From 955cce20918fd79d38aec983c34c949fbde36cde Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Mon, 27 Jul 2020 12:38:05 -0700 Subject: [PATCH 01/23] refactor: move rust agent to its own repo --- Cargo.lock | 48 +- Cargo.toml | 1 - dfx.nix | 14 +- src/agent/rust/Cargo.toml | 29 - src/agent/rust/README.adoc | 9 - src/agent/rust/src/agent/agent_config.rs | 45 -- src/agent/rust/src/agent/agent_error.rs | 71 -- src/agent/rust/src/agent/agent_test.rs | 286 ------- src/agent/rust/src/agent/mod.rs | 308 -------- src/agent/rust/src/agent/nonce.rs | 48 -- src/agent/rust/src/agent/replica_api.rs | 79 -- src/agent/rust/src/agent/response.rs | 23 - .../rust/src/canister/management_canister.rs | 120 --- src/agent/rust/src/canister/mod.rs | 7 - src/agent/rust/src/identity/dummy.rs | 18 - src/agent/rust/src/identity/mod.rs | 28 - src/agent/rust/src/lib.rs | 11 - src/agent/rust/src/types/blob.rs | 85 --- .../rust/src/types/canister_attributes.rs | 62 -- src/agent/rust/src/types/canister_id.rs | 167 ---- src/agent/rust/src/types/mod.rs | 17 - src/agent/rust/src/types/principal.rs | 126 --- src/agent/rust/src/types/request_id.rs | 720 ------------------ src/agent/rust/src/types/request_id_error.rs | 78 -- src/dfx/Cargo.toml | 3 +- src/ic_identity_manager/Cargo.toml | 2 +- 26 files changed, 13 insertions(+), 2392 deletions(-) delete mode 100644 src/agent/rust/Cargo.toml delete mode 100644 src/agent/rust/README.adoc delete mode 100644 src/agent/rust/src/agent/agent_config.rs delete mode 100644 src/agent/rust/src/agent/agent_error.rs delete mode 100644 src/agent/rust/src/agent/agent_test.rs delete mode 100644 src/agent/rust/src/agent/mod.rs delete mode 100644 src/agent/rust/src/agent/nonce.rs delete mode 100644 src/agent/rust/src/agent/replica_api.rs delete mode 100644 src/agent/rust/src/agent/response.rs delete mode 100644 src/agent/rust/src/canister/management_canister.rs delete mode 100644 src/agent/rust/src/canister/mod.rs delete mode 100644 src/agent/rust/src/identity/dummy.rs delete mode 100644 src/agent/rust/src/identity/mod.rs delete mode 100644 src/agent/rust/src/lib.rs delete mode 100644 src/agent/rust/src/types/blob.rs delete mode 100644 src/agent/rust/src/types/canister_attributes.rs delete mode 100644 src/agent/rust/src/types/canister_id.rs delete mode 100644 src/agent/rust/src/types/mod.rs delete mode 100644 src/agent/rust/src/types/principal.rs delete mode 100644 src/agent/rust/src/types/request_id.rs delete mode 100644 src/agent/rust/src/types/request_id_error.rs diff --git a/Cargo.lock b/Cargo.lock index 287cbec3f9..531a53d76c 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -692,14 +692,6 @@ dependencies = [ "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", ] -[[package]] -name = "cmake" -version = "0.1.42" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", -] - [[package]] name = "colored" version = "1.8.0" @@ -982,7 +974,7 @@ dependencies = [ "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", "hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", "hotwatch 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", - "ic-agent 0.6.0", + "ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)", "ic-identity-manager 0.6.0", "indicatif 0.13.0 (registry+https://github.com/rust-lang/crates.io-index)", "lazy-init 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1013,7 +1005,6 @@ dependencies = [ "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", "toml 0.5.5 (registry+https://github.com/rust-lang/crates.io-index)", "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "wabt 0.9.2 (registry+https://github.com/rust-lang/crates.io-index)", "walkdir 2.2.9 (registry+https://github.com/rust-lang/crates.io-index)", "wasmparser 0.45.0 (registry+https://github.com/rust-lang/crates.io-index)", "webpki-roots 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1361,11 +1352,6 @@ dependencies = [ "wasi 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", ] -[[package]] -name = "glob" -version = "0.2.11" -source = "registry+https://github.com/rust-lang/crates.io-index" - [[package]] name = "h2" version = "0.1.26" @@ -1553,6 +1539,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" +source = "git+https://github.com/dfinity-lab/rust-agent#db5e93b2f50e5bf1b89780e1f0ca02063c1625a2" dependencies = [ "async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)", "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1562,15 +1549,12 @@ dependencies = [ "delay 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", "hex 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", "leb128 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)", - "mockito 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)", "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "proptest 0.9.5 (registry+https://github.com/rust-lang/crates.io-index)", "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", "reqwest 0.10.4 (registry+https://github.com/rust-lang/crates.io-index)", "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", "serde_bytes 0.11.2 (registry+https://github.com/rust-lang/crates.io-index)", "serde_cbor 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", ] @@ -1578,7 +1562,7 @@ dependencies = [ name = "ic-identity-manager" version = "0.6.0" dependencies = [ - "ic-agent 0.6.0", + "ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)", "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", "pem 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", @@ -3567,27 +3551,6 @@ name = "version_check" version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" -[[package]] -name = "wabt" -version = "0.9.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_derive 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "wabt-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "wabt-sys" -version = "0.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "cmake 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", - "glob 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", -] - [[package]] name = "wait-timeout" version = "0.2.0" @@ -3879,7 +3842,6 @@ dependencies = [ "checksum clap 2.33.0 (registry+https://github.com/rust-lang/crates.io-index)" = "5067f5bb2d80ef5d68b4c87db81601f0b75bca627bc2ef76b141d7b846a3c6d9" "checksum clicolors-control 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "90082ee5dcdd64dc4e9e0d37fbf3ee325419e39c0092191e0393df65518f741e" "checksum cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ddfc5b9aa5d4507acaf872de71051dfd0e309860e88966e1051e462a077aac4f" -"checksum cmake 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)" = "81fb25b677f8bf1eb325017cb6bb8452f87969db0fedb4f757b297bee78a7c62" "checksum colored 1.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "6cdb90b60f2927f8d76139c72dbde7e10c3a2bc47c8594c9c7a66529f2687c03" "checksum console 0.11.3 (registry+https://github.com/rust-lang/crates.io-index)" = "8c0994e656bba7b922d8dd1245db90672ffb701e684e45be58f20719d69abc5a" "checksum console 0.7.7 (registry+https://github.com/rust-lang/crates.io-index)" = "8ca57c2c14b8a2bf3105bc9d15574aad80babf6a9c44b1058034cdf8bd169628" @@ -3952,7 +3914,6 @@ dependencies = [ "checksum futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "8764574ff08b701a084482c3c7031349104b07ac897393010494beaa18ce32c6" "checksum generic-array 0.12.3 (registry+https://github.com/rust-lang/crates.io-index)" = "c68f0274ae0e023facc3c97b2e00f076be70e254bc851d972503b328db79b2ec" "checksum getrandom 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "473a1265acc8ff1e808cd0a1af8cee3c2ee5200916058a2ca113c29f2d903571" -"checksum glob 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)" = "8be18de09a56b60ed0edf84bc9df007e30040691af7acd1c41874faac5895bfb" "checksum h2 0.1.26 (registry+https://github.com/rust-lang/crates.io-index)" = "a5b34c246847f938a410a03c5458c7fee2274436675e76d8b903c08efc29c462" "checksum h2 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "7938e6aa2a31df4e21f224dc84704bd31c089a6d1355c535b03667371cccc843" "checksum half 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "9353c2a89d550b58fa0061d8ed8d002a7d8cdf2494eb0e432859bd3a9e543836" @@ -3971,6 +3932,7 @@ dependencies = [ "checksum hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)" = "ed6081100e960d9d74734659ffc9cc91daf1c0fc7aceb8eaa94ee1a3f5046f2e" "checksum hyper-rustls 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ac965ea399ec3a25ac7d13b8affd4b8f39325cca00858ddf5eb29b79e6b14b08" "checksum hyper-tls 0.4.1 (registry+https://github.com/rust-lang/crates.io-index)" = "3adcd308402b9553630734e9c36b77a7e48b3821251ca2493e8cd596763aafaa" +"checksum ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)" = "" "checksum idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "38f09e0f0b1fb55fdee1f17470ad800da77af5186a1a76c026b679358b7e844e" "checksum idna 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "02e2673c30ee86b5b96a9cb52ad15718aa1f966f5ab9ad54a8b95d5ca33120a9" "checksum indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "712d7b3ea5827fcb9d4fda14bf4da5f136f0db2ae9c8f4bd4e2d1c6fde4e6db2" @@ -4191,8 +4153,6 @@ dependencies = [ "checksum vcpkg 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)" = "33dd455d0f96e90a75803cfeb7f948768c08d70a6de9a8d2362461935698bf95" "checksum vec_map 0.8.1 (registry+https://github.com/rust-lang/crates.io-index)" = "05c78687fb1a80548ae3250346c3db86a80a7cdd77bda190189f2d0a0987c81a" "checksum version_check 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "914b1a6776c4c929a602fafd8bc742e06365d4bcbe48c30f9cca5824f70dc9dd" -"checksum wabt 0.9.2 (registry+https://github.com/rust-lang/crates.io-index)" = "3c5c5c1286c6e578416982609f47594265f9d489f9b836157d403ad605a46693" -"checksum wabt-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "af5d153dc96aad7dc13ab90835b892c69867948112d95299e522d370c4e13a08" "checksum wait-timeout 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "9f200f5b12eb75f8c1ed65abd4b2db8a6e1b138a20de009dacee265a2498f3f6" "checksum walkdir 2.2.9 (registry+https://github.com/rust-lang/crates.io-index)" = "9658c94fa8b940eab2250bd5a457f9c48b748420d71293b165c8cdbe2f55f71e" "checksum want 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" diff --git a/Cargo.toml b/Cargo.toml index ee0acffc79..c6e1df3b7c 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -1,6 +1,5 @@ [workspace] members = [ "src/dfx", - "src/agent/rust", "src/ic_identity_manager", ] diff --git a/dfx.nix b/dfx.nix index 78c9953fb8..d41b81b08e 100644 --- a/dfx.nix +++ b/dfx.nix @@ -26,14 +26,8 @@ let "^.cargo/config$" ]; cargoTestCommands = _: [ - ''cargo $cargo_options test $cargo_test_options --workspace --exclude ic-agent'' - ''RUST_TEST_THREADS=1 cargo $cargo_options test $cargo_test_options -p ic-agent'' + ''cargo $cargo_options test $cargo_test_options --workspace'' ]; - override = oldAttrs: { - # both needed for bindgen, used by rocksdb-sys, zstd-sys, lmdb-sys, etc - LIBCLANG_PATH = "${pkgs.llvmPackages.libclang}/lib"; - CLANG_PATH = "${pkgs.llvmPackages.clang}/bin/clang"; - }; }; # add extra executables used when linting @@ -110,6 +104,12 @@ let # Set CARGO_HOME to minimize interaction with any environment outside nix export CARGO_HOME=${if pkgs.lib.isHydra then "." else toString ./.}/.cargo-home + if [ ! -d "$CARGO_HOME" ]; then + mkdir -p $CARGO_HOME + echo "[net] + git-fetch-with-cli = true" > $CARGO_HOME/config + fi + # Set environment variable for debug version. export DFX_TIMESTAMP_DEBUG_MODE_ONLY=$(date +%s) ''; diff --git a/src/agent/rust/Cargo.toml b/src/agent/rust/Cargo.toml deleted file mode 100644 index a4bc6ee383..0000000000 --- a/src/agent/rust/Cargo.toml +++ /dev/null @@ -1,29 +0,0 @@ -[package] -name = "ic-agent" -version = "0.6.0" -authors = ["Hans Larsen "] -edition = "2018" - -# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html - -[dependencies] -async-trait = "0.1.35" -byteorder = "1.3.2" -candid = "0.3.1" -candid_derive = "0.2.2" -crc8 = "0.1.1" -delay = "0.1.1" -hex = "0.4.0" -leb128 = "0.2.4" -openssl = "0.10.24" -rand = "0.7.2" -reqwest = "0.10.4" -serde = { version = "1.0.101", features = ["derive"] } -serde_bytes = "0.11.2" -serde_cbor = "0.10" -url = "2.1.0" - -[dev-dependencies] -mockito = "0.20.0" -proptest = "0.9.5" -tokio = "0.2.6" diff --git a/src/agent/rust/README.adoc b/src/agent/rust/README.adoc deleted file mode 100644 index 1adc848631..0000000000 --- a/src/agent/rust/README.adoc +++ /dev/null @@ -1,9 +0,0 @@ -= Public Spec - -== Goal -This library contains typings and utility functions dealing with the public spec and the HTTP -client. It might be shared in the future but for now is separated for the purpose of testing and -development. - -== References -The latest version of the https://hydra.dfinity.systems/latest/dfinity-ci-build/dfinity/dfinity.docs.x86_64-linux/dfinity/spec/public/index.html[public spec] is available internally on hydra. diff --git a/src/agent/rust/src/agent/agent_config.rs b/src/agent/rust/src/agent/agent_config.rs deleted file mode 100644 index ef51556402..0000000000 --- a/src/agent/rust/src/agent/agent_config.rs +++ /dev/null @@ -1,45 +0,0 @@ -use crate::identity::dummy::DummyIdentity; -use crate::identity::Identity; -use crate::{AgentError, NonceFactory}; -use async_trait::async_trait; - -#[async_trait] -pub trait AgentRequestExecutor: Sync + Send { - async fn execute(&self, request: reqwest::Request) -> Result; -} - -pub struct DefaultAgentClient { - client: reqwest::Client, -} - -#[async_trait] -impl AgentRequestExecutor for DefaultAgentClient { - async fn execute(&self, request: reqwest::Request) -> Result { - self.client.execute(request).await.map_err(AgentError::from) - } -} - -pub struct AgentConfig<'a> { - pub url: &'a str, - pub nonce_factory: NonceFactory, - pub identity: Box, - pub request_executor: Box, - pub default_waiter: delay::Delay, -} - -impl Default for AgentConfig<'_> { - fn default() -> Self { - Self { - // Making sure this is invalid so users have to overwrite it. - url: "-", - nonce_factory: NonceFactory::random(), - identity: Box::new(DummyIdentity {}), - request_executor: Box::new(DefaultAgentClient { - client: reqwest::Client::builder() - .build() - .expect("Could not create HTTP client."), - }), - default_waiter: delay::Delay::instant(), - } - } -} diff --git a/src/agent/rust/src/agent/agent_error.rs b/src/agent/rust/src/agent/agent_error.rs deleted file mode 100644 index 18263907b8..0000000000 --- a/src/agent/rust/src/agent/agent_error.rs +++ /dev/null @@ -1,71 +0,0 @@ -use crate::{Replied, RequestIdError, TextualCanisterIdError}; -use serde_cbor::error::Error as SerdeError; - -#[derive(Debug)] -pub enum AgentError { - InvalidClientUrl(String), - InvalidClientResponse, - CannotCalculateRequestId(RequestIdError), - EmptyResponse(), - TimeoutWaitingForResponse, - - SigningError(String), - - InvalidCborData(serde_cbor::Error), - ReqwestError(reqwest::Error), - SerdeError(SerdeError), - UrlParseError(url::ParseError), - - ReplicaError { - reject_code: u64, - reject_message: String, - }, - ServerError { - status: u16, - content_type: Option, - content: String, - }, - - UnexpectedReply(Replied), - - CandidError(candid::Error), - CanisterIdTextError(TextualCanisterIdError), - - InstallModeError(String), -} - -impl From for AgentError { - fn from(err: SerdeError) -> Self { - Self::SerdeError(err) - } -} - -impl From for AgentError { - fn from(err: reqwest::Error) -> Self { - Self::ReqwestError(err) - } -} - -impl From for AgentError { - fn from(err: candid::Error) -> Self { - Self::CandidError(err) - } -} - -impl From for AgentError { - fn from(err: url::ParseError) -> Self { - Self::UrlParseError(err) - } -} - -impl From for AgentError { - fn from(err: RequestIdError) -> Self { - Self::CannotCalculateRequestId(err) - } -} - -impl From for AgentError { - fn from(err: TextualCanisterIdError) -> Self { - Self::CanisterIdTextError(err) - } -} diff --git a/src/agent/rust/src/agent/agent_test.rs b/src/agent/rust/src/agent/agent_test.rs deleted file mode 100644 index 2cafd9073b..0000000000 --- a/src/agent/rust/src/agent/agent_test.rs +++ /dev/null @@ -1,286 +0,0 @@ -use crate::agent::replica_api::{CallReply, QueryResponse}; -use crate::agent::response::{Replied, RequestStatusResponse}; -use crate::{Agent, AgentConfig, AgentError, Blob, CanisterId}; -use delay::Delay; -use mockito::mock; -use std::collections::BTreeMap; -use std::time::Duration; - -#[test] -fn query() -> Result<(), AgentError> { - let blob = Blob(Vec::from("Hello World")); - let response = QueryResponse::Replied { - reply: CallReply { arg: blob.clone() }, - }; - - let read_mock = mock("POST", "/api/v1/read") - .with_status(200) - .with_header("content-type", "application/cbor") - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(async { - agent - .query(&CanisterId::from_bytes(&[1u8]), "main", &Blob(vec![])) - .await - }); - - read_mock.assert(); - - assert_eq!(result?, blob); - - Ok(()) -} - -#[test] -fn query_error() -> Result<(), AgentError> { - let read_mock = mock("POST", "/api/v1/read").with_status(500).create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - - let result: Result = runtime.block_on(async { - agent - .query(&CanisterId::from_bytes(&[2u8]), "greet", &Blob::empty()) - .await - }); - - read_mock.assert(); - - assert!(result.is_err()); - - Ok(()) -} - -#[test] -fn query_rejected() -> Result<(), AgentError> { - let response: QueryResponse = QueryResponse::Rejected { - reject_code: 1234, - reject_message: "Rejected Message".to_string(), - }; - - let read_mock = mock("POST", "/api/v1/read") - .with_status(200) - .with_header("content-type", "application/cbor") - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - - let result: Result = runtime.block_on(async { - agent - .query(&CanisterId::from_bytes(&[3u8]), "greet", &Blob::empty()) - .await - }); - - read_mock.assert(); - - match result { - Err(AgentError::ReplicaError { - reject_code: code, - reject_message: msg, - }) => { - assert_eq!(code, 1234); - assert_eq!(msg, "Rejected Message"); - } - result => unreachable!("{:?}", result), - } - - Ok(()) -} - -#[test] -fn call() -> Result<(), AgentError> { - let blob = Blob(Vec::from("Hello World")); - let response = QueryResponse::Replied { - reply: CallReply { arg: blob.clone() }, - }; - - let submit_mock = mock("POST", "/api/v1/submit").with_status(200).create(); - let status_mock = mock("POST", "/api/v1/read") - .with_status(200) - .with_header("content-type", "application/cbor") - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(async { - let request_id = agent - .call_raw(&CanisterId::from_bytes(&[4u8]), "greet", &Blob::empty()) - .await?; - agent.request_status_raw(&request_id).await - }); - - submit_mock.assert(); - status_mock.assert(); - - assert_eq!( - result?, - RequestStatusResponse::Replied { - reply: Replied::CallReplied(blob) - } - ); - - Ok(()) -} - -#[test] -fn call_error() -> Result<(), AgentError> { - let submit_mock = mock("POST", "/api/v1/submit").with_status(500).create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(async { - agent - .call(&CanisterId::from_bytes(&[5u8]), "greet", &Blob::empty()) - .await - }); - - submit_mock.assert(); - - assert!(result.is_err()); - - Ok(()) -} - -#[test] -fn call_rejected() -> Result<(), AgentError> { - let response: QueryResponse = QueryResponse::Rejected { - reject_code: 1234, - reject_message: "Rejected Message".to_string(), - }; - - let submit_mock = mock("POST", "/api/v1/submit").with_status(200).create(); - let status_mock = mock("POST", "/api/v1/read") - .with_status(200) - .with_header("content-type", "application/cbor") - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result: Result = runtime.block_on(async { - let request_id = agent - .call_raw(&CanisterId::from_bytes(&[6u8]), "greet", &Blob::empty()) - .await?; - agent - .request_status_and_wait(&request_id, Delay::timeout(Duration::from_millis(100))) - .await - }); - - match result { - Err(AgentError::ReplicaError { - reject_code: code, - reject_message: msg, - }) => { - assert_eq!(code, 1234); - assert_eq!(msg, "Rejected Message"); - } - result => unreachable!("{:?}", result), - } - - submit_mock.assert(); - status_mock.assert(); - - Ok(()) -} - -#[test] -fn ping() -> Result<(), AgentError> { - let response = serde_cbor::Value::Map(BTreeMap::new()); - let read_mock = mock("GET", "/api/v1/status") - .with_status(200) - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(async { agent.ping(Delay::instant()).await }); - - read_mock.assert(); - - assert!(result.is_ok()); - - Ok(()) -} - -#[test] -fn ping_okay() -> Result<(), AgentError> { - let response = serde_cbor::Value::Map(BTreeMap::new()); - let read_mock = mock("GET", "/api/v1/status") - .with_status(200) - .with_body(serde_cbor::to_vec(&response)?) - .create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(agent.ping(Delay::instant())); - - read_mock.assert(); - - assert!(result.is_ok()); - - Ok(()) -} - -#[test] -// test that the agent (re)tries to reach the server. -// We spawn an agent that waits 400ms between requests, and times out after 600ms. The agent is -// expected to hit the server at ~ 0ms and ~ 400 ms, and then shut down at 600ms, so we check that -// the server got two requests. -fn ping_error() -> Result<(), AgentError> { - // This mock is never asserted as we don't know (nor do we need to know) how many times - // it is called. - let _read_mock = mock("GET", "/api/v1/status").with_status(500).create(); - - let agent = Agent::new(AgentConfig { - url: &mockito::server_url(), - ..AgentConfig::default() - })?; - let mut runtime = tokio::runtime::Runtime::new().expect("Unable to create a runtime"); - let result = runtime.block_on(async { - agent - .ping( - Delay::builder() - .throttle(Duration::from_millis(4)) - .timeout(Duration::from_millis(6)) - .build(), - ) - .await - }); - - assert!(result.is_err()); - - Ok(()) -} diff --git a/src/agent/rust/src/agent/mod.rs b/src/agent/rust/src/agent/mod.rs deleted file mode 100644 index c8dbca91d9..0000000000 --- a/src/agent/rust/src/agent/mod.rs +++ /dev/null @@ -1,308 +0,0 @@ -pub(crate) mod agent_config; -pub(crate) mod agent_error; -pub(crate) mod nonce; -pub(crate) mod replica_api; -pub(crate) mod response; - -pub(crate) mod public { - pub use super::agent_config::{AgentConfig, AgentRequestExecutor}; - pub use super::agent_error::AgentError; - pub use super::nonce::NonceFactory; - pub use super::response::{Replied, RequestStatusResponse}; - pub use super::Agent; -} - -#[cfg(test)] -mod agent_test; - -use crate::agent::replica_api::{AsyncContent, Envelope, SyncContent}; -use crate::identity::Identity; -use crate::{to_request_id, Blob, CanisterId, Principal, RequestId}; -use reqwest::Method; -use serde::Serialize; - -use public::*; - -pub struct Agent { - url: reqwest::Url, - nonce_factory: NonceFactory, - request_executor: Box, - identity: Box, - default_waiter: delay::Delay, -} - -impl Agent { - pub fn new(config: AgentConfig<'_>) -> Result { - let url = config.url; - - Ok(Agent { - url: reqwest::Url::parse(url) - .and_then(|url| url.join("api/v1/")) - .map_err(|_| AgentError::InvalidClientUrl(String::from(url)))?, - request_executor: config.request_executor, - nonce_factory: config.nonce_factory, - identity: config.identity, - default_waiter: config.default_waiter, - }) - } - - async fn execute( - &self, - endpoint: &str, - envelope: Envelope, - ) -> Result, AgentError> { - let mut serialized_bytes = Vec::new(); - let mut serializer = serde_cbor::Serializer::new(&mut serialized_bytes); - serializer.self_describe()?; - envelope.serialize(&mut serializer)?; - - let url = self.url.join(endpoint)?; - - let mut http_request = reqwest::Request::new(Method::POST, url); - http_request.headers_mut().insert( - reqwest::header::CONTENT_TYPE, - "application/cbor".parse().unwrap(), - ); - http_request - .body_mut() - .get_or_insert(reqwest::Body::from(serialized_bytes)); - - let response = self.request_executor.execute(http_request).await?; - if response.status().is_client_error() || response.status().is_server_error() { - Err(AgentError::ServerError { - status: response.status().into(), - content_type: response - .headers() - .get(reqwest::header::CONTENT_TYPE) - .and_then(|value| value.to_str().ok()) - .map(|x| x.to_string()), - content: response.text().await?, - }) - } else { - Ok(response.bytes().await?.to_vec()) - } - } - - async fn read(&self, request: SyncContent) -> Result - where - A: serde::de::DeserializeOwned, - { - let anonymous = Principal::anonymous(); - let request_id = to_request_id(&request)?; - let sender = match &request { - SyncContent::QueryRequest { sender, .. } => sender, - SyncContent::RequestStatusRequest { .. } => &anonymous, - }; - let signature = self.identity.sign(&request_id, &sender)?; - let bytes = self - .execute( - "read", - Envelope { - content: request, - sender_pubkey: signature.public_key, - sender_sig: signature.signature, - }, - ) - .await?; - - serde_cbor::from_slice(&bytes).map_err(AgentError::InvalidCborData) - } - - async fn submit(&self, request: AsyncContent) -> Result { - let request_id = to_request_id(&request)?; - let sender = match request.clone() { - AsyncContent::CallRequest { sender, .. } => sender, - }; - let signature = self.identity.sign(&request_id, &sender)?; - let _ = self - .execute( - "submit", - Envelope { - content: request, - sender_pubkey: signature.public_key, - sender_sig: signature.signature, - }, - ) - .await?; - - Ok(request_id) - } - - /// The simplest for of query; sends a Blob and will return a Blob. The encoding is - /// left as an exercise to the user. - pub async fn query<'a>( - &self, - canister_id: &'a CanisterId, - method_name: &'a str, - arg: &'a Blob, - ) -> Result { - self.read::(SyncContent::QueryRequest { - sender: self.identity.sender()?, - canister_id: canister_id.clone(), - method_name: method_name.to_string(), - arg: arg.clone(), - }) - .await - .and_then(|response| match response { - replica_api::QueryResponse::Replied { reply } => Ok(reply.arg), - replica_api::QueryResponse::Rejected { - reject_code, - reject_message, - } => Err(AgentError::ReplicaError { - reject_code, - reject_message, - }), - }) - } - - pub async fn request_status(&self, request_id: &RequestId) -> Result { - self.request_status_and_wait(request_id, self.default_waiter.clone()) - .await - } - - pub async fn request_status_raw( - &self, - request_id: &RequestId, - ) -> Result { - self.read(SyncContent::RequestStatusRequest { - request_id: request_id.as_slice().into(), - }) - .await - .map(|response| match response { - replica_api::RequestStatusResponse::Replied { reply } => { - let reply = match reply { - replica_api::RequestStatusResponseReplied::CallReply(reply) => { - Replied::CallReplied(reply.arg) - } - }; - - RequestStatusResponse::Replied { reply } - } - replica_api::RequestStatusResponse::Unknown {} => RequestStatusResponse::Unknown, - replica_api::RequestStatusResponse::Received {} => RequestStatusResponse::Received, - replica_api::RequestStatusResponse::Processing {} => RequestStatusResponse::Processing, - replica_api::RequestStatusResponse::Rejected { - reject_code, - reject_message, - } => RequestStatusResponse::Rejected { - reject_code, - reject_message, - }, - }) - } - - pub async fn request_status_and_wait( - &self, - request_id: &RequestId, - mut waiter: W, - ) -> Result { - waiter.start(); - - loop { - match self.request_status_raw(request_id).await? { - RequestStatusResponse::Replied { reply } => return Ok(reply), - RequestStatusResponse::Rejected { - reject_code, - reject_message, - } => { - return Err(AgentError::ReplicaError { - reject_code, - reject_message, - }) - } - RequestStatusResponse::Unknown => (), - RequestStatusResponse::Received => (), - RequestStatusResponse::Processing => (), - }; - - waiter - .wait() - .map_err(|_| AgentError::TimeoutWaitingForResponse)?; - } - } - - pub async fn call_and_wait( - &self, - canister_id: &CanisterId, - method_name: &str, - arg: &Blob, - waiter: W, - ) -> Result { - let request_id = self.call_raw(canister_id, method_name, arg).await?; - match self.request_status_and_wait(&request_id, waiter).await? { - Replied::CallReplied(arg) => Ok(arg), - reply => Err(AgentError::UnexpectedReply(reply)), - } - } - - pub async fn call( - &self, - canister_id: &CanisterId, - method_name: &str, - arg: &Blob, - ) -> Result { - self.call_and_wait(canister_id, method_name, arg, self.default_waiter.clone()) - .await - } - - pub async fn call_raw( - &self, - canister_id: &CanisterId, - method_name: &str, - arg: &Blob, - ) -> Result { - self.submit(AsyncContent::CallRequest { - canister_id: canister_id.clone(), - method_name: method_name.into(), - arg: arg.clone(), - nonce: self.nonce_factory.generate().map(|b| b.as_slice().into()), - sender: self.identity.sender()?, - }) - .await - } - - pub async fn ping_once(&self) -> Result { - let url = self.url.join("status")?; - let mut http_request = reqwest::Request::new(Method::GET, url); - http_request.headers_mut().insert( - reqwest::header::CONTENT_TYPE, - "application/cbor".parse().unwrap(), - ); - let response = self.request_executor.execute(http_request).await?; - - if response.status().is_client_error() || response.status().is_server_error() { - Err(AgentError::ServerError { - status: response.status().into(), - content_type: response - .headers() - .get(reqwest::header::CONTENT_TYPE) - .and_then(|value| value.to_str().ok()) - .map(|x| x.to_string()), - content: response.text().await?, - }) - } else { - let bytes = response.bytes().await?.to_vec(); - Ok(serde_cbor::from_slice(&bytes).map_err(AgentError::InvalidCborData)?) - } - } - - pub async fn ping( - &self, - mut waiter: W, - ) -> Result { - waiter.start(); - loop { - // Break if the server/replica answered but was an error (compared to not being - // able to reach the server). - match self.ping_once().await { - Ok(x) => return Ok(x), - Err(AgentError::ReqwestError(_)) => {} - Err(x) => return Err(x), - } - - waiter - .wait() - .map_err(|_| AgentError::TimeoutWaitingForResponse)?; - } - } -} diff --git a/src/agent/rust/src/agent/nonce.rs b/src/agent/rust/src/agent/nonce.rs deleted file mode 100644 index 4a695d6a61..0000000000 --- a/src/agent/rust/src/agent/nonce.rs +++ /dev/null @@ -1,48 +0,0 @@ -use crate::Blob; -use rand::rngs::OsRng; -use rand::Rng; -use std::sync::Mutex; - -pub struct NonceFactory { - inner: Mutex + Send>>, -} - -impl NonceFactory { - pub fn from_iterator(iter: Box + Send>) -> Self { - Self { - inner: Mutex::new(iter), - } - } - - pub fn random() -> NonceFactory { - Self::from_iterator(Box::new(RandomBlobIter {})) - } - - pub fn empty() -> NonceFactory { - Self::from_iterator(Box::new(EmptyBlobIter {})) - } - - pub fn generate(&self) -> Option { - self.inner.lock().unwrap().next() - } -} - -struct RandomBlobIter {} - -impl Iterator for RandomBlobIter { - type Item = Blob; - - fn next(&mut self) -> Option { - Some(Blob(OsRng.gen::<[u8; 16]>().to_vec())) - } -} - -struct EmptyBlobIter {} - -impl Iterator for EmptyBlobIter { - type Item = Blob; - - fn next(&mut self) -> Option { - None - } -} diff --git a/src/agent/rust/src/agent/replica_api.rs b/src/agent/rust/src/agent/replica_api.rs deleted file mode 100644 index 662b3d55b5..0000000000 --- a/src/agent/rust/src/agent/replica_api.rs +++ /dev/null @@ -1,79 +0,0 @@ -use crate::{Blob, CanisterId, Principal}; -use serde::{Deserialize, Serialize}; - -#[derive(Debug, Clone, Serialize)] -#[serde(rename_all = "snake_case")] -pub struct Envelope { - pub content: T, - pub sender_pubkey: Blob, - pub sender_sig: Blob, -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -#[serde(tag = "request_type")] -pub enum AsyncContent { - #[serde(rename = "call")] - CallRequest { - #[serde(skip_serializing_if = "Option::is_none")] - nonce: Option, - sender: Principal, - canister_id: CanisterId, - method_name: String, - arg: Blob, - }, -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -#[serde(tag = "request_type")] -pub enum SyncContent { - #[serde(rename = "request_status")] - RequestStatusRequest { request_id: Blob }, - #[serde(rename = "query")] - QueryRequest { - sender: Principal, - canister_id: CanisterId, - method_name: String, - arg: Blob, - }, -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -#[serde(tag = "status")] -pub enum RequestStatusResponse { - #[serde(rename = "unknown")] - Unknown {}, - #[serde(rename = "received")] - Received {}, - #[serde(rename = "processing")] - Processing {}, - #[serde(rename = "replied")] - Replied { reply: RequestStatusResponseReplied }, - #[serde(rename = "rejected")] - Rejected { - reject_code: u64, - reject_message: String, - }, -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -#[serde(untagged)] -pub enum RequestStatusResponseReplied { - CallReply(CallReply), -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -pub struct CallReply { - pub arg: Blob, -} - -#[derive(Debug, Clone, Deserialize, Serialize)] -#[serde(tag = "status")] -pub enum QueryResponse { - #[serde(rename = "replied")] - Replied { reply: CallReply }, - #[serde(rename = "rejected")] - Rejected { - reject_code: u64, - reject_message: String, - }, -} diff --git a/src/agent/rust/src/agent/response.rs b/src/agent/rust/src/agent/response.rs deleted file mode 100644 index a7c7e6388a..0000000000 --- a/src/agent/rust/src/agent/response.rs +++ /dev/null @@ -1,23 +0,0 @@ -use crate::{Blob, CanisterId}; - -/// The response of /api/v1/read with "request_status" request type. -#[derive(Debug, Ord, PartialOrd, Eq, PartialEq)] -pub enum RequestStatusResponse { - Unknown, - Received, - Processing, - Replied { - reply: Replied, - }, - Rejected { - reject_code: u64, - reject_message: String, - }, -} - -#[derive(Debug, Ord, PartialOrd, Eq, PartialEq)] -pub enum Replied { - CallReplied(Blob), - CreateCanisterReplied(CanisterId), - InstallCodeReplied, -} diff --git a/src/agent/rust/src/canister/management_canister.rs b/src/agent/rust/src/canister/management_canister.rs deleted file mode 100644 index 95c0148831..0000000000 --- a/src/agent/rust/src/canister/management_canister.rs +++ /dev/null @@ -1,120 +0,0 @@ -use crate::agent::agent_error::AgentError; -use crate::agent::response::Replied; -use crate::agent::Agent; -use crate::{Blob, CanisterAttributes, CanisterId, RequestId}; -use candid::{Decode, Encode}; -use std::str::FromStr; - -const MANAGEMENT_CANISTER_ID: &str = "ic:00"; -const CREATE_METHOD_NAME: &str = "create_canister"; -const INSTALL_METHOD_NAME: &str = "install_code"; - -#[derive(candid::CandidType, candid::Deserialize)] -struct CreateResult { - canister_id: candid::Principal, -} - -#[derive(Clone, candid::CandidType, candid::Deserialize)] -pub enum InstallMode { - #[serde(rename = "install")] - Install, - #[serde(rename = "reinstall")] - Reinstall, - #[serde(rename = "upgrade")] - Upgrade, -} - -impl FromStr for InstallMode { - type Err = AgentError; - - fn from_str(s: &str) -> Result { - match s { - "install" => Ok(InstallMode::Install), - "reinstall" => Ok(InstallMode::Reinstall), - "upgrade" => Ok(InstallMode::Upgrade), - &_ => Err(AgentError::InstallModeError(s.to_string())), - } - } -} - -#[derive(candid::CandidType, candid::Deserialize)] -struct CanisterInstall { - mode: InstallMode, - canister_id: candid::Principal, - wasm_module: Vec, - arg: Vec, - compute_allocation: Option, -} - -pub struct ManagementCanister<'agent> { - agent: &'agent Agent, -} - -impl<'agent> ManagementCanister<'agent> { - pub fn new(agent: &'agent Agent) -> Self { - ManagementCanister { agent } - } - - pub async fn create_canister( - &self, - waiter: W, - ) -> Result { - // candid encoding of () i.e. no arguments - let bytes: Vec = candid::Encode!(&()).unwrap(); - let request_id = self - .agent - .call_raw( - &CanisterId::from_text(MANAGEMENT_CANISTER_ID).unwrap(), - CREATE_METHOD_NAME, - &Blob::from(bytes), - ) - .await?; - match self - .agent - .request_status_and_wait(&request_id, waiter) - .await? - { - Replied::CallReplied(blob) => { - let cid = Decode!(blob.as_slice(), CreateResult)?; - Ok(CanisterId::from_text(cid.canister_id.to_text())?) - } - reply => Err(AgentError::UnexpectedReply(reply)), - } - } - - pub async fn install_code( - &self, - waiter: W, - canister_id: &CanisterId, - mode: InstallMode, - module: &Blob, - arg: &Blob, - attributes: &CanisterAttributes, - ) -> Result { - let canister_to_install = CanisterInstall { - mode, - canister_id: candid::Principal::from_text(canister_id.to_text())?, - wasm_module: module.as_slice().to_vec(), - arg: arg.as_slice().to_vec(), - compute_allocation: attributes.compute_allocation.map(|x| x.into()), - }; - let bytes: Vec = candid::Encode!