "2025-10-08T19:46:54.511Z" }, + { url = "https://files.pythonhosted.org/packages/6e/a5/8a5e8678bcc9d3a1a15b9a29165640d64762d424a16af543f00629c87338/propcache-0.4.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:031dce78b9dc099f4c29785d9cf5577a3faf9ebf74ecbd3c856a7b92768c3df3", size = 216736, upload-time = "2025-10-08T19:46:56.212Z" }, + { url = "https://files.pythonhosted.org/packages/f1/63/b7b215eddeac83ca1c6b934f89d09a625aa9ee4ba158338854c87210cc36/propcache-0.4.1-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:ab08df6c9a035bee56e31af99be621526bd237bea9f32def431c656b29e41778", size = 213019, upload-time = "2025-10-08T19:46:57.595Z" }, + { url = "https://files.pythonhosted.org/packages/57/74/f580099a58c8af587cac7ba19ee7cb418506342fbbe2d4a4401661cca886/propcache-0.4.1-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:4d7af63f9f93fe593afbf104c21b3b15868efb2c21d07d8732c0c4287e66b6a6", size = 220376, upload-time = "2025-10-08T19:46:59.067Z" }, + { url = "https://files.pythonhosted.org/packages/c4/ee/542f1313aff7eaf19c2bb758c5d0560d2683dac001a1c96d0774af799843/propcache-0.4.1-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:cfc27c945f422e8b5071b6e93169679e4eb5bf73bbcbf1ba3ae3a83d2f78ebd9", size = 226988, upload-time = "2025-10-08T19:47:00.544Z" }, + { url = "https://files.pythonhosted.org/packages/8f/18/9c6b015dd9c6930f6ce2229e1f02fb35298b847f2087ea2b436a5bfa7287/propcache-0.4.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:35c3277624a080cc6ec6f847cbbbb5b49affa3598c4535a0a4682a697aaa5c75", size = 215615, upload-time = "2025-10-08T19:47:01.968Z" }, + { url = "https://files.pythonhosted.org/packages/80/9e/e7b85720b98c45a45e1fca6a177024934dc9bc5f4d5dd04207f216fc33ed/propcache-0.4.1-cp312-cp312-win32.whl", hash = "sha256:671538c2262dadb5ba6395e26c1731e1d52534bfe9ae56d0b5573ce539266aa8", size = 38066, upload-time = "2025-10-08T19:47:03.503Z" }, + { url = "https://files.pythonhosted.org/packages/54/09/d19cff2a5aaac632ec8fc03737b223597b1e347416934c1b3a7df079784c/propcache-0.4.1-cp312-cp312-win_amd64.whl", hash = "sha256:cb2d222e72399fcf5890d1d5cc1060857b9b236adff2792ff48ca2dfd46c81db", size = 41655, upload-time = "2025-10-08T19:47:04.973Z" }, + { url = "https://files.pythonhosted.org/packages/68/ab/6b5c191bb5de08036a8c697b265d4ca76148efb10fa162f14af14fb5f076/propcache-0.4.1-cp312-cp312-win_arm64.whl", hash = "sha256:204483131fb222bdaaeeea9f9e6c6ed0cac32731f75dfc1d4a567fc1926477c1", size = 37789, upload-time = "2025-10-08T19:47:06.077Z" }, + { url = "https://files.pythonhosted.org/packages/bf/df/6d9c1b6ac12b003837dde8a10231a7344512186e87b36e855bef32241942/propcache-0.4.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:43eedf29202c08550aac1d14e0ee619b0430aaef78f85864c1a892294fbc28cf", size = 77750, upload-time = "2025-10-08T19:47:07.648Z" }, + { url = "https://files.pythonhosted.org/packages/8b/e8/677a0025e8a2acf07d3418a2e7ba529c9c33caf09d3c1f25513023c1db56/propcache-0.4.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:d62cdfcfd89ccb8de04e0eda998535c406bf5e060ffd56be6c586cbcc05b3311", size = 44780, upload-time = "2025-10-08T19:47:08.851Z" }, + { url = "https://files.pythonhosted.org/packages/89/a4/92380f7ca60f99ebae761936bc48a72a639e8a47b29050615eef757cb2a7/propcache-0.4.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:cae65ad55793da34db5f54e4029b89d3b9b9490d8abe1b4c7ab5d4b8ec7ebf74", size = 46308, upload-time = "2025-10-08T19:47:09.982Z" }, + { url = "https://files.pythonhosted.org/packages/2d/48/c5ac64dee5262044348d1d78a5f85dd1a57464a60d30daee946699963eb3/propcache-0.4.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:333ddb9031d2704a301ee3e506dc46b1fe5f294ec198ed6435ad5b6a085facfe", size = 208182, upload-time = "2025-10-08T19:47:11.319Z" }, + { url = "https://files.pythonhosted.org/packages/c6/0c/cd762dd011a9287389a6a3eb43aa30207bde253610cca06824aeabfe9653/propcache-0.4.1-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:fd0858c20f078a32cf55f7e81473d96dcf3b93fd2ccdb3d40fdf54b8573df3af", size = 211215, upload-time = "2025-10-08T19:47:13.146Z" }, + { url = "https://files.pythonhosted.org/packages/30/3e/49861e90233ba36890ae0ca4c660e95df565b2cd15d4a68556ab5865974e/propcache-0.4.1-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:678ae89ebc632c5c204c794f8dab2837c5f159aeb59e6ed0539500400577298c", size = 218112, upload-time = "2025-10-08T19:47:14.913Z" }, + { url = "https://files.pythonhosted.org/packages/f1/8b/544bc867e24e1bd48f3118cecd3b05c694e160a168478fa28770f22fd094/propcache-0.4.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d472aeb4fbf9865e0c6d622d7f4d54a4e101a89715d8904282bb5f9a2f476c3f", size = 204442, upload-time = "2025-10-08T19:47:16.277Z" }, + { url = "https://files.pythonhosted.org/packages/50/a6/4282772fd016a76d3e5c0df58380a5ea64900afd836cec2c2f662d1b9bb3/propcache-0.4.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4d3df5fa7e36b3225954fba85589da77a0fe6a53e3976de39caf04a0db4c36f1", size = 199398, upload-time = "2025-10-08T19:47:17.962Z" }, + { url = "https://files.pythonhosted.org/packages/3e/ec/d8a7cd406ee1ddb705db2139f8a10a8a427100347bd698e7014351c7af09/propcache-0.4.1-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:ee17f18d2498f2673e432faaa71698032b0127ebf23ae5974eeaf806c279df24", size = 196920, upload-time = "2025-10-08T19:47:19.355Z" }, + { url = "https://files.pythonhosted.org/packages/f6/6c/f38ab64af3764f431e359f8baf9e0a21013e24329e8b85d2da32e8ed07ca/propcache-0.4.1-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:580e97762b950f993ae618e167e7be9256b8353c2dcd8b99ec100eb50f5286aa", size = 203748, upload-time = "2025-10-08T19:47:21.338Z" }, + { url = "https://files.pythonhosted.org/packages/d6/e3/fa846bd70f6534d647886621388f0a265254d30e3ce47e5c8e6e27dbf153/propcache-0.4.1-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:501d20b891688eb8e7aa903021f0b72d5a55db40ffaab27edefd1027caaafa61", size = 205877, upload-time = "2025-10-08T19:47:23.059Z" }, + { url = "https://files.pythonhosted.org/packages/e2/39/8163fc6f3133fea7b5f2827e8eba2029a0277ab2c5beee6c1db7b10fc23d/propcache-0.4.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a0bd56e5b100aef69bd8562b74b46254e7c8812918d3baa700c8a8009b0af66", size = 199437, upload-time = "2025-10-08T19:47:24.445Z" }, + { url = "https://files.pythonhosted.org/packages/93/89/caa9089970ca49c7c01662bd0eeedfe85494e863e8043565aeb6472ce8fe/propcache-0.4.1-cp313-cp313-win32.whl", hash = "sha256:bcc9aaa5d80322bc2fb24bb7accb4a30f81e90ab8d6ba187aec0744bc302ad81", size = 37586, upload-time = "2025-10-08T19:47:25.736Z" }, + { url = "https://files.pythonhosted.org/packages/f5/ab/f76ec3c3627c883215b5c8080debb4394ef5a7a29be811f786415fc1e6fd/propcache-0.4.1-cp313-cp313-win_amd64.whl", hash = "sha256:381914df18634f5494334d201e98245c0596067504b9372d8cf93f4bb23e025e", size = 40790, upload-time = "2025-10-08T19:47:26.847Z" }, + { url = "https://files.pythonhosted.org/packages/59/1b/e71ae98235f8e2ba5004d8cb19765a74877abf189bc53fc0c80d799e56c3/propcache-0.4.1-cp313-cp313-win_arm64.whl", hash = "sha256:8873eb4460fd55333ea49b7d189749ecf6e55bf85080f11b1c4530ed3034cba1", size = 37158, upload-time = "2025-10-08T19:47:27.961Z" }, + { url = "https://files.pythonhosted.org/packages/83/ce/a31bbdfc24ee0dcbba458c8175ed26089cf109a55bbe7b7640ed2470cfe9/propcache-0.4.1-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:92d1935ee1f8d7442da9c0c4fa7ac20d07e94064184811b685f5c4fada64553b", size = 81451, upload-time = "2025-10-08T19:47:29.445Z" }, + { url = "https://files.pythonhosted.org/packages/25/9c/442a45a470a68456e710d96cacd3573ef26a1d0a60067e6a7d5e655621ed/propcache-0.4.1-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:473c61b39e1460d386479b9b2f337da492042447c9b685f28be4f74d3529e566", size = 46374, upload-time = "2025-10-08T19:47:30.579Z" }, + { url = "https://files.pythonhosted.org/packages/f4/bf/b1d5e21dbc3b2e889ea4327044fb16312a736d97640fb8b6aa3f9c7b3b65/propcache-0.4.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:c0ef0aaafc66fbd87842a3fe3902fd889825646bc21149eafe47be6072725835", size = 48396, upload-time = "2025-10-08T19:47:31.79Z" }, + { url = "https://files.pythonhosted.org/packages/f4/04/5b4c54a103d480e978d3c8a76073502b18db0c4bc17ab91b3cb5092ad949/propcache-0.4.1-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f95393b4d66bfae908c3ca8d169d5f79cd65636ae15b5e7a4f6e67af675adb0e", size = 275950, upload-time = "2025-10-08T19:47:33.481Z" }, + { url = "https://files.pythonhosted.org/packages/b4/c1/86f846827fb969c4b78b0af79bba1d1ea2156492e1b83dea8b8a6ae27395/propcache-0.4.1-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c07fda85708bc48578467e85099645167a955ba093be0a2dcba962195676e859", size = 273856, upload-time = "2025-10-08T19:47:34.906Z" }, + { url = "https://files.pythonhosted.org/packages/36/1d/fc272a63c8d3bbad6878c336c7a7dea15e8f2d23a544bda43205dfa83ada/propcache-0.4.1-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:af223b406d6d000830c6f65f1e6431783fc3f713ba3e6cc8c024d5ee96170a4b", size = 280420, upload-time = "2025-10-08T19:47:36.338Z" }, + { url = "https://files.pythonhosted.org/packages/07/0c/01f2219d39f7e53d52e5173bcb09c976609ba30209912a0680adfb8c593a/propcache-0.4.1-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a78372c932c90ee474559c5ddfffd718238e8673c340dc21fe45c5b8b54559a0", size = 263254, upload-time = "2025-10-08T19:47:37.692Z" }, + { url = "https://files.pythonhosted.org/packages/2d/18/cd28081658ce597898f0c4d174d4d0f3c5b6d4dc27ffafeef835c95eb359/propcache-0.4.1-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:564d9f0d4d9509e1a870c920a89b2fec951b44bf5ba7d537a9e7c1ccec2c18af", size = 261205, upload-time = "2025-10-08T19:47:39.659Z" }, + { url = "https://files.pythonhosted.org/packages/7a/71/1f9e22eb8b8316701c2a19fa1f388c8a3185082607da8e406a803c9b954e/propcache-0.4.1-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:17612831fda0138059cc5546f4d12a2aacfb9e47068c06af35c400ba58ba7393", size = 247873, upload-time = "2025-10-08T19:47:41.084Z" }, + { url = "https://files.pythonhosted.org/packages/4a/65/3d4b61f36af2b4eddba9def857959f1016a51066b4f1ce348e0cf7881f58/propcache-0.4.1-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:41a89040cb10bd345b3c1a873b2bf36413d48da1def52f268a055f7398514874", size = 262739, upload-time = "2025-10-08T19:47:42.51Z" }, + { url = "https://files.pythonhosted.org/packages/2a/42/26746ab087faa77c1c68079b228810436ccd9a5ce9ac85e2b7307195fd06/propcache-0.4.1-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:e35b88984e7fa64aacecea39236cee32dd9bd8c55f57ba8a75cf2399553f9bd7", size = 263514, upload-time = "2025-10-08T19:47:43.927Z" }, + { url = "https://files.pythonhosted.org/packages/94/13/630690fe201f5502d2403dd3cfd451ed8858fe3c738ee88d095ad2ff407b/propcache-0.4.1-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:6f8b465489f927b0df505cbe26ffbeed4d6d8a2bbc61ce90eb074ff129ef0ab1", size = 257781, upload-time = "2025-10-08T19:47:45.448Z" }, + { url = "https://files.pythonhosted.org/packages/92/f7/1d4ec5841505f423469efbfc381d64b7b467438cd5a4bbcbb063f3b73d27/propcache-0.4.1-cp313-cp313t-win32.whl", hash = "sha256:2ad890caa1d928c7c2965b48f3a3815c853180831d0e5503d35cf00c472f4717", size = 41396, upload-time = "2025-10-08T19:47:47.202Z" }, + { url = "https://files.pythonhosted.org/packages/48/f0/615c30622316496d2cbbc29f5985f7777d3ada70f23370608c1d3e081c1f/propcache-0.4.1-cp313-cp313t-win_amd64.whl", hash = "sha256:f7ee0e597f495cf415bcbd3da3caa3bd7e816b74d0d52b8145954c5e6fd3ff37", size = 44897, upload-time = "2025-10-08T19:47:48.336Z" }, + { url = "https://files.pythonhosted.org/packages/fd/ca/6002e46eccbe0e33dcd4069ef32f7f1c9e243736e07adca37ae8c4830ec3/propcache-0.4.1-cp313-cp313t-win_arm64.whl", hash = "sha256:929d7cbe1f01bb7baffb33dc14eb5691c95831450a26354cd210a8155170c93a", size = 39789, upload-time = "2025-10-08T19:47:49.876Z" }, + { url = "https://files.pythonhosted.org/packages/8e/5c/bca52d654a896f831b8256683457ceddd490ec18d9ec50e97dfd8fc726a8/propcache-0.4.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3f7124c9d820ba5548d431afb4632301acf965db49e666aa21c305cbe8c6de12", size = 78152, upload-time = "2025-10-08T19:47:51.051Z" }, + { url = "https://files.pythonhosted.org/packages/65/9b/03b04e7d82a5f54fb16113d839f5ea1ede58a61e90edf515f6577c66fa8f/propcache-0.4.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:c0d4b719b7da33599dfe3b22d3db1ef789210a0597bc650b7cee9c77c2be8c5c", size = 44869, upload-time = "2025-10-08T19:47:52.594Z" }, + { url = "https://files.pythonhosted.org/packages/b2/fa/89a8ef0468d5833a23fff277b143d0573897cf75bd56670a6d28126c7d68/propcache-0.4.1-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:9f302f4783709a78240ebc311b793f123328716a60911d667e0c036bc5dcbded", size = 46596, upload-time = "2025-10-08T19:47:54.073Z" }, + { url = "https://files.pythonhosted.org/packages/86/bd/47816020d337f4a746edc42fe8d53669965138f39ee117414c7d7a340cfe/propcache-0.4.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c80ee5802e3fb9ea37938e7eecc307fb984837091d5fd262bb37238b1ae97641", size = 206981, upload-time = "2025-10-08T19:47:55.715Z" }, + { url = "https://files.pythonhosted.org/packages/df/f6/c5fa1357cc9748510ee55f37173eb31bfde6d94e98ccd9e6f033f2fc06e1/propcache-0.4.1-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ed5a841e8bb29a55fb8159ed526b26adc5bdd7e8bd7bf793ce647cb08656cdf4", size = 211490, upload-time = "2025-10-08T19:47:57.499Z" }, + { url = "https://files.pythonhosted.org/packages/80/1e/e5889652a7c4a3846683401a48f0f2e5083ce0ec1a8a5221d8058fbd1adf/propcache-0.4.1-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:55c72fd6ea2da4c318e74ffdf93c4fe4e926051133657459131a95c846d16d44", size = 215371, upload-time = "2025-10-08T19:47:59.317Z" }, + { url = "https://files.pythonhosted.org/packages/b2/f2/889ad4b2408f72fe1a4f6a19491177b30ea7bf1a0fd5f17050ca08cfc882/propcache-0.4.1-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8326e144341460402713f91df60ade3c999d601e7eb5ff8f6f7862d54de0610d", size = 201424, upload-time = "2025-10-08T19:48:00.67Z" }, + { url = "https://files.pythonhosted.org/packages/27/73/033d63069b57b0812c8bd19f311faebeceb6ba31b8f32b73432d12a0b826/propcache-0.4.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:060b16ae65bc098da7f6d25bf359f1f31f688384858204fe5d652979e0015e5b", size = 197566, upload-time = "2025-10-08T19:48:02.604Z" }, + { url = "https://files.pythonhosted.org/packages/dc/89/ce24f3dc182630b4e07aa6d15f0ff4b14ed4b9955fae95a0b54c58d66c05/propcache-0.4.1-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:89eb3fa9524f7bec9de6e83cf3faed9d79bffa560672c118a96a171a6f55831e", size = 193130, upload-time = "2025-10-08T19:48:04.499Z" }, + { url = "https://files.pythonhosted.org/packages/a9/24/ef0d5fd1a811fb5c609278d0209c9f10c35f20581fcc16f818da959fc5b4/propcache-0.4.1-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:dee69d7015dc235f526fe80a9c90d65eb0039103fe565776250881731f06349f", size = 202625, upload-time = "2025-10-08T19:48:06.213Z" }, + { url = "https://files.pythonhosted.org/packages/f5/02/98ec20ff5546f68d673df2f7a69e8c0d076b5abd05ca882dc7ee3a83653d/propcache-0.4.1-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:5558992a00dfd54ccbc64a32726a3357ec93825a418a401f5cc67df0ac5d9e49", size = 204209, upload-time = "2025-10-08T19:48:08.432Z" }, + { url = "https://files.pythonhosted.org/packages/a0/87/492694f76759b15f0467a2a93ab68d32859672b646aa8a04ce4864e7932d/propcache-0.4.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:c9b822a577f560fbd9554812526831712c1436d2c046cedee4c3796d3543b144", size = 197797, upload-time = "2025-10-08T19:48:09.968Z" }, + { url = "https://files.pythonhosted.org/packages/ee/36/66367de3575db1d2d3f3d177432bd14ee577a39d3f5d1b3d5df8afe3b6e2/propcache-0.4.1-cp314-cp314-win32.whl", hash = "sha256:ab4c29b49d560fe48b696cdcb127dd36e0bc2472548f3bf56cc5cb3da2b2984f", size = 38140, upload-time = "2025-10-08T19:48:11.232Z" }, + { url = "https://files.pythonhosted.org/packages/0c/2a/a758b47de253636e1b8aef181c0b4f4f204bf0dd964914fb2af90a95b49b/propcache-0.4.1-cp314-cp314-win_amd64.whl", hash = "sha256:5a103c3eb905fcea0ab98be99c3a9a5ab2de60228aa5aceedc614c0281cf6153", size = 41257, upload-time = "2025-10-08T19:48:12.707Z" }, + { url = "https://files.pythonhosted.org/packages/34/5e/63bd5896c3fec12edcbd6f12508d4890d23c265df28c74b175e1ef9f4f3b/propcache-0.4.1-cp314-cp314-win_arm64.whl", hash = "sha256:74c1fb26515153e482e00177a1ad654721bf9207da8a494a0c05e797ad27b992", size = 38097, upload-time = "2025-10-08T19:48:13.923Z" }, + { url = "https://files.pythonhosted.org/packages/99/85/9ff785d787ccf9bbb3f3106f79884a130951436f58392000231b4c737c80/propcache-0.4.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:824e908bce90fb2743bd6b59db36eb4f45cd350a39637c9f73b1c1ea66f5b75f", size = 81455, upload-time = "2025-10-08T19:48:15.16Z" }, + { url = "https://files.pythonhosted.org/packages/90/85/2431c10c8e7ddb1445c1f7c4b54d886e8ad20e3c6307e7218f05922cad67/propcache-0.4.