(&canister_to_install).unwrap(); - let request_id = self - .agent - .call_raw( - &CanisterId::from_text(MANAGEMENT_CANISTER_ID).unwrap(), - INSTALL_METHOD_NAME, - &Blob::from(bytes), - ) - .await?; - match self - .agent - .request_status_and_wait(&request_id, waiter) - .await? - { - // Candid type returned is () so ignoring _blob on purpose - Replied::CallReplied(_blob) => Ok(request_id), - reply => Err(AgentError::UnexpectedReply(reply)), - } - } -} diff --git a/src/agent/rust/src/canister/mod.rs b/src/agent/rust/src/canister/mod.rs deleted file mode 100644 index 8459b7f835..0000000000 --- a/src/agent/rust/src/canister/mod.rs +++ /dev/null @@ -1,7 +0,0 @@ -pub(crate) mod management_canister; - -pub(crate) mod public { - use super::*; - - pub use management_canister::{InstallMode, ManagementCanister}; -} diff --git a/src/agent/rust/src/identity/dummy.rs b/src/agent/rust/src/identity/dummy.rs deleted file mode 100644 index 2f65244f52..0000000000 --- a/src/agent/rust/src/identity/dummy.rs +++ /dev/null @@ -1,18 +0,0 @@ -use crate::agent::agent_error::AgentError; -use crate::identity::Identity; -use crate::{Blob, Principal, RequestId, Signature}; - -pub(crate) struct DummyIdentity {} - -impl Identity for DummyIdentity { - fn sender(&self) -> Result { - Ok(Principal::anonymous()) - } - - fn sign(&self, _request: &RequestId, _principal: &Principal) -> Result { - Ok(Signature { - signature: Blob::from(vec![1; 32]), - public_key: Blob::from(vec![2; 32]), - }) - } -} diff --git a/src/agent/rust/src/identity/mod.rs b/src/agent/rust/src/identity/mod.rs deleted file mode 100644 index 8c21a22a8d..0000000000 --- a/src/agent/rust/src/identity/mod.rs +++ /dev/null @@ -1,28 +0,0 @@ -use crate::{AgentError, Blob, Principal, RequestId}; - -pub(crate) mod dummy; - -pub(crate) mod public { - pub use super::{Identity, Signature}; -} - -#[derive(Clone, Debug)] -pub struct Signature { - pub public_key: Blob, - pub signature: Blob, -} - -/// An Identity takes a request id and returns the [Signature]. Since it -/// also knows about the Principal of the sender. -/// -/// Agents are assigned a single Identity object, but there can be multiple -/// identities used -pub trait Identity: Send + Sync { - /// Returns a sender, ie. the Principal ID that is used to sign a request. - /// Only one sender can be used per request. - fn sender(&self) -> Result; - - /// Sign a request ID with the principal passed in. The principal should be - /// the same returned by the call to `sender()`. - fn sign(&self, request: &RequestId, principal: &Principal) -> Result; -} diff --git a/src/agent/rust/src/lib.rs b/src/agent/rust/src/lib.rs deleted file mode 100644 index 3e0c0e2797..0000000000 --- a/src/agent/rust/src/lib.rs +++ /dev/null @@ -1,11 +0,0 @@ -mod agent; -pub use agent::public::*; - -mod identity; -pub use identity::public::*; - -mod types; -pub use types::public::*; - -mod canister; -pub use canister::public::*; diff --git a/src/agent/rust/src/types/blob.rs b/src/agent/rust/src/types/blob.rs deleted file mode 100644 index 3ad0efbd08..0000000000 --- a/src/agent/rust/src/types/blob.rs +++ /dev/null @@ -1,85 +0,0 @@ -use crate::types::request_id; -use serde::{de, Deserialize, Deserializer, Serialize, Serializer}; -use std::fmt; - -#[cfg(test)] -use rand::{thread_rng, RngCore}; - -/// A binary "blob", i.e. a byte array -#[derive(Clone, Debug, Ord, PartialOrd, Eq)] -pub struct Blob(pub Vec); - -impl Blob { - pub fn empty() -> Blob { - Blob(Vec::new()) - } - - pub fn as_slice(&self) -> &[u8] { - self.0.as_slice() - } - - #[cfg(test)] - pub fn random(size: usize) -> Blob { - let mut rng = thread_rng(); - let mut v: Vec = Vec::with_capacity(size); - rng.fill_bytes(v.as_mut_slice()); - - Blob(v) - } -} - -impl PartialEq for Blob { - fn eq(&self, other: &Self) -> bool { - other.0.eq(&self.0) - } -} - -impl> From for Blob { - fn from(a: T) -> Blob { - Blob(a.as_ref().to_vec()) - } -} - -/// Serialize into a u64 for now. -impl Serialize for Blob { - fn serialize(&self, serializer: S) -> Result - where - S: Serializer, - { - serializer.serialize_bytes(self.0.as_slice()) - } -} - -/// Simple visitor for deserialization from bytes. We don't support other number types -/// as there's no need for it. -struct BlobVisitor; - -impl<'de> de::Visitor<'de> for BlobVisitor { - type Value = Blob; - - fn expecting(&self, formatter: &mut fmt::Formatter<'_>) -> fmt::Result { - formatter.write_str("a binary large object (bytes)") - } - - fn visit_bytes(self, value: &[u8]) -> Result - where - E: de::Error, - { - Ok(Blob::from(value)) - } -} - -impl<'de> Deserialize<'de> for Blob { - fn deserialize(deserializer: S) -> Result - where - S: Deserializer<'de>, - { - deserializer.deserialize_bytes(BlobVisitor) - } -} - -impl From for Blob { - fn from(rid: request_id::RequestId) -> Blob { - Blob(rid.to_vec()) - } -} diff --git a/src/agent/rust/src/types/canister_attributes.rs b/src/agent/rust/src/types/canister_attributes.rs deleted file mode 100644 index fc7b91b018..0000000000 --- a/src/agent/rust/src/types/canister_attributes.rs +++ /dev/null @@ -1,62 +0,0 @@ -#[derive(Clone, Debug)] -pub enum ComputeAllocationError { - MustBeAPercentage, -} - -impl std::fmt::Display for ComputeAllocationError { - fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> Result<(), std::fmt::Error> { - match self { - ComputeAllocationError::MustBeAPercentage => { - f.write_str("Must be a percent between 0 and 100.") - } - } - } -} - -#[derive(Copy, Clone, Debug)] -pub struct ComputeAllocation(pub(crate) u8); - -impl std::convert::From for u8 { - fn from(compute_allocation: ComputeAllocation) -> Self { - compute_allocation.0 - } -} - -impl std::convert::TryFrom for ComputeAllocation { - type Error = ComputeAllocationError; - - fn try_from(value: u64) -> Result { - if value > 100 { - Err(ComputeAllocationError::MustBeAPercentage) - } else { - Ok(Self(value as u8)) - } - } -} - -impl std::convert::TryFrom for ComputeAllocation { - type Error = ComputeAllocationError; - - fn try_from(value: u8) -> Result { - if value > 100 { - Err(ComputeAllocationError::MustBeAPercentage) - } else { - Ok(Self(value)) - } - } -} - -// #[derive(Copy, Clone, Debug)] -// pub struct MemoryAllocation(pub(crate) u64); - -pub struct CanisterAttributes { - pub compute_allocation: Option, -} - -impl Default for CanisterAttributes { - fn default() -> Self { - CanisterAttributes { - compute_allocation: None, - } - } -} diff --git a/src/agent/rust/src/types/canister_id.rs b/src/agent/rust/src/types/canister_id.rs deleted file mode 100644 index 01ba3cfabd..0000000000 --- a/src/agent/rust/src/types/canister_id.rs +++ /dev/null @@ -1,167 +0,0 @@ -use crate::types::blob::Blob; -use crc8::Crc8; -use hex; -use serde::{Deserialize, Deserializer, Serialize, Serializer}; -use std::{fmt, str}; - -/// Prefix for [textual form of ID](https://docs.dfinity.systems/spec/public/#textual-ids) -const CANISTER_ID_TEXT_PREFIX: &str = "ic:"; - -/// A Canister ID. -/// -/// This type is described as a Blob in the public spec, but used as an integer in most -/// code samples (including this library). For now, we newtype it to abstract its usage -/// from a number, and will change its internal type when time comes. -#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)] -pub struct CanisterId(Blob); - -#[derive(Clone, Debug)] -pub enum TextualCanisterIdError { - TooShort, - BadPrefix, - BadChecksum, - FromHexError(hex::FromHexError), -} - -impl std::convert::From for TextualCanisterIdError { - fn from(e: hex::FromHexError) -> Self { - TextualCanisterIdError::FromHexError(e) - } -} - -impl CanisterId { - /// Allow to move canister Ids in blobs. - pub fn into_blob(self) -> Blob { - self.0 - } - - pub fn from_bytes>(bytes: S) -> CanisterId { - CanisterId(Blob::from(bytes.as_ref())) - } - - /// Parse the text format for canister IDs (e.g., `ic:010840FFAD`). - /// - /// The text format follows this - /// [section of our public spec doc](https://docs.dfinity.systems/spec/public/#textual-ids). - pub fn from_text>(text: S) -> Result { - if text.as_ref().len() < 4 { - Err(TextualCanisterIdError::TooShort) - } else { - let (text_prefix, text_rest) = text.as_ref().split_at(3); - match std::str::from_utf8(text_prefix) { - Ok(ref s) => { - if s != &CANISTER_ID_TEXT_PREFIX { - return Err(TextualCanisterIdError::BadPrefix); - } - } - Err(_) => return Err(TextualCanisterIdError::BadPrefix), - }; - match hex::decode(text_rest)?.as_slice().split_last() { - None => Err(TextualCanisterIdError::TooShort), - Some((last_byte, buf_head)) => { - let mut crc8 = Crc8::create_msb(0x07); - let checksum_byte: u8 = crc8.calc(buf_head, buf_head.len() as i32, 0); - if *last_byte == checksum_byte { - Ok(CanisterId(Blob::from(buf_head))) - } else { - Err(TextualCanisterIdError::BadChecksum) - } - } - } - } - } - - pub fn to_text(&self) -> String { - let mut crc8 = Crc8::create_msb(0x07); - let checksum_byte: u8 = crc8.calc(&(self.0).0, (self.0).0.len() as i32, 0); - let mut buf = (self.0).0.clone(); - buf.push(checksum_byte); - format!("{}{}", CANISTER_ID_TEXT_PREFIX, hex::encode_upper(buf)) - } - - pub fn as_bytes(&self) -> &[u8] { - self.0.as_slice() - } -} - -/// Serialize into a blob. -impl Serialize for CanisterId { - fn serialize(&self, serializer: S) -> Result - where - S: Serializer, - { - self.0.serialize(serializer) - } -} - -impl<'de> Deserialize<'de> for CanisterId { - fn deserialize(deserializer: S) -> Result - where - S: Deserializer<'de>, - { - Ok(CanisterId::from(Blob::deserialize(deserializer)?)) - } -} - -/// Conversion of different types that should be coerce-able to Canister Ids. -impl From for CanisterId { - fn from(b: Blob) -> CanisterId { - // We don't need to make a copy as this assume ownership. - CanisterId(b) - } -} - -impl str::FromStr for CanisterId { - type Err = TextualCanisterIdError; - - fn from_str(s: &str) -> Result { - CanisterId::from_text(s) - } -} - -impl fmt::Display for CanisterId { - fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { - write!(f, "{}", self.to_text()) - } -} - -impl Into for CanisterId { - fn into(self) -> Blob { - self.0 - } -} - -#[cfg(test)] -mod tests { - use super::*; - - #[test] - fn check_serialize_deserialize() { - let id = CanisterId::from_text("ic:ABCD01A7").unwrap(); - - // Use cbor serialization. - let vec = serde_cbor::to_vec(&id).unwrap(); - let value = serde_cbor::from_slice(vec.as_slice()).unwrap(); - - assert_eq!(id, value); - } - - #[test] - fn text_form_matches_public_spec() { - // See example here: https://docs.dfinity.systems/spec/public/#textual-ids - let textid = "ic:ABCD01A7"; - match CanisterId::from_text(textid) { - Ok(ref cid) => assert_eq!(CanisterId::to_text(cid), textid), - Err(_) => unreachable!(), - } - } - - #[test] - fn text_form() { - let cid: CanisterId = CanisterId::from(Blob::from(vec![1, 8, 64, 255].as_slice())); - let text = cid.to_text(); - let cid2 = CanisterId::from_text(&text).unwrap(); - assert_eq!(cid, cid2); - assert_eq!(text, "ic:010840FFEF"); - } -} diff --git a/src/agent/rust/src/types/mod.rs b/src/agent/rust/src/types/mod.rs deleted file mode 100644 index 06da3a72c7..0000000000 --- a/src/agent/rust/src/types/mod.rs +++ /dev/null @@ -1,17 +0,0 @@ -pub(crate) mod blob; -pub(crate) mod canister_attributes; -pub(crate) mod canister_id; -pub(crate) mod principal; -pub(crate) mod request_id; -pub(crate) mod request_id_error; - -pub(crate) mod public { - use super::*; - - pub use blob::Blob; - pub use canister_attributes::{CanisterAttributes, ComputeAllocation, ComputeAllocationError}; - pub use canister_id::{CanisterId, TextualCanisterIdError}; - pub use principal::Principal; - pub use request_id::{to_request_id, RequestId}; - pub use request_id_error::{RequestIdError, RequestIdFromStringError}; -} diff --git a/src/agent/rust/src/types/principal.rs b/src/agent/rust/src/types/principal.rs deleted file mode 100644 index b72571e543..0000000000 --- a/src/agent/rust/src/types/principal.rs +++ /dev/null @@ -1,126 +0,0 @@ -use crate::Blob; -use openssl::sha::sha256; -use serde::de::Error; -use serde::{Deserialize, Deserializer, Serialize, Serializer}; -use std::convert::TryFrom; - -const ID_SELF_AUTHENTICATING_LEN: usize = 33; -const ID_SELF_AUTHENTICATING_SUFFIX: u8 = 0x02; -const ID_ANONYMOUS_SUFFIX: u8 = 0x04; -const ID_ANONYMOUS_BYTES: &[u8] = &[ID_ANONYMOUS_SUFFIX]; - -/// A principal describes the security context of an identity, namely -/// any identity that can be authenticated along with a specific -/// role. In the case of the Internet Computer this maps currently to -/// the identities that can be authenticated by a canister. -/// -/// Note a principal is not necessarily tied with a public key-pair, -/// yet we need at least a key-pair of a related principal to sign -/// requests. -#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)] -pub struct Principal(PrincipalInner); - -#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)] -pub enum PrincipalInner { - /// Defined as H(public_key) || 0x02. - SelfAuthenticating(Vec), - - /// The anonymous Principal. - Anonymous, -} - -impl Principal { - /// Right now we are enforcing a Twisted Edwards Curve 25519 point - /// as the public key. - pub fn self_authenticating(public_key: impl AsRef<[u8]>) -> Self { - let mut bytes = Vec::with_capacity(ID_SELF_AUTHENTICATING_LEN); - let hash = sha256(public_key.as_ref()); - bytes.extend(&hash); - // Now add a suffix denoting the identifier as representing a - // self-authenticating principal. - bytes.push(ID_SELF_AUTHENTICATING_SUFFIX); - Self(PrincipalInner::SelfAuthenticating(bytes)) - } - - pub fn anonymous() -> Self { - Self(PrincipalInner::SelfAuthenticating(vec![ - ID_ANONYMOUS_SUFFIX, - ])) - } -} - -impl TryFrom for Principal { - type Error = String; - - fn try_from(bytes: Blob) -> Result { - Self::try_from(bytes.0.as_slice()) - } -} - -impl TryFrom<&[u8]> for Principal { - type Error = String; - - fn try_from(bytes: &[u8]) -> Result { - let last_byte = bytes.last().ok_or_else(|| { - "empty slice of bytes can not be parsed into an principal identifier".to_owned() - })?; - match *last_byte { - ID_SELF_AUTHENTICATING_SUFFIX => Ok(Principal(PrincipalInner::SelfAuthenticating( - bytes.to_vec(), - ))), - ID_ANONYMOUS_SUFFIX => Ok(Principal(PrincipalInner::Anonymous)), - suffix => Err(format!("not supported principal type: {}", suffix)), - } - } -} - -impl AsRef<[u8]> for Principal { - fn as_ref(&self) -> &[u8] { - self.0.as_ref() - } -} - -impl AsRef<[u8]> for PrincipalInner { - fn as_ref(&self) -> &[u8] { - match self { - PrincipalInner::SelfAuthenticating(v) => v, - PrincipalInner::Anonymous => ID_ANONYMOUS_BYTES, - } - } -} - -impl Serialize for Principal { - fn serialize(&self, serializer: S) -> Result { - serializer.serialize_bytes(self.0.as_ref()) - } -} - -impl<'de> Deserialize<'de> for Principal { - fn deserialize>(deserializer: D) -> Result { - Principal::try_from(Blob::deserialize(deserializer)?).map_err(D::Error::custom) - } -} - -#[cfg(test)] -mod tests { - use super::*; - - #[test] - fn check_parsing() { - let seed = [ - 0xff, 0xee, 0xdd, 0xcc, 0xbb, 0xaa, 0x99, 0x88, 0x77, 0x66, 0x55, 0x44, 0x33, 0x22, - 0x11, 0x00, 0xff, 0xee, 0xdd, 0xcc, 0xbb, 0xaa, 0x99, 0x88, 0x77, 0x66, 0x55, 0x44, - 0x33, 0x22, 0x11, 0x00, - ]; - let principal: Principal = Principal::self_authenticating(&seed); - assert_eq!( - serde_cbor::from_slice::( - serde_cbor::to_vec(&principal) - .expect("Failed to serialize") - .as_slice() - ) - .unwrap(), - principal - ); - } -} diff --git a/src/agent/rust/src/types/request_id.rs b/src/agent/rust/src/types/request_id.rs deleted file mode 100644 index a2ccb35e66..0000000000 --- a/src/agent/rust/src/types/request_id.rs +++ /dev/null @@ -1,720 +0,0 @@ -//! This module deals with computing Request IDs based on the content of a -//! message. -//! -//! We compute the `RequestId` according to the public spec, which -//! specifies it as a "sha256" digest. -//! -//! A single method is exported, to_request_id, which returns a RequestId -//! (a 256 bits slice) or an error. -use crate::types::request_id_error::{RequestIdError, RequestIdFromStringError}; -use openssl::sha::Sha256; -use serde::{ser, Serialize, Serializer}; -use std::collections::BTreeMap; -use std::iter::Extend; -use std::str::FromStr; - -/// Type alias for a sha256 result (ie. a u256). -type Sha256Hash = [u8; 32]; - -/// A Request ID. -#[derive(Clone, Copy, Debug, PartialOrd, Ord, PartialEq, Eq)] -pub struct RequestId(Sha256Hash); - -impl RequestId { - pub fn new(from: &[u8; 32]) -> RequestId { - RequestId(*from) - } - - pub fn as_slice(&self) -> &[u8] { - &self.0 - } - - pub(crate) fn to_vec(&self) -> Vec { - self.0.to_vec() - } -} - -impl FromStr for RequestId { - type Err = RequestIdFromStringError; - - fn from_str(from: &str) -> Result { - let mut blob: [u8; 32] = [0; 32]; - let vec = hex::decode(from).map_err(RequestIdFromStringError::FromHexError)?; - if vec.len() != 32 { - return Err(RequestIdFromStringError::InvalidSize(vec.len())); - } - - blob.copy_from_slice(vec.as_slice()); - Ok(RequestId::new(&blob)) - } -} - -impl From for String { - fn from(id: RequestId) -> String { - hex::encode(id.0) - } -} - -/// We only allow to serialize a Request ID. -impl Serialize for RequestId { - fn serialize(&self, serializer: S) -> Result - where - S: Serializer, - { - serializer.serialize_bytes(&self.to_vec()) - } -} - -/// A Serde Serializer that collects fields and values in order to hash them later. -/// We serialize the type to this structure, then use the trait to hash its content. -/// It is a simple state machine that contains 3 states: -/// 1. The root value, which is a structure. If a value other than a structure is -/// serialized, this errors. This is determined by whether `fields` is Some(_). -/// 2. The structure is being processed, and the value of a field is being -/// serialized. The field_value_hash will be set to Some(_). -/// 3. The finish() function has been called and the hasher cannot be reused. The -/// hash should have been gotten at this point. -/// -/// Inconsistent state are when a field is being serialized and `fields` is None, or -/// when a value (not struct) is being serialized and field_value_hash is None. -/// -/// This will always fail on types that are unknown to the Request format (e.g. i8). -/// An UnsupportedTypeXXX error will be returned. -/// -/// The only types that are supported right now are: -/// . Strings and string slices. -/// . Blobs (the newtype exported from this crate). -/// . A structure as the base level. Its typename and fields are not validated. -/// -/// Additionally, this will fail if there are unsupported data structure, for example -/// if a UnitVariant of another type than Blob is used, or a structure inside a -/// structure. -/// -/// This does not validate whether a message is valid. This is very important as -/// the message format might change faster than the ID calculation. -struct RequestIdSerializer { - // We use a BTreeMap here as there is no indication that keys might not be duplicated, - // and we want to make sure they're overwritten in that case. - fields: Option>, - field_key_hash: Option, // Only used in maps, not structs. - field_value_hash: Option, - hasher: Sha256, -} - -impl RequestIdSerializer { - pub fn new() -> RequestIdSerializer { - Default::default() - } - - /// Finish the hashing and returns the RequestId for the structure that was - /// serialized. - /// - /// This can only be called once (it borrows self). Since this whole class is not public, - /// it should not be a problem. - pub fn finish(mut self) -> Result { - if self.fields.is_some() { - self.fields = None; - Ok(RequestId(self.hasher.finish())) - } else { - Err(RequestIdError::EmptySerializer) - } - } - - /// Hash a single value, returning its sha256_hash. If there is already a value - /// being hashed it will return an InvalidState. This cannot happen currently - /// as we don't allow embedded structures, but is left as a safeguard when - /// making changes. - fn hash_value(&mut self, value: &T) -> Result - where - T: ?Sized + Serialize, - { - if self.field_value_hash.is_some() { - return Err(RequestIdError::InvalidState); - } - - self.field_value_hash = Some(Sha256::new()); - value.serialize(&mut *self)?; - if let Some(r) = self.field_value_hash.take() { - Ok(r.finish()) - } else { - Err(RequestIdError::InvalidState) - } - } -} - -impl Default for RequestIdSerializer { - fn default() -> RequestIdSerializer { - RequestIdSerializer { - fields: None, - field_key_hash: None, - field_value_hash: None, - hasher: Sha256::new(), - } - } -} - -/// See https://serde.rs/data-format.html for more information on how to implement a -/// custom data format. -impl<'a> ser::Serializer for &'a mut RequestIdSerializer { - /// The output type produced by this `Serializer` during successful - /// serialization. Most serializers that produce text or binary output - /// should set `Ok = ()` and serialize into an [`io::Write`] or buffer - /// contained within the `Serializer` instance. Serializers that build - /// in-memory data structures may be simplified by using `Ok` to propagate - /// the data structure around. - /// - /// [`io::Write`]: https://doc.rust-lang.org/std/io/trait.Write.html - type Ok = (); - - /// The error type when some error occurs during serialization. - type Error = RequestIdError; - - // Associated types for keeping track of additional state while serializing - // compound data structures like sequences and maps. In this case no - // additional state is required beyond what is already stored in the - // Serializer struct. - type SerializeSeq = Self; - type SerializeTuple = Self; - type SerializeTupleStruct = Self; - type SerializeTupleVariant = Self; - type SerializeMap = Self; - type SerializeStruct = Self; - type SerializeStructVariant = Self; - - /// Serialize a `bool` value. - fn serialize_bool(self, _v: bool) -> Result { - Err(RequestIdError::UnsupportedTypeBool) - } - - /// Serialize an `i8` value. - fn serialize_i8(self, _v: i8) -> Result { - Err(RequestIdError::UnsupportedTypeI8) - } - - /// Serialize an `i16` value. - fn serialize_i16(self, _v: i16) -> Result { - Err(RequestIdError::UnsupportedTypeI16) - } - - /// Serialize an `i32` value. - fn serialize_i32(self, _v: i32) -> Result { - Err(RequestIdError::UnsupportedTypeI32) - } - - /// Serialize an `i64` value. - fn serialize_i64(self, _v: i64) -> Result { - Err(RequestIdError::UnsupportedTypeI64) - } - - /// Serialize a `u8` value. - fn serialize_u8(self, v: u8) -> Result { - self.serialize_u64(v as u64) - } - - /// Serialize a `u16` value. - fn serialize_u16(self, v: u16) -> Result { - self.serialize_u64(v as u64) - } - - /// Serialize a `u32` value. - fn serialize_u32(self, v: u32) -> Result { - self.serialize_u64(v as u64) - } - - /// Serialize a `u64` value. - fn serialize_u64(self, v: u64) -> Result { - // 10 bytes is enough for a 64-bit number in leb128. - let mut buffer = [0; 10]; - let mut writable = &mut buffer[..]; - let n_bytes = leb128::write::unsigned(&mut writable, v) - .map_err(|e| RequestIdError::Custom(format!("{}", e)))?; - self.serialize_bytes(&buffer[..n_bytes]) - } - - /// Serialize an `f32` value. - fn serialize_f32(self, _v: f32) -> Result { - Err(RequestIdError::UnsupportedTypeF32) - } - - /// Serialize an `f64` value. - fn serialize_f64(self, _v: f64) -> Result { - Err(RequestIdError::UnsupportedTypeF64) - } - - /// Serialize a character. - fn serialize_char(self, _v: char) -> Result { - Err(RequestIdError::UnsupportedTypeChar) - } - - /// Serialize a `&str`. - fn serialize_str(self, v: &str) -> Result { - self.serialize_bytes(v.as_bytes()) - } - - /// Serialize a chunk of raw byte data. - fn serialize_bytes(self, v: &[u8]) -> Result { - match self.field_value_hash { - None => Err(RequestIdError::InvalidState), - Some(ref mut hash) => { - (*hash).update(v); - Ok(()) - } - } - } - - /// Serialize a [`None`] value. - fn serialize_none(self) -> Result { - // Compute the hash as if it was empty string or blob. - match self.field_value_hash { - None => Err(RequestIdError::InvalidState), - Some(ref mut _hash) => Ok(()), - } - } - - /// Serialize a [`Some(T)`] value. - fn serialize_some(self, value: &T) -> Result - where - T: Serialize, - { - // Compute the hash as if it was the value itself. - value.serialize(self) - } - - /// Serialize a `()` value. - fn serialize_unit(self) -> Result { - Err(RequestIdError::UnsupportedTypeUnit) - } - - /// Serialize a unit struct like `struct Unit` or `PhantomData`. - fn serialize_unit_struct(self, _name: &'static str) -> Result { - Err(RequestIdError::UnsupportedTypePhantomData) - } - - /// Serialize a unit variant like `E::A` in `enum E { A, B }`. - fn serialize_unit_variant( - self, - _name: &'static str, - _variant_index: u32, - _variant: &'static str, - ) -> Result { - Err(RequestIdError::UnsupportedTypeUnitVariant) - } - - /// Serialize a newtype struct like `struct Millimeters(u8)`. - fn serialize_newtype_struct( - self, - name: &'static str, - value: &T, - ) -> Result - where - T: Serialize, - { - match name { - "Blob" => value.serialize(self), // value is of type Vec. - v => Err(RequestIdError::UnsupportedTypeNewtypeStruct(v.to_owned())), - } - } - - /// Serialize a newtype variant like `E::N` in `enum E { N(u8) }`. - fn serialize_newtype_variant( - self, - _name: &'static str, - _variant_index: u32, - _variant: &'static str, - _value: &T, - ) -> Result - where - T: Serialize, - { - Err(RequestIdError::UnsupportedTypeNewTypeVariant) - } - - /// Begin to serialize a variably sized sequence. This call must be - /// followed by zero or more calls to `serialize_element`, then a call to - /// `end`. - fn serialize_seq(self, _len: Option) -> Result { - Ok(self) - } - - /// Begin to serialize a statically sized sequence whose length will be - /// known at deserialization time without looking at the serialized data. - /// This call must be followed by zero or more calls to `serialize_element`, - /// then a call to `end`. - fn serialize_tuple(self, _len: usize) -> Result { - Err(RequestIdError::UnsupportedTypeTuple) - } - - /// Begin to serialize a tuple struct like `struct Rgb(u8, u8, u8)`. This - /// call must be followed by zero or more calls to `serialize_field`, then a - /// call to `end`. - fn serialize_tuple_struct( - self, - _name: &'static str, - _len: usize, - ) -> Result { - Err(RequestIdError::UnsupportedTypeTupleStruct) - } - - /// Begin to serialize a tuple variant like `E::T` in `enum E { T(u8, u8) - /// }`. This call must be followed by zero or more calls to - /// `serialize_field`, then a call to `end`. - fn serialize_tuple_variant( - self, - _name: &'static str, - _variant_index: u32, - _variant: &'static str, - _len: usize, - ) -> Result { - Err(RequestIdError::UnsupportedTypeTupleVariant) - } - - /// Begin to serialize a map. This call must be followed by zero or more - /// calls to `serialize_key` and `serialize_value`, then a call to `end`. - fn serialize_map(self, _len: Option) -> Result { - // This is the same as struct, but unnamed. We will use the current_field field - // here though, as serialize key and value are separate functions. - if self.fields.is_none() { - self.fields = Some(BTreeMap::new()); - Ok(self) - } else { - Err(RequestIdError::UnsupportedStructInsideStruct) - } - } - - /// Begin to serialize a struct like `struct Rgb { r: u8, g: u8, b: u8 }`. - /// This call must be followed by zero or more calls to `serialize_field`, - /// then a call to `end`. - fn serialize_struct( - self, - _name: &'static str, - _len: usize, - ) -> Result { - if self.fields.is_none() { - self.fields = Some(BTreeMap::new()); - Ok(self) - } else { - Err(RequestIdError::UnsupportedStructInsideStruct) - } - } - - /// Begin to serialize a struct variant like `E::S` in `enum E { S { r: u8, - /// g: u8, b: u8 } }`. This call must be followed by zero or more calls to - /// `serialize_field`, then a call to `end`. - fn serialize_struct_variant( - self, - _name: &'static str, - _variant_index: u32, - _variant: &'static str, - _len: usize, - ) -> Result { - Err(RequestIdError::UnsupportedTypeStructVariant) - } -} - -// The following 7 impls deal with the serialization of compound types like -// sequences and maps. Serialization of such types is begun by a Serializer -// method and followed by zero or more calls to serialize individual elements of -// the compound type and one call to end the compound type. -// -// This impl is SerializeSeq so these methods are called after `serialize_seq` -// is called on the Serializer. -impl<'a> ser::SerializeSeq for &'a mut RequestIdSerializer { - // Must match the `Ok` type of the serializer. - type Ok = (); - // Must match the `Error` type of the serializer. - type Error = RequestIdError; - - // Serialize a single element of the sequence. - fn serialize_element(&mut self, value: &T) -> Result - where - T: ?Sized + Serialize, - { - value.serialize(&mut **self) - } - - // Close the sequence. - fn end(self) -> Result { - Ok(()) - } -} - -// Same thing but for tuples. -impl<'a> ser::SerializeTuple for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - fn serialize_element(&mut self, _value: &T) -> Result - where - T: ?Sized + Serialize, - { - Err(RequestIdError::Custom( - "Unsupported field type: SerializeTuple element.".to_string(), - )) - } - - fn end(self) -> Result { - Ok(()) - } -} - -// Same thing but for tuple structs. -impl<'a> ser::SerializeTupleStruct for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - fn serialize_field(&mut self, _value: &T) -> Result - where - T: ?Sized + Serialize, - { - Err(RequestIdError::Custom( - "Unsupported field type: SerializeTupleStruct field.".to_string(), - )) - } - - fn end(self) -> Result { - Ok(()) - } -} - -// Tuple variants are a little different. Refer back to the -// `serialize_tuple_variant` method above: -// -// self.output += "{"; -// variant.serialize(&mut *self)?; -// self.output += ":["; -// -// So the `end` method in this impl is responsible for closing both the `]` and -// the `}`. -impl<'a> ser::SerializeTupleVariant for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - fn serialize_field(&mut self, _value: &T) -> Result - where - T: ?Sized + Serialize, - { - Err(RequestIdError::Custom( - "Unsupported field type: SerializeTupleVariant field.".to_string(), - )) - } - - fn end(self) -> Result { - Ok(()) - } -} - -// Some `Serialize` types are not able to hold a key and value in memory at the -// same time so `SerializeMap` implementations are required to support -// `serialize_key` and `serialize_value` individually. -// -// There is a third optional method on the `SerializeMap` trait. The -// `serialize_entry` method allows serializers to optimize for the case where -// key and value are both available simultaneously. In JSON it doesn't make a -// difference so the default behavior for `serialize_entry` is fine. -impl<'a> ser::SerializeMap for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - // The Serde data model allows map keys to be any serializable type. JSON - // only allows string keys so the implementation below will produce invalid - // JSON if the key serializes as something other than a string. - // - // A real JSON serializer would need to validate that map keys are strings. - // This can be done by using a different Serializer to serialize the key - // (instead of `&mut **self`) and having that other serializer only - // implement `serialize_str` and return an error on any other data type. - fn serialize_key(&mut self, key: &T) -> Result - where - T: ?Sized + Serialize, - { - if self.field_key_hash.is_some() { - Err(RequestIdError::InvalidState) - } else { - let key_hash = self.hash_value(key)?; - self.field_key_hash = Some(key_hash); - Ok(()) - } - } - - // It doesn't make a difference whether the colon is printed at the end of - // `serialize_key` or at the beginning of `serialize_value`. In this case - // the code is a bit simpler having it here. - fn serialize_value(&mut self, value: &T) -> Result - where - T: ?Sized + Serialize, - { - let value_hash = self.hash_value(value)?; - - match self.field_key_hash.take() { - None => Err(RequestIdError::InvalidState), - Some(key_hash) => match self.fields { - None => Err(RequestIdError::InvalidState), - Some(ref mut f) => { - f.insert(key_hash, value_hash); - Ok(()) - } - }, - } - } - - fn end(self) -> Result { - Ok(()) - } -} - -// Structs are like maps in which the keys are constrained to be compile-time -// constant strings. -impl<'a> ser::SerializeStruct for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - fn serialize_field(&mut self, key: &'static str, value: &T) -> Result - where - T: ?Sized + Serialize, - { - if self.field_value_hash.is_some() { - return Err(RequestIdError::InvalidState); - } - - let key_hash = self.hash_value(key)?; - let value_hash = self.hash_value(value)?; - - match self.fields { - None => Err(RequestIdError::InvalidState), - Some(ref mut f) => { - f.insert(key_hash, value_hash); - Ok(()) - } - } - } - - fn end(self) -> Result { - if let Some(fields) = &self.fields { - // Sort the fields. - let mut keyvalues: Vec> = fields - .keys() - .zip(fields.values()) - .map(|(k, v)| { - let mut x = k.to_vec(); - x.extend(v); - x - }) - .collect(); - keyvalues.sort(); - - for kv in keyvalues { - self.hasher.update(&kv); - } - - Ok(()) - } else { - Err(RequestIdError::InvalidState) - } - } -} - -// Similar to `SerializeTupleVariant`, here the `end` method is responsible for -// closing both of the curly braces opened by `serialize_struct_variant`. -impl<'a> ser::SerializeStructVariant for &'a mut RequestIdSerializer { - type Ok = (); - type Error = RequestIdError; - - fn serialize_field( - &mut self, - _key: &'static str, - _value: &T, - ) -> Result - where - T: ?Sized + Serialize, - { - Err(RequestIdError::Custom( - "Unsupported field type: SerializeStructVariant field.".to_string(), - )) - } - - fn end(self) -> Result { - Ok(()) - } -} - -/// Derive the request ID from a serializable data structure. -/// -/// See https://hydra.dfinity.systems//build/268411/download/1/dfinity/spec/public/index.html#api-request-id -/// -/// # Warnings -/// -/// The argument type simply needs to be serializable; the function -/// does NOT sift between fields to include them or not and assumes -/// the passed value only includes fields that are not part of the -/// envelope and should be included in the calculation of the request -/// id. -/// -/// # Panics -/// -/// This function panics if the value provided is not a struct or a map. -pub fn to_request_id<'a, V>(value: &V) -> Result -where - V: 'a + Serialize, -{ - let mut serializer = RequestIdSerializer::new(); - value.serialize(&mut serializer)?; - serializer.finish() -} - -#[cfg(test)] -mod tests { - use super::*; - use crate::{Blob, CanisterId}; - - /// The actual example used in the public spec in the Request ID section. - #[test] - fn public_spec_example() { - #[derive(Serialize)] - struct PublicSpecExampleStruct { - request_type: &'static str, - canister_id: CanisterId, - method_name: &'static str, - arg: Blob, - }; - let data = PublicSpecExampleStruct { - request_type: "call", - canister_id: CanisterId::from_bytes(&[0, 0, 0, 0, 0, 0, 0x04, 0xD2]), // 1234 in u64 - method_name: "hello", - arg: Blob(b"DIDL\x00\xFD*".to_vec()), - }; - - // Hash taken from the example on the public spec. - let request_id = to_request_id(&data).unwrap(); - assert_eq!( - hex::encode(request_id.0.to_vec()), - "8781291c347db32a9d8c10eb62b710fce5a93be676474c42babc74c51858f94b" - ); - } - - /// The same example as above, except we use the ApiClient enum newtypes. - #[test] - fn public_spec_example_api_client() { - #[derive(Serialize)] - #[serde(rename_all = "snake_case")] - #[serde(tag = "request_type")] - enum PublicSpec { - Call { - canister_id: CanisterId, - method_name: String, - arg: Option, - }, - } - let data = PublicSpec::Call { - canister_id: CanisterId::from_bytes(&[0, 0, 0, 0, 0, 0, 0x04, 0xD2]), // 1234 in u64 - method_name: "hello".to_owned(), - arg: Some(Blob(b"DIDL\x00\xFD*".to_vec())), - }; - - // Hash taken from the example on the public spec. - let request_id = to_request_id(&data).unwrap(); - assert_eq!( - hex::encode(request_id.0.to_vec()), - "8781291c347db32a9d8c10eb62b710fce5a93be676474c42babc74c51858f94b" - ); - } -} diff --git a/src/agent/rust/src/types/request_id_error.rs b/src/agent/rust/src/types/request_id_error.rs deleted file mode 100644 index d3ab95dc68..0000000000 --- a/src/agent/rust/src/types/request_id_error.rs +++ /dev/null @@ -1,78 +0,0 @@ -use serde::ser; -use std::error::Error; -use std::fmt::{Display, Formatter}; - -/// Errors from reading a RequestId from a string. This is not the same as -/// deserialization. -#[derive(Debug)] -pub enum RequestIdFromStringError { - InvalidSize(usize), - FromHexError(hex::FromHexError), -} - -/// An error during the calculation of the RequestId. -/// Since we use serde for serializing a data type into a hash, this has to support traits that -/// serde expects, such as Display -#[derive(Clone, Debug, PartialEq)] -pub enum RequestIdError { - Custom(String), - - EmptySerializer, - InvalidState, - UnsupportedStructInsideStruct, - - // Base types. - UnsupportedTypeBool, - UnsupportedTypeU8, - UnsupportedTypeU16, - UnsupportedTypeU32, - UnsupportedTypeU64, - UnsupportedTypeU128, - UnsupportedTypeI8, - UnsupportedTypeI16, - UnsupportedTypeI32, - UnsupportedTypeI64, - UnsupportedTypeI128, - UnsupportedTypeF32, - UnsupportedTypeF64, - UnsupportedTypeChar, - // UnsupportedTypeStr, // Supported - UnsupportedTypeBytes, - // UnsupportedTypeNone, // Supported - // UnsupportedTypeSome, // Supported - UnsupportedTypeUnit, - UnsupportedTypePhantomData, - - // Variants and complex types. - UnsupportedTypeUnitVariant, - UnsupportedTypeNewtypeStruct(String), - UnsupportedTypeNewTypeVariant, - UnsupportedTypeSequence, - UnsupportedTypeTuple, - UnsupportedTypeTupleStruct, - UnsupportedTypeTupleVariant, - UnsupportedTypeMap, - // UnsupportedTypeStruct, // Supported - UnsupportedTypeStructVariant, -} - -impl Display for RequestIdError { - fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result { - write!(f, "{:?}", self) - } -} - -impl Error for RequestIdError { - fn description(&self) -> &str { - "An error happened during request_id." - } -} - -impl ser::Error for RequestIdError { - fn custom(msg: T) -> Self - where - T: std::fmt::Display, - { - RequestIdError::Custom(msg.to_string()) - } -} diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 8bd241c86c..d52f159e2b 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -33,7 +33,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { path = "../agent/rust" } +ic-agent = { git = "https://github.com/dfinity-lab/rust-agent.git", branch = "master" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" @@ -64,7 +64,6 @@ toml = "0.5.5" tokio = "0.2.10" url = "2.1.0" webpki-roots = "0.19.0" -wabt = "0.9.2" walkdir = "2.2.9" wasmparser = "0.45.0" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 10bda52834..9e75d00a33 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { path = "../agent/rust" } +ic-agent = { git = "https://github.com/dfinity-lab/rust-agent.git", branch = "master" } [dev-dependencies] From 412a47e68c31eb990b5f3b4554f70cbabb8735a5 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Mon, 27 Jul 2020 16:55:44 -0700 Subject: [PATCH 02/23] Empty commit to trigger CI. From 524d9702864716ebed837fb6bb41f2025469b26d Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 29 Jul 2020 11:16:48 -0700 Subject: [PATCH 03/23] moving to ssh links for github --- Cargo.lock | 8 ++++---- src/dfx/Cargo.toml | 2 +- src/ic_identity_manager/Cargo.toml | 2 +- 3 files changed, 6 insertions(+), 6 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 531a53d76c..60fe09aae1 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -974,7 +974,7 @@ dependencies = [ "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", "hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", "hotwatch 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", - "ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)", + "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)", "ic-identity-manager 0.6.0", "indicatif 0.13.0 (registry+https://github.com/rust-lang/crates.io-index)", "lazy-init 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1539,7 +1539,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+https://github.com/dfinity-lab/rust-agent#db5e93b2f50e5bf1b89780e1f0ca02063c1625a2" +source = "git+ssh://git@github.com/dfinity-lab/rust-agent.git#1a3188ab5e116809461b8196f2dee160aec03dfd" dependencies = [ "async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)", "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1562,7 +1562,7 @@ dependencies = [ name = "ic-identity-manager" version = "0.6.0" dependencies = [ - "ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)", + "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)", "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", "pem 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", @@ -3932,7 +3932,7 @@ dependencies = [ "checksum hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)" = "ed6081100e960d9d74734659ffc9cc91daf1c0fc7aceb8eaa94ee1a3f5046f2e" "checksum hyper-rustls 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ac965ea399ec3a25ac7d13b8affd4b8f39325cca00858ddf5eb29b79e6b14b08" "checksum hyper-tls 0.4.1 (registry+https://github.com/rust-lang/crates.io-index)" = "3adcd308402b9553630734e9c36b77a7e48b3821251ca2493e8cd596763aafaa" -"checksum ic-agent 0.6.0 (git+https://github.com/dfinity-lab/rust-agent)" = "" +"checksum ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)" = "" "checksum idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "38f09e0f0b1fb55fdee1f17470ad800da77af5186a1a76c026b679358b7e844e" "checksum idna 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "02e2673c30ee86b5b96a9cb52ad15718aa1f966f5ab9ad54a8b95d5ca33120a9" "checksum indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "712d7b3ea5827fcb9d4fda14bf4da5f136f0db2ae9c8f4bd4e2d1c6fde4e6db2" diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index d52f159e2b..30fdf5a73a 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -33,7 +33,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "https://github.com/dfinity-lab/rust-agent.git", branch = "master" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/rust-agent.git", branch = "master" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 9e75d00a33..ec6fd34d8f 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "https://github.com/dfinity-lab/rust-agent.git", branch = "master" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/rust-agent.git", branch = "master" } [dev-dependencies] From e4b06049da52bc511a95322fa50f2c20736e5bd5 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 29 Jul 2020 12:12:07 -0700 Subject: [PATCH 04/23] new repo name --- src/dfx/Cargo.toml | 2 +- src/ic_identity_manager/Cargo.toml | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 0f73444c13..6e4bfc9cdd 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -33,7 +33,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/rust-agent.git", branch = "master" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "0.6.0" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 8184614826..4077b33ce9 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/rust-agent.git", branch = "master" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "0.6.0" } [dev-dependencies] From 09bc78fc227077db199c7d2c5f1ba0cbb499d63a Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 29 Jul 2020 13:13:11 -0700 Subject: [PATCH 05/23] fix version --- Cargo.lock | 8 ++++---- src/dfx/Cargo.toml | 2 +- src/ic_identity_manager/Cargo.toml | 2 +- 3 files changed, 6 insertions(+), 6 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index a125bc4fa0..5c722758c6 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -974,7 +974,7 @@ dependencies = [ "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", "hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", "hotwatch 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", - "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)", + "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)", "ic-identity-manager 0.6.1", "indicatif 0.13.0 (registry+https://github.com/rust-lang/crates.io-index)", "lazy-init 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1539,7 +1539,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/rust-agent.git#1a3188ab5e116809461b8196f2dee160aec03dfd" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0#1a3188ab5e116809461b8196f2dee160aec03dfd" dependencies = [ "async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)", "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", @@ -1562,7 +1562,7 @@ dependencies = [ name = "ic-identity-manager" version = "0.6.1" dependencies = [ - "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)", + "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)", "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", "pem 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", @@ -3932,7 +3932,7 @@ dependencies = [ "checksum hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)" = "ed6081100e960d9d74734659ffc9cc91daf1c0fc7aceb8eaa94ee1a3f5046f2e" "checksum hyper-rustls 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ac965ea399ec3a25ac7d13b8affd4b8f39325cca00858ddf5eb29b79e6b14b08" "checksum hyper-tls 0.4.1 (registry+https://github.com/rust-lang/crates.io-index)" = "3adcd308402b9553630734e9c36b77a7e48b3821251ca2493e8cd596763aafaa" -"checksum ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/rust-agent.git)" = "" +"checksum ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)" = "" "checksum idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "38f09e0f0b1fb55fdee1f17470ad800da77af5186a1a76c026b679358b7e844e" "checksum idna 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "02e2673c30ee86b5b96a9cb52ad15718aa1f966f5ab9ad54a8b95d5ca33120a9" "checksum indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "712d7b3ea5827fcb9d4fda14bf4da5f136f0db2ae9c8f4bd4e2d1c6fde4e6db2" diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 6e4bfc9cdd..e0fbc87ee6 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -33,7 +33,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "0.6.0" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.0" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 4077b33ce9..026b2bd582 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "0.6.0" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.0" } [dev-dependencies] From 6a50ff7063054f1b40b545480894993338f5200a Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 5 Aug 2020 16:06:29 -0700 Subject: [PATCH 06/23] Fix dependency issues. --- Cargo.lock | 3766 +++++++++++----------- src/dfx/Cargo.toml | 8 +- src/dfx/src/commands/canister/install.rs | 36 +- src/ic_identity_manager/Cargo.toml | 2 +- 4 files changed, 1877 insertions(+), 1935 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 388063d1ef..a16369a107 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -4,4147 +4,4111 @@ name = "actix" version = "0.8.3" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "actix-http 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix_derive 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-channel 0.3.9 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.14.1 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "hashbrown 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-codec 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "trust-dns-resolver 0.11.1 (registry+https://github.com/rust-lang/crates.io-index)", +checksum = "671ce3d27313f236827a5dd153a1073ad03ef31fc77f562020263e7830cf1ef7" +dependencies = [ + "actix-http", + "actix-rt", + "actix_derive", + "bitflags", + "bytes 0.4.12", + "crossbeam-channel 0.3.9", + "derive_more 0.14.1", + "futures", + "hashbrown 0.3.1", + "lazy_static", + "log", + "parking_lot 0.8.0", + "smallvec 0.6.13", + "tokio-codec", + "tokio-executor", + "tokio-io", + "tokio-tcp", + "tokio-timer", + "trust-dns-resolver", ] [[package]] name = "actix-codec" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9f2c11af4b06dc935d8e1b1491dad56bfb32febc49096a91e773f8535c176453" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-codec 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "futures", + "log", + "tokio-codec", + "tokio-io", ] [[package]] name = "actix-connect" version = "0.2.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9fade9bd4bb46bacde89f1e726c7a3dd230536092712f5d94d77ca57c087fca0" dependencies = [ - "actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-utils 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.1.21 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-current-thread 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-openssl 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "trust-dns-resolver 0.11.1 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-codec", + "actix-rt", + "actix-service", + "actix-utils", + "derive_more 0.15.0", + "either", + "futures", + "http 0.1.21", + "log", + "openssl", + "tokio-current-thread", + "tokio-openssl", + "tokio-tcp", + "trust-dns-resolver", ] [[package]] name = "actix-cors" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "66e5b071c68ac8ab182e7b7717167ef29ea93e166bc26391f678f19ac08ed129" dependencies = [ - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-web 1.0.9 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.14.1 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-service", + "actix-web", + "derive_more 0.14.1", + "futures", ] [[package]] name = "actix-files" version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f1ee66089e3453334aac7e96ed10c48b6659f21f407826b92014c8097e4c0511" dependencies = [ - "actix-http 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-web 1.0.9 (registry+https://github.com/rust-lang/crates.io-index)", - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "mime_guess 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "v_htmlescape 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-http", + "actix-service", + "actix-web", + "bitflags", + "bytes 0.4.12", + "derive_more 0.15.0", + "futures", + "log", + "mime", + "mime_guess", + "percent-encoding 2.1.0", + "v_htmlescape", ] [[package]] name = "actix-http" version = "0.2.11" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-connect 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server-config 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-threadpool 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-utils 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)", - "base64 0.10.1 (registry+https://github.com/rust-lang/crates.io-index)", - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "brotli2 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "chrono 0.4.9 (registry+https://github.com/rust-lang/crates.io-index)", - "copyless 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)", - "encoding_rs 0.8.20 (registry+https://github.com/rust-lang/crates.io-index)", - "failure 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "flate2 1.0.13 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "h2 0.1.26 (registry+https://github.com/rust-lang/crates.io-index)", - "hashbrown 0.6.3 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.1.21 (registry+https://github.com/rust-lang/crates.io-index)", - "httparse 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)", - "indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "language-tags 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_urlencoded 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "sha1 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-current-thread 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "trust-dns-resolver 0.11.1 (registry+https://github.com/rust-lang/crates.io-index)", +checksum = "fcb50f77cd28240d344fd54afd205bae8760a3b0ad448b1716a2aa31e24db139" +dependencies = [ + "actix-codec", + "actix-connect", + "actix-server-config", + "actix-service", + "actix-threadpool", + "actix-utils", + "base64 0.10.1", + "bitflags", + "brotli2", + "bytes 0.4.12", + "chrono", + "copyless", + "derive_more 0.15.0", + "either", + "encoding_rs", + "failure", + "flate2", + "futures", + "h2 0.1.26", + "hashbrown 0.6.3", + "http 0.1.21", + "httparse", + "indexmap", + "language-tags", + "lazy_static", + "log", + "mime", + "openssl", + "percent-encoding 2.1.0", + "rand 0.7.3", + "regex", + "serde", + "serde_json", + "serde_urlencoded", + "sha1", + "slab", + "time", + "tokio-current-thread", + "tokio-tcp", + "tokio-timer", + "trust-dns-resolver", ] [[package]] name = "actix-router" version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "23224bb527e204261d0291102cb9b52713084def67d94f7874923baefe04ccf7" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.1.21 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "string 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "http 0.1.21", + "log", + "regex", + "serde", + "string", ] [[package]] name = "actix-rt" -version = "0.2.5" +version = "0.2.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88c9da1d06603d82ec2b6690fc5b80eb626cd2d6b573f3d9a71d5252e06d098e" dependencies = [ - "actix-threadpool 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "copyless 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-current-thread 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-threadpool", + "copyless", + "futures", + "tokio-current-thread", + "tokio-executor", + "tokio-reactor", + "tokio-timer", ] [[package]] name = "actix-server" version = "0.6.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd626534af8d0a738e5f74901fe603af0445708f91b86a7d763d80df10d562a5" dependencies = [ - "actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server-config 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-openssl 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-signal 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-rt", + "actix-server-config", + "actix-service", + "futures", + "log", + "mio", + "net2", + "num_cpus", + "openssl", + "slab", + "tokio-io", + "tokio-openssl", + "tokio-reactor", + "tokio-signal", + "tokio-tcp", + "tokio-timer", ] [[package]] name = "actix-server-config" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "483a34989c682d93142bacad6300375bb6ad8002d2e0bb249dbad86128b9ff30" dependencies = [ - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-openssl 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", + "futures", + "tokio-io", + "tokio-openssl", + "tokio-tcp", ] [[package]] name = "actix-service" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bca5b48e928841ff7e7dce1fdb5b0d4582f6b1b976e08f4bac3f640643e0773f" dependencies = [ - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", + "futures", ] [[package]] name = "actix-testing" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af001e97ac6750994824d400a1b7087055aab14317aa012f528d0b2b363f37f1" dependencies = [ - "actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server-config 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-rt", + "actix-server", + "actix-server-config", + "actix-service", + "futures", + "log", + "net2", + "tokio-reactor", + "tokio-tcp", ] [[package]] name = "actix-threadpool" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6b5ae85d13da7e6fb86b1b7bc83185e0e3bd4cc5f421c887e1803796c034d35d" dependencies = [ - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", - "threadpool 1.7.1 (registry+https://github.com/rust-lang/crates.io-index)", + "derive_more 0.15.0", + "futures", + "lazy_static", + "log", + "num_cpus", + "parking_lot 0.9.0", + "threadpool", ] [[package]] name = "actix-utils" -version = "0.4.5" +version = "0.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "908c3109948f5c37a8b57fd343a37dcad5bb1d90bfd06300ac96b17bbe017b95" dependencies = [ - "actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-current-thread 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-codec", + "actix-service", + "bytes 0.4.12", + "either", + "futures", + "log", + "tokio-current-thread", + "tokio-timer", ] [[package]] name = "actix-web" version = "1.0.9" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-http 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-router 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server-config 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-testing 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-threadpool 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-utils 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-web-codegen 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "awc 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "encoding_rs 0.8.20 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "hashbrown 0.6.3 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_urlencoded 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", - "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", +checksum = "af3a1b967cdbacb903c4b9ae71257a7f098d881b25eb483d0c468b7dac579b03" +dependencies = [ + "actix-codec", + "actix-http", + "actix-router", + "actix-rt", + "actix-server", + "actix-server-config", + "actix-service", + "actix-testing", + "actix-threadpool", + "actix-utils", + "actix-web-codegen", + "awc", + "bytes 0.4.12", + "derive_more 0.15.0", + "encoding_rs", + "futures", + "hashbrown 0.6.3", + "log", + "mime", + "net2", + "openssl", + "parking_lot 0.9.0", + "regex", + "serde", + "serde_json", + "serde_urlencoded", + "time", + "url 2.1.1", ] [[package]] name = "actix-web-codegen" version = "0.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "068a33520e21c1eea89726be4d6b3ce2e6b81046904367e1677287695a043abb" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "actix_derive" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0bf5f6d7bf2d220ae8b4a7ae02a572bb35b7c4806b24049af905ab8110de156c" +dependencies = [ + "proc-macro2 0.4.30", + "quote 0.6.13", + "syn 0.15.44", +] + +[[package]] +name = "addr2line" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1b6a2d3371669ab3ca9797670853d61402b03d0b4b9ebf33d677dfa720203072" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", + "gimli", ] +[[package]] +name = "adler" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ee2a4ec343196209d6594e19543ae87a39f96d5534d7174822a3ad825dd6ed7e" + [[package]] name = "adler32" -version = "1.0.4" +version = "1.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aae1277d39aeec15cb388266ecc24b11c80469deae6067e17a1a7aa9e5c1f234" [[package]] name = "ahash" version = "0.2.18" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6f33b5018f120946c1dcf279194f238a9f146725593ead1c08fa47ff22b0b5d3" dependencies = [ - "const-random 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", + "const-random", ] [[package]] name = "aho-corasick" -version = "0.7.6" +version = "0.7.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "043164d8ba5c4c3035fec9bbee8647c0261d788f3474306f93bb65901cae0e86" dependencies = [ - "memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)", + "memchr", ] [[package]] name = "ansi_term" version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ee49baf6cb617b853aa8d93bf420db2383fab46d314482ca2803b40d5fde979b" dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.3.9", ] -[[package]] -name = "approx" -version = "0.1.1" -source = "registry+https://github.com/rust-lang/crates.io-index" - [[package]] name = "arc-swap" -version = "0.4.3" +version = "0.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4d25d88fd6b8041580a654f9d0c581a047baee2b3efee13275f2fc392fc75034" [[package]] name = "arrayref" -version = "0.3.5" -source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "arrayvec" -version = "0.4.11" +version = "0.3.6" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "nodrop 0.1.13 (registry+https://github.com/rust-lang/crates.io-index)", -] +checksum = "a4c527152e37cf757a3f78aae5a06fbeefdb07ccc535c980a3208ee3060dd544" [[package]] name = "arrayvec" version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cff77d8686867eceff3105329d4698d96c2391c176d5d03adc90c7389162b5b8" [[package]] name = "ascii-canvas" version = "2.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ff8eb72df928aafb99fe5d37b383f2fe25bd2a765e3e5f7c365916b6f2463a29" dependencies = [ - "term 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)", + "term 0.5.2", ] [[package]] name = "assert-json-diff" -version = "1.0.0" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4259cbe96513d2f1073027a259fc2ca917feb3026a5a8d984e3628e490255cc0" dependencies = [ - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", + "extend", + "serde", + "serde_json", ] [[package]] name = "async-trait" -version = "0.1.35" +version = "0.1.36" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a265e3abeffdce30b2e26b7a11b222fe37c6067404001b434101457d0385eb92" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "atty" -version = "0.2.13" +version = "0.2.14" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9b39be18770d11421cdb1b9947a45dd3f37e93092cbf377614828a319d5fee8" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "hermit-abi", + "libc", + "winapi 0.3.9", ] [[package]] name = "autocfg" -version = "0.1.6" +version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d49d90015b3c36167a20fe2810c5cd875ad504b39cff3d4eae7977e6b7c1cb2" [[package]] name = "autocfg" version = "1.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f8aac770f1885fd7e387acedd76065302551364496e46b3dd00860b2f8359b9d" [[package]] name = "awc" version = "0.2.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5e995283278dd3bf0449e7534e77184adb1570c0de8b6a50bf7c9d01ad8db8c4" dependencies = [ - "actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-http 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "base64 0.10.1 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_urlencoded 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "actix-codec", + "actix-http", + "actix-service", + "base64 0.10.1", + "bytes 0.4.12", + "derive_more 0.15.0", + "futures", + "log", + "mime", + "openssl", + "percent-encoding 2.1.0", + "rand 0.7.3", + "serde", + "serde_json", + "serde_urlencoded", + "tokio-timer", ] [[package]] name = "backtrace" -version = "0.3.38" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "backtrace-sys 0.1.31 (registry+https://github.com/rust-lang/crates.io-index)", - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc-demangle 0.1.16 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "backtrace-sys" -version = "0.1.31" +version = "0.3.50" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "46254cf2fdcdf1badb5934448c1bcbe046a56537b3987d96c51a7afc5d03f293" dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "addr2line", + "cfg-if", + "libc", + "miniz_oxide", + "object", + "rustc-demangle", ] [[package]] name = "base32" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "23ce669cd6c8588f79e15cf450314f9638f967fc5770ff1c7c1deb0925ea7cfa" [[package]] name = "base64" version = "0.10.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b25d992356d2eb0ed82172f5248873db5560c4721f564b13cb5193bda5e668e" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", ] [[package]] name = "base64" version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b41b7ea54a0c9d92199de89e20e58d49f02f8e699814ef3fdf266f6f748d15c7" + +[[package]] +name = "base64" +version = "0.12.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3441f0f7b02788e948e47f457ca01f1d7e6d92c693bc132c22b087d3141c03ff" [[package]] name = "bit-set" -version = "0.5.1" +version = "0.5.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e11e16035ea35e4e5997b393eacbf6f63983188f7a2ad25bfb13465f5ad59de" dependencies = [ - "bit-vec 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", + "bit-vec", ] [[package]] name = "bit-vec" -version = "0.5.1" +version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5f0dc55f2d8a1a85650ac47858bb001b4c0dd73d79e3c455a842925e68d29cd3" [[package]] name = "bitflags" version = "1.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693" [[package]] name = "blake2b_simd" -version = "0.5.8" +version = "0.5.10" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d8fb2d74254a3a0b5cac33ac9f8ed0e44aa50378d9dbb2e5d83bd21ed1dc2c8a" dependencies = [ - "arrayref 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "arrayvec 0.4.11 (registry+https://github.com/rust-lang/crates.io-index)", - "constant_time_eq 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", + "arrayref", + "arrayvec", + "constant_time_eq", ] [[package]] name = "block-buffer" version = "0.7.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0940dc441f31689269e10ac70eb1002a3a1d3ad1390e030043662eb7fe4688b" dependencies = [ - "block-padding 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "byte-tools 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "generic-array 0.12.3 (registry+https://github.com/rust-lang/crates.io-index)", + "block-padding", + "byte-tools", + "byteorder", + "generic-array", ] [[package]] name = "block-padding" -version = "0.1.4" +version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fa79dedbb091f449f1f39e53edf88d5dbe95f895dae6135a8d7b881fb5af73f5" dependencies = [ - "byte-tools 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "byte-tools", ] [[package]] name = "brotli-sys" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4445dea95f4c2b41cde57cc9fee236ae4dbae88d8fcbdb4750fc1bb5d86aaecd" dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "cc", + "libc", ] [[package]] name = "brotli2" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0cb036c3eade309815c15ddbacec5b22c4d1f3983a774ab2eac2e3e9ea85568e" dependencies = [ - "brotli-sys 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "brotli-sys", + "libc", ] [[package]] name = "bumpalo" -version = "3.2.1" +version = "3.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e8c087f005730276d1096a652e92a8bacee2e2472bcc9715a74d2bec38b5820" [[package]] name = "byte-tools" version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3b5ca7a04898ad4bcd41c90c5285445ff5b791899bb1b0abdd2a2aa791211d7" [[package]] name = "byteorder" -version = "1.3.2" +version = "1.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "08c48aae112d48ed9f069b33538ea9e3e90aa263cfa3d1c24309612b1f7472de" [[package]] name = "bytes" version = "0.4.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "206fdffcfa2df7cbe15601ef46c813fce0965eb3286db6b56c583b814b51c81c" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", + "iovec", ] [[package]] name = "bytes" -version = "0.5.4" -source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "c2-chacha" -version = "0.2.2" +version = "0.5.6" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "ppv-lite86 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)", -] +checksum = "0e4cec68f03f32e44924783795810fa50a7035d8c8ebe78580ad7e6c703fba38" [[package]] name = "candid" version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2abe09120c9838a3e3cc60c1f3b16b25a1b6208f3bf2d91bf9dd0aef0904f5ed" dependencies = [ - "base32 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "candid_derive 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "crc32fast 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "lalrpop 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lalrpop-util 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)", - "leb128 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)", - "num-bigint 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "num_enum 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", - "paste 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "pretty 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "base32", + "byteorder", + "candid_derive", + "crc32fast", + "hex 0.3.2", + "lalrpop", + "lalrpop-util", + "leb128", + "num-bigint", + "num-traits", + "num_enum", + "paste", + "pretty", + "serde", ] [[package]] name = "candid_derive" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a51d65ed24b5b03624aefc86967af49039882d63161a67aef0dd4306f7251330" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "cc" -version = "1.0.54" +version = "1.0.58" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f9a06fb2e53271d7c279ec1efea6ab691c35a2ae67ec0d91d7acec0caf13b518" [[package]] name = "cfg-if" version = "0.1.10" source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "cgmath" -version = "0.16.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "approx 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.1.43 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.4.6 (registry+https://github.com/rust-lang/crates.io-index)", -] +checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822" [[package]] name = "chrono" -version = "0.4.9" +version = "0.4.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c74d84029116787153e02106bf53e66828452a4b325cc8652b788b5967c0a0b6" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "num-integer 0.1.41 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", + "num-integer", + "num-traits", + "time", ] [[package]] name = "clap" -version = "2.33.0" +version = "2.33.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "10040cdf04294b565d9e0319955430099ec3813a64c952b86a41200ad714ae48" dependencies = [ - "ansi_term 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "strsim 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "textwrap 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-width 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "vec_map 0.8.1 (registry+https://github.com/rust-lang/crates.io-index)", + "ansi_term", + "atty", + "bitflags", + "strsim 0.8.0", + "textwrap", + "unicode-width", + "vec_map", ] [[package]] name = "clicolors-control" version = "1.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "90082ee5dcdd64dc4e9e0d37fbf3ee325419e39c0092191e0393df65518f741e" dependencies = [ - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "atty", + "lazy_static", + "libc", + "winapi 0.3.9", ] [[package]] name = "cloudabi" version = "0.0.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ddfc5b9aa5d4507acaf872de71051dfd0e309860e88966e1051e462a077aac4f" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", +] + +[[package]] +name = "cloudabi" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4344512281c643ae7638bbabc3af17a11307803ec8f0fcad9fae512a8bf36467" +dependencies = [ + "bitflags", ] [[package]] name = "colored" -version = "1.8.0" +version = "1.9.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4ffc801dacf156c5854b9df4f425a626539c3a6ef7893cc0c5084a23f0b6c59" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winconsole 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)", + "atty", + "lazy_static", + "winapi 0.3.9", ] [[package]] name = "console" version = "0.7.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ca57c2c14b8a2bf3105bc9d15574aad80babf6a9c44b1058034cdf8bd169628" dependencies = [ - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "clicolors-control 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "encode_unicode 0.3.6 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "termios 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-width 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "atty", + "clicolors-control", + "encode_unicode", + "lazy_static", + "libc", + "parking_lot 0.11.0", + "regex", + "termios", + "unicode-width", + "winapi 0.3.9", ] [[package]] name = "console" version = "0.11.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c0994e656bba7b922d8dd1245db90672ffb701e684e45be58f20719d69abc5a" dependencies = [ - "encode_unicode 0.3.6 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "terminal_size 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "termios 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-width 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-util 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "encode_unicode", + "lazy_static", + "libc", + "regex", + "terminal_size", + "termios", + "unicode-width", + "winapi 0.3.9", + "winapi-util", ] [[package]] name = "const-random" -version = "0.1.6" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2f1af9ac737b2dd2d577701e59fd09ba34822f6f2ebdb30a7647405d9e55e16a" dependencies = [ - "const-random-macro 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", + "const-random-macro", + "proc-macro-hack", ] [[package]] name = "const-random-macro" -version = "0.1.6" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "25e4c606eb459dd29f7c57b2e0879f2b6f14ee130918c2b78ccb58a9624e6c7a" dependencies = [ - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", + "getrandom", + "proc-macro-hack", ] [[package]] name = "constant_time_eq" -version = "0.1.4" +version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "245097e9a4535ee1e3e3931fcfcd55a796a44c643e8596ff6566d68f09b87bbc" [[package]] name = "copyless" -version = "0.1.4" -source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "core-foundation" -version = "0.6.4" +version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "core-foundation-sys 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", -] +checksum = "a2df960f5d869b2dd8532793fde43eb5427cceb126c929747a26823ab0eeb536" [[package]] name = "core-foundation" version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "57d24c7a13c43e870e37c1556b74555437870a04514f7685f5b354e090567171" dependencies = [ - "core-foundation-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "core-foundation-sys", + "libc", ] -[[package]] -name = "core-foundation-sys" -version = "0.6.2" -source = "registry+https://github.com/rust-lang/crates.io-index" - [[package]] name = "core-foundation-sys" version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b3a71ab494c0b5b860bdc8407ae08978052417070c2ced38573a9157ad75b8ac" [[package]] name = "crc32fast" version = "1.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ba125de2af0df55319f41944744ad91c71113bf74a4646efff39afe1f6842db1" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", ] [[package]] name = "crossbeam" version = "0.7.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "69323bff1fb41c635347b8ead484a5ca6c3f11914d784170b158d8449ab07f8e" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-channel 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-deque 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-epoch 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-queue 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "crossbeam-channel 0.4.3", + "crossbeam-deque", + "crossbeam-epoch", + "crossbeam-queue", + "crossbeam-utils 0.7.2", ] [[package]] name = "crossbeam-channel" version = "0.3.9" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8ec7fcd21571dc78f96cc96243cab8d8f035247c3efd16c687be154c3fa9efa" dependencies = [ - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-utils 0.6.6", ] [[package]] name = "crossbeam-channel" -version = "0.4.0" +version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09ee0cc8804d5393478d743b035099520087a5186f3b93fa58cec08fa62407b6" dependencies = [ - "crossbeam-utils 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "crossbeam-utils 0.7.2", ] [[package]] name = "crossbeam-deque" -version = "0.7.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "crossbeam-epoch 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "crossbeam-epoch" -version = "0.7.2" +version = "0.7.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9f02af974daeee82218205558e51ec8768b48cf524bd01d550abe5573a608285" dependencies = [ - "arrayvec 0.4.11 (registry+https://github.com/rust-lang/crates.io-index)", - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "memoffset 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "scopeguard 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-epoch", + "crossbeam-utils 0.7.2", + "maybe-uninit", ] [[package]] name = "crossbeam-epoch" -version = "0.8.0" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "058ed274caafc1f60c4997b5fc07bf7dc7cca454af7c6e81edffe5f33f70dace" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "memoffset 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "scopeguard 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "cfg-if", + "crossbeam-utils 0.7.2", + "lazy_static", + "maybe-uninit", + "memoffset", + "scopeguard", ] [[package]] name = "crossbeam-queue" -version = "0.1.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "crossbeam-queue" -version = "0.2.0" +version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "774ba60a54c213d409d5353bda12d49cd68d14e45036a285234c8d6f91f92570" dependencies = [ - "crossbeam-utils 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "crossbeam-utils 0.7.2", + "maybe-uninit", ] [[package]] name = "crossbeam-utils" version = "0.6.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "04973fa96e96579258a5091af6003abde64af786b860f18622b82e026cca60e6" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "lazy_static", ] [[package]] name = "crossbeam-utils" -version = "0.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "ct-logs" -version = "0.6.0" +version = "0.7.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c3c7c73a2d1e9fc0886a08b93e98eb643461230d5f1925e4036204d5f2e261a8" dependencies = [ - "sct 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "cfg-if", + "lazy_static", ] [[package]] name = "delay" -version = "0.1.1" +version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6eb11c569f9e41ce743746d5995ba75531d13e4f9763db6f4061e25d46fb9758" [[package]] name = "derivative" version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb582b60359da160a9477ee80f15c8d784c477e69c217ef2cdd4169c24ea380f" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "derive_more" version = "0.14.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d944ac6003ed268757ef1ee686753b57efc5fcf0ebe7b64c9fc81e7e32ff839" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 0.4.30", + "quote 0.6.13", + "rustc_version", + "syn 0.15.44", ] [[package]] name = "derive_more" version = "0.15.