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:c2b5e7db5328427c57c8e8831abda175421b709672f6cfc3d630c3b7e2146393", size = 46372, upload-time = "2025-10-08T19:48:16.424Z" }, + { url = "https://files.pythonhosted.org/packages/01/20/b0972d902472da9bcb683fa595099911f4d2e86e5683bcc45de60dd05dc3/propcache-0.4.1-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:6f6ff873ed40292cd4969ef5310179afd5db59fdf055897e282485043fc80ad0", size = 48411, upload-time = "2025-10-08T19:48:17.577Z" }, + { url = "https://files.pythonhosted.org/packages/e2/e3/7dc89f4f21e8f99bad3d5ddb3a3389afcf9da4ac69e3deb2dcdc96e74169/propcache-0.4.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:49a2dc67c154db2c1463013594c458881a069fcf98940e61a0569016a583020a", size = 275712, upload-time = "2025-10-08T19:48:18.901Z" }, + { url = "https://files.pythonhosted.org/packages/20/67/89800c8352489b21a8047c773067644e3897f02ecbbd610f4d46b7f08612/propcache-0.4.1-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:005f08e6a0529984491e37d8dbc3dd86f84bd78a8ceb5fa9a021f4c48d4984be", size = 273557, upload-time = "2025-10-08T19:48:20.762Z" }, + { url = "https://files.pythonhosted.org/packages/e2/a1/b52b055c766a54ce6d9c16d9aca0cad8059acd9637cdf8aa0222f4a026ef/propcache-0.4.1-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5c3310452e0d31390da9035c348633b43d7e7feb2e37be252be6da45abd1abcc", size = 280015, upload-time = "2025-10-08T19:48:22.592Z" }, + { url = "https://files.pythonhosted.org/packages/48/c8/33cee30bd890672c63743049f3c9e4be087e6780906bfc3ec58528be59c1/propcache-0.4.1-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4c3c70630930447f9ef1caac7728c8ad1c56bc5015338b20fed0d08ea2480b3a", size = 262880, upload-time = "2025-10-08T19:48:23.947Z" }, + { url = "https://files.pythonhosted.org/packages/0c/b1/8f08a143b204b418285c88b83d00edbd61afbc2c6415ffafc8905da7038b/propcache-0.4.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:8e57061305815dfc910a3634dcf584f08168a8836e6999983569f51a8544cd89", size = 260938, upload-time = "2025-10-08T19:48:25.656Z" }, + { url = "https://files.pythonhosted.org/packages/cf/12/96e4664c82ca2f31e1c8dff86afb867348979eb78d3cb8546a680287a1e9/propcache-0.4.1-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:521a463429ef54143092c11a77e04056dd00636f72e8c45b70aaa3140d639726", size = 247641, upload-time = "2025-10-08T19:48:27.207Z" }, + { url = "https://files.pythonhosted.org/packages/18/ed/e7a9cfca28133386ba52278136d42209d3125db08d0a6395f0cba0c0285c/propcache-0.4.1-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:120c964da3fdc75e3731aa392527136d4ad35868cc556fd09bb6d09172d9a367", size = 262510, upload-time = "2025-10-08T19:48:28.65Z" }, + { url = "https://files.pythonhosted.org/packages/f5/76/16d8bf65e8845dd62b4e2b57444ab81f07f40caa5652b8969b87ddcf2ef6/propcache-0.4.1-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:d8f353eb14ee3441ee844ade4277d560cdd68288838673273b978e3d6d2c8f36", size = 263161, upload-time = "2025-10-08T19:48:30.133Z" }, + { url = "https://files.pythonhosted.org/packages/e7/70/c99e9edb5d91d5ad8a49fa3c1e8285ba64f1476782fed10ab251ff413ba1/propcache-0.4.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ab2943be7c652f09638800905ee1bab2c544e537edb57d527997a24c13dc1455", size = 257393, upload-time = "2025-10-08T19:48:31.567Z" }, + { url = "https://files.pythonhosted.org/packages/08/02/87b25304249a35c0915d236575bc3574a323f60b47939a2262b77632a3ee/propcache-0.4.1-cp314-cp314t-win32.whl", hash = "sha256:05674a162469f31358c30bcaa8883cb7829fa3110bf9c0991fe27d7896c42d85", size = 42546, upload-time = "2025-10-08T19:48:32.872Z" }, + { url = "https://files.pythonhosted.org/packages/cb/ef/3c6ecf8b317aa982f309835e8f96987466123c6e596646d4e6a1dfcd080f/propcache-0.4.1-cp314-cp314t-win_amd64.whl", hash = "sha256:990f6b3e2a27d683cb7602ed6c86f15ee6b43b1194736f9baaeb93d0016633b1", size = 46259, upload-time = "2025-10-08T19:48:34.226Z" }, + { url = "https://files.pythonhosted.org/packages/c4/2d/346e946d4951f37eca1e4f55be0f0174c52cd70720f84029b02f296f4a38/propcache-0.4.1-cp314-cp314t-win_arm64.whl", hash = "sha256:ecef2343af4cc68e05131e45024ba34f6095821988a9d0a02aa7c73fcc448aa9", size = 40428, upload-time = "2025-10-08T19:48:35.441Z" }, + { url = "https://files.pythonhosted.org/packages/9b/01/0ebaec9003f5d619a7475165961f8e3083cf8644d704b60395df3601632d/propcache-0.4.1-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:3d233076ccf9e450c8b3bc6720af226b898ef5d051a2d145f7d765e6e9f9bcff", size = 80277, upload-time = "2025-10-08T19:48:36.647Z" }, + { url = "https://files.pythonhosted.org/packages/34/58/04af97ac586b4ef6b9026c3fd36ee7798b737a832f5d3440a4280dcebd3a/propcache-0.4.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:357f5bb5c377a82e105e44bd3d52ba22b616f7b9773714bff93573988ef0a5fb", size = 45865, upload-time = "2025-10-08T19:48:37.859Z" }, + { url = "https://files.pythonhosted.org/packages/7c/19/b65d98ae21384518b291d9939e24a8aeac4fdb5101b732576f8f7540e834/propcache-0.4.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:cbc3b6dfc728105b2a57c06791eb07a94229202ea75c59db644d7d496b698cac", size = 47636, upload-time = "2025-10-08T19:48:39.038Z" }, + { url = "https://files.pythonhosted.org/packages/b3/0f/317048c6d91c356c7154dca5af019e6effeb7ee15fa6a6db327cc19e12b4/propcache-0.4.1-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:182b51b421f0501952d938dc0b0eb45246a5b5153c50d42b495ad5fb7517c888", size = 201126, upload-time = "2025-10-08T19:48:40.774Z" }, + { url = "https://files.pythonhosted.org/packages/71/69/0b2a7a5a6ee83292b4b997dbd80549d8ce7d40b6397c1646c0d9495f5a85/propcache-0.4.1-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:4b536b39c5199b96fc6245eb5fb796c497381d3942f169e44e8e392b29c9ebcc", size = 209837, upload-time = "2025-10-08T19:48:42.167Z" }, + { url = "https://files.pythonhosted.org/packages/a5/92/c699ac495a6698df6e497fc2de27af4b6ace10d8e76528357ce153722e45/propcache-0.4.1-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:db65d2af507bbfbdcedb254a11149f894169d90488dd3e7190f7cdcb2d6cd57a", size = 215578, upload-time = "2025-10-08T19:48:43.56Z" }, + { url = "https://files.pythonhosted.org/packages/b3/ee/14de81c5eb02c0ee4f500b4e39c4e1bd0677c06e72379e6ab18923c773fc/propcache-0.4.1-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fd2dbc472da1f772a4dae4fa24be938a6c544671a912e30529984dd80400cd88", size = 197187, upload-time = "2025-10-08T19:48:45.309Z" }, + { url = "https://files.pythonhosted.org/packages/1d/94/48dce9aaa6d8dd5a0859bad75158ec522546d4ac23f8e2f05fac469477dd/propcache-0.4.1-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:daede9cd44e0f8bdd9e6cc9a607fc81feb80fae7a5fc6cecaff0e0bb32e42d00", size = 193478, upload-time = "2025-10-08T19:48:47.743Z" }, + { url = "https://files.pythonhosted.org/packages/60/b5/0516b563e801e1ace212afde869a0596a0d7115eec0b12d296d75633fb29/propcache-0.4.1-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:71b749281b816793678ae7f3d0d84bd36e694953822eaad408d682efc5ca18e0", size = 190650, upload-time = "2025-10-08T19:48:49.373Z" }, + { url = "https://files.pythonhosted.org/packages/24/89/e0f7d4a5978cd56f8cd67735f74052f257dc471ec901694e430f0d1572fe/propcache-0.4.1-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:0002004213ee1f36cfb3f9a42b5066100c44276b9b72b4e1504cddd3d692e86e", size = 200251, upload-time = "2025-10-08T19:48:51.4Z" }, + { url = "https://files.pythonhosted.org/packages/06/7d/a1fac863d473876ed4406c914f2e14aa82d2f10dd207c9e16fc383cc5a24/propcache-0.4.1-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:fe49d0a85038f36ba9e3ffafa1103e61170b28e95b16622e11be0a0ea07c6781", size = 200919, upload-time = "2025-10-08T19:48:53.227Z" }, + { url = "https://files.pythonhosted.org/packages/c3/4e/f86a256ff24944cf5743e4e6c6994e3526f6acfcfb55e21694c2424f758c/propcache-0.4.1-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:99d43339c83aaf4d32bda60928231848eee470c6bda8d02599cc4cebe872d183", size = 193211, upload-time = "2025-10-08T19:48:55.027Z" }, + { url = "https://files.pythonhosted.org/packages/6e/3f/3fbad5f4356b068f1b047d300a6ff2c66614d7030f078cd50be3fec04228/propcache-0.4.1-cp39-cp39-win32.whl", hash = "sha256:a129e76735bc792794d5177069691c3217898b9f5cee2b2661471e52ffe13f19", size = 38314, upload-time = "2025-10-08T19:48:56.792Z" }, + { url = "https://files.pythonhosted.org/packages/a4/45/d78d136c3a3d215677abb886785aae744da2c3005bcb99e58640c56529b1/propcache-0.4.1-cp39-cp39-win_amd64.whl", hash = "sha256:948dab269721ae9a87fd16c514a0a2c2a1bdb23a9a61b969b0f9d9ee2968546f", size = 41912, upload-time = "2025-10-08T19:48:57.995Z" }, + { url = "https://files.pythonhosted.org/packages/fc/2a/b0632941f25139f4e58450b307242951f7c2717a5704977c6d5323a800af/propcache-0.4.1-cp39-cp39-win_arm64.whl", hash = "sha256:5fd37c406dd6dc85aa743e214cef35dc54bbdd1419baac4f6ae5e5b1a2976938", size = 38450, upload-time = "2025-10-08T19:48:59.349Z" }, + { url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" }, +] + [[package]] name = "psutil" version = "7.1.1" @@ -2290,6 +3716,121 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842, upload-time = "2024-07-21T12:58:20.04Z" }, ] +[[package]] +name = "pyarrow" +version = "21.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/ef/c2/ea068b8f00905c06329a3dfcd40d0fcc2b7d0f2e355bdb25b65e0a0e4cd4/pyarrow-21.0.0.tar.gz", hash = "sha256:5051f2dccf0e283ff56335760cbc8622cf52264d67e359d5569541ac11b6d5bc", size = 1133487, upload-time = "2025-07-18T00:57:31.761Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/17/d9/110de31880016e2afc52d8580b397dbe47615defbf09ca8cf55f56c62165/pyarrow-21.0.0-cp310-cp310-macosx_12_0_arm64.whl", hash = "sha256:e563271e2c5ff4d4a4cbeb2c83d5cf0d4938b891518e676025f7268c6fe5fe26", size = 31196837, upload-time = "2025-07-18T00:54:34.755Z" }, + { url = "https://files.pythonhosted.org/packages/df/5f/c1c1997613abf24fceb087e79432d24c19bc6f7259cab57c2c8e5e545fab/pyarrow-21.0.0-cp310-cp310-macosx_12_0_x86_64.whl", hash = "sha256:fee33b0ca46f4c85443d6c450357101e47d53e6c3f008d658c27a2d020d44c79", size = 32659470, upload-time = "2025-07-18T00:54:38.329Z" }, + { url = "https://files.pythonhosted.org/packages/3e/ed/b1589a777816ee33ba123ba1e4f8f02243a844fed0deec97bde9fb21a5cf/pyarrow-21.0.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:7be45519b830f7c24b21d630a31d48bcebfd5d4d7f9d3bdb49da9cdf6d764edb", size = 41055619, upload-time = "2025-07-18T00:54:42.172Z" }, + { url = "https://files.pythonhosted.org/packages/44/28/b6672962639e85dc0ac36f71ab3a8f5f38e01b51343d7aa372a6b56fa3f3/pyarrow-21.0.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:26bfd95f6bff443ceae63c65dc7e048670b7e98bc892210acba7e4995d3d4b51", size = 42733488, upload-time = "2025-07-18T00:54:47.132Z" }, + { url = "https://files.pythonhosted.org/packages/f8/cc/de02c3614874b9089c94eac093f90ca5dfa6d5afe45de3ba847fd950fdf1/pyarrow-21.0.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:bd04ec08f7f8bd113c55868bd3fc442a9db67c27af098c5f814a3091e71cc61a", size = 43329159, upload-time = "2025-07-18T00:54:51.686Z" }, + { url = "https://files.pythonhosted.org/packages/a6/3e/99473332ac40278f196e105ce30b79ab8affab12f6194802f2593d6b0be2/pyarrow-21.0.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:9b0b14b49ac10654332a805aedfc0147fb3469cbf8ea951b3d040dab12372594", size = 45050567, upload-time = "2025-07-18T00:54:56.679Z" }, + { url = "https://files.pythonhosted.org/packages/7b/f5/c372ef60593d713e8bfbb7e0c743501605f0ad00719146dc075faf11172b/pyarrow-21.0.0-cp310-cp310-win_amd64.whl", hash = "sha256:9d9f8bcb4c3be7738add259738abdeddc363de1b80e3310e04067aa1ca596634", size = 26217959, upload-time = "2025-07-18T00:55:00.482Z" }, + { url = "https://files.pythonhosted.org/packages/94/dc/80564a3071a57c20b7c32575e4a0120e8a330ef487c319b122942d665960/pyarrow-21.0.0-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:c077f48aab61738c237802836fc3844f85409a46015635198761b0d6a688f87b", size = 31243234, upload-time = "2025-07-18T00:55:03.812Z" }, + { url = "https://files.pythonhosted.org/packages/ea/cc/3b51cb2db26fe535d14f74cab4c79b191ed9a8cd4cbba45e2379b5ca2746/pyarrow-21.0.0-cp311-cp311-macosx_12_0_x86_64.whl", hash = "sha256:689f448066781856237eca8d1975b98cace19b8dd2ab6145bf49475478bcaa10", size = 32714370, upload-time = "2025-07-18T00:55:07.495Z" }, + { url = "https://files.pythonhosted.org/packages/24/11/a4431f36d5ad7d83b87146f515c063e4d07ef0b7240876ddb885e6b44f2e/pyarrow-21.0.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:479ee41399fcddc46159a551705b89c05f11e8b8cb8e968f7fec64f62d91985e", size = 41135424, upload-time = "2025-07-18T00:55:11.461Z" }, + { url = "https://files.pythonhosted.org/packages/74/dc/035d54638fc5d2971cbf1e987ccd45f1091c83bcf747281cf6cc25e72c88/pyarrow-21.0.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:40ebfcb54a4f11bcde86bc586cbd0272bac0d516cfa539c799c2453768477569", size = 42823810, upload-time = "2025-07-18T00:55:16.301Z" }, + { url = "https://files.pythonhosted.org/packages/2e/3b/89fced102448a9e3e0d4dded1f37fa3ce4700f02cdb8665457fcc8015f5b/pyarrow-21.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8d58d8497814274d3d20214fbb24abcad2f7e351474357d552a8d53bce70c70e", size = 43391538, upload-time = "2025-07-18T00:55:23.82Z" }, + { url = "https://files.pythonhosted.org/packages/fb/bb/ea7f1bd08978d39debd3b23611c293f64a642557e8141c80635d501e6d53/pyarrow-21.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:585e7224f21124dd57836b1530ac8f2df2afc43c861d7bf3d58a4870c42ae36c", size = 45120056, upload-time = "2025-07-18T00:55:28.231Z" }, + { url = "https://files.pythonhosted.org/packages/6e/0b/77ea0600009842b30ceebc3337639a7380cd946061b620ac1a2f3cb541e2/pyarrow-21.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:555ca6935b2cbca2c0e932bedd853e9bc523098c39636de9ad4693b5b1df86d6", size = 26220568, upload-time = "2025-07-18T00:55:32.122Z" }, + { url = "https://files.pythonhosted.org/packages/ca/d4/d4f817b21aacc30195cf6a46ba041dd1be827efa4a623cc8bf39a1c2a0c0/pyarrow-21.0.0-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:3a302f0e0963db37e0a24a70c56cf91a4faa0bca51c23812279ca2e23481fccd", size = 31160305, upload-time = "2025-07-18T00:55:35.373Z" }, + { url = "https://files.pythonhosted.org/packages/a2/9c/dcd38ce6e4b4d9a19e1d36914cb8e2b1da4e6003dd075474c4cfcdfe0601/pyarrow-21.0.0-cp312-cp312-macosx_12_0_x86_64.whl", hash = "sha256:b6b27cf01e243871390474a211a7922bfbe3bda21e39bc9160daf0da3fe48876", size = 32684264, upload-time = "2025-07-18T00:55:39.303Z" }, + { url = "https://files.pythonhosted.org/packages/4f/74/2a2d9f8d7a59b639523454bec12dba35ae3d0a07d8ab529dc0809f74b23c/pyarrow-21.0.0-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:e72a8ec6b868e258a2cd2672d91f2860ad532d590ce94cdf7d5e7ec674ccf03d", size = 41108099, upload-time = "2025-07-18T00:55:42.889Z" }, + { url = "https://files.pythonhosted.org/packages/ad/90/2660332eeb31303c13b653ea566a9918484b6e4d6b9d2d46879a33ab0622/pyarrow-21.0.0-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:b7ae0bbdc8c6674259b25bef5d2a1d6af5d39d7200c819cf99e07f7dfef1c51e", size = 42829529, upload-time = "2025-07-18T00:55:47.069Z" }, + { url = "https://files.pythonhosted.org/packages/33/27/1a93a25c92717f6aa0fca06eb4700860577d016cd3ae51aad0e0488ac899/pyarrow-21.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:58c30a1729f82d201627c173d91bd431db88ea74dcaa3885855bc6203e433b82", size = 43367883, upload-time = "2025-07-18T00:55:53.069Z" }, + { url = "https://files.pythonhosted.org/packages/05/d9/4d09d919f35d599bc05c6950095e358c3e15148ead26292dfca1fb659b0c/pyarrow-21.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:072116f65604b822a7f22945a7a6e581cfa28e3454fdcc6939d4ff6090126623", size = 45133802, upload-time = "2025-07-18T00:55:57.714Z" }, + { url = "https://files.pythonhosted.org/packages/71/30/f3795b6e192c3ab881325ffe172e526499eb3780e306a15103a2764916a2/pyarrow-21.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:cf56ec8b0a5c8c9d7021d6fd754e688104f9ebebf1bf4449613c9531f5346a18", size = 26203175, upload-time = "2025-07-18T00:56:01.364Z" }, + { url = "https://files.pythonhosted.org/packages/16/ca/c7eaa8e62db8fb37ce942b1ea0c6d7abfe3786ca193957afa25e71b81b66/pyarrow-21.0.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:e99310a4ebd4479bcd1964dff9e14af33746300cb014aa4a3781738ac63baf4a", size = 31154306, upload-time = "2025-07-18T00:56:04.42Z" }, + { url = "https://files.pythonhosted.org/packages/ce/e8/e87d9e3b2489302b3a1aea709aaca4b781c5252fcb812a17ab6275a9a484/pyarrow-21.0.0-cp313-cp313-macosx_12_0_x86_64.whl", hash = "sha256:d2fe8e7f3ce329a71b7ddd7498b3cfac0eeb200c2789bd840234f0dc271a8efe", size = 32680622, upload-time = "2025-07-18T00:56:07.505Z" }, + { url = "https://files.pythonhosted.org/packages/84/52/79095d73a742aa0aba370c7942b1b655f598069489ab387fe47261a849e1/pyarrow-21.0.0-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:f522e5709379d72fb3da7785aa489ff0bb87448a9dc5a75f45763a795a089ebd", size = 41104094, upload-time = "2025-07-18T00:56:10.994Z" }, + { url = "https://files.pythonhosted.org/packages/89/4b/7782438b551dbb0468892a276b8c789b8bbdb25ea5c5eb27faadd753e037/pyarrow-21.0.0-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:69cbbdf0631396e9925e048cfa5bce4e8c3d3b41562bbd70c685a8eb53a91e61", size = 42825576, upload-time = "2025-07-18T00:56:15.569Z" }, + { url = "https://files.pythonhosted.org/packages/b3/62/0f29de6e0a1e33518dec92c65be0351d32d7ca351e51ec5f4f837a9aab91/pyarrow-21.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:731c7022587006b755d0bdb27626a1a3bb004bb56b11fb30d98b6c1b4718579d", size = 43368342, upload-time = "2025-07-18T00:56:19.531Z" }, + { url = "https://files.pythonhosted.org/packages/90/c7/0fa1f3f29cf75f339768cc698c8ad4ddd2481c1742e9741459911c9ac477/pyarrow-21.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:dc56bc708f2d8ac71bd1dcb927e458c93cec10b98eb4120206a4091db7b67b99", size = 45131218, upload-time = "2025-07-18T00:56:23.347Z" }, + { url = "https://files.pythonhosted.org/packages/01/63/581f2076465e67b23bc5a37d4a2abff8362d389d29d8105832e82c9c811c/pyarrow-21.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:186aa00bca62139f75b7de8420f745f2af12941595bbbfa7ed3870ff63e25636", size = 26087551, upload-time = "2025-07-18T00:56:26.758Z" }, + { url = "https://files.pythonhosted.org/packages/c9/ab/357d0d9648bb8241ee7348e564f2479d206ebe6e1c47ac5027c2e31ecd39/pyarrow-21.0.0-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:a7a102574faa3f421141a64c10216e078df467ab9576684d5cd696952546e2da", size = 31290064, upload-time = "2025-07-18T00:56:30.214Z" }, + { url = "https://files.pythonhosted.org/packages/3f/8a/5685d62a990e4cac2043fc76b4661bf38d06efed55cf45a334b455bd2759/pyarrow-21.0.0-cp313-cp313t-macosx_12_0_x86_64.whl", hash = "sha256:1e005378c4a2c6db3ada3ad4c217b381f6c886f0a80d6a316fe586b90f77efd7", size = 32727837, upload-time = "2025-07-18T00:56:33.935Z" }, + { url = "https://files.pythonhosted.org/packages/fc/de/c0828ee09525c2bafefd3e736a248ebe764d07d0fd762d4f0929dbc516c9/pyarrow-21.0.0-cp313-cp313t-manylinux_2_28_aarch64.whl", hash = "sha256:65f8e85f79031449ec8706b74504a316805217b35b6099155dd7e227eef0d4b6", size = 41014158, upload-time = "2025-07-18T00:56:37.528Z" }, + { url = "https://files.pythonhosted.org/packages/6e/26/a2865c420c50b7a3748320b614f3484bfcde8347b2639b2b903b21ce6a72/pyarrow-21.0.0-cp313-cp313t-manylinux_2_28_x86_64.whl", hash = "sha256:3a81486adc665c7eb1a2bde0224cfca6ceaba344a82a971ef059678417880eb8", size = 42667885, upload-time = "2025-07-18T00:56:41.483Z" }, + { url = "https://files.pythonhosted.org/packages/0a/f9/4ee798dc902533159250fb4321267730bc0a107d8c6889e07c3add4fe3a5/pyarrow-21.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:fc0d2f88b81dcf3ccf9a6ae17f89183762c8a94a5bdcfa09e05cfe413acf0503", size = 43276625, upload-time = "2025-07-18T00:56:48.002Z" }, + { url = "https://files.pythonhosted.org/packages/5a/da/e02544d6997037a4b0d22d8e5f66bc9315c3671371a8b18c79ade1cefe14/pyarrow-21.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:6299449adf89df38537837487a4f8d3bd91ec94354fdd2a7d30bc11c48ef6e79", size = 44951890, upload-time = "2025-07-18T00:56:52.568Z" }, + { url = "https://files.pythonhosted.org/packages/e5/4e/519c1bc1876625fe6b71e9a28287c43ec2f20f73c658b9ae1d485c0c206e/pyarrow-21.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:222c39e2c70113543982c6b34f3077962b44fca38c0bd9e68bb6781534425c10", size = 26371006, upload-time = "2025-07-18T00:56:56.379Z" }, + { url = "https://files.pythonhosted.org/packages/3e/cc/ce4939f4b316457a083dc5718b3982801e8c33f921b3c98e7a93b7c7491f/pyarrow-21.0.0-cp39-cp39-macosx_12_0_arm64.whl", hash = "sha256:a7f6524e3747e35f80744537c78e7302cd41deee8baa668d56d55f77d9c464b3", size = 31211248, upload-time = "2025-07-18T00:56:59.7Z" }, + { url = "https://files.pythonhosted.org/packages/1f/c2/7a860931420d73985e2f340f06516b21740c15b28d24a0e99a900bb27d2b/pyarrow-21.0.0-cp39-cp39-macosx_12_0_x86_64.whl", hash = "sha256:203003786c9fd253ebcafa44b03c06983c9c8d06c3145e37f1b76a1f317aeae1", size = 32676896, upload-time = "2025-07-18T00:57:03.884Z" }, + { url = "https://files.pythonhosted.org/packages/68/a8/197f989b9a75e59b4ca0db6a13c56f19a0ad8a298c68da9cc28145e0bb97/pyarrow-21.0.0-cp39-cp39-manylinux_2_28_aarch64.whl", hash = "sha256:3b4d97e297741796fead24867a8dabf86c87e4584ccc03167e4a811f50fdf74d", size = 41067862, upload-time = "2025-07-18T00:57:07.587Z" }, + { url = "https://files.pythonhosted.org/packages/fa/82/6ecfa89487b35aa21accb014b64e0a6b814cc860d5e3170287bf5135c7d8/pyarrow-21.0.0-cp39-cp39-manylinux_2_28_x86_64.whl", hash = "sha256:898afce396b80fdda05e3086b4256f8677c671f7b1d27a6976fa011d3fd0a86e", size = 42747508, upload-time = "2025-07-18T00:57:13.917Z" }, + { url = "https://files.pythonhosted.org/packages/3b/b7/ba252f399bbf3addc731e8643c05532cf32e74cebb5e32f8f7409bc243cf/pyarrow-21.0.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:067c66ca29aaedae08218569a114e413b26e742171f526e828e1064fcdec13f4", size = 43345293, upload-time = "2025-07-18T00:57:19.828Z" }, + { url = "https://files.pythonhosted.org/packages/ff/0a/a20819795bd702b9486f536a8eeb70a6aa64046fce32071c19ec8230dbaa/pyarrow-21.0.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:0c4e75d13eb76295a49e0ea056eb18dbd87d81450bfeb8afa19a7e5a75ae2ad7", size = 45060670, upload-time = "2025-07-18T00:57:24.477Z" }, + { url = "https://files.pythonhosted.org/packages/10/15/6b30e77872012bbfe8265d42a01d5b3c17ef0ac0f2fae531ad91b6a6c02e/pyarrow-21.0.0-cp39-cp39-win_amd64.whl", hash = "sha256:cdc4c17afda4dab2a9c0b79148a43a7f4e1094916b3e18d8975bfd6d6d52241f", size = 26227521, upload-time = "2025-07-18T00:57:29.119Z" }, +] + +[[package]] +name = "pyarrow" +version = "22.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", + "python_full_version == '3.10.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/30/53/04a7fdc63e6056116c9ddc8b43bc28c12cdd181b85cbeadb79278475f3ae/pyarrow-22.0.0.tar.gz", hash = "sha256:3d600dc583260d845c7d8a6db540339dd883081925da2bd1c5cb808f720b3cd9", size = 1151151, upload-time = "2025-10-24T12:30:00.762Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d9/9b/cb3f7e0a345353def531ca879053e9ef6b9f38ed91aebcf68b09ba54dec0/pyarrow-22.0.0-cp310-cp310-macosx_12_0_arm64.whl", hash = "sha256:77718810bd3066158db1e95a63c160ad7ce08c6b0710bc656055033e39cdad88", size = 34223968, upload-time = "2025-10-24T10:03:31.21Z" }, + { url = "https://files.pythonhosted.org/packages/6c/41/3184b8192a120306270c5307f105b70320fdaa592c99843c5ef78aaefdcf/pyarrow-22.0.0-cp310-cp310-macosx_12_0_x86_64.whl", hash = "sha256:44d2d26cda26d18f7af7db71453b7b783788322d756e81730acb98f24eb90ace", size = 35942085, upload-time = "2025-10-24T10:03:38.146Z" }, + { url = "https://files.pythonhosted.org/packages/d9/3d/a1eab2f6f08001f9fb714b8ed5cfb045e2fe3e3e3c0c221f2c9ed1e6d67d/pyarrow-22.0.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:b9d71701ce97c95480fecb0039ec5bb889e75f110da72005743451339262f4ce", size = 44964613, upload-time = "2025-10-24T10:03:46.516Z" }, + { url = "https://files.pythonhosted.org/packages/46/46/a1d9c24baf21cfd9ce994ac820a24608decf2710521b29223d4334985127/pyarrow-22.0.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:710624ab925dc2b05a6229d47f6f0dac1c1155e6ed559be7109f684eba048a48", size = 47627059, upload-time = "2025-10-24T10:03:55.353Z" }, + { url = "https://files.pythonhosted.org/packages/3a/4c/f711acb13075c1391fd54bc17e078587672c575f8de2a6e62509af026dcf/pyarrow-22.0.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:f963ba8c3b0199f9d6b794c90ec77545e05eadc83973897a4523c9e8d84e9340", size = 47947043, upload-time = "2025-10-24T10:04:05.408Z" }, + { url = "https://files.pythonhosted.org/packages/4e/70/1f3180dd7c2eab35c2aca2b29ace6c519f827dcd4cfeb8e0dca41612cf7a/pyarrow-22.0.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:bd0d42297ace400d8febe55f13fdf46e86754842b860c978dfec16f081e5c653", size = 50206505, upload-time = "2025-10-24T10:04:15.786Z" }, + { url = "https://files.pythonhosted.org/packages/80/07/fea6578112c8c60ffde55883a571e4c4c6bc7049f119d6b09333b5cc6f73/pyarrow-22.0.0-cp310-cp310-win_amd64.whl", hash = "sha256:00626d9dc0f5ef3a75fe63fd68b9c7c8302d2b5bbc7f74ecaedba83447a24f84", size = 28101641, upload-time = "2025-10-24T10:04:22.57Z" }, + { url = "https://files.pythonhosted.org/packages/2e/b7/18f611a8cdc43417f9394a3ccd3eace2f32183c08b9eddc3d17681819f37/pyarrow-22.0.0-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:3e294c5eadfb93d78b0763e859a0c16d4051fc1c5231ae8956d61cb0b5666f5a", size = 34272022, upload-time = "2025-10-24T10:04:28.973Z" }, + { url = "https://files.pythonhosted.org/packages/26/5c/f259e2526c67eb4b9e511741b19870a02363a47a35edbebc55c3178db22d/pyarrow-22.0.0-cp311-cp311-macosx_12_0_x86_64.whl", hash = "sha256:69763ab2445f632d90b504a815a2a033f74332997052b721002298ed6de40f2e", size = 35995834, upload-time = "2025-10-24T10:04:35.467Z" }, + { url = "https://files.pythonhosted.org/packages/50/8d/281f0f9b9376d4b7f146913b26fac0aa2829cd1ee7e997f53a27411bbb92/pyarrow-22.0.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:b41f37cabfe2463232684de44bad753d6be08a7a072f6a83447eeaf0e4d2a215", size = 45030348, upload-time = "2025-10-24T10:04:43.366Z" }, + { url = "https://files.pythonhosted.org/packages/f5/e5/53c0a1c428f0976bf22f513d79c73000926cb00b9c138d8e02daf2102e18/pyarrow-22.0.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:35ad0f0378c9359b3f297299c3309778bb03b8612f987399a0333a560b43862d", size = 47699480, upload-time = "2025-10-24T10:04:51.486Z" }, + { url = "https://files.pythonhosted.org/packages/95/e1/9dbe4c465c3365959d183e6345d0a8d1dc5b02ca3f8db4760b3bc834cf25/pyarrow-22.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8382ad21458075c2e66a82a29d650f963ce51c7708c7c0ff313a8c206c4fd5e8", size = 48011148, upload-time = "2025-10-24T10:04:59.585Z" }, + { url = "https://files.pythonhosted.org/packages/c5/b4/7caf5d21930061444c3cf4fa7535c82faf5263e22ce43af7c2759ceb5b8b/pyarrow-22.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:1a812a5b727bc09c3d7ea072c4eebf657c2f7066155506ba31ebf4792f88f016", size = 50276964, upload-time = "2025-10-24T10:05:08.175Z" }, + { url = "https://files.pythonhosted.org/packages/ae/f3/cec89bd99fa3abf826f14d4e53d3d11340ce6f6af4d14bdcd54cd83b6576/pyarrow-22.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:ec5d40dd494882704fb876c16fa7261a69791e784ae34e6b5992e977bd2e238c", size = 28106517, upload-time = "2025-10-24T10:05:14.314Z" }, + { url = "https://files.pythonhosted.org/packages/af/63/ba23862d69652f85b615ca14ad14f3bcfc5bf1b99ef3f0cd04ff93fdad5a/pyarrow-22.0.0-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:bea79263d55c24a32b0d79c00a1c58bb2ee5f0757ed95656b01c0fb310c5af3d", size = 34211578, upload-time = "2025-10-24T10:05:21.583Z" }, + { url = "https://files.pythonhosted.org/packages/b1/d0/f9ad86fe809efd2bcc8be32032fa72e8b0d112b01ae56a053006376c5930/pyarrow-22.0.0-cp312-cp312-macosx_12_0_x86_64.whl", hash = "sha256:12fe549c9b10ac98c91cf791d2945e878875d95508e1a5d14091a7aaa66d9cf8", size = 35989906, upload-time = "2025-10-24T10:05:29.485Z" }, + { url = "https://files.pythonhosted.org/packages/b4/a8/f910afcb14630e64d673f15904ec27dd31f1e009b77033c365c84e8c1e1d/pyarrow-22.0.0-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:334f900ff08ce0423407af97e6c26ad5d4e3b0763645559ece6fbf3747d6a8f5", size = 45021677, upload-time = "2025-10-24T10:05:38.274Z" }, + { url = "https://files.pythonhosted.org/packages/13/95/aec81f781c75cd10554dc17a25849c720d54feafb6f7847690478dcf5ef8/pyarrow-22.0.0-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:c6c791b09c57ed76a18b03f2631753a4960eefbbca80f846da8baefc6491fcfe", size = 47726315, upload-time = "2025-10-24T10:05:47.314Z" }, + { url = "https://files.pythonhosted.org/packages/bb/d4/74ac9f7a54cfde12ee42734ea25d5a3c9a45db78f9def949307a92720d37/pyarrow-22.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:c3200cb41cdbc65156e5f8c908d739b0dfed57e890329413da2748d1a2cd1a4e", size = 47990906, upload-time = "2025-10-24T10:05:58.254Z" }, + { url = "https://files.pythonhosted.org/packages/2e/71/fedf2499bf7a95062eafc989ace56572f3343432570e1c54e6599d5b88da/pyarrow-22.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ac93252226cf288753d8b46280f4edf3433bf9508b6977f8dd8526b521a1bbb9", size = 50306783, upload-time = "2025-10-24T10:06:08.08Z" }, + { url = "https://files.pythonhosted.org/packages/68/ed/b202abd5a5b78f519722f3d29063dda03c114711093c1995a33b8e2e0f4b/pyarrow-22.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:44729980b6c50a5f2bfcc2668d36c569ce17f8b17bccaf470c4313dcbbf13c9d", size = 27972883, upload-time = "2025-10-24T10:06:14.204Z" }, + { url = "https://files.pythonhosted.org/packages/a6/d6/d0fac16a2963002fc22c8fa75180a838737203d558f0ed3b564c4a54eef5/pyarrow-22.0.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:e6e95176209257803a8b3d0394f21604e796dadb643d2f7ca21b66c9c0b30c9a", size = 34204629, upload-time = "2025-10-24T10:06:20.274Z" }, + { url = "https://files.pythonhosted.org/packages/c6/9c/1d6357347fbae062ad3f17082f9ebc29cc733321e892c0d2085f42a2212b/pyarrow-22.0.0-cp313-cp313-macosx_12_0_x86_64.whl", hash = "sha256:001ea83a58024818826a9e3f89bf9310a114f7e26dfe404a4c32686f97bd7901", size = 35985783, upload-time = "2025-10-24T10:06:27.301Z" }, + { url = "https://files.pythonhosted.org/packages/ff/c0/782344c2ce58afbea010150df07e3a2f5fdad299cd631697ae7bd3bac6e3/pyarrow-22.0.0-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:ce20fe000754f477c8a9125543f1936ea5b8867c5406757c224d745ed033e691", size = 45020999, upload-time = "2025-10-24T10:06:35.387Z" }, + { url = "https://files.pythonhosted.org/packages/1b/8b/5362443737a5307a7b67c1017c42cd104213189b4970bf607e05faf9c525/pyarrow-22.0.0-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:e0a15757fccb38c410947df156f9749ae4a3c89b2393741a50521f39a8cf202a", size = 47724601, upload-time = "2025-10-24T10:06:43.551Z" }, + { url = "https://files.pythonhosted.org/packages/69/4d/76e567a4fc2e190ee6072967cb4672b7d9249ac59ae65af2d7e3047afa3b/pyarrow-22.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:cedb9dd9358e4ea1d9bce3665ce0797f6adf97ff142c8e25b46ba9cdd508e9b6", size = 48001050, upload-time = "2025-10-24T10:06:52.284Z" }, + { url = "https://files.pythonhosted.org/packages/01/5e/5653f0535d2a1aef8223cee9d92944cb6bccfee5cf1cd3f462d7cb022790/pyarrow-22.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:252be4a05f9d9185bb8c18e83764ebcfea7185076c07a7a662253af3a8c07941", size = 50307877, upload-time = "2025-10-24T10:07:02.405Z" }, + { url = "https://files.pythonhosted.org/packages/2d/f8/1d0bd75bf9328a3b826e24a16e5517cd7f9fbf8d34a3184a4566ef5a7f29/pyarrow-22.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:a4893d31e5ef780b6edcaf63122df0f8d321088bb0dee4c8c06eccb1ca28d145", size = 27977099, upload-time = "2025-10-24T10:08:07.259Z" }, + { url = "https://files.pythonhosted.org/packages/90/81/db56870c997805bf2b0f6eeeb2d68458bf4654652dccdcf1bf7a42d80903/pyarrow-22.0.0-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:f7fe3dbe871294ba70d789be16b6e7e52b418311e166e0e3cba9522f0f437fb1", size = 34336685, upload-time = "2025-10-24T10:07:11.47Z" }, + { url = "https://files.pythonhosted.org/packages/1c/98/0727947f199aba8a120f47dfc229eeb05df15bcd7a6f1b669e9f882afc58/pyarrow-22.0.0-cp313-cp313t-macosx_12_0_x86_64.whl", hash = "sha256:ba95112d15fd4f1105fb2402c4eab9068f0554435e9b7085924bcfaac2cc306f", size = 36032158, upload-time = "2025-10-24T10:07:18.626Z" }, + { url = "https://files.pythonhosted.org/packages/96/b4/9babdef9c01720a0785945c7cf550e4acd0ebcd7bdd2e6f0aa7981fa85e2/pyarrow-22.0.0-cp313-cp313t-manylinux_2_28_aarch64.whl", hash = "sha256:c064e28361c05d72eed8e744c9605cbd6d2bb7481a511c74071fd9b24bc65d7d", size = 44892060, upload-time = "2025-10-24T10:07:26.002Z" }, + { url = "https://files.pythonhosted.org/packages/f8/ca/2f8804edd6279f78a37062d813de3f16f29183874447ef6d1aadbb4efa0f/pyarrow-22.0.0-cp313-cp313t-manylinux_2_28_x86_64.whl", hash = "sha256:6f9762274496c244d951c819348afbcf212714902742225f649cf02823a6a10f", size = 47504395, upload-time = "2025-10-24T10:07:34.09Z" }, + { url = "https://files.pythonhosted.org/packages/b9/f0/77aa5198fd3943682b2e4faaf179a674f0edea0d55d326d83cb2277d9363/pyarrow-22.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a9d9ffdc2ab696f6b15b4d1f7cec6658e1d788124418cb30030afbae31c64746", size = 48066216, upload-time = "2025-10-24T10:07:43.528Z" }, + { url = "https://files.pythonhosted.org/packages/79/87/a1937b6e78b2aff18b706d738c9e46ade5bfcf11b294e39c87706a0089ac/pyarrow-22.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:ec1a15968a9d80da01e1d30349b2b0d7cc91e96588ee324ce1b5228175043e95", size = 50288552, upload-time = "2025-10-24T10:07:53.519Z" }, + { url = "https://files.pythonhosted.org/packages/60/ae/b5a5811e11f25788ccfdaa8f26b6791c9807119dffcf80514505527c384c/pyarrow-22.