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a141330240c921ec6d074a3e188a7c7ef95668bb95e7d44fa0e5778ec2a7afe" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", + "proc-macro2 0.4.30", + "quote 0.6.13", + "regex", + "rustc_version", + "syn 0.15.44", ] [[package]] name = "dfx" version = "0.6.2" dependencies = [ - "actix 0.8.3 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-cors 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-files 0.1.7 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-server 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "actix-web 1.0.9 (registry+https://github.com/rust-lang/crates.io-index)", - "async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)", - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "base64 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "candid 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "chrono 0.4.9 (registry+https://github.com/rust-lang/crates.io-index)", - "clap 2.33.0 (registry+https://github.com/rust-lang/crates.io-index)", - "console 0.7.7 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam 0.7.3 (registry+https://github.com/rust-lang/crates.io-index)", - "delay 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "dialoguer 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "env_logger 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "erased-serde 0.3.10 (registry+https://github.com/rust-lang/crates.io-index)", - "flate2 1.0.13 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "hotwatch 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", -<<<<<<< HEAD - "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)", - "ic-identity-manager 0.6.1", -======= - "ic-agent 0.6.2", - "ic-identity-manager 0.6.2", ->>>>>>> origin/master - "indicatif 0.13.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy-init 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libflate 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)", - "mockall 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", - "mockito 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)", - "petgraph 0.5.0 (registry+https://github.com/rust-lang/crates.io-index)", - "proptest 0.9.5 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "reqwest 0.10.4 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)", - "semver 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_bytes 0.11.2 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_cbor 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_repr 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "shell-words 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "signal-hook 0.1.13 (registry+https://github.com/rust-lang/crates.io-index)", - "slog 2.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "slog-async 2.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "slog-term 2.5.0 (registry+https://github.com/rust-lang/crates.io-index)", - "sysinfo 0.9.6 (registry+https://github.com/rust-lang/crates.io-index)", - "tar 0.4.26 (registry+https://github.com/rust-lang/crates.io-index)", - "tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "toml 0.5.5 (registry+https://github.com/rust-lang/crates.io-index)", - "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "walkdir 2.2.9 (registry+https://github.com/rust-lang/crates.io-index)", - "wasmparser 0.45.0 (registry+https://github.com/rust-lang/crates.io-index)", - "webpki-roots 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)", + "actix", + "actix-cors", + "actix-files", + "actix-server", + "actix-web", + "async-trait", + "atty", + "base64 0.11.0", + "candid", + "chrono", + "clap", + "console 0.7.7", + "crossbeam", + "delay", + "dialoguer", + "env_logger", + "erased-serde", + "flate2", + "futures", + "hex 0.3.2", + "hotwatch", + "ic-agent", + "ic-identity-manager", + "indicatif", + "lazy-init", + "lazy_static", + "libflate", + "mockall", + "mockito", + "petgraph", + "proptest", + "rand 0.7.3", + "regex", + "reqwest", + "rustls 0.17.0", + "semver", + "serde", + "serde_bytes", + "serde_cbor 0.11.1", + "serde_json", + "serde_repr", + "shell-words", + "signal-hook", + "slog", + "slog-async", + "slog-term", + "sysinfo", + "tar", + "tempfile", + "tokio", + "toml", + "url 2.1.1", + "walkdir", + "wasmparser", + "webpki-roots", ] [[package]] name = "dialoguer" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4aa86af7b19b40ef9cbef761ed411a49f0afa06b7b6dcd3dfe2f96a3c546138" dependencies = [ - "console 0.11.3 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "console 0.11.3", + "lazy_static", + "tempfile", ] [[package]] name = "diff" version = "0.1.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0e25ea47919b1560c4e3b7fe0aaab9becf5b84a10325ddf7db0f0ba5e1026499" [[package]] name = "difference" version = "2.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "524cbf6897b527295dff137cec09ecf3a05f4fddffd7dfcd1585403449e74198" [[package]] name = "digest" version = "0.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f3d0c8c8752312f9713efd397ff63acb9f85585afbf179282e720e7704954dd5" dependencies = [ - "generic-array 0.12.3 (registry+https://github.com/rust-lang/crates.io-index)", + "generic-array", ] [[package]] name = "dirs" version = "1.0.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3fd78930633bd1c6e35c4b42b1df7b0cbc6bc191146e512bb3bedf243fcc3901" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_users 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "redox_users", + "winapi 0.3.9", ] [[package]] name = "dirs" version = "2.0.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "13aea89a5c93364a98e9b37b2fa237effbb694d5cfe01c5b70941f7eb087d5e3" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "dirs-sys 0.3.4 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "dirs-sys", ] [[package]] name = "dirs-sys" -version = "0.3.4" +version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e93d7f5705de3e49895a2b5e0b8855a1c27f080192ae9c32a6432d50741a57a" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_users 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "redox_users", + "winapi 0.3.9", ] [[package]] name = "doc-comment" -version = "0.3.1" +version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fea41bba32d969b513997752735605054bc0dfa92b4c56bf1189f2e174be7a10" [[package]] name = "docopt" version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f525a586d310c87df72ebcd98009e57f1cc030c8c268305287a476beb653969" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "strsim 0.9.2 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", + "regex", + "serde", + "strsim 0.9.3", ] [[package]] name = "downcast" version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4bb454f0228b18c7f4c3b0ebbee346ed9c52e7443b0999cd543ff3571205701d" [[package]] name = "dtoa" -version = "0.4.4" +version = "0.4.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "134951f4028bdadb9b84baf4232681efbf277da25144b9b0ad65df75946c422b" [[package]] name = "either" version = "1.5.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bb1f6b1ce1c140482ea30ddd3335fc0024ac7ee112895426e0a629a6c20adfe3" [[package]] name = "ena" version = "0.14.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d7402b94a93c24e742487327a7cd839dc9d36fec9de9fb25b09f2dae459f36c3" dependencies = [ - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", + "log", ] [[package]] name = "encode_unicode" version = "0.3.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a357d28ed41a50f9c765dbfe56cbc04a64e53e5fc58ba79fbc34c10ef3df831f" [[package]] name = "encoding_rs" -version = "0.8.20" +version = "0.8.23" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e8ac63f94732332f44fe654443c46f6375d1939684c17b0afb6cb56b0456e171" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", ] [[package]] name = "enum-as-inner" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3d58266c97445680766be408285e798d3401c6d4c378ec5552e78737e681e37d" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 0.4.30", + "quote 0.6.13", + "syn 0.15.44", ] [[package]] name = "env_logger" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aafcde04e90a5226a6443b7aabdb016ba2f8307c847d524724bd9b346dd1a2d3" dependencies = [ - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "humantime 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "termcolor 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)", + "atty", + "humantime", + "log", + "regex", + "termcolor", ] [[package]] name = "erased-serde" -version = "0.3.10" +version = "0.3.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6ca8b296792113e1500fd935ae487be6e00ce318952a6880555554824d6ebf38" +dependencies = [ + "serde", +] + +[[package]] +name = "extend" +version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f47da3a72ec598d9c8937a7ebca8962a5c7a1f28444e38c2b33c771ba3f55f05" dependencies = [ - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro-error", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "failure" -version = "0.1.5" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d32e9bd16cc02eae7db7ef620b392808b89f6a5e16bb3497d159c6b92a0f4f86" dependencies = [ - "backtrace 0.3.38 (registry+https://github.com/rust-lang/crates.io-index)", - "failure_derive 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "backtrace", + "failure_derive", ] [[package]] name = "failure_derive" -version = "0.1.5" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aa4da3c766cd7a0db8242e326e9e4e081edd567072893ed320008189715366a4" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", - "synstructure 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", + "synstructure", ] [[package]] name = "fake-simd" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e88a8acf291dafb59c2d96e8f59828f3838bb1a70398823ade51a84de6a6deed" [[package]] name = "filetime" -version = "0.2.7" +version = "0.2.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3ed85775dcc68644b5c950ac06a2b23768d3bc9390464151aaf27136998dcf9e" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "libc", + "redox_syscall", + "winapi 0.3.9", ] [[package]] name = "fixedbitset" version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d" [[package]] name = "flate2" -version = "1.0.13" +version = "1.0.16" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "68c90b0fc46cf89d227cc78b40e494ff81287a92dd07631e5af0d06fe3cf885e" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "crc32fast 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "miniz-sys 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "miniz_oxide 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "crc32fast", + "libc", + "miniz-sys", + "miniz_oxide", ] [[package]] name = "float-cmp" -version = "0.5.3" +version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e1267f4ac4f343772758f7b1bdcbe767c218bbab93bb432acbf5162bbf85a6c4" dependencies = [ - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", + "num-traits", ] [[package]] name = "fnv" -version = "1.0.6" +version = "1.0.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" [[package]] name = "foreign-types" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1" dependencies = [ - "foreign-types-shared 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", + "foreign-types-shared", ] [[package]] name = "foreign-types-shared" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" [[package]] name = "fragile" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05f8140122fa0d5dcb9fc8627cfce2b37cc1500f752636d46ea28bc26785c2f9" [[package]] name = "fsevent" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5ab7d1bd1bd33cc98b0889831b72da23c0aa4df9cec7e0702f46ecea04b35db6" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "fsevent-sys 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "fsevent-sys", ] [[package]] name = "fsevent-sys" version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f41b048a94555da0f42f1d632e2e19510084fb8e303b0daa2816e733fb3644a0" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] [[package]] name = "fuchsia-cprng" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a06f77d526c1a601b7c4cdd98f54b5eaabffc14d5f2f0296febdc7f357c6d3ba" [[package]] name = "fuchsia-zircon" version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e9763c69ebaae630ba35f74888db465e49e259ba1bc0eda7d06f4a067615d82" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "fuchsia-zircon-sys 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "fuchsia-zircon-sys", ] [[package]] name = "fuchsia-zircon-sys" version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3dcaa9ae7725d12cdb85b3ad99a434db70b468c09ded17e012d86b5c1010f7a7" [[package]] name = "futures" version = "0.1.29" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1b980f2816d6ee8673b6517b52cb0e808a180efc92e5c19d02cdda79066703ef" [[package]] name = "futures-channel" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f366ad74c28cca6ba456d95e6422883cfb4b252a83bed929c83abfdbbf2967d5" dependencies = [ - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", + "futures-core", ] [[package]] name = "futures-core" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59f5fff90fd5d971f936ad674802482ba441b6f09ba5e15fd8b39145582ca399" [[package]] name = "futures-io" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "de27142b013a8e869c14957e6d2edeef89e97c289e69d042ee3a49acd8b51789" [[package]] name = "futures-macro" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d0b5a30a4328ab5473878237c447333c093297bded83a4983d10f4deea240d39" dependencies = [ - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro-hack", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "futures-sink" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f2032893cb734c7a05d85ce0cc8b8c4075278e93b24b66f9de99d6eb0fa8acc" [[package]] name = "futures-task" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bdb66b5f09e22019b1ab0830f7785bcea8e7a42148683f99214f73f8ec21a626" dependencies = [ - "once_cell 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", + "once_cell", ] [[package]] name = "futures-util" version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8764574ff08b701a084482c3c7031349104b07ac897393010494beaa18ce32c6" dependencies = [ - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-io 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-macro 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-task 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-project 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro-nested 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", + "futures-core", + "futures-io", + "futures-macro", + "futures-task", + "memchr", + "pin-project", + "pin-utils", + "proc-macro-hack", + "proc-macro-nested", + "slab", ] [[package]] name = "generic-array" version = "0.12.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c68f0274ae0e023facc3c97b2e00f076be70e254bc851d972503b328db79b2ec" dependencies = [ - "typenum 1.11.2 (registry+https://github.com/rust-lang/crates.io-index)", + "typenum", ] [[package]] name = "getrandom" -version = "0.1.12" +version = "0.1.14" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7abc8dd8451921606d809ba32e95b6111925cd2906060d2dcc29c070220503eb" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "wasi 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "libc", + "wasi", ] +[[package]] +name = "gimli" +version = "0.22.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aaf91faf136cb47367fa430cd46e37a788775e7fa104f8b4bcb3861dc389b724" + [[package]] name = "h2" version = "0.1.26" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a5b34c246847f938a410a03c5458c7fee2274436675e76d8b903c08efc29c462" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.1.21 (registry+https://github.com/rust-lang/crates.io-index)", - "indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "string 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", + "bytes 0.4.12", + "fnv", + "futures", + "http 0.1.21", + "indexmap", + "log", + "slab", + "string", + "tokio-io", ] [[package]] name = "h2" -version = "0.2.3" +version = "0.2.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "993f9e0baeed60001cf565546b0d3dbe6a6ad23f2bd31644a133c641eccf6d53" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-sink 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-util 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "fnv", + "futures-core", + "futures-sink", + "futures-util", + "http 0.2.1", + "indexmap", + "slab", + "tokio", + "tokio-util", + "tracing", ] [[package]] name = "half" -version = "1.3.0" +version = "1.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d36fab90f82edc3c747f9d438e06cf0a491055896f2a279638bb5beed6c40177" [[package]] name = "hashbrown" version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "29fba9abe4742d586dfd0c06ae4f7e73a1c2d86b856933509b269d82cdf06e18" [[package]] name = "hashbrown" version = "0.6.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e6073d0ca812575946eb5f35ff68dbe519907b25c42530389ff946dc84c6ead" dependencies = [ - "ahash 0.2.18 (registry+https://github.com/rust-lang/crates.io-index)", - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", + "ahash", + "autocfg 0.1.7", +] + +[[package]] +name = "hashbrown" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "34f595585f103464d8d2f6e9864682d74c1601fed5e07d62b1c9058dba8246fb" +dependencies = [ + "autocfg 1.0.0", ] [[package]] name = "hermit-abi" -version = "0.1.6" +version = "0.1.15" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3deed196b6e7f9e44a2ae8d94225d80302d81208b1bb673fd21fe634645c85a9" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] [[package]] name = "hex" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "805026a5d0141ffc30abb3be3173848ad46a1b1664fe632428479619a3644d77" [[package]] name = "hex" -version = "0.4.0" +version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "644f9158b2f133fd50f5fb3242878846d9eb792e445c893805ff0e3824006e35" [[package]] name = "hostname" -version = "0.1.5" +version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3c731c3e10504cc8ed35cfe2f1db4c9274c3d35fa486e3b31df46f068ef3e867" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "winutil 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "match_cfg", + "winapi 0.3.9", ] [[package]] name = "hotwatch" version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ba0add391e9cd7d19c29024617a44df79c867ab003bce7f3224c1636595ec740" dependencies = [ - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "notify 4.0.14 (registry+https://github.com/rust-lang/crates.io-index)", + "log", + "notify", ] [[package]] name = "http" version = "0.1.21" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d6ccf5ede3a895d8856620237b2f02972c1bbc78d2965ad7fe8838d4a0ed41f0" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "fnv", + "itoa", ] [[package]] name = "http" -version = "0.2.0" +version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28d569972648b2c512421b5f2a405ad6ac9666547189d0c5477a3f200f3e02f9" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "fnv", + "itoa", ] [[package]] name = "http-body" version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "13d5ff830006f7646652e057693569bfe0d51760c0085a071769d142a205111b" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "http 0.2.1", ] [[package]] name = "httparse" version = "1.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd179ae861f0c2e53da70d892f5f3029f9594be0c41dc5269cd371691b1dc2f9" [[package]] name = "humantime" version = "1.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df004cfca50ef23c36850aaaa59ad52cc70d0e90243c3c7737a4dd32dc7a3c4f" dependencies = [ - "quick-error 1.2.2 (registry+https://github.com/rust-lang/crates.io-index)", + "quick-error", ] [[package]] name = "hyper" -version = "0.13.4" +version = "0.13.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3e68a8dd9716185d9e64ea473ea6ef63529252e3e27623295a0378a19665d5eb" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-channel 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "h2 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "http-body 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "httparse 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)", - "itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-project 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tower-service 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "want 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "futures-channel", + "futures-core", + "futures-util", + "h2 0.2.6", + "http 0.2.1", + "http-body", + "httparse", + "itoa", + "pin-project", + "socket2", + "time", + "tokio", + "tower-service", + "tracing", + "want", ] [[package]] name = "hyper-rustls" -version = "0.20.0" +version = "0.21.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "37743cc83e8ee85eacfce90f2f4102030d9ff0a95244098d781e9bee4a90abb6" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "ct-logs 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls-native-certs 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-rustls 0.13.1 (registry+https://github.com/rust-lang/crates.io-index)", - "webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "futures-util", + "hyper", + "log", + "rustls 0.18.0", + "tokio", + "tokio-rustls", + "webpki", ] [[package]] name = "hyper-tls" -version = "0.4.1" +version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d979acc56dcb5b8dddba3917601745e877576475aa046df3226eabdecef78eed" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)", - "native-tls 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tls 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "hyper", + "native-tls", + "tokio", + "tokio-tls", ] [[package]] name = "ic-agent" -<<<<<<< HEAD version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0#1a3188ab5e116809461b8196f2dee160aec03dfd" -======= -version = "0.6.2" ->>>>>>> origin/master -dependencies = [ - "async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)", - "base32 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "candid 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "crc32fast 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "delay 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "hex 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "leb128 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "reqwest 0.10.4 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_bytes 0.11.2 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_cbor 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)", - "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.2#7d18fe54cb24025cec75d2892601af10ae18363e" +dependencies = [ + "async-trait", + "base32", + "byteorder", + "candid", + "crc32fast", + "delay", + "hex 0.4.2", + "leb128", + "openssl", + "rand 0.7.3", + "reqwest", + "ring", + "serde", + "serde_bytes", + "serde_cbor 0.11.1", + "url 2.1.1", ] [[package]] name = "ic-identity-manager" version = "0.6.2" dependencies = [ -<<<<<<< HEAD - "ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)", -======= - "ic-agent 0.6.2", ->>>>>>> origin/master - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "pem 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_cbor 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)", + "ic-agent", + "openssl", + "pem", + "ring", + "serde", + "serde_cbor 0.10.2", ] [[package]] name = "idna" version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "38f09e0f0b1fb55fdee1f17470ad800da77af5186a1a76c026b679358b7e844e" dependencies = [ - "matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-bidi 0.3.4 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-normalization 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", + "matches", + "unicode-bidi", + "unicode-normalization", ] [[package]] name = "idna" version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "02e2673c30ee86b5b96a9cb52ad15718aa1f966f5ab9ad54a8b95d5ca33120a9" dependencies = [ - "matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-bidi 0.3.4 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-normalization 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", + "matches", + "unicode-bidi", + "unicode-normalization", ] [[package]] name = "indexmap" -version = "1.3.0" +version = "1.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b88cd59ee5f71fea89a62248fc8f387d44400cefe05ef548466d61ced9029a7" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "hashbrown 0.8.1", ] [[package]] name = "indicatif" version = "0.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8572bccfb0665e70b7faf44ee28841b8e0823450cd4ad562a76b5a3c4bf48487" dependencies = [ - "console 0.11.3 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "number_prefix 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "console 0.11.3", + "lazy_static", + "number_prefix", + "regex", ] [[package]] name = "inotify" -version = "0.6.1" +version = "0.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4816c66d2c8ae673df83366c18341538f234a26d65a9ecea5c348b453ac1d02f" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "inotify-sys 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "inotify-sys", + "libc", ] [[package]] name = "inotify-sys" version = "0.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e74a1aa87c59aeff6ef2cc2fa62d41bc43f54952f55652656b18a02fd5e356c0" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] +[[package]] +name = "instant" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b141fdc7836c525d4d594027d318c84161ca17aaf8113ab1f81ab93ae897485" + [[package]] name = "iovec" version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2b3ea6ff95e175473f8ffe6a7eb7c00d054240321b84c57051175fe3c1e075e" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] [[package]] name = "ipconfig" -version = "0.2.1" +version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7e2f18aece9709094573a9f24f483c4f65caa4298e2f7ae1b71cc65d853fad7" dependencies = [ - "socket2 0.3.11 (registry+https://github.com/rust-lang/crates.io-index)", - "widestring 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winreg 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", + "socket2", + "widestring", + "winapi 0.3.9", + "winreg 0.6.2", ] +[[package]] +name = "ipnet" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47be2f14c678be2fdcab04ab1171db51b2762ce6f0a8ee87c8dd4a04ed216135" + [[package]] name = "itertools" version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "284f18f85651fe11e8a991b2adb42cb078325c996ed026d994719efcfca1d54b" dependencies = [ - "either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)", + "either", ] [[package]] name = "itoa" -version = "0.4.4" +version = "0.4.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc6f3ad7b9d11a0c00842ff8de1b60ee58661048eb8049ed33c73594f359d7e6" [[package]] name = "js-sys" -version = "0.3.40" +version = "0.3.44" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85a7e2c92a4804dd459b86c339278d0fe87cf93757fae222c3fa3ae75458bc73" dependencies = [ - "wasm-bindgen 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "wasm-bindgen", ] [[package]] name = "kernel32-sys" version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7507624b29483431c0ba2d82aece8ca6cdba9382bff4ddd0f7490560c056098d" dependencies = [ - "winapi 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-build 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.2.8", + "winapi-build", ] [[package]] name = "lalrpop" version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d6f55673d283313791404be21209bb433f128f7e5c451986df107eb5fdbd68d2" dependencies = [ - "ascii-canvas 2.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "bit-set 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "diff 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "docopt 1.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "ena 0.14.0 (registry+https://github.com/rust-lang/crates.io-index)", - "itertools 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lalrpop-util 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)", - "petgraph 0.5.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "regex-syntax 0.6.12 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_derive 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "sha2 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "string_cache 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "term 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-xid 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "ascii-canvas", + "atty", + "bit-set", + "diff", + "docopt", + "ena", + "itertools", + "lalrpop-util", + "petgraph", + "regex", + "regex-syntax", + "serde", + "serde_derive", + "sha2", + "string_cache", + "term 0.5.2", + "unicode-xid 0.2.1", ] [[package]] name = "lalrpop-util" version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7e88f15a7d31dfa8fb607986819039127f0161058a3b248a146142d276cbd28" [[package]] name = "language-tags" version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a91d884b6667cd606bb5a69aa0c99ba811a115fc68915e7056ec08a46e93199a" [[package]] name = "lazy-init" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e71f2233af239a915476da8ee21a57331d82b9880c78220451ece7cb5862d313" [[package]] name = "lazy_static" version = "1.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" [[package]] name = "lazycell" version = "1.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b294d6fa9ee409a054354afc4352b0b9ef7ca222c69b8812cbea9e7d2bf3783f" [[package]] name = "leb128" version = "0.2.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3576a87f2ba00f6f106fdfcd16db1d698d648a26ad8e0573cad8537c3c362d2a" [[package]] name = "libc" -version = "0.2.71" +version = "0.2.74" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2f02823cf78b754822df5f7f268fb59822e7296276d3e069d8e8cb26a14bd10" [[package]] name = "libflate" version = "0.1.27" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9135df43b1f5d0e333385cb6e7897ecd1a43d7d11b91ac003f4d2c2d2401fdd" dependencies = [ - "adler32 1.0.4 (registry+https://github.com/rust-lang/crates.io-index)", - "crc32fast 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rle-decode-fast 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "take_mut 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", + "adler32", + "crc32fast", + "rle-decode-fast", + "take_mut", ] [[package]] name = "linked-hash-map" -version = "0.5.2" +version = "0.5.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8dd5a6d5999d9907cda8ed67bbd137d3af8085216c2ac62de5be860bd41f304a" [[package]] name = "lock_api" version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ed946d4529956a20f2d63ebe1b69996d5a2137c91913fe3ebbeff957f5bca7ff" dependencies = [ - "scopeguard 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "scopeguard", ] [[package]] name = "lock_api" -version = "0.3.1" +version = "0.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c4da24a77a3d8a6d4862d95f72e6fdb9c09a643ecdb402d754004a557f2bec75" dependencies = [ - "scopeguard 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "scopeguard", +] + +[[package]] +name = "lock_api" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28247cc5a5be2f05fbcd76dd0cf2c7d3b5400cb978a28042abcd4fa0b3f8261c" +dependencies = [ + "scopeguard", ] [[package]] name = "log" -version = "0.4.8" +version = "0.4.11" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4fabed175da42fed1fa0746b0ea71f412aa9d35e76e95e59b192c64b9dc2bf8b" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", ] [[package]] name = "lru-cache" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "31e24f1ad8321ca0e8a1e0ac13f23cb668e6f5466c2c57319f6a5cf1cc8e3b1c" dependencies = [ - "linked-hash-map 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)", + "linked-hash-map", ] +[[package]] +name = "match_cfg" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffbee8634e0d45d258acb448e7eaab3fce7a0a467395d4d9f228e3c1f01fb2e4" + [[package]] name = "matches" version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7ffc5c5338469d4d3ea17d269fa8ea3512ad247247c30bd2df69e68309ed0a08" + +[[package]] +name = "maybe-uninit" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "60302e4db3a61da70c0cb7991976248362f30319e88850c487b9b95bbf059e00" [[package]] name = "memchr" -version = "2.2.1" +version = "2.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3728d817d99e5ac407411fa471ff9800a778d88a24685968b36824eaf4bee400" [[package]] name = "memoffset" -version = "0.5.1" +version = "0.5.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c198b026e1bbf08a937e94c6c60f9ec4a2267f5b0d2eec9c1b21b061ce2be55f" dependencies = [ - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", ] [[package]] name = "mime" -version = "0.3.14" +version = "0.3.16" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2a60c7ce501c71e03a9c9c0d35b861413ae925bd979cc7a4e30d060069aaac8d" [[package]] name = "mime_guess" -version = "2.0.1" +version = "2.0.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2684d4c2e97d99848d30b324b00c8fcc7e5c897b7cbb5819b09e7c90e8baf212" dependencies = [ - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "unicase 2.5.1 (registry+https://github.com/rust-lang/crates.io-index)", + "mime", + "unicase", ] [[package]] name = "miniz-sys" version = "0.1.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e9e3ae51cea1576ceba0dde3d484d30e6e5b86dee0b2d412fe3a16a15c98202" dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "cc", + "libc", ] [[package]] name = "miniz_oxide" -version = "0.3.5" +version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be0f75932c1f6cfae3c04000e40114adf955636e19040f9c0a2c380702aa1c7f" dependencies = [ - "adler32 1.0.4 (registry+https://github.com/rust-lang/crates.io-index)", + "adler", ] [[package]] name = "mio" -version = "0.6.21" +version = "0.6.22" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fce347092656428bc8eaf6201042cb551b8d67855af7374542a92a0fbfcac430" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "fuchsia-zircon 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)", - "fuchsia-zircon-sys 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)", - "iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "kernel32-sys 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "miow 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "fuchsia-zircon", + "fuchsia-zircon-sys", + "iovec", + "kernel32-sys", + "libc", + "log", + "miow", + "net2", + "slab", + "winapi 0.2.8", ] [[package]] name = "mio-extras" version = "2.0.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "52403fe290012ce777c4626790c8951324a2b9e3316b3143779c72b029742f19" dependencies = [ - "lazycell 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", + "lazycell", + "log", + "mio", + "slab", ] [[package]] name = "mio-uds" -version = "0.6.7" +version = "0.6.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "afcb699eb26d4332647cc848492bbc15eafb26f08d0304550d5aa1f612e066f0" dependencies = [ - "iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", + "iovec", + "libc", + "mio", ] [[package]] name = "miow" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c1f2f3b1cf331de6896aabf6e9d55dca90356cc9960cca7eaaf408a355ae919" dependencies = [ - "kernel32-sys 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "ws2_32-sys 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", + "kernel32-sys", + "net2", + "winapi 0.2.8", + "ws2_32-sys", ] [[package]] name = "mockall" version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b95a7e7cfbce0e99ebbf5356a085d3b5e320a7ef300f77cd50a7148aa362e7c2" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "downcast 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)", - "fragile 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "mockall_derive 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", - "predicates 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)", - "predicates-tree 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "downcast", + "fragile", + "lazy_static", + "mockall_derive", + "predicates", + "predicates-tree", ] [[package]] name = "mockall_derive" version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d5a615a1ad92048ad5d9633251edb7492b8abc057d7a679a9898476aef173935" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "mockito" version = "0.20.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fa3f481382a4d68c5f1d27fb567db27196630f729706003cb07a9b8330a30306" dependencies = [ - "assert-json-diff 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "colored 1.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "difference 2.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "httparse 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", + "assert-json-diff", + "colored", + "difference", + "httparse", + "lazy_static", + "log", + "percent-encoding 1.0.1", + "rand 0.7.3", + "regex", + "serde_json", ] [[package]] name = "native-tls" -version = "0.2.3" +version = "0.2.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2b0d88c06fe90d5ee94048ba40409ef1d9315d86f6f38c2efdaad4fb50c58b2d" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl-probe 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl-sys 0.9.54 (registry+https://github.com/rust-lang/crates.io-index)", - "schannel 0.1.16 (registry+https://github.com/rust-lang/crates.io-index)", - "security-framework 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "security-framework-sys 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", + "libc", + "log", + "openssl", + "openssl-probe", + "openssl-sys", + "schannel", + "security-framework", + "security-framework-sys", + "tempfile", ] [[package]] name = "net2" -version = "0.2.33" +version = "0.2.34" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2ba7c918ac76704fb42afcbbb43891e72731f3dcca3bef2a19786297baf14af7" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "libc", + "winapi 0.3.9", ] [[package]] name = "new_debug_unreachable" -version = "1.0.3" -source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "nodrop" -version = "0.1.13" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e4a24736216ec316047a1fc4252e27dabb04218aa4a3f37c6e7ddbf1f9782b54" [[package]] name = "nom" version = "4.