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:bba208d9c7decf9961998edf5c65e3ea4355d5818dd6cd0f6809bec1afb951cc", size = 28262504, upload-time = "2025-10-24T10:08:00.932Z" }, + { url = "https://files.pythonhosted.org/packages/bd/b0/0fa4d28a8edb42b0a7144edd20befd04173ac79819547216f8a9f36f9e50/pyarrow-22.0.0-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:9bddc2cade6561f6820d4cd73f99a0243532ad506bc510a75a5a65a522b2d74d", size = 34224062, upload-time = "2025-10-24T10:08:14.101Z" }, + { url = "https://files.pythonhosted.org/packages/0f/a8/7a719076b3c1be0acef56a07220c586f25cd24de0e3f3102b438d18ae5df/pyarrow-22.0.0-cp314-cp314-macosx_12_0_x86_64.whl", hash = "sha256:e70ff90c64419709d38c8932ea9fe1cc98415c4f87ea8da81719e43f02534bc9", size = 35990057, upload-time = "2025-10-24T10:08:21.842Z" }, + { url = "https://files.pythonhosted.org/packages/89/3c/359ed54c93b47fb6fe30ed16cdf50e3f0e8b9ccfb11b86218c3619ae50a8/pyarrow-22.0.0-cp314-cp314-manylinux_2_28_aarch64.whl", hash = "sha256:92843c305330aa94a36e706c16209cd4df274693e777ca47112617db7d0ef3d7", size = 45068002, upload-time = "2025-10-24T10:08:29.034Z" }, + { url = "https://files.pythonhosted.org/packages/55/fc/4945896cc8638536ee787a3bd6ce7cec8ec9acf452d78ec39ab328efa0a1/pyarrow-22.0.0-cp314-cp314-manylinux_2_28_x86_64.whl", hash = "sha256:6dda1ddac033d27421c20d7a7943eec60be44e0db4e079f33cc5af3b8280ccde", size = 47737765, upload-time = "2025-10-24T10:08:38.559Z" }, + { url = "https://files.pythonhosted.org/packages/cd/5e/7cb7edeb2abfaa1f79b5d5eb89432356155c8426f75d3753cbcb9592c0fd/pyarrow-22.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:84378110dd9a6c06323b41b56e129c504d157d1a983ce8f5443761eb5256bafc", size = 48048139, upload-time = "2025-10-24T10:08:46.784Z" }, + { url = "https://files.pythonhosted.org/packages/88/c6/546baa7c48185f5e9d6e59277c4b19f30f48c94d9dd938c2a80d4d6b067c/pyarrow-22.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:854794239111d2b88b40b6ef92aa478024d1e5074f364033e73e21e3f76b25e0", size = 50314244, upload-time = "2025-10-24T10:08:55.771Z" }, + { url = "https://files.pythonhosted.org/packages/3c/79/755ff2d145aafec8d347bf18f95e4e81c00127f06d080135dfc86aea417c/pyarrow-22.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:b883fe6fd85adad7932b3271c38ac289c65b7337c2c132e9569f9d3940620730", size = 28757501, upload-time = "2025-10-24T10:09:59.891Z" }, + { url = "https://files.pythonhosted.org/packages/0e/d2/237d75ac28ced3147912954e3c1a174df43a95f4f88e467809118a8165e0/pyarrow-22.0.0-cp314-cp314t-macosx_12_0_arm64.whl", hash = "sha256:7a820d8ae11facf32585507c11f04e3f38343c1e784c9b5a8b1da5c930547fe2", size = 34355506, upload-time = "2025-10-24T10:09:02.953Z" }, + { url = "https://files.pythonhosted.org/packages/1e/2c/733dfffe6d3069740f98e57ff81007809067d68626c5faef293434d11bd6/pyarrow-22.0.0-cp314-cp314t-macosx_12_0_x86_64.whl", hash = "sha256:c6ec3675d98915bf1ec8b3c7986422682f7232ea76cad276f4c8abd5b7319b70", size = 36047312, upload-time = "2025-10-24T10:09:10.334Z" }, + { url = "https://files.pythonhosted.org/packages/7c/2b/29d6e3782dc1f299727462c1543af357a0f2c1d3c160ce199950d9ca51eb/pyarrow-22.0.0-cp314-cp314t-manylinux_2_28_aarch64.whl", hash = "sha256:3e739edd001b04f654b166204fc7a9de896cf6007eaff33409ee9e50ceaff754", size = 45081609, upload-time = "2025-10-24T10:09:18.61Z" }, + { url = "https://files.pythonhosted.org/packages/8d/42/aa9355ecc05997915af1b7b947a7f66c02dcaa927f3203b87871c114ba10/pyarrow-22.0.0-cp314-cp314t-manylinux_2_28_x86_64.whl", hash = "sha256:7388ac685cab5b279a41dfe0a6ccd99e4dbf322edfb63e02fc0443bf24134e91", size = 47703663, upload-time = "2025-10-24T10:09:27.369Z" }, + { url = "https://files.pythonhosted.org/packages/ee/62/45abedde480168e83a1de005b7b7043fd553321c1e8c5a9a114425f64842/pyarrow-22.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:f633074f36dbc33d5c05b5dc75371e5660f1dbf9c8b1d95669def05e5425989c", size = 48066543, upload-time = "2025-10-24T10:09:34.908Z" }, + { url = "https://files.pythonhosted.org/packages/84/e9/7878940a5b072e4f3bf998770acafeae13b267f9893af5f6d4ab3904b67e/pyarrow-22.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:4c19236ae2402a8663a2c8f21f1870a03cc57f0bef7e4b6eb3238cc82944de80", size = 50288838, upload-time = "2025-10-24T10:09:44.394Z" }, + { url = "https://files.pythonhosted.org/packages/7b/03/f335d6c52b4a4761bcc83499789a1e2e16d9d201a58c327a9b5cc9a41bd9/pyarrow-22.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:0c34fe18094686194f204a3b1787a27456897d8a2d62caf84b61e8dfbc0252ae", size = 29185594, upload-time = "2025-10-24T10:09:53.111Z" }, +] + [[package]] name = "pycodestyle" version = "2.14.0" @@ -2480,6 +4021,15 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/c7/21/705964c7812476f378728bdf590ca4b771ec72385c533964653c68e86bdc/pygments-2.19.2-py3-none-any.whl", hash = "sha256:86540386c03d588bb81d44bc3928634ff26449851e99741617ecb9037ee5ec0b", size = 1225217, upload-time = "2025-06-21T13:39:07.939Z" }, ] +[[package]] +name = "pyparsing" +version = "3.2.5" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/f2/a5/181488fc2b9d093e3972d2a472855aae8a03f000592dbfce716a512b3359/pyparsing-3.2.5.tar.gz", hash = "sha256:2df8d5b7b2802ef88e8d016a2eb9c7aeaa923529cd251ed0fe4608275d4105b6", size = 1099274, upload-time = "2025-09-21T04:11:06.277Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/10/5e/1aa9a93198c6b64513c9d7752de7422c06402de6600a8767da1524f9570b/pyparsing-3.2.5-py3-none-any.whl", hash = "sha256:e38a4f02064cf41fe6593d328d0512495ad1f3d8a91c4f73fc401b3079a59a5e", size = 113890, upload-time = "2025-09-21T04:11:04.117Z" }, +] + [[package]] name = "pytest" version = "8.4.2" @@ -3885,6 +5435,281 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/0b/2c/87f3254fd8ffd29e4c02732eee68a83a1d3c346ae39bc6822dcbcb697f2b/wheel-0.45.1-py3-none-any.whl", hash = "sha256:708e7481cc80179af0e556bbf0cc00b8444c7321e2700b8d8580231d13017248", size = 72494, upload-time = "2024-11-23T00:18:21.207Z" }, ] +[[package]] +name = "xxhash" +version = "3.6.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/02/84/30869e01909fb37a6cc7e18688ee8bf1e42d57e7e0777636bd47524c43c7/xxhash-3.6.0.tar.gz", hash = "sha256:f0162a78b13a0d7617b2845b90c763339d1f1d82bb04a4b07f4ab535cc5e05d6", size = 85160, upload-time = "2025-10-02T14:37:08.097Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/34/ee/f9f1d656ad168681bb0f6b092372c1e533c4416b8069b1896a175c46e484/xxhash-3.6.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:87ff03d7e35c61435976554477a7f4cd1704c3596a89a8300d5ce7fc83874a71", size = 32845, upload-time = "2025-10-02T14:33:51.573Z" }, + { url = "https://files.pythonhosted.org/packages/a3/b1/93508d9460b292c74a09b83d16750c52a0ead89c51eea9951cb97a60d959/xxhash-3.6.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:f572dfd3d0e2eb1a57511831cf6341242f5a9f8298a45862d085f5b93394a27d", size = 30807, upload-time = "2025-10-02T14:33:52.964Z" }, + { url = "https://files.pythonhosted.org/packages/07/55/28c93a3662f2d200c70704efe74aab9640e824f8ce330d8d3943bf7c9b3c/xxhash-3.6.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:89952ea539566b9fed2bbd94e589672794b4286f342254fad28b149f9615fef8", size = 193786, upload-time = "2025-10-02T14:33:54.272Z" }, + { url = "https://files.pythonhosted.org/packages/c1/96/fec0be9bb4b8f5d9c57d76380a366f31a1781fb802f76fc7cda6c84893c7/xxhash-3.6.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:48e6f2ffb07a50b52465a1032c3cf1f4a5683f944acaca8a134a2f23674c2058", size = 212830, upload-time = "2025-10-02T14:33:55.706Z" }, + { url = "https://files.pythonhosted.org/packages/c4/a0/c706845ba77b9611f81fd2e93fad9859346b026e8445e76f8c6fd057cc6d/xxhash-3.6.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b5b848ad6c16d308c3ac7ad4ba6bede80ed5df2ba8ed382f8932df63158dd4b2", size = 211606, upload-time = "2025-10-02T14:33:57.133Z" }, + { url = "https://files.pythonhosted.org/packages/67/1e/164126a2999e5045f04a69257eea946c0dc3e86541b400d4385d646b53d7/xxhash-3.6.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a034590a727b44dd8ac5914236a7b8504144447a9682586c3327e935f33ec8cc", size = 444872, upload-time = "2025-10-02T14:33:58.446Z" }, + { url = "https://files.pythonhosted.org/packages/2d/4b/55ab404c56cd70a2cf5ecfe484838865d0fea5627365c6c8ca156bd09c8f/xxhash-3.6.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8a8f1972e75ebdd161d7896743122834fe87378160c20e97f8b09166213bf8cc", size = 193217, upload-time = "2025-10-02T14:33:59.724Z" }, + { url = "https://files.pythonhosted.org/packages/45/e6/52abf06bac316db33aa269091ae7311bd53cfc6f4b120ae77bac1b348091/xxhash-3.6.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:ee34327b187f002a596d7b167ebc59a1b729e963ce645964bbc050d2f1b73d07", size = 210139, upload-time = "2025-10-02T14:34:02.041Z" }, + { url = "https://files.pythonhosted.org/packages/34/37/db94d490b8691236d356bc249c08819cbcef9273a1a30acf1254ff9ce157/xxhash-3.6.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:339f518c3c7a850dd033ab416ea25a692759dc7478a71131fe8869010d2b75e4", size = 197669, upload-time = "2025-10-02T14:34:03.664Z" }, + { url = "https://files.pythonhosted.org/packages/b7/36/c4f219ef4a17a4f7a64ed3569bc2b5a9c8311abdb22249ac96093625b1a4/xxhash-3.6.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:bf48889c9630542d4709192578aebbd836177c9f7a4a2778a7d6340107c65f06", size = 210018, upload-time = "2025-10-02T14:34:05.325Z" }, + { url = "https://files.pythonhosted.org/packages/fd/06/bfac889a374fc2fc439a69223d1750eed2e18a7db8514737ab630534fa08/xxhash-3.6.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:5576b002a56207f640636056b4160a378fe36a58db73ae5c27a7ec8db35f71d4", size = 413058, upload-time = "2025-10-02T14:34:06.925Z" }, + { url = "https://files.pythonhosted.org/packages/c9/d1/555d8447e0dd32ad0930a249a522bb2e289f0d08b6b16204cfa42c1f5a0c/xxhash-3.6.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:af1f3278bd02814d6dedc5dec397993b549d6f16c19379721e5a1d31e132c49b", size = 190628, upload-time = "2025-10-02T14:34:08.669Z" }, + { url = "https://files.pythonhosted.org/packages/d1/15/8751330b5186cedc4ed4b597989882ea05e0408b53fa47bcb46a6125bfc6/xxhash-3.6.0-cp310-cp310-win32.whl", hash = "sha256:aed058764db109dc9052720da65fafe84873b05eb8b07e5e653597951af57c3b", size = 30577, upload-time = "2025-10-02T14:34:10.234Z" }, + { url = "https://files.pythonhosted.org/packages/bb/cc/53f87e8b5871a6eb2ff7e89c48c66093bda2be52315a8161ddc54ea550c4/xxhash-3.6.0-cp310-cp310-win_amd64.whl", hash = "sha256:e82da5670f2d0d98950317f82a0e4a0197150ff19a6df2ba40399c2a3b9ae5fb", size = 31487, upload-time = "2025-10-02T14:34:11.618Z" }, + { url = "https://files.pythonhosted.org/packages/9f/00/60f9ea3bb697667a14314d7269956f58bf56bb73864f8f8d52a3c2535e9a/xxhash-3.6.0-cp310-cp310-win_arm64.whl", hash = "sha256:4a082ffff8c6ac07707fb6b671caf7c6e020c75226c561830b73d862060f281d", size = 27863, upload-time = "2025-10-02T14:34:12.619Z" }, + { url = "https://files.pythonhosted.org/packages/17/d4/cc2f0400e9154df4b9964249da78ebd72f318e35ccc425e9f403c392f22a/xxhash-3.6.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:b47bbd8cf2d72797f3c2772eaaac0ded3d3af26481a26d7d7d41dc2d3c46b04a", size = 32844, upload-time = "2025-10-02T14:34:14.037Z" }, + { url = "https://files.pythonhosted.org/packages/5e/ec/1cc11cd13e26ea8bc3cb4af4eaadd8d46d5014aebb67be3f71fb0b68802a/xxhash-3.6.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2b6821e94346f96db75abaa6e255706fb06ebd530899ed76d32cd99f20dc52fa", size = 30809, upload-time = "2025-10-02T14:34:15.484Z" }, + { url = "https://files.pythonhosted.org/packages/04/5f/19fe357ea348d98ca22f456f75a30ac0916b51c753e1f8b2e0e6fb884cce/xxhash-3.6.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:d0a9751f71a1a65ce3584e9cae4467651c7e70c9d31017fa57574583a4540248", size = 194665, upload-time = "2025-10-02T14:34:16.541Z" }, + { url = "https://files.pythonhosted.org/packages/90/3b/d1f1a8f5442a5fd8beedae110c5af7604dc37349a8e16519c13c19a9a2de/xxhash-3.6.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8b29ee68625ab37b04c0b40c3fafdf24d2f75ccd778333cfb698f65f6c463f62", size = 213550, upload-time = "2025-10-02T14:34:17.878Z" }, + { url = "https://files.pythonhosted.org/packages/c4/ef/3a9b05eb527457d5db13a135a2ae1a26c80fecd624d20f3e8dcc4cb170f3/xxhash-3.6.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:6812c25fe0d6c36a46ccb002f40f27ac903bf18af9f6dd8f9669cb4d176ab18f", size = 212384, upload-time = "2025-10-02T14:34:19.182Z" }, + { url = "https://files.pythonhosted.org/packages/0f/18/ccc194ee698c6c623acbf0f8c2969811a8a4b6185af5e824cd27b9e4fd3e/xxhash-3.6.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:4ccbff013972390b51a18ef1255ef5ac125c92dc9143b2d1909f59abc765540e", size = 445749, upload-time = "2025-10-02T14:34:20.659Z" }, + { url = "https://files.pythonhosted.org/packages/a5/86/cf2c0321dc3940a7aa73076f4fd677a0fb3e405cb297ead7d864fd90847e/xxhash-3.6.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:297b7fbf86c82c550e12e8fb71968b3f033d27b874276ba3624ea868c11165a8", size = 193880, upload-time = "2025-10-02T14:34:22.431Z" }, + { url = "https://files.pythonhosted.org/packages/82/fb/96213c8560e6f948a1ecc9a7613f8032b19ee45f747f4fca4eb31bb6d6ed/xxhash-3.6.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:dea26ae1eb293db089798d3973a5fc928a18fdd97cc8801226fae705b02b14b0", size = 210912, upload-time = "2025-10-02T14:34:23.937Z" }, + { url = "https://files.pythonhosted.org/packages/40/aa/4395e669b0606a096d6788f40dbdf2b819d6773aa290c19e6e83cbfc312f/xxhash-3.6.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:7a0b169aafb98f4284f73635a8e93f0735f9cbde17bd5ec332480484241aaa77", size = 198654, upload-time = "2025-10-02T14:34:25.644Z" }, + { url = "https://files.pythonhosted.org/packages/67/74/b044fcd6b3d89e9b1b665924d85d3f400636c23590226feb1eb09e1176ce/xxhash-3.6.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:08d45aef063a4531b785cd72de4887766d01dc8f362a515693df349fdb825e0c", size = 210867, upload-time = "2025-10-02T14:34:27.203Z" }, + { url = "https://files.pythonhosted.org/packages/bc/fd/3ce73bf753b08cb19daee1eb14aa0d7fe331f8da9c02dd95316ddfe5275e/xxhash-3.6.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:929142361a48ee07f09121fe9e96a84950e8d4df3bb298ca5d88061969f34d7b", size = 414012, upload-time = "2025-10-02T14:34:28.409Z" }, + { url = "https://files.pythonhosted.org/packages/ba/b3/5a4241309217c5c876f156b10778f3ab3af7ba7e3259e6d5f5c7d0129eb2/xxhash-3.6.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:51312c768403d8540487dbbfb557454cfc55589bbde6424456951f7fcd4facb3", size = 191409, upload-time = "2025-10-02T14:34:29.696Z" }, + { url = "https://files.pythonhosted.org/packages/c0/01/99bfbc15fb9abb9a72b088c1d95219fc4782b7d01fc835bd5744d66dd0b8/xxhash-3.6.0-cp311-cp311-win32.whl", hash = "sha256:d1927a69feddc24c987b337ce81ac15c4720955b667fe9b588e02254b80446fd", size = 30574, upload-time = "2025-10-02T14:34:31.028Z" }, + { url = "https://files.pythonhosted.org/packages/65/79/9d24d7f53819fe301b231044ea362ce64e86c74f6e8c8e51320de248b3e5/xxhash-3.6.0-cp311-cp311-win_amd64.whl", hash = "sha256:26734cdc2d4ffe449b41d186bbeac416f704a482ed835d375a5c0cb02bc63fef", size = 31481, upload-time = "2025-10-02T14:34:32.062Z" }, + { url = "https://files.pythonhosted.org/packages/30/4e/15cd0e3e8772071344eab2961ce83f6e485111fed8beb491a3f1ce100270/xxhash-3.6.0-cp311-cp311-win_arm64.whl", hash = "sha256:d72f67ef8bf36e05f5b6c65e8524f265bd61071471cd4cf1d36743ebeeeb06b7", size = 27861, upload-time = "2025-10-02T14:34:33.555Z" }, + { url = "https://files.pythonhosted.org/packages/9a/07/d9412f3d7d462347e4511181dea65e47e0d0e16e26fbee2ea86a2aefb657/xxhash-3.6.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:01362c4331775398e7bb34e3ab403bc9ee9f7c497bc7dee6272114055277dd3c", size = 32744, upload-time = "2025-10-02T14:34:34.622Z" }, + { url = "https://files.pythonhosted.org/packages/79/35/0429ee11d035fc33abe32dca1b2b69e8c18d236547b9a9b72c1929189b9a/xxhash-3.6.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:b7b2df81a23f8cb99656378e72501b2cb41b1827c0f5a86f87d6b06b69f9f204", size = 30816, upload-time = "2025-10-02T14:34:36.043Z" }, + { url = "https://files.pythonhosted.org/packages/b7/f2/57eb99aa0f7d98624c0932c5b9a170e1806406cdbcdb510546634a1359e0/xxhash-3.6.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:dc94790144e66b14f67b10ac8ed75b39ca47536bf8800eb7c24b50271ea0c490", size = 194035, upload-time = "2025-10-02T14:34:37.354Z" }, + { url = "https://files.pythonhosted.org/packages/4c/ed/6224ba353690d73af7a3f1c7cdb1fc1b002e38f783cb991ae338e1eb3d79/xxhash-3.6.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:93f107c673bccf0d592cdba077dedaf52fe7f42dcd7676eba1f6d6f0c3efffd2", size = 212914, upload-time = "2025-10-02T14:34:38.6Z" }, + { url = "https://files.pythonhosted.org/packages/38/86/fb6b6130d8dd6b8942cc17ab4d90e223653a89aa32ad2776f8af7064ed13/xxhash-3.6.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2aa5ee3444c25b69813663c9f8067dcfaa2e126dc55e8dddf40f4d1c25d7effa", size = 212163, upload-time = "2025-10-02T14:34:39.872Z" }, + { url = "https://files.pythonhosted.org/packages/ee/dc/e84875682b0593e884ad73b2d40767b5790d417bde603cceb6878901d647/xxhash-3.6.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:f7f99123f0e1194fa59cc69ad46dbae2e07becec5df50a0509a808f90a0f03f0", size = 445411, upload-time = "2025-10-02T14:34:41.569Z" }, + { url = "https://files.pythonhosted.org/packages/11/4f/426f91b96701ec2f37bb2b8cec664eff4f658a11f3fa9d94f0a887ea6d2b/xxhash-3.6.