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2ad2a91a8e869eeb30b9cb3119ae87773a8f4ae617f41b1eb9c154b2905f7bd6" dependencies = [ - "memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "version_check 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "memchr", + "version_check 0.1.5", ] [[package]] name = "normalize-line-endings" -version = "0.2.2" +version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "61807f77802ff30975e01f4f071c8ba10c022052f98b3294119f3e615d13e5be" [[package]] name = "notify" -version = "4.0.14" +version = "4.0.15" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "80ae4a7688d1fab81c5bf19c64fc8db920be8d519ce6336ed4e7efe024724dbd" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "filetime 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)", - "fsevent 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "fsevent-sys 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "inotify 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "kernel32-sys 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "mio-extras 2.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "walkdir 2.2.9 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "filetime", + "fsevent", + "fsevent-sys", + "inotify", + "libc", + "mio", + "mio-extras", + "walkdir", + "winapi 0.3.9", ] [[package]] name = "num-bigint" -version = "0.2.4" +version = "0.2.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "090c7f9998ee0ff65aa5b723e4009f7b217707f1fb5ea551329cc4d6231fb304" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "num-integer 0.1.41 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "num-integer", + "num-traits", ] [[package]] name = "num-integer" -version = "0.1.41" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "num-traits" version = "0.1.43" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8d59457e662d541ba17869cf51cf177c0b5f0cbf476c66bdc90bf1edac4f875b" dependencies = [ - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "num-traits", ] [[package]] name = "num-traits" -version = "0.2.8" +version = "0.2.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac267bcc07f48ee5f8935ab0d24f316fb722d7a1292e2913f0cc196b29ffd611" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", ] [[package]] name = "num_cpus" -version = "1.11.1" +version = "1.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3" dependencies = [ - "hermit-abi 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "hermit-abi", + "libc", ] [[package]] name = "num_enum" version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca565a7df06f3d4b485494f25ba05da1435950f4dc263440eda7a6fa9b8e36e4" dependencies = [ - "derivative 2.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "num_enum_derive 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", + "derivative", + "num_enum_derive", ] [[package]] name = "num_enum_derive" version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffa5a33ddddfee04c0283a7653987d634e880347e96b5b2ed64de07efb59db9d" dependencies = [ - "proc-macro-crate 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro-crate", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "number_prefix" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "17b02fc0ff9a9e4b35b3342880f48e896ebf69f2967921fe8646bf5b7125956a" + +[[package]] +name = "object" +version = "0.20.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ab52be62400ca80aa00285d25253d7f7c437b7375c4de678f5405d3afe82ca5" [[package]] name = "once_cell" version = "1.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b631f7e854af39a1739f401cf34a8a013dfe09eac4fa4dba91e9768bd28168d" [[package]] name = "opaque-debug" version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2839e79665f131bdb5782e51f2c6c9599c133c6098982a54c794358bf432529c" [[package]] name = "openssl" -version = "0.10.28" +version = "0.10.30" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8d575eff3665419f9b83678ff2815858ad9d11567e082f5ac1814baba4e2bcb4" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "foreign-types 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl-sys 0.9.54 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "cfg-if", + "foreign-types", + "lazy_static", + "libc", + "openssl-sys", ] [[package]] name = "openssl-probe" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77af24da69f9d9341038eba93a073b1fdaaa1b788221b00a69bce9e762cb32de" [[package]] name = "openssl-sys" -version = "0.9.54" +version = "0.9.58" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a842db4709b604f0fe5d1170ae3565899be2ad3d9cbc72dedc789ac0511f78de" dependencies = [ - "autocfg 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "pkg-config 0.3.16 (registry+https://github.com/rust-lang/crates.io-index)", - "vcpkg 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "cc", + "libc", + "pkg-config", + "vcpkg", ] [[package]] name = "parking_lot" version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fa7767817701cce701d5585b9c4db3cdd02086398322c1d7e8bf5094a96a2ce7" dependencies = [ - "lock_api 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot_core 0.5.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", + "lock_api 0.2.0", + "parking_lot_core 0.5.0", + "rustc_version", ] [[package]] name = "parking_lot" version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f842b1982eb6c2fe34036a4fbfb06dd185a3f5c8edfaacdf7d1ea10b07de6252" dependencies = [ - "lock_api 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot_core 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", + "lock_api 0.3.4", + "parking_lot_core 0.6.2", + "rustc_version", ] [[package]] name = "parking_lot" -version = "0.10.0" +version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4893845fa2ca272e647da5d0e46660a314ead9c2fdd9a883aabc32e481a8733" dependencies = [ - "lock_api 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot_core 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "instant", + "lock_api 0.4.1", + "parking_lot_core 0.8.0", ] [[package]] name = "parking_lot_core" version = "0.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb88cb1cb3790baa6776844f968fea3be44956cf184fa1be5a03341f5491278c" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.6.5 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "cloudabi 0.0.3", + "libc", + "rand 0.6.5", + "redox_syscall", + "rustc_version", + "smallvec 0.6.13", + "winapi 0.3.9", ] [[package]] name = "parking_lot_core" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b876b1b9e7ac6e1a74a6da34d25c42e17e8862aa409cbbbdcfc8d86c6f3bc62b" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "cloudabi 0.0.3", + "libc", + "redox_syscall", + "rustc_version", + "smallvec 0.6.13", + "winapi 0.3.9", ] [[package]] name = "parking_lot_core" -version = "0.7.0" +version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c361aa727dd08437f2f1447be8b59a33b0edd15e0fcee698f935613d9efbca9b" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 1.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "cloudabi 0.1.0", + "instant", + "libc", + "redox_syscall", + "smallvec 1.4.1", + "winapi 0.3.9", ] [[package]] name = "paste" -version = "0.1.6" +version = "0.1.18" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "45ca20c77d80be666aef2b45486da86238fabe33e38306bd3118fe4af33fa880" dependencies = [ - "paste-impl 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", + "paste-impl", + "proc-macro-hack", ] [[package]] name = "paste-impl" -version = "0.1.6" +version = "0.1.18" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d95a7db200b97ef370c8e6de0088252f7e0dfff7d047a28528e47456c0fc98b6" dependencies = [ - "proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro-hack", ] [[package]] name = "pem" version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1581760c757a756a41f0ee3ff01256227bdf64cb752839779b95ffb01c59793" dependencies = [ - "base64 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "base64 0.11.0", + "lazy_static", + "regex", ] [[package]] name = "percent-encoding" version = "1.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "31010dd2e1ac33d5b46a5b413495239882813e0369f8ed8a5e266f173602f831" [[package]] name = "percent-encoding" version = "2.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e" [[package]] name = "petgraph" -version = "0.5.0" +version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7" dependencies = [ - "fixedbitset 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", + "fixedbitset", + "indexmap", ] [[package]] name = "phf_shared" version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c00cf8b9eafe68dde5e9eaa2cef8ee84a9336a47d566ec55ca16589633b65af7" dependencies = [ - "siphasher 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)", + "siphasher", ] [[package]] name = "pin-project" -version = "0.4.8" +version = "0.4.23" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca4433fff2ae79342e497d9f8ee990d174071408f28f726d6d83af93e58e48aa" dependencies = [ - "pin-project-internal 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", + "pin-project-internal", ] [[package]] name = "pin-project-internal" -version = "0.4.8" +version = "0.4.23" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c0e815c3ee9a031fdf5af21c10aa17c573c9c6a566328d99e3936c34e36461f" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "pin-project-lite" -version = "0.1.4" +version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "282adbf10f2698a7a77f8e983a74b2d18176c19a7fd32a45446139ae7b02b715" [[package]] name = "pin-utils" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" [[package]] name = "pkg-config" -version = "0.3.16" +version = "0.3.18" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d36492546b6af1463394d46f0c834346f31548646f6ba10849802c9c9a27ac33" [[package]] name = "ppv-lite86" -version = "0.2.5" +version = "0.2.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "237a5ed80e274dbc66f86bd59c1e25edc039660be53194b5fe0a482e0f2612ea" [[package]] name = "precomputed-hash" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "925383efa346730478fb4838dbe9137d2a47675ad789c546d150a6e1dd4ab31c" [[package]] name = "predicates" -version = "1.0.2" +version = "1.0.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96bfead12e90dccead362d62bb2c90a5f6fc4584963645bc7f71a735e0b0735a" dependencies = [ - "difference 2.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "float-cmp 0.5.3 (registry+https://github.com/rust-lang/crates.io-index)", - "normalize-line-endings 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "predicates-core 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "difference", + "float-cmp", + "normalize-line-endings", + "predicates-core", + "regex", ] [[package]] name = "predicates-core" version = "1.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "06075c3a3e92559ff8929e7a280684489ea27fe44805174c3ebd9328dcb37178" [[package]] name = "predicates-tree" version = "1.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e63c4859013b38a76eca2414c64911fba30def9e3202ac461a2d22831220124" dependencies = [ - "predicates-core 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "treeline 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "predicates-core", + "treeline", ] [[package]] name = "pretty" version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ad9940b913ee56ddd94aec2d3cd179dd47068236f42a1a6415ccf9d880ce2a61" dependencies = [ - "arrayvec 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "typed-arena 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)", + "arrayvec", + "typed-arena", ] [[package]] name = "proc-macro-crate" -version = "0.1.4" +version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d6ea3c4595b96363c13943497db34af4460fb474a95c43f4446ad341b8c9785" dependencies = [ - "toml 0.5.5 (registry+https://github.com/rust-lang/crates.io-index)", + "toml", ] [[package]] -name = "proc-macro-hack" -version = "0.5.10" +name = "proc-macro-error" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c" +dependencies = [ + "proc-macro-error-attr", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", + "version_check 0.9.2", +] + +[[package]] +name = "proc-macro-error-attr" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "version_check 0.9.2", ] +[[package]] +name = "proc-macro-hack" +version = "0.5.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "99c605b9a0adc77b7211c6b1f722dcb613d68d66859a44f3d485a6da332b0598" + [[package]] name = "proc-macro-nested" version = "0.1.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "eba180dafb9038b050a4c280019bbedf9f2467b61e5d892dcad585bb57aadc5a" [[package]] name = "proc-macro2" version = "0.4.30" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cf3d2011ab5c909338f7887f4fc896d35932e29146c12c8d01da6b22a80ba759" dependencies = [ - "unicode-xid 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "unicode-xid 0.1.0", ] [[package]] name = "proc-macro2" -version = "1.0.18" +version = "1.0.19" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "04f5f085b5d71e2188cb8271e5da0161ad52c3f227a661a3c135fdf28e258b12" dependencies = [ - "unicode-xid 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "unicode-xid 0.2.1", ] [[package]] name = "proptest" -version = "0.9.5" +version = "0.9.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "01c477819b845fe023d33583ebf10c9f62518c8d79a0960ba5c36d6ac8a55a5b" dependencies = [ - "bit-set 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "quick-error 1.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.6.5 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_chacha 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_xorshift 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "regex-syntax 0.6.12 (registry+https://github.com/rust-lang/crates.io-index)", - "rusty-fork 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "bit-set", + "bitflags", + "byteorder", + "lazy_static", + "num-traits", + "quick-error", + "rand 0.6.5", + "rand_chacha 0.1.1", + "rand_xorshift", + "regex-syntax", + "rusty-fork", + "tempfile", ] [[package]] name = "quick-error" -version = "1.2.2" +version = "1.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1d01941d82fa2ab50be1e79e6714289dd7cde78eba4c074bc5a4374f650dfe0" [[package]] name = "quote" version = "0.6.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6ce23b6b870e8f94f81fb0a363d65d86675884b34a09043c81e5562f11c1f8e1" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 0.4.30", ] [[package]] name = "quote" version = "1.0.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aa563d17ecb180e500da1cfd2b028310ac758de548efdd203e18f283af693f37" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "rand" -version = "0.4.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "fuchsia-cprng 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rdrand 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", ] [[package]] name = "rand" version = "0.6.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d71dacdc3c88c1fde3885a3be3fbab9f35724e6ce99467f7d9c5026132184ca" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_chacha 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_hc 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_isaac 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_jitter 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_os 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_pcg 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_xorshift 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 0.1.7", + "libc", + "rand_chacha 0.1.1", + "rand_core 0.4.2", + "rand_hc 0.1.0", + "rand_isaac", + "rand_jitter", + "rand_os", + "rand_pcg", + "rand_xorshift", + "winapi 0.3.9", ] [[package]] name = "rand" -version = "0.7.2" +version = "0.7.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a6b1679d49b24bbfe0c803429aa1874472f50d9b363131f0e89fc356b544d03" dependencies = [ - "getrandom 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_chacha 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_hc 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "getrandom", + "libc", + "rand_chacha 0.2.2", + "rand_core 0.5.1", + "rand_hc 0.2.0", ] [[package]] name = "rand_chacha" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "556d3a1ca6600bfcbab7c7c91ccb085ac7fbbcd70e008a98742e7847f4f7bcef" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 0.1.7", + "rand_core 0.3.1", ] [[package]] name = "rand_chacha" -version = "0.2.1" +version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4c8ed856279c9737206bf725bf36935d8666ead7aa69b52be55af369d193402" dependencies = [ - "c2-chacha 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", + "ppv-lite86", + "rand_core 0.5.1", ] [[package]] name = "rand_core" version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a6fdeb83b075e8266dcc8762c22776f6877a63111121f5f8c7411e5be7eed4b" dependencies = [ - "rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.4.2", ] [[package]] name = "rand_core" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9c33a3c44ca05fa6f1807d8e6743f3824e8509beca625669633be0acbdf509dc" [[package]] name = "rand_core" version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "90bde5296fc891b0cef12a6d03ddccc162ce7b2aff54160af9338f8d40df6d19" dependencies = [ - "getrandom 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", + "getrandom", ] [[package]] name = "rand_hc" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b40677c7be09ae76218dc623efbf7b18e34bced3f38883af07bb75630a21bc4" dependencies = [ - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.3.1", ] [[package]] name = "rand_hc" version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca3129af7b92a17112d59ad498c6f81eaf463253766b90396d39ea7a39d6613c" dependencies = [ - "rand_core 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.5.1", ] [[package]] name = "rand_isaac" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ded997c9d5f13925be2a6fd7e66bf1872597f759fd9dd93513dd7e92e5a5ee08" dependencies = [ - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.3.1", ] [[package]] name = "rand_jitter" version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1166d5c91dc97b88d1decc3285bb0a99ed84b05cfd0bc2341bdf2d43fc41e39b" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "rand_core 0.4.2", + "winapi 0.3.9", ] [[package]] name = "rand_os" version = "0.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b75f676a1e053fc562eafbb47838d67c84801e38fc1ba459e8f180deabd5071" dependencies = [ - "cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)", - "fuchsia-cprng 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rdrand 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cloudabi 0.0.3", + "fuchsia-cprng", + "libc", + "rand_core 0.4.2", + "rdrand", + "winapi 0.3.9", ] [[package]] name = "rand_pcg" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "abf9b09b01790cfe0364f52bf32995ea3c39f4d2dd011eac241d2914146d0b44" dependencies = [ - "autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 0.1.7", + "rand_core 0.4.2", ] [[package]] name = "rand_xorshift" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cbf7e9e623549b0e21f6e97cf8ecf247c1a8fd2e8a992ae265314300b2455d5c" dependencies = [ - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.3.1", ] [[package]] name = "rayon" -version = "1.2.0" +version = "1.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62f02856753d04e03e26929f820d0a0a337ebe71f849801eea335d464b349080" dependencies = [ - "crossbeam-deque 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", - "either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)", - "rayon-core 1.6.0 (registry+https://github.com/rust-lang/crates.io-index)", + "autocfg 1.0.0", + "crossbeam-deque", + "either", + "rayon-core", ] [[package]] name = "rayon-core" -version = "1.6.0" +version = "1.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e92e15d89083484e11353891f1af602cc661426deb9564c298b270c726973280" dependencies = [ - "crossbeam-deque 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-queue 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-deque", + "crossbeam-queue", + "crossbeam-utils 0.7.2", + "lazy_static", + "num_cpus", ] [[package]] name = "rdrand" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "678054eb77286b51581ba43620cc911abf02758c91f93f479767aed0f90458b2" dependencies = [ - "rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rand_core 0.3.1", ] [[package]] name = "redox_syscall" -version = "0.1.56" +version = "0.1.57" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "41cc0f7e4d5d4544e8861606a285bb08d3e70712ccc7d2b84d7c0ccfaf4b05ce" [[package]] name = "redox_users" -version = "0.3.1" +version = "0.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09b23093265f8d200fa7b4c2c76297f47e681c655f6f1285a8780d6a022f7431" dependencies = [ - "failure 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "rand_os 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "rust-argon2 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)", + "getrandom", + "redox_syscall", + "rust-argon2", ] [[package]] name = "regex" -version = "1.3.1" +version = "1.3.9" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9c3780fcf44b193bc4d09f36d2a3c87b251da4a046c87795a0d35f4f927ad8e6" dependencies = [ - "aho-corasick 0.7.6 (registry+https://github.com/rust-lang/crates.io-index)", - "memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "regex-syntax 0.6.12 (registry+https://github.com/rust-lang/crates.io-index)", - "thread_local 0.3.6 (registry+https://github.com/rust-lang/crates.io-index)", + "aho-corasick", + "memchr", + "regex-syntax", + "thread_local", ] [[package]] name = "regex-syntax" -version = "0.6.12" +version = "0.6.18" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26412eb97c6b088a6997e05f69403a802a92d520de2f8e63c2b65f9e0f47c4e8" [[package]] name = "remove_dir_all" -version = "0.5.2" +version = "0.5.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7" dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.3.9", ] [[package]] name = "reqwest" -version = "0.10.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "base64 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "encoding_rs 0.8.20 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "http 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "http-body 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)", - "hyper-rustls 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)", - "hyper-tls 0.4.1 (registry+https://github.com/rust-lang/crates.io-index)", - "js-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)", - "mime_guess 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)", - "native-tls 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-project-lite 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_urlencoded 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-rustls 0.13.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tls 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-futures 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "web-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", - "webpki-roots 0.18.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winreg 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", +version = "0.10.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "12427a5577082c24419c9c417db35cfeb65962efc7675bb6b0d5f1f9d315bfe6" +dependencies = [ + "base64 0.12.3", + "bytes 0.5.6", + "encoding_rs", + "futures-core", + "futures-util", + "http 0.2.1", + "http-body", + "hyper", + "hyper-rustls", + "hyper-tls", + "ipnet", + "js-sys", + "lazy_static", + "log", + "mime", + "mime_guess", + "native-tls", + "percent-encoding 2.1.0", + "pin-project-lite", + "rustls 0.18.0", + "serde", + "serde_json", + "serde_urlencoded", + "tokio", + "tokio-rustls", + "tokio-tls", + "url 2.1.1", + "wasm-bindgen", + "wasm-bindgen-futures", + "web-sys", + "webpki-roots", + "winreg 0.7.0", ] [[package]] name = "resolv-conf" -version = "0.6.2" +version = "0.6.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "11834e137f3b14e309437a8276714eed3a80d1ef894869e510f2c0c0b98b9f4a" dependencies = [ - "hostname 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "quick-error 1.2.2 (registry+https://github.com/rust-lang/crates.io-index)", + "hostname", + "quick-error", ] -[[package]] -name = "rgb" -version = "0.8.14" -source = "registry+https://github.com/rust-lang/crates.io-index" - [[package]] name = "ring" -version = "0.16.14" +version = "0.16.15" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "952cd6b98c85bbc30efa1ba5783b8abf12fec8b3287ffa52605b9432313e34e4" dependencies = [ - "cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "once_cell 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "spin 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "untrusted 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", - "web-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cc", + "libc", + "once_cell", + "spin", + "untrusted", + "web-sys", + "winapi 0.3.9", ] [[package]] name = "rle-decode-fast" version = "1.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cabe4fa914dec5870285fa7f71f602645da47c486e68486d2b4ceb4a343e90ac" [[package]] name = "rust-argon2" -version = "0.5.1" +version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2bc8af4bda8e1ff4932523b94d3dd20ee30a87232323eda55903ffd71d2fb017" dependencies = [ - "base64 0.10.1 (registry+https://github.com/rust-lang/crates.io-index)", - "blake2b_simd 0.5.8 (registry+https://github.com/rust-lang/crates.io-index)", - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", + "base64 0.11.0", + "blake2b_simd", + "constant_time_eq", + "crossbeam-utils 0.7.2", ] [[package]] name = "rustc-demangle" version = "0.1.16" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4c691c0e608126e00913e33f0ccf3727d5fc84573623b8d65b2df340b5201783" [[package]] name = "rustc_version" version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "138e3e0acb6c9fb258b19b67cb8abd63c00679d2851805ea151465464fe9030a" dependencies = [ - "semver 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", + "semver", ] [[package]] name = "rustls" version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0d4a31f5d68413404705d6982529b0e11a9aacd4839d1d6222ee3b8cb4015e1" dependencies = [ - "base64 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", - "sct 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)", - "webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)", + "base64 0.11.0", + "log", + "ring", + "sct", + "webpki", ] [[package]] -name = "rustls-native-certs" -version = "0.3.0" +name = "rustls" +version = "0.18.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cac94b333ee2aac3284c5b8a1b7fb4dd11cba88c244e3fe33cdbd047af0eb693" dependencies = [ - "openssl-probe 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)", - "schannel 0.1.16 (registry+https://github.com/rust-lang/crates.io-index)", - "security-framework 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", + "base64 0.12.3", + "log", + "ring", + "sct", + "webpki", ] [[package]] name = "rusty-fork" version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3dd93264e10c577503e926bd1430193eeb5d21b059148910082245309b424fae" dependencies = [ - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "quick-error 1.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)", - "wait-timeout 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "fnv", + "quick-error", + "tempfile", + "wait-timeout", ] [[package]] name = "ryu" -version = "1.0.0" +version = "1.0.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "71d301d4193d031abdd79ff7e3dd721168a9572ef3fe51a1517aba235bd8f86e" [[package]] name = "same-file" -version = "1.0.5" +version = "1.0.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "93fc1dc3aaa9bfed95e02e6eadabb4baf7e3078b0bd1b4d7b6b0b68378900502" dependencies = [ - "winapi-util 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi-util", ] [[package]] name = "schannel" -version = "0.1.16" +version = "0.1.19" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f05ba609c234e60bee0d547fe94a4c7e9da733d1c962cf6e59efa4cd9c8bc75" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", + "winapi 0.3.9", ] [[package]] name = "scopeguard" -version = "1.0.0" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d29ab0c6d3fc0ee92fe66e2d99f700eab17a8d57d1c1d3b748380fb20baa78cd" [[package]] name = "sct" version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3042af939fca8c3453b7af0f1c66e533a15a86169e39de2657310ade8f98d3c" dependencies = [ - "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", - "untrusted 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "security-framework" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "core-foundation 0.6.4 (registry+https://github.com/rust-lang/crates.io-index)", - "core-foundation-sys 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "security-framework-sys 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "ring", + "untrusted", ] [[package]] name = "security-framework" version = "0.4.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "64808902d7d99f78eaddd2b4e2509713babc3dc3c85ad6f4c447680f3c01e535" dependencies = [ - "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "core-foundation 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "core-foundation-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "security-framework-sys 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "security-framework-sys" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "core-foundation-sys 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", + "bitflags", + "core-foundation", + "core-foundation-sys", + "libc", + "security-framework-sys", ] [[package]] name = "security-framework-sys" version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "17bf11d99252f512695eb468de5516e5cf75455521e69dfe343f3b74e4748405" dependencies = [ - "core-foundation-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "core-foundation-sys", + "libc", ] [[package]] name = "semver" version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d7eb9ef2c18661902cc47e535f9bc51b78acd254da71d375c2f6720d9a40403" dependencies = [ - "semver-parser 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)", + "semver-parser", ] [[package]] name = "semver-parser" version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "388a1df253eca08550bef6c72392cfe7c30914bf41df5269b68cbd6ff8f570a3" [[package]] name = "serde" -version = "1.0.110" +version = "1.0.114" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5317f7588f0a5078ee60ef675ef96735a1442132dc645eb1d12c018620ed8cd3" dependencies = [ - "serde_derive 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "serde_derive", ] [[package]] name = "serde_bytes" -version = "0.11.2" +version = "0.11.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "16ae07dd2f88a366f15bd0632ba725227018c69a1c8550a927324f8eb8368bb9" dependencies = [ - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "serde", ] [[package]] name = "serde_cbor" version = "0.10.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7081ed758ec726a6ed8ee7e92f5d3f6e6f8c3901b1f972e3a4a2f2599fad14f" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "half 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", + "half", + "serde", +] + +[[package]] +name = "serde_cbor" +version = "0.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e18acfa2f90e8b735b2836ab8d538de304cbb6729a7360729ea5a895d15a622" +dependencies = [ + "half", + "serde", ] [[package]] name = "serde_derive" -version = "1.0.110" +version = "1.0.114" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2a0be94b04690fbaed37cddffc5c134bf537c8e3329d53e982fe04c374978f8e" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "serde_json" -version = "1.0.40" +version = "1.0.57" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "164eacbdb13512ec2745fb09d51fd5b22b0d65ed294a1dcf7285a360c80a675c" dependencies = [ - "itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", - "ryu 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "itoa", + "ryu", + "serde", ] [[package]] name = "serde_repr" -version = "0.1.5" +version = "0.1.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2dc6b7951b17b051f3210b063f12cc17320e2fe30ae05b0fe2a3abb068551c76" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "serde_urlencoded" version = "0.6.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ec5d77e2d4c73717816afac02670d5c4f534ea95ed430442cad02e7a6e32c97" dependencies = [ - "dtoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", - "itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "dtoa", + "itoa", + "serde", + "url 2.1.1", ] [[package]] name = "sha1" version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2579985fda508104f7587689507983eadd6a6e84dd35d6d115361f530916fa0d" [[package]] name = "sha2" -version = "0.8.0" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a256f46ea78a0c0d9ff00077504903ac881a1dafdc20da66545699e7776b3e69" dependencies = [ - "block-buffer 0.7.3 (registry+https://github.com/rust-lang/crates.io-index)", - "digest 0.8.1 (registry+https://github.com/rust-lang/crates.io-index)", - "fake-simd 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "opaque-debug 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", + "block-buffer", + "digest", + "fake-simd", + "opaque-debug", ] [[package]] name = "shell-words" version = "1.0.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6fa3938c99da4914afedd13bf3d79bcb6c277d1b2c398d23257a304d9e1b074" [[package]] name = "signal-hook" -version = "0.1.13" +version = "0.1.16" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "604508c1418b99dfe1925ca9224829bb2a8a9a04dda655cc01fcad46f4ab05ed" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "signal-hook-registry 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "signal-hook-registry", ] [[package]] name = "signal-hook-registry" -version = "1.2.0" +version = "1.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a3e12110bc539e657a646068aaf5eb5b63af9d0c1f7b29c97113fad80e15f035" dependencies = [ - "arc-swap 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "arc-swap", + "libc", ] [[package]] name = "siphasher" version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fa8f3741c7372e75519bd9346068370c9cdaabcc1f9599cbcf2a2719352286b7" [[package]] name = "slab" version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c111b5bd5695e56cffe5129854aa230b39c93a305372fdbb2668ca2394eea9f8" [[package]] name = "slog" version = "2.5.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1cc9c640a4adbfbcc11ffb95efe5aa7af7309e002adab54b185507dbf2377b99" [[package]] name = "slog-async" -version = "2.4.0" +version = "2.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51b3336ce47ce2f96673499fc07eb85e3472727b9a7a2959964b002c2ce8fbbb" dependencies = [ - "crossbeam-channel 0.3.9 (registry+https://github.com/rust-lang/crates.io-index)", - "slog 2.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "take_mut 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", - "thread_local 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-channel 0.4.3", + "slog", + "take_mut", + "thread_local", ] [[package]] name = "slog-term" -version = "2.5.0" +version = "2.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bab1d807cf71129b05ce36914e1dbb6fbfbdecaf686301cb457f4fa967f9f5b6" dependencies = [ - "atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)", - "chrono 0.4.9 (registry+https://github.com/rust-lang/crates.io-index)", - "slog 2.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "term 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)", - "thread_local 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", + "atty", + "chrono", + "slog", + "term 0.6.1", + "thread_local", ] [[package]] name = "smallvec" -version = "0.6.10" +version = "0.6.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7b0758c52e15a8b5e3691eae6cc559f08eee9406e548a4477ba4e67770a82b6" +dependencies = [ + "maybe-uninit", +] [[package]] name = "smallvec" -version = "1.1.0" +version = "1.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3757cb9d89161a2f24e1cf78efa0c1fcff485d18e3f55e0aa3480824ddaa0f3f" [[package]] name = "socket2" -version = "0.3.11" +version = "0.3.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "03088793f677dce356f3ccc2edb1b314ad191ab702a5de3faf49304f7e104918" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "libc", + "redox_syscall", + "winapi 0.3.9", ] [[package]] name = "spin" version = "0.5.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d" [[package]] name = "string" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d24114bfcceb867ca7f71a0d3fe45d45619ec47a6fbfa98cb14e14250bfa5d6d" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", ] [[package]] name = "string_cache" version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2940c75beb4e3bf3a494cef919a747a2cb81e52571e212bfbd185074add7208a" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "new_debug_unreachable 1.0.3 (registry+https://github.com/rust-lang/crates.io-index)", - "phf_shared 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)", - "precomputed-hash 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", + "new_debug_unreachable", + "phf_shared", + "precomputed-hash", + "serde", ] [[package]] name = "strsim" version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ea5119cdb4c55b55d432abb513a0429384878c15dde60cc77b1c99de1a95a6a" [[package]] name = "strsim" -version = "0.9.2" +version = "0.9.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6446ced80d6c486436db5c078dde11a9f73d42b57fb273121e160b84f63d894c" [[package]] name = "syn" version = "0.15.44" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ca4b3b69a77cbe1ffc9e198781b7acb0c7365a883670e8f1c1bc66fba79a5c5" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-xid 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 0.4.30", + "quote 0.6.13", + "unicode-xid 0.1.0", ] [[package]] name = "syn" -version = "1.0.31" +version = "1.0.38" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e69abc24912995b3038597a7a593be5053eb0fb44f3cc5beec0deb421790c1f4" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-xid 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "unicode-xid 0.2.1", ] [[package]] name = "synstructure" -version = "0.10.2" +version = "0.12.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b834f2d66f734cb897113e34aaff2f1ab4719ca946f9a7358dba8f8064148701" dependencies = [ - "proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)", - "unicode-xid 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", + "unicode-xid 0.2.1", ] [[package]] name = "sysinfo" version = "0.9.