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:49e03e6fe2cac4a1bc64952dd250cf0dbc5ef4ebb7b8d96bce82e2de163c82a2", size = 193883, upload-time = "2025-10-02T14:34:43.249Z" }, + { url = "https://files.pythonhosted.org/packages/53/5a/ddbb83eee8e28b778eacfc5a85c969673e4023cdeedcfcef61f36731610b/xxhash-3.6.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:bd17fede52a17a4f9a7bc4472a5867cb0b160deeb431795c0e4abe158bc784e9", size = 210392, upload-time = "2025-10-02T14:34:45.042Z" }, + { url = "https://files.pythonhosted.org/packages/1e/c2/ff69efd07c8c074ccdf0a4f36fcdd3d27363665bcdf4ba399abebe643465/xxhash-3.6.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:6fb5f5476bef678f69db04f2bd1efbed3030d2aba305b0fc1773645f187d6a4e", size = 197898, upload-time = "2025-10-02T14:34:46.302Z" }, + { url = "https://files.pythonhosted.org/packages/58/ca/faa05ac19b3b622c7c9317ac3e23954187516298a091eb02c976d0d3dd45/xxhash-3.6.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:843b52f6d88071f87eba1631b684fcb4b2068cd2180a0224122fe4ef011a9374", size = 210655, upload-time = "2025-10-02T14:34:47.571Z" }, + { url = "https://files.pythonhosted.org/packages/d4/7a/06aa7482345480cc0cb597f5c875b11a82c3953f534394f620b0be2f700c/xxhash-3.6.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:7d14a6cfaf03b1b6f5f9790f76880601ccc7896aff7ab9cd8978a939c1eb7e0d", size = 414001, upload-time = "2025-10-02T14:34:49.273Z" }, + { url = "https://files.pythonhosted.org/packages/23/07/63ffb386cd47029aa2916b3d2f454e6cc5b9f5c5ada3790377d5430084e7/xxhash-3.6.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:418daf3db71e1413cfe211c2f9a528456936645c17f46b5204705581a45390ae", size = 191431, upload-time = "2025-10-02T14:34:50.798Z" }, + { url = "https://files.pythonhosted.org/packages/0f/93/14fde614cadb4ddf5e7cebf8918b7e8fac5ae7861c1875964f17e678205c/xxhash-3.6.0-cp312-cp312-win32.whl", hash = "sha256:50fc255f39428a27299c20e280d6193d8b63b8ef8028995323bf834a026b4fbb", size = 30617, upload-time = "2025-10-02T14:34:51.954Z" }, + { url = "https://files.pythonhosted.org/packages/13/5d/0d125536cbe7565a83d06e43783389ecae0c0f2ed037b48ede185de477c0/xxhash-3.6.0-cp312-cp312-win_amd64.whl", hash = "sha256:c0f2ab8c715630565ab8991b536ecded9416d615538be8ecddce43ccf26cbc7c", size = 31534, upload-time = "2025-10-02T14:34:53.276Z" }, + { url = "https://files.pythonhosted.org/packages/54/85/6ec269b0952ec7e36ba019125982cf11d91256a778c7c3f98a4c5043d283/xxhash-3.6.0-cp312-cp312-win_arm64.whl", hash = "sha256:eae5c13f3bc455a3bbb68bdc513912dc7356de7e2280363ea235f71f54064829", size = 27876, upload-time = "2025-10-02T14:34:54.371Z" }, + { url = "https://files.pythonhosted.org/packages/33/76/35d05267ac82f53ae9b0e554da7c5e281ee61f3cad44c743f0fcd354f211/xxhash-3.6.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:599e64ba7f67472481ceb6ee80fa3bd828fd61ba59fb11475572cc5ee52b89ec", size = 32738, upload-time = "2025-10-02T14:34:55.839Z" }, + { url = "https://files.pythonhosted.org/packages/31/a8/3fbce1cd96534a95e35d5120637bf29b0d7f5d8fa2f6374e31b4156dd419/xxhash-3.6.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:7d8b8aaa30fca4f16f0c84a5c8d7ddee0e25250ec2796c973775373257dde8f1", size = 30821, upload-time = "2025-10-02T14:34:57.219Z" }, + { url = "https://files.pythonhosted.org/packages/0c/ea/d387530ca7ecfa183cb358027f1833297c6ac6098223fd14f9782cd0015c/xxhash-3.6.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:d597acf8506d6e7101a4a44a5e428977a51c0fadbbfd3c39650cca9253f6e5a6", size = 194127, upload-time = "2025-10-02T14:34:59.21Z" }, + { url = "https://files.pythonhosted.org/packages/ba/0c/71435dcb99874b09a43b8d7c54071e600a7481e42b3e3ce1eb5226a5711a/xxhash-3.6.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:858dc935963a33bc33490128edc1c12b0c14d9c7ebaa4e387a7869ecc4f3e263", size = 212975, upload-time = "2025-10-02T14:35:00.816Z" }, + { url = "https://files.pythonhosted.org/packages/84/7a/c2b3d071e4bb4a90b7057228a99b10d51744878f4a8a6dd643c8bd897620/xxhash-3.6.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ba284920194615cb8edf73bf52236ce2e1664ccd4a38fdb543506413529cc546", size = 212241, upload-time = "2025-10-02T14:35:02.207Z" }, + { url = "https://files.pythonhosted.org/packages/81/5f/640b6eac0128e215f177df99eadcd0f1b7c42c274ab6a394a05059694c5a/xxhash-3.6.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:4b54219177f6c6674d5378bd862c6aedf64725f70dd29c472eaae154df1a2e89", size = 445471, upload-time = "2025-10-02T14:35:03.61Z" }, + { url = "https://files.pythonhosted.org/packages/5e/1e/3c3d3ef071b051cc3abbe3721ffb8365033a172613c04af2da89d5548a87/xxhash-3.6.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:42c36dd7dbad2f5238950c377fcbf6811b1cdb1c444fab447960030cea60504d", size = 193936, upload-time = "2025-10-02T14:35:05.013Z" }, + { url = "https://files.pythonhosted.org/packages/2c/bd/4a5f68381939219abfe1c22a9e3a5854a4f6f6f3c4983a87d255f21f2e5d/xxhash-3.6.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f22927652cba98c44639ffdc7aaf35828dccf679b10b31c4ad72a5b530a18eb7", size = 210440, upload-time = "2025-10-02T14:35:06.239Z" }, + { url = "https://files.pythonhosted.org/packages/eb/37/b80fe3d5cfb9faff01a02121a0f4d565eb7237e9e5fc66e73017e74dcd36/xxhash-3.6.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b45fad44d9c5c119e9c6fbf2e1c656a46dc68e280275007bbfd3d572b21426db", size = 197990, upload-time = "2025-10-02T14:35:07.735Z" }, + { url = "https://files.pythonhosted.org/packages/d7/fd/2c0a00c97b9e18f72e1f240ad4e8f8a90fd9d408289ba9c7c495ed7dc05c/xxhash-3.6.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:6f2580ffab1a8b68ef2b901cde7e55fa8da5e4be0977c68f78fc80f3c143de42", size = 210689, upload-time = "2025-10-02T14:35:09.438Z" }, + { url = "https://files.pythonhosted.org/packages/93/86/5dd8076a926b9a95db3206aba20d89a7fc14dd5aac16e5c4de4b56033140/xxhash-3.6.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:40c391dd3cd041ebc3ffe6f2c862f402e306eb571422e0aa918d8070ba31da11", size = 414068, upload-time = "2025-10-02T14:35:11.162Z" }, + { url = "https://files.pythonhosted.org/packages/af/3c/0bb129170ee8f3650f08e993baee550a09593462a5cddd8e44d0011102b1/xxhash-3.6.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f205badabde7aafd1a31e8ca2a3e5a763107a71c397c4481d6a804eb5063d8bd", size = 191495, upload-time = "2025-10-02T14:35:12.971Z" }, + { url = "https://files.pythonhosted.org/packages/e9/3a/6797e0114c21d1725e2577508e24006fd7ff1d8c0c502d3b52e45c1771d8/xxhash-3.6.0-cp313-cp313-win32.whl", hash = "sha256:2577b276e060b73b73a53042ea5bd5203d3e6347ce0d09f98500f418a9fcf799", size = 30620, upload-time = "2025-10-02T14:35:14.129Z" }, + { url = "https://files.pythonhosted.org/packages/86/15/9bc32671e9a38b413a76d24722a2bf8784a132c043063a8f5152d390b0f9/xxhash-3.6.0-cp313-cp313-win_amd64.whl", hash = "sha256:757320d45d2fbcce8f30c42a6b2f47862967aea7bf458b9625b4bbe7ee390392", size = 31542, upload-time = "2025-10-02T14:35:15.21Z" }, + { url = "https://files.pythonhosted.org/packages/39/c5/cc01e4f6188656e56112d6a8e0dfe298a16934b8c47a247236549a3f7695/xxhash-3.6.0-cp313-cp313-win_arm64.whl", hash = "sha256:457b8f85dec5825eed7b69c11ae86834a018b8e3df5e77783c999663da2f96d6", size = 27880, upload-time = "2025-10-02T14:35:16.315Z" }, + { url = "https://files.pythonhosted.org/packages/f3/30/25e5321c8732759e930c555176d37e24ab84365482d257c3b16362235212/xxhash-3.6.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:a42e633d75cdad6d625434e3468126c73f13f7584545a9cf34e883aa1710e702", size = 32956, upload-time = "2025-10-02T14:35:17.413Z" }, + { url = "https://files.pythonhosted.org/packages/9f/3c/0573299560d7d9f8ab1838f1efc021a280b5ae5ae2e849034ef3dee18810/xxhash-3.6.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:568a6d743219e717b07b4e03b0a828ce593833e498c3b64752e0f5df6bfe84db", size = 31072, upload-time = "2025-10-02T14:35:18.844Z" }, + { url = "https://files.pythonhosted.org/packages/7a/1c/52d83a06e417cd9d4137722693424885cc9878249beb3a7c829e74bf7ce9/xxhash-3.6.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:bec91b562d8012dae276af8025a55811b875baace6af510412a5e58e3121bc54", size = 196409, upload-time = "2025-10-02T14:35:20.31Z" }, + { url = "https://files.pythonhosted.org/packages/e3/8e/c6d158d12a79bbd0b878f8355432075fc82759e356ab5a111463422a239b/xxhash-3.6.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:78e7f2f4c521c30ad5e786fdd6bae89d47a32672a80195467b5de0480aa97b1f", size = 215736, upload-time = "2025-10-02T14:35:21.616Z" }, + { url = "https://files.pythonhosted.org/packages/bc/68/c4c80614716345d55071a396cf03d06e34b5f4917a467faf43083c995155/xxhash-3.6.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3ed0df1b11a79856df5ffcab572cbd6b9627034c1c748c5566fa79df9048a7c5", size = 214833, upload-time = "2025-10-02T14:35:23.32Z" }, + { url = "https://files.pythonhosted.org/packages/7e/e9/ae27c8ffec8b953efa84c7c4a6c6802c263d587b9fc0d6e7cea64e08c3af/xxhash-3.6.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0e4edbfc7d420925b0dd5e792478ed393d6e75ff8fc219a6546fb446b6a417b1", size = 448348, upload-time = "2025-10-02T14:35:25.111Z" }, + { url = "https://files.pythonhosted.org/packages/d7/6b/33e21afb1b5b3f46b74b6bd1913639066af218d704cc0941404ca717fc57/xxhash-3.6.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fba27a198363a7ef87f8c0f6b171ec36b674fe9053742c58dd7e3201c1ab30ee", size = 196070, upload-time = "2025-10-02T14:35:26.586Z" }, + { url = "https://files.pythonhosted.org/packages/96/b6/fcabd337bc5fa624e7203aa0fa7d0c49eed22f72e93229431752bddc83d9/xxhash-3.6.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:794fe9145fe60191c6532fa95063765529770edcdd67b3d537793e8004cabbfd", size = 212907, upload-time = "2025-10-02T14:35:28.087Z" }, + { url = "https://files.pythonhosted.org/packages/4b/d3/9ee6160e644d660fcf176c5825e61411c7f62648728f69c79ba237250143/xxhash-3.6.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:6105ef7e62b5ac73a837778efc331a591d8442f8ef5c7e102376506cb4ae2729", size = 200839, upload-time = "2025-10-02T14:35:29.857Z" }, + { url = "https://files.pythonhosted.org/packages/0d/98/e8de5baa5109394baf5118f5e72ab21a86387c4f89b0e77ef3e2f6b0327b/xxhash-3.6.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:f01375c0e55395b814a679b3eea205db7919ac2af213f4a6682e01220e5fe292", size = 213304, upload-time = "2025-10-02T14:35:31.222Z" }, + { url = "https://files.pythonhosted.org/packages/7b/1d/71056535dec5c3177eeb53e38e3d367dd1d16e024e63b1cee208d572a033/xxhash-3.6.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:d706dca2d24d834a4661619dcacf51a75c16d65985718d6a7d73c1eeeb903ddf", size = 416930, upload-time = "2025-10-02T14:35:32.517Z" }, + { url = "https://files.pythonhosted.org/packages/dc/6c/5cbde9de2cd967c322e651c65c543700b19e7ae3e0aae8ece3469bf9683d/xxhash-3.6.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:5f059d9faeacd49c0215d66f4056e1326c80503f51a1532ca336a385edadd033", size = 193787, upload-time = "2025-10-02T14:35:33.827Z" }, + { url = "https://files.pythonhosted.org/packages/19/fa/0172e350361d61febcea941b0cc541d6e6c8d65d153e85f850a7b256ff8a/xxhash-3.6.0-cp313-cp313t-win32.whl", hash = "sha256:1244460adc3a9be84731d72b8e80625788e5815b68da3da8b83f78115a40a7ec", size = 30916, upload-time = "2025-10-02T14:35:35.107Z" }, + { url = "https://files.pythonhosted.org/packages/ad/e6/e8cf858a2b19d6d45820f072eff1bea413910592ff17157cabc5f1227a16/xxhash-3.6.0-cp313-cp313t-win_amd64.whl", hash = "sha256:b1e420ef35c503869c4064f4a2f2b08ad6431ab7b229a05cce39d74268bca6b8", size = 31799, upload-time = "2025-10-02T14:35:36.165Z" }, + { url = "https://files.pythonhosted.org/packages/56/15/064b197e855bfb7b343210e82490ae672f8bc7cdf3ddb02e92f64304ee8a/xxhash-3.6.0-cp313-cp313t-win_arm64.whl", hash = "sha256:ec44b73a4220623235f67a996c862049f375df3b1052d9899f40a6382c32d746", size = 28044, upload-time = "2025-10-02T14:35:37.195Z" }, + { url = "https://files.pythonhosted.org/packages/7e/5e/0138bc4484ea9b897864d59fce9be9086030825bc778b76cb5a33a906d37/xxhash-3.6.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:a40a3d35b204b7cc7643cbcf8c9976d818cb47befcfac8bbefec8038ac363f3e", size = 32754, upload-time = "2025-10-02T14:35:38.245Z" }, + { url = "https://files.pythonhosted.org/packages/18/d7/5dac2eb2ec75fd771957a13e5dda560efb2176d5203f39502a5fc571f899/xxhash-3.6.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:a54844be970d3fc22630b32d515e79a90d0a3ddb2644d8d7402e3c4c8da61405", size = 30846, upload-time = "2025-10-02T14:35:39.6Z" }, + { url = "https://files.pythonhosted.org/packages/fe/71/8bc5be2bb00deb5682e92e8da955ebe5fa982da13a69da5a40a4c8db12fb/xxhash-3.6.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:016e9190af8f0a4e3741343777710e3d5717427f175adfdc3e72508f59e2a7f3", size = 194343, upload-time = "2025-10-02T14:35:40.69Z" }, + { url = "https://files.pythonhosted.org/packages/e7/3b/52badfb2aecec2c377ddf1ae75f55db3ba2d321c5e164f14461c90837ef3/xxhash-3.6.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4f6f72232f849eb9d0141e2ebe2677ece15adfd0fa599bc058aad83c714bb2c6", size = 213074, upload-time = "2025-10-02T14:35:42.29Z" }, + { url = "https://files.pythonhosted.org/packages/a2/2b/ae46b4e9b92e537fa30d03dbc19cdae57ed407e9c26d163895e968e3de85/xxhash-3.6.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:63275a8aba7865e44b1813d2177e0f5ea7eadad3dd063a21f7cf9afdc7054063", size = 212388, upload-time = "2025-10-02T14:35:43.929Z" }, + { url = "https://files.pythonhosted.org/packages/f5/80/49f88d3afc724b4ac7fbd664c8452d6db51b49915be48c6982659e0e7942/xxhash-3.6.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:3cd01fa2aa00d8b017c97eb46b9a794fbdca53fc14f845f5a328c71254b0abb7", size = 445614, upload-time = "2025-10-02T14:35:45.216Z" }, + { url = "https://files.pythonhosted.org/packages/ed/ba/603ce3961e339413543d8cd44f21f2c80e2a7c5cfe692a7b1f2cccf58f3c/xxhash-3.6.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0226aa89035b62b6a86d3c68df4d7c1f47a342b8683da2b60cedcddb46c4d95b", size = 194024, upload-time = "2025-10-02T14:35:46.959Z" }, + { url = "https://files.pythonhosted.org/packages/78/d1/8e225ff7113bf81545cfdcd79eef124a7b7064a0bba53605ff39590b95c2/xxhash-3.6.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c6e193e9f56e4ca4923c61238cdaced324f0feac782544eb4c6d55ad5cc99ddd", size = 210541, upload-time = "2025-10-02T14:35:48.301Z" }, + { url = "https://files.pythonhosted.org/packages/6f/58/0f89d149f0bad89def1a8dd38feb50ccdeb643d9797ec84707091d4cb494/xxhash-3.6.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:9176dcaddf4ca963d4deb93866d739a343c01c969231dbe21680e13a5d1a5bf0", size = 198305, upload-time = "2025-10-02T14:35:49.584Z" }, + { url = "https://files.pythonhosted.org/packages/11/38/5eab81580703c4df93feb5f32ff8fa7fe1e2c51c1f183ee4e48d4bb9d3d7/xxhash-3.6.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:c1ce4009c97a752e682b897aa99aef84191077a9433eb237774689f14f8ec152", size = 210848, upload-time = "2025-10-02T14:35:50.877Z" }, + { url = "https://files.pythonhosted.org/packages/5e/6b/953dc4b05c3ce678abca756416e4c130d2382f877a9c30a20d08ee6a77c0/xxhash-3.6.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:8cb2f4f679b01513b7adbb9b1b2f0f9cdc31b70007eaf9d59d0878809f385b11", size = 414142, upload-time = "2025-10-02T14:35:52.15Z" }, + { url = "https://files.pythonhosted.org/packages/08/a9/238ec0d4e81a10eb5026d4a6972677cbc898ba6c8b9dbaec12ae001b1b35/xxhash-3.6.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:653a91d7c2ab54a92c19ccf43508b6a555440b9be1bc8be553376778be7f20b5", size = 191547, upload-time = "2025-10-02T14:35:53.547Z" }, + { url = "https://files.pythonhosted.org/packages/f1/ee/3cf8589e06c2164ac77c3bf0aa127012801128f1feebf2a079272da5737c/xxhash-3.6.0-cp314-cp314-win32.whl", hash = "sha256:a756fe893389483ee8c394d06b5ab765d96e68fbbfe6fde7aa17e11f5720559f", size = 31214, upload-time = "2025-10-02T14:35:54.746Z" }, + { url = "https://files.pythonhosted.org/packages/02/5d/a19552fbc6ad4cb54ff953c3908bbc095f4a921bc569433d791f755186f1/xxhash-3.6.0-cp314-cp314-win_amd64.whl", hash = "sha256:39be8e4e142550ef69629c9cd71b88c90e9a5db703fecbcf265546d9536ca4ad", size = 32290, upload-time = "2025-10-02T14:35:55.791Z" }, + { url = "https://files.pythonhosted.org/packages/b1/11/dafa0643bc30442c887b55baf8e73353a344ee89c1901b5a5c54a6c17d39/xxhash-3.6.0-cp314-cp314-win_arm64.whl", hash = "sha256:25915e6000338999236f1eb68a02a32c3275ac338628a7eaa5a269c401995679", size = 28795, upload-time = "2025-10-02T14:35:57.162Z" }, + { url = "https://files.pythonhosted.org/packages/2c/db/0e99732ed7f64182aef4a6fb145e1a295558deec2a746265dcdec12d191e/xxhash-3.6.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:c5294f596a9017ca5a3e3f8884c00b91ab2ad2933cf288f4923c3fd4346cf3d4", size = 32955, upload-time = "2025-10-02T14:35:58.267Z" }, + { url = "https://files.pythonhosted.org/packages/55/f4/2a7c3c68e564a099becfa44bb3d398810cc0ff6749b0d3cb8ccb93f23c14/xxhash-3.6.