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6f4b2468c629cffba39c0a4425849ab3cdb03d9dfacba69684609aea04d08ff9" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "doc-comment 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rayon 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "doc-comment", + "libc", + "rayon", + "winapi 0.3.9", ] [[package]] name = "take_mut" version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f764005d11ee5f36500a149ace24e00e3da98b0158b3e2d53a7495660d3f4d60" [[package]] name = "tar" -version = "0.4.26" +version = "0.4.29" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8a4c1d0bee3230179544336c15eefb563cf0302955d962e456542323e8c2e8a" dependencies = [ - "filetime 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "xattr 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", + "filetime", + "libc", + "redox_syscall", + "xattr", ] [[package]] name = "tempfile" version = "3.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a6e24d9338a0a5be79593e2fa15a648add6138caa803e2d5bc782c371732ca9" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "remove_dir_all 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "libc", + "rand 0.7.3", + "redox_syscall", + "remove_dir_all", + "winapi 0.3.9", ] [[package]] name = "term" version = "0.5.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "edd106a334b7657c10b7c540a0106114feadeb4dc314513e97df481d5d966f42" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "dirs 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", + "dirs 1.0.5", + "winapi 0.3.9", ] [[package]] name = "term" version = "0.6.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0863a3345e70f61d613eab32ee046ccd1bcc5f9105fe402c61fcd0c13eeb8b5" dependencies = [ - "dirs 2.0.2 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "dirs 2.0.2", + "winapi 0.3.9", ] [[package]] name = "termcolor" -version = "1.0.5" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bb6bfa289a4d7c5766392812c0a1f4c1ba45afa1ad47803c11e1f407d846d75f" dependencies = [ - "wincolor 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi-util", ] [[package]] name = "terminal_size" -version = "0.1.12" +version = "0.1.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a14cd9f8c72704232f0bfc8455c0e861f0ad4eb60cc9ec8a170e231414c1e13" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "winapi 0.3.9", ] [[package]] name = "termios" -version = "0.3.1" +version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6f0fcee7b24a25675de40d5bb4de6e41b0df07bc9856295e7e2b3a3600c400c2" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] [[package]] name = "textwrap" version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d326610f408c7a4eb6f51c37c330e496b08506c9457c9d34287ecc38809fb060" dependencies = [ - "unicode-width 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "thread_local" -version = "0.3.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", + "unicode-width", ] [[package]] name = "thread_local" version = "1.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d40c6d1b69745a6ec6fb1ca717914848da4b44ae29d9b3080cbee91d72a69b14" dependencies = [ - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", + "lazy_static", ] [[package]] name = "threadpool" -version = "1.7.1" +version = "1.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d050e60b33d41c19108b32cea32164033a9013fe3b46cbd4457559bfbf77afaa" dependencies = [ - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", + "num_cpus", ] [[package]] name = "time" -version = "0.1.42" +version = "0.1.43" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca8a50ef2360fbd1eeb0ecd46795a87a19024eb4b53c5dc916ca1fd95fe62438" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", + "winapi 0.3.9", ] +[[package]] +name = "tinyvec" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "53953d2d3a5ad81d9f844a32f14ebb121f50b650cd59d0ee2a07cf13c617efed" + [[package]] name = "tokio" -version = "0.2.11" +version = "0.2.22" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5d34ca54d84bf2b5b4d7d31e901a8464f7b60ac145a284fba25ceb801f2ddccd" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-project-lite 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "fnv", + "futures-core", + "iovec", + "lazy_static", + "memchr", + "mio", + "num_cpus", + "pin-project-lite", + "slab", ] [[package]] name = "tokio-codec" -version = "0.1.1" +version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "25b2998660ba0e70d18684de5d06b70b70a3a747469af9dea7618cc59e75976b" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "futures", + "tokio-io", ] [[package]] name = "tokio-current-thread" -version = "0.1.6" +version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b1de0e32a83f131e002238d7ccde18211c0a5397f60cbfffcb112868c2e0e20e" dependencies = [ - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", + "futures", + "tokio-executor", ] [[package]] name = "tokio-executor" -version = "0.1.8" +version = "0.1.10" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fb2d1b8f4548dbf5e1f7818512e9c406860678f29c300cdf0ebac72d1a3a1671" dependencies = [ - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-utils 0.7.2", + "futures", ] [[package]] name = "tokio-io" -version = "0.1.12" +version = "0.1.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "57fc868aae093479e3131e3d165c93b1c7474109d13c90ec0dda2a1bbfff0674" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "futures", + "log", ] [[package]] name = "tokio-openssl" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "771d6246b170ae108d67d9963c23f31a579016c016d73bd4bd7d6ef0252afda7" dependencies = [ - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", + "futures", + "openssl", + "tokio-io", ] [[package]] name = "tokio-reactor" -version = "0.1.10" +version = "0.1.12" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09bc590ec4ba8ba87652da2068d150dcada2cfa2e07faae270a5e0409aa51351" dependencies = [ - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)", - "parking_lot 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-sync 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-utils 0.7.2", + "futures", + "lazy_static", + "log", + "mio", + "num_cpus", + "parking_lot 0.9.0", + "slab", + "tokio-executor", + "tokio-io", + "tokio-sync", ] [[package]] name = "tokio-rustls" -version = "0.13.1" +version = "0.14.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "228139ddd4fea3fa345a29233009635235833e52807af7ea6448ead03890d6a9" dependencies = [ - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)", + "futures-core", + "rustls 0.18.0", + "tokio", + "webpki", ] [[package]] name = "tokio-signal" -version = "0.2.7" +version = "0.2.9" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d0c34c6e548f101053321cba3da7cbb87a610b85555884c41b07da2eb91aff12" dependencies = [ - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "mio-uds 0.6.7 (registry+https://github.com/rust-lang/crates.io-index)", - "signal-hook 0.1.13 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "futures", + "libc", + "mio", + "mio-uds", + "signal-hook-registry", + "tokio-executor", + "tokio-io", + "tokio-reactor", + "winapi 0.3.9", ] [[package]] name = "tokio-sync" -version = "0.1.6" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "edfe50152bc8164fcc456dab7891fa9bf8beaf01c5ee7e1dd43a397c3cf87dee" dependencies = [ - "fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", + "fnv", + "futures", ] [[package]] name = "tokio-tcp" -version = "0.1.3" +version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "98df18ed66e3b72e742f185882a9e201892407957e45fbff8da17ae7a7c51f72" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "futures", + "iovec", + "mio", + "tokio-io", + "tokio-reactor", ] [[package]] name = "tokio-timer" -version = "0.2.11" +version = "0.2.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "93044f2d313c95ff1cb7809ce9a7a05735b012288a888b62d4434fd58c94f296" dependencies = [ - "crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", + "crossbeam-utils 0.7.2", + "futures", + "slab", + "tokio-executor", ] [[package]] name = "tokio-tls" -version = "0.3.0" +version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a70f4fcd7b3b24fb194f837560168208f669ca8cb70d0c4b862944452396343" dependencies = [ - "native-tls 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "native-tls", + "tokio", ] [[package]] name = "tokio-udp" -version = "0.1.5" +version = "0.1.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2a0b10e610b39c38b031a2fcab08e4b82f16ece36504988dcbd81dbba650d82" dependencies = [ - "bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-codec 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.4.12", + "futures", + "log", + "mio", + "tokio-codec", + "tokio-io", + "tokio-reactor", ] [[package]] name = "tokio-util" -version = "0.2.0" +version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be8242891f2b6cbef26a2d7e8605133c2c554cd35b3e4948ea892d6d68436499" dependencies = [ - "bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures-sink 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "pin-project-lite 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", + "bytes 0.5.6", + "futures-core", + "futures-sink", + "log", + "pin-project-lite", + "tokio", ] [[package]] name = "toml" -version = "0.5.5" +version = "0.5.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffc92d160b1eef40665be3a05630d003936a3bc7da7421277846c2613e92c71a" dependencies = [ - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", + "serde", ] [[package]] name = "tower-service" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e987b6bf443f4b5b3b6f38704195592cca41c5bb7aedd3c3693c7081f8289860" + +[[package]] +name = "tracing" +version = "0.1.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f0aae59226cf195d8e74d4b34beae1859257efb4e5fed3f147d2dc2c7d372178" +dependencies = [ + "cfg-if", + "log", + "tracing-core", +] + +[[package]] +name = "tracing-core" +version = "0.1.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d593f98af59ebc017c0648f0117525db358745a8894a8d684e185ba3f45954f9" +dependencies = [ + "lazy_static", +] [[package]] name = "treeline" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a7f741b240f1a48843f9b8e0444fb55fb2a4ff67293b50a9179dfd5ea67f8d41" [[package]] name = "trust-dns-proto" version = "0.7.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5559ebdf6c2368ddd11e20b11d6bbaf9e46deb803acd7815e93f5a7b4a6d2901" dependencies = [ - "byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)", - "enum-as-inner 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "failure 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "rand 0.6.5 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", - "socket2 0.3.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-udp 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "url 1.7.2 (registry+https://github.com/rust-lang/crates.io-index)", + "byteorder", + "enum-as-inner", + "failure", + "futures", + "idna 0.1.5", + "lazy_static", + "log", + "rand 0.6.5", + "smallvec 0.6.13", + "socket2", + "tokio-executor", + "tokio-io", + "tokio-reactor", + "tokio-tcp", + "tokio-timer", + "tokio-udp", + "url 1.7.2", ] [[package]] name = "trust-dns-resolver" version = "0.11.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6c9992e58dba365798803c0b91018ff6c8d3fc77e06977c4539af2a6bfe0a039" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "failure 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)", - "ipconfig 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "lru-cache 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)", - "resolv-conf 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)", - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", - "tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "trust-dns-proto 0.7.4 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "failure", + "futures", + "ipconfig", + "lazy_static", + "log", + "lru-cache", + "resolv-conf", + "smallvec 0.6.13", + "tokio-executor", + "trust-dns-proto", ] [[package]] name = "try-lock" -version = "0.2.2" +version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642" [[package]] name = "typed-arena" version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0685c84d5d54d1c26f7d3eb96cd41550adb97baed141a761cf335d3d33bcd0ae" [[package]] name = "typenum" -version = "1.11.2" +version = "1.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "373c8a200f9e67a0c95e62a4f52fbf80c23b4381c05a17845531982fa99e6b33" [[package]] name = "unicase" -version = "2.5.1" +version = "2.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50f37be617794602aabbeee0be4f259dc1778fabe05e2d67ee8f79326d5cb4f6" dependencies = [ - "version_check 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "version_check 0.9.2", ] [[package]] name = "unicode-bidi" version = "0.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "49f2bd0c6468a8230e1db229cff8029217cf623c767ea5d60bfbd42729ea54d5" dependencies = [ - "matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", + "matches", ] [[package]] name = "unicode-normalization" -version = "0.1.8" +version = "0.1.13" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6fb19cf769fa8c6a80a162df694621ebeb4dafb606470b2b2fce0be40a98a977" dependencies = [ - "smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)", + "tinyvec", ] [[package]] name = "unicode-width" -version = "0.1.6" +version = "0.1.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9337591893a19b88d8d87f2cec1e73fad5cdfd10e5a6f349f498ad6ea2ffb1e3" [[package]] name = "unicode-xid" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fc72304796d0818e357ead4e000d19c9c174ab23dc11093ac919054d20a6a7fc" [[package]] name = "unicode-xid" -version = "0.2.0" +version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7fe0bb3479651439c9112f72b6c505038574c9fbb575ed1bf3b797fa39dd564" [[package]] name = "untrusted" version = "0.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a" [[package]] name = "url" version = "1.7.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd4e7c0d531266369519a4aa4f399d748bd37043b00bde1e4ff1f60a120b355a" dependencies = [ - "idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", - "matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)", + "idna 0.1.5", + "matches", + "percent-encoding 1.0.1", ] [[package]] name = "url" -version = "2.1.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "829d4a8476c35c9bf0bbce5a3b23f4106f79728039b726d292bb93bc106787cb" dependencies = [ - "idna 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)", - "matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)", - "percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)", + "idna 0.2.0", + "matches", + "percent-encoding 2.1.0", ] [[package]] name = "v_escape" version = "0.7.4" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "660b101c07b5d0863deb9e7fb3138777e858d6d2a79f9e6049a27d1cc77c6da6" dependencies = [ - "v_escape_derive 0.5.6 (registry+https://github.com/rust-lang/crates.io-index)", + "v_escape_derive", ] [[package]] name = "v_escape_derive" version = "0.5.6" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2ca2a14bc3fc5b64d188b087a7d3a927df87b152e941ccfbc66672e20c467ae" dependencies = [ - "nom 4.2.3 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", + "nom", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", ] [[package]] name = "v_htmlescape" version = "0.4.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e33e939c0d8cf047514fb6ba7d5aac78bc56677a6938b2ee67000b91f2e97e41" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "v_escape 0.7.4 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "v_escape", ] [[package]] name = "vcpkg" -version = "0.2.7" +version = "0.2.10" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6454029bf181f092ad1b853286f23e2c507d8e8194d01d92da4a55c274a5508c" [[package]] name = "vec_map" -version = "0.8.1" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f1bddf1187be692e79c5ffeab891132dfb0f236ed36a43c7ed39f1165ee20191" [[package]] name = "version_check" version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "914b1a6776c4c929a602fafd8bc742e06365d4bcbe48c30f9cca5824f70dc9dd" + +[[package]] +name = "version_check" +version = "0.9.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b5a972e5669d67ba988ce3dc826706fb0a8b01471c088cb0b6110b805cc36aed" [[package]] name = "wait-timeout" version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9f200f5b12eb75f8c1ed65abd4b2db8a6e1b138a20de009dacee265a2498f3f6" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", + "libc", ] [[package]] name = "walkdir" -version = "2.2.9" +version = "2.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "777182bc735b6424e1a57516d35ed72cb8019d85c8c9bf536dccb3445c1a2f7d" dependencies = [ - "same-file 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-util 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", + "same-file", + "winapi 0.3.9", + "winapi-util", ] [[package]] name = "want" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" dependencies = [ - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "try-lock 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)", + "log", + "try-lock", ] [[package]] name = "wasi" -version = "0.7.0" +version = "0.9.0+wasi-snapshot-preview1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cccddf32554fecc6acb585f82a32a72e28b48f8c4c1883ddfeeeaa96f7d8e519" [[package]] name = "wasm-bindgen" -version = "0.2.63" +version = "0.2.67" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f0563a9a4b071746dd5aedbc3a28c6fe9be4586fb3fbadb67c400d4f53c6b16c" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)", - "serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-macro 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "serde", + "serde_json", + "wasm-bindgen-macro", ] [[package]] name = "wasm-bindgen-backend" -version = "0.2.63" +version = "0.2.67" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc71e4c5efa60fb9e74160e89b93353bc24059999c0ae0fb03affc39770310b0" dependencies = [ - "bumpalo 3.2.1 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)", - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-shared 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "bumpalo", + "lazy_static", + "log", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", + "wasm-bindgen-shared", ] [[package]] name = "wasm-bindgen-futures" -version = "0.4.8" +version = "0.4.17" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "95f8d235a77f880bcef268d379810ea6c0af2eacfa90b1ad5af731776e0c4699" dependencies = [ - "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)", - "js-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", - "web-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", + "cfg-if", + "js-sys", + "wasm-bindgen", + "web-sys", ] [[package]] name = "wasm-bindgen-macro" -version = "0.2.63" +version = "0.2.67" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97c57cefa5fa80e2ba15641578b44d36e7a64279bc5ed43c6dbaf329457a2ed2" dependencies = [ - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-macro-support 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "quote 1.0.7", + "wasm-bindgen-macro-support", ] [[package]] name = "wasm-bindgen-macro-support" -version = "0.2.63" +version = "0.2.67" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "841a6d1c35c6f596ccea1f82504a192a60378f64b3bb0261904ad8f2f5657556" dependencies = [ - "proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)", - "quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)", - "syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-backend 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen-shared 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "proc-macro2 1.0.19", + "quote 1.0.7", + "syn 1.0.38", + "wasm-bindgen-backend", + "wasm-bindgen-shared", ] [[package]] name = "wasm-bindgen-shared" -version = "0.2.63" +version = "0.2.67" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "93b162580e34310e5931c4b792560108b10fd14d64915d7fff8ff00180e70092" [[package]] name = "wasmparser" -version = "0.45.0" +version = "0.45.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b4eab1d9971d0803729cba3617b56eb04fcb4bd25361cb63880ed41a42f20d5" [[package]] name = "web-sys" -version = "0.3.40" +version = "0.3.44" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dda38f4e5ca63eda02c059d243aa25b5f35ab98451e518c51612cd0f1bd19a47" dependencies = [ - "js-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)", - "wasm-bindgen 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)", + "js-sys", + "wasm-bindgen", ] [[package]] name = "webpki" version = "0.21.3" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ab146130f5f790d45f82aeeb09e55a256573373ec64409fc19a6fb82fb1032ae" dependencies = [ - "ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)", - "untrusted 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "webpki-roots" -version = "0.18.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)", + "ring", + "untrusted", ] [[package]] name = "webpki-roots" version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f8eff4b7516a57307f9349c64bf34caa34b940b66fed4b2fb3136cb7386e5739" dependencies = [ - "webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)", + "webpki", ] [[package]] name = "widestring" -version = "0.4.0" +version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a763e303c0e0f23b0da40888724762e802a8ffefbc22de4127ef42493c2ea68c" [[package]] name = "winapi" version = "0.2.8" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "167dc9d6949a9b857f3451275e911c3f44255842c1f7a76f33c55103a909087a" [[package]] name = "winapi" -version = "0.3.8" +version = "0.3.9" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" dependencies = [ - "winapi-i686-pc-windows-gnu 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-x86_64-pc-windows-gnu 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi-i686-pc-windows-gnu", + "winapi-x86_64-pc-windows-gnu", ] [[package]] name = "winapi-build" version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2d315eee3b34aca4797b2da6b13ed88266e6d612562a0c46390af8299fc699bc" [[package]] name = "winapi-i686-pc-windows-gnu" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" [[package]] name = "winapi-util" version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178" dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.3.9", ] [[package]] name = "winapi-x86_64-pc-windows-gnu" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" - -[[package]] -name = "wincolor" -version = "1.0.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-util 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[[package]] -name = "winconsole" -version = "0.10.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -dependencies = [ - "cgmath 0.16.1 (registry+https://github.com/rust-lang/crates.io-index)", - "lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)", - "rgb 0.8.14 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", -] +checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" [[package]] name = "winreg" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2986deb581c4fe11b621998a5e53361efe6b48a151178d0cd9eeffa4dc6acc9" dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.3.9", ] [[package]] -name = "winutil" -version = "0.1.1" +name = "winreg" +version = "0.7.0" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0120db82e8a1e0b9fb3345a539c478767c0048d842860994d96113d5b667bd69" dependencies = [ - "winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.3.9", ] [[package]] name = "ws2_32-sys" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d59cefebd0c892fa2dd6de581e937301d8552cb44489cdff035c6187cb63fa5e" dependencies = [ - "winapi 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)", - "winapi-build 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)", + "winapi 0.2.8", + "winapi-build", ] [[package]] name = "xattr" version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "244c3741f4240ef46274860397c7c74e50eb23624996930e484c16679633a54c" dependencies = [ - "libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)", -] - -[metadata] -"checksum actix 0.8.3 (registry+https://github.com/rust-lang/crates.io-index)" = "671ce3d27313f236827a5dd153a1073ad03ef31fc77f562020263e7830cf1ef7" -"checksum actix-codec 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "9f2c11af4b06dc935d8e1b1491dad56bfb32febc49096a91e773f8535c176453" -"checksum actix-connect 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)" = "9fade9bd4bb46bacde89f1e726c7a3dd230536092712f5d94d77ca57c087fca0" -"checksum actix-cors 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "66e5b071c68ac8ab182e7b7717167ef29ea93e166bc26391f678f19ac08ed129" -"checksum actix-files 0.1.7 (registry+https://github.com/rust-lang/crates.io-index)" = "f1ee66089e3453334aac7e96ed10c48b6659f21f407826b92014c8097e4c0511" -"checksum actix-http 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)" = "fcb50f77cd28240d344fd54afd205bae8760a3b0ad448b1716a2aa31e24db139" -"checksum actix-router 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "23224bb527e204261d0291102cb9b52713084def67d94f7874923baefe04ccf7" -"checksum actix-rt 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)" = "168620aaf00fcd2a16e621790abaf180ef7377c2f8355b4ca5775d6afc778ed8" -"checksum actix-server 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)" = "dd626534af8d0a738e5f74901fe603af0445708f91b86a7d763d80df10d562a5" -"checksum actix-server-config 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "483a34989c682d93142bacad6300375bb6ad8002d2e0bb249dbad86128b9ff30" -"checksum actix-service 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)" = "bca5b48e928841ff7e7dce1fdb5b0d4582f6b1b976e08f4bac3f640643e0773f" -"checksum actix-testing 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "af001e97ac6750994824d400a1b7087055aab14317aa012f528d0b2b363f37f1" -"checksum actix-threadpool 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6b5ae85d13da7e6fb86b1b7bc83185e0e3bd4cc5f421c887e1803796c034d35d" -"checksum actix-utils 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)" = "6ea501068a0173533704be321f149853f702d9e3c3ce9d57e7a96d94b1ab5aca" -"checksum actix-web 1.0.9 (registry+https://github.com/rust-lang/crates.io-index)" = "af3a1b967cdbacb903c4b9ae71257a7f098d881b25eb483d0c468b7dac579b03" -"checksum actix-web-codegen 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)" = "068a33520e21c1eea89726be4d6b3ce2e6b81046904367e1677287695a043abb" -"checksum actix_derive 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0bf5f6d7bf2d220ae8b4a7ae02a572bb35b7c4806b24049af905ab8110de156c" -"checksum adler32 1.0.4 (registry+https://github.com/rust-lang/crates.io-index)" = "5d2e7343e7fc9de883d1b0341e0b13970f764c14101234857d2ddafa1cb1cac2" -"checksum ahash 0.2.18 (registry+https://github.com/rust-lang/crates.io-index)" = "6f33b5018f120946c1dcf279194f238a9f146725593ead1c08fa47ff22b0b5d3" -"checksum aho-corasick 0.7.6 (registry+https://github.com/rust-lang/crates.io-index)" = "58fb5e95d83b38284460a5fda7d6470aa0b8844d283a0b614b8535e880800d2d" -"checksum ansi_term 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ee49baf6cb617b853aa8d93bf420db2383fab46d314482ca2803b40d5fde979b" -"checksum approx 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "08abcc3b4e9339e33a3d0a5ed15d84a687350c05689d825e0f6655eef9e76a94" -"checksum arc-swap 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)" = "f1a1eca3195b729bbd64e292ef2f5fff6b1c28504fed762ce2b1013dde4d8e92" -"checksum arrayref 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "0d382e583f07208808f6b1249e60848879ba3543f57c32277bf52d69c2f0f0ee" -"checksum arrayvec 0.4.11 (registry+https://github.com/rust-lang/crates.io-index)" = "b8d73f9beda665eaa98ab9e4f7442bd4e7de6652587de55b2525e52e29c1b0ba" -"checksum arrayvec 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cff77d8686867eceff3105329d4698d96c2391c176d5d03adc90c7389162b5b8" -"checksum ascii-canvas 2.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ff8eb72df928aafb99fe5d37b383f2fe25bd2a765e3e5f7c365916b6f2463a29" -"checksum assert-json-diff 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "32946b6d31d50d0e35896c864907f9cb7e47b52bd875fa3c058618601cfdefb1" -"checksum async-trait 0.1.35 (registry+https://github.com/rust-lang/crates.io-index)" = "89cb5d814ab2a47fd66d3266e9efccb53ca4c740b7451043b8ffcf9a6208f3f8" -"checksum atty 0.2.13 (registry+https://github.com/rust-lang/crates.io-index)" = "1803c647a3ec87095e7ae7acfca019e98de5ec9a7d01343f611cf3152ed71a90" -"checksum autocfg 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "b671c8fb71b457dd4ae18c4ba1e59aa81793daacc361d82fcd410cef0d491875" -"checksum autocfg 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "f8aac770f1885fd7e387acedd76065302551364496e46b3dd00860b2f8359b9d" -"checksum awc 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)" = "5e995283278dd3bf0449e7534e77184adb1570c0de8b6a50bf7c9d01ad8db8c4" -"checksum backtrace 0.3.38 (registry+https://github.com/rust-lang/crates.io-index)" = "690a62be8920ccf773ee00ef0968649b0e724cda8bd5b12286302b4ae955fdf5" -"checksum backtrace-sys 0.1.31 (registry+https://github.com/rust-lang/crates.io-index)" = "82a830b4ef2d1124a711c71d263c5abdc710ef8e907bd508c88be475cebc422b" -"checksum base32 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "23ce669cd6c8588f79e15cf450314f9638f967fc5770ff1c7c1deb0925ea7cfa" -"checksum base64 0.10.1 (registry+https://github.com/rust-lang/crates.io-index)" = "0b25d992356d2eb0ed82172f5248873db5560c4721f564b13cb5193bda5e668e" -"checksum base64 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b41b7ea54a0c9d92199de89e20e58d49f02f8e699814ef3fdf266f6f748d15c7" -"checksum bit-set 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "e84c238982c4b1e1ee668d136c510c67a13465279c0cb367ea6baf6310620a80" -"checksum bit-vec 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "f59bbe95d4e52a6398ec21238d31577f2b28a9d86807f06ca59d191d8440d0bb" -"checksum bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693" -"checksum blake2b_simd 0.5.8 (registry+https://github.com/rust-lang/crates.io-index)" = "5850aeee1552f495dd0250014cf64b82b7c8879a89d83b33bbdace2cc4f63182" -"checksum block-buffer 0.7.3 (registry+https://github.com/rust-lang/crates.io-index)" = "c0940dc441f31689269e10ac70eb1002a3a1d3ad1390e030043662eb7fe4688b" -"checksum block-padding 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "6d4dc3af3ee2e12f3e5d224e5e1e3d73668abbeb69e566d361f7d5563a4fdf09" -"checksum brotli-sys 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)" = "4445dea95f4c2b41cde57cc9fee236ae4dbae88d8fcbdb4750fc1bb5d86aaecd" -"checksum brotli2 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)" = "0cb036c3eade309815c15ddbacec5b22c4d1f3983a774ab2eac2e3e9ea85568e" -"checksum bumpalo 3.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "12ae9db68ad7fac5fe51304d20f016c911539251075a214f8e663babefa35187" -"checksum byte-tools 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "e3b5ca7a04898ad4bcd41c90c5285445ff5b791899bb1b0abdd2a2aa791211d7" -"checksum byteorder 1.3.2 (registry+https://github.com/rust-lang/crates.io-index)" = "a7c3dd8985a7111efc5c80b44e23ecdd8c007de8ade3b96595387e812b957cf5" -"checksum bytes 0.4.12 (registry+https://github.com/rust-lang/crates.io-index)" = "206fdffcfa2df7cbe15601ef46c813fce0965eb3286db6b56c583b814b51c81c" -"checksum bytes 0.5.4 (registry+https://github.com/rust-lang/crates.io-index)" = "130aac562c0dd69c56b3b1cc8ffd2e17be31d0b6c25b61c96b76231aa23e39e1" -"checksum c2-chacha 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "7d64d04786e0f528460fc884753cf8dddcc466be308f6026f8e355c41a0e4101" -"checksum candid 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "2abe09120c9838a3e3cc60c1f3b16b25a1b6208f3bf2d91bf9dd0aef0904f5ed" -"checksum candid_derive 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a51d65ed24b5b03624aefc86967af49039882d63161a67aef0dd4306f7251330" -"checksum cc 1.0.54 (registry+https://github.com/rust-lang/crates.io-index)" = "7bbb73db36c1246e9034e307d0fba23f9a2e251faa47ade70c1bd252220c8311" -"checksum cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)" = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822" -"checksum cgmath 0.16.1 (registry+https://github.com/rust-lang/crates.io-index)" = "64a4b57c8f4e3a2e9ac07e0f6abc9c24b6fc9e1b54c3478cfb598f3d0023e51c" -"checksum chrono 0.4.9 (registry+https://github.com/rust-lang/crates.io-index)" = "e8493056968583b0193c1bb04d6f7684586f3726992d6c573261941a895dbd68" -"checksum clap 2.33.0 (registry+https://github.com/rust-lang/crates.io-index)" = "5067f5bb2d80ef5d68b4c87db81601f0b75bca627bc2ef76b141d7b846a3c6d9" -"checksum clicolors-control 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "90082ee5dcdd64dc4e9e0d37fbf3ee325419e39c0092191e0393df65518f741e" -"checksum cloudabi 0.0.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ddfc5b9aa5d4507acaf872de71051dfd0e309860e88966e1051e462a077aac4f" -"checksum colored 1.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "6cdb90b60f2927f8d76139c72dbde7e10c3a2bc47c8594c9c7a66529f2687c03" -"checksum console 0.11.3 (registry+https://github.com/rust-lang/crates.io-index)" = "8c0994e656bba7b922d8dd1245db90672ffb701e684e45be58f20719d69abc5a" -"checksum console 0.7.7 (registry+https://github.com/rust-lang/crates.io-index)" = "8ca57c2c14b8a2bf3105bc9d15574aad80babf6a9c44b1058034cdf8bd169628" -"checksum const-random 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "7b641a8c9867e341f3295564203b1c250eb8ce6cb6126e007941f78c4d2ed7fe" -"checksum const-random-macro 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "c750ec12b83377637110d5a57f5ae08e895b06c4b16e2bdbf1a94ef717428c59" -"checksum constant_time_eq 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "995a44c877f9212528ccc74b21a232f66ad69001e40ede5bcee2ac9ef2657120" -"checksum copyless 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "6ff9c56c9fb2a49c05ef0e431485a22400af20d33226dc0764d891d09e724127" -"checksum core-foundation 0.6.4 (registry+https://github.com/rust-lang/crates.io-index)" = "25b9e03f145fd4f2bf705e07b900cd41fc636598fe5dc452fd0db1441c3f496d" -"checksum core-foundation 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "57d24c7a13c43e870e37c1556b74555437870a04514f7685f5b354e090567171" -"checksum core-foundation-sys 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "e7ca8a5221364ef15ce201e8ed2f609fc312682a8f4e0e3d4aa5879764e0fa3b" -"checksum core-foundation-sys 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b3a71ab494c0b5b860bdc8407ae08978052417070c2ced38573a9157ad75b8ac" -"checksum crc32fast 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ba125de2af0df55319f41944744ad91c71113bf74a4646efff39afe1f6842db1" -"checksum crossbeam 0.7.3 (registry+https://github.com/rust-lang/crates.io-index)" = "69323bff1fb41c635347b8ead484a5ca6c3f11914d784170b158d8449ab07f8e" -"checksum crossbeam-channel 0.3.9 (registry+https://github.com/rust-lang/crates.io-index)" = "c8ec7fcd21571dc78f96cc96243cab8d8f035247c3efd16c687be154c3fa9efa" -"checksum crossbeam-channel 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "acec9a3b0b3559f15aee4f90746c4e5e293b701c0f7d3925d24e01645267b68c" -"checksum crossbeam-deque 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "b18cd2e169ad86297e6bc0ad9aa679aee9daa4f19e8163860faf7c164e4f5a71" -"checksum crossbeam-epoch 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)" = "fedcd6772e37f3da2a9af9bf12ebe046c0dfe657992377b4df982a2b54cd37a9" -"checksum crossbeam-epoch 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "5064ebdbf05ce3cb95e45c8b086f72263f4166b29b97f6baff7ef7fe047b55ac" -"checksum crossbeam-queue 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "7c979cd6cfe72335896575c6b5688da489e420d36a27a0b9eb0c73db574b4a4b" -"checksum crossbeam-queue 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "dfd6515864a82d2f877b42813d4553292c6659498c9a2aa31bab5a15243c2700" -"checksum crossbeam-utils 0.6.6 (registry+https://github.com/rust-lang/crates.io-index)" = "04973fa96e96579258a5091af6003abde64af786b860f18622b82e026cca60e6" -"checksum crossbeam-utils 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ce446db02cdc3165b94ae73111e570793400d0794e46125cc4056c81cbb039f4" -"checksum ct-logs 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "4d3686f5fa27dbc1d76c751300376e167c5a43387f44bb451fd1c24776e49113" -"checksum delay 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "c268ae069c316c344d2d4b057003322acf1a166b372af238423df65459258f5b" -"checksum derivative 2.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cb582b60359da160a9477ee80f15c8d784c477e69c217ef2cdd4169c24ea380f" -"checksum derive_more 0.14.1 (registry+https://github.com/rust-lang/crates.io-index)" = "6d944ac6003ed268757ef1ee686753b57efc5fcf0ebe7b64c9fc81e7e32ff839" -"checksum derive_more 0.15.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7a141330240c921ec6d074a3e188a7c7ef95668bb95e7d44fa0e5778ec2a7afe" -"checksum dialoguer 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "f4aa86af7b19b40ef9cbef761ed411a49f0afa06b7b6dcd3dfe2f96a3c546138" -"checksum diff 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "0e25ea47919b1560c4e3b7fe0aaab9becf5b84a10325ddf7db0f0ba5e1026499" -"checksum difference 2.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "524cbf6897b527295dff137cec09ecf3a05f4fddffd7dfcd1585403449e74198" -"checksum digest 0.8.1 (registry+https://github.com/rust-lang/crates.io-index)" = "f3d0c8c8752312f9713efd397ff63acb9f85585afbf179282e720e7704954dd5" -"checksum dirs 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)" = "3fd78930633bd1c6e35c4b42b1df7b0cbc6bc191146e512bb3bedf243fcc3901" -"checksum dirs 2.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "13aea89a5c93364a98e9b37b2fa237effbb694d5cfe01c5b70941f7eb087d5e3" -"checksum dirs-sys 0.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "afa0b23de8fd801745c471deffa6e12d248f962c9fd4b4c33787b055599bde7b" -"checksum doc-comment 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "923dea538cea0aa3025e8685b20d6ee21ef99c4f77e954a30febbaac5ec73a97" -"checksum docopt 1.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7f525a586d310c87df72ebcd98009e57f1cc030c8c268305287a476beb653969" -"checksum downcast 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "4bb454f0228b18c7f4c3b0ebbee346ed9c52e7443b0999cd543ff3571205701d" -"checksum dtoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)" = "ea57b42383d091c85abcc2706240b94ab2a8fa1fc81c10ff23c4de06e2a90b5e" -"checksum either 1.5.3 (registry+https://github.com/rust-lang/crates.io-index)" = "bb1f6b1ce1c140482ea30ddd3335fc0024ac7ee112895426e0a629a6c20adfe3" -"checksum ena 0.14.0 (registry+https://github.com/rust-lang/crates.io-index)" = "d7402b94a93c24e742487327a7cd839dc9d36fec9de9fb25b09f2dae459f36c3" -"checksum encode_unicode 0.3.6 (registry+https://github.com/rust-lang/crates.io-index)" = "a357d28ed41a50f9c765dbfe56cbc04a64e53e5fc58ba79fbc34c10ef3df831f" -"checksum encoding_rs 0.8.20 (registry+https://github.com/rust-lang/crates.io-index)" = "87240518927716f79692c2ed85bfe6e98196d18c6401ec75355760233a7e12e9" -"checksum enum-as-inner 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "3d58266c97445680766be408285e798d3401c6d4c378ec5552e78737e681e37d" -"checksum env_logger 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "aafcde04e90a5226a6443b7aabdb016ba2f8307c847d524724bd9b346dd1a2d3" -"checksum erased-serde 0.3.10 (registry+https://github.com/rust-lang/crates.io-index)" = "cd7d80305c9bd8cd78e3c753eb9fb110f83621e5211f1a3afffcc812b104daf9" -"checksum failure 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "795bd83d3abeb9220f257e597aa0080a508b27533824adf336529648f6abf7e2" -"checksum failure_derive 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "ea1063915fd7ef4309e222a5a07cf9c319fb9c7836b1f89b85458672dbb127e1" -"checksum fake-simd 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "e88a8acf291dafb59c2d96e8f59828f3838bb1a70398823ade51a84de6a6deed" -"checksum filetime 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)" = "6bd7380b54ced79dda72ecc35cc4fbbd1da6bba54afaa37e96fd1c2a308cd469" -"checksum fixedbitset 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d" -"checksum flate2 1.0.13 (registry+https://github.com/rust-lang/crates.io-index)" = "6bd6d6f4752952feb71363cffc9ebac9411b75b87c6ab6058c40c8900cf43c0f" -"checksum float-cmp 0.5.3 (registry+https://github.com/rust-lang/crates.io-index)" = "75224bec9bfe1a65e2d34132933f2de7fe79900c96a0174307554244ece8150e" -"checksum fnv 1.0.6 (registry+https://github.com/rust-lang/crates.io-index)" = "2fad85553e09a6f881f739c29f0b00b0f01357c743266d478b68951ce23285f3" -"checksum foreign-types 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)" = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1" -"checksum foreign-types-shared 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" -"checksum fragile 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "05f8140122fa0d5dcb9fc8627cfce2b37cc1500f752636d46ea28bc26785c2f9" -"checksum fsevent 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "5ab7d1bd1bd33cc98b0889831b72da23c0aa4df9cec7e0702f46ecea04b35db6" -"checksum fsevent-sys 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "f41b048a94555da0f42f1d632e2e19510084fb8e303b0daa2816e733fb3644a0" -"checksum fuchsia-cprng 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "a06f77d526c1a601b7c4cdd98f54b5eaabffc14d5f2f0296febdc7f357c6d3ba" -"checksum fuchsia-zircon 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)" = "2e9763c69ebaae630ba35f74888db465e49e259ba1bc0eda7d06f4a067615d82" -"checksum fuchsia-zircon-sys 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)" = "3dcaa9ae7725d12cdb85b3ad99a434db70b468c09ded17e012d86b5c1010f7a7" -"checksum futures 0.1.29 (registry+https://github.com/rust-lang/crates.io-index)" = "1b980f2816d6ee8673b6517b52cb0e808a180efc92e5c19d02cdda79066703ef" -"checksum futures-channel 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "f366ad74c28cca6ba456d95e6422883cfb4b252a83bed929c83abfdbbf2967d5" -"checksum futures-core 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "59f5fff90fd5d971f936ad674802482ba441b6f09ba5e15fd8b39145582ca399" -"checksum futures-io 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "de27142b013a8e869c14957e6d2edeef89e97c289e69d042ee3a49acd8b51789" -"checksum futures-macro 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "d0b5a30a4328ab5473878237c447333c093297bded83a4983d10f4deea240d39" -"checksum futures-sink 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "3f2032893cb734c7a05d85ce0cc8b8c4075278e93b24b66f9de99d6eb0fa8acc" -"checksum futures-task 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "bdb66b5f09e22019b1ab0830f7785bcea8e7a42148683f99214f73f8ec21a626" -"checksum futures-util 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "8764574ff08b701a084482c3c7031349104b07ac897393010494beaa18ce32c6" -"checksum generic-array 0.12.3 (registry+https://github.com/rust-lang/crates.io-index)" = "c68f0274ae0e023facc3c97b2e00f076be70e254bc851d972503b328db79b2ec" -"checksum getrandom 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "473a1265acc8ff1e808cd0a1af8cee3c2ee5200916058a2ca113c29f2d903571" -"checksum h2 0.1.26 (registry+https://github.com/rust-lang/crates.io-index)" = "a5b34c246847f938a410a03c5458c7fee2274436675e76d8b903c08efc29c462" -"checksum h2 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "7938e6aa2a31df4e21f224dc84704bd31c089a6d1355c535b03667371cccc843" -"checksum half 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "9353c2a89d550b58fa0061d8ed8d002a7d8cdf2494eb0e432859bd3a9e543836" -"checksum hashbrown 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "29fba9abe4742d586dfd0c06ae4f7e73a1c2d86b856933509b269d82cdf06e18" -"checksum hashbrown 0.6.3 (registry+https://github.com/rust-lang/crates.io-index)" = "8e6073d0ca812575946eb5f35ff68dbe519907b25c42530389ff946dc84c6ead" -"checksum hermit-abi 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "eff2656d88f158ce120947499e971d743c05dbcbed62e5bd2f38f1698bbc3772" -"checksum hex 0.3.2 (registry+https://github.com/rust-lang/crates.io-index)" = "805026a5d0141ffc30abb3be3173848ad46a1b1664fe632428479619a3644d77" -"checksum hex 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "023b39be39e3a2da62a94feb433e91e8bcd37676fbc8bea371daf52b7a769a3e" -"checksum hostname 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "21ceb46a83a85e824ef93669c8b390009623863b5c195d1ba747292c0c72f94e" -"checksum hotwatch 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ba0add391e9cd7d19c29024617a44df79c867ab003bce7f3224c1636595ec740" -"checksum http 0.1.21 (registry+https://github.com/rust-lang/crates.io-index)" = "d6ccf5ede3a895d8856620237b2f02972c1bbc78d2965ad7fe8838d4a0ed41f0" -"checksum http 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b708cc7f06493459026f53b9a61a7a121a5d1ec6238dee58ea4941132b30156b" -"checksum http-body 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "13d5ff830006f7646652e057693569bfe0d51760c0085a071769d142a205111b" -"checksum httparse 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "cd179ae861f0c2e53da70d892f5f3029f9594be0c41dc5269cd371691b1dc2f9" -"checksum humantime 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "df004cfca50ef23c36850aaaa59ad52cc70d0e90243c3c7737a4dd32dc7a3c4f" -"checksum hyper 0.13.4 (registry+https://github.com/rust-lang/crates.io-index)" = "ed6081100e960d9d74734659ffc9cc91daf1c0fc7aceb8eaa94ee1a3f5046f2e" -"checksum hyper-rustls 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ac965ea399ec3a25ac7d13b8affd4b8f39325cca00858ddf5eb29b79e6b14b08" -"checksum hyper-tls 0.4.1 (registry+https://github.com/rust-lang/crates.io-index)" = "3adcd308402b9553630734e9c36b77a7e48b3821251ca2493e8cd596763aafaa" -"checksum ic-agent 0.6.0 (git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.0)" = "" -"checksum idna 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "38f09e0f0b1fb55fdee1f17470ad800da77af5186a1a76c026b679358b7e844e" -"checksum idna 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "02e2673c30ee86b5b96a9cb52ad15718aa1f966f5ab9ad54a8b95d5ca33120a9" -"checksum indexmap 1.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "712d7b3ea5827fcb9d4fda14bf4da5f136f0db2ae9c8f4bd4e2d1c6fde4e6db2" -"checksum indicatif 0.13.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8572bccfb0665e70b7faf44ee28841b8e0823450cd4ad562a76b5a3c4bf48487" -"checksum inotify 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)" = "40b54539f3910d6f84fbf9a643efd6e3aa6e4f001426c0329576128255994718" -"checksum inotify-sys 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)" = "e74a1aa87c59aeff6ef2cc2fa62d41bc43f54952f55652656b18a02fd5e356c0" -"checksum iovec 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "b2b3ea6ff95e175473f8ffe6a7eb7c00d054240321b84c57051175fe3c1e075e" -"checksum ipconfig 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "aa79fa216fbe60834a9c0737d7fcd30425b32d1c58854663e24d4c4b328ed83f" -"checksum itertools 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)" = "284f18f85651fe11e8a991b2adb42cb078325c996ed026d994719efcfca1d54b" -"checksum itoa 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)" = "501266b7edd0174f8530248f87f99c88fbe60ca4ef3dd486835b8d8d53136f7f" -"checksum js-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)" = "ce10c23ad2ea25ceca0093bd3192229da4c5b3c0f2de499c1ecac0d98d452177" -"checksum kernel32-sys 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "7507624b29483431c0ba2d82aece8ca6cdba9382bff4ddd0f7490560c056098d" -"checksum lalrpop 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)" = "d6f55673d283313791404be21209bb433f128f7e5c451986df107eb5fdbd68d2" -"checksum lalrpop-util 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)" = "f7e88f15a7d31dfa8fb607986819039127f0161058a3b248a146142d276cbd28" -"checksum language-tags 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "a91d884b6667cd606bb5a69aa0c99ba811a115fc68915e7056ec08a46e93199a" -"checksum lazy-init 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "e71f2233af239a915476da8ee21a57331d82b9880c78220451ece7cb5862d313" -"checksum lazy_static 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" -"checksum lazycell 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "b294d6fa9ee409a054354afc4352b0b9ef7ca222c69b8812cbea9e7d2bf3783f" -"checksum leb128 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)" = "3576a87f2ba00f6f106fdfcd16db1d698d648a26ad8e0573cad8537c3c362d2a" -"checksum libc 0.2.71 (registry+https://github.com/rust-lang/crates.io-index)" = "9457b06509d27052635f90d6466700c65095fdf75409b3fbdd903e988b886f49" -"checksum libflate 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)" = "d9135df43b1f5d0e333385cb6e7897ecd1a43d7d11b91ac003f4d2c2d2401fdd" -"checksum linked-hash-map 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)" = "ae91b68aebc4ddb91978b11a1b02ddd8602a05ec19002801c5666000e05e0f83" -"checksum lock_api 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ed946d4529956a20f2d63ebe1b69996d5a2137c91913fe3ebbeff957f5bca7ff" -"checksum lock_api 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "f8912e782533a93a167888781b836336a6ca5da6175c05944c86cf28c31104dc" -"checksum log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "14b6052be84e6b71ab17edffc2eeabf5c2c3ae1fdb464aae35ac50c67a44e1f7" -"checksum lru-cache 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "31e24f1ad8321ca0e8a1e0ac13f23cb668e6f5466c2c57319f6a5cf1cc8e3b1c" -"checksum matches 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)" = "7ffc5c5338469d4d3ea17d269fa8ea3512ad247247c30bd2df69e68309ed0a08" -"checksum memchr 2.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "88579771288728879b57485cc7d6b07d648c9f0141eb955f8ab7f9d45394468e" -"checksum memoffset 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "ce6075db033bbbb7ee5a0bbd3a3186bbae616f57fb001c485c7ff77955f8177f" -"checksum mime 0.3.14 (registry+https://github.com/rust-lang/crates.io-index)" = "dd1d63acd1b78403cc0c325605908475dd9b9a3acbf65ed8bcab97e27014afcf" -"checksum mime_guess 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "1a0ed03949aef72dbdf3116a383d7b38b4768e6f960528cd6a6044aa9ed68599" -"checksum miniz-sys 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "1e9e3ae51cea1576ceba0dde3d484d30e6e5b86dee0b2d412fe3a16a15c98202" -"checksum miniz_oxide 0.3.5 (registry+https://github.com/rust-lang/crates.io-index)" = "6f3f74f726ae935c3f514300cc6773a0c9492abc5e972d42ba0c0ebb88757625" -"checksum mio 0.6.21 (registry+https://github.com/rust-lang/crates.io-index)" = "302dec22bcf6bae6dfb69c647187f4b4d0fb6f535521f7bc022430ce8e12008f" -"checksum mio-extras 2.0.6 (registry+https://github.com/rust-lang/crates.io-index)" = "52403fe290012ce777c4626790c8951324a2b9e3316b3143779c72b029742f19" -"checksum mio-uds 0.6.7 (registry+https://github.com/rust-lang/crates.io-index)" = "966257a94e196b11bb43aca423754d87429960a768de9414f3691d6957abf125" -"checksum miow 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "8c1f2f3b1cf331de6896aabf6e9d55dca90356cc9960cca7eaaf408a355ae919" -"checksum mockall 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b95a7e7cfbce0e99ebbf5356a085d3b5e320a7ef300f77cd50a7148aa362e7c2" -"checksum mockall_derive 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "d5a615a1ad92048ad5d9633251edb7492b8abc057d7a679a9898476aef173935" -"checksum mockito 0.20.0 (registry+https://github.com/rust-lang/crates.io-index)" = "fa3f481382a4d68c5f1d27fb567db27196630f729706003cb07a9b8330a30306" -"checksum native-tls 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "4b2df1a4c22fd44a62147fd8f13dd0f95c9d8ca7b2610299b2a2f9cf8964274e" -"checksum net2 0.2.33 (registry+https://github.com/rust-lang/crates.io-index)" = "42550d9fb7b6684a6d404d9fa7250c2eb2646df731d1c06afc06dcee9e1bcf88" -"checksum new_debug_unreachable 1.0.3 (registry+https://github.com/rust-lang/crates.io-index)" = "f40f005c60db6e03bae699e414c58bf9aa7ea02a2d0b9bfbcf19286cc4c82b30" -"checksum nodrop 0.1.13 (registry+https://github.com/rust-lang/crates.io-index)" = "2f9667ddcc6cc8a43afc9b7917599d7216aa09c463919ea32c59ed6cac8bc945" -"checksum nom 4.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "2ad2a91a8e869eeb30b9cb3119ae87773a8f4ae617f41b1eb9c154b2905f7bd6" -"checksum normalize-line-endings 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "2e0a1a39eab95caf4f5556da9289b9e68f0aafac901b2ce80daaf020d3b733a8" -"checksum notify 4.0.14 (registry+https://github.com/rust-lang/crates.io-index)" = "199628fc33b21bc767baa057490b00b382ecbae030803a7b36292422d15b778b" -"checksum num-bigint 0.2.4 (registry+https://github.com/rust-lang/crates.io-index)" = "343b3df15c945a59e72aae31e89a7cfc9e11850e96d4fde6fed5e3c7c8d9c887" -"checksum num-integer 0.1.41 (registry+https://github.com/rust-lang/crates.io-index)" = "b85e541ef8255f6cf42bbfe4ef361305c6c135d10919ecc26126c4e5ae94bc09" -"checksum num-traits 0.1.43 (registry+https://github.com/rust-lang/crates.io-index)" = "92e5113e9fd4cc14ded8e499429f396a20f98c772a47cc8622a736e1ec843c31" -"checksum num-traits 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)" = "6ba9a427cfca2be13aa6f6403b0b7e7368fe982bfa16fccc450ce74c46cd9b32" -"checksum num_cpus 1.11.1 (registry+https://github.com/rust-lang/crates.io-index)" = "76dac5ed2a876980778b8b85f75a71b6cbf0db0b1232ee12f826bccb00d09d72" -"checksum num_enum 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ca565a7df06f3d4b485494f25ba05da1435950f4dc263440eda7a6fa9b8e36e4" -"checksum num_enum_derive 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ffa5a33ddddfee04c0283a7653987d634e880347e96b5b2ed64de07efb59db9d" -"checksum number_prefix 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "17b02fc0ff9a9e4b35b3342880f48e896ebf69f2967921fe8646bf5b7125956a" -"checksum once_cell 1.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0b631f7e854af39a1739f401cf34a8a013dfe09eac4fa4dba91e9768bd28168d" -"checksum opaque-debug 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "2839e79665f131bdb5782e51f2c6c9599c133c6098982a54c794358bf432529c" -"checksum openssl 0.10.28 (registry+https://github.com/rust-lang/crates.io-index)" = "973293749822d7dd6370d6da1e523b0d1db19f06c459134c658b2a4261378b52" -"checksum openssl-probe 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "77af24da69f9d9341038eba93a073b1fdaaa1b788221b00a69bce9e762cb32de" -"checksum openssl-sys 0.9.54 (registry+https://github.com/rust-lang/crates.io-index)" = "1024c0a59774200a555087a6da3f253a9095a5f344e353b212ac4c8b8e450986" -"checksum parking_lot 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "92e98c49ab0b7ce5b222f2cc9193fc4efe11c6d0bd4f648e374684a6857b1cfc" -"checksum parking_lot 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "fa7767817701cce701d5585b9c4db3cdd02086398322c1d7e8bf5094a96a2ce7" -"checksum parking_lot 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)" = "f842b1982eb6c2fe34036a4fbfb06dd185a3f5c8edfaacdf7d1ea10b07de6252" -"checksum parking_lot_core 0.5.0 (registry+https://github.com/rust-lang/crates.io-index)" = "cb88cb1cb3790baa6776844f968fea3be44956cf184fa1be5a03341f5491278c" -"checksum parking_lot_core 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b876b1b9e7ac6e1a74a6da34d25c42e17e8862aa409cbbbdcfc8d86c6f3bc62b" -"checksum parking_lot_core 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7582838484df45743c8434fbff785e8edf260c28748353d44bc0da32e0ceabf1" -"checksum paste 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "423a519e1c6e828f1e73b720f9d9ed2fa643dce8a7737fb43235ce0b41eeaa49" -"checksum paste-impl 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "4214c9e912ef61bf42b81ba9a47e8aad1b2ffaf739ab162bf96d1e011f54e6c5" -"checksum pem 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a1581760c757a756a41f0ee3ff01256227bdf64cb752839779b95ffb01c59793" -"checksum percent-encoding 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "31010dd2e1ac33d5b46a5b413495239882813e0369f8ed8a5e266f173602f831" -"checksum percent-encoding 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e" -"checksum petgraph 0.5.0 (registry+https://github.com/rust-lang/crates.io-index)" = "29c127eea4a29ec6c85d153c59dc1213f33ec74cead30fe4730aecc88cc1fd92" -"checksum phf_shared 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "c00cf8b9eafe68dde5e9eaa2cef8ee84a9336a47d566ec55ca16589633b65af7" -"checksum pin-project 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "7804a463a8d9572f13453c516a5faea534a2403d7ced2f0c7e100eeff072772c" -"checksum pin-project-internal 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "385322a45f2ecf3410c68d2a549a4a2685e8051d0f278e39743ff4e451cb9b3f" -"checksum pin-project-lite 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "237844750cfbb86f67afe27eee600dfbbcb6188d734139b534cbfbf4f96792ae" -"checksum pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" -"checksum pkg-config 0.3.16 (registry+https://github.com/rust-lang/crates.io-index)" = "72d5370d90f49f70bd033c3d75e87fc529fbfff9d6f7cccef07d6170079d91ea" -"checksum ppv-lite86 0.2.5 (registry+https://github.com/rust-lang/crates.io-index)" = "e3cbf9f658cdb5000fcf6f362b8ea2ba154b9f146a61c7a20d647034c6b6561b" -"checksum precomputed-hash 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "925383efa346730478fb4838dbe9137d2a47675ad789c546d150a6e1dd4ab31c" -"checksum predicates 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "a9bfe52247e5cc9b2f943682a85a5549fb9662245caf094504e69a2f03fe64d4" -"checksum predicates-core 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "06075c3a3e92559ff8929e7a280684489ea27fe44805174c3ebd9328dcb37178" -"checksum predicates-tree 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8e63c4859013b38a76eca2414c64911fba30def9e3202ac461a2d22831220124" -"checksum pretty 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ad9940b913ee56ddd94aec2d3cd179dd47068236f42a1a6415ccf9d880ce2a61" -"checksum proc-macro-crate 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "e10d4b51f154c8a7fb96fd6dad097cb74b863943ec010ac94b9fd1be8861fe1e" -"checksum proc-macro-hack 0.5.10 (registry+https://github.com/rust-lang/crates.io-index)" = "114cdf1f426eb7f550f01af5f53a33c0946156f6814aec939b3bd77e844f9a9d" -"checksum proc-macro-nested 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "eba180dafb9038b050a4c280019bbedf9f2467b61e5d892dcad585bb57aadc5a" -"checksum proc-macro2 0.4.30 (registry+https://github.com/rust-lang/crates.io-index)" = "cf3d2011ab5c909338f7887f4fc896d35932e29146c12c8d01da6b22a80ba759" -"checksum proc-macro2 1.0.18 (registry+https://github.com/rust-lang/crates.io-index)" = "beae6331a816b1f65d04c45b078fd8e6c93e8071771f41b8163255bbd8d7c8fa" -"checksum proptest 0.9.5 (registry+https://github.com/rust-lang/crates.io-index)" = "bf6147d103a7c9d7598f4105cf049b15c99e2ecd93179bf024f0fd349be5ada4" -"checksum quick-error 1.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "9274b940887ce9addde99c4eee6b5c44cc494b182b97e73dc8ffdcb3397fd3f0" -"checksum quote 0.6.13 (registry+https://github.com/rust-lang/crates.io-index)" = "6ce23b6b870e8f94f81fb0a363d65d86675884b34a09043c81e5562f11c1f8e1" -"checksum quote 1.0.7 (registry+https://github.com/rust-lang/crates.io-index)" = "aa563d17ecb180e500da1cfd2b028310ac758de548efdd203e18f283af693f37" -"checksum rand 0.4.6 (registry+https://github.com/rust-lang/crates.io-index)" = "552840b97013b1a26992c11eac34bdd778e464601a4c2054b5f0bff7c6761293" -"checksum rand 0.6.5 (registry+https://github.com/rust-lang/crates.io-index)" = "6d71dacdc3c88c1fde3885a3be3fbab9f35724e6ce99467f7d9c5026132184ca" -"checksum rand 0.7.2 (registry+https://github.com/rust-lang/crates.io-index)" = "3ae1b169243eaf61759b8475a998f0a385e42042370f3a7dbaf35246eacc8412" -"checksum rand_chacha 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "556d3a1ca6600bfcbab7c7c91ccb085ac7fbbcd70e008a98742e7847f4f7bcef" -"checksum rand_chacha 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "03a2a90da8c7523f554344f921aa97283eadf6ac484a6d2a7d0212fa7f8d6853" -"checksum rand_core 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "7a6fdeb83b075e8266dcc8762c22776f6877a63111121f5f8c7411e5be7eed4b" -"checksum rand_core 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)" = "9c33a3c44ca05fa6f1807d8e6743f3824e8509beca625669633be0acbdf509dc" -"checksum rand_core 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "90bde5296fc891b0cef12a6d03ddccc162ce7b2aff54160af9338f8d40df6d19" -"checksum rand_hc 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7b40677c7be09ae76218dc623efbf7b18e34bced3f38883af07bb75630a21bc4" -"checksum rand_hc 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ca3129af7b92a17112d59ad498c6f81eaf463253766b90396d39ea7a39d6613c" -"checksum rand_isaac 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "ded997c9d5f13925be2a6fd7e66bf1872597f759fd9dd93513dd7e92e5a5ee08" -"checksum rand_jitter 0.1.4 (registry+https://github.com/rust-lang/crates.io-index)" = "1166d5c91dc97b88d1decc3285bb0a99ed84b05cfd0bc2341bdf2d43fc41e39b" -"checksum rand_os 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)" = "7b75f676a1e053fc562eafbb47838d67c84801e38fc1ba459e8f180deabd5071" -"checksum rand_pcg 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "abf9b09b01790cfe0364f52bf32995ea3c39f4d2dd011eac241d2914146d0b44" -"checksum rand_xorshift 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cbf7e9e623549b0e21f6e97cf8ecf247c1a8fd2e8a992ae265314300b2455d5c" -"checksum rayon 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "83a27732a533a1be0a0035a111fe76db89ad312f6f0347004c220c57f209a123" -"checksum rayon-core 1.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "98dcf634205083b17d0861252431eb2acbfb698ab7478a2d20de07954f47ec7b" -"checksum rdrand 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "678054eb77286b51581ba43620cc911abf02758c91f93f479767aed0f90458b2" -"checksum redox_syscall 0.1.56 (registry+https://github.com/rust-lang/crates.io-index)" = "2439c63f3f6139d1b57529d16bc3b8bb855230c8efcc5d3a896c8bea7c3b1e84" -"checksum redox_users 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "4ecedbca3bf205f8d8f5c2b44d83cd0690e39ee84b951ed649e9f1841132b66d" -"checksum regex 1.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "dc220bd33bdce8f093101afe22a037b8eb0e5af33592e6a9caafff0d4cb81cbd" -"checksum regex-syntax 0.6.12 (registry+https://github.com/rust-lang/crates.io-index)" = "11a7e20d1cce64ef2fed88b66d347f88bd9babb82845b2b858f3edbf59a4f716" -"checksum remove_dir_all 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)" = "4a83fa3702a688b9359eccba92d153ac33fd2e8462f9e0e3fdf155239ea7792e" -"checksum reqwest 0.10.4 (registry+https://github.com/rust-lang/crates.io-index)" = "02b81e49ddec5109a9dcfc5f2a317ff53377c915e9ae9d4f2fb50914b85614e2" -"checksum resolv-conf 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b263b4aa1b5de9ffc0054a2386f96992058bb6870aab516f8cdeb8a667d56dcb" -"checksum rgb 0.8.14 (registry+https://github.com/rust-lang/crates.io-index)" = "2089e4031214d129e201f8c3c8c2fe97cd7322478a0d1cdf78e7029b0042efdb" -"checksum ring 0.16.14 (registry+https://github.com/rust-lang/crates.io-index)" = "06b3fefa4f12272808f809a0af618501fdaba41a58963c5fb72238ab0be09603" -"checksum rle-decode-fast 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cabe4fa914dec5870285fa7f71f602645da47c486e68486d2b4ceb4a343e90ac" -"checksum rust-argon2 0.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "4ca4eaef519b494d1f2848fc602d18816fed808a981aedf4f1f00ceb7c9d32cf" -"checksum rustc-demangle 0.1.16 (registry+https://github.com/rust-lang/crates.io-index)" = "4c691c0e608126e00913e33f0ccf3727d5fc84573623b8d65b2df340b5201783" -"checksum rustc_version 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "138e3e0acb6c9fb258b19b67cb8abd63c00679d2851805ea151465464fe9030a" -"checksum rustls 0.17.0 (registry+https://github.com/rust-lang/crates.io-index)" = "c0d4a31f5d68413404705d6982529b0e11a9aacd4839d1d6222ee3b8cb4015e1" -"checksum rustls-native-certs 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a75ffeb84a6bd9d014713119542ce415db3a3e4748f0bfce1e1416cd224a23a5" -"checksum rusty-fork 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "3dd93264e10c577503e926bd1430193eeb5d21b059148910082245309b424fae" -"checksum ryu 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "c92464b447c0ee8c4fb3824ecc8383b81717b9f1e74ba2e72540aef7b9f82997" -"checksum same-file 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)" = "585e8ddcedc187886a30fa705c47985c3fa88d06624095856b36ca0b82ff4421" -"checksum schannel 0.1.16 (registry+https://github.com/rust-lang/crates.io-index)" = "87f550b06b6cba9c8b8be3ee73f391990116bf527450d2556e9b9ce263b9a021" -"checksum scopeguard 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b42e15e59b18a828bbf5c58ea01debb36b9b096346de35d941dcb89009f24a0d" -"checksum sct 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "e3042af939fca8c3453b7af0f1c66e533a15a86169e39de2657310ade8f98d3c" -"checksum security-framework 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "eee63d0f4a9ec776eeb30e220f0bc1e092c3ad744b2a379e3993070364d3adc2" -"checksum security-framework 0.4.4 (registry+https://github.com/rust-lang/crates.io-index)" = "64808902d7d99f78eaddd2b4e2509713babc3dc3c85ad6f4c447680f3c01e535" -"checksum security-framework-sys 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "9636f8989cbf61385ae4824b98c1aaa54c994d7d8b41f11c601ed799f0549a56" -"checksum security-framework-sys 0.4.3 (registry+https://github.com/rust-lang/crates.io-index)" = "17bf11d99252f512695eb468de5516e5cf75455521e69dfe343f3b74e4748405" -"checksum semver 0.9.0 (registry+https://github.com/rust-lang/crates.io-index)" = "1d7eb9ef2c18661902cc47e535f9bc51b78acd254da71d375c2f6720d9a40403" -"checksum semver-parser 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "388a1df253eca08550bef6c72392cfe7c30914bf41df5269b68cbd6ff8f570a3" -"checksum serde 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)" = "99e7b308464d16b56eba9964e4972a3eee817760ab60d88c3f86e1fecb08204c" -"checksum serde_bytes 0.11.2 (registry+https://github.com/rust-lang/crates.io-index)" = "45af0182ff64abaeea290235eb67da3825a576c5d53e642c4d5b652e12e6effc" -"checksum serde_cbor 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)" = "f7081ed758ec726a6ed8ee7e92f5d3f6e6f8c3901b1f972e3a4a2f2599fad14f" -"checksum serde_derive 1.0.110 (registry+https://github.com/rust-lang/crates.io-index)" = "818fbf6bfa9a42d3bfcaca148547aa00c7b915bec71d1757aa2d44ca68771984" -"checksum serde_json 1.0.40 (registry+https://github.com/rust-lang/crates.io-index)" = "051c49229f282f7c6f3813f8286cc1e3323e8051823fce42c7ea80fe13521704" -"checksum serde_repr 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "cd02c7587ec314570041b2754829f84d873ced14a96d1fd1823531e11db40573" -"checksum serde_urlencoded 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)" = "9ec5d77e2d4c73717816afac02670d5c4f534ea95ed430442cad02e7a6e32c97" -"checksum sha1 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "2579985fda508104f7587689507983eadd6a6e84dd35d6d115361f530916fa0d" -"checksum sha2 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7b4d8bfd0e469f417657573d8451fb33d16cfe0989359b93baf3a1ffc639543d" -"checksum shell-words 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b6fa3938c99da4914afedd13bf3d79bcb6c277d1b2c398d23257a304d9e1b074" -"checksum signal-hook 0.1.13 (registry+https://github.com/rust-lang/crates.io-index)" = "10b9f3a1686a29f53cfd91ee5e3db3c12313ec02d33765f02c1a9645a1811e2c" -"checksum signal-hook-registry 1.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "94f478ede9f64724c5d173d7bb56099ec3e2d9fc2774aac65d34b8b890405f41" -"checksum siphasher 0.3.3 (registry+https://github.com/rust-lang/crates.io-index)" = "fa8f3741c7372e75519bd9346068370c9cdaabcc1f9599cbcf2a2719352286b7" -"checksum slab 0.4.2 (registry+https://github.com/rust-lang/crates.io-index)" = "c111b5bd5695e56cffe5129854aa230b39c93a305372fdbb2668ca2394eea9f8" -"checksum slog 2.5.2 (registry+https://github.com/rust-lang/crates.io-index)" = "1cc9c640a4adbfbcc11ffb95efe5aa7af7309e002adab54b185507dbf2377b99" -"checksum slog-async 2.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "78ca925b180da88ccc595cbe4a3d378d79cb49fe5906c2cbc2488eaf700913ee" -"checksum slog-term 2.5.0 (registry+https://github.com/rust-lang/crates.io-index)" = "124501187c410b6a46fe8a47a48435ae462fae4e02d03c558d358f40b17308cb" -"checksum smallvec 0.6.10 (registry+https://github.com/rust-lang/crates.io-index)" = "ab606a9c5e214920bb66c458cd7be8ef094f813f20fe77a54cc7dbfff220d4b7" -"checksum smallvec 1.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "44e59e0c9fa00817912ae6e4e6e3c4fe04455e75699d06eedc7d85917ed8e8f4" -"checksum socket2 0.3.11 (registry+https://github.com/rust-lang/crates.io-index)" = "e8b74de517221a2cb01a53349cf54182acdc31a074727d3079068448c0676d85" -"checksum spin 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d" -"checksum string 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "d24114bfcceb867ca7f71a0d3fe45d45619ec47a6fbfa98cb14e14250bfa5d6d" -"checksum string_cache 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "2940c75beb4e3bf3a494cef919a747a2cb81e52571e212bfbd185074add7208a" -"checksum strsim 0.8.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8ea5119cdb4c55b55d432abb513a0429384878c15dde60cc77b1c99de1a95a6a" -"checksum strsim 0.9.2 (registry+https://github.com/rust-lang/crates.io-index)" = "032c03039aae92b350aad2e3779c352e104d919cb192ba2fabbd7b831ce4f0f6" -"checksum syn 0.15.44 (registry+https://github.com/rust-lang/crates.io-index)" = "9ca4b3b69a77cbe1ffc9e198781b7acb0c7365a883670e8f1c1bc66fba79a5c5" -"checksum syn 1.0.31 (registry+https://github.com/rust-lang/crates.io-index)" = "b5304cfdf27365b7585c25d4af91b35016ed21ef88f17ced89c7093b43dba8b6" -"checksum synstructure 0.10.2 (registry+https://github.com/rust-lang/crates.io-index)" = "02353edf96d6e4dc81aea2d8490a7e9db177bf8acb0e951c24940bf866cb313f" -"checksum sysinfo 0.9.6 (registry+https://github.com/rust-lang/crates.io-index)" = "6f4b2468c629cffba39c0a4425849ab3cdb03d9dfacba69684609aea04d08ff9" -"checksum take_mut 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "f764005d11ee5f36500a149ace24e00e3da98b0158b3e2d53a7495660d3f4d60" -"checksum tar 0.4.26 (registry+https://github.com/rust-lang/crates.io-index)" = "b3196bfbffbba3e57481b6ea32249fbaf590396a52505a2615adbb79d9d826d3" -"checksum tempfile 3.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7a6e24d9338a0a5be79593e2fa15a648add6138caa803e2d5bc782c371732ca9" -"checksum term 0.5.2 (registry+https://github.com/rust-lang/crates.io-index)" = "edd106a334b7657c10b7c540a0106114feadeb4dc314513e97df481d5d966f42" -"checksum term 0.6.1 (registry+https://github.com/rust-lang/crates.io-index)" = "c0863a3345e70f61d613eab32ee046ccd1bcc5f9105fe402c61fcd0c13eeb8b5" -"checksum termcolor 1.0.5 (registry+https://github.com/rust-lang/crates.io-index)" = "96d6098003bde162e4277c70665bd87c326f5a0c3f3fbfb285787fa482d54e6e" -"checksum terminal_size 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "8038f95fc7a6f351163f4b964af631bd26c9e828f7db085f2a84aca56f70d13b" -"checksum termios 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)" = "72b620c5ea021d75a735c943269bb07d30c9b77d6ac6b236bc8b5c496ef05625" -"checksum textwrap 0.11.0 (registry+https://github.com/rust-lang/crates.io-index)" = "d326610f408c7a4eb6f51c37c330e496b08506c9457c9d34287ecc38809fb060" -"checksum thread_local 0.3.6 (registry+https://github.com/rust-lang/crates.io-index)" = "c6b53e329000edc2b34dbe8545fd20e55a333362d0a321909685a19bd28c3f1b" -"checksum thread_local 1.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "d40c6d1b69745a6ec6fb1ca717914848da4b44ae29d9b3080cbee91d72a69b14" -"checksum threadpool 1.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "e2f0c90a5f3459330ac8bc0d2f879c693bb7a2f59689c1083fc4ef83834da865" -"checksum time 0.1.42 (registry+https://github.com/rust-lang/crates.io-index)" = "db8dcfca086c1143c9270ac42a2bbd8a7ee477b78ac8e45b19abfb0cbede4b6f" -"checksum tokio 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)" = "8fdd17989496f49cdc57978c96f0c9fe5e4a58a8bddc6813c449a4624f6a030b" -"checksum tokio-codec 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "5c501eceaf96f0e1793cf26beb63da3d11c738c4a943fdf3746d81d64684c39f" -"checksum tokio-current-thread 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "d16217cad7f1b840c5a97dfb3c43b0c871fef423a6e8d2118c604e843662a443" -"checksum tokio-executor 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)" = "0f27ee0e6db01c5f0b2973824547ce7e637b2ed79b891a9677b0de9bd532b6ac" -"checksum tokio-io 0.1.12 (registry+https://github.com/rust-lang/crates.io-index)" = "5090db468dad16e1a7a54c8c67280c5e4b544f3d3e018f0b913b400261f85926" -"checksum tokio-openssl 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "771d6246b170ae108d67d9963c23f31a579016c016d73bd4bd7d6ef0252afda7" -"checksum tokio-reactor 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)" = "c56391be9805bc80163151c0b9e5164ee64f4b0200962c346fea12773158f22d" -"checksum tokio-rustls 0.13.1 (registry+https://github.com/rust-lang/crates.io-index)" = "15cb62a0d2770787abc96e99c1cd98fcf17f94959f3af63ca85bdfb203f051b4" -"checksum tokio-signal 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)" = "dd6dc5276ea05ce379a16de90083ec80836440d5ef8a6a39545a3207373b8296" -"checksum tokio-sync 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "2162248ff317e2bc713b261f242b69dbb838b85248ed20bb21df56d60ea4cae7" -"checksum tokio-tcp 0.1.3 (registry+https://github.com/rust-lang/crates.io-index)" = "1d14b10654be682ac43efee27401d792507e30fd8d26389e1da3b185de2e4119" -"checksum tokio-timer 0.2.11 (registry+https://github.com/rust-lang/crates.io-index)" = "f2106812d500ed25a4f38235b9cae8f78a09edf43203e16e59c3b769a342a60e" -"checksum tokio-tls 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "7bde02a3a5291395f59b06ec6945a3077602fac2b07eeeaf0dee2122f3619828" -"checksum tokio-udp 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "f02298505547f73e60f568359ef0d016d5acd6e830ab9bc7c4a5b3403440121b" -"checksum tokio-util 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "571da51182ec208780505a32528fc5512a8fe1443ab960b3f2f3ef093cd16930" -"checksum toml 0.5.5 (registry+https://github.com/rust-lang/crates.io-index)" = "01d1404644c8b12b16bfcffa4322403a91a451584daaaa7c28d3152e6cbc98cf" -"checksum tower-service 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "e987b6bf443f4b5b3b6f38704195592cca41c5bb7aedd3c3693c7081f8289860" -"checksum treeline 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a7f741b240f1a48843f9b8e0444fb55fb2a4ff67293b50a9179dfd5ea67f8d41" -"checksum trust-dns-proto 0.7.4 (registry+https://github.com/rust-lang/crates.io-index)" = "5559ebdf6c2368ddd11e20b11d6bbaf9e46deb803acd7815e93f5a7b4a6d2901" -"checksum trust-dns-resolver 0.11.1 (registry+https://github.com/rust-lang/crates.io-index)" = "6c9992e58dba365798803c0b91018ff6c8d3fc77e06977c4539af2a6bfe0a039" -"checksum try-lock 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "e604eb7b43c06650e854be16a2a03155743d3752dd1c943f6829e26b7a36e382" -"checksum typed-arena 2.0.1 (registry+https://github.com/rust-lang/crates.io-index)" = "0685c84d5d54d1c26f7d3eb96cd41550adb97baed141a761cf335d3d33bcd0ae" -"checksum typenum 1.11.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6d2783fe2d6b8c1101136184eb41be8b1ad379e4657050b8aaff0c79ee7575f9" -"checksum unicase 2.5.1 (registry+https://github.com/rust-lang/crates.io-index)" = "2e2e6bd1e59e56598518beb94fd6db628ded570326f0a98c679a304bd9f00150" -"checksum unicode-bidi 0.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "49f2bd0c6468a8230e1db229cff8029217cf623c767ea5d60bfbd42729ea54d5" -"checksum unicode-normalization 0.1.8 (registry+https://github.com/rust-lang/crates.io-index)" = "141339a08b982d942be2ca06ff8b076563cbe223d1befd5450716790d44e2426" -"checksum unicode-width 0.1.6 (registry+https://github.com/rust-lang/crates.io-index)" = "7007dbd421b92cc6e28410fe7362e2e0a2503394908f417b68ec8d1c364c4e20" -"checksum unicode-xid 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "fc72304796d0818e357ead4e000d19c9c174ab23dc11093ac919054d20a6a7fc" -"checksum unicode-xid 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "826e7639553986605ec5979c7dd957c7895e93eabed50ab2ffa7f6128a75097c" -"checksum untrusted 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a" -"checksum url 1.7.2 (registry+https://github.com/rust-lang/crates.io-index)" = "dd4e7c0d531266369519a4aa4f399d748bd37043b00bde1e4ff1f60a120b355a" -"checksum url 2.