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:1cf9dcc4ab9cff01dfbba78544297a3a01dafd60f3bde4e2bfd016cf7e4ddc67", size = 31072, upload-time = "2025-10-02T14:35:59.382Z" }, + { url = "https://files.pythonhosted.org/packages/c6/d9/72a29cddc7250e8a5819dad5d466facb5dc4c802ce120645630149127e73/xxhash-3.6.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:01262da8798422d0685f7cef03b2bd3f4f46511b02830861df548d7def4402ad", size = 196579, upload-time = "2025-10-02T14:36:00.838Z" }, + { url = "https://files.pythonhosted.org/packages/63/93/b21590e1e381040e2ca305a884d89e1c345b347404f7780f07f2cdd47ef4/xxhash-3.6.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:51a73fb7cb3a3ead9f7a8b583ffd9b8038e277cdb8cb87cf890e88b3456afa0b", size = 215854, upload-time = "2025-10-02T14:36:02.207Z" }, + { url = "https://files.pythonhosted.org/packages/ce/b8/edab8a7d4fa14e924b29be877d54155dcbd8b80be85ea00d2be3413a9ed4/xxhash-3.6.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b9c6df83594f7df8f7f708ce5ebeacfc69f72c9fbaaababf6cf4758eaada0c9b", size = 214965, upload-time = "2025-10-02T14:36:03.507Z" }, + { url = "https://files.pythonhosted.org/packages/27/67/dfa980ac7f0d509d54ea0d5a486d2bb4b80c3f1bb22b66e6a05d3efaf6c0/xxhash-3.6.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:627f0af069b0ea56f312fd5189001c24578868643203bca1abbc2c52d3a6f3ca", size = 448484, upload-time = "2025-10-02T14:36:04.828Z" }, + { url = "https://files.pythonhosted.org/packages/8c/63/8ffc2cc97e811c0ca5d00ab36604b3ea6f4254f20b7bc658ca825ce6c954/xxhash-3.6.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aa912c62f842dfd013c5f21a642c9c10cd9f4c4e943e0af83618b4a404d9091a", size = 196162, upload-time = "2025-10-02T14:36:06.182Z" }, + { url = "https://files.pythonhosted.org/packages/4b/77/07f0e7a3edd11a6097e990f6e5b815b6592459cb16dae990d967693e6ea9/xxhash-3.6.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:b465afd7909db30168ab62afe40b2fcf79eedc0b89a6c0ab3123515dc0df8b99", size = 213007, upload-time = "2025-10-02T14:36:07.733Z" }, + { url = "https://files.pythonhosted.org/packages/ae/d8/bc5fa0d152837117eb0bef6f83f956c509332ce133c91c63ce07ee7c4873/xxhash-3.6.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:a881851cf38b0a70e7c4d3ce81fc7afd86fbc2a024f4cfb2a97cf49ce04b75d3", size = 200956, upload-time = "2025-10-02T14:36:09.106Z" }, + { url = "https://files.pythonhosted.org/packages/26/a5/d749334130de9411783873e9b98ecc46688dad5db64ca6e04b02acc8b473/xxhash-3.6.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:9b3222c686a919a0f3253cfc12bb118b8b103506612253b5baeaac10d8027cf6", size = 213401, upload-time = "2025-10-02T14:36:10.585Z" }, + { url = "https://files.pythonhosted.org/packages/89/72/abed959c956a4bfc72b58c0384bb7940663c678127538634d896b1195c10/xxhash-3.6.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:c5aa639bc113e9286137cec8fadc20e9cd732b2cc385c0b7fa673b84fc1f2a93", size = 417083, upload-time = "2025-10-02T14:36:12.276Z" }, + { url = "https://files.pythonhosted.org/packages/0c/b3/62fd2b586283b7d7d665fb98e266decadf31f058f1cf6c478741f68af0cb/xxhash-3.6.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:5c1343d49ac102799905e115aee590183c3921d475356cb24b4de29a4bc56518", size = 193913, upload-time = "2025-10-02T14:36:14.025Z" }, + { url = "https://files.pythonhosted.org/packages/9a/9a/c19c42c5b3f5a4aad748a6d5b4f23df3bed7ee5445accc65a0fb3ff03953/xxhash-3.6.0-cp314-cp314t-win32.whl", hash = "sha256:5851f033c3030dd95c086b4a36a2683c2ff4a799b23af60977188b057e467119", size = 31586, upload-time = "2025-10-02T14:36:15.603Z" }, + { url = "https://files.pythonhosted.org/packages/03/d6/4cc450345be9924fd5dc8c590ceda1db5b43a0a889587b0ae81a95511360/xxhash-3.6.0-cp314-cp314t-win_amd64.whl", hash = "sha256:0444e7967dac37569052d2409b00a8860c2135cff05502df4da80267d384849f", size = 32526, upload-time = "2025-10-02T14:36:16.708Z" }, + { url = "https://files.pythonhosted.org/packages/0f/c9/7243eb3f9eaabd1a88a5a5acadf06df2d83b100c62684b7425c6a11bcaa8/xxhash-3.6.0-cp314-cp314t-win_arm64.whl", hash = "sha256:bb79b1e63f6fd84ec778a4b1916dfe0a7c3fdb986c06addd5db3a0d413819d95", size = 28898, upload-time = "2025-10-02T14:36:17.843Z" }, + { url = "https://files.pythonhosted.org/packages/03/ff/1b4bb3f397552116c1df6266c1b83a21aeeb26061ab1f462984b499a3870/xxhash-3.6.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:cc604dc06027dbeb8281aeac5899c35fcfe7c77b25212833709f0bff4ce74d2a", size = 32844, upload-time = "2025-10-02T14:36:39.157Z" }, + { url = "https://files.pythonhosted.org/packages/c1/db/27146d0bee4346a9a31f7b498a81fc02747f6f1e6c52a2e7989504278051/xxhash-3.6.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:277175a73900ad43a8caeb8b99b9604f21fe8d7c842f2f9061a364a7e220ddb7", size = 30806, upload-time = "2025-10-02T14:36:40.621Z" }, + { url = "https://files.pythonhosted.org/packages/e7/2b/4896188df564908817a75de19bf7f2384b99a75af2d528f9c49326f76458/xxhash-3.6.0-cp39-cp39-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:cfbc5b91397c8c2972fdac13fb3e4ed2f7f8ccac85cd2c644887557780a9b6e2", size = 193448, upload-time = "2025-10-02T14:36:41.797Z" }, + { url = "https://files.pythonhosted.org/packages/51/c5/be8953f62e772340319a826ce1e07489935600089756cf83b628cd36ebe3/xxhash-3.6.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2762bfff264c4e73c0e507274b40634ff465e025f0eaf050897e88ec8367575d", size = 212547, upload-time = "2025-10-02T14:36:43.581Z" }, + { url = "https://files.pythonhosted.org/packages/51/1a/1e9f0b911d1cf00dd537c074ae3fae15b535a7f0d9e7edd42a9d2c4f78ce/xxhash-3.6.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2f171a900d59d51511209f7476933c34a0c2c711078d3c80e74e0fe4f38680ec", size = 211309, upload-time = "2025-10-02T14:36:45.307Z" }, + { url = "https://files.pythonhosted.org/packages/63/88/b284c6a128d88dc47f201957f926e707db79fb7415a87072e15c0e490de0/xxhash-3.6.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:780b90c313348f030b811efc37b0fa1431163cb8db8064cf88a7936b6ce5f222", size = 444480, upload-time = "2025-10-02T14:36:47.226Z" }, + { url = "https://files.pythonhosted.org/packages/87/e4/798293a2bf9e4fac5f6d53ce59cba4739930778dfc6c7c73f40044ab0e6e/xxhash-3.6.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:18b242455eccdfcd1fa4134c431a30737d2b4f045770f8fe84356b3469d4b919", size = 192957, upload-time = "2025-10-02T14:36:48.968Z" }, + { url = "https://files.pythonhosted.org/packages/78/55/bfd0d7db447a927897469048b953caececa3532e743b940dd1f5c1032d24/xxhash-3.6.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:a75ffc1bd5def584129774c158e108e5d768e10b75813f2b32650bb041066ed6", size = 209850, upload-time = "2025-10-02T14:36:50.258Z" }, + { url = "https://files.pythonhosted.org/packages/31/06/d08ef9a792bfebfd2fb2bcbf04a541ad283bef74749ead6f089a0809d288/xxhash-3.6.0-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:1fc1ed882d1e8df932a66e2999429ba6cc4d5172914c904ab193381fba825360", size = 197342, upload-time = "2025-10-02T14:36:51.651Z" }, + { url = "https://files.pythonhosted.org/packages/7b/1a/aebf90797c94e9ca407c28e23f54d71f7149d91a93406a08a09e44d06994/xxhash-3.6.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:44e342e8cc11b4e79dae5c57f2fb6360c3c20cc57d32049af8f567f5b4bcb5f4", size = 209757, upload-time = "2025-10-02T14:36:53.009Z" }, + { url = "https://files.pythonhosted.org/packages/3c/80/799eec3d0a144dc3edf8c19b4f139c27fb923c50b34352796089ca206429/xxhash-3.6.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:c2f9ccd5c4be370939a2e17602fbc49995299203da72a3429db013d44d590e86", size = 412773, upload-time = "2025-10-02T14:36:54.691Z" }, + { url = "https://files.pythonhosted.org/packages/6a/f9/09df7545699de09219a205123b8463ce9ea83f48acc7aeeba0269507f9d3/xxhash-3.6.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:02ea4cb627c76f48cd9fb37cf7ab22bd51e57e1b519807234b473faebe526796", size = 190357, upload-time = "2025-10-02T14:36:56.363Z" }, + { url = "https://files.pythonhosted.org/packages/07/40/2f8327f94e64a3f34d6ce3347c55207c322abbc80ae486ea45df4c62e7b3/xxhash-3.6.0-cp39-cp39-win32.whl", hash = "sha256:6551880383f0e6971dc23e512c9ccc986147ce7bfa1cd2e4b520b876c53e9f3d", size = 30585, upload-time = "2025-10-02T14:36:57.664Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c8/2ecbc6799be9c02e8bf7b5a66cd94832b6ac13d59808746f0d402481c6ad/xxhash-3.6.0-cp39-cp39-win_amd64.whl", hash = "sha256:7c35c4cdc65f2a29f34425c446f2f5cdcd0e3c34158931e1cc927ece925ab802", size = 31512, upload-time = "2025-10-02T14:36:58.837Z" }, + { url = "https://files.pythonhosted.org/packages/19/94/1d5459a9c587c94d7b8bcc710bd08bbfa145cbd814ebde41b48494362a21/xxhash-3.6.0-cp39-cp39-win_arm64.whl", hash = "sha256:ffc578717a347baf25be8397cb10d2528802d24f94cfc005c0e44fef44b5cdd6", size = 27878, upload-time = "2025-10-02T14:37:00.201Z" }, + { url = "https://files.pythonhosted.org/packages/93/1e/8aec23647a34a249f62e2398c42955acd9b4c6ed5cf08cbea94dc46f78d2/xxhash-3.6.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:0f7b7e2ec26c1666ad5fc9dbfa426a6a3367ceaf79db5dd76264659d509d73b0", size = 30662, upload-time = "2025-10-02T14:37:01.743Z" }, + { url = "https://files.pythonhosted.org/packages/b8/0b/b14510b38ba91caf43006209db846a696ceea6a847a0c9ba0a5b1adc53d6/xxhash-3.6.0-pp311-pypy311_pp73-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5dc1e14d14fa0f5789ec29a7062004b5933964bb9b02aae6622b8f530dc40296", size = 41056, upload-time = "2025-10-02T14:37:02.879Z" }, + { url = "https://files.pythonhosted.org/packages/50/55/15a7b8a56590e66ccd374bbfa3f9ffc45b810886c8c3b614e3f90bd2367c/xxhash-3.6.0-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:881b47fc47e051b37d94d13e7455131054b56749b91b508b0907eb07900d1c13", size = 36251, upload-time = "2025-10-02T14:37:04.44Z" }, + { url = "https://files.pythonhosted.org/packages/62/b2/5ac99a041a29e58e95f907876b04f7067a0242cb85b5f39e726153981503/xxhash-3.6.0-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c6dc31591899f5e5666f04cc2e529e69b4072827085c1ef15294d91a004bc1bd", size = 32481, upload-time = "2025-10-02T14:37:05.869Z" }, + { url = "https://files.pythonhosted.org/packages/7b/d9/8d95e906764a386a3d3b596f3c68bb63687dfca806373509f51ce8eea81f/xxhash-3.6.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:15e0dac10eb9309508bfc41f7f9deaa7755c69e35af835db9cb10751adebc35d", size = 31565, upload-time = "2025-10-02T14:37:06.966Z" }, +] + +[[package]] +name = "yarl" +version = "1.22.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "idna" }, + { name = "multidict" }, + { name = "propcache" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/57/63/0c6ebca57330cd313f6102b16dd57ffaf3ec4c83403dcb45dbd15c6f3ea1/yarl-1.22.0.tar.gz", hash = "sha256:bebf8557577d4401ba8bd9ff33906f1376c877aa78d1fe216ad01b4d6745af71", size = 187169, upload-time = "2025-10-06T14:12:55.963Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d1/43/a2204825342f37c337f5edb6637040fa14e365b2fcc2346960201d457579/yarl-1.22.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:c7bd6683587567e5a49ee6e336e0612bec8329be1b7d4c8af5687dcdeb67ee1e", size = 140517, upload-time = "2025-10-06T14:08:42.494Z" }, + { url = "https://files.pythonhosted.org/packages/44/6f/674f3e6f02266428c56f704cd2501c22f78e8b2eeb23f153117cc86fb28a/yarl-1.22.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:5cdac20da754f3a723cceea5b3448e1a2074866406adeb4ef35b469d089adb8f", size = 93495, upload-time = "2025-10-06T14:08:46.2Z" }, + { url = "https://files.pythonhosted.org/packages/b8/12/5b274d8a0f30c07b91b2f02cba69152600b47830fcfb465c108880fcee9c/yarl-1.22.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:07a524d84df0c10f41e3ee918846e1974aba4ec017f990dc735aad487a0bdfdf", size = 94400, upload-time = "2025-10-06T14:08:47.855Z" }, + { url = "https://files.pythonhosted.org/packages/e2/7f/df1b6949b1fa1aa9ff6de6e2631876ad4b73c4437822026e85d8acb56bb1/yarl-1.22.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e1b329cb8146d7b736677a2440e422eadd775d1806a81db2d4cded80a48efc1a", size = 347545, upload-time = "2025-10-06T14:08:49.683Z" }, + { url = "https://files.pythonhosted.org/packages/84/09/f92ed93bd6cd77872ab6c3462df45ca45cd058d8f1d0c9b4f54c1704429f/yarl-1.22.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:75976c6945d85dbb9ee6308cd7ff7b1fb9409380c82d6119bd778d8fcfe2931c", size = 319598, upload-time = "2025-10-06T14:08:51.215Z" }, + { url = "https://files.pythonhosted.org/packages/c3/97/ac3f3feae7d522cf7ccec3d340bb0b2b61c56cb9767923df62a135092c6b/yarl-1.22.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:80ddf7a5f8c86cb3eb4bc9028b07bbbf1f08a96c5c0bc1244be5e8fefcb94147", size = 363893, upload-time = "2025-10-06T14:08:53.144Z" }, + { url = "https://files.pythonhosted.org/packages/06/49/f3219097403b9c84a4d079b1d7bda62dd9b86d0d6e4428c02d46ab2c77fc/yarl-1.22.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d332fc2e3c94dad927f2112395772a4e4fedbcf8f80efc21ed7cdfae4d574fdb", size = 371240, upload-time = "2025-10-06T14:08:55.036Z" }, + { url = "https://files.pythonhosted.org/packages/35/9f/06b765d45c0e44e8ecf0fe15c9eacbbde342bb5b7561c46944f107bfb6c3/yarl-1.22.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0cf71bf877efeac18b38d3930594c0948c82b64547c1cf420ba48722fe5509f6", size = 346965, upload-time = "2025-10-06T14:08:56.722Z" }, + { url = "https://files.pythonhosted.org/packages/c5/69/599e7cea8d0fcb1694323b0db0dda317fa3162f7b90166faddecf532166f/yarl-1.22.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:663e1cadaddae26be034a6ab6072449a8426ddb03d500f43daf952b74553bba0", size = 342026, upload-time = "2025-10-06T14:08:58.563Z" }, + { url = "https://files.pythonhosted.org/packages/95/6f/9dfd12c8bc90fea9eab39832ee32ea48f8e53d1256252a77b710c065c89f/yarl-1.22.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:6dcbb0829c671f305be48a7227918cfcd11276c2d637a8033a99a02b67bf9eda", size = 335637, upload-time = "2025-10-06T14:09:00.506Z" }, + { url = "https://files.pythonhosted.org/packages/57/2e/34c5b4eb9b07e16e873db5b182c71e5f06f9b5af388cdaa97736d79dd9a6/yarl-1.22.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:f0d97c18dfd9a9af4490631905a3f131a8e4c9e80a39353919e2cfed8f00aedc", size = 359082, upload-time = "2025-10-06T14:09:01.936Z" }, + { url = "https://files.pythonhosted.org/packages/31/71/fa7e10fb772d273aa1f096ecb8ab8594117822f683bab7d2c5a89914c92a/yarl-1.22.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:437840083abe022c978470b942ff832c3940b2ad3734d424b7eaffcd07f76737", size = 357811, upload-time = "2025-10-06T14:09:03.445Z" }, + { url = "https://files.pythonhosted.org/packages/26/da/11374c04e8e1184a6a03cf9c8f5688d3e5cec83ed6f31ad3481b3207f709/yarl-1.22.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:a899cbd98dce6f5d8de1aad31cb712ec0a530abc0a86bd6edaa47c1090138467", size = 351223, upload-time = "2025-10-06T14:09:05.401Z" }, + { url = "https://files.pythonhosted.org/packages/82/8f/e2d01f161b0c034a30410e375e191a5d27608c1f8693bab1a08b089ca096/yarl-1.22.0-cp310-cp310-win32.whl", hash = "sha256:595697f68bd1f0c1c159fcb97b661fc9c3f5db46498043555d04805430e79bea", size = 82118, upload-time = "2025-10-06T14:09:11.148Z" }, + { url = "https://files.pythonhosted.org/packages/62/46/94c76196642dbeae634c7a61ba3da88cd77bed875bf6e4a8bed037505aa6/yarl-1.22.0-cp310-cp310-win_amd64.whl", hash = "sha256:cb95a9b1adaa48e41815a55ae740cfda005758104049a640a398120bf02515ca", size = 86852, upload-time = "2025-10-06T14:09:12.958Z" }, + { url = "https://files.pythonhosted.org/packages/af/af/7df4f179d3b1a6dcb9a4bd2ffbc67642746fcafdb62580e66876ce83fff4/yarl-1.22.0-cp310-cp310-win_arm64.whl", hash = "sha256:b85b982afde6df99ecc996990d4ad7ccbdbb70e2a4ba4de0aecde5922ba98a0b", size = 82012, upload-time = "2025-10-06T14:09:14.664Z" }, + { url = "https://files.pythonhosted.org/packages/4d/27/5ab13fc84c76a0250afd3d26d5936349a35be56ce5785447d6c423b26d92/yarl-1.22.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:1ab72135b1f2db3fed3997d7e7dc1b80573c67138023852b6efb336a5eae6511", size = 141607, upload-time = "2025-10-06T14:09:16.298Z" }, + { url = "https://files.pythonhosted.org/packages/6a/a1/d065d51d02dc02ce81501d476b9ed2229d9a990818332242a882d5d60340/yarl-1.22.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:669930400e375570189492dc8d8341301578e8493aec04aebc20d4717f899dd6", size = 94027, upload-time = "2025-10-06T14:09:17.786Z" }, + { url = "https://files.pythonhosted.org/packages/c1/da/8da9f6a53f67b5106ffe902c6fa0164e10398d4e150d85838b82f424072a/yarl-1.22.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:792a2af6d58177ef7c19cbf0097aba92ca1b9cb3ffdd9c7470e156c8f9b5e028", size = 94963, upload-time = "2025-10-06T14:09:19.662Z" }, + { url = "https://files.pythonhosted.org/packages/68/fe/2c1f674960c376e29cb0bec1249b117d11738db92a6ccc4a530b972648db/yarl-1.22.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3ea66b1c11c9150f1372f69afb6b8116f2dd7286f38e14ea71a44eee9ec51b9d", size = 368406, upload-time = "2025-10-06T14:09:21.402Z" }, + { url = "https://files.pythonhosted.org/packages/95/26/812a540e1c3c6418fec60e9bbd38e871eaba9545e94fa5eff8f4a8e28e1e/yarl-1.22.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3e2daa88dc91870215961e96a039ec73e4937da13cf77ce17f9cad0c18df3503", size = 336581, upload-time = "2025-10-06T14:09:22.98Z" }, + { url = "https://files.pythonhosted.org/packages/0b/f5/5777b19e26fdf98563985e481f8be3d8a39f8734147a6ebf459d0dab5a6b/yarl-1.22.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ba440ae430c00eee41509353628600212112cd5018d5def7e9b05ea7ac34eb65", size = 388924, upload-time = "2025-10-06T14:09:24.655Z" }, + { url = "https://files.pythonhosted.org/packages/86/08/24bd2477bd59c0bbd994fe1d93b126e0472e4e3df5a96a277b0a55309e89/yarl-1.22.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:e6438cc8f23a9c1478633d216b16104a586b9761db62bfacb6425bac0a36679e", size = 392890, upload-time = "2025-10-06T14:09:26.617Z" }, + { url = "https://files.pythonhosted.org/packages/46/00/71b90ed48e895667ecfb1eaab27c1523ee2fa217433ed77a73b13205ca4b/yarl-1.22.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4c52a6e78aef5cf47a98ef8e934755abf53953379b7d53e68b15ff4420e6683d", size = 365819, upload-time = "2025-10-06T14:09:28.544Z" }, + { url = "https://files.pythonhosted.org/packages/30/2d/f715501cae832651d3282387c6a9236cd26bd00d0ff1e404b3dc52447884/yarl-1.22.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:3b06bcadaac49c70f4c88af4ffcfbe3dc155aab3163e75777818092478bcbbe7", size = 363601, upload-time = "2025-10-06T14:09:30.568Z" }, + { url = "https://files.pythonhosted.org/packages/f8/f9/a678c992d78e394e7126ee0b0e4e71bd2775e4334d00a9278c06a6cce96a/yarl-1.22.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:6944b2dc72c4d7f7052683487e3677456050ff77fcf5e6204e98caf785ad1967", size = 358072, upload-time = "2025-10-06T14:09:32.528Z" }, + { url = "https://files.pythonhosted.org/packages/2c/d1/b49454411a60edb6fefdcad4f8e6dbba7d8019e3a508a1c5836cba6d0781/yarl-1.22.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:d5372ca1df0f91a86b047d1277c2aaf1edb32d78bbcefffc81b40ffd18f027ed", size = 385311, upload-time = "2025-10-06T14:09:34.634Z" }, + { url = "https://files.pythonhosted.org/packages/87/e5/40d7a94debb8448c7771a916d1861d6609dddf7958dc381117e7ba36d9e8/yarl-1.22.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:51af598701f5299012b8416486b40fceef8c26fc87dc6d7d1f6fc30609ea0aa6", size = 381094, upload-time = "2025-10-06T14:09:36.268Z" }, + { url = "https://files.pythonhosted.org/packages/35/d8/611cc282502381ad855448643e1ad0538957fc82ae83dfe7762c14069e14/yarl-1.22.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:b266bd01fedeffeeac01a79ae181719ff848a5a13ce10075adbefc8f1daee70e", size = 370944, upload-time = "2025-10-06T14:09:37.872Z" }, + { url = "https://files.pythonhosted.org/packages/2d/df/fadd00fb1c90e1a5a8bd731fa3d3de2e165e5a3666a095b04e31b04d9cb6/yarl-1.22.0-cp311-cp311-win32.whl", hash = "sha256:a9b1ba5610a4e20f655258d5a1fdc7ebe3d837bb0e45b581398b99eb98b1f5ca", size = 81804, upload-time = "2025-10-06T14:09:39.359Z" }, + { url = "https://files.pythonhosted.org/packages/b5/f7/149bb6f45f267cb5c074ac40c01c6b3ea6d8a620d34b337f6321928a1b4d/yarl-1.22.0-cp311-cp311-win_amd64.whl", hash = "sha256:078278b9b0b11568937d9509b589ee83ef98ed6d561dfe2020e24a9fd08eaa2b", size = 86858, upload-time = "2025-10-06T14:09:41.068Z" }, + { url = "https://files.pythonhosted.org/packages/2b/13/88b78b93ad3f2f0b78e13bfaaa24d11cbc746e93fe76d8c06bf139615646/yarl-1.22.0-cp311-cp311-win_arm64.whl", hash = "sha256:b6a6f620cfe13ccec221fa312139135166e47ae169f8253f72a0abc0dae94376", size = 81637, upload-time = "2025-10-06T14:09:42.712Z" }, + { url = "https://files.pythonhosted.org/packages/75/ff/46736024fee3429b80a165a732e38e5d5a238721e634ab41b040d49f8738/yarl-1.22.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e340382d1afa5d32b892b3ff062436d592ec3d692aeea3bef3a5cfe11bbf8c6f", size = 142000, upload-time = "2025-10-06T14:09:44.631Z" }, + { url = "https://files.pythonhosted.org/packages/5a/9a/b312ed670df903145598914770eb12de1bac44599549b3360acc96878df8/yarl-1.22.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f1e09112a2c31ffe8d80be1b0988fa6a18c5d5cad92a9ffbb1c04c91bfe52ad2", size = 94338, upload-time = "2025-10-06T14:09:46.372Z" }, + { url = "https://files.pythonhosted.org/packages/ba/f5/0601483296f09c3c65e303d60c070a5c19fcdbc72daa061e96170785bc7d/yarl-1.22.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:939fe60db294c786f6b7c2d2e121576628468f65453d86b0fe36cb52f987bd74", size = 94909, upload-time = "2025-10-06T14:09:48.648Z" }, + { url = "https://files.pythonhosted.org/packages/60/41/9a1fe0b73dbcefce72e46cf149b0e0a67612d60bfc90fb59c2b2efdfbd86/yarl-1.22.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e1651bf8e0398574646744c1885a41198eba53dc8a9312b954073f845c90a8df", size = 372940, upload-time = "2025-10-06T14:09:50.089Z" }, + { url = "https://files.pythonhosted.org/packages/17/7a/795cb6dfee561961c30b800f0ed616b923a2ec6258b5def2a00bf8231334/yarl-1.22.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:b8a0588521a26bf92a57a1705b77b8b59044cdceccac7151bd8d229e66b8dedb", size = 345825, upload-time = "2025-10-06T14:09:52.142Z" }, + { url = "https://files.pythonhosted.org/packages/d7/93/a58f4d596d2be2ae7bab1a5846c4d270b894958845753b2c606d666744d3/yarl-1.22.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:42188e6a615c1a75bcaa6e150c3fe8f3e8680471a6b10150c5f7e83f47cc34d2", size = 386705, upload-time = "2025-10-06T14:09:54.128Z" }, + { url = "https://files.pythonhosted.org/packages/61/92/682279d0e099d0e14d7fd2e176bd04f48de1484f56546a3e1313cd6c8e7c/yarl-1.22.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:f6d2cb59377d99718913ad9a151030d6f83ef420a2b8f521d94609ecc106ee82", size = 396518, upload-time = "2025-10-06T14:09:55.762Z" }, + { url = "https://files.pythonhosted.org/packages/db/0f/0d52c98b8a885aeda831224b78f3be7ec2e1aa4a62091f9f9188c3c65b56/yarl-1.22.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:50678a3b71c751d58d7908edc96d332af328839eea883bb554a43f539101277a", size = 377267, upload-time = "2025-10-06T14:09:57.958Z" }, + { url = "https://files.pythonhosted.org/packages/22/42/d2685e35908cbeaa6532c1fc73e89e7f2efb5d8a7df3959ea8e37177c5a3/yarl-1.22.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1e8fbaa7cec507aa24ea27a01456e8dd4b6fab829059b69844bd348f2d467124", size = 365797, upload-time = "2025-10-06T14:09:59.527Z" }, + { url = "https://files.pythonhosted.org/packages/a2/83/cf8c7bcc6355631762f7d8bdab920ad09b82efa6b722999dfb05afa6cfac/yarl-1.22.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:433885ab5431bc3d3d4f2f9bd15bfa1614c522b0f1405d62c4f926ccd69d04fa", size = 365535, upload-time = "2025-10-06T14:10:01.139Z" }, + { url = "https://files.pythonhosted.org/packages/25/e1/5302ff9b28f0c59cac913b91fe3f16c59a033887e57ce9ca5d41a3a94737/yarl-1.22.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:b790b39c7e9a4192dc2e201a282109ed2985a1ddbd5ac08dc56d0e121400a8f7", size = 382324, upload-time = "2025-10-06T14:10:02.756Z" }, + { url = "https://files.pythonhosted.org/packages/bf/cd/4617eb60f032f19ae3a688dc990d8f0d89ee0ea378b61cac81ede3e52fae/yarl-1.22.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:31f0b53913220599446872d757257be5898019c85e7971599065bc55065dc99d", size = 383803, upload-time = "2025-10-06T14:10:04.552Z" }, + { url = "https://files.pythonhosted.org/packages/59/65/afc6e62bb506a319ea67b694551dab4a7e6fb7bf604e9bd9f3e11d575fec/yarl-1.22.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a49370e8f711daec68d09b821a34e1167792ee2d24d405cbc2387be4f158b520", size = 374220, upload-time = "2025-10-06T14:10:06.489Z" }, + { url = "https://files.pythonhosted.org/packages/e7/3d/68bf18d50dc674b942daec86a9ba922d3113d8399b0e52b9897530442da2/yarl-1.22.0-cp312-cp312-win32.whl", hash = "sha256:70dfd4f241c04bd9239d53b17f11e6ab672b9f1420364af63e8531198e3f5fe8", size = 81589, upload-time = "2025-10-06T14:10:09.254Z" }, + { url = "https://files.pythonhosted.org/packages/c8/9a/6ad1a9b37c2f72874f93e691b2e7ecb6137fb2b899983125db4204e47575/yarl-1.22.0-cp312-cp312-win_amd64.whl", hash = "sha256:8884d8b332a5e9b88e23f60bb166890009429391864c685e17bd73a9eda9105c", size = 87213, upload-time = "2025-10-06T14:10:11.369Z" }, + { url = "https://files.pythonhosted.org/packages/44/c5/c21b562d1680a77634d748e30c653c3ca918beb35555cff24986fff54598/yarl-1.22.0-cp312-cp312-win_arm64.whl", hash = "sha256:ea70f61a47f3cc93bdf8b2f368ed359ef02a01ca6393916bc8ff877427181e74", size = 81330, upload-time = "2025-10-06T14:10:13.112Z" }, + { url = "https://files.pythonhosted.org/packages/ea/f3/d67de7260456ee105dc1d162d43a019ecad6b91e2f51809d6cddaa56690e/yarl-1.22.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8dee9c25c74997f6a750cd317b8ca63545169c098faee42c84aa5e506c819b53", size = 139980, upload-time = "2025-10-06T14:10:14.601Z" }, + { url = "https://files.pythonhosted.org/packages/01/88/04d98af0b47e0ef42597b9b28863b9060bb515524da0a65d5f4db160b2d5/yarl-1.22.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:01e73b85a5434f89fc4fe27dcda2aff08ddf35e4d47bbbea3bdcd25321af538a", size = 93424, upload-time = "2025-10-06T14:10:16.115Z" }, + { url = "https://files.pythonhosted.org/packages/18/91/3274b215fd8442a03975ce6bee5fe6aa57a8326b29b9d3d56234a1dca244/yarl-1.22.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:22965c2af250d20c873cdbee8ff958fb809940aeb2e74ba5f20aaf6b7ac8c70c", size = 93821, upload-time = "2025-10-06T14:10:17.993Z" }, + { url = "https://files.pythonhosted.org/packages/61/3a/caf4e25036db0f2da4ca22a353dfeb3c9d3c95d2761ebe9b14df8fc16eb0/yarl-1.22.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4f15793aa49793ec8d1c708ab7f9eded1aa72edc5174cae703651555ed1b601", size = 373243, upload-time = "2025-10-06T14:10:19.44Z" }, + { url = "https://files.pythonhosted.org/packages/6e/9e/51a77ac7516e8e7803b06e01f74e78649c24ee1021eca3d6a739cb6ea49c/yarl-1.22.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e5542339dcf2747135c5c85f68680353d5cb9ffd741c0f2e8d832d054d41f35a", size = 342361, upload-time = "2025-10-06T14:10:21.124Z" }, + { url = "https://files.pythonhosted.org/packages/d4/f8/33b92454789dde8407f156c00303e9a891f1f51a0330b0fad7c909f87692/yarl-1.22.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5c401e05ad47a75869c3ab3e35137f8468b846770587e70d71e11de797d113df", size = 387036, upload-time = "2025-10-06T14:10:22.902Z" }, + { url = "https://files.pythonhosted.org/packages/d9/9a/c5db84ea024f76838220280f732970aa4ee154015d7f5c1bfb60a267af6f/yarl-1.22.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:243dda95d901c733f5b59214d28b0120893d91777cb8aa043e6ef059d3cddfe2", size = 397671, upload-time = "2025-10-06T14:10:24.523Z" }, + { url = "https://files.pythonhosted.org/packages/11/c9/cd8538dc2e7727095e0c1d867bad1e40c98f37763e6d995c1939f5fdc7b1/yarl-1.22.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bec03d0d388060058f5d291a813f21c011041938a441c593374da6077fe21b1b", size = 377059, upload-time = "2025-10-06T14:10:26.406Z" }, + { url = "https://files.pythonhosted.org/packages/a1/b9/ab437b261702ced75122ed78a876a6dec0a1b0f5e17a4ac7a9a2482d8abe/yarl-1.22.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:b0748275abb8c1e1e09301ee3cf90c8a99678a4e92e4373705f2a2570d581273", size = 365356, upload-time = "2025-10-06T14:10:28.461Z" }, + { url = "https://files.pythonhosted.org/packages/b2/9d/8e1ae6d1d008a9567877b08f0ce4077a29974c04c062dabdb923ed98e6fe/yarl-1.22.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:47fdb18187e2a4e18fda2c25c05d8251a9e4a521edaed757fef033e7d8498d9a", size = 361331, upload-time = "2025-10-06T14:10:30.541Z" }, + { url = "https://files.pythonhosted.org/packages/ca/5a/09b7be3905962f145b73beb468cdd53db8aa171cf18c80400a54c5b82846/yarl-1.22.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:c7044802eec4524fde550afc28edda0dd5784c4c45f0be151a2d3ba017daca7d", size = 382590, upload-time = "2025-10-06T14:10:33.352Z" }, + { url = "https://files.pythonhosted.org/packages/aa/7f/59ec509abf90eda5048b0bc3e2d7b5099dffdb3e6b127019895ab9d5ef44/yarl-1.22.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:139718f35149ff544caba20fce6e8a2f71f1e39b92c700d8438a0b1d2a631a02", size = 385316, upload-time = "2025-10-06T14:10:35.034Z" }, + { url = "https://files.pythonhosted.org/packages/e5/84/891158426bc8036bfdfd862fabd0e0fa25df4176ec793e447f4b85cf1be4/yarl-1.22.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:e1b51bebd221006d3d2f95fbe124b22b247136647ae5dcc8c7acafba66e5ee67", size = 374431, upload-time = "2025-10-06T14:10:37.76Z" }, + { url = "https://files.pythonhosted.org/packages/bb/49/03da1580665baa8bef5e8ed34c6df2c2aca0a2f28bf397ed238cc1bbc6f2/yarl-1.22.0-cp313-cp313-win32.whl", hash = "sha256:d3e32536234a95f513bd374e93d717cf6b2231a791758de6c509e3653f234c95", size = 81555, upload-time = "2025-10-06T14:10:39.649Z" }, + { url = "https://files.pythonhosted.org/packages/9a/ee/450914ae11b419eadd067c6183ae08381cfdfcb9798b90b2b713bbebddda/yarl-1.22.0-cp313-cp313-win_amd64.whl", hash = "sha256:47743b82b76d89a1d20b83e60d5c20314cbd5ba2befc9cda8f28300c4a08ed4d", size = 86965, upload-time = "2025-10-06T14:10:41.313Z" }, + { url = "https://files.pythonhosted.org/packages/98/4d/264a01eae03b6cf629ad69bae94e3b0e5344741e929073678e84bf7a3e3b/yarl-1.22.0-cp313-cp313-win_arm64.whl", hash = "sha256:5d0fcda9608875f7d052eff120c7a5da474a6796fe4d83e152e0e4d42f6d1a9b", size = 81205, upload-time = "2025-10-06T14:10:43.167Z" }, + { url = "https://files.pythonhosted.org/packages/88/fc/6908f062a2f77b5f9f6d69cecb1747260831ff206adcbc5b510aff88df91/yarl-1.22.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:719ae08b6972befcba4310e49edb1161a88cdd331e3a694b84466bd938a6ab10", size = 146209, upload-time = "2025-10-06T14:10:44.643Z" }, + { url = "https://files.pythonhosted.org/packages/65/47/76594ae8eab26210b4867be6f49129861ad33da1f1ebdf7051e98492bf62/yarl-1.22.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:47d8a5c446df1c4db9d21b49619ffdba90e77c89ec6e283f453856c74b50b9e3", size = 95966, upload-time = "2025-10-06T14:10:46.554Z" }, + { url = "https://files.pythonhosted.org/packages/ab/ce/05e9828a49271ba6b5b038b15b3934e996980dd78abdfeb52a04cfb9467e/yarl-1.22.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:cfebc0ac8333520d2d0423cbbe43ae43c8838862ddb898f5ca68565e395516e9", size = 97312, upload-time = "2025-10-06T14:10:48.007Z" }, + { url = "https://files.pythonhosted.org/packages/d1/c5/7dffad5e4f2265b29c9d7ec869c369e4223166e4f9206fc2243ee9eea727/yarl-1.22.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4398557cbf484207df000309235979c79c4356518fd5c99158c7d38203c4da4f", size = 361967, upload-time = "2025-10-06T14:10:49.997Z" }, + { url = "https://files.pythonhosted.org/packages/50/b2/375b933c93a54bff7fc041e1a6ad2c0f6f733ffb0c6e642ce56ee3b39970/yarl-1.22.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:2ca6fd72a8cd803be290d42f2dec5cdcd5299eeb93c2d929bf060ad9efaf5de0", size = 323949, upload-time = "2025-10-06T14:10:52.004Z" }, + { url = "https://files.pythonhosted.org/packages/66/50/bfc2a29a1d78644c5a7220ce2f304f38248dc94124a326794e677634b6cf/yarl-1.22.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ca1f59c4e1ab6e72f0a23c13fca5430f889634166be85dbf1013683e49e3278e", size = 361818, upload-time = "2025-10-06T14:10:54.078Z" }, + { url = "https://files.pythonhosted.org/packages/46/96/f3941a46af7d5d0f0498f86d71275696800ddcdd20426298e572b19b91ff/yarl-1.22.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:6c5010a52015e7c70f86eb967db0f37f3c8bd503a695a49f8d45700144667708", size = 372626, upload-time = "2025-10-06T14:10:55.767Z" }, + { url = "https://files.pythonhosted.org/packages/c1/42/8b27c83bb875cd89448e42cd627e0fb971fa1675c9ec546393d18826cb50/yarl-1.22.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9d7672ecf7557476642c88497c2f8d8542f8e36596e928e9bcba0e42e1e7d71f", size = 341129, upload-time = "2025-10-06T14:10:57.985Z" }, + { url = "https://files.pythonhosted.org/packages/49/36/99ca3122201b382a3cf7cc937b95235b0ac944f7e9f2d5331d50821ed352/yarl-1.22.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:3b7c88eeef021579d600e50363e0b6ee4f7f6f728cd3486b9d0f3ee7b946398d", size = 346776, upload-time = "2025-10-06T14:10:59.633Z" }, + { url = "https://files.pythonhosted.org/packages/85/b4/47328bf996acd01a4c16ef9dcd2f59c969f495073616586f78cd5f2efb99/yarl-1.22.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:f4afb5c34f2c6fecdcc182dfcfc6af6cccf1aa923eed4d6a12e9d96904e1a0d8", size = 334879, upload-time = "2025-10-06T14:11:01.454Z" }, + { url = "https://files.pythonhosted.org/packages/c2/ad/b77d7b3f14a4283bffb8e92c6026496f6de49751c2f97d4352242bba3990/yarl-1.22.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:59c189e3e99a59cf8d83cbb31d4db02d66cda5a1a4374e8a012b51255341abf5", size = 350996, upload-time = "2025-10-06T14:11:03.452Z" }, + { url = "https://files.pythonhosted.org/packages/81/c8/06e1d69295792ba54d556f06686cbd6a7ce39c22307100e3fb4a2c0b0a1d/yarl-1.22.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:5a3bf7f62a289fa90f1990422dc8dff5a458469ea71d1624585ec3a4c8d6960f", size = 356047, upload-time = "2025-10-06T14:11:05.115Z" }, + { url = "https://files.pythonhosted.org/packages/4b/b8/4c0e9e9f597074b208d18cef227d83aac36184bfbc6eab204ea55783dbc5/yarl-1.22.