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "75b414f6c464c879d7f9babf951f23bc3743fb7313c081b2e6ca719067ea9d61" -"checksum v_escape 0.7.4 (registry+https://github.com/rust-lang/crates.io-index)" = "660b101c07b5d0863deb9e7fb3138777e858d6d2a79f9e6049a27d1cc77c6da6" -"checksum v_escape_derive 0.5.6 (registry+https://github.com/rust-lang/crates.io-index)" = "c2ca2a14bc3fc5b64d188b087a7d3a927df87b152e941ccfbc66672e20c467ae" -"checksum v_htmlescape 0.4.5 (registry+https://github.com/rust-lang/crates.io-index)" = "e33e939c0d8cf047514fb6ba7d5aac78bc56677a6938b2ee67000b91f2e97e41" -"checksum vcpkg 0.2.7 (registry+https://github.com/rust-lang/crates.io-index)" = "33dd455d0f96e90a75803cfeb7f948768c08d70a6de9a8d2362461935698bf95" -"checksum vec_map 0.8.1 (registry+https://github.com/rust-lang/crates.io-index)" = "05c78687fb1a80548ae3250346c3db86a80a7cdd77bda190189f2d0a0987c81a" -"checksum version_check 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "914b1a6776c4c929a602fafd8bc742e06365d4bcbe48c30f9cca5824f70dc9dd" -"checksum wait-timeout 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "9f200f5b12eb75f8c1ed65abd4b2db8a6e1b138a20de009dacee265a2498f3f6" -"checksum walkdir 2.2.9 (registry+https://github.com/rust-lang/crates.io-index)" = "9658c94fa8b940eab2250bd5a457f9c48b748420d71293b165c8cdbe2f55f71e" -"checksum want 0.3.0 (registry+https://github.com/rust-lang/crates.io-index)" = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" -"checksum wasi 0.7.0 (registry+https://github.com/rust-lang/crates.io-index)" = "b89c3ce4ce14bdc6fb6beaf9ec7928ca331de5df7e5ea278375642a2f478570d" -"checksum wasm-bindgen 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)" = "4c2dc4aa152834bc334f506c1a06b866416a8b6697d5c9f75b9a689c8486def0" -"checksum wasm-bindgen-backend 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)" = "ded84f06e0ed21499f6184df0e0cb3494727b0c5da89534e0fcc55c51d812101" -"checksum wasm-bindgen-futures 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "8bbdd49e3e28b40dec6a9ba8d17798245ce32b019513a845369c641b275135d9" -"checksum wasm-bindgen-macro 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)" = "838e423688dac18d73e31edce74ddfac468e37b1506ad163ffaf0a46f703ffe3" -"checksum wasm-bindgen-macro-support 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)" = "3156052d8ec77142051a533cdd686cba889537b213f948cd1d20869926e68e92" -"checksum wasm-bindgen-shared 0.2.63 (registry+https://github.com/rust-lang/crates.io-index)" = "c9ba19973a58daf4db6f352eda73dc0e289493cd29fb2632eb172085b6521acd" -"checksum wasmparser 0.45.0 (registry+https://github.com/rust-lang/crates.io-index)" = "cd242c848b25027c3e29fb2bd34c8648755b33fef66a22f65b942d06562d3020" -"checksum web-sys 0.3.40 (registry+https://github.com/rust-lang/crates.io-index)" = "7b72fe77fd39e4bd3eaa4412fd299a0be6b3dfe9d2597e2f1c20beb968f41d17" -"checksum webpki 0.21.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ab146130f5f790d45f82aeeb09e55a256573373ec64409fc19a6fb82fb1032ae" -"checksum webpki-roots 0.18.0 (registry+https://github.com/rust-lang/crates.io-index)" = "91cd5736df7f12a964a5067a12c62fa38e1bd8080aff1f80bc29be7c80d19ab4" -"checksum webpki-roots 0.19.0 (registry+https://github.com/rust-lang/crates.io-index)" = "f8eff4b7516a57307f9349c64bf34caa34b940b66fed4b2fb3136cb7386e5739" -"checksum widestring 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "effc0e4ff8085673ea7b9b2e3c73f6bd4d118810c9009ed8f1e16bd96c331db6" -"checksum winapi 0.2.8 (registry+https://github.com/rust-lang/crates.io-index)" = "167dc9d6949a9b857f3451275e911c3f44255842c1f7a76f33c55103a909087a" -"checksum winapi 0.3.8 (registry+https://github.com/rust-lang/crates.io-index)" = "8093091eeb260906a183e6ae1abdba2ef5ef2257a21801128899c3fc699229c6" -"checksum winapi-build 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "2d315eee3b34aca4797b2da6b13ed88266e6d612562a0c46390af8299fc699bc" -"checksum winapi-i686-pc-windows-gnu 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" -"checksum winapi-util 0.1.5 (registry+https://github.com/rust-lang/crates.io-index)" = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178" -"checksum winapi-x86_64-pc-windows-gnu 0.4.0 (registry+https://github.com/rust-lang/crates.io-index)" = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" -"checksum wincolor 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "96f5016b18804d24db43cebf3c77269e7569b8954a8464501c216cc5e070eaa9" -"checksum winconsole 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "3ef84b96d10db72dd980056666d7f1e7663ce93d82fa33b63e71c966f4cf5032" -"checksum winreg 0.6.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b2986deb581c4fe11b621998a5e53361efe6b48a151178d0cd9eeffa4dc6acc9" -"checksum winutil 0.1.1 (registry+https://github.com/rust-lang/crates.io-index)" = "7daf138b6b14196e3830a588acf1e86966c694d3e8fb026fb105b8b5dca07e6e" -"checksum ws2_32-sys 0.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "d59cefebd0c892fa2dd6de581e937301d8552cb44489cdff035c6187cb63fa5e" -"checksum xattr 0.2.2 (registry+https://github.com/rust-lang/crates.io-index)" = "244c3741f4240ef46274860397c7c74e50eb23624996930e484c16679633a54c" + "libc", +] diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 5855da6233..9f1d7c3b9e 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -27,13 +27,13 @@ chrono = "0.4.9" clap = "2.33.0" console = "0.7.7" crossbeam = "0.7.3" -delay = "0.1.1" +delay = "0.2.0" dialoguer = "0.6.2" erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.0" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.2" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" @@ -49,8 +49,8 @@ rustls = "0.17.0" semver = "0.9.0" serde = "1.0" serde_bytes = "0.11.2" -serde_cbor = "0.10" -serde_json = "1.0.40" +serde_cbor = "0.11.1" +serde_json = "1.0.57" serde_repr = "0.1.5" shell-words = "1.0.0" signal-hook = "0.1.13" diff --git a/src/dfx/src/commands/canister/install.rs b/src/dfx/src/commands/canister/install.rs index fc97db432f..2f65d7abc8 100644 --- a/src/dfx/src/commands/canister/install.rs +++ b/src/dfx/src/commands/canister/install.rs @@ -8,7 +8,7 @@ use crate::lib::waiter::create_waiter; use clap::{App, Arg, ArgMatches, SubCommand}; use ic_agent::{ - Agent, Blob, CanisterAttributes, ComputeAllocation, InstallMode, ManagementCanister, RequestId, + Agent, Blob, CanisterAttributes, ComputeAllocation, InstallMode, ManagementCanister, }; use slog::info; use std::convert::TryFrom; @@ -63,7 +63,7 @@ async fn install_canister( canister_info: &CanisterInfo, compute_allocation: Option, mode: InstallMode, -) -> DfxResult { +) -> DfxResult { let mgr = ManagementCanister::new(agent); let log = env.get_logger(); let canister_id = canister_info.get_canister_id().map_err(|_| { @@ -82,7 +82,7 @@ async fn install_canister( .expect("Cannot get WASM output path."); let wasm = std::fs::read(wasm_path)?; - let result = mgr + mgr .install_code( create_waiter(), &canister_id, @@ -95,13 +95,10 @@ async fn install_canister( .map_err(DfxError::from)?; if canister_info.get_type() == "assets" { - agent - .request_status_and_wait(&result, create_waiter()) - .await?; post_install_store_assets(&canister_info, &agent).await?; } - Ok(result) + Ok(()) } fn compute_allocation_validator(compute_allocation: String) -> Result<(), String> { @@ -114,7 +111,6 @@ fn compute_allocation_validator(compute_allocation: String) -> Result<(), String } pub fn exec(env: &dyn Environment, args: &ArgMatches<'_>) -> DfxResult { - let log = env.get_logger(); let config = env .get_config() .ok_or(DfxError::CommandMustBeRunInAProject)?; @@ -136,24 +132,14 @@ pub fn exec(env: &dyn Environment, args: &ArgMatches<'_>) -> DfxResult { let canister_id = canister_id_store.get(canister_name)?; let canister_info = CanisterInfo::load(&config, canister_name, Some(canister_id))?; - let request_id = runtime.block_on(install_canister( + runtime.block_on(install_canister( env, &agent, &canister_info, compute_allocation, mode, ))?; - - if args.is_present("async") { - info!(log, "Request ID: "); - println!("0x{}", String::from(request_id)); - Ok(()) - } else { - runtime - .block_on(agent.request_status_and_wait(&request_id, create_waiter())) - .map(|_| ()) - .map_err(DfxError::from) - } + Ok(()) } else if args.is_present("all") { // Install all canisters. if let Some(canisters) = &config.get_config().canisters { @@ -161,21 +147,13 @@ pub fn exec(env: &dyn Environment, args: &ArgMatches<'_>) -> DfxResult { let canister_id = canister_id_store.get(canister_name)?; let canister_info = CanisterInfo::load(&config, canister_name, Some(canister_id))?; - let request_id = runtime.block_on(install_canister( + runtime.block_on(install_canister( env, &agent, &canister_info, compute_allocation, mode.clone(), ))?; - - if args.is_present("async") { - info!(log, "Request ID: "); - println!("0x{}", String::from(request_id)); - } else { - runtime - .block_on(agent.request_status_and_wait(&request_id, create_waiter()))?; - } } } Ok(()) diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index df15898d99..3b6edde896 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.0" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.2" } [dev-dependencies] From e44d1345a3fe9e8dc1e97711fdae2b300b14c54b Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 5 Aug 2020 16:08:08 -0700 Subject: [PATCH 07/23] fmt --- src/dfx/src/commands/canister/install.rs | 21 ++++++++++----------- 1 file changed, 10 insertions(+), 11 deletions(-) diff --git a/src/dfx/src/commands/canister/install.rs b/src/dfx/src/commands/canister/install.rs index 2f65d7abc8..3cd4f6e276 100644 --- a/src/dfx/src/commands/canister/install.rs +++ b/src/dfx/src/commands/canister/install.rs @@ -82,17 +82,16 @@ async fn install_canister( .expect("Cannot get WASM output path."); let wasm = std::fs::read(wasm_path)?; - mgr - .install_code( - create_waiter(), - &canister_id, - mode, - &Blob::from(wasm), - &Blob::empty(), - &CanisterAttributes { compute_allocation }, - ) - .await - .map_err(DfxError::from)?; + mgr.install_code( + create_waiter(), + &canister_id, + mode, + &Blob::from(wasm), + &Blob::empty(), + &CanisterAttributes { compute_allocation }, + ) + .await + .map_err(DfxError::from)?; if canister_info.get_type() == "assets" { post_install_store_assets(&canister_info, &agent).await?; From e1f43bfced6935756739f235a93a196c4ca9f535 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 5 Aug 2020 16:22:38 -0700 Subject: [PATCH 08/23] cargo clippy --- Cargo.lock | 6 +++--- src/dfx/Cargo.toml | 2 +- 2 files changed, 4 insertions(+), 4 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index a16369a107..cf06e9b1d5 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -2074,9 +2074,9 @@ dependencies = [ [[package]] name = "mockito" -version = "0.20.0" +version = "0.27.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fa3f481382a4d68c5f1d27fb567db27196630f729706003cb07a9b8330a30306" +checksum = "3a634720d366bcbce30fb05871a35da229cef101ad0b2ea4e46cf5abf031a273" dependencies = [ "assert-json-diff", "colored", @@ -2084,10 +2084,10 @@ dependencies = [ "httparse", "lazy_static", "log", - "percent-encoding 1.0.1", "rand 0.7.3", "regex", "serde_json", + "serde_urlencoded", ] [[package]] diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 9f1d7c3b9e..393de1fc03 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -70,5 +70,5 @@ wasmparser = "0.45.0" [dev-dependencies] env_logger = "0.6" proptest = "0.9.5" -mockito = "0.20.0" +mockito = "0.27.0" tempfile = "3.1.0" From c89959859b58aaf5c4f6153dbdecdfe59f3bdd1b Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Wed, 5 Aug 2020 16:51:29 -0700 Subject: [PATCH 09/23] Empty commit to trigger CI. From bd8871d26f1a129aefc8c1d0a79c619e05d7f208 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Thu, 6 Aug 2020 08:44:08 -0700 Subject: [PATCH 10/23] wip --- Cargo.lock | 17 ++++++++++++++--- src/dfx/Cargo.toml | 2 +- src/dfx/src/lib/environment.rs | 2 +- src/ic_identity_manager/Cargo.toml | 2 +- 4 files changed, 17 insertions(+), 6 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index cf06e9b1d5..426e4ff16d 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -1011,7 +1011,7 @@ dependencies = [ "url 2.1.1", "walkdir", "wasmparser", - "webpki-roots", + "webpki-roots 0.19.0", ] [[package]] @@ -1630,7 +1630,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.2#7d18fe54cb24025cec75d2892601af10ae18363e" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#51fa491050ceb0cdf86b8cae4f68a7024b594802" dependencies = [ "async-trait", "base32", @@ -1644,10 +1644,12 @@ dependencies = [ "rand 0.7.3", "reqwest", "ring", + "rustls 0.18.0", "serde", "serde_bytes", "serde_cbor 0.11.1", "url 2.1.1", + "webpki-roots 0.20.0", ] [[package]] @@ -2875,7 +2877,7 @@ dependencies = [ "wasm-bindgen", "wasm-bindgen-futures", "web-sys", - "webpki-roots", + "webpki-roots 0.19.0", "winreg 0.7.0", ] @@ -4027,6 +4029,15 @@ dependencies = [ "webpki", ] +[[package]] +name = "webpki-roots" +version = "0.20.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0f20dea7535251981a9670857150d571846545088359b28e4951d350bdaf179f" +dependencies = [ + "webpki", +] + [[package]] name = "widestring" version = "0.4.2" diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 393de1fc03..39996e8abe 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -33,7 +33,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.2" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", branch = "hansl/update_rustls" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" diff --git a/src/dfx/src/lib/environment.rs b/src/dfx/src/lib/environment.rs index d0f7573ddf..78f29c27bd 100644 --- a/src/dfx/src/lib/environment.rs +++ b/src/dfx/src/lib/environment.rs @@ -406,7 +406,7 @@ fn create_agent(logger: Logger, url: &str, identity: PathBuf) -> Option { reqwest::Client::builder() .use_preconfigured_tls(cfg) .build() - .expect("Could not create HTTP client."), + .expect("Could not create HTTP client"), ) .ok() .and_then(|executor| { diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 3b6edde896..7ba30f1b79 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.2" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", branch = "hansl/update_rustls" } [dev-dependencies] From 0ebb8c79c21da85011905faa1a3fbdc0493c3e4f Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Thu, 6 Aug 2020 20:03:41 -0700 Subject: [PATCH 11/23] . --- Cargo.lock | 26 +---- src/dfx/Cargo.toml | 2 - src/dfx/src/lib/environment.rs | 203 +++++++++++++++++++-------------- 3 files changed, 124 insertions(+), 107 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 426e4ff16d..393ea68164 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -991,7 +991,6 @@ dependencies = [ "rand 0.7.3", "regex", "reqwest", - "rustls 0.17.0", "semver", "serde", "serde_bytes", @@ -1011,7 +1010,6 @@ dependencies = [ "url 2.1.1", "walkdir", "wasmparser", - "webpki-roots 0.19.0", ] [[package]] @@ -1608,7 +1606,7 @@ dependencies = [ "futures-util", "hyper", "log", - "rustls 0.18.0", + "rustls", "tokio", "tokio-rustls", "webpki", @@ -1630,10 +1628,11 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#51fa491050ceb0cdf86b8cae4f68a7024b594802" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#de2d84a8c9ac972e298dfb6bcba7d0a0fc91a205" dependencies = [ "async-trait", "base32", + "base64 0.12.3", "byteorder", "candid", "crc32fast", @@ -1644,7 +1643,7 @@ dependencies = [ "rand 0.7.3", "reqwest", "ring", - "rustls 0.18.0", + "rustls", "serde", "serde_bytes", "serde_cbor 0.11.1", @@ -2866,7 +2865,7 @@ dependencies = [ "native-tls", "percent-encoding 2.1.0", "pin-project-lite", - "rustls 0.18.0", + "rustls", "serde", "serde_json", "serde_urlencoded", @@ -2939,19 +2938,6 @@ dependencies = [ "semver", ] -[[package]] -name = "rustls" -version = "0.17.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c0d4a31f5d68413404705d6982529b0e11a9aacd4839d1d6222ee3b8cb4015e1" -dependencies = [ - "base64 0.11.0", - "log", - "ring", - "sct", - "webpki", -] - [[package]] name = "rustls" version = "0.18.0" @@ -3562,7 +3548,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "228139ddd4fea3fa345a29233009635235833e52807af7ea6448ead03890d6a9" dependencies = [ "futures-core", - "rustls 0.18.0", + "rustls", "tokio", "webpki", ] diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 39996e8abe..d0fd092ad8 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -45,7 +45,6 @@ petgraph = "0.5.0" rand = "0.7.2" regex = "1.3.1" reqwest = { version = "0.10.4", features = [ "blocking", "json", "rustls-tls" ] } -rustls = "0.17.0" semver = "0.9.0" serde = "1.0" serde_bytes = "0.11.2" @@ -63,7 +62,6 @@ tempfile = "3.1.0" toml = "0.5.5" tokio = "0.2.10" url = "2.1.0" -webpki-roots = "0.19.0" walkdir = "2.2.9" wasmparser = "0.45.0" diff --git a/src/dfx/src/lib/environment.rs b/src/dfx/src/lib/environment.rs index 78f29c27bd..a7c12cb620 100644 --- a/src/dfx/src/lib/environment.rs +++ b/src/dfx/src/lib/environment.rs @@ -6,7 +6,6 @@ use crate::lib::identity::Identity; use crate::lib::network::network_descriptor::NetworkDescriptor; use crate::lib::progress_bar::ProgressBar; -use async_trait::async_trait; use ic_agent::{Agent, AgentConfig}; use semver::Version; use slog::{Logger, Record}; @@ -252,20 +251,18 @@ impl<'a> Environment for AgentEnvironment<'a> { pub struct AgentClient { logger: Logger, - client: reqwest::Client, url: reqwest::Url, - // The auth `username:password`, base64 encoded. - auth: Arc>>, + // The auth `(username, password)`. + auth: Arc>>, } impl AgentClient { - pub fn new(logger: Logger, url: String, client: reqwest::Client) -> DfxResult { + pub fn new(logger: Logger, url: String) -> DfxResult { let url = reqwest::Url::parse(&url).map_err(|e| DfxError::InvalidUrl(url, e))?; let result = Self { logger, - client, url, auth: Arc::new(Mutex::new(None)), }; @@ -298,7 +295,7 @@ impl AgentClient { ) } - fn read_http_auth(&self) -> DfxResult> { + fn read_http_auth(&self) -> DfxResult> { match self.url.host() { None => Ok(None), Some(h) => { @@ -311,7 +308,13 @@ impl AgentClient { ); Ok(None) } else { - Ok(Some(token.clone())) + let pair = base64::decode(&token).unwrap(); + let v: Vec = String::from_utf8_lossy(pair.as_slice()) + .split(":") + .take(2) + .map(|s| s.to_owned()) + .collect(); + Ok(Some((v[0].to_owned(), v[1].to_owned()))) } } else { Ok(None) @@ -332,90 +335,120 @@ impl AgentClient { Ok(p) } } +// +// #[async_trait] +// impl ic_agent::AgentRequestExecutor for AgentClient { +// async fn execute( +// &self, +// mut request: reqwest::Request, +// ) -> Result { +// loop { +// // Support for HTTP Auth if necessary (tries to contact first, then do the HTTP Auth +// // flow). +// if let Some(auth) = self.auth.lock().unwrap().as_ref() { +// request.headers_mut().insert( +// reqwest::header::AUTHORIZATION, +// format!("Basic {}", auth).parse().unwrap(), +// ); +// } +// +// let response = self +// .client +// .execute(request.try_clone().unwrap()) +// .await +// .map_err(ic_agent::AgentError::from)?; +// +// // 401 is HTTP Authentication unauthorized access. +// if response.status() == reqwest::StatusCode::UNAUTHORIZED { +// if !self.is_secure() { +// return Ok(response); +// } +// +// eprintln!("Unauthorized HTTP Access... Please enter credentials:"); +// let username = dialoguer::Input::::new() +// .with_prompt("Username") +// .interact() +// .unwrap(); +// let password = dialoguer::Password::new() +// .with_prompt("Password") +// .interact() +// .unwrap(); +// +// let auth = format!("{}:{}", username, password); +// let auth = base64::encode(&auth); +// +// self.auth.lock().unwrap().replace(auth.clone()); +// +// if let Some(h) = &self.url.host() { +// if let Ok(p) = self.save_http_auth(&h.to_string(), &auth) { +// slog::info!( +// self.logger, +// "Saved HTTP credentials to {}.", +// p.to_string_lossy() +// ); +// } +// } +// } else { +// return Ok(response); +// } +// } +// } +// } + +impl ic_agent::PasswordManager for AgentClient { + fn cached(&self, _url: &str) -> Result, String> { + // Support for HTTP Auth if necessary (tries to contact first, then do the HTTP Auth + // flow). + if let Some(auth) = self.auth.lock().unwrap().as_ref() { + Ok(Some(auth.clone())) + } else { + Ok(None) + } + } -#[async_trait] -impl ic_agent::AgentRequestExecutor for AgentClient { - async fn execute( - &self, - mut request: reqwest::Request, - ) -> Result { - loop { - // Support for HTTP Auth if necessary (tries to contact first, then do the HTTP Auth - // flow). - if let Some(auth) = self.auth.lock().unwrap().as_ref() { - request.headers_mut().insert( - reqwest::header::AUTHORIZATION, - format!("Basic {}", auth).parse().unwrap(), + fn required(&self, _url: &str) -> Result<(String, String), String> { + eprintln!("Unauthorized HTTP Access... Please enter credentials:"); + let username = dialoguer::Input::::new() + .with_prompt("Username") + .interact() + .unwrap(); + let password = dialoguer::Password::new() + .with_prompt("Password") + .interact() + .unwrap(); + + let auth = format!("{}:{}", username, password); + let auth = base64::encode(&auth); + + self.auth + .lock() + .unwrap() + .replace((username.clone(), password.clone())); + + if let Some(h) = &self.url.host() { + if let Ok(p) = self.save_http_auth(&h.to_string(), &auth) { + slog::info!( + self.logger, + "Saved HTTP credentials to {}.", + p.to_string_lossy() ); } - - let response = self - .client - .execute(request.try_clone().unwrap()) - .await - .map_err(ic_agent::AgentError::from)?; - - // 401 is HTTP Authentication unauthorized access. - if response.status() == reqwest::StatusCode::UNAUTHORIZED { - if !self.is_secure() { - return Ok(response); - } - - eprintln!("Unauthorized HTTP Access... Please enter credentials:"); - let username = dialoguer::Input::::new() - .with_prompt("Username") - .interact() - .unwrap(); - let password = dialoguer::Password::new() - .with_prompt("Password") - .interact() - .unwrap(); - - let auth = format!("{}:{}", username, password); - let auth = base64::encode(&auth); - - self.auth.lock().unwrap().replace(auth.clone()); - - if let Some(h) = &self.url.host() { - if let Ok(p) = self.save_http_auth(&h.to_string(), &auth) { - slog::info!( - self.logger, - "Saved HTTP credentials to {}.", - p.to_string_lossy() - ); - } - } - } else { - return Ok(response); - } } + + Ok((username, password)) } } fn create_agent(logger: Logger, url: &str, identity: PathBuf) -> Option { - let mut cfg = rustls::ClientConfig::new(); - // Advertise support for HTTP/2 - cfg.alpn_protocols = vec![b"h2".to_vec(), b"http/1.1".to_vec()]; - // Mozilla CA root store - cfg.root_store - .add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS); - - AgentClient::new( - logger, - url.to_string(), - reqwest::Client::builder() - .use_preconfigured_tls(cfg) - .build() - .expect("Could not create HTTP client"), - ) - .ok() - .and_then(|executor| { - Agent::new(AgentConfig { - url, - identity: Box::new(Identity::new(identity)), - request_executor: Box::new(executor), - ..AgentConfig::default() - }) + AgentClient::new(logger, url.to_string()) .ok() - }) + .and_then(|executor| { + Agent::new(AgentConfig { + url, + identity: Box::new(Identity::new(identity)), + password_manager: Some(Box::new(executor)), + ..AgentConfig::default() + }) + .ok() + }) } From 414175ba9b123c53f4151c9743cc513678bc22d4 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Thu, 6 Aug 2020 20:50:39 -0700 Subject: [PATCH 12/23] . --- Cargo.lock | 3 +- src/dfx/Cargo.toml | 1 - src/dfx/src/lib/environment.rs | 59 ---------------------------------- 3 files changed, 1 insertion(+), 62 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 393ea68164..f7c92499ad 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -962,7 +962,6 @@ dependencies = [ "actix-files", "actix-server", "actix-web", - "async-trait", "atty", "base64 0.11.0", "candid", @@ -1628,7 +1627,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#de2d84a8c9ac972e298dfb6bcba7d0a0fc91a205" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#4ac0bc3b8894685a2b68f1f5f2133f3cc5da1665" dependencies = [ "async-trait", "base32", diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index d0fd092ad8..0afda5c57d 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -19,7 +19,6 @@ actix-cors = "0.1" actix-files = "0.1.4" actix-server = "0.6.1" actix-web = { version = "1.0.8", features = [ "default", "openssl", "ssl" ] } -async-trait = "0.1.35" atty = "0.2.13" base64 = "0.11.0" candid = "0.5.1" diff --git a/src/dfx/src/lib/environment.rs b/src/dfx/src/lib/environment.rs index a7c12cb620..271dc93d49 100644 --- a/src/dfx/src/lib/environment.rs +++ b/src/dfx/src/lib/environment.rs @@ -335,65 +335,6 @@ impl AgentClient { Ok(p) } } -// -// #[async_trait] -// impl ic_agent::AgentRequestExecutor for AgentClient { -// async fn execute( -// &self, -// mut request: reqwest::Request, -// ) -> Result { -// loop { -// // Support for HTTP Auth if necessary (tries to contact first, then do the HTTP Auth -// // flow). -// if let Some(auth) = self.auth.lock().unwrap().as_ref() { -// request.headers_mut().insert( -// reqwest::header::AUTHORIZATION, -// format!("Basic {}", auth).parse().unwrap(), -// ); -// } -// -// let response = self -// .client -// .execute(request.try_clone().unwrap()) -// .await -// .map_err(ic_agent::AgentError::from)?; -// -// // 401 is HTTP Authentication unauthorized access. -// if response.status() == reqwest::StatusCode::UNAUTHORIZED { -// if !self.is_secure() { -// return Ok(response); -// } -// -// eprintln!("Unauthorized HTTP Access... Please enter credentials:"); -// let username = dialoguer::Input::::new() -// .with_prompt("Username") -// .interact() -// .unwrap(); -// let password = dialoguer::Password::new() -// .with_prompt("Password") -// .interact() -// .unwrap(); -// -// let auth = format!("{}:{}", username, password); -// let auth = base64::encode(&auth); -// -// self.auth.lock().unwrap().replace(auth.clone()); -// -// if let Some(h) = &self.url.host() { -// if let Ok(p) = self.save_http_auth(&h.to_string(), &auth) { -// slog::info!( -// self.logger, -// "Saved HTTP credentials to {}.", -// p.to_string_lossy() -// ); -// } -// } -// } else { -// return Ok(response); -// } -// } -// } -// } impl ic_agent::PasswordManager for AgentClient { fn cached(&self, _url: &str) -> Result, String> { From 3a3e3993d326eaada7ac0bdae0c1ff433b6545de Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Thu, 6 Aug 2020 20:53:04 -0700 Subject: [PATCH 13/23] . --- src/dfx/src/lib/environment.rs | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/src/dfx/src/lib/environment.rs b/src/dfx/src/lib/environment.rs index 271dc93d49..b7d03fad1a 100644 --- a/src/dfx/src/lib/environment.rs +++ b/src/dfx/src/lib/environment.rs @@ -308,9 +308,12 @@ impl AgentClient { ); Ok(None) } else { + // For backward compatibility with previous versions of DFX, we still + // store the base64 encoding of `username:password`, but we decode it + // since the Agent requires username and password as separate fields. let pair = base64::decode(&token).unwrap(); let v: Vec = String::from_utf8_lossy(pair.as_slice()) - .split(":") + .split(':') .take(2) .map(|s| s.to_owned()) .collect(); From 1ed68958eab60d9ce2be5926fea6429b5112c489 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Fri, 7 Aug 2020 08:22:00 -0700 Subject: [PATCH 14/23] . --- Cargo.lock | 2 +- src/dfx/Cargo.toml | 2 +- src/ic_identity_manager/Cargo.toml | 2 +- 3 files changed, 3 insertions(+), 3 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index f7c92499ad..302adda709 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -1627,7 +1627,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=hansl/update_rustls#4ac0bc3b8894685a2b68f1f5f2133f3cc5da1665" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.3#5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e" dependencies = [ "async-trait", "base32", diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 0afda5c57d..559c3f260c 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -32,7 +32,7 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", branch = "hansl/update_rustls" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.3" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 7ba30f1b79..66571d800f 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,7 +11,7 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", branch = "hansl/update_rustls" } +ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.3" } [dev-dependencies] From c6103ced900ef72460d6e54f7038d39bb0fc0101 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Fri, 7 Aug 2020 10:32:07 -0700 Subject: [PATCH 15/23] just empty to run CI From f4db6d6acd5519e4c0dd808c93f164e177897874 Mon Sep 17 00:00:00 2001 From: Bas van Dijk Date: Fri, 7 Aug 2020 22:32:11 +0200 Subject: [PATCH 16/23] fix: Nix eval error due to fetchGit only supporting revisions (#909) The following used to work: ``` nix-repl> builtins.fetchGit { url = "ssh://git@github.com/dfinity-lab/agent-rust"; ref = "v0.6.3"; } { outPath = "/nix/store/rrlmgrf9z0nm9jzbimbsl6rpj96ij9yn-source"; rev = "5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e"; revCount = 42; shortRev = "5b2fab2"; } ``` However, due to a Nix upgrade on Hydra this doesn't seem to work anymore: ``` nix-repl> builtins.fetchGit { url = "ssh://git@github.com/dfinity-lab/agent-rust.git"; ref = "v0.6.3"; } fetching Git repository 'ssh://git@github.com/dfinity-lab/agent-rust.git'fatal: couldn't find remote ref refs/heads/v0.6.3 error: --- Error ------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- nix program 'git' failed with exit code 128 ``` I'm not sure this is intended behaviour but it could be that Nix wants to have a revision in order to guarantee that the source doesn't change: ``` nix-repl> builtins.fetchGit { url = "ssh://git@github.com/dfinity-lab/agent-rust"; rev = "5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e"; ref = "0.6"; } { lastModified = 1596813025; lastModifiedDate = "20200807151025"; narHash = "sha256-LJY3PJeTFaR3nn0/SAxbAOhogkcQS3JkHUiyOY14lWA="; outPath = "/nix/store/rrlmgrf9z0nm9jzbimbsl6rpj96ij9yn-source"; rev = "5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e"; revCount = 42; shortRev = "5b2fab2"; submodules = false; } ``` Note that if the revision is not reachable from `master` it's also required to specify a branch. Unfortunately this does currently raise a warning in cargo: ``` $ cargo build warning: /Users/bas/d/sdk/hansl/move-ic-agent-to-own-repo/src/ic_identity_manager/Cargo.toml: dependency (ic-agent) specification is ambiguous. Only one of `branch`, `tag` or `rev` is allowed. This will be considered an error in future versions warning: /Users/bas/d/sdk/hansl/move-ic-agent-to-own-repo/src/dfx/Cargo.toml: dependency (ic-agent) specification is ambiguous. Only one of `branch`, `tag` or `rev` is allowed. This will be considered an error in future versions ``` --- Cargo.lock | 2 +- src/dfx/Cargo.toml | 7 ++++++- src/ic_identity_manager/Cargo.toml | 6 +++++- 3 files changed, 12 insertions(+), 3 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 302adda709..9957f0ba42 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -1627,7 +1627,7 @@ dependencies = [ [[package]] name = "ic-agent" version = "0.6.0" -source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?tag=v0.6.3#5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e" +source = "git+ssh://git@github.com/dfinity-lab/agent-rust.git?branch=0.6#5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e" dependencies = [ "async-trait", "base32", diff --git a/src/dfx/Cargo.toml b/src/dfx/Cargo.toml index 559c3f260c..7c8c24a036 100644 --- a/src/dfx/Cargo.toml +++ b/src/dfx/Cargo.toml @@ -32,7 +32,6 @@ erased-serde = "0.3.10" flate2 = "1.0.11" futures = "0.1.28" hex = "0.3.2" -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.3" } ic-identity-manager = { path = "../ic_identity_manager" } indicatif = "0.13.0" lazy-init = "0.3.0" @@ -64,6 +63,12 @@ url = "2.1.0" walkdir = "2.2.9" wasmparser = "0.45.0" +[dependencies.ic-agent] +version = "0.6" +git = "ssh://git@github.com/dfinity-lab/agent-rust.git" +branch = "0.6" +rev = "5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e" + [dev-dependencies] env_logger = "0.6" proptest = "0.9.5" diff --git a/src/ic_identity_manager/Cargo.toml b/src/ic_identity_manager/Cargo.toml index 66571d800f..61d00b55da 100644 --- a/src/ic_identity_manager/Cargo.toml +++ b/src/ic_identity_manager/Cargo.toml @@ -11,8 +11,12 @@ openssl = "0.10.28" pem = "0.7.0" ring = "0.16.11" serde = { version = "1.0", features = ["derive"] } -ic-agent = { git = "ssh://git@github.com/dfinity-lab/agent-rust.git", tag = "v0.6.3" } +[dependencies.ic-agent] +version = "0.6" +git = "ssh://git@github.com/dfinity-lab/agent-rust.git" +branch = "0.6" +rev = "5b2fab20e1902f8709d1b09fcb6f5ee9feb0084e" [dev-dependencies] serde_cbor = "0.10" From c0b6a0d0274571cb6ab266bf19a595b9c58dac19 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Fri, 7 Aug 2020 18:13:25 -0700 Subject: [PATCH 17/23] try to fix --- Cargo.lock | 4 ++-- dfx.nix | 8 ++++---- 2 files changed, 6 insertions(+), 6 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 9957f0ba42..7700656229 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -1686,9 +1686,9 @@ dependencies = [ [[package]] name = "indexmap" -version = "1.5.0" +version = "1.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5b88cd59ee5f71fea89a62248fc8f387d44400cefe05ef548466d61ced9029a7" +checksum = "86b45e59b16c76b11bf9738fd5d38879d3bd28ad292d7b313608becb17ae2df9" dependencies = [ "autocfg 1.0.0", "hashbrown 0.8.1", diff --git a/dfx.nix b/dfx.nix index d41b81b08e..716b0e9929 100644 --- a/dfx.nix +++ b/dfx.nix @@ -36,19 +36,19 @@ let lint = ws.lint.overrideAttrs ( oldAttrs: { nativeBuildInputs = oldAttrs.nativeBuildInputs ++ [ - pkgs.cargo-graph + pkgs.cargo-deps pkgs.graphviz ]; postDoc = oldAttrs.postDoc + '' pushd src/dfx - cargo graph | dot -Tsvg > \ - ../../target/$CARGO_BUILD_TARGET/doc/dfx/cargo-graph.svg + cargo deps | dot -Tsvg > \ + ../../target/$CARGO_BUILD_TARGET/doc/dfx/cargo-deps.svg popd ''; postInstall = oldAttrs.postInstall + '' - echo "report cargo-graph-dfx $doc dfx/cargo-graph.svg" >> \ + echo "report cargo-graph-dfx $doc dfx/cargo-deps.svg" >> \ $doc/nix-support/hydra-build-products ''; } From 274eaf8aa5e2d7028abbbb2487241a9518fb807f Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Sun, 9 Aug 2020 11:01:14 -0700 Subject: [PATCH 18/23] remove cargo deps - nobody uses it --- dfx.nix | 25 ------------------------- 1 file changed, 25 deletions(-) diff --git a/dfx.nix b/dfx.nix index 716b0e9929..e30fa15520 100644 --- a/dfx.nix +++ b/dfx.nix @@ -30,31 +30,6 @@ let ]; }; - # add extra executables used when linting - addLintInputs = ws: - ws // { - lint = ws.lint.overrideAttrs ( - oldAttrs: { - nativeBuildInputs = oldAttrs.nativeBuildInputs ++ [ - pkgs.cargo-deps - pkgs.graphviz - ]; - - postDoc = oldAttrs.postDoc + '' - pushd src/dfx - cargo deps | dot -Tsvg > \ - ../../target/$CARGO_BUILD_TARGET/doc/dfx/cargo-deps.svg - popd - ''; - - postInstall = oldAttrs.postInstall + '' - echo "report cargo-graph-dfx $doc dfx/cargo-deps.svg" >> \ - $doc/nix-support/hydra-build-products - ''; - } - ); - }; - # set DFX_ASSETS for the builds and shells addAssets = ws: # override all derivations and add DFX_ASSETS as an environment variable From e1a6491d1b987e19100609813418f7bb1dd9b318 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Sun, 9 Aug 2020 11:03:09 -0700 Subject: [PATCH 19/23] . --- dfx.nix | 7 +++++++ 1 file changed, 7 insertions(+) diff --git a/dfx.nix b/dfx.nix index e30fa15520..8b68fcaf1a 100644 --- a/dfx.nix +++ b/dfx.nix @@ -30,6 +30,13 @@ let ]; }; + # add extra executables used when linting + addLintInputs = ws: + ws // { + lint = ws.lint.overrideAttrs ( + ); + }; + # set DFX_ASSETS for the builds and shells addAssets = ws: # override all derivations and add DFX_ASSETS as an environment variable From c0b6d27e90115f5f41fbd9b9230e035a0bde882f Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Sun, 9 Aug 2020 11:04:16 -0700 Subject: [PATCH 20/23] . --- dfx.nix | 2 ++ 1 file changed, 2 insertions(+) diff --git a/dfx.nix b/dfx.nix index 8b68fcaf1a..8cc130fb0d 100644 --- a/dfx.nix +++ b/dfx.nix @@ -34,6 +34,8 @@ let addLintInputs = ws: ws // { lint = ws.lint.overrideAttrs ( + oldAttrs: { + } ); }; From 052d089976d7daaf32c599c2b1557dc26d6307a5 Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Sun, 9 Aug 2020 11:05:22 -0700 Subject: [PATCH 21/23] . --- dfx.nix | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/dfx.nix b/dfx.nix index 8cc130fb0d..ea0d0933d3 100644 --- a/dfx.nix +++ b/dfx.nix @@ -34,8 +34,7 @@ let addLintInputs = ws: ws // { lint = ws.lint.overrideAttrs ( - oldAttrs: { - } + oldAttrs: {} ); }; From ca42ba2b4a2a1c252c30f2e35df3a555b5f023be Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Sun, 9 Aug 2020 11:10:28 -0700 Subject: [PATCH 22/23] . --- e2e/bats/basic-project.bash | 5 +++-- 1 file changed, 3 insertions(+), 2 deletions(-) diff --git a/e2e/bats/basic-project.bash b/e2e/bats/basic-project.bash index 72a644af94..b84fe66b27 100644 --- a/e2e/bats/basic-project.bash +++ b/e2e/bats/basic-project.bash @@ -19,8 +19,9 @@ teardown() { dfx_start dfx canister create --all dfx build - INSTALL_REQUEST_ID=$(dfx canister install hello --async) - dfx canister request-status $INSTALL_REQUEST_ID + # INSTALL_REQUEST_ID=$(dfx canister install hello --async) + # dfx canister request-status $INSTALL_REQUEST_ID + dfx canister install hello assert_command dfx canister call hello greet '("Banzai")' assert_eq '("Hello, Banzai!")' From 1a340c9bf17980a22582d09c0f9f6319d4f8dedc Mon Sep 17 00:00:00 2001 From: Hans Larsen Date: Mon, 10 Aug 2020 09:48:25 -0700 Subject: [PATCH 23/23] . --- dfx.nix | 10 +--------- 1 file changed, 1 insertion(+), 9 deletions(-) diff --git a/dfx.nix b/dfx.nix index ea0d0933d3..703e514b1e 100644 --- a/dfx.nix +++ b/dfx.nix @@ -30,14 +30,6 @@ let ]; }; - # add extra executables used when linting - addLintInputs = ws: - ws // { - lint = ws.lint.overrideAttrs ( - oldAttrs: {} - ); - }; - # set DFX_ASSETS for the builds and shells addAssets = ws: # override all derivations and add DFX_ASSETS as an environment variable @@ -101,6 +93,6 @@ let in fixShell ( - addStandalone ((addLintInputs (addAssets workspace))) + addStandalone (addAssets workspace) (throw "this argument is used to trigger the functor and shouldn't actually be evaluated.") )