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:de6b9a04c606978fdfe72666fa216ffcf2d1a9f6a381058d4378f8d7b1e5de62", size = 342947, upload-time = "2025-10-06T14:11:08.137Z" }, + { url = "https://files.pythonhosted.org/packages/e0/e5/11f140a58bf4c6ad7aca69a892bff0ee638c31bea4206748fc0df4ebcb3a/yarl-1.22.0-cp313-cp313t-win32.whl", hash = "sha256:1834bb90991cc2999f10f97f5f01317f99b143284766d197e43cd5b45eb18d03", size = 86943, upload-time = "2025-10-06T14:11:10.284Z" }, + { url = "https://files.pythonhosted.org/packages/31/74/8b74bae38ed7fe6793d0c15a0c8207bbb819cf287788459e5ed230996cdd/yarl-1.22.0-cp313-cp313t-win_amd64.whl", hash = "sha256:ff86011bd159a9d2dfc89c34cfd8aff12875980e3bd6a39ff097887520e60249", size = 93715, upload-time = "2025-10-06T14:11:11.739Z" }, + { url = "https://files.pythonhosted.org/packages/69/66/991858aa4b5892d57aef7ee1ba6b4d01ec3b7eb3060795d34090a3ca3278/yarl-1.22.0-cp313-cp313t-win_arm64.whl", hash = "sha256:7861058d0582b847bc4e3a4a4c46828a410bca738673f35a29ba3ca5db0b473b", size = 83857, upload-time = "2025-10-06T14:11:13.586Z" }, + { url = "https://files.pythonhosted.org/packages/46/b3/e20ef504049f1a1c54a814b4b9bed96d1ac0e0610c3b4da178f87209db05/yarl-1.22.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:34b36c2c57124530884d89d50ed2c1478697ad7473efd59cfd479945c95650e4", size = 140520, upload-time = "2025-10-06T14:11:15.465Z" }, + { url = "https://files.pythonhosted.org/packages/e4/04/3532d990fdbab02e5ede063676b5c4260e7f3abea2151099c2aa745acc4c/yarl-1.22.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:0dd9a702591ca2e543631c2a017e4a547e38a5c0f29eece37d9097e04a7ac683", size = 93504, upload-time = "2025-10-06T14:11:17.106Z" }, + { url = "https://files.pythonhosted.org/packages/11/63/ff458113c5c2dac9a9719ac68ee7c947cb621432bcf28c9972b1c0e83938/yarl-1.22.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:594fcab1032e2d2cc3321bb2e51271e7cd2b516c7d9aee780ece81b07ff8244b", size = 94282, upload-time = "2025-10-06T14:11:19.064Z" }, + { url = "https://files.pythonhosted.org/packages/a7/bc/315a56aca762d44a6aaaf7ad253f04d996cb6b27bad34410f82d76ea8038/yarl-1.22.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f3d7a87a78d46a2e3d5b72587ac14b4c16952dd0887dbb051451eceac774411e", size = 372080, upload-time = "2025-10-06T14:11:20.996Z" }, + { url = "https://files.pythonhosted.org/packages/3f/3f/08e9b826ec2e099ea6e7c69a61272f4f6da62cb5b1b63590bb80ca2e4a40/yarl-1.22.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:852863707010316c973162e703bddabec35e8757e67fcb8ad58829de1ebc8590", size = 338696, upload-time = "2025-10-06T14:11:22.847Z" }, + { url = "https://files.pythonhosted.org/packages/e3/9f/90360108e3b32bd76789088e99538febfea24a102380ae73827f62073543/yarl-1.22.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:131a085a53bfe839a477c0845acf21efc77457ba2bcf5899618136d64f3303a2", size = 387121, upload-time = "2025-10-06T14:11:24.889Z" }, + { url = "https://files.pythonhosted.org/packages/98/92/ab8d4657bd5b46a38094cfaea498f18bb70ce6b63508fd7e909bd1f93066/yarl-1.22.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:078a8aefd263f4d4f923a9677b942b445a2be970ca24548a8102689a3a8ab8da", size = 394080, upload-time = "2025-10-06T14:11:27.307Z" }, + { url = "https://files.pythonhosted.org/packages/f5/e7/d8c5a7752fef68205296201f8ec2bf718f5c805a7a7e9880576c67600658/yarl-1.22.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bca03b91c323036913993ff5c738d0842fc9c60c4648e5c8d98331526df89784", size = 372661, upload-time = "2025-10-06T14:11:29.387Z" }, + { url = "https://files.pythonhosted.org/packages/b6/2e/f4d26183c8db0bb82d491b072f3127fb8c381a6206a3a56332714b79b751/yarl-1.22.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:68986a61557d37bb90d3051a45b91fa3d5c516d177dfc6dd6f2f436a07ff2b6b", size = 364645, upload-time = "2025-10-06T14:11:31.423Z" }, + { url = "https://files.pythonhosted.org/packages/80/7c/428e5812e6b87cd00ee8e898328a62c95825bf37c7fa87f0b6bb2ad31304/yarl-1.22.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:4792b262d585ff0dff6bcb787f8492e40698443ec982a3568c2096433660c694", size = 355361, upload-time = "2025-10-06T14:11:33.055Z" }, + { url = "https://files.pythonhosted.org/packages/ec/2a/249405fd26776f8b13c067378ef4d7dd49c9098d1b6457cdd152a99e96a9/yarl-1.22.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ebd4549b108d732dba1d4ace67614b9545b21ece30937a63a65dd34efa19732d", size = 381451, upload-time = "2025-10-06T14:11:35.136Z" }, + { url = "https://files.pythonhosted.org/packages/67/a8/fb6b1adbe98cf1e2dd9fad71003d3a63a1bc22459c6e15f5714eb9323b93/yarl-1.22.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:f87ac53513d22240c7d59203f25cc3beac1e574c6cd681bbfd321987b69f95fd", size = 383814, upload-time = "2025-10-06T14:11:37.094Z" }, + { url = "https://files.pythonhosted.org/packages/d9/f9/3aa2c0e480fb73e872ae2814c43bc1e734740bb0d54e8cb2a95925f98131/yarl-1.22.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:22b029f2881599e2f1b06f8f1db2ee63bd309e2293ba2d566e008ba12778b8da", size = 370799, upload-time = "2025-10-06T14:11:38.83Z" }, + { url = "https://files.pythonhosted.org/packages/50/3c/af9dba3b8b5eeb302f36f16f92791f3ea62e3f47763406abf6d5a4a3333b/yarl-1.22.0-cp314-cp314-win32.whl", hash = "sha256:6a635ea45ba4ea8238463b4f7d0e721bad669f80878b7bfd1f89266e2ae63da2", size = 82990, upload-time = "2025-10-06T14:11:40.624Z" }, + { url = "https://files.pythonhosted.org/packages/ac/30/ac3a0c5bdc1d6efd1b41fa24d4897a4329b3b1e98de9449679dd327af4f0/yarl-1.22.0-cp314-cp314-win_amd64.whl", hash = "sha256:0d6e6885777af0f110b0e5d7e5dda8b704efed3894da26220b7f3d887b839a79", size = 88292, upload-time = "2025-10-06T14:11:42.578Z" }, + { url = "https://files.pythonhosted.org/packages/df/0a/227ab4ff5b998a1b7410abc7b46c9b7a26b0ca9e86c34ba4b8d8bc7c63d5/yarl-1.22.0-cp314-cp314-win_arm64.whl", hash = "sha256:8218f4e98d3c10d683584cb40f0424f4b9fd6e95610232dd75e13743b070ee33", size = 82888, upload-time = "2025-10-06T14:11:44.863Z" }, + { url = "https://files.pythonhosted.org/packages/06/5e/a15eb13db90abd87dfbefb9760c0f3f257ac42a5cac7e75dbc23bed97a9f/yarl-1.22.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:45c2842ff0e0d1b35a6bf1cd6c690939dacb617a70827f715232b2e0494d55d1", size = 146223, upload-time = "2025-10-06T14:11:46.796Z" }, + { url = "https://files.pythonhosted.org/packages/18/82/9665c61910d4d84f41a5bf6837597c89e665fa88aa4941080704645932a9/yarl-1.22.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:d947071e6ebcf2e2bee8fce76e10faca8f7a14808ca36a910263acaacef08eca", size = 95981, upload-time = "2025-10-06T14:11:48.845Z" }, + { url = "https://files.pythonhosted.org/packages/5d/9a/2f65743589809af4d0a6d3aa749343c4b5f4c380cc24a8e94a3c6625a808/yarl-1.22.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:334b8721303e61b00019474cc103bdac3d7b1f65e91f0bfedeec2d56dfe74b53", size = 97303, upload-time = "2025-10-06T14:11:50.897Z" }, + { url = "https://files.pythonhosted.org/packages/b0/ab/5b13d3e157505c43c3b43b5a776cbf7b24a02bc4cccc40314771197e3508/yarl-1.22.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1e7ce67c34138a058fd092f67d07a72b8e31ff0c9236e751957465a24b28910c", size = 361820, upload-time = "2025-10-06T14:11:52.549Z" }, + { url = "https://files.pythonhosted.org/packages/fb/76/242a5ef4677615cf95330cfc1b4610e78184400699bdda0acb897ef5e49a/yarl-1.22.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:d77e1b2c6d04711478cb1c4ab90db07f1609ccf06a287d5607fcd90dc9863acf", size = 323203, upload-time = "2025-10-06T14:11:54.225Z" }, + { url = "https://files.pythonhosted.org/packages/8c/96/475509110d3f0153b43d06164cf4195c64d16999e0c7e2d8a099adcd6907/yarl-1.22.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c4647674b6150d2cae088fc07de2738a84b8bcedebef29802cf0b0a82ab6face", size = 363173, upload-time = "2025-10-06T14:11:56.069Z" }, + { url = "https://files.pythonhosted.org/packages/c9/66/59db471aecfbd559a1fd48aedd954435558cd98c7d0da8b03cc6c140a32c/yarl-1.22.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:efb07073be061c8f79d03d04139a80ba33cbd390ca8f0297aae9cce6411e4c6b", size = 373562, upload-time = "2025-10-06T14:11:58.783Z" }, + { url = "https://files.pythonhosted.org/packages/03/1f/c5d94abc91557384719da10ff166b916107c1b45e4d0423a88457071dd88/yarl-1.22.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e51ac5435758ba97ad69617e13233da53908beccc6cfcd6c34bbed8dcbede486", size = 339828, upload-time = "2025-10-06T14:12:00.686Z" }, + { url = "https://files.pythonhosted.org/packages/5f/97/aa6a143d3afba17b6465733681c70cf175af89f76ec8d9286e08437a7454/yarl-1.22.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:33e32a0dd0c8205efa8e83d04fc9f19313772b78522d1bdc7d9aed706bfd6138", size = 347551, upload-time = "2025-10-06T14:12:02.628Z" }, + { url = "https://files.pythonhosted.org/packages/43/3c/45a2b6d80195959239a7b2a8810506d4eea5487dce61c2a3393e7fc3c52e/yarl-1.22.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:bf4a21e58b9cde0e401e683ebd00f6ed30a06d14e93f7c8fd059f8b6e8f87b6a", size = 334512, upload-time = "2025-10-06T14:12:04.871Z" }, + { url = "https://files.pythonhosted.org/packages/86/a0/c2ab48d74599c7c84cb104ebd799c5813de252bea0f360ffc29d270c2caa/yarl-1.22.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:e4b582bab49ac33c8deb97e058cd67c2c50dac0dd134874106d9c774fd272529", size = 352400, upload-time = "2025-10-06T14:12:06.624Z" }, + { url = "https://files.pythonhosted.org/packages/32/75/f8919b2eafc929567d3d8411f72bdb1a2109c01caaab4ebfa5f8ffadc15b/yarl-1.22.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:0b5bcc1a9c4839e7e30b7b30dd47fe5e7e44fb7054ec29b5bb8d526aa1041093", size = 357140, upload-time = "2025-10-06T14:12:08.362Z" }, + { url = "https://files.pythonhosted.org/packages/cf/72/6a85bba382f22cf78add705d8c3731748397d986e197e53ecc7835e76de7/yarl-1.22.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:c0232bce2170103ec23c454e54a57008a9a72b5d1c3105dc2496750da8cfa47c", size = 341473, upload-time = "2025-10-06T14:12:10.994Z" }, + { url = "https://files.pythonhosted.org/packages/35/18/55e6011f7c044dc80b98893060773cefcfdbf60dfefb8cb2f58b9bacbd83/yarl-1.22.0-cp314-cp314t-win32.whl", hash = "sha256:8009b3173bcd637be650922ac455946197d858b3630b6d8787aa9e5c4564533e", size = 89056, upload-time = "2025-10-06T14:12:13.317Z" }, + { url = "https://files.pythonhosted.org/packages/f9/86/0f0dccb6e59a9e7f122c5afd43568b1d31b8ab7dda5f1b01fb5c7025c9a9/yarl-1.22.0-cp314-cp314t-win_amd64.whl", hash = "sha256:9fb17ea16e972c63d25d4a97f016d235c78dd2344820eb35bc034bc32012ee27", size = 96292, upload-time = "2025-10-06T14:12:15.398Z" }, + { url = "https://files.pythonhosted.org/packages/48/b7/503c98092fb3b344a179579f55814b613c1fbb1c23b3ec14a7b008a66a6e/yarl-1.22.0-cp314-cp314t-win_arm64.whl", hash = "sha256:9f6d73c1436b934e3f01df1e1b21ff765cd1d28c77dfb9ace207f746d4610ee1", size = 85171, upload-time = "2025-10-06T14:12:16.935Z" }, + { url = "https://files.pythonhosted.org/packages/94/fd/6480106702a79bcceda5fd9c63cb19a04a6506bd5ce7fd8d9b63742f0021/yarl-1.22.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:3aa27acb6de7a23785d81557577491f6c38a5209a254d1191519d07d8fe51748", size = 141301, upload-time = "2025-10-06T14:12:19.01Z" }, + { url = "https://files.pythonhosted.org/packages/42/e1/6d95d21b17a93e793e4ec420a925fe1f6a9342338ca7a563ed21129c0990/yarl-1.22.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:af74f05666a5e531289cb1cc9c883d1de2088b8e5b4de48004e5ca8a830ac859", size = 93864, upload-time = "2025-10-06T14:12:21.05Z" }, + { url = "https://files.pythonhosted.org/packages/32/58/b8055273c203968e89808413ea4c984988b6649baabf10f4522e67c22d2f/yarl-1.22.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:62441e55958977b8167b2709c164c91a6363e25da322d87ae6dd9c6019ceecf9", size = 94706, upload-time = "2025-10-06T14:12:23.287Z" }, + { url = "https://files.pythonhosted.org/packages/18/91/d7bfbc28a88c2895ecd0da6a874def0c147de78afc52c773c28e1aa233a3/yarl-1.22.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b580e71cac3f8113d3135888770903eaf2f507e9421e5697d6ee6d8cd1c7f054", size = 347100, upload-time = "2025-10-06T14:12:28.527Z" }, + { url = "https://files.pythonhosted.org/packages/bd/e8/37a1e7b99721c0564b1fc7b0a4d1f595ef6fb8060d82ca61775b644185f7/yarl-1.22.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e81fda2fb4a07eda1a2252b216aa0df23ebcd4d584894e9612e80999a78fd95b", size = 318902, upload-time = "2025-10-06T14:12:30.528Z" }, + { url = "https://files.pythonhosted.org/packages/1c/ef/34724449d7ef2db4f22df644f2dac0b8a275d20f585e526937b3ae47b02d/yarl-1.22.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:99b6fc1d55782461b78221e95fc357b47ad98b041e8e20f47c1411d0aacddc60", size = 363302, upload-time = "2025-10-06T14:12:32.295Z" }, + { url = "https://files.pythonhosted.org/packages/8a/04/88a39a5dad39889f192cce8d66cc4c58dbeca983e83f9b6bf23822a7ed91/yarl-1.22.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:088e4e08f033db4be2ccd1f34cf29fe994772fb54cfe004bbf54db320af56890", size = 370816, upload-time = "2025-10-06T14:12:34.01Z" }, + { url = "https://files.pythonhosted.org/packages/6b/1f/5e895e547129413f56c76be2c3ce4b96c797d2d0ff3e16a817d9269b12e6/yarl-1.22.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2e4e1f6f0b4da23e61188676e3ed027ef0baa833a2e633c29ff8530800edccba", size = 346465, upload-time = "2025-10-06T14:12:35.977Z" }, + { url = "https://files.pythonhosted.org/packages/11/13/a750e9fd6f9cc9ed3a52a70fe58ffe505322f0efe0d48e1fd9ffe53281f5/yarl-1.22.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:84fc3ec96fce86ce5aa305eb4aa9358279d1aa644b71fab7b8ed33fe3ba1a7ca", size = 341506, upload-time = "2025-10-06T14:12:37.788Z" }, + { url = "https://files.pythonhosted.org/packages/3c/67/bb6024de76e7186611ebe626aec5b71a2d2ecf9453e795f2dbd80614784c/yarl-1.22.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:5dbeefd6ca588b33576a01b0ad58aa934bc1b41ef89dee505bf2932b22ddffba", size = 335030, upload-time = "2025-10-06T14:12:39.775Z" }, + { url = "https://files.pythonhosted.org/packages/a2/be/50b38447fd94a7992996a62b8b463d0579323fcfc08c61bdba949eef8a5d/yarl-1.22.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:14291620375b1060613f4aab9ebf21850058b6b1b438f386cc814813d901c60b", size = 358560, upload-time = "2025-10-06T14:12:41.547Z" }, + { url = "https://files.pythonhosted.org/packages/e2/89/c020b6f547578c4e3dbb6335bf918f26e2f34ad0d1e515d72fd33ac0c635/yarl-1.22.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:a4fcfc8eb2c34148c118dfa02e6427ca278bfd0f3df7c5f99e33d2c0e81eae3e", size = 357290, upload-time = "2025-10-06T14:12:43.861Z" }, + { url = "https://files.pythonhosted.org/packages/8c/52/c49a619ee35a402fa3a7019a4fa8d26878fec0d1243f6968bbf516789578/yarl-1.22.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:029866bde8d7b0878b9c160e72305bbf0a7342bcd20b9999381704ae03308dc8", size = 350700, upload-time = "2025-10-06T14:12:46.868Z" }, + { url = "https://files.pythonhosted.org/packages/ab/c9/f5042d87777bf6968435f04a2bbb15466b2f142e6e47fa4f34d1a3f32f0c/yarl-1.22.0-cp39-cp39-win32.whl", hash = "sha256:4dcc74149ccc8bba31ce1944acee24813e93cfdee2acda3c172df844948ddf7b", size = 82323, upload-time = "2025-10-06T14:12:48.633Z" }, + { url = "https://files.pythonhosted.org/packages/fd/58/d00f7cad9eba20c4eefac2682f34661d1d1b3a942fc0092eb60e78cfb733/yarl-1.22.0-cp39-cp39-win_amd64.whl", hash = "sha256:10619d9fdee46d20edc49d3479e2f8269d0779f1b031e6f7c2aa1c76be04b7ed", size = 87145, upload-time = "2025-10-06T14:12:50.241Z" }, + { url = "https://files.pythonhosted.org/packages/c2/a3/70904f365080780d38b919edd42d224b8c4ce224a86950d2eaa2a24366ad/yarl-1.22.0-cp39-cp39-win_arm64.whl", hash = "sha256:dd7afd3f8b0bfb4e0d9fc3c31bfe8a4ec7debe124cfd90619305def3c8ca8cd2", size = 82173, upload-time = "2025-10-06T14:12:51.869Z" }, + { url = "https://files.pythonhosted.org/packages/73/ae/b48f95715333080afb75a4504487cbe142cae1268afc482d06692d605ae6/yarl-1.22.0-py3-none-any.whl", hash = "sha256:1380560bdba02b6b6c90de54133c81c9f2a453dee9912fe58c1dcced1edb7cff", size = 46814, upload-time = "2025-10-06T14:12:53.872Z" }, +] + [[package]] name = "zipp" version = "3.23.0" From cc7f2a4b3af4300b9703b8b103cba3820ebd283f Mon Sep 17 00:00:00 2001 From: Peter Staar Date: Sun, 14 Dec 2025 09:21:05 +0100 Subject: [PATCH 17/17] fixed some unclean code Signed-off-by: Peter Staar --- docling_core/experimental/idoctags.py | 5 ++--- 1 file changed, 2 insertions(+), 3 deletions(-) diff --git a/docling_core/experimental/idoctags.py b/docling_core/experimental/idoctags.py index d0b55824..e53853aa 100644 --- a/docling_core/experimental/idoctags.py +++ b/docling_core/experimental/idoctags.py @@ -2,6 +2,7 @@ import re from enum import Enum +from itertools import groupby from typing import Any, ClassVar, Final, Optional, cast from xml.dom.minidom import Element, parseString @@ -2094,9 +2095,7 @@ def _otsl_parse_texts( # Split into rows by NL markers while keeping segments split_row_tokens = [ list(group) - for is_sep, group in __import__("itertools").groupby( - tokens, lambda z: z == nl - ) + for is_sep, group in groupby(tokens, key=lambda z: z == nl) if not is_sep ]